diff options
620 files changed, 47207 insertions, 1217 deletions
diff --git a/.github/assets/hyra.png b/.github/assets/hyra.png Binary files differnew file mode 100644 index 0000000..bcfaa68 --- /dev/null +++ b/.github/assets/hyra.png diff --git a/.github/workflows/cicd.yml b/.github/workflows/cicd.yml index ad6d236..c56641e 100644 --- a/.github/workflows/cicd.yml +++ b/.github/workflows/cicd.yml @@ -20,5 +20,5 @@ jobs: run: sudo apt-get install -y lld clang xorriso - name: Bootstrap and configure run: ./bootstrap && ./configure - - name: Build world with clang - run: make + - name: Build world + run: ./hyra-build.sh -i diff --git a/Makefile.in b/Makefile.in index d3bef70..a7d84c4 100644 --- a/Makefile.in +++ b/Makefile.in @@ -4,6 +4,7 @@ override PROMPT := printf "%s\t\t%s\n" ############################### # CFLAGS, QEMU flags + misc ############################### +KBUILD_ARGS = "" override PROJECT_ROOT = @PROJECT_ROOT@ override BOOT_FW = @BOOT_FW@ override ARCH = @ARCH@ @@ -12,15 +13,9 @@ override PROMPT := printf "%s\t\t%s\n" override KERNEL_CFLAGS = @KERNEL_CFLAGS@ $(KERNEL_DEFINES) override KERNEL_LDFLAGS = -no-pie -nostdlib -znoexecstack -zmax-page-size=0x1000 -static -Tsys/arch/$(ARCH)/conf/link.ld override QEMU_FLAGS = @QEMU_FLAGS@ -override KERNEL_DEFINES = $ -DHYRA_VERSION="\"$(HYRA_VERSION)\""\ +override KERNEL_DEFINES = $(KBUILD_ARGS) -DHYRA_VERSION="\"$(HYRA_VERSION)\""\ -DHYRA_BUILDDATE="\"@HYRA_BUILDDATE@\""\ - -DHYRA_ARCH="\"@ARCH@\"" $(shell cat sys/arch/$(ARCH)/conf/GENERIC | tools/kconf/kconf) -###################### -# Initramfs config -###################### -override RAMFS_TOOL = @RAMFS_TOOL@ -override RAMFS_LOC = ramfs.omar - + -DHYRA_ARCH="\"@ARCH@\"" $(shell cat sys/arch/$(ARCH)/conf/GENERIC sys/conf/GENERIC | tools/kconf/kconf) ###################### # Toolchain ###################### @@ -70,34 +65,28 @@ override SBIN_MAKEDIRS = $(shell find usr.sbin/ -type d -name "*" | awk '!/usr.s override BIN_MAKEDIRS = $(shell find usr.bin/ -type d -name "*" | awk '!/usr.bin\/$$/') override USRDIR = $(shell pwd)/base/usr + .PHONY: all -all: base libc sbin bin base/boot/hyra-kernel ramfs iso +all: stand/boot/ libs sbin bin base/boot/hyra.krq rm -f sys/include/machine - rm -rf iso_root .PHONY: sbin sbin: $(SBIN_MAKEDIRS) make -C usr.sbin/ LDSCRIPT=$(shell pwd)/usr.sbin/link.ld USRDIR=$(USRDIR)\ - ROOT=$(PROJECT_ROOT)\ + ROOT=$(PROJECT_ROOT) OSVER=$(HYRA_VERSION) OSARCH=$(ARCH)\ + CC="$(CC)" .PHONY: bin bin: $(BIN_MAKEDIRS) make -C usr.bin/ LDSCRIPT=$(shell pwd)/usr.bin/link.ld USRDIR=$(USRDIR)\ - ROOT=$(PROJECT_ROOT) - -.PHONY: libc -libc: - $(MAKE) -C lib/libc/ -I$(shell pwd)/builddeps \ - USRDIR=$(USRDIR) ARCH=$(ARCH) ROOT=$(PROJECT_ROOT) - -.PHONY: base -base: - mkdir -p base/usr/lib/ - mkdir -p base/usr/sbin/ - mkdir -p base/usr/bin/ - mkdir -p base/boot/ - mkdir -p base/usr/include/sys/ - cp -f sys/include/sys/*.h base/usr/include/sys/ + ROOT=$(PROJECT_ROOT) OSVER=$(HYRA_VERSION) OSARCH=$(ARCH)\ + CC="$(CC)" + +.PHONY: libs +libs: + $(MAKE) -C lib/ -I$(shell pwd)/builddeps \ + USRDIR=$(USRDIR) ARCH=$(ARCH) ROOT=$(PROJECT_ROOT) \ + CC="$(CC)" .PHONY: cross cross: @@ -107,41 +96,23 @@ cross: run: $(QEMU) $(QEMU_FLAGS) -.PHONY: ramfs -ramfs: - $(RAMFS_TOOL) -i base/ -o ramfs.omar - $(PROMPT) " RAMFS " $(shell pwd)/ramfs.omar - .PHONY: clean clean: rm -f $(KERNEL_ASMOBJECTS) $(KERNEL_OBJECTS) $(KERNEL_HEADER_DEPS) rm -f sys/include/machine -.PHONY: iso -iso: - mkdir -p iso_root/boot/ - mkdir -p iso_root/EFI/BOOT/ - cp stand/limine/$(BOOT_FW) iso_root/EFI/BOOT/ - mv $(RAMFS_LOC) iso_root/boot/ - cp builddeps/limine.conf stand/limine/limine-bios.sys \ - stand/limine/limine-bios-cd.bin stand/limine/limine-uefi-cd.bin iso_root/ - cp base/boot/* iso_root/boot/ - cp builddeps/tree.jpg iso_root/boot/ - xorriso -as mkisofs -b limine-bios-cd.bin -no-emul-boot -boot-load-size 4\ - -boot-info-table --efi-boot limine-uefi-cd.bin -efi-boot-part \ - --efi-boot-image --protective-msdos-label iso_root -o Hyra.iso > /dev/null - stand/limine/limine bios-install Hyra.iso - $(PROMPT) " ISO " $(shell pwd)/Hyra.iso - -base/boot/hyra-kernel: $(KERNEL_OBJECTS) $(KERNEL_ASMOBJECTS) - rm -rf iso_root - $(PROMPT) " LD " $(shell pwd)/base/boot/hyra-kernel - $(LD) $(KERNEL_LDFLAGS) $(KERNEL_OBJECTS) $(KERNEL_ASMOBJECTS) -o base/boot/hyra-kernel - tools/ksyms sys/kern/ksyms.c base/boot/hyra-kernel +stand/boot/: + mkdir -p stand/boot/ + cp stand/limine/$(BOOT_FW) stand/boot/ + +base/boot/hyra.krq: $(KERNEL_OBJECTS) $(KERNEL_ASMOBJECTS) + $(PROMPT) " LD " $(shell pwd)/base/boot/hyra.krq + $(LD) $(KERNEL_LDFLAGS) $(KERNEL_OBJECTS) $(KERNEL_ASMOBJECTS) -o base/boot/hyra.krq + tools/ksyms sys/kern/ksyms.c base/boot/hyra.krq # === Generating symbols === $(CC) -c $(KERNEL_CFLAGS) $(KERNEL_DEFINES) sys/kern/ksyms.c -o sys/kern/ksyms.o $(LD) $(KERNEL_LDFLAGS) $(KERNEL_OBJECTS) $(KERNEL_ASMOBJECTS) \ - sys/kern/ksyms.o -o base/boot/hyra-kernel + sys/kern/ksyms.o -o base/boot/hyra.krq sys/include/machine/: cd sys/include/; ln -sf arch/$(ARCH) machine @@ -1,14 +1,22 @@ The Hyra Operating System ========================= -Welcome to the Hyra Operating System project! +Welcome to the Hyra Operating System project! Hyra is an experimental +operating system inspired by BSD and Plan 9 while being entirely written from scratch. +Hyra aims to rethink core fundamentals in modern operating system design in order to +create new and improved architectural ideas. + Project Goal: -------------- -The goal of this project is to redefine what modern operating systems are while taking inspiration from BSD. Hyra does not use -POSIX by default and instead uses the [OSMORA Uniform System Interface (OUSI)](https://osmora.org/oap/oap-0002). Hyra also does +The goal of this project is to redefine what modern operating systems are while taking inspiration from BSD. Hyra does not use CPIO for its initramfs like other operating systems typically would and instead uses the [OSMORA Archive Format (OMAR)](https://osmora.org/oap/oap-0005). +What Hyra is NOT: +-------------- +Hyra is *NOT* Linux, nor does extend or share any sources with any existing +operating systems as it is written entirely from scratch. Hyra is *NOT* intended as a "toy" project as it is aimed to be the used as the main operating system for internal OSMORA operations and infrastructure. + Getting Started: ---------------- To build Hyra you'll need to bootstrap the project which is essentially just fetching dependencies for the project. This can be done by running the bootstrap script within the project root: `./bootstrap`. @@ -17,20 +25,96 @@ Next, to configure for x86_64 just run configure: `./configure` -Now you'll need to build the cross compiler by running: +After running the configure script, you can now actually build Hyra: + +`./hyra-build.sh` + +This will generate a new `Hyra.iso` file. + + +Default User: +---------------- +Upon booting, the `login` program will ask for user credentials. The default username is `root` and the default +password is also `root`. + +Programs: +---------------- +The Hyra userspace provides the user various programs that they can run. Examples of +such programs include: + +- ``beep`` - Play a tone +- ``cat`` - Print files to stdout +- ``date`` - Get the current date or set system time +- ``echo`` - Print a line of text +- ``elfdump`` - Get information about an ELF binary +- ``fetch`` - System fetch! A must have :~) +- ``getconf`` - Get system configuration values +- ``mex`` - OSMORA hexdump utility +- ``sleep`` - Sleep for a number of seconds +- ``kmsg`` - Read the kernel message buffer +- ``readcore`` - Read coredump files +- ``oasm`` - OSMORA [OSMX64](https://github.com/sigsegv7/OSMX64) Assembler +- ``oemu`` - OSMORA [OSMX64](https://github.com/sigsegv7/OSMX64) Emulator +- ``kstat`` - Read kernel statistics +- ``dmidump`` - Dump DMI/SMBios information +- ``screensave`` - Glitch art screensaver +- ``whoami`` - Print effective user name +- ``sysctl`` - Runtime kernel parameters +- ``notes`` - Music box -`make cross` +And more! See ``usr.bin/*`` -This may take awhile so just sit back, relax and do something else like... well I'm not you so -I don't know what you like. +Libraries: +---------------- +The Hyra userspace additionally provides the user various libraries that they can +link with. Examples of such libraries include: -After the cross compiler is done building you can build and run the project in a virtual machine: +- ``libc`` - C library (link flag: ``-lc``) +- ``libgfx`` - Low-level graphics (link flag: ``-lgfx``) -`make; make run` +And more! See ``lib/*`` Documentation: -------------- -Documentation will be in the form of comments throughout the codebase and can also be found in the share/ directory within the project root. +Documentation will be in the form of comments throughout the codebase and can also be found in: + +- ``share/man/*``: Man pages +- ``share/contrib``: Information on contributing +- ``share/docs/kernel``: Kernel documentation +- ``share/docs/lib``: Library documentation + +# Maintainers (by author) +-------------- +| Maintainer | Component | +|--------------------|--------------------| +| <ian@osmora.org> | Hyra AMD64 Kernel | +| <ian@osmora.org> | User C Library | +| <ian@osmora.org> | NVMe Driver | +| <ian@osmora.org> | AHCI Driver | +| <ian@osmora.org> | xHCI Driver | +| <ian@osmora.org> | RTL8139 Driver | +| <ian@osmora.org> | E1000E Driver | +| <ian@osmora.org> | ET131X Driver | +| <ian@osmora.org> | PCI Driver | +| <ian@osmora.org> | PCIe Driver | +| <quinn@osmora.org> | PCI Driver | +| <quinn@osmora.org> | User C Library | +| <quinn@osmora.org> | Killing MS | + +-------------- +# To-do + +``` +[ ] kern: dev: AHCI DCDR cache (<ian@osmora.org>) +[ ] kern: Worker threads (<ian@osmora.org>) +[ ] kern: Multithreaded driver startup (<quinn@osmora.org>) +[ ] libc: Slab allocator (<quinn@osmora.org>) +... +``` + +Hyra running on bare metal: +-------------- + License: -------- @@ -36,7 +36,7 @@ prepare() { } fetch() { - try_fetch "git clone https://github.com/limine-bootloader/limine.git --branch=v9.x-binary --depth=1" "stand/limine" + try_fetch "git clone https://github.com/limine-bootloader/limine.git --branch=v9.3.0-binary --depth=1" "stand/limine" } build_limine() { diff --git a/builddeps/limine.conf b/builddeps/limine.conf index 308ad26..1ad040c 100644 --- a/builddeps/limine.conf +++ b/builddeps/limine.conf @@ -1,5 +1,5 @@ timeout=10 -${WALLPAPER_PATH}=boot():/boot/tree.jpg +${WALLPAPER_PATH}=boot():/boot/wallpaper.jpg wallpaper: ${WALLPAPER_PATH} interface_branding_color: 1 term_background: 40000000 @@ -8,6 +8,6 @@ resolution: 1280x720 /Hyra protocol: limine - kernel_path: boot():/boot/hyra-kernel + kernel_path: boot():/boot/hyra.krq module_path: boot():/boot/ramfs.omar diff --git a/builddeps/user.mk b/builddeps/user.mk index d7ad582..d991ef8 100644 --- a/builddeps/user.mk +++ b/builddeps/user.mk @@ -4,4 +4,5 @@ USRDIR = LDSCRIPT = INTERNAL_CFLAGS = -T$(LDSCRIPT) -znoexecstack -nostdlib -I$(USRDIR)/include/ \ -L$(USRDIR)/lib -lc -pie -no-pie -fno-stack-protector \ - -fno-asynchronous-unwind-tables + -fno-asynchronous-unwind-tables -D_OSVER=\"$(OSVER)\" \ + -D_OSARCH=\"$(OSARCH)\" diff --git a/builddeps/wallpaper.jpg b/builddeps/wallpaper.jpg Binary files differnew file mode 100644 index 0000000..5d69f53 --- /dev/null +++ b/builddeps/wallpaper.jpg diff --git a/configure.ac b/configure.ac index 7d0f5fa..50c56b4 100644 --- a/configure.ac +++ b/configure.ac @@ -1,6 +1,7 @@ -AC_INIT([Hyra], [1.6], [ian@osmora.org]) +AC_INIT([Hyra], [2.6], [ian@osmora.org]) TARGET="amd64" +QEMU="qemu-system-x86_64" PROJECT_ROOT=`pwd` BOOT_FW="BOOTX64.EFI" AC_ARG_ENABLE([aarch64], @@ -37,12 +38,19 @@ QEMU_FLAGS_AMD64="--enable-kvm -monitor stdio \\ -M q35 -m 1G -smp 4 -cpu host \\ -cdrom Hyra.iso" +QEMU_FLAGS_AARCH64="-monitor stdio \\ + -M versatilepb -m 256M -smp 1 \\ + -cdrom Hyra.iso" + KERN_CFLAGS="$KERN_CFLAGS_AMD64" +QEMU_FLAGS=$QEMU_FLAGS_AMD64 if test "x$TARGET" = "xaarch64" then KERN_CFLAGS="$KERN_CFLAGS_AARCH64" BOOT_FW="BOOTAA64.EFI" + QEMU_FLAGS=$QEMU_FLAGS_AARCH64 + QEMU="qemu-system-aarch64" fi @@ -53,12 +61,11 @@ AC_SUBST(HYRA_BUILDDATE, [$HYRA_BUILDDATE]) AC_SUBST(HYRA_BUILDBRANCH, [$HYRA_BUILDBRANCH]) AC_SUBST(KERNEL_CFLAGS, [$KERN_CFLAGS]) -AC_SUBST(QEMU_FLAGS, [$QEMU_FLAGS_AMD64]) -AC_SUBST(QEMU, [qemu-system-x86_64]) AC_SUBST(BOOT_FW, [$BOOT_FW]) AC_SUBST(ARCH, [$TARGET]) +AC_SUBST(QEMU_FLAGS, [$QEMU_FLAGS]) +AC_SUBST(QEMU, [$QEMU]) AC_SUBST(PROJECT_ROOT, [$PROJECT_ROOT]) AC_SUBST(TOOLCHAIN, [clang]) -AC_SUBST(RAMFS_TOOL, [tools/omar/bin/omar]) AC_CONFIG_FILES([Makefile]) AC_OUTPUT diff --git a/etc/hostname b/etc/hostname new file mode 100644 index 0000000..c90b108 --- /dev/null +++ b/etc/hostname @@ -0,0 +1 @@ +osmora diff --git a/etc/motd b/etc/motd new file mode 100644 index 0000000..62718f4 --- /dev/null +++ b/etc/motd @@ -0,0 +1,4 @@ +::::::::::::::::::::::::::::::::::::::: +:: OSMORA GATEWAY ~ Every key echos :: +:: ..... Proceed with purpose ..... :: +::::::::::::::::::::::::::::::::::::::: diff --git a/etc/oemu/emutest.rc b/etc/oemu/emutest.rc new file mode 100644 index 0000000..39607dd --- /dev/null +++ b/etc/oemu/emutest.rc @@ -0,0 +1,5 @@ +@ Test emulator +echo Generating /tmp/a.out +oasm /etc/oemu/test-00.s /tmp/a.out +echo Running emulator... +oemu /tmp/a.out diff --git a/etc/oemu/test-00.s b/etc/oemu/test-00.s new file mode 100644 index 0000000..f6015c1 --- /dev/null +++ b/etc/oemu/test-00.s @@ -0,0 +1,20 @@ +mov x0, #1 ! ~ 0x00000000 +mov x1, #2 ! ~ 0x00000004 +mov x2, #3 ! ~ 0x00000008 + ! X +some_label: ! X + mov x2, #20 ! ~ 0x0000000C + br x2 ! ~ 0x00000010 -----+ + !!!!!!!!!!!!!! X | + !!!!!!!!!!!!!! X | + ! X | + dec x0 ! ~ 0x00000014 <----+ + inc x1 ! ~ 0x00000018 + add x2, #3 ! ~ 0x0000001C + mrow x4, #0 ! ~ 0x00000020 + nop ! ~ 0x00000024 + or x1, #3 ! ~ 0x00000028 + xor x2, #3 ! ~ 0x0000002C + lsr x2, #1 ! ~ 0x00000030 + lsl x2, #1 ! ~ 0x00000034 + hlt ! ~ 0x00000038 diff --git a/etc/passwd b/etc/passwd new file mode 100644 index 0000000..7855b99 --- /dev/null +++ b/etc/passwd @@ -0,0 +1 @@ +root:4813494d137e1631bba301d5acab6e7bb7aa74ce1185d456565ef51d737677b2:0:0:Not a ruler:/root:/usr/bin/osh diff --git a/hyra-build.sh b/hyra-build.sh new file mode 100755 index 0000000..ab19724 --- /dev/null +++ b/hyra-build.sh @@ -0,0 +1,227 @@ +#!/bin/bash + +# +# Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are met: +# +# 1. Redistributions of source code must retain the above copyright notice, +# this list of conditions and the following disclaimer. +# 2. Redistributions in binary form must reproduce the above copyright +# notice, this list of conditions and the following disclaimer in the +# documentation and/or other materials provided with the distribution. +# 3. Neither the name of Hyra nor the names of its contributors may be used +# to endorse or promote products derived from this software without +# specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +# ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE +# LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR +# CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF +# SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +# INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +# CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) +# ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE +# POSSIBILITY OF SUCH DAMAGE. +# + +set -e + +RAMFS_TOOL="tools/omar/bin/omar" +RAMFS_NAME="ramfs.omar" +install_flag="false" +NTHREADS="-j$(nproc)" + +############################### +# Generate sysroot skeleton +############################### +sysroot_skel() { + mkdir -p base/usr/lib/ + mkdir -p base/usr/sbin/ + mkdir -p base/usr/bin/ + mkdir -p base/boot/ + mkdir -p base/usr/include/sys/ + mkdir -p base/usr/rc + + cp -r rc/* base/usr/rc + cp -f sys/include/sys/*.h base/usr/include/sys + cp -r etc base/etc/ + + # Populate ESP + make stand/boot/ + cp stand/boot/*.EFI iso_root/EFI/BOOT/ +} + +iso_root_skel() { + mkdir -p iso_root/boot/ + mkdir -p iso_root/EFI/BOOT/ +} + +############################### +# Generate ISO root +############################### +gen_iso_root() { + cp $RAMFS_NAME iso_root/boot/ + cp builddeps/limine.conf stand/limine/limine-bios.sys \ + stand/limine/limine-bios-cd.bin stand/limine/limine-uefi-cd.bin iso_root/ + cp builddeps/wallpaper.jpg iso_root/boot/ +} + +################################## +# Stage 1 - generate isofs +# +# ++ ARGS ++ +# $1: ISO output name +# -- -- +################################## +gen_isofs() { + cp base/boot/* iso_root/boot/ + xorriso -as mkisofs -b limine-bios-cd.bin -no-emul-boot -boot-load-size 4\ + -boot-info-table --efi-boot limine-uefi-cd.bin -efi-boot-part \ + --efi-boot-image --protective-msdos-label iso_root -o $1 > /dev/null + stand/limine/limine bios-install $1 +} + +build() { + echo "-- Building libs --" + make libs + + echo "-- Building world --" + make $NTHREADS sbin bin + + echo "-- Building kernel --" + make $NTHREADS base/boot/hyra.krq +} + +#################################### +# Stage 1 - build production media +#################################### +stage1() { + iso_root_skel + sysroot_skel + + echo "[*] stage1: Build kernel" + build + + echo "[*] stage1: Generate stage 1 RAMFS via OMAR" + $RAMFS_TOOL -i base/ -o $RAMFS_NAME + + echo "[*] stage1: Generate stage 1 ISOFS (production)" + gen_iso_root + gen_isofs "Hyra.iso" + + # Clean up + rm $RAMFS_NAME + rm -r iso_root +} + +################################# +# Stage 2 - build install media +################################# +stage2() { + make clean + rm -f base/boot/hyra.krq + + iso_root_skel + sysroot_skel + + echo "[*] stage2: Generate stage 2 RAMFS via OMAR" + mv Hyra.iso base/boot/ + $RAMFS_TOOL -i base/ -o $RAMFS_NAME + + echo "[*] stage2: Build kernel" + gen_iso_root + export KBUILD_ARGS="-D_INSTALL_MEDIA=1" + build + + echo "[*] stage2: Generate stage 2 ISOFS (installer)" + gen_isofs "Hyra-install.iso" + + # Clean up + rm $RAMFS_NAME + rm base/boot/Hyra.iso + rm -r iso_root +} + +################################## +# Clean up completly after build +################################## +hard_clean() { + make clean + rm -rf base/ +} + +################################## +# Build results +# +# ++ ARGS ++ +# $1: ISO output name +# -- -- +################################## +result() { + echo "-------------------------------------------" + echo "Build finish" + + if [[ $1 == "Hyra-install.iso" ]] + then + hard_clean # XXX: For safety + echo "Installer is at ./Hyra-install.iso" + echo "!!NOTE!!: OSMORA is not responsible for incidental data loss" + else + echo "Boot image is at ./Hyra.iso" + fi + + echo "Finished in $(($SECONDS / 60)) minutes and $(($SECONDS % 60)) seconds" + echo "-------------------------------------------" +} + +while getopts "ih" flag +do + case "${flag}" in + i) install_flag="true" + ;; + *) + echo "Hyra build script" + echo "[-i] Build installer" + echo "[-h] Help" + exit 1 + ;; + esac +done + +if [[ ! -f ./configure ]] +then + echo "[!] Please bootstrap and configure Hyra!" + echo "[!] Error in stage 1, exiting" + exit 1 +fi + +if [[ ! -f Makefile ]] +then + echo "[!] 'Makefile' not found, did you run './configure'?" + echo "[!] Error in stage 1, exiting" +fi + +echo "-- Begin stage 1 --" +stage1 + +if [[ $install_flag != "true" ]] +then + echo "[?] Not building installer (-i unset)" + echo "-- Skipping stage 2 --" + result "Hyra.iso" +else + echo "-- Begin stage 2 --" + stage2 + result "Hyra-install.iso" +fi + +if [[ $install_flag == "true" ]] +then + make clean + rm -rf base/ +fi diff --git a/lib/Makefile b/lib/Makefile new file mode 100644 index 0000000..fc77815 --- /dev/null +++ b/lib/Makefile @@ -0,0 +1,10 @@ +LDSCRIPT = +USRDIR = +ROOT = +ARGS = -I$(ROOT)/builddeps LDSCRIPT=$(LDSCRIPT) USRDIR=$(USRDIR) ROOT=$(ROOT) + +.PHONY: all +all: + make -C libc/ $(ARGS) + make -C libgfx/ $(ARGS) + make -C liboda/ $(ARGS) diff --git a/lib/libc/Makefile b/lib/libc/Makefile index f9a1239..be693bd 100644 --- a/lib/libc/Makefile +++ b/lib/libc/Makefile @@ -1,6 +1,6 @@ CFLAGS = -c -fno-stack-protector -nostdlib -static -Iinclude/ -D_OLIBC LIBC_CFILES = $(shell find src/ -name "*.c") -LIBC_ASMFILES = $(shell find src/ -name "*.S") +LIBC_ASMFILES = $(shell find src/arch/$(ARCH) -name "*.S") LIBC_OBJ = $(LIBC_CFILES:.c=.o) LIBC_ASMOBJ = $(LIBC_ASMFILES:.S=.S.o) @@ -30,6 +30,7 @@ headers: sys/include/machine cp -f include/*.h $(USRDIR)/include/ cp -f include/stdlib/*.h $(USRDIR)/include/ cp -rf include/ousi $(USRDIR)/include/ + cp -rf include/crypto $(USRDIR)/include/ .PHONY: build/: diff --git a/lib/libc/include/arch/aarch64/syscall.h b/lib/libc/include/arch/aarch64/syscall.h new file mode 100644 index 0000000..84a51e0 --- /dev/null +++ b/lib/libc/include/arch/aarch64/syscall.h @@ -0,0 +1,85 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _MACHINE_SYSCALL_H_ +#define _MACHINE_SYSCALL_H_ + +#if !defined(__ASSEMBLER__) +__always_inline static inline long +syscall0(uint64_t code) +{ + return 0; +} + +__always_inline static inline long +syscall1(uint64_t code, uint64_t arg0) +{ + return 0; +} + +__always_inline static long inline +syscall2(uint64_t code, uint64_t arg0, uint64_t arg1) +{ + return 0; +} + +__always_inline static inline long +syscall3(uint64_t code, uint64_t arg0, uint64_t arg1, uint64_t arg2) +{ + return 0; +} + +__always_inline static inline long +syscall4(uint64_t code, uint64_t arg0, uint64_t arg1, uint64_t arg2, uint64_t arg3) +{ + return 0; +} + +__always_inline static inline long +syscall5(uint64_t code, uint64_t arg0, uint64_t arg1, uint64_t arg2, uint64_t arg3, uint64_t arg4) +{ + return 0; +} + +__always_inline static inline long +syscall6(uint64_t code, uint64_t arg0, uint64_t arg1, uint64_t arg2, uint64_t arg3, uint64_t arg4, uint64_t arg5) +{ + return 0; +} + +#define _SYSCALL_N(a0, a1, a2, a3, a4, a5, a6, name, ...) \ + name + +#define syscall(...) \ +_SYSCALL_N(__VA_ARGS__, syscall6, syscall5, \ + syscall4, syscall3, syscall2, syscall1, \ + syscall0)(__VA_ARGS__) + +#endif /* !__ASSEMBLER__ */ +#endif /* !_MACHINE_SYSCALL_H_ */ diff --git a/lib/libc/include/crypto/sha256.h b/lib/libc/include/crypto/sha256.h new file mode 100644 index 0000000..6bd1077 --- /dev/null +++ b/lib/libc/include/crypto/sha256.h @@ -0,0 +1,62 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _CRYPTO_SHA256_H +#define _CRYPTO_SHA256_H 1 + +#include <stddef.h> +#include <stdint.h> + +#define SHA256_HEX_SIZE (64 + 1) +#define SHA256_BYTES_SIZE 32 + +/* + * Compute the SHA-256 checksum of a memory region given a pointer and + * the size of that memory region. + * The output is a hexadecimal string of 65 characters. + * The last character will be the null-character. + */ +void sha256_hex(const void *src, size_t n_bytes, char *dst_hex65); + +void sha256_bytes(const void *src, size_t n_bytes, void *dst_bytes32); + +typedef struct sha256 { + uint32_t state[8]; + uint8_t buffer[64]; + uint64_t n_bits; + uint8_t buffer_counter; +} sha256; + +/* Functions to compute streaming SHA-256 checksums. */ +void sha256_init(struct sha256 *sha); +void sha256_append(struct sha256 *sha, const void *data, size_t n_bytes); +void sha256_finalize_hex(struct sha256 *sha, char *dst_hex65); +void sha256_finalize_bytes(struct sha256 *sha, void *dst_bytes32); + +#endif /* !_CRYPTO_SHA256_H */ diff --git a/lib/libc/include/ctype.h b/lib/libc/include/ctype.h new file mode 100644 index 0000000..2a827e3 --- /dev/null +++ b/lib/libc/include/ctype.h @@ -0,0 +1,104 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _CTYPE_H +#define _CTYPE_H 1 + +#include <sys/param.h> +#include <sys/cdefs.h> + +__BEGIN_DECLS + +__always_inline static inline int +__isascii(int c) +{ + return c >= 0 && c <= 127; +} + +__always_inline static inline int +__tolower(int c) +{ + return c | 0x20; +} + +__always_inline static inline int +__toupper(int c) +{ + return c & ~0x20; +} + +__always_inline static inline int +__isalpha(int c) +{ + c = __tolower(c); + return c >= 'a' && c <= 'z'; +} + +__always_inline static inline int +__isdigit(int c) +{ + return c >= '0' && c <= '9'; +} + +__always_inline static inline int +__isspace(int c) +{ + switch (c) { + case ' ': + case '\t': + case '\n': + case '\r': + case '\v': + return 1; + + return 0; + } +} + +__END_DECLS + +/* Conver char to lowercase */ +#define tolower(C) __tolower((C)) + +/* Conver char to uppercase */ +#define toupper(C) __toupper((C)) + +/* Is alphabetical? */ +#define isalpha(C) __isalpha((C)) + +/* Is a digit? */ +#define isdigit(C) __isdigit((C)) + +/* Is a space? */ +#define isspace(C) __isspace((C)) + +/* Is ascii? */ +#define isascii(C) __isascii((C)) + +#endif /* _CTYPE_H */ diff --git a/lib/libc/include/fenv.h b/lib/libc/include/fenv.h new file mode 100644 index 0000000..d0e2fec --- /dev/null +++ b/lib/libc/include/fenv.h @@ -0,0 +1,61 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _FENV_H_ +#define _FENV_H_ 1A + +#include <sys/types.h> + +typedef struct { + __uint32_t __control_word; + __uint32_t __status_word; + __uint32_t __unused[5]; + __uint32_t __mxcsr; +} fenv_t; + +typedef __uint16_t fexcept_t; + +#define FE_TONEAREST 0 +#define FE_DOWNWARD 0x400 +#define FE_UPWARD 0x800 +#define FE_TOWARDZERO 0xC00 + +int feclearexcept(int __excepts); +int fegetenv(fenv_t *__envp); +int fegetexceptflag(fexcept_t *__envp, int __excepts); +int fegetround(void); +int feholdexcept(fenv_t *__envp); +int feraiseexcept(int __excepts); +int fesetenv(const fenv_t *__envp); +int fesetexceptflag(const fexcept_t *__envp, int __excepts); +int fesetround(int __round); +int fetestexcept(int __excepts); +int feupdateenv(const fenv_t *__envp); + +#endif /* !_FENV_H_ */ diff --git a/lib/libc/include/math.h b/lib/libc/include/math.h new file mode 100644 index 0000000..13988cb --- /dev/null +++ b/lib/libc/include/math.h @@ -0,0 +1,274 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _MATH_H_ +#define _MATH_H_ 1 + +#define M_E 2.7182818284590452354 +#define M_LOG2E 1.4426950408889634074 +#define M_LOG10E 0.43429448190325182765 +#define M_LN2 0.69314718055994530942 +#define M_LN10 2.30258509299404568402 +#define M_PI 3.14159265358979323846 +#define M_PI_2 1.57079632679489661923 +#define M_PI_4 0.78539816339744830962 +#define M_1_PI 0.31830988618379067154 +#define M_2_PI 0.63661977236758134308 +#define M_2_SQRTPI 1.12837916709551257390 +#define M_SQRT2 1.41421356237309504880 +#define M_SQRT1_2 0.70710678118654752440 +#define M_PIl 3.141592653589793238462643383279502884L + +#define FP_ILOGBNAN (-1 - (int)(((unsigned)-1) >> 1)) +#define FP_ILOGB0 FP_ILOGBNAN +#define FP_INFINITE 1 +#define FP_NAN 2 +#define FP_NORMAL 4 +#define FP_SUBNORMAL 8 +#define FP_ZERO 16 + +#define isfinite(x) (fpclassify(x) & (FP_NORMAL | FP_SUBNORMAL | FP_ZERO)) +#define isnan(x) (fpclassify(x) == FP_NAN) +#define isinf(x) (fpclassify(x) == FP_INFINITE) +#define isnormal(x) (fpclassify(x) == FP_NORMAL) +#define signbit(x) (__builtin_signbit(x)) + +#define INFINITY (__builtin_inff()) +#define NAN (__builtin_nanf("")) + +int __fpclassify(double __x); +int __fpclassifyf(float __x); +int __fpclassifyl(long double __x); + +#define fpclassify(x) \ + (sizeof(x) == sizeof(double) ? __fpclassify(x) : \ + (sizeof(x) == sizeof(float) ? __fpclassifyf(x) : \ + (sizeof(x) == sizeof(long double) ? __fpclassifyl(x) : \ + 0))) + +typedef double double_t; +typedef float float_t; + +double exp10(double __x); +float exp10f(float __x); +long double exp10l(long double __x); + +double exp(double __x); +float expf(float __x); +long double expl(long double __x); + +double exp2(double __x); +float exp2f(float __x); +long double exp2l(long double __x); + +double expm1(double __x); +float expm1f(float __x); +long double expm1l(long double __x); + +double frexp(double __x, int *__power); +float frexpf(float __x, int *__power); +long double frexpl(long double __x, int *__power); + +int ilogb(double __x); +int ilogbf(float __x); +int ilogbl(long double __x); + +double ldexp(double __x, int __power); +float ldexpf(float __x, int __power); +long double ldexpl(long double __x, int __power); + +double log(double __x); +float logf(float __x); +long double logl(long double __x); + +double log10(double __x); +float log10f(float __x); +long double log10l(long double __x); + +double log1p(double __x); +float log1pf(float __x); +long double log1pl(long double __x); + +double log2(double __x); +float log2f(float __x); +long double log2l(long double __x); + +double logb(double __x); +float logbf(float __x); +long double logbl(long double __x); + +double modf(double __x, double *__integral); +float modff(float __x, float *__integral); +long double modfl(long double __x, long double *__integral); + +double scalbn(double __x, int __power); +float scalbnf(float __x, int __power); +long double scalbnl(long double __x, int __power); + +double scalbln(double __x, long __power); +float scalblnf(float __x, long __power); +long double scalblnl(long double __x, long __power); + +double cbrt(double __x); +float cbrtf(float __x); +long double cbrtl(long double __x); + +double fabs(double __x); +float fabsf(float __x); +long double fabsl(long double __x); + +double hypot(double __x, double __y); +float hypotf(float __x, float __y); +long double hypotl(long double __x, long double __y); + +double pow(double __x, double __y); +float powf(float __x, float __y); +long double powl(long double __x, long double __y); + +double sqrt(double __x); +float sqrtf(float __x); +long double sqrtl(long double __x); + +double erf(double __x); +float erff(float __x); +long double erfl(long double __x); + +double erfc(double __x); +float erfcf(float __x); +long double erfcl(long double __x); + +double lgamma(double __x); +float lgammaf(float __x); +long double lgammal(long double __x); + +double tgamma(double __x); +float tgammaf(float __x); +long double tgammal(long double __x); + +double ceil(double __x); +float ceilf(float __x); +long double ceill(long double __x); + +double floor(double __x); +float floorf(float __x); +long double floorl(long double __x); + +double nearbyint(double __x); +float nearbyintf(float __x); +long double nearbyintl(long double __x); + +double rint(double __x); +float rintf(float __x); +long double rintl(long double __x); + +long lrint(double __x); +long lrintf(float __x); +long lrintl(long double __x); + +long long llrint(double __x); +long long llrintf(float __x); +long long llrintl(long double __x); + +double round(double __x); +float roundf(float __x); +long double roundl(long double __x); + +long lround(double __x); +long lroundf(float __x); +long lroundl(long double __x); + +long long llround(double __x); +long long llroundf(float __x); +long long llroundl(long double __x); + +double trunc(double __x); +float truncf(float __x); +long double truncl(long double __x); + +double fmod(double __x, double __y); +float fmodf(float __x, float __y); +long double fmodl(long double __x, long double __y); + +double remainder(double __x, double __y); +float remainderf(float __x, float __y); +long double remainderl(long double __x, long double __y); + +double remquo(double __x, double __y, int *__quotient); +float remquof(float __x, float __y, int *__quotient); +long double remquol(long double __x, long double __y, int *__quotient); + +double copysign(double __x, double __sign); +float copysignf(float __x, float __sign); +long double copysignl(long double __x, long double __sign); + +double nan(const char *__tag); +float nanf(const char *__tag); +long double nanl(const char *__tag); + +double nextafter(double __x, double __dir); +float nextafterf(float __x, float __dir); +long double nextafterl(long double __x, long double __dir); + +double nexttoward(double __x, long double __dir); +float nexttowardf(float __x, long double __dir); +long double nexttowardl(long double __x, long double __dir); + +double fdim(double __x, double __y); +float fdimf(float __x, float __y); +long double fdiml(long double __x, long double __y); + +double fmax(double __x, double __y); +float fmaxf(float __x, float __y); +long double fmaxl(long double __x, long double __y); + +double fmin(double __x, double __y); +float fminf(float __x, float __y); +long double fminl(long double __x, long double __y); + +double atan(double __x); +float atanf(float __x); +long double atanl(long double __x); + +double atan2(double __x, double __y); +float atan2f(float __x, float __y); +long double atan2l(long double __x, long double __y); + +double cos(double __x); +float cosf(float __x); +long double cosl(long double __x); + +double sin(double __x); +float sinf(float __x); +long double sinl(long double __x); + +double tan(double __x); +float tanf(float __x); +long double tanl(long double __x); + +#endif /* !_MATH_H_ */ diff --git a/lib/libc/include/stdarg.h b/lib/libc/include/stdarg.h new file mode 100644 index 0000000..dc75475 --- /dev/null +++ b/lib/libc/include/stdarg.h @@ -0,0 +1,92 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _STDARG_H +#define _STDARG_H 1 + +#if defined(__STDC_VERSION__) && __STDC_VERSION__ >= 202311L +#define __STDC_VERSION_STDARG_H__ 202311L +#endif + +/* Determine which definitions are needed */ +#if !defined(__need___va_list) && !defined(__need_va_list) && \ + !defined(__need_va_arg) && \ + !defined(__need___va_copy) && !defined(__need_va_copy) +#define __need___va_list +#define __need_va_list +#define __need_va_arg +#define __need___va_copy +#if (defined(__STDC_VERSION__) && __STDC_VERSION__ >= 199901L) || (defined(__cplusplus) && __cplusplus >= 201103L) +#define __need_va_copy +#endif +#endif + +/* __gnuc_va_list type */ +#ifdef __need___va_list +#ifndef __GNUC_VA_LIST +#define __GNUC_VA_LIST +typedef __builtin_va_list __gnuc_va_list; +#endif /* !__GNUC_VA_LIST */ +#undef __need___va_list +#endif /* __need___va_list */ + +/* va_list type */ +#ifdef __need_va_list +#ifndef _VA_LIST +#define _VA_LIST +typedef __builtin_va_list va_list; +#endif /* !_VA_LIST */ +#undef __need_va_list +#endif /* __need_va_list */ + +/* va_start(), va_end(), and va_arg() macros */ +#ifdef __need_va_arg +#if defined(__STDC_VERSION__) && __STDC_VERSION__ >= 202311L +#define va_start(ap, ...) __builtin_va_start(ap, 0) +#else +#define va_start(ap, arg) __builtin_va_start(ap, arg) +#endif +#define va_end(ap) __builtin_va_end(ap) +#define va_arg(ap, type) __builtin_va_arg(ap, type) +#undef __need_va_arg +#endif /* __need_va_arg */ + +/* __va_copy() macro */ +#ifdef __need___va_copy +#define __va_copy(dest, src) __builtin_va_copy(dest, src) +#undef __need___va_copy +#endif /* __need___va_copy */ + +/* va_copy() macro */ +#ifdef __need_va_copy +#define va_copy(dest, src) __builtin_va_copy(dest, src) +#undef __need_va_copy +#endif /* __need_va_copy */ + +#endif /* !_STDARG_H */ diff --git a/lib/libc/include/stdatomic.h b/lib/libc/include/stdatomic.h new file mode 100644 index 0000000..3f80270 --- /dev/null +++ b/lib/libc/include/stdatomic.h @@ -0,0 +1,119 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _STDATOMIC_H +#define _STDATOMIC_H 1 + +#include <stddef.h> +#include <stdint.h> + +#if defined(__STDC_VERSION__) && __STDC_VERSION__ >= 202311L +#define __STDC_VERSION_STDATOMIC_H__ 202311L +#endif + +#if defined(__STDC_VERSION__) && __STDC_VERSION__ >= 201112L + +#define kill_dependency(y) (y) + +#if (defined(__STDC_VERSION__) && __STDC_VERSION__ < 202311L) || defined(__cplusplus) +/* Deprecated in C17, removed in C23 */ +#define ATOMIC_VAR_INIT(value) (value) +#endif + +#if (defined(__STDC_VERSION__) && __STDC_VERSION__ >= 202311L) || defined(__cplusplus) +#define ATOMIC_FLAG_INIT { false } +typedef _Atomic(bool) atomic_bool; +#else +#define ATOMIC_FLAG_INIT { 0 } +typedef _Atomic(_Bool) atomic_bool; +#endif + +typedef _Atomic(signed char) atomic_schar; + +typedef _Atomic(char) atomic_char; +typedef _Atomic(short) atomic_short; +typedef _Atomic(int) atomic_int; +typedef _Atomic(long) atomic_long; +typedef _Atomic(long long) atomic_llong; + +typedef _Atomic(unsigned char) atomic_uchar; +typedef _Atomic(unsigned short) atomic_ushort; +typedef _Atomic(unsigned int) atomic_uint; +typedef _Atomic(unsigned long) atomic_ulong; +typedef _Atomic(unsigned long long) atomic_ullong; + +typedef _Atomic(uintptr_t) atomic_uintptr_t; +typedef _Atomic(size_t) atomic_size_t; + +typedef struct atomic_flag { + atomic_bool _Value; +} atomic_flag; + +typedef enum memory_order { + memory_order_relaxed = __ATOMIC_RELAXED, + memory_order_consume = __ATOMIC_CONSUME, + memory_order_acquire = __ATOMIC_ACQUIRE, + memory_order_release = __ATOMIC_RELEASE, + memory_order_acq_rel = __ATOMIC_ACQ_REL, + memory_order_seq_cst = __ATOMIC_SEQ_CST +} memory_order; + +#define atomic_is_lock_free(obj) __atomic_is_lock_free(sizeof(*(obj)), 0) +#define atomic_flag_test_and_set(obj) __atomic_test_and_set((obj), memory_order_seq_cst) +#define atomic_flag_clear(obj) __atomic_clear((obj), memory_order_seq_cst) +#define atomic_load(obj) __atomic_load_n((obj), memory_order_seq_cst) +#define atomic_store(obj, desired) __atomic_store_n((obj), (desired), memory_order_seq_cst) +#define atomic_exchange(obj, desired) __atomic_exchange_n((obj), (desired), memory_order_seq_cst) +#define atomic_fetch_add(obj, arg) __atomic_fetch_add((obj), (arg), memory_order_seq_cst) +#define atomic_fetch_sub(obj, arg) __atomic_fetch_sub((obj), (arg), memory_order_seq_cst) +#define atomic_fetch_and(obj, arg) __atomic_fetch_and((obj), (arg), memory_order_seq_cst) +#define atomic_fetch_or(obj, arg) __atomic_fetch_or((obj), (arg), memory_order_seq_cst) +#define atomic_fetch_xor(obj, arg) __atomic_fetch_xor((obj), (arg), memory_order_seq_cst) + +#define atomic_signal_fence __atomic_signal_fence +#define atomic_thread_fence __atomic_thread_fence +#define atomic_flag_test_and_set_explicit __atomic_test_and_set +#define atomic_flag_clear_explicit __atomic_clear +#define atomic_load_explicit __atomic_load_n +#define atomic_store_explicit __atomic_store_n +#define atomic_exchange_explicit __atomic_exchange_n +#define atomic_fetch_add_explicit __atomic_fetch_add +#define atomic_fetch_sub_explicit __atomic_fetch_sub +#define atomic_fetch_and_explicit __atomic_fetch_and +#define atomic_fetch_or_explicit __atomic_fetch_or +#define atomic_fetch_xor_explicit __atomic_fetch_xor + +#define atomic_compare_exchange_strong(obj, expected, desired) __atomic_compare_exchange_n((obj), (expected), (desired), false, memory_order_seq_cst, memory_order_seq_cst) +#define atomic_compare_exchange_weak(obj, expected, desired) __atomic_compare_exchange_n((obj), (expected), (desired), true, memory_order_seq_cst, memory_order_seq_cst) +#define atomic_compare_exchange_strong_explicit __atomic_compare_exchange_n +#define atomic_compare_exchange_weak_explicit __atomic_compare_exchange_n + +#endif + +#endif /* !_STDATOMIC_H */ diff --git a/lib/libc/include/stddef.h b/lib/libc/include/stddef.h index 557f69b..642f773 100644 --- a/lib/libc/include/stddef.h +++ b/lib/libc/include/stddef.h @@ -28,18 +28,157 @@ */ #ifndef _STDDEF_H -#define _STDDEF_H +#define _STDDEF_H 1 -#include <sys/types.h> +#if defined(__STDC_VERSION__) && __STDC_VERSION__ >= 202311L +#define __STDC_VERSION_STDDEF_H__ 202311L +#endif + +/* Determine which definitions are needed */ +#if !defined(__need_NULL) && !defined(__need_nullptr_t) && \ + !defined(__need_size_t) && !defined(__need_rsize_t) && \ + !defined(__need_wchar_t) && !defined(__need_wint_t) && \ + !defined(__need_ptrdiff_t) && !defined(__need_max_align_t) && \ + !defined(__need_offsetof) && !defined(__need_unreachable) +#define __need_NULL +#if (defined(__STDC_VERSION__) && __STDC_VERSION__ >= 202311L) || defined(__cplusplus) +#define __need_nullptr_t +#endif +#define __need_ptrdiff_t +#define __need_size_t +#if defined(__STDC_WANT_LIB_EXT1__) && __STDC_WANT_LIB_EXT1__ >= 1 +#define __need_rsize_t +#endif +#define __need_wchar_t +#if (defined(__STDC_VERSION__) && __STDC_VERSION__ >= 201112L) || (defined(__cplusplus) && __cplusplus >= 201103L) +#define __need_max_align_t +#endif +#define __need_offsetof +#if defined(__STDC_VERSION__) && __STDC_VERSION__ >= 202311L +#define __need_unreachable +#endif +#endif +/* NULL pointer constant */ +#ifdef __need_NULL +#ifdef __cplusplus #if __cplusplus >= 201103L #define NULL nullptr -#elif defined(__cplusplus) +#else #define NULL 0L +#endif /* __cplusplus >= 201103L */ #else -#define NULL ((void *) 0) +#define NULL ((void *) 0) +#endif /* __cplusplus */ +#undef __need_NULL +#endif /* __need_NULL */ + +/* nullptr_t type */ +#ifdef __need_nullptr_t +#ifndef _NULLPTR_T +#define _NULLPTR_T +#if defined(__STDC_VERSION__) && __STDC_VERSION__ >= 202311L +typedef typeof(nullptr) nullptr_t; #endif +#endif /* !_NULLPTR_T */ +#undef __need_nullptr_t +#endif /* __need_nullptr_t */ + +/* size_t type */ +#ifdef __need_size_t +#ifndef _SIZE_T +#define _SIZE_T +#ifdef __SIZE_TYPE__ +typedef __SIZE_TYPE__ size_t; +#else +typedef long unsigned int size_t; +#endif /* __SIZE_TYPE__ */ +#endif /* !_SIZE_T */ +#undef __need_size_t +#endif /* __need_size_t */ + +/* rsize_t type */ +#ifdef __need_rsize_t +#ifndef _RSIZE_T +#define _RSIZE_T +#ifdef __SIZE_TYPE__ +typedef __SIZE_TYPE__ rsize_t; +#else +typedef long unsigned int rsize_t; +#endif /* __SIZE_TYPE__ */ +#endif /* !_RSIZE_T */ +#undef __need_rsize_t +#endif /* __need_rsize_t */ -typedef __size_t size_t; +/* wchar_t type */ +#ifdef __need_wchar_t +#ifndef _WCHAR_T +#define _WCHAR_T +#ifdef __WCHAR_TYPE__ +typedef __WCHAR_TYPE__ wchar_t; +#else +typedef int wchar_t; +#endif /* __WCHAR_TYPE__ */ +#endif /* !_WCHAR_T */ +#undef __need_wchar_t +#endif /* __need_wchar_t */ + +/* wint_t type */ +#ifdef __need_wint_t +#ifndef _WINT_T +#define _WINT_T +#ifdef __WINT_TYPE__ +typedef __WINT_TYPE__ wint_t; +#else +typedef unsigned int wint_t; +#endif /* __WINT_TYPE__ */ +#endif /* !_WINT_T */ +#undef __need_wint_t +#endif /* __need_wint_t */ + +/* ptrdiff_t type */ +#ifdef __need_ptrdiff_t +#ifndef _PTRDIFF_T +#define _PTRDIFF_T +#ifdef __PTRDIFF_TYPE__ +typedef __PTRDIFF_TYPE__ ptrdiff_t; +#else +typedef long int ptrdiff_t; +#endif /* __PTRDIFF_TYPE__ */ +#endif /* !_PTRDIFF_T */ +#undef __need_ptrdiff_t +#endif /* __need_ptrdiff_t */ + +/* max_align_t type */ +#ifdef __need_max_align_t +#if defined (_MSC_VER) +typedef double max_align_t; +#elif defined(__APPLE__) +typedef long double max_align_t; +#else +typedef struct { + long long __longlong __attribute__((__aligned__(__alignof__(long long)))); + long double __longdouble __attribute__((__aligned__(__alignof__(long double)))); +} max_align_t; +#endif +#undef __need_max_align_t +#endif /* __need_max_align_t */ + +/* offsetof() macro */ +#ifdef __need_offsetof +#ifndef offsetof +#define offsetof(type, member) __builtin_offsetof(type, member) +#endif +#undef __need_offsetof +#endif /* __need_offsetof */ + +/* unreachable() macro */ +#ifdef __need_unreachable +/* C++ has std::unreachable() */ +#if !defined(__cplusplus) && !defined(unreachable) +#define unreachable() __builtin_unreachable() +#endif +#undef __need_unreachable +#endif /* __need_unreachable */ #endif /* !_STDDEF_H */ diff --git a/lib/libc/include/stdio.h b/lib/libc/include/stdio.h new file mode 100644 index 0000000..37931ce --- /dev/null +++ b/lib/libc/include/stdio.h @@ -0,0 +1,106 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _STDIO_H +#define _STDIO_H 1 + +#include <sys/cdefs.h> +#define __need_NULL +#define __need_size_t +#include <stddef.h> +#include <unistd.h> +#define __need_va_list +#include <stdarg.h> + +#if __STDC_VERSION__ >= 202311L +#define __STDC_VERSION_STDIO_H__ 202311L +#endif + +/* Buffering modes */ +#define _IOFBF 0 /* Fully buffered */ +#define _IOLBF 1 /* Line buffered */ +#define _IONBF 2 /* Unbuffered */ + +/* Default buffer size */ +#define BUFSIZ 256 + +/* End-Of-File indicator */ +#define EOF (-1) + +/* Spec says these should be defined as macros */ +#define stdin stdin +#define stdout stdout +#define stderr stderr + +/* File structure */ +typedef struct _IO_FILE { + int fd; + int buf_mode; +} FILE; + +extern FILE *stdin; +extern FILE *stdout; +extern FILE *stderr; + +#define putc(c, stream) fputc((c), (stream)) +#define getc(stream) fgetc((stream)) + +__BEGIN_DECLS + +size_t fread(void *__restrict ptr, size_t size, size_t n, FILE *__restrict stream); +size_t fwrite(const void *__restrict ptr, size_t size, size_t n, FILE *__restrict stream); + +long ftell(FILE *stream); +char *fgets(char *__restrict s, int size, FILE *__restrict stream); + +FILE *fopen(const char *__restrict path, const char *__restrict mode); +int fseek(FILE *stream, long offset, int whence); +int fclose(FILE *stream); + +int vsnprintf(char *s, size_t size, const char *fmt, va_list ap); +int snprintf(char *s, size_t size, const char *fmt, ...); + +int printf(const char *__restrict fmt, ...); +int fileno(FILE *stream); +int fputc(int c, FILE *stream); + +int putchar(int c); +int fgetc(FILE *stream); +int getchar(void); + +#if defined(__STDC_VERSION__) && __STDC_VERSION__ >= 199901L +int fputs(const char *__restrict s, FILE *__restrict stream); +#else +int fputs(const char *s, FILE *stream); +#endif +int puts(const char *s); + +__END_DECLS + +#endif /* !_STDIO_H */ diff --git a/lib/libc/include/stdlib.h b/lib/libc/include/stdlib.h new file mode 100644 index 0000000..b1de3f3 --- /dev/null +++ b/lib/libc/include/stdlib.h @@ -0,0 +1,97 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _STDLIB_H +#define _STDLIB_H 1 + +/* For __dead */ +#include <sys/cdefs.h> + +/* Get specific definitions from stddef.h */ +#define __need_NULL +#define __need_size_t +#define __need_wchar_t +#include <stddef.h> + +#if __STDC_VERSION__ >= 202311L +#define __STDC_VERSION_STDLIB_H__ 202311L +#endif + +#define EXIT_SUCCESS 0 +#define EXIT_FAILURE 1 + +typedef struct { + int quot; + int rem; +} div_t; + +#ifndef __ldiv_t_defined +typedef struct { + long int quot; + long int rem; +} ldiv_t; +#define __ldiv_t_defined 1 +#endif /* !__ldiv_t_defined */ + +#ifndef __lldiv_t_defined +typedef struct { + long long int quot; + long long int rem; +} lldiv_t; +#define __lldiv_t_defined 1 +#endif /* !__lldiv_t_defined */ + +__BEGIN_DECLS + +#if (defined(__STDC_VERSION__) && __STDC_VERSION__ >= 202311L) || (defined(__cplusplus) && __cplusplus >= 201103L) +[[noreturn]] void abort(void); +[[noreturn]] void exit(int status); +[[noreturn]] void _Exit(int status); +#elif defined(__STDC_VERSION__) && __STDC_VERSION__ >= 201112L +_Noreturn void abort(void); +_Noreturn void exit(int status); +_Noreturn void _Exit(int status); +#else +__dead void abort(void); +__dead void exit(int status); +#if defined(__STDC_VERSION__) && __STDC_VERSION__ >= 199901L +__dead void _Exit(int status); +#endif +#endif + +void *malloc(size_t size); +void *realloc(void *ptr, size_t size); +void free(void *ptr); + +void srand(unsigned int r); +int rand(void); + +__END_DECLS + +#endif /* !_STDLIB_H */ diff --git a/lib/libc/include/string.h b/lib/libc/include/string.h index 60cde56..4ab1e45 100644 --- a/lib/libc/include/string.h +++ b/lib/libc/include/string.h @@ -31,10 +31,18 @@ #define _STRING_H_ 1 #include <stddef.h> +#include <stdint.h> size_t strlen(const char *s); +char *strtok(char *s, const char *delim); +char *strdup(const char *s); + void *memset(void *dst, int c, size_t n); int memcmp(const void *s1, const void *s2, size_t n); + +char *itoa(int64_t value, char *buf, int base); +void *memcpy(void *dest, const void *src, size_t n); int strcmp(const char *s1, const char *s2); +int atoi(const char *s); #endif /* !_STRING_H_ */ diff --git a/lib/libc/include/time.h b/lib/libc/include/time.h new file mode 100644 index 0000000..afb8adc --- /dev/null +++ b/lib/libc/include/time.h @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _TIME_H_ +#define _TIME_H_ 1 + +#include <sys/time.h> + +int sleep(struct timespec *__restrict tsp, struct timespec *__restrict remp); + +#endif /* !_TIME_H_ */ diff --git a/lib/libc/include/unistd.h b/lib/libc/include/unistd.h index 0a8c429..40ebee2 100644 --- a/lib/libc/include/unistd.h +++ b/lib/libc/include/unistd.h @@ -30,15 +30,56 @@ #ifndef _UNISTD_H #define _UNISTD_H +#include <sys/exec.h> #include <sys/types.h> #include <sys/cdefs.h> #include <stddef.h> +#define F_OK 0 + +/* lseek whence, follows Hyra ABI */ +#define SEEK_SET 0 +#define SEEK_CUR 1 +#define SEEK_END 2 + __BEGIN_DECLS +int sysconf(int name); +int setuid(uid_t new); + +int gethostname(char *name, size_t size); +int sethostname(const char *name, size_t size); + +uid_t getuid(void); +char *getlogin(void); + +char *getcwd(char *buf, size_t size); +char *getwd(char *pathname); + +int symlink(const char *target, const char *linkpath); +int synlinkat(const char *target, int newdirfd, const char *linkpath); + ssize_t read(int fd, void *buf, size_t count); ssize_t write(int fd, const void *buf, size_t count); + int close(int fd); +int access(const char *path, int mode); + +off_t lseek(int fildes, off_t offset, int whence); +int unlinkat(int dirfd, const char *pathname, int flags); +int unlink(const char *path); + +int dup(int fd); +int dup2(int fd, int fd1); + +pid_t getpid(void); +pid_t getppid(void); +pid_t fork(void); + +extern char *optarg; +extern int optind, opterr, optopt; + +int getopt(int argc, char *argv[], const char *optstring); __END_DECLS diff --git a/sys/arch/amd64/isa/i8042.S b/lib/libc/src/arch/aarch64/crti.S index 123d3a5..d95220b 100644 --- a/sys/arch/amd64/isa/i8042.S +++ b/lib/libc/src/arch/aarch64/crti.S @@ -27,11 +27,9 @@ * POSSIBILITY OF SUCH DAMAGE. */ -#include <machine/frameasm.h> - .text - .globl i8042_kb_isr -INTRENTRY(i8042_kb_isr, handle_kb) -handle_kb: - call i8042_kb_event - retq + .globl _start +_start: + mov fp, xzr + mov x0, sp +1: b 1b diff --git a/lib/libc/src/crypto/sha256.c b/lib/libc/src/crypto/sha256.c new file mode 100644 index 0000000..c722026 --- /dev/null +++ b/lib/libc/src/crypto/sha256.c @@ -0,0 +1,242 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <crypto/sha256.h> +#include <stdint.h> +#include <stddef.h> + +static inline uint32_t +rotr(uint32_t x, int n) +{ + return (x >> n) | (x << (32 - n)); +} + +static inline uint32_t +step1(uint32_t e, uint32_t f, uint32_t g) +{ + return (rotr(e, 6) ^ rotr(e, 11) ^ rotr(e, 25)) + ((e & f) ^ ((~ e) & g)); +} + +static inline uint32_t +step2(uint32_t a, uint32_t b, uint32_t c) +{ + return (rotr(a, 2) ^ rotr(a, 13) ^ rotr(a, 22)) + ((a & b) ^ (a & c) ^ (b & c)); +} + +static inline void +update_w(uint32_t *w, int i, const uint8_t *buffer) +{ + int j; + for (j = 0; j < 16; j++) { + if (i < 16){ + w[j] = + ((uint32_t)buffer[0] << 24) | + ((uint32_t)buffer[1] << 16) | + ((uint32_t)buffer[2] << 8) | + ((uint32_t)buffer[3]); + buffer += 4; + }else { + uint32_t a = w[(j + 1) & 15]; + uint32_t b = w[(j + 14) & 15]; + uint32_t s0 = (rotr(a, 7) ^ rotr(a, 18) ^ (a >> 3)); + uint32_t s1 = (rotr(b, 17) ^ rotr(b, 19) ^ (b >> 10)); + w[j] += w[(j + 9) & 15] + s0 + s1; + } + } +} + +static void +sha256_block(struct sha256 *sha) +{ + uint32_t *state = sha->state; + + static const uint32_t k[8 * 8] = { + 0x428a2f98, 0x71374491, 0xb5c0fbcf, 0xe9b5dba5, + 0x3956c25b, 0x59f111f1, 0x923f82a4, 0xab1c5ed5, + 0xd807aa98, 0x12835b01, 0x243185be, 0x550c7dc3, + 0x72be5d74, 0x80deb1fe, 0x9bdc06a7, 0xc19bf174, + 0xe49b69c1, 0xefbe4786, 0x0fc19dc6, 0x240ca1cc, + 0x2de92c6f, 0x4a7484aa, 0x5cb0a9dc, 0x76f988da, + 0x983e5152, 0xa831c66d, 0xb00327c8, 0xbf597fc7, + 0xc6e00bf3, 0xd5a79147, 0x06ca6351, 0x14292967, + 0x27b70a85, 0x2e1b2138, 0x4d2c6dfc, 0x53380d13, + 0x650a7354, 0x766a0abb, 0x81c2c92e, 0x92722c85, + 0xa2bfe8a1, 0xa81a664b, 0xc24b8b70, 0xc76c51a3, + 0xd192e819, 0xd6990624, 0xf40e3585, 0x106aa070, + 0x19a4c116, 0x1e376c08, 0x2748774c, 0x34b0bcb5, + 0x391c0cb3, 0x4ed8aa4a, 0x5b9cca4f, 0x682e6ff3, + 0x748f82ee, 0x78a5636f, 0x84c87814, 0x8cc70208, + 0x90befffa, 0xa4506ceb, 0xbef9a3f7, 0xc67178f2, + }; + + uint32_t a = state[0]; + uint32_t b = state[1]; + uint32_t c = state[2]; + uint32_t d = state[3]; + uint32_t e = state[4]; + uint32_t f = state[5]; + uint32_t g = state[6]; + uint32_t h = state[7]; + + uint32_t w[16]; + + int i, j; + for (i = 0; i < 64; i += 16) { + update_w(w, i, sha->buffer); + + for (j = 0; j < 16; j += 4) { + uint32_t temp; + temp = h + step1(e, f, g) + k[i + j + 0] + w[j + 0]; + h = temp + d; + d = temp + step2(a, b, c); + temp = g + step1(h, e, f) + k[i + j + 1] + w[j + 1]; + g = temp + c; + c = temp + step2(d, a, b); + temp = f + step1(g, h, e) + k[i + j + 2] + w[j + 2]; + f = temp + b; + b = temp + step2(c, d, a); + temp = e + step1(f, g, h) + k[i + j + 3] + w[j + 3]; + e = temp + a; + a = temp + step2(b, c, d); + } + } + + state[0] += a; + state[1] += b; + state[2] += c; + state[3] += d; + state[4] += e; + state[5] += f; + state[6] += g; + state[7] += h; +} + +void +sha256_init(struct sha256 *sha) +{ + sha->state[0] = 0x6a09e667; + sha->state[1] = 0xbb67ae85; + sha->state[2] = 0x3c6ef372; + sha->state[3] = 0xa54ff53a; + sha->state[4] = 0x510e527f; + sha->state[5] = 0x9b05688c; + sha->state[6] = 0x1f83d9ab; + sha->state[7] = 0x5be0cd19; + sha->n_bits = 0; + sha->buffer_counter = 0; +} + +void +sha256_append_byte(struct sha256 *sha, uint8_t byte) +{ + sha->buffer[sha->buffer_counter++] = byte; + sha->n_bits += 8; + + if (sha->buffer_counter == 64) { + sha->buffer_counter = 0; + sha256_block(sha); + } +} + +void +sha256_append(struct sha256 *sha, const void *src, size_t n_bytes) +{ + const uint8_t *bytes = (const uint8_t*)src; + size_t i; + + for (i = 0; i < n_bytes; i++) { + sha256_append_byte(sha, bytes[i]); + } +} + +void +sha256_finalize(struct sha256 *sha) +{ + int i; + uint64_t n_bits = sha->n_bits; + + sha256_append_byte(sha, 0x80); + + while (sha->buffer_counter != 56) { + sha256_append_byte(sha, 0); + } + + for (i = 7; i >= 0; i--) { + uint8_t byte = (n_bits >> 8 * i) & 0xff; + sha256_append_byte(sha, byte); + } +} + +void +sha256_finalize_hex(struct sha256 *sha, char *dst_hex65) +{ + int i, j; + sha256_finalize(sha); + + for (i = 0; i < 8; i++) { + for (j = 7; j >= 0; j--) { + uint8_t nibble = (sha->state[i] >> j * 4) & 0xf; + *dst_hex65++ = "0123456789abcdef"[nibble]; + } + } + + *dst_hex65 = '\0'; +} + +void +sha256_finalize_bytes(struct sha256 *sha, void *dst_bytes32) +{ + uint8_t *ptr = (uint8_t*)dst_bytes32; + int i, j; + sha256_finalize(sha); + + for (i = 0; i < 8; i++) { + for (j = 3; j >= 0; j--) { + *ptr++ = (sha->state[i] >> j * 8) & 0xff; + } + } +} + +void +sha256_hex(const void *src, size_t n_bytes, char *dst_hex65) +{ + struct sha256 sha; + + sha256_init(&sha); + sha256_append(&sha, src, n_bytes); + sha256_finalize_hex(&sha, dst_hex65); +} + +void sha256_bytes(const void *src, size_t n_bytes, void *dst_bytes32){ + struct sha256 sha; + + sha256_init(&sha); + sha256_append(&sha, src, n_bytes); + sha256_finalize_bytes(&sha, dst_bytes32); +} diff --git a/lib/libc/src/hyra/disk.c b/lib/libc/src/hyra/disk.c new file mode 100644 index 0000000..c7c7930 --- /dev/null +++ b/lib/libc/src/hyra/disk.c @@ -0,0 +1,125 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <sys/syscall.h> +#include <sys/disk.h> + +/* + * Disk I/O multiplexer system call which routes + * various disk operations via a single call. + * + * @id: The ID of the disk to be operated on + * @op: Operation code + * @param: Operation parameters + * + * Returns the number of bytes operated on upon success, + * otherwise a less than zero value is returned. + */ +ssize_t +__disk_io(diskid_t id, diskop_t op, const struct disk_param *param) +{ + if (param == NULL) { + return -EINVAL; + } + + return syscall( + SYS_disk, + id, + op, + (uintptr_t)param + ); +} + +/* + * Performs a write operation on a specific disk + * + * @id: ID of disk to operate on + * @blk: Block offset to operate on + * @buf: Data to write + * @len: Number of bytes to write + * + * Returns the number of bytes written upon success, otherwise + * a less than zero value is returned on error. + */ +ssize_t +disk_write(diskid_t id, blkoff_t blk, const void *buf, size_t len) +{ + struct disk_param param; + + if (buf == NULL || len == 0) { + return -EINVAL; + } + + disk_param_init((void *)buf, blk, len, ¶m); + return __disk_io(id, DISK_IO_WRITE, ¶m); +} + +/* + * Performs a read operation on a specific disk + * + * @id: ID of disk to operate on + * @blk: Block offset to operate on + * @buf: Buffer to read data into + * @len: Number of bytes to read + * + * Returns the number of bytes read upon success, otherwise + * a less than zero value is returned on error. + */ +ssize_t +disk_read(diskid_t id, blkoff_t blk, void *buf, size_t len) +{ + struct disk_param param; + + if (buf == NULL || len == 0) { + return -EINVAL; + } + + disk_param_init(buf, blk, len, ¶m); + return __disk_io(id, DISK_IO_READ, ¶m); +} + +/* + * Query information from a specific disk + * + * @id: ID of disk to query from + * @res: Resulting information goes here + */ +int +disk_query(diskid_t id, struct disk_info *res) +{ + struct disk_param param; + + if (res == NULL) { + return -EINVAL; + } + + disk_param_init(res, 0, sizeof(*res), ¶m); + return __disk_io(id, DISK_IO_QUERY, ¶m); +} diff --git a/lib/libc/src/hyra/inject.c b/lib/libc/src/hyra/inject.c new file mode 100644 index 0000000..b1fd7dc --- /dev/null +++ b/lib/libc/src/hyra/inject.c @@ -0,0 +1,51 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/syscall.h> +#include <sys/errno.h> +#include <sys/krq.h> +#include <stdlib.h> + +/* + * Inject a kernel runtime quantum + * + * @path: NULL for all builtin but deferrable drivers. + * They are not initialized more than once but + * can be send up through this routine. + */ +int +inject(const char *path) +{ + /* TODO: Support this */ + if (path != NULL) { + return -EINVAL; + } + + return syscall(SYS_inject, (uintptr_t)path); +} diff --git a/lib/libc/src/hyra/mmap.c b/lib/libc/src/hyra/mmap.c new file mode 100644 index 0000000..6870c75 --- /dev/null +++ b/lib/libc/src/hyra/mmap.c @@ -0,0 +1,47 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/syscall.h> +#include <sys/mman.h> +#include <sys/types.h> + +void * +mmap(void *addr, size_t len, int prot, int flags, + int fildes, off_t off) + +{ + return (void *)syscall(SYS_mmap, (uintptr_t)addr, len, + prot, flags, fildes, off); +} + +int +munmap(void *addr, size_t len) +{ + return syscall(SYS_munmap, (uintptr_t)addr, len); +} diff --git a/lib/libc/src/hyra/sleep.c b/lib/libc/src/hyra/sleep.c new file mode 100644 index 0000000..14830f6 --- /dev/null +++ b/lib/libc/src/hyra/sleep.c @@ -0,0 +1,43 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/syscall.h> +#include <time.h> + +/* + * Sleep using a timespec value + * + * @tsp: Timespec to sleep with + * @remp: Remaining time if interrupted during sleep + */ +int +sleep(struct timespec *__restrict tsp, struct timespec *__restrict remp) +{ + return syscall(SYS_sleep, (uintptr_t)tsp, (uintptr_t)remp); +} diff --git a/lib/libc/src/hyra/socket.c b/lib/libc/src/hyra/socket.c new file mode 100644 index 0000000..2a62541 --- /dev/null +++ b/lib/libc/src/hyra/socket.c @@ -0,0 +1,86 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/socket.h> +#include <sys/syscall.h> + +int +socket(int domain, int type, int protocol) +{ + return syscall(SYS_socket, domain, type, protocol); +} + +int +bind(int sockfd, const struct sockaddr *addr, socklen_t len) +{ + return syscall(SYS_bind, sockfd, (uintptr_t)addr, len); +} + +ssize_t +send(int sockfd, const void *buf, size_t size, int flags) +{ + return syscall(SYS_send, sockfd, (uintptr_t)buf, size, flags); +} + +ssize_t +recv(int sockfd, void *buf, size_t len, int flags) +{ + return syscall(SYS_recv, sockfd, (uintptr_t)buf, len, flags); +} + +ssize_t +sendmsg(int socket, const struct msghdr *msg, int flags) +{ + return syscall(SYS_sendmsg, socket, (uintptr_t)msg, flags); +} + +ssize_t +recvmsg(int socket, struct msghdr *msg, int flags) +{ + return syscall(SYS_recvmsg, socket, (uintptr_t)msg, flags); +} + +int +connect(int socket, const struct sockaddr *address, socklen_t len) +{ + return syscall(SYS_connect, socket, (uintptr_t)address, len); +} + +int +setsockopt(int sockfd, int level, int name, const void *v, socklen_t len) +{ + return syscall( + SYS_setsockopt, + sockfd, + level, + name, + (uintptr_t)v, + len + ); +} diff --git a/lib/libc/src/hyra/spawn.c b/lib/libc/src/hyra/spawn.c index 227d8f7..b4c92ef 100644 --- a/lib/libc/src/hyra/spawn.c +++ b/lib/libc/src/hyra/spawn.c @@ -35,10 +35,13 @@ * Spawn a process * * @pathname: Path to executable. + * @argv: Argument vector + * @envp: Environment vector * @flags: Spawn flags. */ pid_t -spawn(const char *pathname, int flags) +spawn(const char *pathname, char **argv, char **envp, int flags) { - return syscall(SYS_spawn, (uintptr_t)pathname, flags); + return syscall(SYS_spawn, (uintptr_t)pathname, (uintptr_t)argv, + (uintptr_t)envp, flags); } diff --git a/lib/libc/src/hyra/stat.c b/lib/libc/src/hyra/stat.c new file mode 100644 index 0000000..42a353b --- /dev/null +++ b/lib/libc/src/hyra/stat.c @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/stat.h> +#include <sys/syscall.h> + +int +stat(const char *path, struct stat *buf) +{ + return syscall(SYS_stat, (uintptr_t)path, (uintptr_t)buf); +} diff --git a/lib/libc/src/hyra/sysctl.c b/lib/libc/src/hyra/sysctl.c new file mode 100644 index 0000000..2903e6f --- /dev/null +++ b/lib/libc/src/hyra/sysctl.c @@ -0,0 +1,38 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/syscall.h> +#include <sys/sysctl.h> + +int +sysctl(struct sysctl_args *args) +{ + return syscall(SYS_sysctl, (uintptr_t)args); +} diff --git a/lib/libc/src/hyra/wait.c b/lib/libc/src/hyra/wait.c new file mode 100644 index 0000000..99f9228 --- /dev/null +++ b/lib/libc/src/hyra/wait.c @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/syscall.h> +#include <sys/wait.h> + +pid_t +waitpid(pid_t pid, int *wstatus, int options) +{ + return syscall(SYS_waitpid, pid, (uintptr_t)wstatus, options); +} diff --git a/lib/libc/src/main.c b/lib/libc/src/main.c index 1154b21..68f9bdb 100644 --- a/lib/libc/src/main.c +++ b/lib/libc/src/main.c @@ -27,13 +27,57 @@ * POSSIBILITY OF SUCH DAMAGE. */ +#include <sys/exec.h> #include <stdint.h> #include <stddef.h> +#include <unistd.h> + +extern int __libc_stdio_init(void); +extern int __malloc_mem_init(void); +uint64_t __libc_auxv[_AT_MAX]; int main(int argc, char **argv); +struct auxv_entry { + uint64_t tag; + uint64_t val; +}; + int __libc_entry(uint64_t *ctx) { - return main(0, NULL); + const struct auxv_entry *auxvp; + int status; + uint64_t argc, envc, tag; + char **argv; + char **envp; + + optind = 1; + argc = *ctx; + argv = (char **)(ctx + 1); + envp = (char **)(argv + argc + 1); + + envc = 0; + while (envp[envc] != NULL) { + ++envc; + } + + auxvp = (void *)(envp + envc + 1); + for (int i = 0; i < _AT_MAX; ++i) { + if (auxvp->tag == AT_NULL) { + break; + } + if (auxvp->tag < _AT_MAX) { + __libc_auxv[auxvp->tag] = auxvp->val; + } + + ++auxvp; + } + + if ((status = __libc_stdio_init()) != 0) { + return status; + } + + __malloc_mem_init(); + return main(argc, argv); } diff --git a/lib/libc/src/musl-math/__cos.c b/lib/libc/src/musl-math/__cos.c new file mode 100644 index 0000000..46cefb3 --- /dev/null +++ b/lib/libc/src/musl-math/__cos.c @@ -0,0 +1,71 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_cos.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * __cos( x, y ) + * kernel cos function on [-pi/4, pi/4], pi/4 ~ 0.785398164 + * Input x is assumed to be bounded by ~pi/4 in magnitude. + * Input y is the tail of x. + * + * Algorithm + * 1. Since cos(-x) = cos(x), we need only to consider positive x. + * 2. if x < 2^-27 (hx<0x3e400000 0), return 1 with inexact if x!=0. + * 3. cos(x) is approximated by a polynomial of degree 14 on + * [0,pi/4] + * 4 14 + * cos(x) ~ 1 - x*x/2 + C1*x + ... + C6*x + * where the remez error is + * + * | 2 4 6 8 10 12 14 | -58 + * |cos(x)-(1-.5*x +C1*x +C2*x +C3*x +C4*x +C5*x +C6*x )| <= 2 + * | | + * + * 4 6 8 10 12 14 + * 4. let r = C1*x +C2*x +C3*x +C4*x +C5*x +C6*x , then + * cos(x) ~ 1 - x*x/2 + r + * since cos(x+y) ~ cos(x) - sin(x)*y + * ~ cos(x) - x*y, + * a correction term is necessary in cos(x) and hence + * cos(x+y) = 1 - (x*x/2 - (r - x*y)) + * For better accuracy, rearrange to + * cos(x+y) ~ w + (tmp + (r-x*y)) + * where w = 1 - x*x/2 and tmp is a tiny correction term + * (1 - x*x/2 == w + tmp exactly in infinite precision). + * The exactness of w + tmp in infinite precision depends on w + * and tmp having the same precision as x. If they have extra + * precision due to compiler bugs, then the extra precision is + * only good provided it is retained in all terms of the final + * expression for cos(). Retention happens in all cases tested + * under FreeBSD, so don't pessimize things by forcibly clipping + * any extra precision in w. + */ + +#include "libm.h" + +static const double +C1 = 4.16666666666666019037e-02, /* 0x3FA55555, 0x5555554C */ +C2 = -1.38888888888741095749e-03, /* 0xBF56C16C, 0x16C15177 */ +C3 = 2.48015872894767294178e-05, /* 0x3EFA01A0, 0x19CB1590 */ +C4 = -2.75573143513906633035e-07, /* 0xBE927E4F, 0x809C52AD */ +C5 = 2.08757232129817482790e-09, /* 0x3E21EE9E, 0xBDB4B1C4 */ +C6 = -1.13596475577881948265e-11; /* 0xBDA8FAE9, 0xBE8838D4 */ + +double __cos(double x, double y) +{ + double_t hz,z,r,w; + + z = x*x; + w = z*z; + r = z*(C1+z*(C2+z*C3)) + w*w*(C4+z*(C5+z*C6)); + hz = 0.5*z; + w = 1.0-hz; + return w + (((1.0-w)-hz) + (z*r-x*y)); +} diff --git a/lib/libc/src/musl-math/__cosdf.c b/lib/libc/src/musl-math/__cosdf.c new file mode 100644 index 0000000..2124989 --- /dev/null +++ b/lib/libc/src/musl-math/__cosdf.c @@ -0,0 +1,35 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_cosf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Debugged and optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* |cos(x) - c(x)| < 2**-34.1 (~[-5.37e-11, 5.295e-11]). */ +static const double +C0 = -0x1ffffffd0c5e81.0p-54, /* -0.499999997251031003120 */ +C1 = 0x155553e1053a42.0p-57, /* 0.0416666233237390631894 */ +C2 = -0x16c087e80f1e27.0p-62, /* -0.00138867637746099294692 */ +C3 = 0x199342e0ee5069.0p-68; /* 0.0000243904487962774090654 */ + +float __cosdf(double x) +{ + double_t r, w, z; + + /* Try to optimize for parallel evaluation as in __tandf.c. */ + z = x*x; + w = z*z; + r = C2+z*C3; + return ((1.0+z*C0) + w*C1) + (w*z)*r; +} diff --git a/lib/libc/src/musl-math/__cosl.c b/lib/libc/src/musl-math/__cosl.c new file mode 100644 index 0000000..fa522dd --- /dev/null +++ b/lib/libc/src/musl-math/__cosl.c @@ -0,0 +1,96 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/k_cosl.c */ +/* origin: FreeBSD /usr/src/lib/msun/ld128/k_cosl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * Copyright (c) 2008 Steven G. Kargl, David Schultz, Bruce D. Evans. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + + +#include "libm.h" + +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#if LDBL_MANT_DIG == 64 +/* + * ld80 version of __cos.c. See __cos.c for most comments. + */ +/* + * Domain [-0.7854, 0.7854], range ~[-2.43e-23, 2.425e-23]: + * |cos(x) - c(x)| < 2**-75.1 + * + * The coefficients of c(x) were generated by a pari-gp script using + * a Remez algorithm that searches for the best higher coefficients + * after rounding leading coefficients to a specified precision. + * + * Simpler methods like Chebyshev or basic Remez barely suffice for + * cos() in 64-bit precision, because we want the coefficient of x^2 + * to be precisely -0.5 so that multiplying by it is exact, and plain + * rounding of the coefficients of a good polynomial approximation only + * gives this up to about 64-bit precision. Plain rounding also gives + * a mediocre approximation for the coefficient of x^4, but a rounding + * error of 0.5 ulps for this coefficient would only contribute ~0.01 + * ulps to the final error, so this is unimportant. Rounding errors in + * higher coefficients are even less important. + * + * In fact, coefficients above the x^4 one only need to have 53-bit + * precision, and this is more efficient. We get this optimization + * almost for free from the complications needed to search for the best + * higher coefficients. + */ +static const long double +C1 = 0.0416666666666666666136L; /* 0xaaaaaaaaaaaaaa9b.0p-68 */ +static const double +C2 = -0.0013888888888888874, /* -0x16c16c16c16c10.0p-62 */ +C3 = 0.000024801587301571716, /* 0x1a01a01a018e22.0p-68 */ +C4 = -0.00000027557319215507120, /* -0x127e4fb7602f22.0p-74 */ +C5 = 0.0000000020876754400407278, /* 0x11eed8caaeccf1.0p-81 */ +C6 = -1.1470297442401303e-11, /* -0x19393412bd1529.0p-89 */ +C7 = 4.7383039476436467e-14; /* 0x1aac9d9af5c43e.0p-97 */ +#define POLY(z) (z*(C1+z*(C2+z*(C3+z*(C4+z*(C5+z*(C6+z*C7))))))) +#elif LDBL_MANT_DIG == 113 +/* + * ld128 version of __cos.c. See __cos.c for most comments. + */ +/* + * Domain [-0.7854, 0.7854], range ~[-1.80e-37, 1.79e-37]: + * |cos(x) - c(x))| < 2**-122.0 + * + * 113-bit precision requires more care than 64-bit precision, since + * simple methods give a minimax polynomial with coefficient for x^2 + * that is 1 ulp below 0.5, but we want it to be precisely 0.5. See + * above for more details. + */ +static const long double +C1 = 0.04166666666666666666666666666666658424671L, +C2 = -0.001388888888888888888888888888863490893732L, +C3 = 0.00002480158730158730158730158600795304914210L, +C4 = -0.2755731922398589065255474947078934284324e-6L, +C5 = 0.2087675698786809897659225313136400793948e-8L, +C6 = -0.1147074559772972315817149986812031204775e-10L, +C7 = 0.4779477332386808976875457937252120293400e-13L; +static const double +C8 = -0.1561920696721507929516718307820958119868e-15, +C9 = 0.4110317413744594971475941557607804508039e-18, +C10 = -0.8896592467191938803288521958313920156409e-21, +C11 = 0.1601061435794535138244346256065192782581e-23; +#define POLY(z) (z*(C1+z*(C2+z*(C3+z*(C4+z*(C5+z*(C6+z*(C7+ \ + z*(C8+z*(C9+z*(C10+z*C11))))))))))) +#endif + +long double __cosl(long double x, long double y) +{ + long double hz,z,r,w; + + z = x*x; + r = POLY(z); + hz = 0.5*z; + w = 1.0-hz; + return w + (((1.0-w)-hz) + (z*r-x*y)); +} +#endif diff --git a/lib/libc/src/musl-math/__expo2.c b/lib/libc/src/musl-math/__expo2.c new file mode 100644 index 0000000..740ac68 --- /dev/null +++ b/lib/libc/src/musl-math/__expo2.c @@ -0,0 +1,16 @@ +#include "libm.h" + +/* k is such that k*ln2 has minimal relative error and x - kln2 > log(DBL_MIN) */ +static const int k = 2043; +static const double kln2 = 0x1.62066151add8bp+10; + +/* exp(x)/2 for x >= log(DBL_MAX), slightly better than 0.5*exp(x/2)*exp(x/2) */ +double __expo2(double x) +{ + double scale; + + /* note that k is odd and scale*scale overflows */ + INSERT_WORDS(scale, (uint32_t)(0x3ff + k/2) << 20, 0); + /* exp(x - k ln2) * 2**(k-1) */ + return exp(x - kln2) * scale * scale; +} diff --git a/lib/libc/src/musl-math/__expo2f.c b/lib/libc/src/musl-math/__expo2f.c new file mode 100644 index 0000000..5163e41 --- /dev/null +++ b/lib/libc/src/musl-math/__expo2f.c @@ -0,0 +1,16 @@ +#include "libm.h" + +/* k is such that k*ln2 has minimal relative error and x - kln2 > log(FLT_MIN) */ +static const int k = 235; +static const float kln2 = 0x1.45c778p+7f; + +/* expf(x)/2 for x >= log(FLT_MAX), slightly better than 0.5f*expf(x/2)*expf(x/2) */ +float __expo2f(float x) +{ + float scale; + + /* note that k is odd and scale*scale overflows */ + SET_FLOAT_WORD(scale, (uint32_t)(0x7f + k/2) << 23); + /* exp(x - k ln2) * 2**(k-1) */ + return expf(x - kln2) * scale * scale; +} diff --git a/lib/libc/src/musl-math/__fpclassify.c b/lib/libc/src/musl-math/__fpclassify.c new file mode 100644 index 0000000..f7c0e2d --- /dev/null +++ b/lib/libc/src/musl-math/__fpclassify.c @@ -0,0 +1,11 @@ +#include <math.h> +#include <stdint.h> + +int __fpclassify(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i>>52 & 0x7ff; + if (!e) return u.i<<1 ? FP_SUBNORMAL : FP_ZERO; + if (e==0x7ff) return u.i<<12 ? FP_NAN : FP_INFINITE; + return FP_NORMAL; +} diff --git a/lib/libc/src/musl-math/__fpclassifyf.c b/lib/libc/src/musl-math/__fpclassifyf.c new file mode 100644 index 0000000..fd00eb1 --- /dev/null +++ b/lib/libc/src/musl-math/__fpclassifyf.c @@ -0,0 +1,11 @@ +#include <math.h> +#include <stdint.h> + +int __fpclassifyf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = u.i>>23 & 0xff; + if (!e) return u.i<<1 ? FP_SUBNORMAL : FP_ZERO; + if (e==0xff) return u.i<<9 ? FP_NAN : FP_INFINITE; + return FP_NORMAL; +} diff --git a/lib/libc/src/musl-math/__fpclassifyl.c b/lib/libc/src/musl-math/__fpclassifyl.c new file mode 100644 index 0000000..fb62dd9 --- /dev/null +++ b/lib/libc/src/musl-math/__fpclassifyl.c @@ -0,0 +1,42 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +int __fpclassifyl(long double x) +{ + return __fpclassify(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +int __fpclassifyl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + int msb = u.i.m>>63; + if (!e && !msb) + return u.i.m ? FP_SUBNORMAL : FP_ZERO; + if (e == 0x7fff) { + /* The x86 variant of 80-bit extended precision only admits + * one representation of each infinity, with the mantissa msb + * necessarily set. The version with it clear is invalid/nan. + * The m68k variant, however, allows either, and tooling uses + * the version with it clear. */ + if (__BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__ && !msb) + return FP_NAN; + return u.i.m << 1 ? FP_NAN : FP_INFINITE; + } + if (!msb) + return FP_NAN; + return FP_NORMAL; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +int __fpclassifyl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + u.i.se = 0; + if (!e) + return u.i2.lo | u.i2.hi ? FP_SUBNORMAL : FP_ZERO; + if (e == 0x7fff) + return u.i2.lo | u.i2.hi ? FP_NAN : FP_INFINITE; + return FP_NORMAL; +} +#endif diff --git a/lib/libc/src/musl-math/__invtrigl.c b/lib/libc/src/musl-math/__invtrigl.c new file mode 100644 index 0000000..48f83aa --- /dev/null +++ b/lib/libc/src/musl-math/__invtrigl.c @@ -0,0 +1,63 @@ +#include <float.h> +#include "__invtrigl.h" + +#if LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +static const long double +pS0 = 1.66666666666666666631e-01L, +pS1 = -4.16313987993683104320e-01L, +pS2 = 3.69068046323246813704e-01L, +pS3 = -1.36213932016738603108e-01L, +pS4 = 1.78324189708471965733e-02L, +pS5 = -2.19216428382605211588e-04L, +pS6 = -7.10526623669075243183e-06L, +qS1 = -2.94788392796209867269e+00L, +qS2 = 3.27309890266528636716e+00L, +qS3 = -1.68285799854822427013e+00L, +qS4 = 3.90699412641738801874e-01L, +qS5 = -3.14365703596053263322e-02L; + +const long double pio2_hi = 1.57079632679489661926L; +const long double pio2_lo = -2.50827880633416601173e-20L; + +/* used in asinl() and acosl() */ +/* R(x^2) is a rational approximation of (asin(x)-x)/x^3 with Remez algorithm */ +long double __invtrigl_R(long double z) +{ + long double p, q; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*(pS5+z*pS6)))))); + q = 1.0+z*(qS1+z*(qS2+z*(qS3+z*(qS4+z*qS5)))); + return p/q; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +static const long double +pS0 = 1.66666666666666666666666666666700314e-01L, +pS1 = -7.32816946414566252574527475428622708e-01L, +pS2 = 1.34215708714992334609030036562143589e+00L, +pS3 = -1.32483151677116409805070261790752040e+00L, +pS4 = 7.61206183613632558824485341162121989e-01L, +pS5 = -2.56165783329023486777386833928147375e-01L, +pS6 = 4.80718586374448793411019434585413855e-02L, +pS7 = -4.42523267167024279410230886239774718e-03L, +pS8 = 1.44551535183911458253205638280410064e-04L, +pS9 = -2.10558957916600254061591040482706179e-07L, +qS1 = -4.84690167848739751544716485245697428e+00L, +qS2 = 9.96619113536172610135016921140206980e+00L, +qS3 = -1.13177895428973036660836798461641458e+01L, +qS4 = 7.74004374389488266169304117714658761e+00L, +qS5 = -3.25871986053534084709023539900339905e+00L, +qS6 = 8.27830318881232209752469022352928864e-01L, +qS7 = -1.18768052702942805423330715206348004e-01L, +qS8 = 8.32600764660522313269101537926539470e-03L, +qS9 = -1.99407384882605586705979504567947007e-04L; + +const long double pio2_hi = 1.57079632679489661923132169163975140L; +const long double pio2_lo = 4.33590506506189051239852201302167613e-35L; + +long double __invtrigl_R(long double z) +{ + long double p, q; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*(pS5+z*(pS6+z*(pS7+z*(pS8+z*pS9))))))))); + q = 1.0+z*(qS1+z*(qS2+z*(qS3+z*(qS4+z*(qS5+z*(qS6+z*(qS7+z*(qS8+z*qS9)))))))); + return p/q; +} +#endif diff --git a/lib/libc/src/musl-math/__invtrigl.h b/lib/libc/src/musl-math/__invtrigl.h new file mode 100644 index 0000000..6dedac3 --- /dev/null +++ b/lib/libc/src/musl-math/__invtrigl.h @@ -0,0 +1,11 @@ +/* shared by acosl, asinl and atan2l */ +#define pio2_hi __pio2_hi +#define pio2_lo __pio2_lo + +#ifndef __MLIBC_ABI_ONLY + +extern const long double pio2_hi, pio2_lo; + +long double __invtrigl_R(long double z); + +#endif /* !__MLIBC_ABI_ONLY */ diff --git a/lib/libc/src/musl-math/__polevll.c b/lib/libc/src/musl-math/__polevll.c new file mode 100644 index 0000000..ce1a840 --- /dev/null +++ b/lib/libc/src/musl-math/__polevll.c @@ -0,0 +1,93 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/polevll.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Evaluate polynomial + * + * + * SYNOPSIS: + * + * int N; + * long double x, y, coef[N+1], polevl[]; + * + * y = polevll( x, coef, N ); + * + * + * DESCRIPTION: + * + * Evaluates polynomial of degree N: + * + * 2 N + * y = C + C x + C x +...+ C x + * 0 1 2 N + * + * Coefficients are stored in reverse order: + * + * coef[0] = C , ..., coef[N] = C . + * N 0 + * + * The function p1evll() assumes that coef[N] = 1.0 and is + * omitted from the array. Its calling arguments are + * otherwise the same as polevll(). + * + * + * SPEED: + * + * In the interest of speed, there are no checks for out + * of bounds arithmetic. This routine is used by most of + * the functions in the library. Depending on available + * equipment features, the user may wish to rewrite the + * program in microcode or assembly language. + * + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +#else +/* + * Polynomial evaluator: + * P[0] x^n + P[1] x^(n-1) + ... + P[n] + */ +long double __polevll(long double x, const long double *P, int n) +{ + long double y; + + y = *P++; + do { + y = y * x + *P++; + } while (--n); + + return y; +} + +/* + * Polynomial evaluator: + * x^n + P[0] x^(n-1) + P[1] x^(n-2) + ... + P[n] + */ +long double __p1evll(long double x, const long double *P, int n) +{ + long double y; + + n -= 1; + y = x + *P++; + do { + y = y * x + *P++; + } while (--n); + + return y; +} +#endif diff --git a/lib/libc/src/musl-math/__rem_pio2.c b/lib/libc/src/musl-math/__rem_pio2.c new file mode 100644 index 0000000..d403f81 --- /dev/null +++ b/lib/libc/src/musl-math/__rem_pio2.c @@ -0,0 +1,177 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_rem_pio2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + * Optimized by Bruce D. Evans. + */ +/* __rem_pio2(x,y) + * + * return the remainder of x rem pi/2 in y[0]+y[1] + * use __rem_pio2_large() for large x + */ + +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif + +/* + * invpio2: 53 bits of 2/pi + * pio2_1: first 33 bit of pi/2 + * pio2_1t: pi/2 - pio2_1 + * pio2_2: second 33 bit of pi/2 + * pio2_2t: pi/2 - (pio2_1+pio2_2) + * pio2_3: third 33 bit of pi/2 + * pio2_3t: pi/2 - (pio2_1+pio2_2+pio2_3) + */ +static const double +toint = 1.5/EPS, +invpio2 = 6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */ +pio2_1 = 1.57079632673412561417e+00, /* 0x3FF921FB, 0x54400000 */ +pio2_1t = 6.07710050650619224932e-11, /* 0x3DD0B461, 0x1A626331 */ +pio2_2 = 6.07710050630396597660e-11, /* 0x3DD0B461, 0x1A600000 */ +pio2_2t = 2.02226624879595063154e-21, /* 0x3BA3198A, 0x2E037073 */ +pio2_3 = 2.02226624871116645580e-21, /* 0x3BA3198A, 0x2E000000 */ +pio2_3t = 8.47842766036889956997e-32; /* 0x397B839A, 0x252049C1 */ + +/* caller must handle the case when reduction is not needed: |x| ~<= pi/4 */ +int __rem_pio2(double x, double *y) +{ + union {double f; uint64_t i;} u = {x}; + double_t z,w,t,r,fn; + double tx[3],ty[2]; + uint32_t ix; + int sign, n, ex, ey, i; + + sign = u.i>>63; + ix = u.i>>32 & 0x7fffffff; + if (ix <= 0x400f6a7a) { /* |x| ~<= 5pi/4 */ + if ((ix & 0xfffff) == 0x921fb) /* |x| ~= pi/2 or 2pi/2 */ + goto medium; /* cancellation -- use medium case */ + if (ix <= 0x4002d97c) { /* |x| ~<= 3pi/4 */ + if (!sign) { + z = x - pio2_1; /* one round good to 85 bits */ + y[0] = z - pio2_1t; + y[1] = (z-y[0]) - pio2_1t; + return 1; + } else { + z = x + pio2_1; + y[0] = z + pio2_1t; + y[1] = (z-y[0]) + pio2_1t; + return -1; + } + } else { + if (!sign) { + z = x - 2*pio2_1; + y[0] = z - 2*pio2_1t; + y[1] = (z-y[0]) - 2*pio2_1t; + return 2; + } else { + z = x + 2*pio2_1; + y[0] = z + 2*pio2_1t; + y[1] = (z-y[0]) + 2*pio2_1t; + return -2; + } + } + } + if (ix <= 0x401c463b) { /* |x| ~<= 9pi/4 */ + if (ix <= 0x4015fdbc) { /* |x| ~<= 7pi/4 */ + if (ix == 0x4012d97c) /* |x| ~= 3pi/2 */ + goto medium; + if (!sign) { + z = x - 3*pio2_1; + y[0] = z - 3*pio2_1t; + y[1] = (z-y[0]) - 3*pio2_1t; + return 3; + } else { + z = x + 3*pio2_1; + y[0] = z + 3*pio2_1t; + y[1] = (z-y[0]) + 3*pio2_1t; + return -3; + } + } else { + if (ix == 0x401921fb) /* |x| ~= 4pi/2 */ + goto medium; + if (!sign) { + z = x - 4*pio2_1; + y[0] = z - 4*pio2_1t; + y[1] = (z-y[0]) - 4*pio2_1t; + return 4; + } else { + z = x + 4*pio2_1; + y[0] = z + 4*pio2_1t; + y[1] = (z-y[0]) + 4*pio2_1t; + return -4; + } + } + } + if (ix < 0x413921fb) { /* |x| ~< 2^20*(pi/2), medium size */ +medium: + /* rint(x/(pi/2)), Assume round-to-nearest. */ + fn = (double_t)x*invpio2 + toint - toint; + n = (int32_t)fn; + r = x - fn*pio2_1; + w = fn*pio2_1t; /* 1st round, good to 85 bits */ + y[0] = r - w; + u.f = y[0]; + ey = u.i>>52 & 0x7ff; + ex = ix>>20; + if (ex - ey > 16) { /* 2nd round, good to 118 bits */ + t = r; + w = fn*pio2_2; + r = t - w; + w = fn*pio2_2t - ((t-r)-w); + y[0] = r - w; + u.f = y[0]; + ey = u.i>>52 & 0x7ff; + if (ex - ey > 49) { /* 3rd round, good to 151 bits, covers all cases */ + t = r; + w = fn*pio2_3; + r = t - w; + w = fn*pio2_3t - ((t-r)-w); + y[0] = r - w; + } + } + y[1] = (r - y[0]) - w; + return n; + } + /* + * all other (large) arguments + */ + if (ix >= 0x7ff00000) { /* x is inf or NaN */ + y[0] = y[1] = x - x; + return 0; + } + /* set z = scalbn(|x|,-ilogb(x)+23) */ + u.f = x; + u.i &= (uint64_t)-1>>12; + u.i |= (uint64_t)(0x3ff + 23)<<52; + z = u.f; + for (i=0; i < 2; i++) { + tx[i] = (double)(int32_t)z; + z = (z-tx[i])*0x1p24; + } + tx[i] = z; + /* skip zero terms, first term is non-zero */ + while (tx[i] == 0.0) + i--; + n = __rem_pio2_large(tx,ty,(int)(ix>>20)-(0x3ff+23),i+1,1); + if (sign) { + y[0] = -ty[0]; + y[1] = -ty[1]; + return -n; + } + y[0] = ty[0]; + y[1] = ty[1]; + return n; +} diff --git a/lib/libc/src/musl-math/__rem_pio2_large.c b/lib/libc/src/musl-math/__rem_pio2_large.c new file mode 100644 index 0000000..958f28c --- /dev/null +++ b/lib/libc/src/musl-math/__rem_pio2_large.c @@ -0,0 +1,442 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_rem_pio2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * __rem_pio2_large(x,y,e0,nx,prec) + * double x[],y[]; int e0,nx,prec; + * + * __rem_pio2_large return the last three digits of N with + * y = x - N*pi/2 + * so that |y| < pi/2. + * + * The method is to compute the integer (mod 8) and fraction parts of + * (2/pi)*x without doing the full multiplication. In general we + * skip the part of the product that are known to be a huge integer ( + * more accurately, = 0 mod 8 ). Thus the number of operations are + * independent of the exponent of the input. + * + * (2/pi) is represented by an array of 24-bit integers in ipio2[]. + * + * Input parameters: + * x[] The input value (must be positive) is broken into nx + * pieces of 24-bit integers in double precision format. + * x[i] will be the i-th 24 bit of x. The scaled exponent + * of x[0] is given in input parameter e0 (i.e., x[0]*2^e0 + * match x's up to 24 bits. + * + * Example of breaking a double positive z into x[0]+x[1]+x[2]: + * e0 = ilogb(z)-23 + * z = scalbn(z,-e0) + * for i = 0,1,2 + * x[i] = floor(z) + * z = (z-x[i])*2**24 + * + * + * y[] ouput result in an array of double precision numbers. + * The dimension of y[] is: + * 24-bit precision 1 + * 53-bit precision 2 + * 64-bit precision 2 + * 113-bit precision 3 + * The actual value is the sum of them. Thus for 113-bit + * precison, one may have to do something like: + * + * long double t,w,r_head, r_tail; + * t = (long double)y[2] + (long double)y[1]; + * w = (long double)y[0]; + * r_head = t+w; + * r_tail = w - (r_head - t); + * + * e0 The exponent of x[0]. Must be <= 16360 or you need to + * expand the ipio2 table. + * + * nx dimension of x[] + * + * prec an integer indicating the precision: + * 0 24 bits (single) + * 1 53 bits (double) + * 2 64 bits (extended) + * 3 113 bits (quad) + * + * External function: + * double scalbn(), floor(); + * + * + * Here is the description of some local variables: + * + * jk jk+1 is the initial number of terms of ipio2[] needed + * in the computation. The minimum and recommended value + * for jk is 3,4,4,6 for single, double, extended, and quad. + * jk+1 must be 2 larger than you might expect so that our + * recomputation test works. (Up to 24 bits in the integer + * part (the 24 bits of it that we compute) and 23 bits in + * the fraction part may be lost to cancelation before we + * recompute.) + * + * jz local integer variable indicating the number of + * terms of ipio2[] used. + * + * jx nx - 1 + * + * jv index for pointing to the suitable ipio2[] for the + * computation. In general, we want + * ( 2^e0*x[0] * ipio2[jv-1]*2^(-24jv) )/8 + * is an integer. Thus + * e0-3-24*jv >= 0 or (e0-3)/24 >= jv + * Hence jv = max(0,(e0-3)/24). + * + * jp jp+1 is the number of terms in PIo2[] needed, jp = jk. + * + * q[] double array with integral value, representing the + * 24-bits chunk of the product of x and 2/pi. + * + * q0 the corresponding exponent of q[0]. Note that the + * exponent for q[i] would be q0-24*i. + * + * PIo2[] double precision array, obtained by cutting pi/2 + * into 24 bits chunks. + * + * f[] ipio2[] in floating point + * + * iq[] integer array by breaking up q[] in 24-bits chunk. + * + * fq[] final product of x*(2/pi) in fq[0],..,fq[jk] + * + * ih integer. If >0 it indicates q[] is >= 0.5, hence + * it also indicates the *sign* of the result. + * + */ +/* + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "libm.h" + +static const int init_jk[] = {3,4,4,6}; /* initial value for jk */ + +/* + * Table of constants for 2/pi, 396 Hex digits (476 decimal) of 2/pi + * + * integer array, contains the (24*i)-th to (24*i+23)-th + * bit of 2/pi after binary point. The corresponding + * floating value is + * + * ipio2[i] * 2^(-24(i+1)). + * + * NB: This table must have at least (e0-3)/24 + jk terms. + * For quad precision (e0 <= 16360, jk = 6), this is 686. + */ +static const int32_t ipio2[] = { +0xA2F983, 0x6E4E44, 0x1529FC, 0x2757D1, 0xF534DD, 0xC0DB62, +0x95993C, 0x439041, 0xFE5163, 0xABDEBB, 0xC561B7, 0x246E3A, +0x424DD2, 0xE00649, 0x2EEA09, 0xD1921C, 0xFE1DEB, 0x1CB129, +0xA73EE8, 0x8235F5, 0x2EBB44, 0x84E99C, 0x7026B4, 0x5F7E41, +0x3991D6, 0x398353, 0x39F49C, 0x845F8B, 0xBDF928, 0x3B1FF8, +0x97FFDE, 0x05980F, 0xEF2F11, 0x8B5A0A, 0x6D1F6D, 0x367ECF, +0x27CB09, 0xB74F46, 0x3F669E, 0x5FEA2D, 0x7527BA, 0xC7EBE5, +0xF17B3D, 0x0739F7, 0x8A5292, 0xEA6BFB, 0x5FB11F, 0x8D5D08, +0x560330, 0x46FC7B, 0x6BABF0, 0xCFBC20, 0x9AF436, 0x1DA9E3, +0x91615E, 0xE61B08, 0x659985, 0x5F14A0, 0x68408D, 0xFFD880, +0x4D7327, 0x310606, 0x1556CA, 0x73A8C9, 0x60E27B, 0xC08C6B, + +#if LDBL_MAX_EXP > 1024 +0x47C419, 0xC367CD, 0xDCE809, 0x2A8359, 0xC4768B, 0x961CA6, +0xDDAF44, 0xD15719, 0x053EA5, 0xFF0705, 0x3F7E33, 0xE832C2, +0xDE4F98, 0x327DBB, 0xC33D26, 0xEF6B1E, 0x5EF89F, 0x3A1F35, +0xCAF27F, 0x1D87F1, 0x21907C, 0x7C246A, 0xFA6ED5, 0x772D30, +0x433B15, 0xC614B5, 0x9D19C3, 0xC2C4AD, 0x414D2C, 0x5D000C, +0x467D86, 0x2D71E3, 0x9AC69B, 0x006233, 0x7CD2B4, 0x97A7B4, +0xD55537, 0xF63ED7, 0x1810A3, 0xFC764D, 0x2A9D64, 0xABD770, +0xF87C63, 0x57B07A, 0xE71517, 0x5649C0, 0xD9D63B, 0x3884A7, +0xCB2324, 0x778AD6, 0x23545A, 0xB91F00, 0x1B0AF1, 0xDFCE19, +0xFF319F, 0x6A1E66, 0x615799, 0x47FBAC, 0xD87F7E, 0xB76522, +0x89E832, 0x60BFE6, 0xCDC4EF, 0x09366C, 0xD43F5D, 0xD7DE16, +0xDE3B58, 0x929BDE, 0x2822D2, 0xE88628, 0x4D58E2, 0x32CAC6, +0x16E308, 0xCB7DE0, 0x50C017, 0xA71DF3, 0x5BE018, 0x34132E, +0x621283, 0x014883, 0x5B8EF5, 0x7FB0AD, 0xF2E91E, 0x434A48, +0xD36710, 0xD8DDAA, 0x425FAE, 0xCE616A, 0xA4280A, 0xB499D3, +0xF2A606, 0x7F775C, 0x83C2A3, 0x883C61, 0x78738A, 0x5A8CAF, +0xBDD76F, 0x63A62D, 0xCBBFF4, 0xEF818D, 0x67C126, 0x45CA55, +0x36D9CA, 0xD2A828, 0x8D61C2, 0x77C912, 0x142604, 0x9B4612, +0xC459C4, 0x44C5C8, 0x91B24D, 0xF31700, 0xAD43D4, 0xE54929, +0x10D5FD, 0xFCBE00, 0xCC941E, 0xEECE70, 0xF53E13, 0x80F1EC, +0xC3E7B3, 0x28F8C7, 0x940593, 0x3E71C1, 0xB3092E, 0xF3450B, +0x9C1288, 0x7B20AB, 0x9FB52E, 0xC29247, 0x2F327B, 0x6D550C, +0x90A772, 0x1FE76B, 0x96CB31, 0x4A1679, 0xE27941, 0x89DFF4, +0x9794E8, 0x84E6E2, 0x973199, 0x6BED88, 0x365F5F, 0x0EFDBB, +0xB49A48, 0x6CA467, 0x427271, 0x325D8D, 0xB8159F, 0x09E5BC, +0x25318D, 0x3974F7, 0x1C0530, 0x010C0D, 0x68084B, 0x58EE2C, +0x90AA47, 0x02E774, 0x24D6BD, 0xA67DF7, 0x72486E, 0xEF169F, +0xA6948E, 0xF691B4, 0x5153D1, 0xF20ACF, 0x339820, 0x7E4BF5, +0x6863B2, 0x5F3EDD, 0x035D40, 0x7F8985, 0x295255, 0xC06437, +0x10D86D, 0x324832, 0x754C5B, 0xD4714E, 0x6E5445, 0xC1090B, +0x69F52A, 0xD56614, 0x9D0727, 0x50045D, 0xDB3BB4, 0xC576EA, +0x17F987, 0x7D6B49, 0xBA271D, 0x296996, 0xACCCC6, 0x5414AD, +0x6AE290, 0x89D988, 0x50722C, 0xBEA404, 0x940777, 0x7030F3, +0x27FC00, 0xA871EA, 0x49C266, 0x3DE064, 0x83DD97, 0x973FA3, +0xFD9443, 0x8C860D, 0xDE4131, 0x9D3992, 0x8C70DD, 0xE7B717, +0x3BDF08, 0x2B3715, 0xA0805C, 0x93805A, 0x921110, 0xD8E80F, +0xAF806C, 0x4BFFDB, 0x0F9038, 0x761859, 0x15A562, 0xBBCB61, +0xB989C7, 0xBD4010, 0x04F2D2, 0x277549, 0xF6B6EB, 0xBB22DB, +0xAA140A, 0x2F2689, 0x768364, 0x333B09, 0x1A940E, 0xAA3A51, +0xC2A31D, 0xAEEDAF, 0x12265C, 0x4DC26D, 0x9C7A2D, 0x9756C0, +0x833F03, 0xF6F009, 0x8C402B, 0x99316D, 0x07B439, 0x15200C, +0x5BC3D8, 0xC492F5, 0x4BADC6, 0xA5CA4E, 0xCD37A7, 0x36A9E6, +0x9492AB, 0x6842DD, 0xDE6319, 0xEF8C76, 0x528B68, 0x37DBFC, +0xABA1AE, 0x3115DF, 0xA1AE00, 0xDAFB0C, 0x664D64, 0xB705ED, +0x306529, 0xBF5657, 0x3AFF47, 0xB9F96A, 0xF3BE75, 0xDF9328, +0x3080AB, 0xF68C66, 0x15CB04, 0x0622FA, 0x1DE4D9, 0xA4B33D, +0x8F1B57, 0x09CD36, 0xE9424E, 0xA4BE13, 0xB52333, 0x1AAAF0, +0xA8654F, 0xA5C1D2, 0x0F3F0B, 0xCD785B, 0x76F923, 0x048B7B, +0x721789, 0x53A6C6, 0xE26E6F, 0x00EBEF, 0x584A9B, 0xB7DAC4, +0xBA66AA, 0xCFCF76, 0x1D02D1, 0x2DF1B1, 0xC1998C, 0x77ADC3, +0xDA4886, 0xA05DF7, 0xF480C6, 0x2FF0AC, 0x9AECDD, 0xBC5C3F, +0x6DDED0, 0x1FC790, 0xB6DB2A, 0x3A25A3, 0x9AAF00, 0x9353AD, +0x0457B6, 0xB42D29, 0x7E804B, 0xA707DA, 0x0EAA76, 0xA1597B, +0x2A1216, 0x2DB7DC, 0xFDE5FA, 0xFEDB89, 0xFDBE89, 0x6C76E4, +0xFCA906, 0x70803E, 0x156E85, 0xFF87FD, 0x073E28, 0x336761, +0x86182A, 0xEABD4D, 0xAFE7B3, 0x6E6D8F, 0x396795, 0x5BBF31, +0x48D784, 0x16DF30, 0x432DC7, 0x356125, 0xCE70C9, 0xB8CB30, +0xFD6CBF, 0xA200A4, 0xE46C05, 0xA0DD5A, 0x476F21, 0xD21262, +0x845CB9, 0x496170, 0xE0566B, 0x015299, 0x375550, 0xB7D51E, +0xC4F133, 0x5F6E13, 0xE4305D, 0xA92E85, 0xC3B21D, 0x3632A1, +0xA4B708, 0xD4B1EA, 0x21F716, 0xE4698F, 0x77FF27, 0x80030C, +0x2D408D, 0xA0CD4F, 0x99A520, 0xD3A2B3, 0x0A5D2F, 0x42F9B4, +0xCBDA11, 0xD0BE7D, 0xC1DB9B, 0xBD17AB, 0x81A2CA, 0x5C6A08, +0x17552E, 0x550027, 0xF0147F, 0x8607E1, 0x640B14, 0x8D4196, +0xDEBE87, 0x2AFDDA, 0xB6256B, 0x34897B, 0xFEF305, 0x9EBFB9, +0x4F6A68, 0xA82A4A, 0x5AC44F, 0xBCF82D, 0x985AD7, 0x95C7F4, +0x8D4D0D, 0xA63A20, 0x5F57A4, 0xB13F14, 0x953880, 0x0120CC, +0x86DD71, 0xB6DEC9, 0xF560BF, 0x11654D, 0x6B0701, 0xACB08C, +0xD0C0B2, 0x485551, 0x0EFB1E, 0xC37295, 0x3B06A3, 0x3540C0, +0x7BDC06, 0xCC45E0, 0xFA294E, 0xC8CAD6, 0x41F3E8, 0xDE647C, +0xD8649B, 0x31BED9, 0xC397A4, 0xD45877, 0xC5E369, 0x13DAF0, +0x3C3ABA, 0x461846, 0x5F7555, 0xF5BDD2, 0xC6926E, 0x5D2EAC, +0xED440E, 0x423E1C, 0x87C461, 0xE9FD29, 0xF3D6E7, 0xCA7C22, +0x35916F, 0xC5E008, 0x8DD7FF, 0xE26A6E, 0xC6FDB0, 0xC10893, +0x745D7C, 0xB2AD6B, 0x9D6ECD, 0x7B723E, 0x6A11C6, 0xA9CFF7, +0xDF7329, 0xBAC9B5, 0x5100B7, 0x0DB2E2, 0x24BA74, 0x607DE5, +0x8AD874, 0x2C150D, 0x0C1881, 0x94667E, 0x162901, 0x767A9F, +0xBEFDFD, 0xEF4556, 0x367ED9, 0x13D9EC, 0xB9BA8B, 0xFC97C4, +0x27A831, 0xC36EF1, 0x36C594, 0x56A8D8, 0xB5A8B4, 0x0ECCCF, +0x2D8912, 0x34576F, 0x89562C, 0xE3CE99, 0xB920D6, 0xAA5E6B, +0x9C2A3E, 0xCC5F11, 0x4A0BFD, 0xFBF4E1, 0x6D3B8E, 0x2C86E2, +0x84D4E9, 0xA9B4FC, 0xD1EEEF, 0xC9352E, 0x61392F, 0x442138, +0xC8D91B, 0x0AFC81, 0x6A4AFB, 0xD81C2F, 0x84B453, 0x8C994E, +0xCC2254, 0xDC552A, 0xD6C6C0, 0x96190B, 0xB8701A, 0x649569, +0x605A26, 0xEE523F, 0x0F117F, 0x11B5F4, 0xF5CBFC, 0x2DBC34, +0xEEBC34, 0xCC5DE8, 0x605EDD, 0x9B8E67, 0xEF3392, 0xB817C9, +0x9B5861, 0xBC57E1, 0xC68351, 0x103ED8, 0x4871DD, 0xDD1C2D, +0xA118AF, 0x462C21, 0xD7F359, 0x987AD9, 0xC0549E, 0xFA864F, +0xFC0656, 0xAE79E5, 0x362289, 0x22AD38, 0xDC9367, 0xAAE855, +0x382682, 0x9BE7CA, 0xA40D51, 0xB13399, 0x0ED7A9, 0x480569, +0xF0B265, 0xA7887F, 0x974C88, 0x36D1F9, 0xB39221, 0x4A827B, +0x21CF98, 0xDC9F40, 0x5547DC, 0x3A74E1, 0x42EB67, 0xDF9DFE, +0x5FD45E, 0xA4677B, 0x7AACBA, 0xA2F655, 0x23882B, 0x55BA41, +0x086E59, 0x862A21, 0x834739, 0xE6E389, 0xD49EE5, 0x40FB49, +0xE956FF, 0xCA0F1C, 0x8A59C5, 0x2BFA94, 0xC5C1D3, 0xCFC50F, +0xAE5ADB, 0x86C547, 0x624385, 0x3B8621, 0x94792C, 0x876110, +0x7B4C2A, 0x1A2C80, 0x12BF43, 0x902688, 0x893C78, 0xE4C4A8, +0x7BDBE5, 0xC23AC4, 0xEAF426, 0x8A67F7, 0xBF920D, 0x2BA365, +0xB1933D, 0x0B7CBD, 0xDC51A4, 0x63DD27, 0xDDE169, 0x19949A, +0x9529A8, 0x28CE68, 0xB4ED09, 0x209F44, 0xCA984E, 0x638270, +0x237C7E, 0x32B90F, 0x8EF5A7, 0xE75614, 0x08F121, 0x2A9DB5, +0x4D7E6F, 0x5119A5, 0xABF9B5, 0xD6DF82, 0x61DD96, 0x023616, +0x9F3AC4, 0xA1A283, 0x6DED72, 0x7A8D39, 0xA9B882, 0x5C326B, +0x5B2746, 0xED3400, 0x7700D2, 0x55F4FC, 0x4D5901, 0x8071E0, +#endif +}; + +static const double PIo2[] = { + 1.57079625129699707031e+00, /* 0x3FF921FB, 0x40000000 */ + 7.54978941586159635335e-08, /* 0x3E74442D, 0x00000000 */ + 5.39030252995776476554e-15, /* 0x3CF84698, 0x80000000 */ + 3.28200341580791294123e-22, /* 0x3B78CC51, 0x60000000 */ + 1.27065575308067607349e-29, /* 0x39F01B83, 0x80000000 */ + 1.22933308981111328932e-36, /* 0x387A2520, 0x40000000 */ + 2.73370053816464559624e-44, /* 0x36E38222, 0x80000000 */ + 2.16741683877804819444e-51, /* 0x3569F31D, 0x00000000 */ +}; + +int __rem_pio2_large(double *x, double *y, int e0, int nx, int prec) +{ + int32_t jz,jx,jv,jp,jk,carry,n,iq[20],i,j,k,m,q0,ih; + double z,fw,f[20],fq[20],q[20]; + + /* initialize jk*/ + jk = init_jk[prec]; + jp = jk; + + /* determine jx,jv,q0, note that 3>q0 */ + jx = nx-1; + jv = (e0-3)/24; if(jv<0) jv=0; + q0 = e0-24*(jv+1); + + /* set up f[0] to f[jx+jk] where f[jx+jk] = ipio2[jv+jk] */ + j = jv-jx; m = jx+jk; + for (i=0; i<=m; i++,j++) + f[i] = j<0 ? 0.0 : (double)ipio2[j]; + + /* compute q[0],q[1],...q[jk] */ + for (i=0; i<=jk; i++) { + for (j=0,fw=0.0; j<=jx; j++) + fw += x[j]*f[jx+i-j]; + q[i] = fw; + } + + jz = jk; +recompute: + /* distill q[] into iq[] reversingly */ + for (i=0,j=jz,z=q[jz]; j>0; i++,j--) { + fw = (double)(int32_t)(0x1p-24*z); + iq[i] = (int32_t)(z - 0x1p24*fw); + z = q[j-1]+fw; + } + + /* compute n */ + z = scalbn(z,q0); /* actual value of z */ + z -= 8.0*floor(z*0.125); /* trim off integer >= 8 */ + n = (int32_t)z; + z -= (double)n; + ih = 0; + if (q0 > 0) { /* need iq[jz-1] to determine n */ + i = iq[jz-1]>>(24-q0); n += i; + iq[jz-1] -= i<<(24-q0); + ih = iq[jz-1]>>(23-q0); + } + else if (q0 == 0) ih = iq[jz-1]>>23; + else if (z >= 0.5) ih = 2; + + if (ih > 0) { /* q > 0.5 */ + n += 1; carry = 0; + for (i=0; i<jz; i++) { /* compute 1-q */ + j = iq[i]; + if (carry == 0) { + if (j != 0) { + carry = 1; + iq[i] = 0x1000000 - j; + } + } else + iq[i] = 0xffffff - j; + } + if (q0 > 0) { /* rare case: chance is 1 in 12 */ + switch(q0) { + case 1: + iq[jz-1] &= 0x7fffff; break; + case 2: + iq[jz-1] &= 0x3fffff; break; + } + } + if (ih == 2) { + z = 1.0 - z; + if (carry != 0) + z -= scalbn(1.0,q0); + } + } + + /* check if recomputation is needed */ + if (z == 0.0) { + j = 0; + for (i=jz-1; i>=jk; i--) j |= iq[i]; + if (j == 0) { /* need recomputation */ + for (k=1; iq[jk-k]==0; k++); /* k = no. of terms needed */ + + for (i=jz+1; i<=jz+k; i++) { /* add q[jz+1] to q[jz+k] */ + f[jx+i] = (double)ipio2[jv+i]; + for (j=0,fw=0.0; j<=jx; j++) + fw += x[j]*f[jx+i-j]; + q[i] = fw; + } + jz += k; + goto recompute; + } + } + + /* chop off zero terms */ + if (z == 0.0) { + jz -= 1; + q0 -= 24; + while (iq[jz] == 0) { + jz--; + q0 -= 24; + } + } else { /* break z into 24-bit if necessary */ + z = scalbn(z,-q0); + if (z >= 0x1p24) { + fw = (double)(int32_t)(0x1p-24*z); + iq[jz] = (int32_t)(z - 0x1p24*fw); + jz += 1; + q0 += 24; + iq[jz] = (int32_t)fw; + } else + iq[jz] = (int32_t)z; + } + + /* convert integer "bit" chunk to floating-point value */ + fw = scalbn(1.0,q0); + for (i=jz; i>=0; i--) { + q[i] = fw*(double)iq[i]; + fw *= 0x1p-24; + } + + /* compute PIo2[0,...,jp]*q[jz,...,0] */ + for(i=jz; i>=0; i--) { + for (fw=0.0,k=0; k<=jp && k<=jz-i; k++) + fw += PIo2[k]*q[i+k]; + fq[jz-i] = fw; + } + + /* compress fq[] into y[] */ + switch(prec) { + case 0: + fw = 0.0; + for (i=jz; i>=0; i--) + fw += fq[i]; + y[0] = ih==0 ? fw : -fw; + break; + case 1: + case 2: + fw = 0.0; + for (i=jz; i>=0; i--) + fw += fq[i]; + // TODO: drop excess precision here once double_t is used + fw = (double)fw; + y[0] = ih==0 ? fw : -fw; + fw = fq[0]-fw; + for (i=1; i<=jz; i++) + fw += fq[i]; + y[1] = ih==0 ? fw : -fw; + break; + case 3: /* painful */ + for (i=jz; i>0; i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (i=jz; i>1; i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (fw=0.0,i=jz; i>=2; i--) + fw += fq[i]; + if (ih==0) { + y[0] = fq[0]; y[1] = fq[1]; y[2] = fw; + } else { + y[0] = -fq[0]; y[1] = -fq[1]; y[2] = -fw; + } + } + return n&7; +} diff --git a/lib/libc/src/musl-math/__rem_pio2f.c b/lib/libc/src/musl-math/__rem_pio2f.c new file mode 100644 index 0000000..4473c1c --- /dev/null +++ b/lib/libc/src/musl-math/__rem_pio2f.c @@ -0,0 +1,75 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_rem_pio2f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Debugged and optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* __rem_pio2f(x,y) + * + * return the remainder of x rem pi/2 in *y + * use double precision for everything except passing x + * use __rem_pio2_large() for large x + */ + +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif + +/* + * invpio2: 53 bits of 2/pi + * pio2_1: first 25 bits of pi/2 + * pio2_1t: pi/2 - pio2_1 + */ +static const double +toint = 1.5/EPS, +invpio2 = 6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */ +pio2_1 = 1.57079631090164184570e+00, /* 0x3FF921FB, 0x50000000 */ +pio2_1t = 1.58932547735281966916e-08; /* 0x3E5110b4, 0x611A6263 */ + +int __rem_pio2f(float x, double *y) +{ + union {float f; uint32_t i;} u = {x}; + double tx[1],ty[1]; + double_t fn; + uint32_t ix; + int n, sign, e0; + + ix = u.i & 0x7fffffff; + /* 25+53 bit pi is good enough for medium size */ + if (ix < 0x4dc90fdb) { /* |x| ~< 2^28*(pi/2), medium size */ + /* Use a specialized rint() to get fn. Assume round-to-nearest. */ + fn = (double_t)x*invpio2 + toint - toint; + n = (int32_t)fn; + *y = x - fn*pio2_1 - fn*pio2_1t; + return n; + } + if(ix>=0x7f800000) { /* x is inf or NaN */ + *y = x-x; + return 0; + } + /* scale x into [2^23, 2^24-1] */ + sign = u.i>>31; + e0 = (ix>>23) - (0x7f+23); /* e0 = ilogb(|x|)-23, positive */ + u.i = ix - (e0<<23); + tx[0] = u.f; + n = __rem_pio2_large(tx,ty,e0,1,0); + if (sign) { + *y = -ty[0]; + return -n; + } + *y = ty[0]; + return n; +} diff --git a/lib/libc/src/musl-math/__rem_pio2l.c b/lib/libc/src/musl-math/__rem_pio2l.c new file mode 100644 index 0000000..77255bd --- /dev/null +++ b/lib/libc/src/musl-math/__rem_pio2l.c @@ -0,0 +1,141 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/e_rem_pio2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * Copyright (c) 2008 Steven G. Kargl, David Schultz, Bruce D. Evans. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + * Optimized by Bruce D. Evans. + */ +#include "libm.h" +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +/* ld80 and ld128 version of __rem_pio2(x,y) + * + * return the remainder of x rem pi/2 in y[0]+y[1] + * use __rem_pio2_large() for large x + */ + +static const long double toint = 1.5/LDBL_EPSILON; + +#if LDBL_MANT_DIG == 64 +/* u ~< 0x1p25*pi/2 */ +#define SMALL(u) (((u.i.se & 0x7fffU)<<16 | u.i.m>>48) < ((0x3fff + 25)<<16 | 0x921f>>1 | 0x8000)) +#define QUOBITS(x) ((uint32_t)(int32_t)x & 0x7fffffff) +#define ROUND1 22 +#define ROUND2 61 +#define NX 3 +#define NY 2 +/* + * invpio2: 64 bits of 2/pi + * pio2_1: first 39 bits of pi/2 + * pio2_1t: pi/2 - pio2_1 + * pio2_2: second 39 bits of pi/2 + * pio2_2t: pi/2 - (pio2_1+pio2_2) + * pio2_3: third 39 bits of pi/2 + * pio2_3t: pi/2 - (pio2_1+pio2_2+pio2_3) + */ +static const double +pio2_1 = 1.57079632679597125389e+00, /* 0x3FF921FB, 0x54444000 */ +pio2_2 = -1.07463465549783099519e-12, /* -0x12e7b967674000.0p-92 */ +pio2_3 = 6.36831716351370313614e-25; /* 0x18a2e037074000.0p-133 */ +static const long double +invpio2 = 6.36619772367581343076e-01L, /* 0xa2f9836e4e44152a.0p-64 */ +pio2_1t = -1.07463465549719416346e-12L, /* -0x973dcb3b399d747f.0p-103 */ +pio2_2t = 6.36831716351095013979e-25L, /* 0xc51701b839a25205.0p-144 */ +pio2_3t = -2.75299651904407171810e-37L; /* -0xbb5bf6c7ddd660ce.0p-185 */ +#elif LDBL_MANT_DIG == 113 +/* u ~< 0x1p45*pi/2 */ +#define SMALL(u) (((u.i.se & 0x7fffU)<<16 | u.i.top) < ((0x3fff + 45)<<16 | 0x921f)) +#define QUOBITS(x) ((uint32_t)(int64_t)x & 0x7fffffff) +#define ROUND1 51 +#define ROUND2 119 +#define NX 5 +#define NY 3 +static const long double +invpio2 = 6.3661977236758134307553505349005747e-01L, /* 0x145f306dc9c882a53f84eafa3ea6a.0p-113 */ +pio2_1 = 1.5707963267948966192292994253909555e+00L, /* 0x1921fb54442d18469800000000000.0p-112 */ +pio2_1t = 2.0222662487959507323996846200947577e-21L, /* 0x13198a2e03707344a4093822299f3.0p-181 */ +pio2_2 = 2.0222662487959507323994779168837751e-21L, /* 0x13198a2e03707344a400000000000.0p-181 */ +pio2_2t = 2.0670321098263988236496903051604844e-43L, /* 0x127044533e63a0105df531d89cd91.0p-254 */ +pio2_3 = 2.0670321098263988236499468110329591e-43L, /* 0x127044533e63a0105e00000000000.0p-254 */ +pio2_3t = -2.5650587247459238361625433492959285e-65L; /* -0x159c4ec64ddaeb5f78671cbfb2210.0p-327 */ +#endif + +int __rem_pio2l(long double x, long double *y) +{ + union ldshape u,uz; + long double z,w,t,r,fn; + double tx[NX],ty[NY]; + int ex,ey,n,i; + + u.f = x; + ex = u.i.se & 0x7fff; + if (SMALL(u)) { + /* rint(x/(pi/2)), Assume round-to-nearest. */ + fn = x*invpio2 + toint - toint; + n = QUOBITS(fn); + r = x-fn*pio2_1; + w = fn*pio2_1t; /* 1st round good to 102/180 bits (ld80/ld128) */ + y[0] = r-w; + u.f = y[0]; + ey = u.i.se & 0x7fff; + if (ex - ey > ROUND1) { /* 2nd iteration needed, good to 141/248 (ld80/ld128) */ + t = r; + w = fn*pio2_2; + r = t-w; + w = fn*pio2_2t-((t-r)-w); + y[0] = r-w; + u.f = y[0]; + ey = u.i.se & 0x7fff; + if (ex - ey > ROUND2) { /* 3rd iteration, good to 180/316 bits */ + t = r; /* will cover all possible cases (not verified for ld128) */ + w = fn*pio2_3; + r = t-w; + w = fn*pio2_3t-((t-r)-w); + y[0] = r-w; + } + } + y[1] = (r - y[0]) - w; + return n; + } + /* + * all other (large) arguments + */ + if (ex == 0x7fff) { /* x is inf or NaN */ + y[0] = y[1] = x - x; + return 0; + } + /* set z = scalbn(|x|,-ilogb(x)+23) */ + uz.f = x; + uz.i.se = 0x3fff + 23; + z = uz.f; + for (i=0; i < NX - 1; i++) { + tx[i] = (double)(int32_t)z; + z = (z-tx[i])*0x1p24; + } + tx[i] = z; + while (tx[i] == 0) + i--; + n = __rem_pio2_large(tx, ty, ex-0x3fff-23, i+1, NY); + w = ty[1]; + if (NY == 3) + w += ty[2]; + r = ty[0] + w; + /* TODO: for ld128 this does not follow the recommendation of the + comments of __rem_pio2_large which seem wrong if |ty[0]| > |ty[1]+ty[2]| */ + w -= r - ty[0]; + if (u.i.se >> 15) { + y[0] = -r; + y[1] = -w; + return -n; + } + y[0] = r; + y[1] = w; + return n; +} +#endif diff --git a/lib/libc/src/musl-math/__signbit.c b/lib/libc/src/musl-math/__signbit.c new file mode 100644 index 0000000..e700b6b --- /dev/null +++ b/lib/libc/src/musl-math/__signbit.c @@ -0,0 +1,13 @@ +#include "libm.h" + +// FIXME: macro in math.h +int __signbit(double x) +{ + union { + double d; + uint64_t i; + } y = { x }; + return y.i>>63; +} + + diff --git a/lib/libc/src/musl-math/__signbitf.c b/lib/libc/src/musl-math/__signbitf.c new file mode 100644 index 0000000..40ad3cf --- /dev/null +++ b/lib/libc/src/musl-math/__signbitf.c @@ -0,0 +1,11 @@ +#include "libm.h" + +// FIXME: macro in math.h +int __signbitf(float x) +{ + union { + float f; + uint32_t i; + } y = { x }; + return y.i>>31; +} diff --git a/lib/libc/src/musl-math/__signbitl.c b/lib/libc/src/musl-math/__signbitl.c new file mode 100644 index 0000000..63b3dc5 --- /dev/null +++ b/lib/libc/src/musl-math/__signbitl.c @@ -0,0 +1,14 @@ +#include "libm.h" + +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +int __signbitl(long double x) +{ + union ldshape u = {x}; + return u.i.se >> 15; +} +#elif LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +int __signbitl(long double x) +{ + return __signbit(x); +} +#endif diff --git a/lib/libc/src/musl-math/__sin.c b/lib/libc/src/musl-math/__sin.c new file mode 100644 index 0000000..4030949 --- /dev/null +++ b/lib/libc/src/musl-math/__sin.c @@ -0,0 +1,64 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_sin.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* __sin( x, y, iy) + * kernel sin function on ~[-pi/4, pi/4] (except on -0), pi/4 ~ 0.7854 + * Input x is assumed to be bounded by ~pi/4 in magnitude. + * Input y is the tail of x. + * Input iy indicates whether y is 0. (if iy=0, y assume to be 0). + * + * Algorithm + * 1. Since sin(-x) = -sin(x), we need only to consider positive x. + * 2. Callers must return sin(-0) = -0 without calling here since our + * odd polynomial is not evaluated in a way that preserves -0. + * Callers may do the optimization sin(x) ~ x for tiny x. + * 3. sin(x) is approximated by a polynomial of degree 13 on + * [0,pi/4] + * 3 13 + * sin(x) ~ x + S1*x + ... + S6*x + * where + * + * |sin(x) 2 4 6 8 10 12 | -58 + * |----- - (1+S1*x +S2*x +S3*x +S4*x +S5*x +S6*x )| <= 2 + * | x | + * + * 4. sin(x+y) = sin(x) + sin'(x')*y + * ~ sin(x) + (1-x*x/2)*y + * For better accuracy, let + * 3 2 2 2 2 + * r = x *(S2+x *(S3+x *(S4+x *(S5+x *S6)))) + * then 3 2 + * sin(x) = x + (S1*x + (x *(r-y/2)+y)) + */ + +#include "libm.h" + +static const double +S1 = -1.66666666666666324348e-01, /* 0xBFC55555, 0x55555549 */ +S2 = 8.33333333332248946124e-03, /* 0x3F811111, 0x1110F8A6 */ +S3 = -1.98412698298579493134e-04, /* 0xBF2A01A0, 0x19C161D5 */ +S4 = 2.75573137070700676789e-06, /* 0x3EC71DE3, 0x57B1FE7D */ +S5 = -2.50507602534068634195e-08, /* 0xBE5AE5E6, 0x8A2B9CEB */ +S6 = 1.58969099521155010221e-10; /* 0x3DE5D93A, 0x5ACFD57C */ + +double __sin(double x, double y, int iy) +{ + double_t z,r,v,w; + + z = x*x; + w = z*z; + r = S2 + z*(S3 + z*S4) + z*w*(S5 + z*S6); + v = z*x; + if (iy == 0) + return x + v*(S1 + z*r); + else + return x - ((z*(0.5*y - v*r) - y) - v*S1); +} diff --git a/lib/libc/src/musl-math/__sindf.c b/lib/libc/src/musl-math/__sindf.c new file mode 100644 index 0000000..8fec2a3 --- /dev/null +++ b/lib/libc/src/musl-math/__sindf.c @@ -0,0 +1,36 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_sinf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* |sin(x)/x - s(x)| < 2**-37.5 (~[-4.89e-12, 4.824e-12]). */ +static const double +S1 = -0x15555554cbac77.0p-55, /* -0.166666666416265235595 */ +S2 = 0x111110896efbb2.0p-59, /* 0.0083333293858894631756 */ +S3 = -0x1a00f9e2cae774.0p-65, /* -0.000198393348360966317347 */ +S4 = 0x16cd878c3b46a7.0p-71; /* 0.0000027183114939898219064 */ + +float __sindf(double x) +{ + double_t r, s, w, z; + + /* Try to optimize for parallel evaluation as in __tandf.c. */ + z = x*x; + w = z*z; + r = S3 + z*S4; + s = z*x; + return (x + s*(S1 + z*S2)) + s*w*r; +} diff --git a/lib/libc/src/musl-math/__sinl.c b/lib/libc/src/musl-math/__sinl.c new file mode 100644 index 0000000..2525bbe --- /dev/null +++ b/lib/libc/src/musl-math/__sinl.c @@ -0,0 +1,78 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/k_sinl.c */ +/* origin: FreeBSD /usr/src/lib/msun/ld128/k_sinl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * Copyright (c) 2008 Steven G. Kargl, David Schultz, Bruce D. Evans. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#if LDBL_MANT_DIG == 64 +/* + * ld80 version of __sin.c. See __sin.c for most comments. + */ +/* + * Domain [-0.7854, 0.7854], range ~[-1.89e-22, 1.915e-22] + * |sin(x)/x - s(x)| < 2**-72.1 + * + * See __cosl.c for more details about the polynomial. + */ +static const long double +S1 = -0.166666666666666666671L; /* -0xaaaaaaaaaaaaaaab.0p-66 */ +static const double +S2 = 0.0083333333333333332, /* 0x11111111111111.0p-59 */ +S3 = -0.00019841269841269427, /* -0x1a01a01a019f81.0p-65 */ +S4 = 0.0000027557319223597490, /* 0x171de3a55560f7.0p-71 */ +S5 = -0.000000025052108218074604, /* -0x1ae64564f16cad.0p-78 */ +S6 = 1.6059006598854211e-10, /* 0x161242b90243b5.0p-85 */ +S7 = -7.6429779983024564e-13, /* -0x1ae42ebd1b2e00.0p-93 */ +S8 = 2.6174587166648325e-15; /* 0x179372ea0b3f64.0p-101 */ +#define POLY(z) (S2+z*(S3+z*(S4+z*(S5+z*(S6+z*(S7+z*S8)))))) +#elif LDBL_MANT_DIG == 113 +/* + * ld128 version of __sin.c. See __sin.c for most comments. + */ +/* + * Domain [-0.7854, 0.7854], range ~[-1.53e-37, 1.659e-37] + * |sin(x)/x - s(x)| < 2**-122.1 + * + * See __cosl.c for more details about the polynomial. + */ +static const long double +S1 = -0.16666666666666666666666666666666666606732416116558L, +S2 = 0.0083333333333333333333333333333331135404851288270047L, +S3 = -0.00019841269841269841269841269839935785325638310428717L, +S4 = 0.27557319223985890652557316053039946268333231205686e-5L, +S5 = -0.25052108385441718775048214826384312253862930064745e-7L, +S6 = 0.16059043836821614596571832194524392581082444805729e-9L, +S7 = -0.76471637318198151807063387954939213287488216303768e-12L, +S8 = 0.28114572543451292625024967174638477283187397621303e-14L; +static const double +S9 = -0.82206352458348947812512122163446202498005154296863e-17, +S10 = 0.19572940011906109418080609928334380560135358385256e-19, +S11 = -0.38680813379701966970673724299207480965452616911420e-22, +S12 = 0.64038150078671872796678569586315881020659912139412e-25; +#define POLY(z) (S2+z*(S3+z*(S4+z*(S5+z*(S6+z*(S7+z*(S8+ \ + z*(S9+z*(S10+z*(S11+z*S12)))))))))) +#endif + +long double __sinl(long double x, long double y, int iy) +{ + long double z,r,v; + + z = x*x; + v = z*x; + r = POLY(z); + if (iy == 0) + return x+v*(S1+z*r); + return x-((z*(0.5*y-v*r)-y)-v*S1); +} +#endif diff --git a/lib/libc/src/musl-math/__tan.c b/lib/libc/src/musl-math/__tan.c new file mode 100644 index 0000000..8019844 --- /dev/null +++ b/lib/libc/src/musl-math/__tan.c @@ -0,0 +1,110 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_tan.c */ +/* + * ==================================================== + * Copyright 2004 Sun Microsystems, Inc. All Rights Reserved. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* __tan( x, y, k ) + * kernel tan function on ~[-pi/4, pi/4] (except on -0), pi/4 ~ 0.7854 + * Input x is assumed to be bounded by ~pi/4 in magnitude. + * Input y is the tail of x. + * Input odd indicates whether tan (if odd = 0) or -1/tan (if odd = 1) is returned. + * + * Algorithm + * 1. Since tan(-x) = -tan(x), we need only to consider positive x. + * 2. Callers must return tan(-0) = -0 without calling here since our + * odd polynomial is not evaluated in a way that preserves -0. + * Callers may do the optimization tan(x) ~ x for tiny x. + * 3. tan(x) is approximated by a odd polynomial of degree 27 on + * [0,0.67434] + * 3 27 + * tan(x) ~ x + T1*x + ... + T13*x + * where + * + * |tan(x) 2 4 26 | -59.2 + * |----- - (1+T1*x +T2*x +.... +T13*x )| <= 2 + * | x | + * + * Note: tan(x+y) = tan(x) + tan'(x)*y + * ~ tan(x) + (1+x*x)*y + * Therefore, for better accuracy in computing tan(x+y), let + * 3 2 2 2 2 + * r = x *(T2+x *(T3+x *(...+x *(T12+x *T13)))) + * then + * 3 2 + * tan(x+y) = x + (T1*x + (x *(r+y)+y)) + * + * 4. For x in [0.67434,pi/4], let y = pi/4 - x, then + * tan(x) = tan(pi/4-y) = (1-tan(y))/(1+tan(y)) + * = 1 - 2*(tan(y) - (tan(y)^2)/(1+tan(y))) + */ + +#include "libm.h" + +static const double T[] = { + 3.33333333333334091986e-01, /* 3FD55555, 55555563 */ + 1.33333333333201242699e-01, /* 3FC11111, 1110FE7A */ + 5.39682539762260521377e-02, /* 3FABA1BA, 1BB341FE */ + 2.18694882948595424599e-02, /* 3F9664F4, 8406D637 */ + 8.86323982359930005737e-03, /* 3F8226E3, E96E8493 */ + 3.59207910759131235356e-03, /* 3F6D6D22, C9560328 */ + 1.45620945432529025516e-03, /* 3F57DBC8, FEE08315 */ + 5.88041240820264096874e-04, /* 3F4344D8, F2F26501 */ + 2.46463134818469906812e-04, /* 3F3026F7, 1A8D1068 */ + 7.81794442939557092300e-05, /* 3F147E88, A03792A6 */ + 7.14072491382608190305e-05, /* 3F12B80F, 32F0A7E9 */ + -1.85586374855275456654e-05, /* BEF375CB, DB605373 */ + 2.59073051863633712884e-05, /* 3EFB2A70, 74BF7AD4 */ +}, +pio4 = 7.85398163397448278999e-01, /* 3FE921FB, 54442D18 */ +pio4lo = 3.06161699786838301793e-17; /* 3C81A626, 33145C07 */ + +double __tan(double x, double y, int odd) +{ + double_t z, r, v, w, s, a; + double w0, a0; + uint32_t hx; + int big, sign; + + GET_HIGH_WORD(hx,x); + big = (hx&0x7fffffff) >= 0x3FE59428; /* |x| >= 0.6744 */ + if (big) { + sign = hx>>31; + if (sign) { + x = -x; + y = -y; + } + x = (pio4 - x) + (pio4lo - y); + y = 0.0; + } + z = x * x; + w = z * z; + /* + * Break x^5*(T[1]+x^2*T[2]+...) into + * x^5(T[1]+x^4*T[3]+...+x^20*T[11]) + + * x^5(x^2*(T[2]+x^4*T[4]+...+x^22*[T12])) + */ + r = T[1] + w*(T[3] + w*(T[5] + w*(T[7] + w*(T[9] + w*T[11])))); + v = z*(T[2] + w*(T[4] + w*(T[6] + w*(T[8] + w*(T[10] + w*T[12]))))); + s = z * x; + r = y + z*(s*(r + v) + y) + s*T[0]; + w = x + r; + if (big) { + s = 1 - 2*odd; + v = s - 2.0 * (x + (r - w*w/(w + s))); + return sign ? -v : v; + } + if (!odd) + return w; + /* -1.0/(x+r) has up to 2ulp error, so compute it accurately */ + w0 = w; + SET_LOW_WORD(w0, 0); + v = r - (w0 - x); /* w0+v = r+x */ + a0 = a = -1.0 / w; + SET_LOW_WORD(a0, 0); + return a0 + a*(1.0 + a0*w0 + a0*v); +} diff --git a/lib/libc/src/musl-math/__tandf.c b/lib/libc/src/musl-math/__tandf.c new file mode 100644 index 0000000..25047ee --- /dev/null +++ b/lib/libc/src/musl-math/__tandf.c @@ -0,0 +1,54 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_tanf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright 2004 Sun Microsystems, Inc. All Rights Reserved. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* |tan(x)/x - t(x)| < 2**-25.5 (~[-2e-08, 2e-08]). */ +static const double T[] = { + 0x15554d3418c99f.0p-54, /* 0.333331395030791399758 */ + 0x1112fd38999f72.0p-55, /* 0.133392002712976742718 */ + 0x1b54c91d865afe.0p-57, /* 0.0533812378445670393523 */ + 0x191df3908c33ce.0p-58, /* 0.0245283181166547278873 */ + 0x185dadfcecf44e.0p-61, /* 0.00297435743359967304927 */ + 0x1362b9bf971bcd.0p-59, /* 0.00946564784943673166728 */ +}; + +float __tandf(double x, int odd) +{ + double_t z,r,w,s,t,u; + + z = x*x; + /* + * Split up the polynomial into small independent terms to give + * opportunities for parallel evaluation. The chosen splitting is + * micro-optimized for Athlons (XP, X64). It costs 2 multiplications + * relative to Horner's method on sequential machines. + * + * We add the small terms from lowest degree up for efficiency on + * non-sequential machines (the lowest degree terms tend to be ready + * earlier). Apart from this, we don't care about order of + * operations, and don't need to to care since we have precision to + * spare. However, the chosen splitting is good for accuracy too, + * and would give results as accurate as Horner's method if the + * small terms were added from highest degree down. + */ + r = T[4] + z*T[5]; + t = T[2] + z*T[3]; + w = z*z; + s = z*x; + u = T[0] + z*T[1]; + r = (x + s*u) + (s*w)*(t + w*r); + return odd ? -1.0/r : r; +} diff --git a/lib/libc/src/musl-math/__tanl.c b/lib/libc/src/musl-math/__tanl.c new file mode 100644 index 0000000..54abc3d --- /dev/null +++ b/lib/libc/src/musl-math/__tanl.c @@ -0,0 +1,143 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/k_tanl.c */ +/* origin: FreeBSD /usr/src/lib/msun/ld128/k_tanl.c */ +/* + * ==================================================== + * Copyright 2004 Sun Microsystems, Inc. All Rights Reserved. + * Copyright (c) 2008 Steven G. Kargl, David Schultz, Bruce D. Evans. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#if LDBL_MANT_DIG == 64 +/* + * ld80 version of __tan.c. See __tan.c for most comments. + */ +/* + * Domain [-0.67434, 0.67434], range ~[-2.25e-22, 1.921e-22] + * |tan(x)/x - t(x)| < 2**-71.9 + * + * See __cosl.c for more details about the polynomial. + */ +static const long double +T3 = 0.333333333333333333180L, /* 0xaaaaaaaaaaaaaaa5.0p-65 */ +T5 = 0.133333333333333372290L, /* 0x88888888888893c3.0p-66 */ +T7 = 0.0539682539682504975744L, /* 0xdd0dd0dd0dc13ba2.0p-68 */ +pio4 = 0.785398163397448309628L, /* 0xc90fdaa22168c235.0p-64 */ +pio4lo = -1.25413940316708300586e-20L; /* -0xece675d1fc8f8cbb.0p-130 */ +static const double +T9 = 0.021869488536312216, /* 0x1664f4882cc1c2.0p-58 */ +T11 = 0.0088632355256619590, /* 0x1226e355c17612.0p-59 */ +T13 = 0.0035921281113786528, /* 0x1d6d3d185d7ff8.0p-61 */ +T15 = 0.0014558334756312418, /* 0x17da354aa3f96b.0p-62 */ +T17 = 0.00059003538700862256, /* 0x13559358685b83.0p-63 */ +T19 = 0.00023907843576635544, /* 0x1f56242026b5be.0p-65 */ +T21 = 0.000097154625656538905, /* 0x1977efc26806f4.0p-66 */ +T23 = 0.000038440165747303162, /* 0x14275a09b3ceac.0p-67 */ +T25 = 0.000018082171885432524, /* 0x12f5e563e5487e.0p-68 */ +T27 = 0.0000024196006108814377, /* 0x144c0d80cc6896.0p-71 */ +T29 = 0.0000078293456938132840, /* 0x106b59141a6cb3.0p-69 */ +T31 = -0.0000032609076735050182, /* -0x1b5abef3ba4b59.0p-71 */ +T33 = 0.0000023261313142559411; /* 0x13835436c0c87f.0p-71 */ +#define RPOLY(w) (T5 + w * (T9 + w * (T13 + w * (T17 + w * (T21 + \ + w * (T25 + w * (T29 + w * T33))))))) +#define VPOLY(w) (T7 + w * (T11 + w * (T15 + w * (T19 + w * (T23 + \ + w * (T27 + w * T31)))))) +#elif LDBL_MANT_DIG == 113 +/* + * ld128 version of __tan.c. See __tan.c for most comments. + */ +/* + * Domain [-0.67434, 0.67434], range ~[-3.37e-36, 1.982e-37] + * |tan(x)/x - t(x)| < 2**-117.8 (XXX should be ~1e-37) + * + * See __cosl.c for more details about the polynomial. + */ +static const long double +T3 = 0x1.5555555555555555555555555553p-2L, +T5 = 0x1.1111111111111111111111111eb5p-3L, +T7 = 0x1.ba1ba1ba1ba1ba1ba1ba1b694cd6p-5L, +T9 = 0x1.664f4882c10f9f32d6bbe09d8bcdp-6L, +T11 = 0x1.226e355e6c23c8f5b4f5762322eep-7L, +T13 = 0x1.d6d3d0e157ddfb5fed8e84e27b37p-9L, +T15 = 0x1.7da36452b75e2b5fce9ee7c2c92ep-10L, +T17 = 0x1.355824803674477dfcf726649efep-11L, +T19 = 0x1.f57d7734d1656e0aceb716f614c2p-13L, +T21 = 0x1.967e18afcb180ed942dfdc518d6cp-14L, +T23 = 0x1.497d8eea21e95bc7e2aa79b9f2cdp-15L, +T25 = 0x1.0b132d39f055c81be49eff7afd50p-16L, +T27 = 0x1.b0f72d33eff7bfa2fbc1059d90b6p-18L, +T29 = 0x1.5ef2daf21d1113df38d0fbc00267p-19L, +T31 = 0x1.1c77d6eac0234988cdaa04c96626p-20L, +T33 = 0x1.cd2a5a292b180e0bdd701057dfe3p-22L, +T35 = 0x1.75c7357d0298c01a31d0a6f7d518p-23L, +T37 = 0x1.2f3190f4718a9a520f98f50081fcp-24L, +pio4 = 0x1.921fb54442d18469898cc51701b8p-1L, +pio4lo = 0x1.cd129024e088a67cc74020bbea60p-116L; +static const double +T39 = 0.000000028443389121318352, /* 0x1e8a7592977938.0p-78 */ +T41 = 0.000000011981013102001973, /* 0x19baa1b1223219.0p-79 */ +T43 = 0.0000000038303578044958070, /* 0x107385dfb24529.0p-80 */ +T45 = 0.0000000034664378216909893, /* 0x1dc6c702a05262.0p-81 */ +T47 = -0.0000000015090641701997785, /* -0x19ecef3569ebb6.0p-82 */ +T49 = 0.0000000029449552300483952, /* 0x194c0668da786a.0p-81 */ +T51 = -0.0000000022006995706097711, /* -0x12e763b8845268.0p-81 */ +T53 = 0.0000000015468200913196612, /* 0x1a92fc98c29554.0p-82 */ +T55 = -0.00000000061311613386849674, /* -0x151106cbc779a9.0p-83 */ +T57 = 1.4912469681508012e-10; /* 0x147edbdba6f43a.0p-85 */ +#define RPOLY(w) (T5 + w * (T9 + w * (T13 + w * (T17 + w * (T21 + \ + w * (T25 + w * (T29 + w * (T33 + w * (T37 + w * (T41 + \ + w * (T45 + w * (T49 + w * (T53 + w * T57))))))))))))) +#define VPOLY(w) (T7 + w * (T11 + w * (T15 + w * (T19 + w * (T23 + \ + w * (T27 + w * (T31 + w * (T35 + w * (T39 + w * (T43 + \ + w * (T47 + w * (T51 + w * T55)))))))))))) +#endif + +long double __tanl(long double x, long double y, int odd) { + long double z, r, v, w, s, a, t; + int big, sign; + + big = fabsl(x) >= 0.67434; + if (big) { + sign = 0; + if (x < 0) { + sign = 1; + x = -x; + y = -y; + } + x = (pio4 - x) + (pio4lo - y); + y = 0.0; + } + z = x * x; + w = z * z; + r = RPOLY(w); + v = z * VPOLY(w); + s = z * x; + r = y + z * (s * (r + v) + y) + T3 * s; + w = x + r; + if (big) { + s = 1 - 2*odd; + v = s - 2.0 * (x + (r - w * w / (w + s))); + return sign ? -v : v; + } + if (!odd) + return w; + /* + * if allow error up to 2 ulp, simply return + * -1.0 / (x+r) here + */ + /* compute -1.0 / (x+r) accurately */ + z = w; + z = z + 0x1p32 - 0x1p32; + v = r - (z - x); /* z+v = r+x */ + t = a = -1.0 / w; /* a = -1.0/w */ + t = t + 0x1p32 - 0x1p32; + s = 1.0 + t * z; + return t + a * (s + t * v); +} +#endif diff --git a/lib/libc/src/musl-math/acos.c b/lib/libc/src/musl-math/acos.c new file mode 100644 index 0000000..ea9c87b --- /dev/null +++ b/lib/libc/src/musl-math/acos.c @@ -0,0 +1,101 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_acos.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* acos(x) + * Method : + * acos(x) = pi/2 - asin(x) + * acos(-x) = pi/2 + asin(x) + * For |x|<=0.5 + * acos(x) = pi/2 - (x + x*x^2*R(x^2)) (see asin.c) + * For x>0.5 + * acos(x) = pi/2 - (pi/2 - 2asin(sqrt((1-x)/2))) + * = 2asin(sqrt((1-x)/2)) + * = 2s + 2s*z*R(z) ...z=(1-x)/2, s=sqrt(z) + * = 2f + (2c + 2s*z*R(z)) + * where f=hi part of s, and c = (z-f*f)/(s+f) is the correction term + * for f so that f+c ~ sqrt(z). + * For x<-0.5 + * acos(x) = pi - 2asin(sqrt((1-|x|)/2)) + * = pi - 0.5*(s+s*z*R(z)), where z=(1-|x|)/2,s=sqrt(z) + * + * Special cases: + * if x is NaN, return x itself; + * if |x|>1, return NaN with invalid signal. + * + * Function needed: sqrt + */ + +#include "libm.h" + +static const double +pio2_hi = 1.57079632679489655800e+00, /* 0x3FF921FB, 0x54442D18 */ +pio2_lo = 6.12323399573676603587e-17, /* 0x3C91A626, 0x33145C07 */ +pS0 = 1.66666666666666657415e-01, /* 0x3FC55555, 0x55555555 */ +pS1 = -3.25565818622400915405e-01, /* 0xBFD4D612, 0x03EB6F7D */ +pS2 = 2.01212532134862925881e-01, /* 0x3FC9C155, 0x0E884455 */ +pS3 = -4.00555345006794114027e-02, /* 0xBFA48228, 0xB5688F3B */ +pS4 = 7.91534994289814532176e-04, /* 0x3F49EFE0, 0x7501B288 */ +pS5 = 3.47933107596021167570e-05, /* 0x3F023DE1, 0x0DFDF709 */ +qS1 = -2.40339491173441421878e+00, /* 0xC0033A27, 0x1C8A2D4B */ +qS2 = 2.02094576023350569471e+00, /* 0x40002AE5, 0x9C598AC8 */ +qS3 = -6.88283971605453293030e-01, /* 0xBFE6066C, 0x1B8D0159 */ +qS4 = 7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */ + +static double R(double z) +{ + double_t p, q; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5))))); + q = 1.0+z*(qS1+z*(qS2+z*(qS3+z*qS4))); + return p/q; +} + +double acos(double x) +{ + double z,w,s,c,df; + uint32_t hx,ix; + + GET_HIGH_WORD(hx, x); + ix = hx & 0x7fffffff; + /* |x| >= 1 or nan */ + if (ix >= 0x3ff00000) { + uint32_t lx; + + GET_LOW_WORD(lx,x); + if ((ix-0x3ff00000 | lx) == 0) { + /* acos(1)=0, acos(-1)=pi */ + if (hx >> 31) + return 2*pio2_hi + 0x1p-120f; + return 0; + } + return 0/(x-x); + } + /* |x| < 0.5 */ + if (ix < 0x3fe00000) { + if (ix <= 0x3c600000) /* |x| < 2**-57 */ + return pio2_hi + 0x1p-120f; + return pio2_hi - (x - (pio2_lo-x*R(x*x))); + } + /* x < -0.5 */ + if (hx >> 31) { + z = (1.0+x)*0.5; + s = sqrt(z); + w = R(z)*s-pio2_lo; + return 2*(pio2_hi - (s+w)); + } + /* x > 0.5 */ + z = (1.0-x)*0.5; + s = sqrt(z); + df = s; + SET_LOW_WORD(df,0); + c = (z-df*df)/(s+df); + w = R(z)*s+c; + return 2*(df+w); +} diff --git a/lib/libc/src/musl-math/acosf.c b/lib/libc/src/musl-math/acosf.c new file mode 100644 index 0000000..8ee1a71 --- /dev/null +++ b/lib/libc/src/musl-math/acosf.c @@ -0,0 +1,71 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_acosf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +pio2_hi = 1.5707962513e+00, /* 0x3fc90fda */ +pio2_lo = 7.5497894159e-08, /* 0x33a22168 */ +pS0 = 1.6666586697e-01, +pS1 = -4.2743422091e-02, +pS2 = -8.6563630030e-03, +qS1 = -7.0662963390e-01; + +static float R(float z) +{ + float_t p, q; + p = z*(pS0+z*(pS1+z*pS2)); + q = 1.0f+z*qS1; + return p/q; +} + +float acosf(float x) +{ + float z,w,s,c,df; + uint32_t hx,ix; + + GET_FLOAT_WORD(hx, x); + ix = hx & 0x7fffffff; + /* |x| >= 1 or nan */ + if (ix >= 0x3f800000) { + if (ix == 0x3f800000) { + if (hx >> 31) + return 2*pio2_hi + 0x1p-120f; + return 0; + } + return 0/(x-x); + } + /* |x| < 0.5 */ + if (ix < 0x3f000000) { + if (ix <= 0x32800000) /* |x| < 2**-26 */ + return pio2_hi + 0x1p-120f; + return pio2_hi - (x - (pio2_lo-x*R(x*x))); + } + /* x < -0.5 */ + if (hx >> 31) { + z = (1+x)*0.5f; + s = sqrtf(z); + w = R(z)*s-pio2_lo; + return 2*(pio2_hi - (s+w)); + } + /* x > 0.5 */ + z = (1-x)*0.5f; + s = sqrtf(z); + GET_FLOAT_WORD(hx,s); + SET_FLOAT_WORD(df,hx&0xfffff000); + c = (z-df*df)/(s+df); + w = R(z)*s+c; + return 2*(df+w); +} diff --git a/lib/libc/src/musl-math/acosh.c b/lib/libc/src/musl-math/acosh.c new file mode 100644 index 0000000..badbf90 --- /dev/null +++ b/lib/libc/src/musl-math/acosh.c @@ -0,0 +1,24 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==2 +#undef sqrt +#define sqrt sqrtl +#endif + +/* acosh(x) = log(x + sqrt(x*x-1)) */ +double acosh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + unsigned e = u.i >> 52 & 0x7ff; + + /* x < 1 domain error is handled in the called functions */ + + if (e < 0x3ff + 1) + /* |x| < 2, up to 2ulp error in [1,1.125] */ + return log1p(x-1 + sqrt((x-1)*(x-1)+2*(x-1))); + if (e < 0x3ff + 26) + /* |x| < 0x1p26 */ + return log(2*x - 1/(x+sqrt(x*x-1))); + /* |x| >= 0x1p26 or nan */ + return log(x) + 0.693147180559945309417232121458176568; +} diff --git a/lib/libc/src/musl-math/acoshf.c b/lib/libc/src/musl-math/acoshf.c new file mode 100644 index 0000000..8a4ec4d --- /dev/null +++ b/lib/libc/src/musl-math/acoshf.c @@ -0,0 +1,26 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==2 +#undef sqrtf +#define sqrtf sqrtl +#elif FLT_EVAL_METHOD==1 +#undef sqrtf +#define sqrtf sqrt +#endif + +/* acosh(x) = log(x + sqrt(x*x-1)) */ +float acoshf(float x) +{ + union {float f; uint32_t i;} u = {x}; + uint32_t a = u.i & 0x7fffffff; + + if (a < 0x3f800000+(1<<23)) + /* |x| < 2, invalid if x < 1 or nan */ + /* up to 2ulp error in [1,1.125] */ + return log1pf(x-1 + sqrtf((x-1)*(x-1)+2*(x-1))); + if (a < 0x3f800000+(12<<23)) + /* |x| < 0x1p12 */ + return logf(2*x - 1/(x+sqrtf(x*x-1))); + /* x >= 0x1p12 */ + return logf(x) + 0.693147180559945309417232121458176568f; +} diff --git a/lib/libc/src/musl-math/acoshl.c b/lib/libc/src/musl-math/acoshl.c new file mode 100644 index 0000000..8d4b43f --- /dev/null +++ b/lib/libc/src/musl-math/acoshl.c @@ -0,0 +1,29 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double acoshl(long double x) +{ + return acosh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* acosh(x) = log(x + sqrt(x*x-1)) */ +long double acoshl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + + if (e < 0x3fff + 1) + /* |x| < 2, invalid if x < 1 or nan */ + return log1pl(x-1 + sqrtl((x-1)*(x-1)+2*(x-1))); + if (e < 0x3fff + 32) + /* |x| < 0x1p32 */ + return logl(2*x - 1/(x+sqrtl(x*x-1))); + return logl(x) + 0.693147180559945309417232121458176568L; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double acoshl(long double x) +{ + return acosh(x); +} +#endif diff --git a/lib/libc/src/musl-math/acosl.c b/lib/libc/src/musl-math/acosl.c new file mode 100644 index 0000000..c03bdf0 --- /dev/null +++ b/lib/libc/src/musl-math/acosl.c @@ -0,0 +1,67 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_acosl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in acos.c. + * Converted to long double by David Schultz <das@FreeBSD.ORG>. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double acosl(long double x) +{ + return acos(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#include "__invtrigl.h" +#if LDBL_MANT_DIG == 64 +#define CLEARBOTTOM(u) (u.i.m &= -1ULL << 32) +#elif LDBL_MANT_DIG == 113 +#define CLEARBOTTOM(u) (u.i.lo = 0) +#endif + +long double acosl(long double x) +{ + union ldshape u = {x}; + long double z, s, c, f; + uint16_t e = u.i.se & 0x7fff; + + /* |x| >= 1 or nan */ + if (e >= 0x3fff) { + if (x == 1) + return 0; + if (x == -1) + return 2*pio2_hi + 0x1p-120f; + return 0/(x-x); + } + /* |x| < 0.5 */ + if (e < 0x3fff - 1) { + if (e < 0x3fff - LDBL_MANT_DIG - 1) + return pio2_hi + 0x1p-120f; + return pio2_hi - (__invtrigl_R(x*x)*x - pio2_lo + x); + } + /* x < -0.5 */ + if (u.i.se >> 15) { + z = (1 + x)*0.5; + s = sqrtl(z); + return 2*(pio2_hi - (__invtrigl_R(z)*s - pio2_lo + s)); + } + /* x > 0.5 */ + z = (1 - x)*0.5; + s = sqrtl(z); + u.f = s; + CLEARBOTTOM(u); + f = u.f; + c = (z - f*f)/(s + f); + return 2*(__invtrigl_R(z)*s + c + f); +} +#endif diff --git a/lib/libc/src/musl-math/asin.c b/lib/libc/src/musl-math/asin.c new file mode 100644 index 0000000..c926b18 --- /dev/null +++ b/lib/libc/src/musl-math/asin.c @@ -0,0 +1,107 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_asin.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* asin(x) + * Method : + * Since asin(x) = x + x^3/6 + x^5*3/40 + x^7*15/336 + ... + * we approximate asin(x) on [0,0.5] by + * asin(x) = x + x*x^2*R(x^2) + * where + * R(x^2) is a rational approximation of (asin(x)-x)/x^3 + * and its remez error is bounded by + * |(asin(x)-x)/x^3 - R(x^2)| < 2^(-58.75) + * + * For x in [0.5,1] + * asin(x) = pi/2-2*asin(sqrt((1-x)/2)) + * Let y = (1-x), z = y/2, s := sqrt(z), and pio2_hi+pio2_lo=pi/2; + * then for x>0.98 + * asin(x) = pi/2 - 2*(s+s*z*R(z)) + * = pio2_hi - (2*(s+s*z*R(z)) - pio2_lo) + * For x<=0.98, let pio4_hi = pio2_hi/2, then + * f = hi part of s; + * c = sqrt(z) - f = (z-f*f)/(s+f) ...f+c=sqrt(z) + * and + * asin(x) = pi/2 - 2*(s+s*z*R(z)) + * = pio4_hi+(pio4-2s)-(2s*z*R(z)-pio2_lo) + * = pio4_hi+(pio4-2f)-(2s*z*R(z)-(pio2_lo+2c)) + * + * Special cases: + * if x is NaN, return x itself; + * if |x|>1, return NaN with invalid signal. + * + */ + +#include "libm.h" + +static const double +pio2_hi = 1.57079632679489655800e+00, /* 0x3FF921FB, 0x54442D18 */ +pio2_lo = 6.12323399573676603587e-17, /* 0x3C91A626, 0x33145C07 */ +/* coefficients for R(x^2) */ +pS0 = 1.66666666666666657415e-01, /* 0x3FC55555, 0x55555555 */ +pS1 = -3.25565818622400915405e-01, /* 0xBFD4D612, 0x03EB6F7D */ +pS2 = 2.01212532134862925881e-01, /* 0x3FC9C155, 0x0E884455 */ +pS3 = -4.00555345006794114027e-02, /* 0xBFA48228, 0xB5688F3B */ +pS4 = 7.91534994289814532176e-04, /* 0x3F49EFE0, 0x7501B288 */ +pS5 = 3.47933107596021167570e-05, /* 0x3F023DE1, 0x0DFDF709 */ +qS1 = -2.40339491173441421878e+00, /* 0xC0033A27, 0x1C8A2D4B */ +qS2 = 2.02094576023350569471e+00, /* 0x40002AE5, 0x9C598AC8 */ +qS3 = -6.88283971605453293030e-01, /* 0xBFE6066C, 0x1B8D0159 */ +qS4 = 7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */ + +static double R(double z) +{ + double_t p, q; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5))))); + q = 1.0+z*(qS1+z*(qS2+z*(qS3+z*qS4))); + return p/q; +} + +double asin(double x) +{ + double z,r,s; + uint32_t hx,ix; + + GET_HIGH_WORD(hx, x); + ix = hx & 0x7fffffff; + /* |x| >= 1 or nan */ + if (ix >= 0x3ff00000) { + uint32_t lx; + GET_LOW_WORD(lx, x); + if ((ix-0x3ff00000 | lx) == 0) + /* asin(1) = +-pi/2 with inexact */ + return x*pio2_hi + 0x1p-120f; + return 0/(x-x); + } + /* |x| < 0.5 */ + if (ix < 0x3fe00000) { + /* if 0x1p-1022 <= |x| < 0x1p-26, avoid raising underflow */ + if (ix < 0x3e500000 && ix >= 0x00100000) + return x; + return x + x*R(x*x); + } + /* 1 > |x| >= 0.5 */ + z = (1 - fabs(x))*0.5; + s = sqrt(z); + r = R(z); + if (ix >= 0x3fef3333) { /* if |x| > 0.975 */ + x = pio2_hi-(2*(s+s*r)-pio2_lo); + } else { + double f,c; + /* f+c = sqrt(z) */ + f = s; + SET_LOW_WORD(f,0); + c = (z-f*f)/(s+f); + x = 0.5*pio2_hi - (2*s*r - (pio2_lo-2*c) - (0.5*pio2_hi-2*f)); + } + if (hx >> 31) + return -x; + return x; +} diff --git a/lib/libc/src/musl-math/asinf.c b/lib/libc/src/musl-math/asinf.c new file mode 100644 index 0000000..bcd304a --- /dev/null +++ b/lib/libc/src/musl-math/asinf.c @@ -0,0 +1,61 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_asinf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +#include "libm.h" + +static const double +pio2 = 1.570796326794896558e+00; + +static const float +/* coefficients for R(x^2) */ +pS0 = 1.6666586697e-01, +pS1 = -4.2743422091e-02, +pS2 = -8.6563630030e-03, +qS1 = -7.0662963390e-01; + +static float R(float z) +{ + float_t p, q; + p = z*(pS0+z*(pS1+z*pS2)); + q = 1.0f+z*qS1; + return p/q; +} + +float asinf(float x) +{ + double s; + float z; + uint32_t hx,ix; + + GET_FLOAT_WORD(hx, x); + ix = hx & 0x7fffffff; + if (ix >= 0x3f800000) { /* |x| >= 1 */ + if (ix == 0x3f800000) /* |x| == 1 */ + return x*pio2 + 0x1p-120f; /* asin(+-1) = +-pi/2 with inexact */ + return 0/(x-x); /* asin(|x|>1) is NaN */ + } + if (ix < 0x3f000000) { /* |x| < 0.5 */ + /* if 0x1p-126 <= |x| < 0x1p-12, avoid raising underflow */ + if (ix < 0x39800000 && ix >= 0x00800000) + return x; + return x + x*R(x*x); + } + /* 1 > |x| >= 0.5 */ + z = (1 - fabsf(x))*0.5f; + s = sqrt(z); + x = pio2 - 2*(s+s*R(z)); + if (hx >> 31) + return -x; + return x; +} diff --git a/lib/libc/src/musl-math/asinh.c b/lib/libc/src/musl-math/asinh.c new file mode 100644 index 0000000..0829f22 --- /dev/null +++ b/lib/libc/src/musl-math/asinh.c @@ -0,0 +1,28 @@ +#include "libm.h" + +/* asinh(x) = sign(x)*log(|x|+sqrt(x*x+1)) ~= x - x^3/6 + o(x^5) */ +double asinh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + unsigned e = u.i >> 52 & 0x7ff; + unsigned s = u.i >> 63; + + /* |x| */ + u.i &= (uint64_t)-1/2; + x = u.f; + + if (e >= 0x3ff + 26) { + /* |x| >= 0x1p26 or inf or nan */ + x = log(x) + 0.693147180559945309417232121458176568; + } else if (e >= 0x3ff + 1) { + /* |x| >= 2 */ + x = log(2*x + 1/(sqrt(x*x+1)+x)); + } else if (e >= 0x3ff - 26) { + /* |x| >= 0x1p-26, up to 1.6ulp error in [0.125,0.5] */ + x = log1p(x + x*x/(sqrt(x*x+1)+1)); + } else { + /* |x| < 0x1p-26, raise inexact if x != 0 */ + FORCE_EVAL(x + 0x1p120f); + } + return s ? -x : x; +} diff --git a/lib/libc/src/musl-math/asinhf.c b/lib/libc/src/musl-math/asinhf.c new file mode 100644 index 0000000..fc9f091 --- /dev/null +++ b/lib/libc/src/musl-math/asinhf.c @@ -0,0 +1,28 @@ +#include "libm.h" + +/* asinh(x) = sign(x)*log(|x|+sqrt(x*x+1)) ~= x - x^3/6 + o(x^5) */ +float asinhf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + uint32_t i = u.i & 0x7fffffff; + unsigned s = u.i >> 31; + + /* |x| */ + u.i = i; + x = u.f; + + if (i >= 0x3f800000 + (12<<23)) { + /* |x| >= 0x1p12 or inf or nan */ + x = logf(x) + 0.693147180559945309417232121458176568f; + } else if (i >= 0x3f800000 + (1<<23)) { + /* |x| >= 2 */ + x = logf(2*x + 1/(sqrtf(x*x+1)+x)); + } else if (i >= 0x3f800000 - (12<<23)) { + /* |x| >= 0x1p-12, up to 1.6ulp error in [0.125,0.5] */ + x = log1pf(x + x*x/(sqrtf(x*x+1)+1)); + } else { + /* |x| < 0x1p-12, raise inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + } + return s ? -x : x; +} diff --git a/lib/libc/src/musl-math/asinhl.c b/lib/libc/src/musl-math/asinhl.c new file mode 100644 index 0000000..8635f52 --- /dev/null +++ b/lib/libc/src/musl-math/asinhl.c @@ -0,0 +1,41 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double asinhl(long double x) +{ + return asinh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* asinh(x) = sign(x)*log(|x|+sqrt(x*x+1)) ~= x - x^3/6 + o(x^5) */ +long double asinhl(long double x) +{ + union ldshape u = {x}; + unsigned e = u.i.se & 0x7fff; + unsigned s = u.i.se >> 15; + + /* |x| */ + u.i.se = e; + x = u.f; + + if (e >= 0x3fff + 32) { + /* |x| >= 0x1p32 or inf or nan */ + x = logl(x) + 0.693147180559945309417232121458176568L; + } else if (e >= 0x3fff + 1) { + /* |x| >= 2 */ + x = logl(2*x + 1/(sqrtl(x*x+1)+x)); + } else if (e >= 0x3fff - 32) { + /* |x| >= 0x1p-32 */ + x = log1pl(x + x*x/(sqrtl(x*x+1)+1)); + } else { + /* |x| < 0x1p-32, raise inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + } + return s ? -x : x; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double asinhl(long double x) +{ + return asinh(x); +} +#endif diff --git a/lib/libc/src/musl-math/asinl.c b/lib/libc/src/musl-math/asinl.c new file mode 100644 index 0000000..347c535 --- /dev/null +++ b/lib/libc/src/musl-math/asinl.c @@ -0,0 +1,71 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_asinl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in asin.c. + * Converted to long double by David Schultz <das@FreeBSD.ORG>. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double asinl(long double x) +{ + return asin(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#include "__invtrigl.h" +#if LDBL_MANT_DIG == 64 +#define CLOSETO1(u) (u.i.m>>56 >= 0xf7) +#define CLEARBOTTOM(u) (u.i.m &= -1ULL << 32) +#elif LDBL_MANT_DIG == 113 +#define CLOSETO1(u) (u.i.top >= 0xee00) +#define CLEARBOTTOM(u) (u.i.lo = 0) +#endif + +long double asinl(long double x) +{ + union ldshape u = {x}; + long double z, r, s; + uint16_t e = u.i.se & 0x7fff; + int sign = u.i.se >> 15; + + if (e >= 0x3fff) { /* |x| >= 1 or nan */ + /* asin(+-1)=+-pi/2 with inexact */ + if (x == 1 || x == -1) + return x*pio2_hi + 0x1p-120f; + return 0/(x-x); + } + if (e < 0x3fff - 1) { /* |x| < 0.5 */ + if (e < 0x3fff - (LDBL_MANT_DIG+1)/2) { + /* return x with inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + return x; + } + return x + x*__invtrigl_R(x*x); + } + /* 1 > |x| >= 0.5 */ + z = (1.0 - fabsl(x))*0.5; + s = sqrtl(z); + r = __invtrigl_R(z); + if (CLOSETO1(u)) { + x = pio2_hi - (2*(s+s*r)-pio2_lo); + } else { + long double f, c; + u.f = s; + CLEARBOTTOM(u); + f = u.f; + c = (z - f*f)/(s + f); + x = 0.5*pio2_hi-(2*s*r - (pio2_lo-2*c) - (0.5*pio2_hi-2*f)); + } + return sign ? -x : x; +} +#endif diff --git a/lib/libc/src/musl-math/atan.c b/lib/libc/src/musl-math/atan.c new file mode 100644 index 0000000..63b0ab2 --- /dev/null +++ b/lib/libc/src/musl-math/atan.c @@ -0,0 +1,116 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_atan.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* atan(x) + * Method + * 1. Reduce x to positive by atan(x) = -atan(-x). + * 2. According to the integer k=4t+0.25 chopped, t=x, the argument + * is further reduced to one of the following intervals and the + * arctangent of t is evaluated by the corresponding formula: + * + * [0,7/16] atan(x) = t-t^3*(a1+t^2*(a2+...(a10+t^2*a11)...) + * [7/16,11/16] atan(x) = atan(1/2) + atan( (t-0.5)/(1+t/2) ) + * [11/16.19/16] atan(x) = atan( 1 ) + atan( (t-1)/(1+t) ) + * [19/16,39/16] atan(x) = atan(3/2) + atan( (t-1.5)/(1+1.5t) ) + * [39/16,INF] atan(x) = atan(INF) + atan( -1/t ) + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + + +#include "libm.h" + +static const double atanhi[] = { + 4.63647609000806093515e-01, /* atan(0.5)hi 0x3FDDAC67, 0x0561BB4F */ + 7.85398163397448278999e-01, /* atan(1.0)hi 0x3FE921FB, 0x54442D18 */ + 9.82793723247329054082e-01, /* atan(1.5)hi 0x3FEF730B, 0xD281F69B */ + 1.57079632679489655800e+00, /* atan(inf)hi 0x3FF921FB, 0x54442D18 */ +}; + +static const double atanlo[] = { + 2.26987774529616870924e-17, /* atan(0.5)lo 0x3C7A2B7F, 0x222F65E2 */ + 3.06161699786838301793e-17, /* atan(1.0)lo 0x3C81A626, 0x33145C07 */ + 1.39033110312309984516e-17, /* atan(1.5)lo 0x3C700788, 0x7AF0CBBD */ + 6.12323399573676603587e-17, /* atan(inf)lo 0x3C91A626, 0x33145C07 */ +}; + +static const double aT[] = { + 3.33333333333329318027e-01, /* 0x3FD55555, 0x5555550D */ + -1.99999999998764832476e-01, /* 0xBFC99999, 0x9998EBC4 */ + 1.42857142725034663711e-01, /* 0x3FC24924, 0x920083FF */ + -1.11111104054623557880e-01, /* 0xBFBC71C6, 0xFE231671 */ + 9.09088713343650656196e-02, /* 0x3FB745CD, 0xC54C206E */ + -7.69187620504482999495e-02, /* 0xBFB3B0F2, 0xAF749A6D */ + 6.66107313738753120669e-02, /* 0x3FB10D66, 0xA0D03D51 */ + -5.83357013379057348645e-02, /* 0xBFADDE2D, 0x52DEFD9A */ + 4.97687799461593236017e-02, /* 0x3FA97B4B, 0x24760DEB */ + -3.65315727442169155270e-02, /* 0xBFA2B444, 0x2C6A6C2F */ + 1.62858201153657823623e-02, /* 0x3F90AD3A, 0xE322DA11 */ +}; + +double atan(double x) +{ + double_t w,s1,s2,z; + uint32_t ix,sign; + int id; + + GET_HIGH_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + if (ix >= 0x44100000) { /* if |x| >= 2^66 */ + if (isnan(x)) + return x; + z = atanhi[3] + 0x1p-120f; + return sign ? -z : z; + } + if (ix < 0x3fdc0000) { /* |x| < 0.4375 */ + if (ix < 0x3e400000) { /* |x| < 2^-27 */ + if (ix < 0x00100000) + /* raise underflow for subnormal x */ + FORCE_EVAL((float)x); + return x; + } + id = -1; + } else { + x = fabs(x); + if (ix < 0x3ff30000) { /* |x| < 1.1875 */ + if (ix < 0x3fe60000) { /* 7/16 <= |x| < 11/16 */ + id = 0; + x = (2.0*x-1.0)/(2.0+x); + } else { /* 11/16 <= |x| < 19/16 */ + id = 1; + x = (x-1.0)/(x+1.0); + } + } else { + if (ix < 0x40038000) { /* |x| < 2.4375 */ + id = 2; + x = (x-1.5)/(1.0+1.5*x); + } else { /* 2.4375 <= |x| < 2^66 */ + id = 3; + x = -1.0/x; + } + } + } + /* end of argument reduction */ + z = x*x; + w = z*z; + /* break sum from i=0 to 10 aT[i]z**(i+1) into odd and even poly */ + s1 = z*(aT[0]+w*(aT[2]+w*(aT[4]+w*(aT[6]+w*(aT[8]+w*aT[10]))))); + s2 = w*(aT[1]+w*(aT[3]+w*(aT[5]+w*(aT[7]+w*aT[9])))); + if (id < 0) + return x - x*(s1+s2); + z = atanhi[id] - (x*(s1+s2) - atanlo[id] - x); + return sign ? -z : z; +} diff --git a/lib/libc/src/musl-math/atan2.c b/lib/libc/src/musl-math/atan2.c new file mode 100644 index 0000000..5a1903c --- /dev/null +++ b/lib/libc/src/musl-math/atan2.c @@ -0,0 +1,107 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_atan2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ +/* atan2(y,x) + * Method : + * 1. Reduce y to positive by atan2(y,x)=-atan2(-y,x). + * 2. Reduce x to positive by (if x and y are unexceptional): + * ARG (x+iy) = arctan(y/x) ... if x > 0, + * ARG (x+iy) = pi - arctan[y/(-x)] ... if x < 0, + * + * Special cases: + * + * ATAN2((anything), NaN ) is NaN; + * ATAN2(NAN , (anything) ) is NaN; + * ATAN2(+-0, +(anything but NaN)) is +-0 ; + * ATAN2(+-0, -(anything but NaN)) is +-pi ; + * ATAN2(+-(anything but 0 and NaN), 0) is +-pi/2; + * ATAN2(+-(anything but INF and NaN), +INF) is +-0 ; + * ATAN2(+-(anything but INF and NaN), -INF) is +-pi; + * ATAN2(+-INF,+INF ) is +-pi/4 ; + * ATAN2(+-INF,-INF ) is +-3pi/4; + * ATAN2(+-INF, (anything but,0,NaN, and INF)) is +-pi/2; + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "libm.h" + +static const double +pi = 3.1415926535897931160E+00, /* 0x400921FB, 0x54442D18 */ +pi_lo = 1.2246467991473531772E-16; /* 0x3CA1A626, 0x33145C07 */ + +double atan2(double y, double x) +{ + double z; + uint32_t m,lx,ly,ix,iy; + + if (isnan(x) || isnan(y)) + return x+y; + EXTRACT_WORDS(ix, lx, x); + EXTRACT_WORDS(iy, ly, y); + if ((ix-0x3ff00000 | lx) == 0) /* x = 1.0 */ + return atan(y); + m = ((iy>>31)&1) | ((ix>>30)&2); /* 2*sign(x)+sign(y) */ + ix = ix & 0x7fffffff; + iy = iy & 0x7fffffff; + + /* when y = 0 */ + if ((iy|ly) == 0) { + switch(m) { + case 0: + case 1: return y; /* atan(+-0,+anything)=+-0 */ + case 2: return pi; /* atan(+0,-anything) = pi */ + case 3: return -pi; /* atan(-0,-anything) =-pi */ + } + } + /* when x = 0 */ + if ((ix|lx) == 0) + return m&1 ? -pi/2 : pi/2; + /* when x is INF */ + if (ix == 0x7ff00000) { + if (iy == 0x7ff00000) { + switch(m) { + case 0: return pi/4; /* atan(+INF,+INF) */ + case 1: return -pi/4; /* atan(-INF,+INF) */ + case 2: return 3*pi/4; /* atan(+INF,-INF) */ + case 3: return -3*pi/4; /* atan(-INF,-INF) */ + } + } else { + switch(m) { + case 0: return 0.0; /* atan(+...,+INF) */ + case 1: return -0.0; /* atan(-...,+INF) */ + case 2: return pi; /* atan(+...,-INF) */ + case 3: return -pi; /* atan(-...,-INF) */ + } + } + } + /* |y/x| > 0x1p64 */ + if (ix+(64<<20) < iy || iy == 0x7ff00000) + return m&1 ? -pi/2 : pi/2; + + /* z = atan(|y/x|) without spurious underflow */ + if ((m&2) && iy+(64<<20) < ix) /* |y/x| < 0x1p-64, x<0 */ + z = 0; + else + z = atan(fabs(y/x)); + switch (m) { + case 0: return z; /* atan(+,+) */ + case 1: return -z; /* atan(-,+) */ + case 2: return pi - (z-pi_lo); /* atan(+,-) */ + default: /* case 3 */ + return (z-pi_lo) - pi; /* atan(-,-) */ + } +} diff --git a/lib/libc/src/musl-math/atan2f.c b/lib/libc/src/musl-math/atan2f.c new file mode 100644 index 0000000..c634d00 --- /dev/null +++ b/lib/libc/src/musl-math/atan2f.c @@ -0,0 +1,83 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_atan2f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +pi = 3.1415927410e+00, /* 0x40490fdb */ +pi_lo = -8.7422776573e-08; /* 0xb3bbbd2e */ + +float atan2f(float y, float x) +{ + float z; + uint32_t m,ix,iy; + + if (isnan(x) || isnan(y)) + return x+y; + GET_FLOAT_WORD(ix, x); + GET_FLOAT_WORD(iy, y); + if (ix == 0x3f800000) /* x=1.0 */ + return atanf(y); + m = ((iy>>31)&1) | ((ix>>30)&2); /* 2*sign(x)+sign(y) */ + ix &= 0x7fffffff; + iy &= 0x7fffffff; + + /* when y = 0 */ + if (iy == 0) { + switch (m) { + case 0: + case 1: return y; /* atan(+-0,+anything)=+-0 */ + case 2: return pi; /* atan(+0,-anything) = pi */ + case 3: return -pi; /* atan(-0,-anything) =-pi */ + } + } + /* when x = 0 */ + if (ix == 0) + return m&1 ? -pi/2 : pi/2; + /* when x is INF */ + if (ix == 0x7f800000) { + if (iy == 0x7f800000) { + switch (m) { + case 0: return pi/4; /* atan(+INF,+INF) */ + case 1: return -pi/4; /* atan(-INF,+INF) */ + case 2: return 3*pi/4; /*atan(+INF,-INF)*/ + case 3: return -3*pi/4; /*atan(-INF,-INF)*/ + } + } else { + switch (m) { + case 0: return 0.0f; /* atan(+...,+INF) */ + case 1: return -0.0f; /* atan(-...,+INF) */ + case 2: return pi; /* atan(+...,-INF) */ + case 3: return -pi; /* atan(-...,-INF) */ + } + } + } + /* |y/x| > 0x1p26 */ + if (ix+(26<<23) < iy || iy == 0x7f800000) + return m&1 ? -pi/2 : pi/2; + + /* z = atan(|y/x|) with correct underflow */ + if ((m&2) && iy+(26<<23) < ix) /*|y/x| < 0x1p-26, x < 0 */ + z = 0.0; + else + z = atanf(fabsf(y/x)); + switch (m) { + case 0: return z; /* atan(+,+) */ + case 1: return -z; /* atan(-,+) */ + case 2: return pi - (z-pi_lo); /* atan(+,-) */ + default: /* case 3 */ + return (z-pi_lo) - pi; /* atan(-,-) */ + } +} diff --git a/lib/libc/src/musl-math/atan2l.c b/lib/libc/src/musl-math/atan2l.c new file mode 100644 index 0000000..f0937a9 --- /dev/null +++ b/lib/libc/src/musl-math/atan2l.c @@ -0,0 +1,85 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_atan2l.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ +/* + * See comments in atan2.c. + * Converted to long double by David Schultz <das@FreeBSD.ORG>. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double atan2l(long double y, long double x) +{ + return atan2(y, x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#include "__invtrigl.h" + +long double atan2l(long double y, long double x) +{ + union ldshape ux, uy; + long double z; + int m, ex, ey; + + if (isnan(x) || isnan(y)) + return x+y; + if (x == 1) + return atanl(y); + ux.f = x; + uy.f = y; + ex = ux.i.se & 0x7fff; + ey = uy.i.se & 0x7fff; + m = 2*(ux.i.se>>15) | uy.i.se>>15; + if (y == 0) { + switch(m) { + case 0: + case 1: return y; /* atan(+-0,+anything)=+-0 */ + case 2: return 2*pio2_hi; /* atan(+0,-anything) = pi */ + case 3: return -2*pio2_hi; /* atan(-0,-anything) =-pi */ + } + } + if (x == 0) + return m&1 ? -pio2_hi : pio2_hi; + if (ex == 0x7fff) { + if (ey == 0x7fff) { + switch(m) { + case 0: return pio2_hi/2; /* atan(+INF,+INF) */ + case 1: return -pio2_hi/2; /* atan(-INF,+INF) */ + case 2: return 1.5*pio2_hi; /* atan(+INF,-INF) */ + case 3: return -1.5*pio2_hi; /* atan(-INF,-INF) */ + } + } else { + switch(m) { + case 0: return 0.0; /* atan(+...,+INF) */ + case 1: return -0.0; /* atan(-...,+INF) */ + case 2: return 2*pio2_hi; /* atan(+...,-INF) */ + case 3: return -2*pio2_hi; /* atan(-...,-INF) */ + } + } + } + if (ex+120 < ey || ey == 0x7fff) + return m&1 ? -pio2_hi : pio2_hi; + /* z = atan(|y/x|) without spurious underflow */ + if ((m&2) && ey+120 < ex) /* |y/x| < 0x1p-120, x<0 */ + z = 0.0; + else + z = atanl(fabsl(y/x)); + switch (m) { + case 0: return z; /* atan(+,+) */ + case 1: return -z; /* atan(-,+) */ + case 2: return 2*pio2_hi-(z-2*pio2_lo); /* atan(+,-) */ + default: /* case 3 */ + return (z-2*pio2_lo)-2*pio2_hi; /* atan(-,-) */ + } +} +#endif diff --git a/lib/libc/src/musl-math/atanf.c b/lib/libc/src/musl-math/atanf.c new file mode 100644 index 0000000..178341b --- /dev/null +++ b/lib/libc/src/musl-math/atanf.c @@ -0,0 +1,94 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_atanf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + + +#include "libm.h" + +static const float atanhi[] = { + 4.6364760399e-01, /* atan(0.5)hi 0x3eed6338 */ + 7.8539812565e-01, /* atan(1.0)hi 0x3f490fda */ + 9.8279368877e-01, /* atan(1.5)hi 0x3f7b985e */ + 1.5707962513e+00, /* atan(inf)hi 0x3fc90fda */ +}; + +static const float atanlo[] = { + 5.0121582440e-09, /* atan(0.5)lo 0x31ac3769 */ + 3.7748947079e-08, /* atan(1.0)lo 0x33222168 */ + 3.4473217170e-08, /* atan(1.5)lo 0x33140fb4 */ + 7.5497894159e-08, /* atan(inf)lo 0x33a22168 */ +}; + +static const float aT[] = { + 3.3333328366e-01, + -1.9999158382e-01, + 1.4253635705e-01, + -1.0648017377e-01, + 6.1687607318e-02, +}; + +float atanf(float x) +{ + float_t w,s1,s2,z; + uint32_t ix,sign; + int id; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x4c800000) { /* if |x| >= 2**26 */ + if (isnan(x)) + return x; + z = atanhi[3] + 0x1p-120f; + return sign ? -z : z; + } + if (ix < 0x3ee00000) { /* |x| < 0.4375 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + if (ix < 0x00800000) + /* raise underflow for subnormal x */ + FORCE_EVAL(x*x); + return x; + } + id = -1; + } else { + x = fabsf(x); + if (ix < 0x3f980000) { /* |x| < 1.1875 */ + if (ix < 0x3f300000) { /* 7/16 <= |x| < 11/16 */ + id = 0; + x = (2.0f*x - 1.0f)/(2.0f + x); + } else { /* 11/16 <= |x| < 19/16 */ + id = 1; + x = (x - 1.0f)/(x + 1.0f); + } + } else { + if (ix < 0x401c0000) { /* |x| < 2.4375 */ + id = 2; + x = (x - 1.5f)/(1.0f + 1.5f*x); + } else { /* 2.4375 <= |x| < 2**26 */ + id = 3; + x = -1.0f/x; + } + } + } + /* end of argument reduction */ + z = x*x; + w = z*z; + /* break sum from i=0 to 10 aT[i]z**(i+1) into odd and even poly */ + s1 = z*(aT[0]+w*(aT[2]+w*aT[4])); + s2 = w*(aT[1]+w*aT[3]); + if (id < 0) + return x - x*(s1+s2); + z = atanhi[id] - ((x*(s1+s2) - atanlo[id]) - x); + return sign ? -z : z; +} diff --git a/lib/libc/src/musl-math/atanh.c b/lib/libc/src/musl-math/atanh.c new file mode 100644 index 0000000..63a035d --- /dev/null +++ b/lib/libc/src/musl-math/atanh.c @@ -0,0 +1,29 @@ +#include "libm.h" + +/* atanh(x) = log((1+x)/(1-x))/2 = log1p(2x/(1-x))/2 ~= x + x^3/3 + o(x^5) */ +double atanh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + unsigned e = u.i >> 52 & 0x7ff; + unsigned s = u.i >> 63; + double_t y; + + /* |x| */ + u.i &= (uint64_t)-1/2; + y = u.f; + + if (e < 0x3ff - 1) { + if (e < 0x3ff - 32) { + /* handle underflow */ + if (e == 0) + FORCE_EVAL((float)y); + } else { + /* |x| < 0.5, up to 1.7ulp error */ + y = 0.5*log1p(2*y + 2*y*y/(1-y)); + } + } else { + /* avoid overflow */ + y = 0.5*log1p(2*(y/(1-y))); + } + return s ? -y : y; +} diff --git a/lib/libc/src/musl-math/atanhf.c b/lib/libc/src/musl-math/atanhf.c new file mode 100644 index 0000000..65f07c0 --- /dev/null +++ b/lib/libc/src/musl-math/atanhf.c @@ -0,0 +1,28 @@ +#include "libm.h" + +/* atanh(x) = log((1+x)/(1-x))/2 = log1p(2x/(1-x))/2 ~= x + x^3/3 + o(x^5) */ +float atanhf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + unsigned s = u.i >> 31; + float_t y; + + /* |x| */ + u.i &= 0x7fffffff; + y = u.f; + + if (u.i < 0x3f800000 - (1<<23)) { + if (u.i < 0x3f800000 - (32<<23)) { + /* handle underflow */ + if (u.i < (1<<23)) + FORCE_EVAL((float)(y*y)); + } else { + /* |x| < 0.5, up to 1.7ulp error */ + y = 0.5f*log1pf(2*y + 2*y*y/(1-y)); + } + } else { + /* avoid overflow */ + y = 0.5f*log1pf(2*(y/(1-y))); + } + return s ? -y : y; +} diff --git a/lib/libc/src/musl-math/atanhl.c b/lib/libc/src/musl-math/atanhl.c new file mode 100644 index 0000000..87cd1cd --- /dev/null +++ b/lib/libc/src/musl-math/atanhl.c @@ -0,0 +1,35 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double atanhl(long double x) +{ + return atanh(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +/* atanh(x) = log((1+x)/(1-x))/2 = log1p(2x/(1-x))/2 ~= x + x^3/3 + o(x^5) */ +long double atanhl(long double x) +{ + union ldshape u = {x}; + unsigned e = u.i.se & 0x7fff; + unsigned s = u.i.se >> 15; + + /* |x| */ + u.i.se = e; + x = u.f; + + if (e < 0x3ff - 1) { + if (e < 0x3ff - LDBL_MANT_DIG/2) { + /* handle underflow */ + if (e == 0) + FORCE_EVAL((float)x); + } else { + /* |x| < 0.5, up to 1.7ulp error */ + x = 0.5*log1pl(2*x + 2*x*x/(1-x)); + } + } else { + /* avoid overflow */ + x = 0.5*log1pl(2*(x/(1-x))); + } + return s ? -x : x; +} +#endif diff --git a/lib/libc/src/musl-math/atanl.c b/lib/libc/src/musl-math/atanl.c new file mode 100644 index 0000000..79a3edb --- /dev/null +++ b/lib/libc/src/musl-math/atanl.c @@ -0,0 +1,184 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_atanl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in atan.c. + * Converted to long double by David Schultz <das@FreeBSD.ORG>. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double atanl(long double x) +{ + return atan(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +#if LDBL_MANT_DIG == 64 +#define EXPMAN(u) ((u.i.se & 0x7fff)<<8 | (u.i.m>>55 & 0xff)) + +static const long double atanhi[] = { + 4.63647609000806116202e-01L, + 7.85398163397448309628e-01L, + 9.82793723247329067960e-01L, + 1.57079632679489661926e+00L, +}; + +static const long double atanlo[] = { + 1.18469937025062860669e-20L, + -1.25413940316708300586e-20L, + 2.55232234165405176172e-20L, + -2.50827880633416601173e-20L, +}; + +static const long double aT[] = { + 3.33333333333333333017e-01L, + -1.99999999999999632011e-01L, + 1.42857142857046531280e-01L, + -1.11111111100562372733e-01L, + 9.09090902935647302252e-02L, + -7.69230552476207730353e-02L, + 6.66661718042406260546e-02L, + -5.88158892835030888692e-02L, + 5.25499891539726639379e-02L, + -4.70119845393155721494e-02L, + 4.03539201366454414072e-02L, + -2.91303858419364158725e-02L, + 1.24822046299269234080e-02L, +}; + +static long double T_even(long double x) +{ + return aT[0] + x * (aT[2] + x * (aT[4] + x * (aT[6] + + x * (aT[8] + x * (aT[10] + x * aT[12]))))); +} + +static long double T_odd(long double x) +{ + return aT[1] + x * (aT[3] + x * (aT[5] + x * (aT[7] + + x * (aT[9] + x * aT[11])))); +} +#elif LDBL_MANT_DIG == 113 +#define EXPMAN(u) ((u.i.se & 0x7fff)<<8 | u.i.top>>8) + +const long double atanhi[] = { + 4.63647609000806116214256231461214397e-01L, + 7.85398163397448309615660845819875699e-01L, + 9.82793723247329067985710611014666038e-01L, + 1.57079632679489661923132169163975140e+00L, +}; + +const long double atanlo[] = { + 4.89509642257333492668618435220297706e-36L, + 2.16795253253094525619926100651083806e-35L, + -2.31288434538183565909319952098066272e-35L, + 4.33590506506189051239852201302167613e-35L, +}; + +const long double aT[] = { + 3.33333333333333333333333333333333125e-01L, + -1.99999999999999999999999999999180430e-01L, + 1.42857142857142857142857142125269827e-01L, + -1.11111111111111111111110834490810169e-01L, + 9.09090909090909090908522355708623681e-02L, + -7.69230769230769230696553844935357021e-02L, + 6.66666666666666660390096773046256096e-02L, + -5.88235294117646671706582985209643694e-02L, + 5.26315789473666478515847092020327506e-02L, + -4.76190476189855517021024424991436144e-02L, + 4.34782608678695085948531993458097026e-02L, + -3.99999999632663469330634215991142368e-02L, + 3.70370363987423702891250829918659723e-02L, + -3.44827496515048090726669907612335954e-02L, + 3.22579620681420149871973710852268528e-02L, + -3.03020767654269261041647570626778067e-02L, + 2.85641979882534783223403715930946138e-02L, + -2.69824879726738568189929461383741323e-02L, + 2.54194698498808542954187110873675769e-02L, + -2.35083879708189059926183138130183215e-02L, + 2.04832358998165364349957325067131428e-02L, + -1.54489555488544397858507248612362957e-02L, + 8.64492360989278761493037861575248038e-03L, + -2.58521121597609872727919154569765469e-03L, +}; + +static long double T_even(long double x) +{ + return (aT[0] + x * (aT[2] + x * (aT[4] + x * (aT[6] + x * (aT[8] + + x * (aT[10] + x * (aT[12] + x * (aT[14] + x * (aT[16] + + x * (aT[18] + x * (aT[20] + x * aT[22]))))))))))); +} + +static long double T_odd(long double x) +{ + return (aT[1] + x * (aT[3] + x * (aT[5] + x * (aT[7] + x * (aT[9] + + x * (aT[11] + x * (aT[13] + x * (aT[15] + x * (aT[17] + + x * (aT[19] + x * (aT[21] + x * aT[23]))))))))))); +} +#endif + +long double atanl(long double x) +{ + union ldshape u = {x}; + long double w, s1, s2, z; + int id; + unsigned e = u.i.se & 0x7fff; + unsigned sign = u.i.se >> 15; + unsigned expman; + + if (e >= 0x3fff + LDBL_MANT_DIG + 1) { /* if |x| is large, atan(x)~=pi/2 */ + if (isnan(x)) + return x; + return sign ? -atanhi[3] : atanhi[3]; + } + /* Extract the exponent and the first few bits of the mantissa. */ + expman = EXPMAN(u); + if (expman < ((0x3fff - 2) << 8) + 0xc0) { /* |x| < 0.4375 */ + if (e < 0x3fff - (LDBL_MANT_DIG+1)/2) { /* if |x| is small, atanl(x)~=x */ + /* raise underflow if subnormal */ + if (e == 0) + FORCE_EVAL((float)x); + return x; + } + id = -1; + } else { + x = fabsl(x); + if (expman < (0x3fff << 8) + 0x30) { /* |x| < 1.1875 */ + if (expman < ((0x3fff - 1) << 8) + 0x60) { /* 7/16 <= |x| < 11/16 */ + id = 0; + x = (2.0*x-1.0)/(2.0+x); + } else { /* 11/16 <= |x| < 19/16 */ + id = 1; + x = (x-1.0)/(x+1.0); + } + } else { + if (expman < ((0x3fff + 1) << 8) + 0x38) { /* |x| < 2.4375 */ + id = 2; + x = (x-1.5)/(1.0+1.5*x); + } else { /* 2.4375 <= |x| */ + id = 3; + x = -1.0/x; + } + } + } + /* end of argument reduction */ + z = x*x; + w = z*z; + /* break sum aT[i]z**(i+1) into odd and even poly */ + s1 = z*T_even(w); + s2 = w*T_odd(w); + if (id < 0) + return x - x*(s1+s2); + z = atanhi[id] - ((x*(s1+s2) - atanlo[id]) - x); + return sign ? -z : z; +} +#endif diff --git a/lib/libc/src/musl-math/cbrt.c b/lib/libc/src/musl-math/cbrt.c new file mode 100644 index 0000000..7599d3e --- /dev/null +++ b/lib/libc/src/musl-math/cbrt.c @@ -0,0 +1,103 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cbrt.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + * Optimized by Bruce D. Evans. + */ +/* cbrt(x) + * Return cube root of x + */ + +#include <math.h> +#include <stdint.h> + +static const uint32_t +B1 = 715094163, /* B1 = (1023-1023/3-0.03306235651)*2**20 */ +B2 = 696219795; /* B2 = (1023-1023/3-54/3-0.03306235651)*2**20 */ + +/* |1/cbrt(x) - p(x)| < 2**-23.5 (~[-7.93e-8, 7.929e-8]). */ +static const double +P0 = 1.87595182427177009643, /* 0x3ffe03e6, 0x0f61e692 */ +P1 = -1.88497979543377169875, /* 0xbffe28e0, 0x92f02420 */ +P2 = 1.621429720105354466140, /* 0x3ff9f160, 0x4a49d6c2 */ +P3 = -0.758397934778766047437, /* 0xbfe844cb, 0xbee751d9 */ +P4 = 0.145996192886612446982; /* 0x3fc2b000, 0xd4e4edd7 */ + +double cbrt(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t r,s,t,w; + uint32_t hx = u.i>>32 & 0x7fffffff; + + if (hx >= 0x7ff00000) /* cbrt(NaN,INF) is itself */ + return x+x; + + /* + * Rough cbrt to 5 bits: + * cbrt(2**e*(1+m) ~= 2**(e/3)*(1+(e%3+m)/3) + * where e is integral and >= 0, m is real and in [0, 1), and "/" and + * "%" are integer division and modulus with rounding towards minus + * infinity. The RHS is always >= the LHS and has a maximum relative + * error of about 1 in 16. Adding a bias of -0.03306235651 to the + * (e%3+m)/3 term reduces the error to about 1 in 32. With the IEEE + * floating point representation, for finite positive normal values, + * ordinary integer divison of the value in bits magically gives + * almost exactly the RHS of the above provided we first subtract the + * exponent bias (1023 for doubles) and later add it back. We do the + * subtraction virtually to keep e >= 0 so that ordinary integer + * division rounds towards minus infinity; this is also efficient. + */ + if (hx < 0x00100000) { /* zero or subnormal? */ + u.f = x*0x1p54; + hx = u.i>>32 & 0x7fffffff; + if (hx == 0) + return x; /* cbrt(0) is itself */ + hx = hx/3 + B2; + } else + hx = hx/3 + B1; + u.i &= 1ULL<<63; + u.i |= (uint64_t)hx << 32; + t = u.f; + + /* + * New cbrt to 23 bits: + * cbrt(x) = t*cbrt(x/t**3) ~= t*P(t**3/x) + * where P(r) is a polynomial of degree 4 that approximates 1/cbrt(r) + * to within 2**-23.5 when |r - 1| < 1/10. The rough approximation + * has produced t such than |t/cbrt(x) - 1| ~< 1/32, and cubing this + * gives us bounds for r = t**3/x. + * + * Try to optimize for parallel evaluation as in __tanf.c. + */ + r = (t*t)*(t/x); + t = t*((P0+r*(P1+r*P2))+((r*r)*r)*(P3+r*P4)); + + /* + * Round t away from zero to 23 bits (sloppily except for ensuring that + * the result is larger in magnitude than cbrt(x) but not much more than + * 2 23-bit ulps larger). With rounding towards zero, the error bound + * would be ~5/6 instead of ~4/6. With a maximum error of 2 23-bit ulps + * in the rounded t, the infinite-precision error in the Newton + * approximation barely affects third digit in the final error + * 0.667; the error in the rounded t can be up to about 3 23-bit ulps + * before the final error is larger than 0.667 ulps. + */ + u.f = t; + u.i = (u.i + 0x80000000) & 0xffffffffc0000000ULL; + t = u.f; + + /* one step Newton iteration to 53 bits with error < 0.667 ulps */ + s = t*t; /* t*t is exact */ + r = x/s; /* error <= 0.5 ulps; |r| < |t| */ + w = t+t; /* t+t is exact */ + r = (r-t)/(w+r); /* r-t is exact; w+r ~= 3*t */ + t = t+t*r; /* error <= 0.5 + 0.5/3 + epsilon */ + return t; +} diff --git a/lib/libc/src/musl-math/cbrtf.c b/lib/libc/src/musl-math/cbrtf.c new file mode 100644 index 0000000..89c2c86 --- /dev/null +++ b/lib/libc/src/musl-math/cbrtf.c @@ -0,0 +1,66 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cbrtf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Debugged and optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* cbrtf(x) + * Return cube root of x + */ + +#include <math.h> +#include <stdint.h> + +static const unsigned +B1 = 709958130, /* B1 = (127-127.0/3-0.03306235651)*2**23 */ +B2 = 642849266; /* B2 = (127-127.0/3-24/3-0.03306235651)*2**23 */ + +float cbrtf(float x) +{ + double_t r,T; + union {float f; uint32_t i;} u = {x}; + uint32_t hx = u.i & 0x7fffffff; + + if (hx >= 0x7f800000) /* cbrt(NaN,INF) is itself */ + return x + x; + + /* rough cbrt to 5 bits */ + if (hx < 0x00800000) { /* zero or subnormal? */ + if (hx == 0) + return x; /* cbrt(+-0) is itself */ + u.f = x*0x1p24f; + hx = u.i & 0x7fffffff; + hx = hx/3 + B2; + } else + hx = hx/3 + B1; + u.i &= 0x80000000; + u.i |= hx; + + /* + * First step Newton iteration (solving t*t-x/t == 0) to 16 bits. In + * double precision so that its terms can be arranged for efficiency + * without causing overflow or underflow. + */ + T = u.f; + r = T*T*T; + T = T*((double_t)x+x+r)/(x+r+r); + + /* + * Second step Newton iteration to 47 bits. In double precision for + * efficiency and accuracy. + */ + r = T*T*T; + T = T*((double_t)x+x+r)/(x+r+r); + + /* rounding to 24 bits is perfect in round-to-nearest mode */ + return T; +} diff --git a/lib/libc/src/musl-math/cbrtl.c b/lib/libc/src/musl-math/cbrtl.c new file mode 100644 index 0000000..ceff913 --- /dev/null +++ b/lib/libc/src/musl-math/cbrtl.c @@ -0,0 +1,124 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cbrtl.c */ +/*- + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * Copyright (c) 2009-2011, Bruce D. Evans, Steven G. Kargl, David Schultz. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + * The argument reduction and testing for exceptional cases was + * written by Steven G. Kargl with input from Bruce D. Evans + * and David A. Schultz. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double cbrtl(long double x) +{ + return cbrt(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +static const unsigned B1 = 709958130; /* B1 = (127-127.0/3-0.03306235651)*2**23 */ + +long double cbrtl(long double x) +{ + union ldshape u = {x}, v; + union {float f; uint32_t i;} uft; + long double r, s, t, w; + double_t dr, dt, dx; + float_t ft; + int e = u.i.se & 0x7fff; + int sign = u.i.se & 0x8000; + + /* + * If x = +-Inf, then cbrt(x) = +-Inf. + * If x = NaN, then cbrt(x) = NaN. + */ + if (e == 0x7fff) + return x + x; + if (e == 0) { + /* Adjust subnormal numbers. */ + u.f *= 0x1p120; + e = u.i.se & 0x7fff; + /* If x = +-0, then cbrt(x) = +-0. */ + if (e == 0) + return x; + e -= 120; + } + e -= 0x3fff; + u.i.se = 0x3fff; + x = u.f; + switch (e % 3) { + case 1: + case -2: + x *= 2; + e--; + break; + case 2: + case -1: + x *= 4; + e -= 2; + break; + } + v.f = 1.0; + v.i.se = sign | (0x3fff + e/3); + + /* + * The following is the guts of s_cbrtf, with the handling of + * special values removed and extra care for accuracy not taken, + * but with most of the extra accuracy not discarded. + */ + + /* ~5-bit estimate: */ + uft.f = x; + uft.i = (uft.i & 0x7fffffff)/3 + B1; + ft = uft.f; + + /* ~16-bit estimate: */ + dx = x; + dt = ft; + dr = dt * dt * dt; + dt = dt * (dx + dx + dr) / (dx + dr + dr); + + /* ~47-bit estimate: */ + dr = dt * dt * dt; + dt = dt * (dx + dx + dr) / (dx + dr + dr); + +#if LDBL_MANT_DIG == 64 + /* + * dt is cbrtl(x) to ~47 bits (after x has been reduced to 1 <= x < 8). + * Round it away from zero to 32 bits (32 so that t*t is exact, and + * away from zero for technical reasons). + */ + t = dt + (0x1.0p32L + 0x1.0p-31L) - 0x1.0p32; +#elif LDBL_MANT_DIG == 113 + /* + * Round dt away from zero to 47 bits. Since we don't trust the 47, + * add 2 47-bit ulps instead of 1 to round up. Rounding is slow and + * might be avoidable in this case, since on most machines dt will + * have been evaluated in 53-bit precision and the technical reasons + * for rounding up might not apply to either case in cbrtl() since + * dt is much more accurate than needed. + */ + t = dt + 0x2.0p-46 + 0x1.0p60L - 0x1.0p60; +#endif + + /* + * Final step Newton iteration to 64 or 113 bits with + * error < 0.667 ulps + */ + s = t*t; /* t*t is exact */ + r = x/s; /* error <= 0.5 ulps; |r| < |t| */ + w = t+t; /* t+t is exact */ + r = (r-t)/(w+r); /* r-t is exact; w+r ~= 3*t */ + t = t+t*r; /* error <= 0.5 + 0.5/3 + epsilon */ + + t *= v.f; + return t; +} +#endif diff --git a/lib/libc/src/musl-math/ceil.c b/lib/libc/src/musl-math/ceil.c new file mode 100644 index 0000000..b13e6f2 --- /dev/null +++ b/lib/libc/src/musl-math/ceil.c @@ -0,0 +1,31 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const double_t toint = 1/EPS; + +double ceil(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i >> 52 & 0x7ff; + double_t y; + + if (e >= 0x3ff+52 || x == 0) + return x; + /* y = int(x) - x, where int(x) is an integer neighbor of x */ + if (u.i >> 63) + y = x - toint + toint - x; + else + y = x + toint - toint - x; + /* special case because of non-nearest rounding modes */ + if (e <= 0x3ff-1) { + FORCE_EVAL(y); + return u.i >> 63 ? -0.0 : 1; + } + if (y < 0) + return x + y + 1; + return x + y; +} diff --git a/lib/libc/src/musl-math/ceilf.c b/lib/libc/src/musl-math/ceilf.c new file mode 100644 index 0000000..869835f --- /dev/null +++ b/lib/libc/src/musl-math/ceilf.c @@ -0,0 +1,27 @@ +#include "libm.h" + +float ceilf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = (int)(u.i >> 23 & 0xff) - 0x7f; + uint32_t m; + + if (e >= 23) + return x; + if (e >= 0) { + m = 0x007fffff >> e; + if ((u.i & m) == 0) + return x; + FORCE_EVAL(x + 0x1p120f); + if (u.i >> 31 == 0) + u.i += m; + u.i &= ~m; + } else { + FORCE_EVAL(x + 0x1p120f); + if (u.i >> 31) + u.f = -0.0; + else if (u.i << 1) + u.f = 1.0; + } + return u.f; +} diff --git a/lib/libc/src/musl-math/ceill.c b/lib/libc/src/musl-math/ceill.c new file mode 100644 index 0000000..60a8302 --- /dev/null +++ b/lib/libc/src/musl-math/ceill.c @@ -0,0 +1,34 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double ceill(long double x) +{ + return ceil(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double ceill(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1 || x == 0) + return x; + /* y = int(x) - x, where int(x) is an integer neighbor of x */ + if (u.i.se >> 15) + y = x - toint + toint - x; + else + y = x + toint - toint - x; + /* special case because of non-nearest rounding modes */ + if (e <= 0x3fff-1) { + FORCE_EVAL(y); + return u.i.se >> 15 ? -0.0 : 1; + } + if (y < 0) + return x + y + 1; + return x + y; +} +#endif diff --git a/lib/libc/src/musl-math/copysign.c b/lib/libc/src/musl-math/copysign.c new file mode 100644 index 0000000..b09331b --- /dev/null +++ b/lib/libc/src/musl-math/copysign.c @@ -0,0 +1,8 @@ +#include "libm.h" + +double copysign(double x, double y) { + union {double f; uint64_t i;} ux={x}, uy={y}; + ux.i &= -1ULL/2; + ux.i |= uy.i & 1ULL<<63; + return ux.f; +} diff --git a/lib/libc/src/musl-math/copysignf.c b/lib/libc/src/musl-math/copysignf.c new file mode 100644 index 0000000..0af6ae9 --- /dev/null +++ b/lib/libc/src/musl-math/copysignf.c @@ -0,0 +1,10 @@ +#include <math.h> +#include <stdint.h> + +float copysignf(float x, float y) +{ + union {float f; uint32_t i;} ux={x}, uy={y}; + ux.i &= 0x7fffffff; + ux.i |= uy.i & 0x80000000; + return ux.f; +} diff --git a/lib/libc/src/musl-math/copysignl.c b/lib/libc/src/musl-math/copysignl.c new file mode 100644 index 0000000..9dd933c --- /dev/null +++ b/lib/libc/src/musl-math/copysignl.c @@ -0,0 +1,16 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double copysignl(long double x, long double y) +{ + return copysign(x, y); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double copysignl(long double x, long double y) +{ + union ldshape ux = {x}, uy = {y}; + ux.i.se &= 0x7fff; + ux.i.se |= uy.i.se & 0x8000; + return ux.f; +} +#endif diff --git a/lib/libc/src/musl-math/cos.c b/lib/libc/src/musl-math/cos.c new file mode 100644 index 0000000..ee97f68 --- /dev/null +++ b/lib/libc/src/musl-math/cos.c @@ -0,0 +1,77 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cos.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* cos(x) + * Return cosine function of x. + * + * kernel function: + * __sin ... sine function on [-pi/4,pi/4] + * __cos ... cosine function on [-pi/4,pi/4] + * __rem_pio2 ... argument reduction routine + * + * Method. + * Let S,C and T denote the sin, cos and tan respectively on + * [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 + * in [-pi/4 , +pi/4], and let n = k mod 4. + * We have + * + * n sin(x) cos(x) tan(x) + * ---------------------------------------------------------- + * 0 S C T + * 1 C -S -1/T + * 2 -S -C T + * 3 -C S -1/T + * ---------------------------------------------------------- + * + * Special cases: + * Let trig be any of sin, cos, or tan. + * trig(+-INF) is NaN, with signals; + * trig(NaN) is that NaN; + * + * Accuracy: + * TRIG(x) returns trig(x) nearly rounded + */ + +#include "libm.h" + +double cos(double x) +{ + double y[2]; + uint32_t ix; + unsigned n; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* |x| ~< pi/4 */ + if (ix <= 0x3fe921fb) { + if (ix < 0x3e46a09e) { /* |x| < 2**-27 * sqrt(2) */ + /* raise inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + return 1.0; + } + return __cos(x, 0); + } + + /* cos(Inf or NaN) is NaN */ + if (ix >= 0x7ff00000) + return x-x; + + /* argument reduction */ + n = __rem_pio2(x, y); + switch (n&3) { + case 0: return __cos(y[0], y[1]); + case 1: return -__sin(y[0], y[1], 1); + case 2: return -__cos(y[0], y[1]); + default: + return __sin(y[0], y[1], 1); + } +} diff --git a/lib/libc/src/musl-math/cosf.c b/lib/libc/src/musl-math/cosf.c new file mode 100644 index 0000000..23f3e5b --- /dev/null +++ b/lib/libc/src/musl-math/cosf.c @@ -0,0 +1,78 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cosf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* Small multiples of pi/2 rounded to double precision. */ +static const double +c1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ +c2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ +c3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ +c4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + +float cosf(float x) +{ + double y; + uint32_t ix; + unsigned n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x != 0 */ + FORCE_EVAL(x + 0x1p120f); + return 1.0f; + } + return __cosdf(x); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix > 0x4016cbe3) /* |x| ~> 3*pi/4 */ + return -__cosdf(sign ? x+c2pio2 : x-c2pio2); + else { + if (sign) + return __sindf(x + c1pio2); + else + return __sindf(c1pio2 - x); + } + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix > 0x40afeddf) /* |x| ~> 7*pi/4 */ + return __cosdf(sign ? x+c4pio2 : x-c4pio2); + else { + if (sign) + return __sindf(-x - c3pio2); + else + return __sindf(x - c3pio2); + } + } + + /* cos(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x-x; + + /* general argument reduction needed */ + n = __rem_pio2f(x,&y); + switch (n&3) { + case 0: return __cosdf(y); + case 1: return __sindf(-y); + case 2: return -__cosdf(y); + default: + return __sindf(y); + } +} diff --git a/lib/libc/src/musl-math/cosh.c b/lib/libc/src/musl-math/cosh.c new file mode 100644 index 0000000..100f823 --- /dev/null +++ b/lib/libc/src/musl-math/cosh.c @@ -0,0 +1,40 @@ +#include "libm.h" + +/* cosh(x) = (exp(x) + 1/exp(x))/2 + * = 1 + 0.5*(exp(x)-1)*(exp(x)-1)/exp(x) + * = 1 + x*x/2 + o(x^4) + */ +double cosh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + uint32_t w; + double t; + + /* |x| */ + u.i &= (uint64_t)-1/2; + x = u.f; + w = u.i >> 32; + + /* |x| < log(2) */ + if (w < 0x3fe62e42) { + if (w < 0x3ff00000 - (26<<20)) { + /* raise inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + return 1; + } + t = expm1(x); + return 1 + t*t/(2*(1+t)); + } + + /* |x| < log(DBL_MAX) */ + if (w < 0x40862e42) { + t = exp(x); + /* note: if x>log(0x1p26) then the 1/t is not needed */ + return 0.5*(t + 1/t); + } + + /* |x| > log(DBL_MAX) or nan */ + /* note: the result is stored to handle overflow */ + t = __expo2(x); + return t; +} diff --git a/lib/libc/src/musl-math/coshf.c b/lib/libc/src/musl-math/coshf.c new file mode 100644 index 0000000..b09f2ee --- /dev/null +++ b/lib/libc/src/musl-math/coshf.c @@ -0,0 +1,33 @@ +#include "libm.h" + +float coshf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + uint32_t w; + float t; + + /* |x| */ + u.i &= 0x7fffffff; + x = u.f; + w = u.i; + + /* |x| < log(2) */ + if (w < 0x3f317217) { + if (w < 0x3f800000 - (12<<23)) { + FORCE_EVAL(x + 0x1p120f); + return 1; + } + t = expm1f(x); + return 1 + t*t/(2*(1+t)); + } + + /* |x| < log(FLT_MAX) */ + if (w < 0x42b17217) { + t = expf(x); + return 0.5f*(t + 1/t); + } + + /* |x| > log(FLT_MAX) or nan */ + t = __expo2f(x); + return t; +} diff --git a/lib/libc/src/musl-math/coshl.c b/lib/libc/src/musl-math/coshl.c new file mode 100644 index 0000000..06a56fe --- /dev/null +++ b/lib/libc/src/musl-math/coshl.c @@ -0,0 +1,47 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double coshl(long double x) +{ + return cosh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +long double coshl(long double x) +{ + union ldshape u = {x}; + unsigned ex = u.i.se & 0x7fff; + uint32_t w; + long double t; + + /* |x| */ + u.i.se = ex; + x = u.f; + w = u.i.m >> 32; + + /* |x| < log(2) */ + if (ex < 0x3fff-1 || (ex == 0x3fff-1 && w < 0xb17217f7)) { + if (ex < 0x3fff-32) { + FORCE_EVAL(x + 0x1p120f); + return 1; + } + t = expm1l(x); + return 1 + t*t/(2*(1+t)); + } + + /* |x| < log(LDBL_MAX) */ + if (ex < 0x3fff+13 || (ex == 0x3fff+13 && w < 0xb17217f7)) { + t = expl(x); + return 0.5*(t + 1/t); + } + + /* |x| > log(LDBL_MAX) or nan */ + t = expl(0.5*x); + return 0.5*t*t; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double coshl(long double x) +{ + return cosh(x); +} +#endif diff --git a/lib/libc/src/musl-math/cosl.c b/lib/libc/src/musl-math/cosl.c new file mode 100644 index 0000000..79c41c7 --- /dev/null +++ b/lib/libc/src/musl-math/cosl.c @@ -0,0 +1,39 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double cosl(long double x) { + return cos(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double cosl(long double x) +{ + union ldshape u = {x}; + unsigned n; + long double y[2], hi, lo; + + u.i.se &= 0x7fff; + if (u.i.se == 0x7fff) + return x - x; + x = u.f; + if (x < M_PI_4) { + if (u.i.se < 0x3fff - LDBL_MANT_DIG) + /* raise inexact if x!=0 */ + return 1.0 + x; + return __cosl(x, 0); + } + n = __rem_pio2l(x, y); + hi = y[0]; + lo = y[1]; + switch (n & 3) { + case 0: + return __cosl(hi, lo); + case 1: + return -__sinl(hi, lo, 1); + case 2: + return -__cosl(hi, lo); + case 3: + default: + return __sinl(hi, lo, 1); + } +} +#endif diff --git a/lib/libc/src/musl-math/erf.c b/lib/libc/src/musl-math/erf.c new file mode 100644 index 0000000..2f30a29 --- /dev/null +++ b/lib/libc/src/musl-math/erf.c @@ -0,0 +1,273 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_erf.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* double erf(double x) + * double erfc(double x) + * x + * 2 |\ + * erf(x) = --------- | exp(-t*t)dt + * sqrt(pi) \| + * 0 + * + * erfc(x) = 1-erf(x) + * Note that + * erf(-x) = -erf(x) + * erfc(-x) = 2 - erfc(x) + * + * Method: + * 1. For |x| in [0, 0.84375] + * erf(x) = x + x*R(x^2) + * erfc(x) = 1 - erf(x) if x in [-.84375,0.25] + * = 0.5 + ((0.5-x)-x*R) if x in [0.25,0.84375] + * where R = P/Q where P is an odd poly of degree 8 and + * Q is an odd poly of degree 10. + * -57.90 + * | R - (erf(x)-x)/x | <= 2 + * + * + * Remark. The formula is derived by noting + * erf(x) = (2/sqrt(pi))*(x - x^3/3 + x^5/10 - x^7/42 + ....) + * and that + * 2/sqrt(pi) = 1.128379167095512573896158903121545171688 + * is close to one. The interval is chosen because the fix + * point of erf(x) is near 0.6174 (i.e., erf(x)=x when x is + * near 0.6174), and by some experiment, 0.84375 is chosen to + * guarantee the error is less than one ulp for erf. + * + * 2. For |x| in [0.84375,1.25], let s = |x| - 1, and + * c = 0.84506291151 rounded to single (24 bits) + * erf(x) = sign(x) * (c + P1(s)/Q1(s)) + * erfc(x) = (1-c) - P1(s)/Q1(s) if x > 0 + * 1+(c+P1(s)/Q1(s)) if x < 0 + * |P1/Q1 - (erf(|x|)-c)| <= 2**-59.06 + * Remark: here we use the taylor series expansion at x=1. + * erf(1+s) = erf(1) + s*Poly(s) + * = 0.845.. + P1(s)/Q1(s) + * That is, we use rational approximation to approximate + * erf(1+s) - (c = (single)0.84506291151) + * Note that |P1/Q1|< 0.078 for x in [0.84375,1.25] + * where + * P1(s) = degree 6 poly in s + * Q1(s) = degree 6 poly in s + * + * 3. For x in [1.25,1/0.35(~2.857143)], + * erfc(x) = (1/x)*exp(-x*x-0.5625+R1/S1) + * erf(x) = 1 - erfc(x) + * where + * R1(z) = degree 7 poly in z, (z=1/x^2) + * S1(z) = degree 8 poly in z + * + * 4. For x in [1/0.35,28] + * erfc(x) = (1/x)*exp(-x*x-0.5625+R2/S2) if x > 0 + * = 2.0 - (1/x)*exp(-x*x-0.5625+R2/S2) if -6<x<0 + * = 2.0 - tiny (if x <= -6) + * erf(x) = sign(x)*(1.0 - erfc(x)) if x < 6, else + * erf(x) = sign(x)*(1.0 - tiny) + * where + * R2(z) = degree 6 poly in z, (z=1/x^2) + * S2(z) = degree 7 poly in z + * + * Note1: + * To compute exp(-x*x-0.5625+R/S), let s be a single + * precision number and s := x; then + * -x*x = -s*s + (s-x)*(s+x) + * exp(-x*x-0.5626+R/S) = + * exp(-s*s-0.5625)*exp((s-x)*(s+x)+R/S); + * Note2: + * Here 4 and 5 make use of the asymptotic series + * exp(-x*x) + * erfc(x) ~ ---------- * ( 1 + Poly(1/x^2) ) + * x*sqrt(pi) + * We use rational approximation to approximate + * g(s)=f(1/x^2) = log(erfc(x)*x) - x*x + 0.5625 + * Here is the error bound for R1/S1 and R2/S2 + * |R1/S1 - f(x)| < 2**(-62.57) + * |R2/S2 - f(x)| < 2**(-61.52) + * + * 5. For inf > x >= 28 + * erf(x) = sign(x) *(1 - tiny) (raise inexact) + * erfc(x) = tiny*tiny (raise underflow) if x > 0 + * = 2 - tiny if x<0 + * + * 7. Special case: + * erf(0) = 0, erf(inf) = 1, erf(-inf) = -1, + * erfc(0) = 1, erfc(inf) = 0, erfc(-inf) = 2, + * erfc/erf(NaN) is NaN + */ + +#include "libm.h" + +static const double +erx = 8.45062911510467529297e-01, /* 0x3FEB0AC1, 0x60000000 */ +/* + * Coefficients for approximation to erf on [0,0.84375] + */ +efx8 = 1.02703333676410069053e+00, /* 0x3FF06EBA, 0x8214DB69 */ +pp0 = 1.28379167095512558561e-01, /* 0x3FC06EBA, 0x8214DB68 */ +pp1 = -3.25042107247001499370e-01, /* 0xBFD4CD7D, 0x691CB913 */ +pp2 = -2.84817495755985104766e-02, /* 0xBF9D2A51, 0xDBD7194F */ +pp3 = -5.77027029648944159157e-03, /* 0xBF77A291, 0x236668E4 */ +pp4 = -2.37630166566501626084e-05, /* 0xBEF8EAD6, 0x120016AC */ +qq1 = 3.97917223959155352819e-01, /* 0x3FD97779, 0xCDDADC09 */ +qq2 = 6.50222499887672944485e-02, /* 0x3FB0A54C, 0x5536CEBA */ +qq3 = 5.08130628187576562776e-03, /* 0x3F74D022, 0xC4D36B0F */ +qq4 = 1.32494738004321644526e-04, /* 0x3F215DC9, 0x221C1A10 */ +qq5 = -3.96022827877536812320e-06, /* 0xBED09C43, 0x42A26120 */ +/* + * Coefficients for approximation to erf in [0.84375,1.25] + */ +pa0 = -2.36211856075265944077e-03, /* 0xBF6359B8, 0xBEF77538 */ +pa1 = 4.14856118683748331666e-01, /* 0x3FDA8D00, 0xAD92B34D */ +pa2 = -3.72207876035701323847e-01, /* 0xBFD7D240, 0xFBB8C3F1 */ +pa3 = 3.18346619901161753674e-01, /* 0x3FD45FCA, 0x805120E4 */ +pa4 = -1.10894694282396677476e-01, /* 0xBFBC6398, 0x3D3E28EC */ +pa5 = 3.54783043256182359371e-02, /* 0x3FA22A36, 0x599795EB */ +pa6 = -2.16637559486879084300e-03, /* 0xBF61BF38, 0x0A96073F */ +qa1 = 1.06420880400844228286e-01, /* 0x3FBB3E66, 0x18EEE323 */ +qa2 = 5.40397917702171048937e-01, /* 0x3FE14AF0, 0x92EB6F33 */ +qa3 = 7.18286544141962662868e-02, /* 0x3FB2635C, 0xD99FE9A7 */ +qa4 = 1.26171219808761642112e-01, /* 0x3FC02660, 0xE763351F */ +qa5 = 1.36370839120290507362e-02, /* 0x3F8BEDC2, 0x6B51DD1C */ +qa6 = 1.19844998467991074170e-02, /* 0x3F888B54, 0x5735151D */ +/* + * Coefficients for approximation to erfc in [1.25,1/0.35] + */ +ra0 = -9.86494403484714822705e-03, /* 0xBF843412, 0x600D6435 */ +ra1 = -6.93858572707181764372e-01, /* 0xBFE63416, 0xE4BA7360 */ +ra2 = -1.05586262253232909814e+01, /* 0xC0251E04, 0x41B0E726 */ +ra3 = -6.23753324503260060396e+01, /* 0xC04F300A, 0xE4CBA38D */ +ra4 = -1.62396669462573470355e+02, /* 0xC0644CB1, 0x84282266 */ +ra5 = -1.84605092906711035994e+02, /* 0xC067135C, 0xEBCCABB2 */ +ra6 = -8.12874355063065934246e+01, /* 0xC0545265, 0x57E4D2F2 */ +ra7 = -9.81432934416914548592e+00, /* 0xC023A0EF, 0xC69AC25C */ +sa1 = 1.96512716674392571292e+01, /* 0x4033A6B9, 0xBD707687 */ +sa2 = 1.37657754143519042600e+02, /* 0x4061350C, 0x526AE721 */ +sa3 = 4.34565877475229228821e+02, /* 0x407B290D, 0xD58A1A71 */ +sa4 = 6.45387271733267880336e+02, /* 0x40842B19, 0x21EC2868 */ +sa5 = 4.29008140027567833386e+02, /* 0x407AD021, 0x57700314 */ +sa6 = 1.08635005541779435134e+02, /* 0x405B28A3, 0xEE48AE2C */ +sa7 = 6.57024977031928170135e+00, /* 0x401A47EF, 0x8E484A93 */ +sa8 = -6.04244152148580987438e-02, /* 0xBFAEEFF2, 0xEE749A62 */ +/* + * Coefficients for approximation to erfc in [1/.35,28] + */ +rb0 = -9.86494292470009928597e-03, /* 0xBF843412, 0x39E86F4A */ +rb1 = -7.99283237680523006574e-01, /* 0xBFE993BA, 0x70C285DE */ +rb2 = -1.77579549177547519889e+01, /* 0xC031C209, 0x555F995A */ +rb3 = -1.60636384855821916062e+02, /* 0xC064145D, 0x43C5ED98 */ +rb4 = -6.37566443368389627722e+02, /* 0xC083EC88, 0x1375F228 */ +rb5 = -1.02509513161107724954e+03, /* 0xC0900461, 0x6A2E5992 */ +rb6 = -4.83519191608651397019e+02, /* 0xC07E384E, 0x9BDC383F */ +sb1 = 3.03380607434824582924e+01, /* 0x403E568B, 0x261D5190 */ +sb2 = 3.25792512996573918826e+02, /* 0x40745CAE, 0x221B9F0A */ +sb3 = 1.53672958608443695994e+03, /* 0x409802EB, 0x189D5118 */ +sb4 = 3.19985821950859553908e+03, /* 0x40A8FFB7, 0x688C246A */ +sb5 = 2.55305040643316442583e+03, /* 0x40A3F219, 0xCEDF3BE6 */ +sb6 = 4.74528541206955367215e+02, /* 0x407DA874, 0xE79FE763 */ +sb7 = -2.24409524465858183362e+01; /* 0xC03670E2, 0x42712D62 */ + +static double erfc1(double x) +{ + double_t s,P,Q; + + s = fabs(x) - 1; + P = pa0+s*(pa1+s*(pa2+s*(pa3+s*(pa4+s*(pa5+s*pa6))))); + Q = 1+s*(qa1+s*(qa2+s*(qa3+s*(qa4+s*(qa5+s*qa6))))); + return 1 - erx - P/Q; +} + +static double erfc2(uint32_t ix, double x) +{ + double_t s,R,S; + double z; + + if (ix < 0x3ff40000) /* |x| < 1.25 */ + return erfc1(x); + + x = fabs(x); + s = 1/(x*x); + if (ix < 0x4006db6d) { /* |x| < 1/.35 ~ 2.85714 */ + R = ra0+s*(ra1+s*(ra2+s*(ra3+s*(ra4+s*( + ra5+s*(ra6+s*ra7)))))); + S = 1.0+s*(sa1+s*(sa2+s*(sa3+s*(sa4+s*( + sa5+s*(sa6+s*(sa7+s*sa8))))))); + } else { /* |x| > 1/.35 */ + R = rb0+s*(rb1+s*(rb2+s*(rb3+s*(rb4+s*( + rb5+s*rb6))))); + S = 1.0+s*(sb1+s*(sb2+s*(sb3+s*(sb4+s*( + sb5+s*(sb6+s*sb7)))))); + } + z = x; + SET_LOW_WORD(z,0); + return exp(-z*z-0.5625)*exp((z-x)*(z+x)+R/S)/x; +} + +double erf(double x) +{ + double r,s,z,y; + uint32_t ix; + int sign; + + GET_HIGH_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7ff00000) { + /* erf(nan)=nan, erf(+-inf)=+-1 */ + return 1-2*sign + 1/x; + } + if (ix < 0x3feb0000) { /* |x| < 0.84375 */ + if (ix < 0x3e300000) { /* |x| < 2**-28 */ + /* avoid underflow */ + return 0.125*(8*x + efx8*x); + } + z = x*x; + r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4))); + s = 1.0+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5)))); + y = r/s; + return x + x*y; + } + if (ix < 0x40180000) /* 0.84375 <= |x| < 6 */ + y = 1 - erfc2(ix,x); + else + y = 1 - 0x1p-1022; + return sign ? -y : y; +} + +double erfc(double x) +{ + double r,s,z,y; + uint32_t ix; + int sign; + + GET_HIGH_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7ff00000) { + /* erfc(nan)=nan, erfc(+-inf)=0,2 */ + return 2*sign + 1/x; + } + if (ix < 0x3feb0000) { /* |x| < 0.84375 */ + if (ix < 0x3c700000) /* |x| < 2**-56 */ + return 1.0 - x; + z = x*x; + r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4))); + s = 1.0+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5)))); + y = r/s; + if (sign || ix < 0x3fd00000) { /* x < 1/4 */ + return 1.0 - (x+x*y); + } + return 0.5 - (x - 0.5 + x*y); + } + if (ix < 0x403c0000) { /* 0.84375 <= |x| < 28 */ + return sign ? 2 - erfc2(ix,x) : erfc2(ix,x); + } + return sign ? 2 - 0x1p-1022 : 0x1p-1022*0x1p-1022; +} diff --git a/lib/libc/src/musl-math/erff.c b/lib/libc/src/musl-math/erff.c new file mode 100644 index 0000000..ed5f397 --- /dev/null +++ b/lib/libc/src/musl-math/erff.c @@ -0,0 +1,183 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_erff.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +erx = 8.4506291151e-01, /* 0x3f58560b */ +/* + * Coefficients for approximation to erf on [0,0.84375] + */ +efx8 = 1.0270333290e+00, /* 0x3f8375d4 */ +pp0 = 1.2837916613e-01, /* 0x3e0375d4 */ +pp1 = -3.2504209876e-01, /* 0xbea66beb */ +pp2 = -2.8481749818e-02, /* 0xbce9528f */ +pp3 = -5.7702702470e-03, /* 0xbbbd1489 */ +pp4 = -2.3763017452e-05, /* 0xb7c756b1 */ +qq1 = 3.9791721106e-01, /* 0x3ecbbbce */ +qq2 = 6.5022252500e-02, /* 0x3d852a63 */ +qq3 = 5.0813062117e-03, /* 0x3ba68116 */ +qq4 = 1.3249473704e-04, /* 0x390aee49 */ +qq5 = -3.9602282413e-06, /* 0xb684e21a */ +/* + * Coefficients for approximation to erf in [0.84375,1.25] + */ +pa0 = -2.3621185683e-03, /* 0xbb1acdc6 */ +pa1 = 4.1485610604e-01, /* 0x3ed46805 */ +pa2 = -3.7220788002e-01, /* 0xbebe9208 */ +pa3 = 3.1834661961e-01, /* 0x3ea2fe54 */ +pa4 = -1.1089469492e-01, /* 0xbde31cc2 */ +pa5 = 3.5478305072e-02, /* 0x3d1151b3 */ +pa6 = -2.1663755178e-03, /* 0xbb0df9c0 */ +qa1 = 1.0642088205e-01, /* 0x3dd9f331 */ +qa2 = 5.4039794207e-01, /* 0x3f0a5785 */ +qa3 = 7.1828655899e-02, /* 0x3d931ae7 */ +qa4 = 1.2617121637e-01, /* 0x3e013307 */ +qa5 = 1.3637083583e-02, /* 0x3c5f6e13 */ +qa6 = 1.1984500103e-02, /* 0x3c445aa3 */ +/* + * Coefficients for approximation to erfc in [1.25,1/0.35] + */ +ra0 = -9.8649440333e-03, /* 0xbc21a093 */ +ra1 = -6.9385856390e-01, /* 0xbf31a0b7 */ +ra2 = -1.0558626175e+01, /* 0xc128f022 */ +ra3 = -6.2375331879e+01, /* 0xc2798057 */ +ra4 = -1.6239666748e+02, /* 0xc322658c */ +ra5 = -1.8460508728e+02, /* 0xc3389ae7 */ +ra6 = -8.1287437439e+01, /* 0xc2a2932b */ +ra7 = -9.8143291473e+00, /* 0xc11d077e */ +sa1 = 1.9651271820e+01, /* 0x419d35ce */ +sa2 = 1.3765776062e+02, /* 0x4309a863 */ +sa3 = 4.3456588745e+02, /* 0x43d9486f */ +sa4 = 6.4538726807e+02, /* 0x442158c9 */ +sa5 = 4.2900814819e+02, /* 0x43d6810b */ +sa6 = 1.0863500214e+02, /* 0x42d9451f */ +sa7 = 6.5702495575e+00, /* 0x40d23f7c */ +sa8 = -6.0424413532e-02, /* 0xbd777f97 */ +/* + * Coefficients for approximation to erfc in [1/.35,28] + */ +rb0 = -9.8649431020e-03, /* 0xbc21a092 */ +rb1 = -7.9928326607e-01, /* 0xbf4c9dd4 */ +rb2 = -1.7757955551e+01, /* 0xc18e104b */ +rb3 = -1.6063638306e+02, /* 0xc320a2ea */ +rb4 = -6.3756646729e+02, /* 0xc41f6441 */ +rb5 = -1.0250950928e+03, /* 0xc480230b */ +rb6 = -4.8351919556e+02, /* 0xc3f1c275 */ +sb1 = 3.0338060379e+01, /* 0x41f2b459 */ +sb2 = 3.2579251099e+02, /* 0x43a2e571 */ +sb3 = 1.5367296143e+03, /* 0x44c01759 */ +sb4 = 3.1998581543e+03, /* 0x4547fdbb */ +sb5 = 2.5530502930e+03, /* 0x451f90ce */ +sb6 = 4.7452853394e+02, /* 0x43ed43a7 */ +sb7 = -2.2440952301e+01; /* 0xc1b38712 */ + +static float erfc1(float x) +{ + float_t s,P,Q; + + s = fabsf(x) - 1; + P = pa0+s*(pa1+s*(pa2+s*(pa3+s*(pa4+s*(pa5+s*pa6))))); + Q = 1+s*(qa1+s*(qa2+s*(qa3+s*(qa4+s*(qa5+s*qa6))))); + return 1 - erx - P/Q; +} + +static float erfc2(uint32_t ix, float x) +{ + float_t s,R,S; + float z; + + if (ix < 0x3fa00000) /* |x| < 1.25 */ + return erfc1(x); + + x = fabsf(x); + s = 1/(x*x); + if (ix < 0x4036db6d) { /* |x| < 1/0.35 */ + R = ra0+s*(ra1+s*(ra2+s*(ra3+s*(ra4+s*( + ra5+s*(ra6+s*ra7)))))); + S = 1.0f+s*(sa1+s*(sa2+s*(sa3+s*(sa4+s*( + sa5+s*(sa6+s*(sa7+s*sa8))))))); + } else { /* |x| >= 1/0.35 */ + R = rb0+s*(rb1+s*(rb2+s*(rb3+s*(rb4+s*( + rb5+s*rb6))))); + S = 1.0f+s*(sb1+s*(sb2+s*(sb3+s*(sb4+s*( + sb5+s*(sb6+s*sb7)))))); + } + GET_FLOAT_WORD(ix, x); + SET_FLOAT_WORD(z, ix&0xffffe000); + return expf(-z*z - 0.5625f) * expf((z-x)*(z+x) + R/S)/x; +} + +float erff(float x) +{ + float r,s,z,y; + uint32_t ix; + int sign; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7f800000) { + /* erf(nan)=nan, erf(+-inf)=+-1 */ + return 1-2*sign + 1/x; + } + if (ix < 0x3f580000) { /* |x| < 0.84375 */ + if (ix < 0x31800000) { /* |x| < 2**-28 */ + /*avoid underflow */ + return 0.125f*(8*x + efx8*x); + } + z = x*x; + r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4))); + s = 1+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5)))); + y = r/s; + return x + x*y; + } + if (ix < 0x40c00000) /* |x| < 6 */ + y = 1 - erfc2(ix,x); + else + y = 1 - 0x1p-120f; + return sign ? -y : y; +} + +float erfcf(float x) +{ + float r,s,z,y; + uint32_t ix; + int sign; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7f800000) { + /* erfc(nan)=nan, erfc(+-inf)=0,2 */ + return 2*sign + 1/x; + } + + if (ix < 0x3f580000) { /* |x| < 0.84375 */ + if (ix < 0x23800000) /* |x| < 2**-56 */ + return 1.0f - x; + z = x*x; + r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4))); + s = 1.0f+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5)))); + y = r/s; + if (sign || ix < 0x3e800000) /* x < 1/4 */ + return 1.0f - (x+x*y); + return 0.5f - (x - 0.5f + x*y); + } + if (ix < 0x41e00000) { /* |x| < 28 */ + return sign ? 2 - erfc2(ix,x) : erfc2(ix,x); + } + return sign ? 2 - 0x1p-120f : 0x1p-120f*0x1p-120f; +} diff --git a/lib/libc/src/musl-math/erfl.c b/lib/libc/src/musl-math/erfl.c new file mode 100644 index 0000000..e267c23 --- /dev/null +++ b/lib/libc/src/musl-math/erfl.c @@ -0,0 +1,353 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_erfl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* double erf(double x) + * double erfc(double x) + * x + * 2 |\ + * erf(x) = --------- | exp(-t*t)dt + * sqrt(pi) \| + * 0 + * + * erfc(x) = 1-erf(x) + * Note that + * erf(-x) = -erf(x) + * erfc(-x) = 2 - erfc(x) + * + * Method: + * 1. For |x| in [0, 0.84375] + * erf(x) = x + x*R(x^2) + * erfc(x) = 1 - erf(x) if x in [-.84375,0.25] + * = 0.5 + ((0.5-x)-x*R) if x in [0.25,0.84375] + * Remark. The formula is derived by noting + * erf(x) = (2/sqrt(pi))*(x - x^3/3 + x^5/10 - x^7/42 + ....) + * and that + * 2/sqrt(pi) = 1.128379167095512573896158903121545171688 + * is close to one. The interval is chosen because the fix + * point of erf(x) is near 0.6174 (i.e., erf(x)=x when x is + * near 0.6174), and by some experiment, 0.84375 is chosen to + * guarantee the error is less than one ulp for erf. + * + * 2. For |x| in [0.84375,1.25], let s = |x| - 1, and + * c = 0.84506291151 rounded to single (24 bits) + * erf(x) = sign(x) * (c + P1(s)/Q1(s)) + * erfc(x) = (1-c) - P1(s)/Q1(s) if x > 0 + * 1+(c+P1(s)/Q1(s)) if x < 0 + * Remark: here we use the taylor series expansion at x=1. + * erf(1+s) = erf(1) + s*Poly(s) + * = 0.845.. + P1(s)/Q1(s) + * Note that |P1/Q1|< 0.078 for x in [0.84375,1.25] + * + * 3. For x in [1.25,1/0.35(~2.857143)], + * erfc(x) = (1/x)*exp(-x*x-0.5625+R1(z)/S1(z)) + * z=1/x^2 + * erf(x) = 1 - erfc(x) + * + * 4. For x in [1/0.35,107] + * erfc(x) = (1/x)*exp(-x*x-0.5625+R2/S2) if x > 0 + * = 2.0 - (1/x)*exp(-x*x-0.5625+R2(z)/S2(z)) + * if -6.666<x<0 + * = 2.0 - tiny (if x <= -6.666) + * z=1/x^2 + * erf(x) = sign(x)*(1.0 - erfc(x)) if x < 6.666, else + * erf(x) = sign(x)*(1.0 - tiny) + * Note1: + * To compute exp(-x*x-0.5625+R/S), let s be a single + * precision number and s := x; then + * -x*x = -s*s + (s-x)*(s+x) + * exp(-x*x-0.5626+R/S) = + * exp(-s*s-0.5625)*exp((s-x)*(s+x)+R/S); + * Note2: + * Here 4 and 5 make use of the asymptotic series + * exp(-x*x) + * erfc(x) ~ ---------- * ( 1 + Poly(1/x^2) ) + * x*sqrt(pi) + * + * 5. For inf > x >= 107 + * erf(x) = sign(x) *(1 - tiny) (raise inexact) + * erfc(x) = tiny*tiny (raise underflow) if x > 0 + * = 2 - tiny if x<0 + * + * 7. Special case: + * erf(0) = 0, erf(inf) = 1, erf(-inf) = -1, + * erfc(0) = 1, erfc(inf) = 0, erfc(-inf) = 2, + * erfc/erf(NaN) is NaN + */ + + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double erfl(long double x) +{ + return erf(x); +} +long double erfcl(long double x) +{ + return erfc(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +static const long double +erx = 0.845062911510467529296875L, + +/* + * Coefficients for approximation to erf on [0,0.84375] + */ +/* 8 * (2/sqrt(pi) - 1) */ +efx8 = 1.0270333367641005911692712249723613735048E0L, +pp[6] = { + 1.122751350964552113068262337278335028553E6L, + -2.808533301997696164408397079650699163276E6L, + -3.314325479115357458197119660818768924100E5L, + -6.848684465326256109712135497895525446398E4L, + -2.657817695110739185591505062971929859314E3L, + -1.655310302737837556654146291646499062882E2L, +}, +qq[6] = { + 8.745588372054466262548908189000448124232E6L, + 3.746038264792471129367533128637019611485E6L, + 7.066358783162407559861156173539693900031E5L, + 7.448928604824620999413120955705448117056E4L, + 4.511583986730994111992253980546131408924E3L, + 1.368902937933296323345610240009071254014E2L, + /* 1.000000000000000000000000000000000000000E0 */ +}, + +/* + * Coefficients for approximation to erf in [0.84375,1.25] + */ +/* erf(x+1) = 0.845062911510467529296875 + pa(x)/qa(x) + -0.15625 <= x <= +.25 + Peak relative error 8.5e-22 */ +pa[8] = { + -1.076952146179812072156734957705102256059E0L, + 1.884814957770385593365179835059971587220E2L, + -5.339153975012804282890066622962070115606E1L, + 4.435910679869176625928504532109635632618E1L, + 1.683219516032328828278557309642929135179E1L, + -2.360236618396952560064259585299045804293E0L, + 1.852230047861891953244413872297940938041E0L, + 9.394994446747752308256773044667843200719E-2L, +}, +qa[7] = { + 4.559263722294508998149925774781887811255E2L, + 3.289248982200800575749795055149780689738E2L, + 2.846070965875643009598627918383314457912E2L, + 1.398715859064535039433275722017479994465E2L, + 6.060190733759793706299079050985358190726E1L, + 2.078695677795422351040502569964299664233E1L, + 4.641271134150895940966798357442234498546E0L, + /* 1.000000000000000000000000000000000000000E0 */ +}, + +/* + * Coefficients for approximation to erfc in [1.25,1/0.35] + */ +/* erfc(1/x) = x exp (-1/x^2 - 0.5625 + ra(x^2)/sa(x^2)) + 1/2.85711669921875 < 1/x < 1/1.25 + Peak relative error 3.1e-21 */ +ra[] = { + 1.363566591833846324191000679620738857234E-1L, + 1.018203167219873573808450274314658434507E1L, + 1.862359362334248675526472871224778045594E2L, + 1.411622588180721285284945138667933330348E3L, + 5.088538459741511988784440103218342840478E3L, + 8.928251553922176506858267311750789273656E3L, + 7.264436000148052545243018622742770549982E3L, + 2.387492459664548651671894725748959751119E3L, + 2.220916652813908085449221282808458466556E2L, +}, +sa[] = { + -1.382234625202480685182526402169222331847E1L, + -3.315638835627950255832519203687435946482E2L, + -2.949124863912936259747237164260785326692E3L, + -1.246622099070875940506391433635999693661E4L, + -2.673079795851665428695842853070996219632E4L, + -2.880269786660559337358397106518918220991E4L, + -1.450600228493968044773354186390390823713E4L, + -2.874539731125893533960680525192064277816E3L, + -1.402241261419067750237395034116942296027E2L, + /* 1.000000000000000000000000000000000000000E0 */ +}, + +/* + * Coefficients for approximation to erfc in [1/.35,107] + */ +/* erfc(1/x) = x exp (-1/x^2 - 0.5625 + rb(x^2)/sb(x^2)) + 1/6.6666259765625 < 1/x < 1/2.85711669921875 + Peak relative error 4.2e-22 */ +rb[] = { + -4.869587348270494309550558460786501252369E-5L, + -4.030199390527997378549161722412466959403E-3L, + -9.434425866377037610206443566288917589122E-2L, + -9.319032754357658601200655161585539404155E-1L, + -4.273788174307459947350256581445442062291E0L, + -8.842289940696150508373541814064198259278E0L, + -7.069215249419887403187988144752613025255E0L, + -1.401228723639514787920274427443330704764E0L, +}, +sb[] = { + 4.936254964107175160157544545879293019085E-3L, + 1.583457624037795744377163924895349412015E-1L, + 1.850647991850328356622940552450636420484E0L, + 9.927611557279019463768050710008450625415E0L, + 2.531667257649436709617165336779212114570E1L, + 2.869752886406743386458304052862814690045E1L, + 1.182059497870819562441683560749192539345E1L, + /* 1.000000000000000000000000000000000000000E0 */ +}, +/* erfc(1/x) = x exp (-1/x^2 - 0.5625 + rc(x^2)/sc(x^2)) + 1/107 <= 1/x <= 1/6.6666259765625 + Peak relative error 1.1e-21 */ +rc[] = { + -8.299617545269701963973537248996670806850E-5L, + -6.243845685115818513578933902532056244108E-3L, + -1.141667210620380223113693474478394397230E-1L, + -7.521343797212024245375240432734425789409E-1L, + -1.765321928311155824664963633786967602934E0L, + -1.029403473103215800456761180695263439188E0L, +}, +sc[] = { + 8.413244363014929493035952542677768808601E-3L, + 2.065114333816877479753334599639158060979E-1L, + 1.639064941530797583766364412782135680148E0L, + 4.936788463787115555582319302981666347450E0L, + 5.005177727208955487404729933261347679090E0L, + /* 1.000000000000000000000000000000000000000E0 */ +}; + +static long double erfc1(long double x) +{ + long double s,P,Q; + + s = fabsl(x) - 1; + P = pa[0] + s * (pa[1] + s * (pa[2] + + s * (pa[3] + s * (pa[4] + s * (pa[5] + s * (pa[6] + s * pa[7])))))); + Q = qa[0] + s * (qa[1] + s * (qa[2] + + s * (qa[3] + s * (qa[4] + s * (qa[5] + s * (qa[6] + s)))))); + return 1 - erx - P / Q; +} + +static long double erfc2(uint32_t ix, long double x) +{ + union ldshape u; + long double s,z,R,S; + + if (ix < 0x3fffa000) /* 0.84375 <= |x| < 1.25 */ + return erfc1(x); + + x = fabsl(x); + s = 1 / (x * x); + if (ix < 0x4000b6db) { /* 1.25 <= |x| < 2.857 ~ 1/.35 */ + R = ra[0] + s * (ra[1] + s * (ra[2] + s * (ra[3] + s * (ra[4] + + s * (ra[5] + s * (ra[6] + s * (ra[7] + s * ra[8]))))))); + S = sa[0] + s * (sa[1] + s * (sa[2] + s * (sa[3] + s * (sa[4] + + s * (sa[5] + s * (sa[6] + s * (sa[7] + s * (sa[8] + s)))))))); + } else if (ix < 0x4001d555) { /* 2.857 <= |x| < 6.6666259765625 */ + R = rb[0] + s * (rb[1] + s * (rb[2] + s * (rb[3] + s * (rb[4] + + s * (rb[5] + s * (rb[6] + s * rb[7])))))); + S = sb[0] + s * (sb[1] + s * (sb[2] + s * (sb[3] + s * (sb[4] + + s * (sb[5] + s * (sb[6] + s)))))); + } else { /* 6.666 <= |x| < 107 (erfc only) */ + R = rc[0] + s * (rc[1] + s * (rc[2] + s * (rc[3] + + s * (rc[4] + s * rc[5])))); + S = sc[0] + s * (sc[1] + s * (sc[2] + s * (sc[3] + + s * (sc[4] + s)))); + } + u.f = x; + u.i.m &= -1ULL << 40; + z = u.f; + return expl(-z*z - 0.5625) * expl((z - x) * (z + x) + R / S) / x; +} + +long double erfl(long double x) +{ + long double r, s, z, y; + union ldshape u = {x}; + uint32_t ix = (u.i.se & 0x7fffU)<<16 | u.i.m>>48; + int sign = u.i.se >> 15; + + if (ix >= 0x7fff0000) + /* erf(nan)=nan, erf(+-inf)=+-1 */ + return 1 - 2*sign + 1/x; + if (ix < 0x3ffed800) { /* |x| < 0.84375 */ + if (ix < 0x3fde8000) { /* |x| < 2**-33 */ + return 0.125 * (8 * x + efx8 * x); /* avoid underflow */ + } + z = x * x; + r = pp[0] + z * (pp[1] + + z * (pp[2] + z * (pp[3] + z * (pp[4] + z * pp[5])))); + s = qq[0] + z * (qq[1] + + z * (qq[2] + z * (qq[3] + z * (qq[4] + z * (qq[5] + z))))); + y = r / s; + return x + x * y; + } + if (ix < 0x4001d555) /* |x| < 6.6666259765625 */ + y = 1 - erfc2(ix,x); + else + y = 1 - 0x1p-16382L; + return sign ? -y : y; +} + +long double erfcl(long double x) +{ + long double r, s, z, y; + union ldshape u = {x}; + uint32_t ix = (u.i.se & 0x7fffU)<<16 | u.i.m>>48; + int sign = u.i.se >> 15; + + if (ix >= 0x7fff0000) + /* erfc(nan) = nan, erfc(+-inf) = 0,2 */ + return 2*sign + 1/x; + if (ix < 0x3ffed800) { /* |x| < 0.84375 */ + if (ix < 0x3fbe0000) /* |x| < 2**-65 */ + return 1.0 - x; + z = x * x; + r = pp[0] + z * (pp[1] + + z * (pp[2] + z * (pp[3] + z * (pp[4] + z * pp[5])))); + s = qq[0] + z * (qq[1] + + z * (qq[2] + z * (qq[3] + z * (qq[4] + z * (qq[5] + z))))); + y = r / s; + if (ix < 0x3ffd8000) /* x < 1/4 */ + return 1.0 - (x + x * y); + return 0.5 - (x - 0.5 + x * y); + } + if (ix < 0x4005d600) /* |x| < 107 */ + return sign ? 2 - erfc2(ix,x) : erfc2(ix,x); + y = 0x1p-16382L; + return sign ? 2 - y : y*y; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double erfl(long double x) +{ + return erf(x); +} +long double erfcl(long double x) +{ + return erfc(x); +} +#endif diff --git a/lib/libc/src/musl-math/exp.c b/lib/libc/src/musl-math/exp.c new file mode 100644 index 0000000..9ea672f --- /dev/null +++ b/lib/libc/src/musl-math/exp.c @@ -0,0 +1,134 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_exp.c */ +/* + * ==================================================== + * Copyright (C) 2004 by Sun Microsystems, Inc. All rights reserved. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* exp(x) + * Returns the exponential of x. + * + * Method + * 1. Argument reduction: + * Reduce x to an r so that |r| <= 0.5*ln2 ~ 0.34658. + * Given x, find r and integer k such that + * + * x = k*ln2 + r, |r| <= 0.5*ln2. + * + * Here r will be represented as r = hi-lo for better + * accuracy. + * + * 2. Approximation of exp(r) by a special rational function on + * the interval [0,0.34658]: + * Write + * R(r**2) = r*(exp(r)+1)/(exp(r)-1) = 2 + r*r/6 - r**4/360 + ... + * We use a special Remez algorithm on [0,0.34658] to generate + * a polynomial of degree 5 to approximate R. The maximum error + * of this polynomial approximation is bounded by 2**-59. In + * other words, + * R(z) ~ 2.0 + P1*z + P2*z**2 + P3*z**3 + P4*z**4 + P5*z**5 + * (where z=r*r, and the values of P1 to P5 are listed below) + * and + * | 5 | -59 + * | 2.0+P1*z+...+P5*z - R(z) | <= 2 + * | | + * The computation of exp(r) thus becomes + * 2*r + * exp(r) = 1 + ---------- + * R(r) - r + * r*c(r) + * = 1 + r + ----------- (for better accuracy) + * 2 - c(r) + * where + * 2 4 10 + * c(r) = r - (P1*r + P2*r + ... + P5*r ). + * + * 3. Scale back to obtain exp(x): + * From step 1, we have + * exp(x) = 2^k * exp(r) + * + * Special cases: + * exp(INF) is INF, exp(NaN) is NaN; + * exp(-INF) is 0, and + * for finite argument, only exp(0)=1 is exact. + * + * Accuracy: + * according to an error analysis, the error is always less than + * 1 ulp (unit in the last place). + * + * Misc. info. + * For IEEE double + * if x > 709.782712893383973096 then exp(x) overflows + * if x < -745.133219101941108420 then exp(x) underflows + */ + +#include "libm.h" + +static const double +half[2] = {0.5,-0.5}, +ln2hi = 6.93147180369123816490e-01, /* 0x3fe62e42, 0xfee00000 */ +ln2lo = 1.90821492927058770002e-10, /* 0x3dea39ef, 0x35793c76 */ +invln2 = 1.44269504088896338700e+00, /* 0x3ff71547, 0x652b82fe */ +P1 = 1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */ +P2 = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */ +P3 = 6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */ +P4 = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */ +P5 = 4.13813679705723846039e-08; /* 0x3E663769, 0x72BEA4D0 */ + +double exp(double x) +{ + double_t hi, lo, c, xx, y; + int k, sign; + uint32_t hx; + + GET_HIGH_WORD(hx, x); + sign = hx>>31; + hx &= 0x7fffffff; /* high word of |x| */ + + /* special cases */ + if (hx >= 0x4086232b) { /* if |x| >= 708.39... */ + if (isnan(x)) + return x; + if (x > 709.782712893383973096) { + /* overflow if x!=inf */ + x *= 0x1p1023; + return x; + } + if (x < -708.39641853226410622) { + /* underflow if x!=-inf */ + FORCE_EVAL((float)(-0x1p-149/x)); + if (x < -745.13321910194110842) + return 0; + } + } + + /* argument reduction */ + if (hx > 0x3fd62e42) { /* if |x| > 0.5 ln2 */ + if (hx >= 0x3ff0a2b2) /* if |x| >= 1.5 ln2 */ + k = (int)(invln2*x + half[sign]); + else + k = 1 - sign - sign; + hi = x - k*ln2hi; /* k*ln2hi is exact here */ + lo = k*ln2lo; + x = hi - lo; + } else if (hx > 0x3e300000) { /* if |x| > 2**-28 */ + k = 0; + hi = x; + lo = 0; + } else { + /* inexact if x!=0 */ + FORCE_EVAL(0x1p1023 + x); + return 1 + x; + } + + /* x is now in primary range */ + xx = x*x; + c = x - xx*(P1+xx*(P2+xx*(P3+xx*(P4+xx*P5)))); + y = 1 + (x*c/(2-c) - lo + hi); + if (k == 0) + return y; + return scalbn(y, k); +} diff --git a/lib/libc/src/musl-math/exp10.c b/lib/libc/src/musl-math/exp10.c new file mode 100644 index 0000000..47b4dc7 --- /dev/null +++ b/lib/libc/src/musl-math/exp10.c @@ -0,0 +1,26 @@ +#define _GNU_SOURCE +#include <math.h> +#include <stdint.h> +#include "weak_alias.h" +//#include "libc.h" + +double exp10(double x) +{ + static const double p10[] = { + 1e-15, 1e-14, 1e-13, 1e-12, 1e-11, 1e-10, + 1e-9, 1e-8, 1e-7, 1e-6, 1e-5, 1e-4, 1e-3, 1e-2, 1e-1, + 1, 1e1, 1e2, 1e3, 1e4, 1e5, 1e6, 1e7, 1e8, 1e9, + 1e10, 1e11, 1e12, 1e13, 1e14, 1e15 + }; + double n, y = modf(x, &n); + union {double f; uint64_t i;} u = {n}; + /* fabs(n) < 16 without raising invalid on nan */ + if ((u.i>>52 & 0x7ff) < 0x3ff+4) { + if (!y) return p10[(int)n+15]; + y = exp2(3.32192809488736234787031942948939 * y); + return y * p10[(int)n+15]; + } + return pow(10.0, x); +} + +weak_alias(exp10, pow10); diff --git a/lib/libc/src/musl-math/exp10f.c b/lib/libc/src/musl-math/exp10f.c new file mode 100644 index 0000000..74f8909 --- /dev/null +++ b/lib/libc/src/musl-math/exp10f.c @@ -0,0 +1,24 @@ +#define _GNU_SOURCE +#include <math.h> +#include <stdint.h> +#include "weak_alias.h" +//#include "libc.h" + +float exp10f(float x) +{ + static const float p10[] = { + 1e-7f, 1e-6f, 1e-5f, 1e-4f, 1e-3f, 1e-2f, 1e-1f, + 1, 1e1, 1e2, 1e3, 1e4, 1e5, 1e6, 1e7 + }; + float n, y = modff(x, &n); + union {float f; uint32_t i;} u = {n}; + /* fabsf(n) < 8 without raising invalid on nan */ + if ((u.i>>23 & 0xff) < 0x7f+3) { + if (!y) return p10[(int)n+7]; + y = exp2f(3.32192809488736234787031942948939f * y); + return y * p10[(int)n+7]; + } + return exp2(3.32192809488736234787031942948939 * x); +} + +weak_alias(exp10f, pow10f); diff --git a/lib/libc/src/musl-math/exp10l.c b/lib/libc/src/musl-math/exp10l.c new file mode 100644 index 0000000..f18e554 --- /dev/null +++ b/lib/libc/src/musl-math/exp10l.c @@ -0,0 +1,34 @@ +#define _GNU_SOURCE +#include <float.h> +#include <math.h> +//#include "libc.h" +#include "libm.h" +#include "weak_alias.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double exp10l(long double x) +{ + return exp10(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double exp10l(long double x) +{ + static const long double p10[] = { + 1e-15L, 1e-14L, 1e-13L, 1e-12L, 1e-11L, 1e-10L, + 1e-9L, 1e-8L, 1e-7L, 1e-6L, 1e-5L, 1e-4L, 1e-3L, 1e-2L, 1e-1L, + 1, 1e1, 1e2, 1e3, 1e4, 1e5, 1e6, 1e7, 1e8, 1e9, + 1e10, 1e11, 1e12, 1e13, 1e14, 1e15 + }; + long double n, y = modfl(x, &n); + union ldshape u = {n}; + /* fabsl(n) < 16 without raising invalid on nan */ + if ((u.i.se & 0x7fff) < 0x3fff+4) { + if (!y) return p10[(int)n+15]; + y = exp2l(3.32192809488736234787031942948939L * y); + return y * p10[(int)n+15]; + } + return powl(10.0, x); +} +#endif + +weak_alias(exp10l, pow10l); diff --git a/lib/libc/src/musl-math/exp2.c b/lib/libc/src/musl-math/exp2.c new file mode 100644 index 0000000..e14adba --- /dev/null +++ b/lib/libc/src/musl-math/exp2.c @@ -0,0 +1,375 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_exp2.c */ +/*- + * Copyright (c) 2005 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#include "libm.h" + +#define TBLSIZE 256 + +static const double +redux = 0x1.8p52 / TBLSIZE, +P1 = 0x1.62e42fefa39efp-1, +P2 = 0x1.ebfbdff82c575p-3, +P3 = 0x1.c6b08d704a0a6p-5, +P4 = 0x1.3b2ab88f70400p-7, +P5 = 0x1.5d88003875c74p-10; + +static const double tbl[TBLSIZE * 2] = { +/* exp2(z + eps) eps */ + 0x1.6a09e667f3d5dp-1, 0x1.9880p-44, + 0x1.6b052fa751744p-1, 0x1.8000p-50, + 0x1.6c012750bd9fep-1, -0x1.8780p-45, + 0x1.6cfdcddd476bfp-1, 0x1.ec00p-46, + 0x1.6dfb23c651a29p-1, -0x1.8000p-50, + 0x1.6ef9298593ae3p-1, -0x1.c000p-52, + 0x1.6ff7df9519386p-1, -0x1.fd80p-45, + 0x1.70f7466f42da3p-1, -0x1.c880p-45, + 0x1.71f75e8ec5fc3p-1, 0x1.3c00p-46, + 0x1.72f8286eacf05p-1, -0x1.8300p-44, + 0x1.73f9a48a58152p-1, -0x1.0c00p-47, + 0x1.74fbd35d7ccfcp-1, 0x1.f880p-45, + 0x1.75feb564267f1p-1, 0x1.3e00p-47, + 0x1.77024b1ab6d48p-1, -0x1.7d00p-45, + 0x1.780694fde5d38p-1, -0x1.d000p-50, + 0x1.790b938ac1d00p-1, 0x1.3000p-49, + 0x1.7a11473eb0178p-1, -0x1.d000p-49, + 0x1.7b17b0976d060p-1, 0x1.0400p-45, + 0x1.7c1ed0130c133p-1, 0x1.0000p-53, + 0x1.7d26a62ff8636p-1, -0x1.6900p-45, + 0x1.7e2f336cf4e3bp-1, -0x1.2e00p-47, + 0x1.7f3878491c3e8p-1, -0x1.4580p-45, + 0x1.80427543e1b4ep-1, 0x1.3000p-44, + 0x1.814d2add1071ap-1, 0x1.f000p-47, + 0x1.82589994ccd7ep-1, -0x1.1c00p-45, + 0x1.8364c1eb942d0p-1, 0x1.9d00p-45, + 0x1.8471a4623cab5p-1, 0x1.7100p-43, + 0x1.857f4179f5bbcp-1, 0x1.2600p-45, + 0x1.868d99b4491afp-1, -0x1.2c40p-44, + 0x1.879cad931a395p-1, -0x1.3000p-45, + 0x1.88ac7d98a65b8p-1, -0x1.a800p-45, + 0x1.89bd0a4785800p-1, -0x1.d000p-49, + 0x1.8ace5422aa223p-1, 0x1.3280p-44, + 0x1.8be05bad619fap-1, 0x1.2b40p-43, + 0x1.8cf3216b54383p-1, -0x1.ed00p-45, + 0x1.8e06a5e08664cp-1, -0x1.0500p-45, + 0x1.8f1ae99157807p-1, 0x1.8280p-45, + 0x1.902fed0282c0ep-1, -0x1.cb00p-46, + 0x1.9145b0b91ff96p-1, -0x1.5e00p-47, + 0x1.925c353aa2ff9p-1, 0x1.5400p-48, + 0x1.93737b0cdc64ap-1, 0x1.7200p-46, + 0x1.948b82b5f98aep-1, -0x1.9000p-47, + 0x1.95a44cbc852cbp-1, 0x1.5680p-45, + 0x1.96bdd9a766f21p-1, -0x1.6d00p-44, + 0x1.97d829fde4e2ap-1, -0x1.1000p-47, + 0x1.98f33e47a23a3p-1, 0x1.d000p-45, + 0x1.9a0f170ca0604p-1, -0x1.8a40p-44, + 0x1.9b2bb4d53ff89p-1, 0x1.55c0p-44, + 0x1.9c49182a3f15bp-1, 0x1.6b80p-45, + 0x1.9d674194bb8c5p-1, -0x1.c000p-49, + 0x1.9e86319e3238ep-1, 0x1.7d00p-46, + 0x1.9fa5e8d07f302p-1, 0x1.6400p-46, + 0x1.a0c667b5de54dp-1, -0x1.5000p-48, + 0x1.a1e7aed8eb8f6p-1, 0x1.9e00p-47, + 0x1.a309bec4a2e27p-1, 0x1.ad80p-45, + 0x1.a42c980460a5dp-1, -0x1.af00p-46, + 0x1.a5503b23e259bp-1, 0x1.b600p-47, + 0x1.a674a8af46213p-1, 0x1.8880p-44, + 0x1.a799e1330b3a7p-1, 0x1.1200p-46, + 0x1.a8bfe53c12e8dp-1, 0x1.6c00p-47, + 0x1.a9e6b5579fcd2p-1, -0x1.9b80p-45, + 0x1.ab0e521356fb8p-1, 0x1.b700p-45, + 0x1.ac36bbfd3f381p-1, 0x1.9000p-50, + 0x1.ad5ff3a3c2780p-1, 0x1.4000p-49, + 0x1.ae89f995ad2a3p-1, -0x1.c900p-45, + 0x1.afb4ce622f367p-1, 0x1.6500p-46, + 0x1.b0e07298db790p-1, 0x1.fd40p-45, + 0x1.b20ce6c9a89a9p-1, 0x1.2700p-46, + 0x1.b33a2b84f1a4bp-1, 0x1.d470p-43, + 0x1.b468415b747e7p-1, -0x1.8380p-44, + 0x1.b59728de5593ap-1, 0x1.8000p-54, + 0x1.b6c6e29f1c56ap-1, 0x1.ad00p-47, + 0x1.b7f76f2fb5e50p-1, 0x1.e800p-50, + 0x1.b928cf22749b2p-1, -0x1.4c00p-47, + 0x1.ba5b030a10603p-1, -0x1.d700p-47, + 0x1.bb8e0b79a6f66p-1, 0x1.d900p-47, + 0x1.bcc1e904bc1ffp-1, 0x1.2a00p-47, + 0x1.bdf69c3f3a16fp-1, -0x1.f780p-46, + 0x1.bf2c25bd71db8p-1, -0x1.0a00p-46, + 0x1.c06286141b2e9p-1, -0x1.1400p-46, + 0x1.c199bdd8552e0p-1, 0x1.be00p-47, + 0x1.c2d1cd9fa64eep-1, -0x1.9400p-47, + 0x1.c40ab5fffd02fp-1, -0x1.ed00p-47, + 0x1.c544778fafd15p-1, 0x1.9660p-44, + 0x1.c67f12e57d0cbp-1, -0x1.a100p-46, + 0x1.c7ba88988c1b6p-1, -0x1.8458p-42, + 0x1.c8f6d9406e733p-1, -0x1.a480p-46, + 0x1.ca3405751c4dfp-1, 0x1.b000p-51, + 0x1.cb720dcef9094p-1, 0x1.1400p-47, + 0x1.ccb0f2e6d1689p-1, 0x1.0200p-48, + 0x1.cdf0b555dc412p-1, 0x1.3600p-48, + 0x1.cf3155b5bab3bp-1, -0x1.6900p-47, + 0x1.d072d4a0789bcp-1, 0x1.9a00p-47, + 0x1.d1b532b08c8fap-1, -0x1.5e00p-46, + 0x1.d2f87080d8a85p-1, 0x1.d280p-46, + 0x1.d43c8eacaa203p-1, 0x1.1a00p-47, + 0x1.d5818dcfba491p-1, 0x1.f000p-50, + 0x1.d6c76e862e6a1p-1, -0x1.3a00p-47, + 0x1.d80e316c9834ep-1, -0x1.cd80p-47, + 0x1.d955d71ff6090p-1, 0x1.4c00p-48, + 0x1.da9e603db32aep-1, 0x1.f900p-48, + 0x1.dbe7cd63a8325p-1, 0x1.9800p-49, + 0x1.dd321f301b445p-1, -0x1.5200p-48, + 0x1.de7d5641c05bfp-1, -0x1.d700p-46, + 0x1.dfc97337b9aecp-1, -0x1.6140p-46, + 0x1.e11676b197d5ep-1, 0x1.b480p-47, + 0x1.e264614f5a3e7p-1, 0x1.0ce0p-43, + 0x1.e3b333b16ee5cp-1, 0x1.c680p-47, + 0x1.e502ee78b3fb4p-1, -0x1.9300p-47, + 0x1.e653924676d68p-1, -0x1.5000p-49, + 0x1.e7a51fbc74c44p-1, -0x1.7f80p-47, + 0x1.e8f7977cdb726p-1, -0x1.3700p-48, + 0x1.ea4afa2a490e8p-1, 0x1.5d00p-49, + 0x1.eb9f4867ccae4p-1, 0x1.61a0p-46, + 0x1.ecf482d8e680dp-1, 0x1.5500p-48, + 0x1.ee4aaa2188514p-1, 0x1.6400p-51, + 0x1.efa1bee615a13p-1, -0x1.e800p-49, + 0x1.f0f9c1cb64106p-1, -0x1.a880p-48, + 0x1.f252b376bb963p-1, -0x1.c900p-45, + 0x1.f3ac948dd7275p-1, 0x1.a000p-53, + 0x1.f50765b6e4524p-1, -0x1.4f00p-48, + 0x1.f6632798844fdp-1, 0x1.a800p-51, + 0x1.f7bfdad9cbe38p-1, 0x1.abc0p-48, + 0x1.f91d802243c82p-1, -0x1.4600p-50, + 0x1.fa7c1819e908ep-1, -0x1.b0c0p-47, + 0x1.fbdba3692d511p-1, -0x1.0e00p-51, + 0x1.fd3c22b8f7194p-1, -0x1.0de8p-46, + 0x1.fe9d96b2a23eep-1, 0x1.e430p-49, + 0x1.0000000000000p+0, 0x0.0000p+0, + 0x1.00b1afa5abcbep+0, -0x1.3400p-52, + 0x1.0163da9fb3303p+0, -0x1.2170p-46, + 0x1.02168143b0282p+0, 0x1.a400p-52, + 0x1.02c9a3e77806cp+0, 0x1.f980p-49, + 0x1.037d42e11bbcap+0, -0x1.7400p-51, + 0x1.04315e86e7f89p+0, 0x1.8300p-50, + 0x1.04e5f72f65467p+0, -0x1.a3f0p-46, + 0x1.059b0d315855ap+0, -0x1.2840p-47, + 0x1.0650a0e3c1f95p+0, 0x1.1600p-48, + 0x1.0706b29ddf71ap+0, 0x1.5240p-46, + 0x1.07bd42b72a82dp+0, -0x1.9a00p-49, + 0x1.0874518759bd0p+0, 0x1.6400p-49, + 0x1.092bdf66607c8p+0, -0x1.0780p-47, + 0x1.09e3ecac6f383p+0, -0x1.8000p-54, + 0x1.0a9c79b1f3930p+0, 0x1.fa00p-48, + 0x1.0b5586cf988fcp+0, -0x1.ac80p-48, + 0x1.0c0f145e46c8ap+0, 0x1.9c00p-50, + 0x1.0cc922b724816p+0, 0x1.5200p-47, + 0x1.0d83b23395dd8p+0, -0x1.ad00p-48, + 0x1.0e3ec32d3d1f3p+0, 0x1.bac0p-46, + 0x1.0efa55fdfa9a6p+0, -0x1.4e80p-47, + 0x1.0fb66affed2f0p+0, -0x1.d300p-47, + 0x1.1073028d7234bp+0, 0x1.1500p-48, + 0x1.11301d0125b5bp+0, 0x1.c000p-49, + 0x1.11edbab5e2af9p+0, 0x1.6bc0p-46, + 0x1.12abdc06c31d5p+0, 0x1.8400p-49, + 0x1.136a814f2047dp+0, -0x1.ed00p-47, + 0x1.1429aaea92de9p+0, 0x1.8e00p-49, + 0x1.14e95934f3138p+0, 0x1.b400p-49, + 0x1.15a98c8a58e71p+0, 0x1.5300p-47, + 0x1.166a45471c3dfp+0, 0x1.3380p-47, + 0x1.172b83c7d5211p+0, 0x1.8d40p-45, + 0x1.17ed48695bb9fp+0, -0x1.5d00p-47, + 0x1.18af9388c8d93p+0, -0x1.c880p-46, + 0x1.1972658375d66p+0, 0x1.1f00p-46, + 0x1.1a35beb6fcba7p+0, 0x1.0480p-46, + 0x1.1af99f81387e3p+0, -0x1.7390p-43, + 0x1.1bbe084045d54p+0, 0x1.4e40p-45, + 0x1.1c82f95281c43p+0, -0x1.a200p-47, + 0x1.1d4873168b9b2p+0, 0x1.3800p-49, + 0x1.1e0e75eb44031p+0, 0x1.ac00p-49, + 0x1.1ed5022fcd938p+0, 0x1.1900p-47, + 0x1.1f9c18438cdf7p+0, -0x1.b780p-46, + 0x1.2063b88628d8fp+0, 0x1.d940p-45, + 0x1.212be3578a81ep+0, 0x1.8000p-50, + 0x1.21f49917ddd41p+0, 0x1.b340p-45, + 0x1.22bdda2791323p+0, 0x1.9f80p-46, + 0x1.2387a6e7561e7p+0, -0x1.9c80p-46, + 0x1.2451ffb821427p+0, 0x1.2300p-47, + 0x1.251ce4fb2a602p+0, -0x1.3480p-46, + 0x1.25e85711eceb0p+0, 0x1.2700p-46, + 0x1.26b4565e27d16p+0, 0x1.1d00p-46, + 0x1.2780e341de00fp+0, 0x1.1ee0p-44, + 0x1.284dfe1f5633ep+0, -0x1.4c00p-46, + 0x1.291ba7591bb30p+0, -0x1.3d80p-46, + 0x1.29e9df51fdf09p+0, 0x1.8b00p-47, + 0x1.2ab8a66d10e9bp+0, -0x1.27c0p-45, + 0x1.2b87fd0dada3ap+0, 0x1.a340p-45, + 0x1.2c57e39771af9p+0, -0x1.0800p-46, + 0x1.2d285a6e402d9p+0, -0x1.ed00p-47, + 0x1.2df961f641579p+0, -0x1.4200p-48, + 0x1.2ecafa93e2ecfp+0, -0x1.4980p-45, + 0x1.2f9d24abd8822p+0, -0x1.6300p-46, + 0x1.306fe0a31b625p+0, -0x1.2360p-44, + 0x1.31432edeea50bp+0, -0x1.0df8p-40, + 0x1.32170fc4cd7b8p+0, -0x1.2480p-45, + 0x1.32eb83ba8e9a2p+0, -0x1.5980p-45, + 0x1.33c08b2641766p+0, 0x1.ed00p-46, + 0x1.3496266e3fa27p+0, -0x1.c000p-50, + 0x1.356c55f929f0fp+0, -0x1.0d80p-44, + 0x1.36431a2de88b9p+0, 0x1.2c80p-45, + 0x1.371a7373aaa39p+0, 0x1.0600p-45, + 0x1.37f26231e74fep+0, -0x1.6600p-46, + 0x1.38cae6d05d838p+0, -0x1.ae00p-47, + 0x1.39a401b713ec3p+0, -0x1.4720p-43, + 0x1.3a7db34e5a020p+0, 0x1.8200p-47, + 0x1.3b57fbfec6e95p+0, 0x1.e800p-44, + 0x1.3c32dc313a8f2p+0, 0x1.f800p-49, + 0x1.3d0e544ede122p+0, -0x1.7a00p-46, + 0x1.3dea64c1234bbp+0, 0x1.6300p-45, + 0x1.3ec70df1c4eccp+0, -0x1.8a60p-43, + 0x1.3fa4504ac7e8cp+0, -0x1.cdc0p-44, + 0x1.40822c367a0bbp+0, 0x1.5b80p-45, + 0x1.4160a21f72e95p+0, 0x1.ec00p-46, + 0x1.423fb27094646p+0, -0x1.3600p-46, + 0x1.431f5d950a920p+0, 0x1.3980p-45, + 0x1.43ffa3f84b9ebp+0, 0x1.a000p-48, + 0x1.44e0860618919p+0, -0x1.6c00p-48, + 0x1.45c2042a7d201p+0, -0x1.bc00p-47, + 0x1.46a41ed1d0016p+0, -0x1.2800p-46, + 0x1.4786d668b3326p+0, 0x1.0e00p-44, + 0x1.486a2b5c13c00p+0, -0x1.d400p-45, + 0x1.494e1e192af04p+0, 0x1.c200p-47, + 0x1.4a32af0d7d372p+0, -0x1.e500p-46, + 0x1.4b17dea6db801p+0, 0x1.7800p-47, + 0x1.4bfdad53629e1p+0, -0x1.3800p-46, + 0x1.4ce41b817c132p+0, 0x1.0800p-47, + 0x1.4dcb299fddddbp+0, 0x1.c700p-45, + 0x1.4eb2d81d8ab96p+0, -0x1.ce00p-46, + 0x1.4f9b2769d2d02p+0, 0x1.9200p-46, + 0x1.508417f4531c1p+0, -0x1.8c00p-47, + 0x1.516daa2cf662ap+0, -0x1.a000p-48, + 0x1.5257de83f51eap+0, 0x1.a080p-43, + 0x1.5342b569d4edap+0, -0x1.6d80p-45, + 0x1.542e2f4f6ac1ap+0, -0x1.2440p-44, + 0x1.551a4ca5d94dbp+0, 0x1.83c0p-43, + 0x1.56070dde9116bp+0, 0x1.4b00p-45, + 0x1.56f4736b529dep+0, 0x1.15a0p-43, + 0x1.57e27dbe2c40ep+0, -0x1.9e00p-45, + 0x1.58d12d497c76fp+0, -0x1.3080p-45, + 0x1.59c0827ff0b4cp+0, 0x1.dec0p-43, + 0x1.5ab07dd485427p+0, -0x1.4000p-51, + 0x1.5ba11fba87af4p+0, 0x1.0080p-44, + 0x1.5c9268a59460bp+0, -0x1.6c80p-45, + 0x1.5d84590998e3fp+0, 0x1.69a0p-43, + 0x1.5e76f15ad20e1p+0, -0x1.b400p-46, + 0x1.5f6a320dcebcap+0, 0x1.7700p-46, + 0x1.605e1b976dcb8p+0, 0x1.6f80p-45, + 0x1.6152ae6cdf715p+0, 0x1.1000p-47, + 0x1.6247eb03a5531p+0, -0x1.5d00p-46, + 0x1.633dd1d1929b5p+0, -0x1.2d00p-46, + 0x1.6434634ccc313p+0, -0x1.a800p-49, + 0x1.652b9febc8efap+0, -0x1.8600p-45, + 0x1.6623882553397p+0, 0x1.1fe0p-40, + 0x1.671c1c708328ep+0, -0x1.7200p-44, + 0x1.68155d44ca97ep+0, 0x1.6800p-49, + 0x1.690f4b19e9471p+0, -0x1.9780p-45, +}; + +/* + * exp2(x): compute the base 2 exponential of x + * + * Accuracy: Peak error < 0.503 ulp for normalized results. + * + * Method: (accurate tables) + * + * Reduce x: + * x = k + y, for integer k and |y| <= 1/2. + * Thus we have exp2(x) = 2**k * exp2(y). + * + * Reduce y: + * y = i/TBLSIZE + z - eps[i] for integer i near y * TBLSIZE. + * Thus we have exp2(y) = exp2(i/TBLSIZE) * exp2(z - eps[i]), + * with |z - eps[i]| <= 2**-9 + 2**-39 for the table used. + * + * We compute exp2(i/TBLSIZE) via table lookup and exp2(z - eps[i]) via + * a degree-5 minimax polynomial with maximum error under 1.3 * 2**-61. + * The values in exp2t[] and eps[] are chosen such that + * exp2t[i] = exp2(i/TBLSIZE + eps[i]), and eps[i] is a small offset such + * that exp2t[i] is accurate to 2**-64. + * + * Note that the range of i is +-TBLSIZE/2, so we actually index the tables + * by i0 = i + TBLSIZE/2. For cache efficiency, exp2t[] and eps[] are + * virtual tables, interleaved in the real table tbl[]. + * + * This method is due to Gal, with many details due to Gal and Bachelis: + * + * Gal, S. and Bachelis, B. An Accurate Elementary Mathematical Library + * for the IEEE Floating Point Standard. TOMS 17(1), 26-46 (1991). + */ +double exp2(double x) +{ + double_t r, t, z; + uint32_t ix, i0; + union {double f; uint64_t i;} u = {x}; + union {uint32_t u; int32_t i;} k; + + /* Filter out exceptional cases. */ + ix = u.i>>32 & 0x7fffffff; + if (ix >= 0x408ff000) { /* |x| >= 1022 or nan */ + if (ix >= 0x40900000 && u.i>>63 == 0) { /* x >= 1024 or nan */ + /* overflow */ + x *= 0x1p1023; + return x; + } + if (ix >= 0x7ff00000) /* -inf or -nan */ + return -1/x; + if (u.i>>63) { /* x <= -1022 */ + /* underflow */ + if (x <= -1075 || x - 0x1p52 + 0x1p52 != x) + FORCE_EVAL((float)(-0x1p-149/x)); + if (x <= -1075) + return 0; + } + } else if (ix < 0x3c900000) { /* |x| < 0x1p-54 */ + return 1.0 + x; + } + + /* Reduce x, computing z, i0, and k. */ + u.f = x + redux; + i0 = u.i; + i0 += TBLSIZE / 2; + k.u = i0 / TBLSIZE * TBLSIZE; + k.i /= TBLSIZE; + i0 %= TBLSIZE; + u.f -= redux; + z = x - u.f; + + /* Compute r = exp2(y) = exp2t[i0] * p(z - eps[i]). */ + t = tbl[2*i0]; /* exp2t[i0] */ + z -= tbl[2*i0 + 1]; /* eps[i0] */ + r = t + t * z * (P1 + z * (P2 + z * (P3 + z * (P4 + z * P5)))); + + return scalbn(r, k.i); +} diff --git a/lib/libc/src/musl-math/exp2f.c b/lib/libc/src/musl-math/exp2f.c new file mode 100644 index 0000000..296b634 --- /dev/null +++ b/lib/libc/src/musl-math/exp2f.c @@ -0,0 +1,126 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_exp2f.c */ +/*- + * Copyright (c) 2005 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#include "libm.h" + +#define TBLSIZE 16 + +static const float +redux = 0x1.8p23f / TBLSIZE, +P1 = 0x1.62e430p-1f, +P2 = 0x1.ebfbe0p-3f, +P3 = 0x1.c6b348p-5f, +P4 = 0x1.3b2c9cp-7f; + +static const double exp2ft[TBLSIZE] = { + 0x1.6a09e667f3bcdp-1, + 0x1.7a11473eb0187p-1, + 0x1.8ace5422aa0dbp-1, + 0x1.9c49182a3f090p-1, + 0x1.ae89f995ad3adp-1, + 0x1.c199bdd85529cp-1, + 0x1.d5818dcfba487p-1, + 0x1.ea4afa2a490dap-1, + 0x1.0000000000000p+0, + 0x1.0b5586cf9890fp+0, + 0x1.172b83c7d517bp+0, + 0x1.2387a6e756238p+0, + 0x1.306fe0a31b715p+0, + 0x1.3dea64c123422p+0, + 0x1.4bfdad5362a27p+0, + 0x1.5ab07dd485429p+0, +}; + +/* + * exp2f(x): compute the base 2 exponential of x + * + * Accuracy: Peak error < 0.501 ulp; location of peak: -0.030110927. + * + * Method: (equally-spaced tables) + * + * Reduce x: + * x = k + y, for integer k and |y| <= 1/2. + * Thus we have exp2f(x) = 2**k * exp2(y). + * + * Reduce y: + * y = i/TBLSIZE + z for integer i near y * TBLSIZE. + * Thus we have exp2(y) = exp2(i/TBLSIZE) * exp2(z), + * with |z| <= 2**-(TBLSIZE+1). + * + * We compute exp2(i/TBLSIZE) via table lookup and exp2(z) via a + * degree-4 minimax polynomial with maximum error under 1.4 * 2**-33. + * Using double precision for everything except the reduction makes + * roundoff error insignificant and simplifies the scaling step. + * + * This method is due to Tang, but I do not use his suggested parameters: + * + * Tang, P. Table-driven Implementation of the Exponential Function + * in IEEE Floating-Point Arithmetic. TOMS 15(2), 144-157 (1989). + */ +float exp2f(float x) +{ + double_t t, r, z; + union {float f; uint32_t i;} u = {x}; + union {double f; uint64_t i;} uk; + uint32_t ix, i0, k; + + /* Filter out exceptional cases. */ + ix = u.i & 0x7fffffff; + if (ix > 0x42fc0000) { /* |x| > 126 */ + if (ix > 0x7f800000) /* NaN */ + return x; + if (u.i >= 0x43000000 && u.i < 0x80000000) { /* x >= 128 */ + x *= 0x1p127f; + return x; + } + if (u.i >= 0x80000000) { /* x < -126 */ + if (u.i >= 0xc3160000 || (u.i & 0x0000ffff)) + FORCE_EVAL(-0x1p-149f/x); + if (u.i >= 0xc3160000) /* x <= -150 */ + return 0; + } + } else if (ix <= 0x33000000) { /* |x| <= 0x1p-25 */ + return 1.0f + x; + } + + /* Reduce x, computing z, i0, and k. */ + u.f = x + redux; + i0 = u.i; + i0 += TBLSIZE / 2; + k = i0 / TBLSIZE; + uk.i = (uint64_t)(0x3ff + k)<<52; + i0 &= TBLSIZE - 1; + u.f -= redux; + z = x - u.f; + /* Compute r = exp2(y) = exp2ft[i0] * p(z). */ + r = exp2ft[i0]; + t = r * z; + r = r + t * (P1 + z * P2) + t * (z * z) * (P3 + z * P4); + + /* Scale by 2**k */ + return r * uk.f; +} diff --git a/lib/libc/src/musl-math/exp2l.c b/lib/libc/src/musl-math/exp2l.c new file mode 100644 index 0000000..3565c1e --- /dev/null +++ b/lib/libc/src/musl-math/exp2l.c @@ -0,0 +1,619 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/s_exp2l.c and /usr/src/lib/msun/ld128/s_exp2l.c */ +/*- + * Copyright (c) 2005-2008 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double exp2l(long double x) +{ + return exp2(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +#define TBLBITS 7 +#define TBLSIZE (1 << TBLBITS) + +static const double +redux = 0x1.8p63 / TBLSIZE, +P1 = 0x1.62e42fefa39efp-1, +P2 = 0x1.ebfbdff82c58fp-3, +P3 = 0x1.c6b08d7049fap-5, +P4 = 0x1.3b2ab6fba4da5p-7, +P5 = 0x1.5d8804780a736p-10, +P6 = 0x1.430918835e33dp-13; + +static const double tbl[TBLSIZE * 2] = { + 0x1.6a09e667f3bcdp-1, -0x1.bdd3413b2648p-55, + 0x1.6c012750bdabfp-1, -0x1.2895667ff0cp-57, + 0x1.6dfb23c651a2fp-1, -0x1.bbe3a683c88p-58, + 0x1.6ff7df9519484p-1, -0x1.83c0f25860fp-56, + 0x1.71f75e8ec5f74p-1, -0x1.16e4786887bp-56, + 0x1.73f9a48a58174p-1, -0x1.0a8d96c65d5p-55, + 0x1.75feb564267c9p-1, -0x1.0245957316ep-55, + 0x1.780694fde5d3fp-1, 0x1.866b80a0216p-55, + 0x1.7a11473eb0187p-1, -0x1.41577ee0499p-56, + 0x1.7c1ed0130c132p-1, 0x1.f124cd1164ep-55, + 0x1.7e2f336cf4e62p-1, 0x1.05d02ba157ap-57, + 0x1.80427543e1a12p-1, -0x1.27c86626d97p-55, + 0x1.82589994cce13p-1, -0x1.d4c1dd41533p-55, + 0x1.8471a4623c7adp-1, -0x1.8d684a341cep-56, + 0x1.868d99b4492edp-1, -0x1.fc6f89bd4f68p-55, + 0x1.88ac7d98a6699p-1, 0x1.994c2f37cb5p-55, + 0x1.8ace5422aa0dbp-1, 0x1.6e9f156864bp-55, + 0x1.8cf3216b5448cp-1, -0x1.0d55e32e9e4p-57, + 0x1.8f1ae99157736p-1, 0x1.5cc13a2e397p-56, + 0x1.9145b0b91ffc6p-1, -0x1.dd6792e5825p-55, + 0x1.93737b0cdc5e5p-1, -0x1.75fc781b58p-58, + 0x1.95a44cbc8520fp-1, -0x1.64b7c96a5fp-57, + 0x1.97d829fde4e5p-1, -0x1.d185b7c1b86p-55, + 0x1.9a0f170ca07bap-1, -0x1.173bd91cee6p-55, + 0x1.9c49182a3f09p-1, 0x1.c7c46b071f2p-57, + 0x1.9e86319e32323p-1, 0x1.824ca78e64cp-57, + 0x1.a0c667b5de565p-1, -0x1.359495d1cd5p-55, + 0x1.a309bec4a2d33p-1, 0x1.6305c7ddc368p-55, + 0x1.a5503b23e255dp-1, -0x1.d2f6edb8d42p-55, + 0x1.a799e1330b358p-1, 0x1.bcb7ecac564p-55, + 0x1.a9e6b5579fdbfp-1, 0x1.0fac90ef7fdp-55, + 0x1.ac36bbfd3f37ap-1, -0x1.f9234cae76dp-56, + 0x1.ae89f995ad3adp-1, 0x1.7a1cd345dcc8p-55, + 0x1.b0e07298db666p-1, -0x1.bdef54c80e4p-55, + 0x1.b33a2b84f15fbp-1, -0x1.2805e3084d8p-58, + 0x1.b59728de5593ap-1, -0x1.c71dfbbba6ep-55, + 0x1.b7f76f2fb5e47p-1, -0x1.5584f7e54acp-57, + 0x1.ba5b030a1064ap-1, -0x1.efcd30e5429p-55, + 0x1.bcc1e904bc1d2p-1, 0x1.23dd07a2d9fp-56, + 0x1.bf2c25bd71e09p-1, -0x1.efdca3f6b9c8p-55, + 0x1.c199bdd85529cp-1, 0x1.11065895049p-56, + 0x1.c40ab5fffd07ap-1, 0x1.b4537e083c6p-55, + 0x1.c67f12e57d14bp-1, 0x1.2884dff483c8p-55, + 0x1.c8f6d9406e7b5p-1, 0x1.1acbc48805cp-57, + 0x1.cb720dcef9069p-1, 0x1.503cbd1e94ap-57, + 0x1.cdf0b555dc3fap-1, -0x1.dd83b53829dp-56, + 0x1.d072d4a07897cp-1, -0x1.cbc3743797a8p-55, + 0x1.d2f87080d89f2p-1, -0x1.d487b719d858p-55, + 0x1.d5818dcfba487p-1, 0x1.2ed02d75b37p-56, + 0x1.d80e316c98398p-1, -0x1.11ec18bedep-55, + 0x1.da9e603db3285p-1, 0x1.c2300696db5p-55, + 0x1.dd321f301b46p-1, 0x1.2da5778f019p-55, + 0x1.dfc97337b9b5fp-1, -0x1.1a5cd4f184b8p-55, + 0x1.e264614f5a129p-1, -0x1.7b627817a148p-55, + 0x1.e502ee78b3ff6p-1, 0x1.39e8980a9cdp-56, + 0x1.e7a51fbc74c83p-1, 0x1.2d522ca0c8ep-55, + 0x1.ea4afa2a490dap-1, -0x1.e9c23179c288p-55, + 0x1.ecf482d8e67f1p-1, -0x1.c93f3b411ad8p-55, + 0x1.efa1bee615a27p-1, 0x1.dc7f486a4b68p-55, + 0x1.f252b376bba97p-1, 0x1.3a1a5bf0d8e8p-55, + 0x1.f50765b6e454p-1, 0x1.9d3e12dd8a18p-55, + 0x1.f7bfdad9cbe14p-1, -0x1.dbb12d00635p-55, + 0x1.fa7c1819e90d8p-1, 0x1.74853f3a593p-56, + 0x1.fd3c22b8f71f1p-1, 0x1.2eb74966578p-58, + 0x1p+0, 0x0p+0, + 0x1.0163da9fb3335p+0, 0x1.b61299ab8cd8p-54, + 0x1.02c9a3e778061p+0, -0x1.19083535b08p-56, + 0x1.04315e86e7f85p+0, -0x1.0a31c1977c98p-54, + 0x1.059b0d3158574p+0, 0x1.d73e2a475b4p-55, + 0x1.0706b29ddf6dep+0, -0x1.c91dfe2b13cp-55, + 0x1.0874518759bc8p+0, 0x1.186be4bb284p-57, + 0x1.09e3ecac6f383p+0, 0x1.14878183161p-54, + 0x1.0b5586cf9890fp+0, 0x1.8a62e4adc61p-54, + 0x1.0cc922b7247f7p+0, 0x1.01edc16e24f8p-54, + 0x1.0e3ec32d3d1a2p+0, 0x1.03a1727c58p-59, + 0x1.0fb66affed31bp+0, -0x1.b9bedc44ebcp-57, + 0x1.11301d0125b51p+0, -0x1.6c51039449bp-54, + 0x1.12abdc06c31ccp+0, -0x1.1b514b36ca8p-58, + 0x1.1429aaea92dep+0, -0x1.32fbf9af1368p-54, + 0x1.15a98c8a58e51p+0, 0x1.2406ab9eeabp-55, + 0x1.172b83c7d517bp+0, -0x1.19041b9d78ap-55, + 0x1.18af9388c8deap+0, -0x1.11023d1970f8p-54, + 0x1.1a35beb6fcb75p+0, 0x1.e5b4c7b4969p-55, + 0x1.1bbe084045cd4p+0, -0x1.95386352ef6p-54, + 0x1.1d4873168b9aap+0, 0x1.e016e00a264p-54, + 0x1.1ed5022fcd91dp+0, -0x1.1df98027bb78p-54, + 0x1.2063b88628cd6p+0, 0x1.dc775814a85p-55, + 0x1.21f49917ddc96p+0, 0x1.2a97e9494a6p-55, + 0x1.2387a6e756238p+0, 0x1.9b07eb6c7058p-54, + 0x1.251ce4fb2a63fp+0, 0x1.ac155bef4f5p-55, + 0x1.26b4565e27cddp+0, 0x1.2bd339940eap-55, + 0x1.284dfe1f56381p+0, -0x1.a4c3a8c3f0d8p-54, + 0x1.29e9df51fdee1p+0, 0x1.612e8afad12p-55, + 0x1.2b87fd0dad99p+0, -0x1.10adcd6382p-59, + 0x1.2d285a6e4030bp+0, 0x1.0024754db42p-54, + 0x1.2ecafa93e2f56p+0, 0x1.1ca0f45d524p-56, + 0x1.306fe0a31b715p+0, 0x1.6f46ad23183p-55, + 0x1.32170fc4cd831p+0, 0x1.a9ce78e1804p-55, + 0x1.33c08b26416ffp+0, 0x1.327218436598p-54, + 0x1.356c55f929ff1p+0, -0x1.b5cee5c4e46p-55, + 0x1.371a7373aa9cbp+0, -0x1.63aeabf42ebp-54, + 0x1.38cae6d05d866p+0, -0x1.e958d3c99048p-54, + 0x1.3a7db34e59ff7p+0, -0x1.5e436d661f6p-56, + 0x1.3c32dc313a8e5p+0, -0x1.efff8375d2ap-54, + 0x1.3dea64c123422p+0, 0x1.ada0911f09fp-55, + 0x1.3fa4504ac801cp+0, -0x1.7d023f956fap-54, + 0x1.4160a21f72e2ap+0, -0x1.ef3691c309p-58, + 0x1.431f5d950a897p+0, -0x1.1c7dde35f7ap-55, + 0x1.44e086061892dp+0, 0x1.89b7a04ef8p-59, + 0x1.46a41ed1d0057p+0, 0x1.c944bd1648a8p-54, + 0x1.486a2b5c13cdp+0, 0x1.3c1a3b69062p-56, + 0x1.4a32af0d7d3dep+0, 0x1.9cb62f3d1be8p-54, + 0x1.4bfdad5362a27p+0, 0x1.d4397afec42p-56, + 0x1.4dcb299fddd0dp+0, 0x1.8ecdbbc6a78p-54, + 0x1.4f9b2769d2ca7p+0, -0x1.4b309d25958p-54, + 0x1.516daa2cf6642p+0, -0x1.f768569bd94p-55, + 0x1.5342b569d4f82p+0, -0x1.07abe1db13dp-55, + 0x1.551a4ca5d920fp+0, -0x1.d689cefede6p-55, + 0x1.56f4736b527dap+0, 0x1.9bb2c011d938p-54, + 0x1.58d12d497c7fdp+0, 0x1.295e15b9a1ep-55, + 0x1.5ab07dd485429p+0, 0x1.6324c0546478p-54, + 0x1.5c9268a5946b7p+0, 0x1.c4b1b81698p-60, + 0x1.5e76f15ad2148p+0, 0x1.ba6f93080e68p-54, + 0x1.605e1b976dc09p+0, -0x1.3e2429b56de8p-54, + 0x1.6247eb03a5585p+0, -0x1.383c17e40b48p-54, + 0x1.6434634ccc32p+0, -0x1.c483c759d89p-55, + 0x1.6623882552225p+0, -0x1.bb60987591cp-54, + 0x1.68155d44ca973p+0, 0x1.038ae44f74p-57, +}; + +/* + * exp2l(x): compute the base 2 exponential of x + * + * Accuracy: Peak error < 0.511 ulp. + * + * Method: (equally-spaced tables) + * + * Reduce x: + * x = 2**k + y, for integer k and |y| <= 1/2. + * Thus we have exp2l(x) = 2**k * exp2(y). + * + * Reduce y: + * y = i/TBLSIZE + z for integer i near y * TBLSIZE. + * Thus we have exp2(y) = exp2(i/TBLSIZE) * exp2(z), + * with |z| <= 2**-(TBLBITS+1). + * + * We compute exp2(i/TBLSIZE) via table lookup and exp2(z) via a + * degree-6 minimax polynomial with maximum error under 2**-69. + * The table entries each have 104 bits of accuracy, encoded as + * a pair of double precision values. + */ +long double exp2l(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double r, z; + uint32_t i0; + union {uint32_t u; int32_t i;} k; + + /* Filter out exceptional cases. */ + if (e >= 0x3fff + 13) { /* |x| >= 8192 or x is NaN */ + if (u.i.se >= 0x3fff + 14 && u.i.se >> 15 == 0) + /* overflow */ + return x * 0x1p16383L; + if (e == 0x7fff) /* -inf or -nan */ + return -1/x; + if (x < -16382) { + if (x <= -16446 || x - 0x1p63 + 0x1p63 != x) + /* underflow */ + FORCE_EVAL((float)(-0x1p-149/x)); + if (x <= -16446) + return 0; + } + } else if (e < 0x3fff - 64) { + return 1 + x; + } + + /* + * Reduce x, computing z, i0, and k. The low bits of x + redux + * contain the 16-bit integer part of the exponent (k) followed by + * TBLBITS fractional bits (i0). We use bit tricks to extract these + * as integers, then set z to the remainder. + * + * Example: Suppose x is 0xabc.123456p0 and TBLBITS is 8. + * Then the low-order word of x + redux is 0x000abc12, + * We split this into k = 0xabc and i0 = 0x12 (adjusted to + * index into the table), then we compute z = 0x0.003456p0. + */ + u.f = x + redux; + i0 = u.i.m + TBLSIZE / 2; + k.u = i0 / TBLSIZE * TBLSIZE; + k.i /= TBLSIZE; + i0 %= TBLSIZE; + u.f -= redux; + z = x - u.f; + + /* Compute r = exp2l(y) = exp2lt[i0] * p(z). */ + long double t_hi = tbl[2*i0]; + long double t_lo = tbl[2*i0 + 1]; + /* XXX This gives > 1 ulp errors outside of FE_TONEAREST mode */ + r = t_lo + (t_hi + t_lo) * z * (P1 + z * (P2 + z * (P3 + z * (P4 + + z * (P5 + z * P6))))) + t_hi; + + return scalbnl(r, k.i); +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +#define TBLBITS 7 +#define TBLSIZE (1 << TBLBITS) + +static const long double + P1 = 0x1.62e42fefa39ef35793c7673007e6p-1L, + P2 = 0x1.ebfbdff82c58ea86f16b06ec9736p-3L, + P3 = 0x1.c6b08d704a0bf8b33a762bad3459p-5L, + P4 = 0x1.3b2ab6fba4e7729ccbbe0b4f3fc2p-7L, + P5 = 0x1.5d87fe78a67311071dee13fd11d9p-10L, + P6 = 0x1.430912f86c7876f4b663b23c5fe5p-13L; + +static const double + P7 = 0x1.ffcbfc588b041p-17, + P8 = 0x1.62c0223a5c7c7p-20, + P9 = 0x1.b52541ff59713p-24, + P10 = 0x1.e4cf56a391e22p-28, + redux = 0x1.8p112 / TBLSIZE; + +static const long double tbl[TBLSIZE] = { + 0x1.6a09e667f3bcc908b2fb1366dfeap-1L, + 0x1.6c012750bdabeed76a99800f4edep-1L, + 0x1.6dfb23c651a2ef220e2cbe1bc0d4p-1L, + 0x1.6ff7df9519483cf87e1b4f3e1e98p-1L, + 0x1.71f75e8ec5f73dd2370f2ef0b148p-1L, + 0x1.73f9a48a58173bd5c9a4e68ab074p-1L, + 0x1.75feb564267c8bf6e9aa33a489a8p-1L, + 0x1.780694fde5d3f619ae02808592a4p-1L, + 0x1.7a11473eb0186d7d51023f6ccb1ap-1L, + 0x1.7c1ed0130c1327c49334459378dep-1L, + 0x1.7e2f336cf4e62105d02ba1579756p-1L, + 0x1.80427543e1a11b60de67649a3842p-1L, + 0x1.82589994cce128acf88afab34928p-1L, + 0x1.8471a4623c7acce52f6b97c6444cp-1L, + 0x1.868d99b4492ec80e41d90ac2556ap-1L, + 0x1.88ac7d98a669966530bcdf2d4cc0p-1L, + 0x1.8ace5422aa0db5ba7c55a192c648p-1L, + 0x1.8cf3216b5448bef2aa1cd161c57ap-1L, + 0x1.8f1ae991577362b982745c72eddap-1L, + 0x1.9145b0b91ffc588a61b469f6b6a0p-1L, + 0x1.93737b0cdc5e4f4501c3f2540ae8p-1L, + 0x1.95a44cbc8520ee9b483695a0e7fep-1L, + 0x1.97d829fde4e4f8b9e920f91e8eb6p-1L, + 0x1.9a0f170ca07b9ba3109b8c467844p-1L, + 0x1.9c49182a3f0901c7c46b071f28dep-1L, + 0x1.9e86319e323231824ca78e64c462p-1L, + 0x1.a0c667b5de564b29ada8b8cabbacp-1L, + 0x1.a309bec4a2d3358c171f770db1f4p-1L, + 0x1.a5503b23e255c8b424491caf88ccp-1L, + 0x1.a799e1330b3586f2dfb2b158f31ep-1L, + 0x1.a9e6b5579fdbf43eb243bdff53a2p-1L, + 0x1.ac36bbfd3f379c0db966a3126988p-1L, + 0x1.ae89f995ad3ad5e8734d17731c80p-1L, + 0x1.b0e07298db66590842acdfc6fb4ep-1L, + 0x1.b33a2b84f15faf6bfd0e7bd941b0p-1L, + 0x1.b59728de559398e3881111648738p-1L, + 0x1.b7f76f2fb5e46eaa7b081ab53ff6p-1L, + 0x1.ba5b030a10649840cb3c6af5b74cp-1L, + 0x1.bcc1e904bc1d2247ba0f45b3d06cp-1L, + 0x1.bf2c25bd71e088408d7025190cd0p-1L, + 0x1.c199bdd85529c2220cb12a0916bap-1L, + 0x1.c40ab5fffd07a6d14df820f17deap-1L, + 0x1.c67f12e57d14b4a2137fd20f2a26p-1L, + 0x1.c8f6d9406e7b511acbc48805c3f6p-1L, + 0x1.cb720dcef90691503cbd1e949d0ap-1L, + 0x1.cdf0b555dc3f9c44f8958fac4f12p-1L, + 0x1.d072d4a07897b8d0f22f21a13792p-1L, + 0x1.d2f87080d89f18ade123989ea50ep-1L, + 0x1.d5818dcfba48725da05aeb66dff8p-1L, + 0x1.d80e316c98397bb84f9d048807a0p-1L, + 0x1.da9e603db3285708c01a5b6d480cp-1L, + 0x1.dd321f301b4604b695de3c0630c0p-1L, + 0x1.dfc97337b9b5eb968cac39ed284cp-1L, + 0x1.e264614f5a128a12761fa17adc74p-1L, + 0x1.e502ee78b3ff6273d130153992d0p-1L, + 0x1.e7a51fbc74c834b548b2832378a4p-1L, + 0x1.ea4afa2a490d9858f73a18f5dab4p-1L, + 0x1.ecf482d8e67f08db0312fb949d50p-1L, + 0x1.efa1bee615a27771fd21a92dabb6p-1L, + 0x1.f252b376bba974e8696fc3638f24p-1L, + 0x1.f50765b6e4540674f84b762861a6p-1L, + 0x1.f7bfdad9cbe138913b4bfe72bd78p-1L, + 0x1.fa7c1819e90d82e90a7e74b26360p-1L, + 0x1.fd3c22b8f71f10975ba4b32bd006p-1L, + 0x1.0000000000000000000000000000p+0L, + 0x1.0163da9fb33356d84a66ae336e98p+0L, + 0x1.02c9a3e778060ee6f7caca4f7a18p+0L, + 0x1.04315e86e7f84bd738f9a20da442p+0L, + 0x1.059b0d31585743ae7c548eb68c6ap+0L, + 0x1.0706b29ddf6ddc6dc403a9d87b1ep+0L, + 0x1.0874518759bc808c35f25d942856p+0L, + 0x1.09e3ecac6f3834521e060c584d5cp+0L, + 0x1.0b5586cf9890f6298b92b7184200p+0L, + 0x1.0cc922b7247f7407b705b893dbdep+0L, + 0x1.0e3ec32d3d1a2020742e4f8af794p+0L, + 0x1.0fb66affed31af232091dd8a169ep+0L, + 0x1.11301d0125b50a4ebbf1aed9321cp+0L, + 0x1.12abdc06c31cbfb92bad324d6f84p+0L, + 0x1.1429aaea92ddfb34101943b2588ep+0L, + 0x1.15a98c8a58e512480d573dd562aep+0L, + 0x1.172b83c7d517adcdf7c8c50eb162p+0L, + 0x1.18af9388c8de9bbbf70b9a3c269cp+0L, + 0x1.1a35beb6fcb753cb698f692d2038p+0L, + 0x1.1bbe084045cd39ab1e72b442810ep+0L, + 0x1.1d4873168b9aa7805b8028990be8p+0L, + 0x1.1ed5022fcd91cb8819ff61121fbep+0L, + 0x1.2063b88628cd63b8eeb0295093f6p+0L, + 0x1.21f49917ddc962552fd29294bc20p+0L, + 0x1.2387a6e75623866c1fadb1c159c0p+0L, + 0x1.251ce4fb2a63f3582ab7de9e9562p+0L, + 0x1.26b4565e27cdd257a673281d3068p+0L, + 0x1.284dfe1f5638096cf15cf03c9fa0p+0L, + 0x1.29e9df51fdee12c25d15f5a25022p+0L, + 0x1.2b87fd0dad98ffddea46538fca24p+0L, + 0x1.2d285a6e4030b40091d536d0733ep+0L, + 0x1.2ecafa93e2f5611ca0f45d5239a4p+0L, + 0x1.306fe0a31b7152de8d5a463063bep+0L, + 0x1.32170fc4cd8313539cf1c3009330p+0L, + 0x1.33c08b26416ff4c9c8610d96680ep+0L, + 0x1.356c55f929ff0c94623476373be4p+0L, + 0x1.371a7373aa9caa7145502f45452ap+0L, + 0x1.38cae6d05d86585a9cb0d9bed530p+0L, + 0x1.3a7db34e59ff6ea1bc9299e0a1fep+0L, + 0x1.3c32dc313a8e484001f228b58cf0p+0L, + 0x1.3dea64c12342235b41223e13d7eep+0L, + 0x1.3fa4504ac801ba0bf701aa417b9cp+0L, + 0x1.4160a21f72e29f84325b8f3dbacap+0L, + 0x1.431f5d950a896dc704439410b628p+0L, + 0x1.44e086061892d03136f409df0724p+0L, + 0x1.46a41ed1d005772512f459229f0ap+0L, + 0x1.486a2b5c13cd013c1a3b69062f26p+0L, + 0x1.4a32af0d7d3de672d8bcf46f99b4p+0L, + 0x1.4bfdad5362a271d4397afec42e36p+0L, + 0x1.4dcb299fddd0d63b36ef1a9e19dep+0L, + 0x1.4f9b2769d2ca6ad33d8b69aa0b8cp+0L, + 0x1.516daa2cf6641c112f52c84d6066p+0L, + 0x1.5342b569d4f81df0a83c49d86bf4p+0L, + 0x1.551a4ca5d920ec52ec620243540cp+0L, + 0x1.56f4736b527da66ecb004764e61ep+0L, + 0x1.58d12d497c7fd252bc2b7343d554p+0L, + 0x1.5ab07dd48542958c93015191e9a8p+0L, + 0x1.5c9268a5946b701c4b1b81697ed4p+0L, + 0x1.5e76f15ad21486e9be4c20399d12p+0L, + 0x1.605e1b976dc08b076f592a487066p+0L, + 0x1.6247eb03a5584b1f0fa06fd2d9eap+0L, + 0x1.6434634ccc31fc76f8714c4ee122p+0L, + 0x1.66238825522249127d9e29b92ea2p+0L, + 0x1.68155d44ca973081c57227b9f69ep+0L, +}; + +static const float eps[TBLSIZE] = { + -0x1.5c50p-101, + -0x1.5d00p-106, + 0x1.8e90p-102, + -0x1.5340p-103, + 0x1.1bd0p-102, + -0x1.4600p-105, + -0x1.7a40p-104, + 0x1.d590p-102, + -0x1.d590p-101, + 0x1.b100p-103, + -0x1.0d80p-105, + 0x1.6b00p-103, + -0x1.9f00p-105, + 0x1.c400p-103, + 0x1.e120p-103, + -0x1.c100p-104, + -0x1.9d20p-103, + 0x1.a800p-108, + 0x1.4c00p-106, + -0x1.9500p-106, + 0x1.6900p-105, + -0x1.29d0p-100, + 0x1.4c60p-103, + 0x1.13a0p-102, + -0x1.5b60p-103, + -0x1.1c40p-103, + 0x1.db80p-102, + 0x1.91a0p-102, + 0x1.dc00p-105, + 0x1.44c0p-104, + 0x1.9710p-102, + 0x1.8760p-103, + -0x1.a720p-103, + 0x1.ed20p-103, + -0x1.49c0p-102, + -0x1.e000p-111, + 0x1.86a0p-103, + 0x1.2b40p-103, + -0x1.b400p-108, + 0x1.1280p-99, + -0x1.02d8p-102, + -0x1.e3d0p-103, + -0x1.b080p-105, + -0x1.f100p-107, + -0x1.16c0p-105, + -0x1.1190p-103, + -0x1.a7d2p-100, + 0x1.3450p-103, + -0x1.67c0p-105, + 0x1.4b80p-104, + -0x1.c4e0p-103, + 0x1.6000p-108, + -0x1.3f60p-105, + 0x1.93f0p-104, + 0x1.5fe0p-105, + 0x1.6f80p-107, + -0x1.7600p-106, + 0x1.21e0p-106, + -0x1.3a40p-106, + -0x1.40c0p-104, + -0x1.9860p-105, + -0x1.5d40p-108, + -0x1.1d70p-106, + 0x1.2760p-105, + 0x0.0000p+0, + 0x1.21e2p-104, + -0x1.9520p-108, + -0x1.5720p-106, + -0x1.4810p-106, + -0x1.be00p-109, + 0x1.0080p-105, + -0x1.5780p-108, + -0x1.d460p-105, + -0x1.6140p-105, + 0x1.4630p-104, + 0x1.ad50p-103, + 0x1.82e0p-105, + 0x1.1d3cp-101, + 0x1.6100p-107, + 0x1.ec30p-104, + 0x1.f200p-108, + 0x1.0b40p-103, + 0x1.3660p-102, + 0x1.d9d0p-103, + -0x1.02d0p-102, + 0x1.b070p-103, + 0x1.b9c0p-104, + -0x1.01c0p-103, + -0x1.dfe0p-103, + 0x1.1b60p-104, + -0x1.ae94p-101, + -0x1.3340p-104, + 0x1.b3d8p-102, + -0x1.6e40p-105, + -0x1.3670p-103, + 0x1.c140p-104, + 0x1.1840p-101, + 0x1.1ab0p-102, + -0x1.a400p-104, + 0x1.1f00p-104, + -0x1.7180p-103, + 0x1.4ce0p-102, + 0x1.9200p-107, + -0x1.54c0p-103, + 0x1.1b80p-105, + -0x1.1828p-101, + 0x1.5720p-102, + -0x1.a060p-100, + 0x1.9160p-102, + 0x1.a280p-104, + 0x1.3400p-107, + 0x1.2b20p-102, + 0x1.7800p-108, + 0x1.cfd0p-101, + 0x1.2ef0p-102, + -0x1.2760p-99, + 0x1.b380p-104, + 0x1.0048p-101, + -0x1.60b0p-102, + 0x1.a1ccp-100, + -0x1.a640p-104, + -0x1.08a0p-101, + 0x1.7e60p-102, + 0x1.22c0p-103, + -0x1.7200p-106, + 0x1.f0f0p-102, + 0x1.eb4ep-99, + 0x1.c6e0p-103, +}; + +/* + * exp2l(x): compute the base 2 exponential of x + * + * Accuracy: Peak error < 0.502 ulp. + * + * Method: (accurate tables) + * + * Reduce x: + * x = 2**k + y, for integer k and |y| <= 1/2. + * Thus we have exp2(x) = 2**k * exp2(y). + * + * Reduce y: + * y = i/TBLSIZE + z - eps[i] for integer i near y * TBLSIZE. + * Thus we have exp2(y) = exp2(i/TBLSIZE) * exp2(z - eps[i]), + * with |z - eps[i]| <= 2**-8 + 2**-98 for the table used. + * + * We compute exp2(i/TBLSIZE) via table lookup and exp2(z - eps[i]) via + * a degree-10 minimax polynomial with maximum error under 2**-120. + * The values in exp2t[] and eps[] are chosen such that + * exp2t[i] = exp2(i/TBLSIZE + eps[i]), and eps[i] is a small offset such + * that exp2t[i] is accurate to 2**-122. + * + * Note that the range of i is +-TBLSIZE/2, so we actually index the tables + * by i0 = i + TBLSIZE/2. + * + * This method is due to Gal, with many details due to Gal and Bachelis: + * + * Gal, S. and Bachelis, B. An Accurate Elementary Mathematical Library + * for the IEEE Floating Point Standard. TOMS 17(1), 26-46 (1991). + */ +long double +exp2l(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double r, z, t; + uint32_t i0; + union {uint32_t u; int32_t i;} k; + + /* Filter out exceptional cases. */ + if (e >= 0x3fff + 14) { /* |x| >= 16384 or x is NaN */ + if (u.i.se >= 0x3fff + 15 && u.i.se >> 15 == 0) + /* overflow */ + return x * 0x1p16383L; + if (e == 0x7fff) /* -inf or -nan */ + return -1/x; + if (x < -16382) { + if (x <= -16495 || x - 0x1p112 + 0x1p112 != x) + /* underflow */ + FORCE_EVAL((float)(-0x1p-149/x)); + if (x <= -16446) + return 0; + } + } else if (e < 0x3fff - 114) { + return 1 + x; + } + + /* + * Reduce x, computing z, i0, and k. The low bits of x + redux + * contain the 16-bit integer part of the exponent (k) followed by + * TBLBITS fractional bits (i0). We use bit tricks to extract these + * as integers, then set z to the remainder. + * + * Example: Suppose x is 0xabc.123456p0 and TBLBITS is 8. + * Then the low-order word of x + redux is 0x000abc12, + * We split this into k = 0xabc and i0 = 0x12 (adjusted to + * index into the table), then we compute z = 0x0.003456p0. + */ + u.f = x + redux; + i0 = u.i2.lo + TBLSIZE / 2; + k.u = i0 / TBLSIZE * TBLSIZE; + k.i /= TBLSIZE; + i0 %= TBLSIZE; + u.f -= redux; + z = x - u.f; + + /* Compute r = exp2(y) = exp2t[i0] * p(z - eps[i]). */ + t = tbl[i0]; + z -= eps[i0]; + r = t + t * z * (P1 + z * (P2 + z * (P3 + z * (P4 + z * (P5 + z * (P6 + + z * (P7 + z * (P8 + z * (P9 + z * P10))))))))); + + return scalbnl(r, k.i); +} +#endif diff --git a/lib/libc/src/musl-math/expf.c b/lib/libc/src/musl-math/expf.c new file mode 100644 index 0000000..feee2b0 --- /dev/null +++ b/lib/libc/src/musl-math/expf.c @@ -0,0 +1,83 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_expf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +half[2] = {0.5,-0.5}, +ln2hi = 6.9314575195e-1f, /* 0x3f317200 */ +ln2lo = 1.4286067653e-6f, /* 0x35bfbe8e */ +invln2 = 1.4426950216e+0f, /* 0x3fb8aa3b */ +/* + * Domain [-0.34568, 0.34568], range ~[-4.278e-9, 4.447e-9]: + * |x*(exp(x)+1)/(exp(x)-1) - p(x)| < 2**-27.74 + */ +P1 = 1.6666625440e-1f, /* 0xaaaa8f.0p-26 */ +P2 = -2.7667332906e-3f; /* -0xb55215.0p-32 */ + +float expf(float x) +{ + float_t hi, lo, c, xx, y; + int k, sign; + uint32_t hx; + + GET_FLOAT_WORD(hx, x); + sign = hx >> 31; /* sign bit of x */ + hx &= 0x7fffffff; /* high word of |x| */ + + /* special cases */ + if (hx >= 0x42aeac50) { /* if |x| >= -87.33655f or NaN */ + if (hx > 0x7f800000) /* NaN */ + return x; + if (hx >= 0x42b17218 && !sign) { /* x >= 88.722839f */ + /* overflow */ + x *= 0x1p127f; + return x; + } + if (sign) { + /* underflow */ + FORCE_EVAL(-0x1p-149f/x); + if (hx >= 0x42cff1b5) /* x <= -103.972084f */ + return 0; + } + } + + /* argument reduction */ + if (hx > 0x3eb17218) { /* if |x| > 0.5 ln2 */ + if (hx > 0x3f851592) /* if |x| > 1.5 ln2 */ + k = invln2*x + half[sign]; + else + k = 1 - sign - sign; + hi = x - k*ln2hi; /* k*ln2hi is exact here */ + lo = k*ln2lo; + x = hi - lo; + } else if (hx > 0x39000000) { /* |x| > 2**-14 */ + k = 0; + hi = x; + lo = 0; + } else { + /* raise inexact */ + FORCE_EVAL(0x1p127f + x); + return 1 + x; + } + + /* x is now in primary range */ + xx = x*x; + c = x - xx*(P1+xx*P2); + y = 1 + (x*c/(2-c) - lo + hi); + if (k == 0) + return y; + return scalbnf(y, k); +} diff --git a/lib/libc/src/musl-math/expl.c b/lib/libc/src/musl-math/expl.c new file mode 100644 index 0000000..0a7f44f --- /dev/null +++ b/lib/libc/src/musl-math/expl.c @@ -0,0 +1,128 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_expl.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Exponential function, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, expl(); + * + * y = expl( x ); + * + * + * DESCRIPTION: + * + * Returns e (2.71828...) raised to the x power. + * + * Range reduction is accomplished by separating the argument + * into an integer k and fraction f such that + * + * x k f + * e = 2 e. + * + * A Pade' form of degree 5/6 is used to approximate exp(f) - 1 + * in the basic range [-0.5 ln 2, 0.5 ln 2]. + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE +-10000 50000 1.12e-19 2.81e-20 + * + * + * Error amplification in the exponential function can be + * a serious matter. The error propagation involves + * exp( X(1+delta) ) = exp(X) ( 1 + X*delta + ... ), + * which shows that a 1 lsb error in representing X produces + * a relative error of X times 1 lsb in the function. + * While the routine gives an accurate result for arguments + * that are exactly represented by a long double precision + * computer number, the result contains amplified roundoff + * error for large arguments not exactly represented. + * + * + * ERROR MESSAGES: + * + * message condition value returned + * exp underflow x < MINLOG 0.0 + * exp overflow x > MAXLOG MAXNUM + * + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double expl(long double x) +{ + return exp(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 + +static const long double P[3] = { + 1.2617719307481059087798E-4L, + 3.0299440770744196129956E-2L, + 9.9999999999999999991025E-1L, +}; +static const long double Q[4] = { + 3.0019850513866445504159E-6L, + 2.5244834034968410419224E-3L, + 2.2726554820815502876593E-1L, + 2.0000000000000000000897E0L, +}; +static const long double +LN2HI = 6.9314575195312500000000E-1L, +LN2LO = 1.4286068203094172321215E-6L, +LOG2E = 1.4426950408889634073599E0L; + +long double expl(long double x) +{ + long double px, xx; + int k; + + if (isnan(x)) + return x; + if (x > 11356.5234062941439488L) /* x > ln(2^16384 - 0.5) */ + return x * 0x1p16383L; + if (x < -11399.4985314888605581L) /* x < ln(2^-16446) */ + return -0x1p-16445L/x; + + /* Express e**x = e**f 2**k + * = e**(f + k ln(2)) + */ + px = floorl(LOG2E * x + 0.5); + k = px; + x -= px * LN2HI; + x -= px * LN2LO; + + /* rational approximation of the fractional part: + * e**x = 1 + 2x P(x**2)/(Q(x**2) - x P(x**2)) + */ + xx = x * x; + px = x * __polevll(xx, P, 2); + x = px/(__polevll(xx, Q, 3) - px); + x = 1.0 + 2.0 * x; + return scalbnl(x, k); +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double expl(long double x) +{ + return exp(x); +} +#endif diff --git a/lib/libc/src/musl-math/expm1.c b/lib/libc/src/musl-math/expm1.c new file mode 100644 index 0000000..ac1e61e --- /dev/null +++ b/lib/libc/src/musl-math/expm1.c @@ -0,0 +1,201 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_expm1.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* expm1(x) + * Returns exp(x)-1, the exponential of x minus 1. + * + * Method + * 1. Argument reduction: + * Given x, find r and integer k such that + * + * x = k*ln2 + r, |r| <= 0.5*ln2 ~ 0.34658 + * + * Here a correction term c will be computed to compensate + * the error in r when rounded to a floating-point number. + * + * 2. Approximating expm1(r) by a special rational function on + * the interval [0,0.34658]: + * Since + * r*(exp(r)+1)/(exp(r)-1) = 2+ r^2/6 - r^4/360 + ... + * we define R1(r*r) by + * r*(exp(r)+1)/(exp(r)-1) = 2+ r^2/6 * R1(r*r) + * That is, + * R1(r**2) = 6/r *((exp(r)+1)/(exp(r)-1) - 2/r) + * = 6/r * ( 1 + 2.0*(1/(exp(r)-1) - 1/r)) + * = 1 - r^2/60 + r^4/2520 - r^6/100800 + ... + * We use a special Remez algorithm on [0,0.347] to generate + * a polynomial of degree 5 in r*r to approximate R1. The + * maximum error of this polynomial approximation is bounded + * by 2**-61. In other words, + * R1(z) ~ 1.0 + Q1*z + Q2*z**2 + Q3*z**3 + Q4*z**4 + Q5*z**5 + * where Q1 = -1.6666666666666567384E-2, + * Q2 = 3.9682539681370365873E-4, + * Q3 = -9.9206344733435987357E-6, + * Q4 = 2.5051361420808517002E-7, + * Q5 = -6.2843505682382617102E-9; + * z = r*r, + * with error bounded by + * | 5 | -61 + * | 1.0+Q1*z+...+Q5*z - R1(z) | <= 2 + * | | + * + * expm1(r) = exp(r)-1 is then computed by the following + * specific way which minimize the accumulation rounding error: + * 2 3 + * r r [ 3 - (R1 + R1*r/2) ] + * expm1(r) = r + --- + --- * [--------------------] + * 2 2 [ 6 - r*(3 - R1*r/2) ] + * + * To compensate the error in the argument reduction, we use + * expm1(r+c) = expm1(r) + c + expm1(r)*c + * ~ expm1(r) + c + r*c + * Thus c+r*c will be added in as the correction terms for + * expm1(r+c). Now rearrange the term to avoid optimization + * screw up: + * ( 2 2 ) + * ({ ( r [ R1 - (3 - R1*r/2) ] ) } r ) + * expm1(r+c)~r - ({r*(--- * [--------------------]-c)-c} - --- ) + * ({ ( 2 [ 6 - r*(3 - R1*r/2) ] ) } 2 ) + * ( ) + * + * = r - E + * 3. Scale back to obtain expm1(x): + * From step 1, we have + * expm1(x) = either 2^k*[expm1(r)+1] - 1 + * = or 2^k*[expm1(r) + (1-2^-k)] + * 4. Implementation notes: + * (A). To save one multiplication, we scale the coefficient Qi + * to Qi*2^i, and replace z by (x^2)/2. + * (B). To achieve maximum accuracy, we compute expm1(x) by + * (i) if x < -56*ln2, return -1.0, (raise inexact if x!=inf) + * (ii) if k=0, return r-E + * (iii) if k=-1, return 0.5*(r-E)-0.5 + * (iv) if k=1 if r < -0.25, return 2*((r+0.5)- E) + * else return 1.0+2.0*(r-E); + * (v) if (k<-2||k>56) return 2^k(1-(E-r)) - 1 (or exp(x)-1) + * (vi) if k <= 20, return 2^k((1-2^-k)-(E-r)), else + * (vii) return 2^k(1-((E+2^-k)-r)) + * + * Special cases: + * expm1(INF) is INF, expm1(NaN) is NaN; + * expm1(-INF) is -1, and + * for finite argument, only expm1(0)=0 is exact. + * + * Accuracy: + * according to an error analysis, the error is always less than + * 1 ulp (unit in the last place). + * + * Misc. info. + * For IEEE double + * if x > 7.09782712893383973096e+02 then expm1(x) overflow + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "libm.h" + +static const double +o_threshold = 7.09782712893383973096e+02, /* 0x40862E42, 0xFEFA39EF */ +ln2_hi = 6.93147180369123816490e-01, /* 0x3fe62e42, 0xfee00000 */ +ln2_lo = 1.90821492927058770002e-10, /* 0x3dea39ef, 0x35793c76 */ +invln2 = 1.44269504088896338700e+00, /* 0x3ff71547, 0x652b82fe */ +/* Scaled Q's: Qn_here = 2**n * Qn_above, for R(2*z) where z = hxs = x*x/2: */ +Q1 = -3.33333333333331316428e-02, /* BFA11111 111110F4 */ +Q2 = 1.58730158725481460165e-03, /* 3F5A01A0 19FE5585 */ +Q3 = -7.93650757867487942473e-05, /* BF14CE19 9EAADBB7 */ +Q4 = 4.00821782732936239552e-06, /* 3ED0CFCA 86E65239 */ +Q5 = -2.01099218183624371326e-07; /* BE8AFDB7 6E09C32D */ + +double expm1(double x) +{ + double_t y,hi,lo,c,t,e,hxs,hfx,r1,twopk; + union {double f; uint64_t i;} u = {x}; + uint32_t hx = u.i>>32 & 0x7fffffff; + int k, sign = u.i>>63; + + /* filter out huge and non-finite argument */ + if (hx >= 0x4043687A) { /* if |x|>=56*ln2 */ + if (isnan(x)) + return x; + if (sign) + return -1; + if (x > o_threshold) { + x *= 0x1p1023; + return x; + } + } + + /* argument reduction */ + if (hx > 0x3fd62e42) { /* if |x| > 0.5 ln2 */ + if (hx < 0x3FF0A2B2) { /* and |x| < 1.5 ln2 */ + if (!sign) { + hi = x - ln2_hi; + lo = ln2_lo; + k = 1; + } else { + hi = x + ln2_hi; + lo = -ln2_lo; + k = -1; + } + } else { + k = invln2*x + (sign ? -0.5 : 0.5); + t = k; + hi = x - t*ln2_hi; /* t*ln2_hi is exact here */ + lo = t*ln2_lo; + } + x = hi-lo; + c = (hi-x)-lo; + } else if (hx < 0x3c900000) { /* |x| < 2**-54, return x */ + if (hx < 0x00100000) + FORCE_EVAL((float)x); + return x; + } else + k = 0; + + /* x is now in primary range */ + hfx = 0.5*x; + hxs = x*hfx; + r1 = 1.0+hxs*(Q1+hxs*(Q2+hxs*(Q3+hxs*(Q4+hxs*Q5)))); + t = 3.0-r1*hfx; + e = hxs*((r1-t)/(6.0 - x*t)); + if (k == 0) /* c is 0 */ + return x - (x*e-hxs); + e = x*(e-c) - c; + e -= hxs; + /* exp(x) ~ 2^k (x_reduced - e + 1) */ + if (k == -1) + return 0.5*(x-e) - 0.5; + if (k == 1) { + if (x < -0.25) + return -2.0*(e-(x+0.5)); + return 1.0+2.0*(x-e); + } + u.i = (uint64_t)(0x3ff + k)<<52; /* 2^k */ + twopk = u.f; + if (k < 0 || k > 56) { /* suffice to return exp(x)-1 */ + y = x - e + 1.0; + if (k == 1024) + y = y*2.0*0x1p1023; + else + y = y*twopk; + return y - 1.0; + } + u.i = (uint64_t)(0x3ff - k)<<52; /* 2^-k */ + if (k < 20) + y = (x-e+(1-u.f))*twopk; + else + y = (x-(e+u.f)+1)*twopk; + return y; +} diff --git a/lib/libc/src/musl-math/expm1f.c b/lib/libc/src/musl-math/expm1f.c new file mode 100644 index 0000000..297e0b4 --- /dev/null +++ b/lib/libc/src/musl-math/expm1f.c @@ -0,0 +1,111 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_expm1f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +o_threshold = 8.8721679688e+01, /* 0x42b17180 */ +ln2_hi = 6.9313812256e-01, /* 0x3f317180 */ +ln2_lo = 9.0580006145e-06, /* 0x3717f7d1 */ +invln2 = 1.4426950216e+00, /* 0x3fb8aa3b */ +/* + * Domain [-0.34568, 0.34568], range ~[-6.694e-10, 6.696e-10]: + * |6 / x * (1 + 2 * (1 / (exp(x) - 1) - 1 / x)) - q(x)| < 2**-30.04 + * Scaled coefficients: Qn_here = 2**n * Qn_for_q (see s_expm1.c): + */ +Q1 = -3.3333212137e-2, /* -0x888868.0p-28 */ +Q2 = 1.5807170421e-3; /* 0xcf3010.0p-33 */ + +float expm1f(float x) +{ + float_t y,hi,lo,c,t,e,hxs,hfx,r1,twopk; + union {float f; uint32_t i;} u = {x}; + uint32_t hx = u.i & 0x7fffffff; + int k, sign = u.i >> 31; + + /* filter out huge and non-finite argument */ + if (hx >= 0x4195b844) { /* if |x|>=27*ln2 */ + if (hx > 0x7f800000) /* NaN */ + return x; + if (sign) + return -1; + if (x > o_threshold) { + x *= 0x1p127f; + return x; + } + } + + /* argument reduction */ + if (hx > 0x3eb17218) { /* if |x| > 0.5 ln2 */ + if (hx < 0x3F851592) { /* and |x| < 1.5 ln2 */ + if (!sign) { + hi = x - ln2_hi; + lo = ln2_lo; + k = 1; + } else { + hi = x + ln2_hi; + lo = -ln2_lo; + k = -1; + } + } else { + k = invln2*x + (sign ? -0.5f : 0.5f); + t = k; + hi = x - t*ln2_hi; /* t*ln2_hi is exact here */ + lo = t*ln2_lo; + } + x = hi-lo; + c = (hi-x)-lo; + } else if (hx < 0x33000000) { /* when |x|<2**-25, return x */ + if (hx < 0x00800000) + FORCE_EVAL(x*x); + return x; + } else + k = 0; + + /* x is now in primary range */ + hfx = 0.5f*x; + hxs = x*hfx; + r1 = 1.0f+hxs*(Q1+hxs*Q2); + t = 3.0f - r1*hfx; + e = hxs*((r1-t)/(6.0f - x*t)); + if (k == 0) /* c is 0 */ + return x - (x*e-hxs); + e = x*(e-c) - c; + e -= hxs; + /* exp(x) ~ 2^k (x_reduced - e + 1) */ + if (k == -1) + return 0.5f*(x-e) - 0.5f; + if (k == 1) { + if (x < -0.25f) + return -2.0f*(e-(x+0.5f)); + return 1.0f + 2.0f*(x-e); + } + u.i = (0x7f+k)<<23; /* 2^k */ + twopk = u.f; + if (k < 0 || k > 56) { /* suffice to return exp(x)-1 */ + y = x - e + 1.0f; + if (k == 128) + y = y*2.0f*0x1p127f; + else + y = y*twopk; + return y - 1.0f; + } + u.i = (0x7f-k)<<23; /* 2^-k */ + if (k < 23) + y = (x-e+(1-u.f))*twopk; + else + y = (x-(e+u.f)+1)*twopk; + return y; +} diff --git a/lib/libc/src/musl-math/expm1l.c b/lib/libc/src/musl-math/expm1l.c new file mode 100644 index 0000000..d171507 --- /dev/null +++ b/lib/libc/src/musl-math/expm1l.c @@ -0,0 +1,123 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_expm1l.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Exponential function, minus 1 + * Long double precision + * + * + * SYNOPSIS: + * + * long double x, y, expm1l(); + * + * y = expm1l( x ); + * + * + * DESCRIPTION: + * + * Returns e (2.71828...) raised to the x power, minus 1. + * + * Range reduction is accomplished by separating the argument + * into an integer k and fraction f such that + * + * x k f + * e = 2 e. + * + * An expansion x + .5 x^2 + x^3 R(x) approximates exp(f) - 1 + * in the basic range [-0.5 ln 2, 0.5 ln 2]. + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE -45,+maxarg 200,000 1.2e-19 2.5e-20 + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double expm1l(long double x) +{ + return expm1(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 + +/* exp(x) - 1 = x + 0.5 x^2 + x^3 P(x)/Q(x) + -.5 ln 2 < x < .5 ln 2 + Theoretical peak relative error = 3.4e-22 */ +static const long double +P0 = -1.586135578666346600772998894928250240826E4L, +P1 = 2.642771505685952966904660652518429479531E3L, +P2 = -3.423199068835684263987132888286791620673E2L, +P3 = 1.800826371455042224581246202420972737840E1L, +P4 = -5.238523121205561042771939008061958820811E-1L, +Q0 = -9.516813471998079611319047060563358064497E4L, +Q1 = 3.964866271411091674556850458227710004570E4L, +Q2 = -7.207678383830091850230366618190187434796E3L, +Q3 = 7.206038318724600171970199625081491823079E2L, +Q4 = -4.002027679107076077238836622982900945173E1L, +/* Q5 = 1.000000000000000000000000000000000000000E0 */ +/* C1 + C2 = ln 2 */ +C1 = 6.93145751953125E-1L, +C2 = 1.428606820309417232121458176568075500134E-6L, +/* ln 2^-65 */ +minarg = -4.5054566736396445112120088E1L, +/* ln 2^16384 */ +maxarg = 1.1356523406294143949492E4L; + +long double expm1l(long double x) +{ + long double px, qx, xx; + int k; + + if (isnan(x)) + return x; + if (x > maxarg) + return x*0x1p16383L; /* overflow, unless x==inf */ + if (x == 0.0) + return x; + if (x < minarg) + return -1.0; + + xx = C1 + C2; + /* Express x = ln 2 (k + remainder), remainder not exceeding 1/2. */ + px = floorl(0.5 + x / xx); + k = px; + /* remainder times ln 2 */ + x -= px * C1; + x -= px * C2; + + /* Approximate exp(remainder ln 2).*/ + px = (((( P4 * x + P3) * x + P2) * x + P1) * x + P0) * x; + qx = (((( x + Q4) * x + Q3) * x + Q2) * x + Q1) * x + Q0; + xx = x * x; + qx = x + (0.5 * xx + xx * px / qx); + + /* exp(x) = exp(k ln 2) exp(remainder ln 2) = 2^k exp(remainder ln 2). + We have qx = exp(remainder ln 2) - 1, so + exp(x) - 1 = 2^k (qx + 1) - 1 = 2^k qx + 2^k - 1. */ + px = scalbnl(1.0, k); + x = px * qx + (px - 1.0); + return x; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double expm1l(long double x) +{ + return expm1(x); +} +#endif diff --git a/lib/libc/src/musl-math/fabs.c b/lib/libc/src/musl-math/fabs.c new file mode 100644 index 0000000..e8258cf --- /dev/null +++ b/lib/libc/src/musl-math/fabs.c @@ -0,0 +1,9 @@ +#include <math.h> +#include <stdint.h> + +double fabs(double x) +{ + union {double f; uint64_t i;} u = {x}; + u.i &= -1ULL/2; + return u.f; +} diff --git a/lib/libc/src/musl-math/fabsf.c b/lib/libc/src/musl-math/fabsf.c new file mode 100644 index 0000000..4efc8d6 --- /dev/null +++ b/lib/libc/src/musl-math/fabsf.c @@ -0,0 +1,9 @@ +#include <math.h> +#include <stdint.h> + +float fabsf(float x) +{ + union {float f; uint32_t i;} u = {x}; + u.i &= 0x7fffffff; + return u.f; +} diff --git a/lib/libc/src/musl-math/fabsl.c b/lib/libc/src/musl-math/fabsl.c new file mode 100644 index 0000000..c4f36ec --- /dev/null +++ b/lib/libc/src/musl-math/fabsl.c @@ -0,0 +1,15 @@ +#include "libm.h" +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fabsl(long double x) +{ + return fabs(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double fabsl(long double x) +{ + union ldshape u = {x}; + + u.i.se &= 0x7fff; + return u.f; +} +#endif diff --git a/lib/libc/src/musl-math/fdim.c b/lib/libc/src/musl-math/fdim.c new file mode 100644 index 0000000..9585460 --- /dev/null +++ b/lib/libc/src/musl-math/fdim.c @@ -0,0 +1,10 @@ +#include <math.h> + +double fdim(double x, double y) +{ + if (isnan(x)) + return x; + if (isnan(y)) + return y; + return x > y ? x - y : 0; +} diff --git a/lib/libc/src/musl-math/fdimf.c b/lib/libc/src/musl-math/fdimf.c new file mode 100644 index 0000000..543c364 --- /dev/null +++ b/lib/libc/src/musl-math/fdimf.c @@ -0,0 +1,10 @@ +#include <math.h> + +float fdimf(float x, float y) +{ + if (isnan(x)) + return x; + if (isnan(y)) + return y; + return x > y ? x - y : 0; +} diff --git a/lib/libc/src/musl-math/fdiml.c b/lib/libc/src/musl-math/fdiml.c new file mode 100644 index 0000000..62e29b7 --- /dev/null +++ b/lib/libc/src/musl-math/fdiml.c @@ -0,0 +1,18 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fdiml(long double x, long double y) +{ + return fdim(x, y); +} +#else +long double fdiml(long double x, long double y) +{ + if (isnan(x)) + return x; + if (isnan(y)) + return y; + return x > y ? x - y : 0; +} +#endif diff --git a/lib/libc/src/musl-math/finite.c b/lib/libc/src/musl-math/finite.c new file mode 100644 index 0000000..25a0575 --- /dev/null +++ b/lib/libc/src/musl-math/finite.c @@ -0,0 +1,7 @@ +#define _GNU_SOURCE +#include <math.h> + +int finite(double x) +{ + return isfinite(x); +} diff --git a/lib/libc/src/musl-math/finitef.c b/lib/libc/src/musl-math/finitef.c new file mode 100644 index 0000000..2c4c771 --- /dev/null +++ b/lib/libc/src/musl-math/finitef.c @@ -0,0 +1,7 @@ +#define _GNU_SOURCE +#include <math.h> + +int finitef(float x) +{ + return isfinite(x); +} diff --git a/lib/libc/src/musl-math/floor.c b/lib/libc/src/musl-math/floor.c new file mode 100644 index 0000000..14a31cd --- /dev/null +++ b/lib/libc/src/musl-math/floor.c @@ -0,0 +1,31 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const double_t toint = 1/EPS; + +double floor(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i >> 52 & 0x7ff; + double_t y; + + if (e >= 0x3ff+52 || x == 0) + return x; + /* y = int(x) - x, where int(x) is an integer neighbor of x */ + if (u.i >> 63) + y = x - toint + toint - x; + else + y = x + toint - toint - x; + /* special case because of non-nearest rounding modes */ + if (e <= 0x3ff-1) { + FORCE_EVAL(y); + return u.i >> 63 ? -1 : 0; + } + if (y > 0) + return x + y - 1; + return x + y; +} diff --git a/lib/libc/src/musl-math/floorf.c b/lib/libc/src/musl-math/floorf.c new file mode 100644 index 0000000..dceec73 --- /dev/null +++ b/lib/libc/src/musl-math/floorf.c @@ -0,0 +1,27 @@ +#include "libm.h" + +float floorf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = (int)(u.i >> 23 & 0xff) - 0x7f; + uint32_t m; + + if (e >= 23) + return x; + if (e >= 0) { + m = 0x007fffff >> e; + if ((u.i & m) == 0) + return x; + FORCE_EVAL(x + 0x1p120f); + if (u.i >> 31) + u.i += m; + u.i &= ~m; + } else { + FORCE_EVAL(x + 0x1p120f); + if (u.i >> 31 == 0) + u.i = 0; + else if (u.i << 1) + u.f = -1.0; + } + return u.f; +} diff --git a/lib/libc/src/musl-math/floorl.c b/lib/libc/src/musl-math/floorl.c new file mode 100644 index 0000000..16aaec4 --- /dev/null +++ b/lib/libc/src/musl-math/floorl.c @@ -0,0 +1,34 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double floorl(long double x) +{ + return floor(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double floorl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1 || x == 0) + return x; + /* y = int(x) - x, where int(x) is an integer neighbor of x */ + if (u.i.se >> 15) + y = x - toint + toint - x; + else + y = x + toint - toint - x; + /* special case because of non-nearest rounding modes */ + if (e <= 0x3fff-1) { + FORCE_EVAL(y); + return u.i.se >> 15 ? -1 : 0; + } + if (y > 0) + return x + y - 1; + return x + y; +} +#endif diff --git a/lib/libc/src/musl-math/fmaf.c b/lib/libc/src/musl-math/fmaf.c new file mode 100644 index 0000000..aa57feb --- /dev/null +++ b/lib/libc/src/musl-math/fmaf.c @@ -0,0 +1,93 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_fmaf.c */ +/*- + * Copyright (c) 2005-2011 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#include <fenv.h> +#include <math.h> +#include <stdint.h> + +/* + * Fused multiply-add: Compute x * y + z with a single rounding error. + * + * A double has more than twice as much precision than a float, so + * direct double-precision arithmetic suffices, except where double + * rounding occurs. + */ +float fmaf(float x, float y, float z) +{ + #pragma STDC FENV_ACCESS ON + double xy, result; + union {double f; uint64_t i;} u; + int e; + + xy = (double)x * y; + result = xy + z; + u.f = result; + e = u.i>>52 & 0x7ff; + /* Common case: The double precision result is fine. */ + if ((u.i & 0x1fffffff) != 0x10000000 || /* not a halfway case */ + e == 0x7ff || /* NaN */ + result - xy == z || /* exact */ + fegetround() != FE_TONEAREST) /* not round-to-nearest */ + { + /* + underflow may not be raised correctly, example: + fmaf(0x1p-120f, 0x1p-120f, 0x1p-149f) + */ +#if defined(FE_INEXACT) && defined(FE_UNDERFLOW) + if (e < 0x3ff-126 && e >= 0x3ff-149 && fetestexcept(FE_INEXACT)) { + feclearexcept(FE_INEXACT); + /* TODO: gcc and clang bug workaround */ + volatile float vz = z; + result = xy + vz; + if (fetestexcept(FE_INEXACT)) + feraiseexcept(FE_UNDERFLOW); + else + feraiseexcept(FE_INEXACT); + } +#endif + z = result; + return z; + } + + /* + * If result is inexact, and exactly halfway between two float values, + * we need to adjust the low-order bit in the direction of the error. + */ +#ifdef FE_TOWARDZERO + fesetround(FE_TOWARDZERO); +#endif + volatile double vxy = xy; /* XXX work around gcc CSE bug */ + double adjusted_result = vxy + z; + fesetround(FE_TONEAREST); + if (result == adjusted_result) { + u.f = adjusted_result; + u.i++; + adjusted_result = u.f; + } + z = adjusted_result; + return z; +} diff --git a/lib/libc/src/musl-math/fmal.c b/lib/libc/src/musl-math/fmal.c new file mode 100644 index 0000000..4506aac --- /dev/null +++ b/lib/libc/src/musl-math/fmal.c @@ -0,0 +1,293 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_fmal.c */ +/*- + * Copyright (c) 2005-2011 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + + +#include "libm.h" +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fmal(long double x, long double y, long double z) +{ + return fma(x, y, z); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#include <fenv.h> +#if LDBL_MANT_DIG == 64 +#define LASTBIT(u) (u.i.m & 1) +#define SPLIT (0x1p32L + 1) +#elif LDBL_MANT_DIG == 113 +#define LASTBIT(u) (u.i.lo & 1) +#define SPLIT (0x1p57L + 1) +#endif + +/* + * A struct dd represents a floating-point number with twice the precision + * of a long double. We maintain the invariant that "hi" stores the high-order + * bits of the result. + */ +struct dd { + long double hi; + long double lo; +}; + +/* + * Compute a+b exactly, returning the exact result in a struct dd. We assume + * that both a and b are finite, but make no assumptions about their relative + * magnitudes. + */ +static inline struct dd dd_add(long double a, long double b) +{ + struct dd ret; + long double s; + + ret.hi = a + b; + s = ret.hi - a; + ret.lo = (a - (ret.hi - s)) + (b - s); + return (ret); +} + +/* + * Compute a+b, with a small tweak: The least significant bit of the + * result is adjusted into a sticky bit summarizing all the bits that + * were lost to rounding. This adjustment negates the effects of double + * rounding when the result is added to another number with a higher + * exponent. For an explanation of round and sticky bits, see any reference + * on FPU design, e.g., + * + * J. Coonen. An Implementation Guide to a Proposed Standard for + * Floating-Point Arithmetic. Computer, vol. 13, no. 1, Jan 1980. + */ +static inline long double add_adjusted(long double a, long double b) +{ + struct dd sum; + union ldshape u; + + sum = dd_add(a, b); + if (sum.lo != 0) { + u.f = sum.hi; + if (!LASTBIT(u)) + sum.hi = nextafterl(sum.hi, INFINITY * sum.lo); + } + return (sum.hi); +} + +/* + * Compute ldexp(a+b, scale) with a single rounding error. It is assumed + * that the result will be subnormal, and care is taken to ensure that + * double rounding does not occur. + */ +static inline long double add_and_denormalize(long double a, long double b, int scale) +{ + struct dd sum; + int bits_lost; + union ldshape u; + + sum = dd_add(a, b); + + /* + * If we are losing at least two bits of accuracy to denormalization, + * then the first lost bit becomes a round bit, and we adjust the + * lowest bit of sum.hi to make it a sticky bit summarizing all the + * bits in sum.lo. With the sticky bit adjusted, the hardware will + * break any ties in the correct direction. + * + * If we are losing only one bit to denormalization, however, we must + * break the ties manually. + */ + if (sum.lo != 0) { + u.f = sum.hi; + bits_lost = -u.i.se - scale + 1; + if ((bits_lost != 1) ^ LASTBIT(u)) + sum.hi = nextafterl(sum.hi, INFINITY * sum.lo); + } + return scalbnl(sum.hi, scale); +} + +/* + * Compute a*b exactly, returning the exact result in a struct dd. We assume + * that both a and b are normalized, so no underflow or overflow will occur. + * The current rounding mode must be round-to-nearest. + */ +static inline struct dd dd_mul(long double a, long double b) +{ + struct dd ret; + long double ha, hb, la, lb, p, q; + + p = a * SPLIT; + ha = a - p; + ha += p; + la = a - ha; + + p = b * SPLIT; + hb = b - p; + hb += p; + lb = b - hb; + + p = ha * hb; + q = ha * lb + la * hb; + + ret.hi = p + q; + ret.lo = p - ret.hi + q + la * lb; + return (ret); +} + +/* + * Fused multiply-add: Compute x * y + z with a single rounding error. + * + * We use scaling to avoid overflow/underflow, along with the + * canonical precision-doubling technique adapted from: + * + * Dekker, T. A Floating-Point Technique for Extending the + * Available Precision. Numer. Math. 18, 224-242 (1971). + */ +long double fmal(long double x, long double y, long double z) +{ + #pragma STDC FENV_ACCESS ON + long double xs, ys, zs, adj; + struct dd xy, r; + int oround; + int ex, ey, ez; + int spread; + + /* + * Handle special cases. The order of operations and the particular + * return values here are crucial in handling special cases involving + * infinities, NaNs, overflows, and signed zeroes correctly. + */ + if (!isfinite(x) || !isfinite(y)) + return (x * y + z); + if (!isfinite(z)) + return (z); + if (x == 0.0 || y == 0.0) + return (x * y + z); + if (z == 0.0) + return (x * y); + + xs = frexpl(x, &ex); + ys = frexpl(y, &ey); + zs = frexpl(z, &ez); + oround = fegetround(); + spread = ex + ey - ez; + + /* + * If x * y and z are many orders of magnitude apart, the scaling + * will overflow, so we handle these cases specially. Rounding + * modes other than FE_TONEAREST are painful. + */ + if (spread < -LDBL_MANT_DIG) { +#ifdef FE_INEXACT + feraiseexcept(FE_INEXACT); +#endif +#ifdef FE_UNDERFLOW + if (!isnormal(z)) + feraiseexcept(FE_UNDERFLOW); +#endif + switch (oround) { + default: /* FE_TONEAREST */ + return (z); +#ifdef FE_TOWARDZERO + case FE_TOWARDZERO: + if (x > 0.0 ^ y < 0.0 ^ z < 0.0) + return (z); + else + return (nextafterl(z, 0)); +#endif +#ifdef FE_DOWNWARD + case FE_DOWNWARD: + if (x > 0.0 ^ y < 0.0) + return (z); + else + return (nextafterl(z, -INFINITY)); +#endif +#ifdef FE_UPWARD + case FE_UPWARD: + if (x > 0.0 ^ y < 0.0) + return (nextafterl(z, INFINITY)); + else + return (z); +#endif + } + } + if (spread <= LDBL_MANT_DIG * 2) + zs = scalbnl(zs, -spread); + else + zs = copysignl(LDBL_MIN, zs); + + fesetround(FE_TONEAREST); + + /* + * Basic approach for round-to-nearest: + * + * (xy.hi, xy.lo) = x * y (exact) + * (r.hi, r.lo) = xy.hi + z (exact) + * adj = xy.lo + r.lo (inexact; low bit is sticky) + * result = r.hi + adj (correctly rounded) + */ + xy = dd_mul(xs, ys); + r = dd_add(xy.hi, zs); + + spread = ex + ey; + + if (r.hi == 0.0) { + /* + * When the addends cancel to 0, ensure that the result has + * the correct sign. + */ + fesetround(oround); + volatile long double vzs = zs; /* XXX gcc CSE bug workaround */ + return xy.hi + vzs + scalbnl(xy.lo, spread); + } + + if (oround != FE_TONEAREST) { + /* + * There is no need to worry about double rounding in directed + * rounding modes. + * But underflow may not be raised correctly, example in downward rounding: + * fmal(0x1.0000000001p-16000L, 0x1.0000000001p-400L, -0x1p-16440L) + */ + long double ret; +#if defined(FE_INEXACT) && defined(FE_UNDERFLOW) + int e = fetestexcept(FE_INEXACT); + feclearexcept(FE_INEXACT); +#endif + fesetround(oround); + adj = r.lo + xy.lo; + ret = scalbnl(r.hi + adj, spread); +#if defined(FE_INEXACT) && defined(FE_UNDERFLOW) + if (ilogbl(ret) < -16382 && fetestexcept(FE_INEXACT)) + feraiseexcept(FE_UNDERFLOW); + else if (e) + feraiseexcept(FE_INEXACT); +#endif + return ret; + } + + adj = add_adjusted(r.lo, xy.lo); + if (spread + ilogbl(r.hi) > -16383) + return scalbnl(r.hi + adj, spread); + else + return add_and_denormalize(r.hi, adj, spread); +} +#endif diff --git a/lib/libc/src/musl-math/fmax.c b/lib/libc/src/musl-math/fmax.c new file mode 100644 index 0000000..94f0caa --- /dev/null +++ b/lib/libc/src/musl-math/fmax.c @@ -0,0 +1,13 @@ +#include <math.h> + +double fmax(double x, double y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? y : x; + return x < y ? y : x; +} diff --git a/lib/libc/src/musl-math/fmaxf.c b/lib/libc/src/musl-math/fmaxf.c new file mode 100644 index 0000000..695d817 --- /dev/null +++ b/lib/libc/src/musl-math/fmaxf.c @@ -0,0 +1,13 @@ +#include <math.h> + +float fmaxf(float x, float y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeroes, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? y : x; + return x < y ? y : x; +} diff --git a/lib/libc/src/musl-math/fmaxl.c b/lib/libc/src/musl-math/fmaxl.c new file mode 100644 index 0000000..4b03158 --- /dev/null +++ b/lib/libc/src/musl-math/fmaxl.c @@ -0,0 +1,21 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fmaxl(long double x, long double y) +{ + return fmax(x, y); +} +#else +long double fmaxl(long double x, long double y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? y : x; + return x < y ? y : x; +} +#endif diff --git a/lib/libc/src/musl-math/fmin.c b/lib/libc/src/musl-math/fmin.c new file mode 100644 index 0000000..08a8fd1 --- /dev/null +++ b/lib/libc/src/musl-math/fmin.c @@ -0,0 +1,13 @@ +#include <math.h> + +double fmin(double x, double y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? x : y; + return x < y ? x : y; +} diff --git a/lib/libc/src/musl-math/fminf.c b/lib/libc/src/musl-math/fminf.c new file mode 100644 index 0000000..3573c7d --- /dev/null +++ b/lib/libc/src/musl-math/fminf.c @@ -0,0 +1,13 @@ +#include <math.h> + +float fminf(float x, float y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? x : y; + return x < y ? x : y; +} diff --git a/lib/libc/src/musl-math/fminl.c b/lib/libc/src/musl-math/fminl.c new file mode 100644 index 0000000..69bc24a --- /dev/null +++ b/lib/libc/src/musl-math/fminl.c @@ -0,0 +1,21 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fminl(long double x, long double y) +{ + return fmin(x, y); +} +#else +long double fminl(long double x, long double y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? x : y; + return x < y ? x : y; +} +#endif diff --git a/lib/libc/src/musl-math/fmod.c b/lib/libc/src/musl-math/fmod.c new file mode 100644 index 0000000..6849722 --- /dev/null +++ b/lib/libc/src/musl-math/fmod.c @@ -0,0 +1,68 @@ +#include <math.h> +#include <stdint.h> + +double fmod(double x, double y) +{ + union {double f; uint64_t i;} ux = {x}, uy = {y}; + int ex = ux.i>>52 & 0x7ff; + int ey = uy.i>>52 & 0x7ff; + int sx = ux.i>>63; + uint64_t i; + + /* in the followings uxi should be ux.i, but then gcc wrongly adds */ + /* float load/store to inner loops ruining performance and code size */ + uint64_t uxi = ux.i; + + if (uy.i<<1 == 0 || isnan(y) || ex == 0x7ff) + return (x*y)/(x*y); + if (uxi<<1 <= uy.i<<1) { + if (uxi<<1 == uy.i<<1) + return 0*x; + return x; + } + + /* normalize x and y */ + if (!ex) { + for (i = uxi<<12; i>>63 == 0; ex--, i <<= 1); + uxi <<= -ex + 1; + } else { + uxi &= -1ULL >> 12; + uxi |= 1ULL << 52; + } + if (!ey) { + for (i = uy.i<<12; i>>63 == 0; ey--, i <<= 1); + uy.i <<= -ey + 1; + } else { + uy.i &= -1ULL >> 12; + uy.i |= 1ULL << 52; + } + + /* x mod y */ + for (; ex > ey; ex--) { + i = uxi - uy.i; + if (i >> 63 == 0) { + if (i == 0) + return 0*x; + uxi = i; + } + uxi <<= 1; + } + i = uxi - uy.i; + if (i >> 63 == 0) { + if (i == 0) + return 0*x; + uxi = i; + } + for (; uxi>>52 == 0; uxi <<= 1, ex--); + + /* scale result */ + if (ex > 0) { + uxi -= 1ULL << 52; + uxi |= (uint64_t)ex << 52; + } else { + uxi >>= -ex + 1; + } + uxi |= (uint64_t)sx << 63; + ux.i = uxi; + return ux.f; +} diff --git a/lib/libc/src/musl-math/fmodf.c b/lib/libc/src/musl-math/fmodf.c new file mode 100644 index 0000000..ff58f93 --- /dev/null +++ b/lib/libc/src/musl-math/fmodf.c @@ -0,0 +1,65 @@ +#include <math.h> +#include <stdint.h> + +float fmodf(float x, float y) +{ + union {float f; uint32_t i;} ux = {x}, uy = {y}; + int ex = ux.i>>23 & 0xff; + int ey = uy.i>>23 & 0xff; + uint32_t sx = ux.i & 0x80000000; + uint32_t i; + uint32_t uxi = ux.i; + + if (uy.i<<1 == 0 || isnan(y) || ex == 0xff) + return (x*y)/(x*y); + if (uxi<<1 <= uy.i<<1) { + if (uxi<<1 == uy.i<<1) + return 0*x; + return x; + } + + /* normalize x and y */ + if (!ex) { + for (i = uxi<<9; i>>31 == 0; ex--, i <<= 1); + uxi <<= -ex + 1; + } else { + uxi &= -1U >> 9; + uxi |= 1U << 23; + } + if (!ey) { + for (i = uy.i<<9; i>>31 == 0; ey--, i <<= 1); + uy.i <<= -ey + 1; + } else { + uy.i &= -1U >> 9; + uy.i |= 1U << 23; + } + + /* x mod y */ + for (; ex > ey; ex--) { + i = uxi - uy.i; + if (i >> 31 == 0) { + if (i == 0) + return 0*x; + uxi = i; + } + uxi <<= 1; + } + i = uxi - uy.i; + if (i >> 31 == 0) { + if (i == 0) + return 0*x; + uxi = i; + } + for (; uxi>>23 == 0; uxi <<= 1, ex--); + + /* scale result up */ + if (ex > 0) { + uxi -= 1U << 23; + uxi |= (uint32_t)ex << 23; + } else { + uxi >>= -ex + 1; + } + uxi |= sx; + ux.i = uxi; + return ux.f; +} diff --git a/lib/libc/src/musl-math/fmodl.c b/lib/libc/src/musl-math/fmodl.c new file mode 100644 index 0000000..9f5b873 --- /dev/null +++ b/lib/libc/src/musl-math/fmodl.c @@ -0,0 +1,105 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fmodl(long double x, long double y) +{ + return fmod(x, y); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double fmodl(long double x, long double y) +{ + union ldshape ux = {x}, uy = {y}; + int ex = ux.i.se & 0x7fff; + int ey = uy.i.se & 0x7fff; + int sx = ux.i.se & 0x8000; + + if (y == 0 || isnan(y) || ex == 0x7fff) + return (x*y)/(x*y); + ux.i.se = ex; + uy.i.se = ey; + if (ux.f <= uy.f) { + if (ux.f == uy.f) + return 0*x; + return x; + } + + /* normalize x and y */ + if (!ex) { + ux.f *= 0x1p120f; + ex = ux.i.se - 120; + } + if (!ey) { + uy.f *= 0x1p120f; + ey = uy.i.se - 120; + } + + /* x mod y */ +#if LDBL_MANT_DIG == 64 + uint64_t i, mx, my; + mx = ux.i.m; + my = uy.i.m; + for (; ex > ey; ex--) { + i = mx - my; + if (mx >= my) { + if (i == 0) + return 0*x; + mx = 2*i; + } else if (2*mx < mx) { + mx = 2*mx - my; + } else { + mx = 2*mx; + } + } + i = mx - my; + if (mx >= my) { + if (i == 0) + return 0*x; + mx = i; + } + for (; mx >> 63 == 0; mx *= 2, ex--); + ux.i.m = mx; +#elif LDBL_MANT_DIG == 113 + uint64_t hi, lo, xhi, xlo, yhi, ylo; + xhi = (ux.i2.hi & -1ULL>>16) | 1ULL<<48; + yhi = (uy.i2.hi & -1ULL>>16) | 1ULL<<48; + xlo = ux.i2.lo; + ylo = uy.i2.lo; + for (; ex > ey; ex--) { + hi = xhi - yhi; + lo = xlo - ylo; + if (xlo < ylo) + hi -= 1; + if (hi >> 63 == 0) { + if ((hi|lo) == 0) + return 0*x; + xhi = 2*hi + (lo>>63); + xlo = 2*lo; + } else { + xhi = 2*xhi + (xlo>>63); + xlo = 2*xlo; + } + } + hi = xhi - yhi; + lo = xlo - ylo; + if (xlo < ylo) + hi -= 1; + if (hi >> 63 == 0) { + if ((hi|lo) == 0) + return 0*x; + xhi = hi; + xlo = lo; + } + for (; xhi >> 48 == 0; xhi = 2*xhi + (xlo>>63), xlo = 2*xlo, ex--); + ux.i2.hi = xhi; + ux.i2.lo = xlo; +#endif + + /* scale result */ + if (ex <= 0) { + ux.i.se = (ex+120)|sx; + ux.f *= 0x1p-120f; + } else + ux.i.se = ex|sx; + return ux.f; +} +#endif diff --git a/lib/libc/src/musl-math/frexp.c b/lib/libc/src/musl-math/frexp.c new file mode 100644 index 0000000..abac0ea --- /dev/null +++ b/lib/libc/src/musl-math/frexp.c @@ -0,0 +1,24 @@ +#include <math.h> +#include <stdint.h> + +double frexp(double x, int *e) +{ + union { double d; uint64_t i; } y = { x }; + int ee = y.i>>52 & 0x7ff; + + if (!ee) { + if (x) { + x = frexp(x*0x1p64, e); + *e -= 64; + } else *e = 0; + return x; + } else if (ee == 0x7ff) { + *e = 0; + return x; + } + + *e = ee - 0x3fe; + y.i &= 0x800fffffffffffffull; + y.i |= 0x3fe0000000000000ull; + return y.d; +} diff --git a/lib/libc/src/musl-math/frexpf.c b/lib/libc/src/musl-math/frexpf.c new file mode 100644 index 0000000..2dabe37 --- /dev/null +++ b/lib/libc/src/musl-math/frexpf.c @@ -0,0 +1,24 @@ +#include <math.h> +#include <stdint.h> + +float frexpf(float x, int *e) +{ + union { float f; uint32_t i; } y = { x }; + int ee = y.i>>23 & 0xff; + + if (!ee) { + if (x) { + x = frexpf(x*0x1p64, e); + *e -= 64; + } else *e = 0; + return x; + } else if (ee == 0xff) { + *e = 0; + return x; + } + + *e = ee - 0x7e; + y.i &= 0x807ffffful; + y.i |= 0x3f000000ul; + return y.f; +} diff --git a/lib/libc/src/musl-math/frexpl.c b/lib/libc/src/musl-math/frexpl.c new file mode 100644 index 0000000..e05cf75 --- /dev/null +++ b/lib/libc/src/musl-math/frexpl.c @@ -0,0 +1,30 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double frexpl(long double x, int *e) +{ + return frexp(x, e); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double frexpl(long double x, int *e) +{ + union ldshape u = {x}; + int ee = u.i.se & 0x7fff; + + if (!ee) { + if (x) { + x = frexpl(x*0x1p120, e); + *e -= 120; + } else *e = 0; + return x; + } else if (ee == 0x7fff) { + *e = 0; + return x; + } + + *e = ee - 0x3ffe; + u.i.se &= 0x8000; + u.i.se |= 0x3ffe; + return u.f; +} +#endif diff --git a/lib/libc/src/musl-math/hypot.c b/lib/libc/src/musl-math/hypot.c new file mode 100644 index 0000000..6071bf1 --- /dev/null +++ b/lib/libc/src/musl-math/hypot.c @@ -0,0 +1,67 @@ +#include <math.h> +#include <stdint.h> +#include <float.h> + +#if FLT_EVAL_METHOD > 1U && LDBL_MANT_DIG == 64 +#define SPLIT (0x1p32 + 1) +#else +#define SPLIT (0x1p27 + 1) +#endif + +static void sq(double_t *hi, double_t *lo, double x) +{ + double_t xh, xl, xc; + + xc = (double_t)x*SPLIT; + xh = x - xc + xc; + xl = x - xh; + *hi = (double_t)x*x; + *lo = xh*xh - *hi + 2*xh*xl + xl*xl; +} + +double hypot(double x, double y) +{ + union {double f; uint64_t i;} ux = {x}, uy = {y}, ut; + int ex, ey; + double_t hx, lx, hy, ly, z; + + /* arrange |x| >= |y| */ + ux.i &= -1ULL>>1; + uy.i &= -1ULL>>1; + if (ux.i < uy.i) { + ut = ux; + ux = uy; + uy = ut; + } + + /* special cases */ + ex = ux.i>>52; + ey = uy.i>>52; + x = ux.f; + y = uy.f; + /* note: hypot(inf,nan) == inf */ + if (ey == 0x7ff) + return y; + if (ex == 0x7ff || uy.i == 0) + return x; + /* note: hypot(x,y) ~= x + y*y/x/2 with inexact for small y/x */ + /* 64 difference is enough for ld80 double_t */ + if (ex - ey > 64) + return x + y; + + /* precise sqrt argument in nearest rounding mode without overflow */ + /* xh*xh must not overflow and xl*xl must not underflow in sq */ + z = 1; + if (ex > 0x3ff+510) { + z = 0x1p700; + x *= 0x1p-700; + y *= 0x1p-700; + } else if (ey < 0x3ff-450) { + z = 0x1p-700; + x *= 0x1p700; + y *= 0x1p700; + } + sq(&hx, &lx, x); + sq(&hy, &ly, y); + return z*sqrt(ly+lx+hy+hx); +} diff --git a/lib/libc/src/musl-math/hypotf.c b/lib/libc/src/musl-math/hypotf.c new file mode 100644 index 0000000..2fc214b --- /dev/null +++ b/lib/libc/src/musl-math/hypotf.c @@ -0,0 +1,35 @@ +#include <math.h> +#include <stdint.h> + +float hypotf(float x, float y) +{ + union {float f; uint32_t i;} ux = {x}, uy = {y}, ut; + float_t z; + + ux.i &= -1U>>1; + uy.i &= -1U>>1; + if (ux.i < uy.i) { + ut = ux; + ux = uy; + uy = ut; + } + + x = ux.f; + y = uy.f; + if (uy.i == 0xff<<23) + return y; + if (ux.i >= 0xff<<23 || uy.i == 0 || ux.i - uy.i >= 25<<23) + return x + y; + + z = 1; + if (ux.i >= (0x7f+60)<<23) { + z = 0x1p90f; + x *= 0x1p-90f; + y *= 0x1p-90f; + } else if (uy.i < (0x7f-60)<<23) { + z = 0x1p-90f; + x *= 0x1p90f; + y *= 0x1p90f; + } + return z*sqrtf((double)x*x + (double)y*y); +} diff --git a/lib/libc/src/musl-math/hypotl.c b/lib/libc/src/musl-math/hypotl.c new file mode 100644 index 0000000..479aa92 --- /dev/null +++ b/lib/libc/src/musl-math/hypotl.c @@ -0,0 +1,66 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double hypotl(long double x, long double y) +{ + return hypot(x, y); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#if LDBL_MANT_DIG == 64 +#define SPLIT (0x1p32L+1) +#elif LDBL_MANT_DIG == 113 +#define SPLIT (0x1p57L+1) +#endif + +static void sq(long double *hi, long double *lo, long double x) +{ + long double xh, xl, xc; + xc = x*SPLIT; + xh = x - xc + xc; + xl = x - xh; + *hi = x*x; + *lo = xh*xh - *hi + 2*xh*xl + xl*xl; +} + +long double hypotl(long double x, long double y) +{ + union ldshape ux = {x}, uy = {y}; + int ex, ey; + long double hx, lx, hy, ly, z; + + ux.i.se &= 0x7fff; + uy.i.se &= 0x7fff; + if (ux.i.se < uy.i.se) { + ex = uy.i.se; + ey = ux.i.se; + x = uy.f; + y = ux.f; + } else { + ex = ux.i.se; + ey = uy.i.se; + x = ux.f; + y = uy.f; + } + + if (ex == 0x7fff && isinf(y)) + return y; + if (ex == 0x7fff || y == 0) + return x; + if (ex - ey > LDBL_MANT_DIG) + return x + y; + + z = 1; + if (ex > 0x3fff+8000) { + z = 0x1p10000L; + x *= 0x1p-10000L; + y *= 0x1p-10000L; + } else if (ey < 0x3fff-8000) { + z = 0x1p-10000L; + x *= 0x1p10000L; + y *= 0x1p10000L; + } + sq(&hx, &lx, x); + sq(&hy, &ly, y); + return z*sqrtl(ly+lx+hy+hx); +} +#endif diff --git a/lib/libc/src/musl-math/ilogb.c b/lib/libc/src/musl-math/ilogb.c new file mode 100644 index 0000000..64d4015 --- /dev/null +++ b/lib/libc/src/musl-math/ilogb.c @@ -0,0 +1,26 @@ +#include <limits.h> +#include "libm.h" + +int ilogb(double x) +{ + #pragma STDC FENV_ACCESS ON + union {double f; uint64_t i;} u = {x}; + uint64_t i = u.i; + int e = i>>52 & 0x7ff; + + if (!e) { + i <<= 12; + if (i == 0) { + FORCE_EVAL(0/0.0f); + return FP_ILOGB0; + } + /* subnormal x */ + for (e = -0x3ff; i>>63 == 0; e--, i<<=1); + return e; + } + if (e == 0x7ff) { + FORCE_EVAL(0/0.0f); + return i<<12 ? FP_ILOGBNAN : INT_MAX; + } + return e - 0x3ff; +} diff --git a/lib/libc/src/musl-math/ilogbf.c b/lib/libc/src/musl-math/ilogbf.c new file mode 100644 index 0000000..e23ba20 --- /dev/null +++ b/lib/libc/src/musl-math/ilogbf.c @@ -0,0 +1,26 @@ +#include <limits.h> +#include "libm.h" + +int ilogbf(float x) +{ + #pragma STDC FENV_ACCESS ON + union {float f; uint32_t i;} u = {x}; + uint32_t i = u.i; + int e = i>>23 & 0xff; + + if (!e) { + i <<= 9; + if (i == 0) { + FORCE_EVAL(0/0.0f); + return FP_ILOGB0; + } + /* subnormal x */ + for (e = -0x7f; i>>31 == 0; e--, i<<=1); + return e; + } + if (e == 0xff) { + FORCE_EVAL(0/0.0f); + return i<<9 ? FP_ILOGBNAN : INT_MAX; + } + return e - 0x7f; +} diff --git a/lib/libc/src/musl-math/ilogbl.c b/lib/libc/src/musl-math/ilogbl.c new file mode 100644 index 0000000..7b1a9cf --- /dev/null +++ b/lib/libc/src/musl-math/ilogbl.c @@ -0,0 +1,55 @@ +#include <limits.h> +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +int ilogbl(long double x) +{ + return ilogb(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +int ilogbl(long double x) +{ + #pragma STDC FENV_ACCESS ON + union ldshape u = {x}; + uint64_t m = u.i.m; + int e = u.i.se & 0x7fff; + + if (!e) { + if (m == 0) { + FORCE_EVAL(0/0.0f); + return FP_ILOGB0; + } + /* subnormal x */ + for (e = -0x3fff+1; m>>63 == 0; e--, m<<=1); + return e; + } + if (e == 0x7fff) { + FORCE_EVAL(0/0.0f); + return m<<1 ? FP_ILOGBNAN : INT_MAX; + } + return e - 0x3fff; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +int ilogbl(long double x) +{ + #pragma STDC FENV_ACCESS ON + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + + if (!e) { + if (x == 0) { + FORCE_EVAL(0/0.0f); + return FP_ILOGB0; + } + /* subnormal x */ + x *= 0x1p120; + return ilogbl(x) - 120; + } + if (e == 0x7fff) { + FORCE_EVAL(0/0.0f); + u.i.se = 0; + return u.f ? FP_ILOGBNAN : INT_MAX; + } + return e - 0x3fff; +} +#endif diff --git a/lib/libc/src/musl-math/j0.c b/lib/libc/src/musl-math/j0.c new file mode 100644 index 0000000..d722d94 --- /dev/null +++ b/lib/libc/src/musl-math/j0.c @@ -0,0 +1,375 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_j0.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* j0(x), y0(x) + * Bessel function of the first and second kinds of order zero. + * Method -- j0(x): + * 1. For tiny x, we use j0(x) = 1 - x^2/4 + x^4/64 - ... + * 2. Reduce x to |x| since j0(x)=j0(-x), and + * for x in (0,2) + * j0(x) = 1-z/4+ z^2*R0/S0, where z = x*x; + * (precision: |j0-1+z/4-z^2R0/S0 |<2**-63.67 ) + * for x in (2,inf) + * j0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)-q0(x)*sin(x0)) + * where x0 = x-pi/4. It is better to compute sin(x0),cos(x0) + * as follow: + * cos(x0) = cos(x)cos(pi/4)+sin(x)sin(pi/4) + * = 1/sqrt(2) * (cos(x) + sin(x)) + * sin(x0) = sin(x)cos(pi/4)-cos(x)sin(pi/4) + * = 1/sqrt(2) * (sin(x) - cos(x)) + * (To avoid cancellation, use + * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) + * to compute the worse one.) + * + * 3 Special cases + * j0(nan)= nan + * j0(0) = 1 + * j0(inf) = 0 + * + * Method -- y0(x): + * 1. For x<2. + * Since + * y0(x) = 2/pi*(j0(x)*(ln(x/2)+Euler) + x^2/4 - ...) + * therefore y0(x)-2/pi*j0(x)*ln(x) is an even function. + * We use the following function to approximate y0, + * y0(x) = U(z)/V(z) + (2/pi)*(j0(x)*ln(x)), z= x^2 + * where + * U(z) = u00 + u01*z + ... + u06*z^6 + * V(z) = 1 + v01*z + ... + v04*z^4 + * with absolute approximation error bounded by 2**-72. + * Note: For tiny x, U/V = u0 and j0(x)~1, hence + * y0(tiny) = u0 + (2/pi)*ln(tiny), (choose tiny<2**-27) + * 2. For x>=2. + * y0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)+q0(x)*sin(x0)) + * where x0 = x-pi/4. It is better to compute sin(x0),cos(x0) + * by the method mentioned above. + * 3. Special cases: y0(0)=-inf, y0(x<0)=NaN, y0(inf)=0. + */ + +#include "libm.h" + +static double pzero(double), qzero(double); + +static const double +invsqrtpi = 5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */ +tpi = 6.36619772367581382433e-01; /* 0x3FE45F30, 0x6DC9C883 */ + +/* common method when |x|>=2 */ +static double common(uint32_t ix, double x, int y0) +{ + double s,c,ss,cc,z; + + /* + * j0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x-pi/4)-q0(x)*sin(x-pi/4)) + * y0(x) = sqrt(2/(pi*x))*(p0(x)*sin(x-pi/4)+q0(x)*cos(x-pi/4)) + * + * sin(x-pi/4) = (sin(x) - cos(x))/sqrt(2) + * cos(x-pi/4) = (sin(x) + cos(x))/sqrt(2) + * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) + */ + s = sin(x); + c = cos(x); + if (y0) + c = -c; + cc = s+c; + /* avoid overflow in 2*x, big ulp error when x>=0x1p1023 */ + if (ix < 0x7fe00000) { + ss = s-c; + z = -cos(2*x); + if (s*c < 0) + cc = z/ss; + else + ss = z/cc; + if (ix < 0x48000000) { + if (y0) + ss = -ss; + cc = pzero(x)*cc-qzero(x)*ss; + } + } + return invsqrtpi*cc/sqrt(x); +} + +/* R0/S0 on [0, 2.00] */ +static const double +R02 = 1.56249999999999947958e-02, /* 0x3F8FFFFF, 0xFFFFFFFD */ +R03 = -1.89979294238854721751e-04, /* 0xBF28E6A5, 0xB61AC6E9 */ +R04 = 1.82954049532700665670e-06, /* 0x3EBEB1D1, 0x0C503919 */ +R05 = -4.61832688532103189199e-09, /* 0xBE33D5E7, 0x73D63FCE */ +S01 = 1.56191029464890010492e-02, /* 0x3F8FFCE8, 0x82C8C2A4 */ +S02 = 1.16926784663337450260e-04, /* 0x3F1EA6D2, 0xDD57DBF4 */ +S03 = 5.13546550207318111446e-07, /* 0x3EA13B54, 0xCE84D5A9 */ +S04 = 1.16614003333790000205e-09; /* 0x3E1408BC, 0xF4745D8F */ + +double j0(double x) +{ + double z,r,s; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* j0(+-inf)=0, j0(nan)=nan */ + if (ix >= 0x7ff00000) + return 1/(x*x); + x = fabs(x); + + if (ix >= 0x40000000) { /* |x| >= 2 */ + /* large ulp error near zeros: 2.4, 5.52, 8.6537,.. */ + return common(ix,x,0); + } + + /* 1 - x*x/4 + x*x*R(x^2)/S(x^2) */ + if (ix >= 0x3f200000) { /* |x| >= 2**-13 */ + /* up to 4ulp error close to 2 */ + z = x*x; + r = z*(R02+z*(R03+z*(R04+z*R05))); + s = 1+z*(S01+z*(S02+z*(S03+z*S04))); + return (1+x/2)*(1-x/2) + z*(r/s); + } + + /* 1 - x*x/4 */ + /* prevent underflow */ + /* inexact should be raised when x!=0, this is not done correctly */ + if (ix >= 0x38000000) /* |x| >= 2**-127 */ + x = 0.25*x*x; + return 1 - x; +} + +static const double +u00 = -7.38042951086872317523e-02, /* 0xBFB2E4D6, 0x99CBD01F */ +u01 = 1.76666452509181115538e-01, /* 0x3FC69D01, 0x9DE9E3FC */ +u02 = -1.38185671945596898896e-02, /* 0xBF8C4CE8, 0xB16CFA97 */ +u03 = 3.47453432093683650238e-04, /* 0x3F36C54D, 0x20B29B6B */ +u04 = -3.81407053724364161125e-06, /* 0xBECFFEA7, 0x73D25CAD */ +u05 = 1.95590137035022920206e-08, /* 0x3E550057, 0x3B4EABD4 */ +u06 = -3.98205194132103398453e-11, /* 0xBDC5E43D, 0x693FB3C8 */ +v01 = 1.27304834834123699328e-02, /* 0x3F8A1270, 0x91C9C71A */ +v02 = 7.60068627350353253702e-05, /* 0x3F13ECBB, 0xF578C6C1 */ +v03 = 2.59150851840457805467e-07, /* 0x3E91642D, 0x7FF202FD */ +v04 = 4.41110311332675467403e-10; /* 0x3DFE5018, 0x3BD6D9EF */ + +double y0(double x) +{ + double z,u,v; + uint32_t ix,lx; + + EXTRACT_WORDS(ix, lx, x); + + /* y0(nan)=nan, y0(<0)=nan, y0(0)=-inf, y0(inf)=0 */ + if ((ix<<1 | lx) == 0) + return -1/0.0; + if (ix>>31) + return 0/0.0; + if (ix >= 0x7ff00000) + return 1/x; + + if (ix >= 0x40000000) { /* x >= 2 */ + /* large ulp errors near zeros: 3.958, 7.086,.. */ + return common(ix,x,1); + } + + /* U(x^2)/V(x^2) + (2/pi)*j0(x)*log(x) */ + if (ix >= 0x3e400000) { /* x >= 2**-27 */ + /* large ulp error near the first zero, x ~= 0.89 */ + z = x*x; + u = u00+z*(u01+z*(u02+z*(u03+z*(u04+z*(u05+z*u06))))); + v = 1.0+z*(v01+z*(v02+z*(v03+z*v04))); + return u/v + tpi*(j0(x)*log(x)); + } + return u00 + tpi*log(x); +} + +/* The asymptotic expansions of pzero is + * 1 - 9/128 s^2 + 11025/98304 s^4 - ..., where s = 1/x. + * For x >= 2, We approximate pzero by + * pzero(x) = 1 + (R/S) + * where R = pR0 + pR1*s^2 + pR2*s^4 + ... + pR5*s^10 + * S = 1 + pS0*s^2 + ... + pS4*s^10 + * and + * | pzero(x)-1-R/S | <= 2 ** ( -60.26) + */ +static const double pR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ + -7.03124999999900357484e-02, /* 0xBFB1FFFF, 0xFFFFFD32 */ + -8.08167041275349795626e+00, /* 0xC02029D0, 0xB44FA779 */ + -2.57063105679704847262e+02, /* 0xC0701102, 0x7B19E863 */ + -2.48521641009428822144e+03, /* 0xC0A36A6E, 0xCD4DCAFC */ + -5.25304380490729545272e+03, /* 0xC0B4850B, 0x36CC643D */ +}; +static const double pS8[5] = { + 1.16534364619668181717e+02, /* 0x405D2233, 0x07A96751 */ + 3.83374475364121826715e+03, /* 0x40ADF37D, 0x50596938 */ + 4.05978572648472545552e+04, /* 0x40E3D2BB, 0x6EB6B05F */ + 1.16752972564375915681e+05, /* 0x40FC810F, 0x8F9FA9BD */ + 4.76277284146730962675e+04, /* 0x40E74177, 0x4F2C49DC */ +}; + +static const double pR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + -1.14125464691894502584e-11, /* 0xBDA918B1, 0x47E495CC */ + -7.03124940873599280078e-02, /* 0xBFB1FFFF, 0xE69AFBC6 */ + -4.15961064470587782438e+00, /* 0xC010A370, 0xF90C6BBF */ + -6.76747652265167261021e+01, /* 0xC050EB2F, 0x5A7D1783 */ + -3.31231299649172967747e+02, /* 0xC074B3B3, 0x6742CC63 */ + -3.46433388365604912451e+02, /* 0xC075A6EF, 0x28A38BD7 */ +}; +static const double pS5[5] = { + 6.07539382692300335975e+01, /* 0x404E6081, 0x0C98C5DE */ + 1.05125230595704579173e+03, /* 0x40906D02, 0x5C7E2864 */ + 5.97897094333855784498e+03, /* 0x40B75AF8, 0x8FBE1D60 */ + 9.62544514357774460223e+03, /* 0x40C2CCB8, 0xFA76FA38 */ + 2.40605815922939109441e+03, /* 0x40A2CC1D, 0xC70BE864 */ +}; + +static const double pR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ + -2.54704601771951915620e-09, /* 0xBE25E103, 0x6FE1AA86 */ + -7.03119616381481654654e-02, /* 0xBFB1FFF6, 0xF7C0E24B */ + -2.40903221549529611423e+00, /* 0xC00345B2, 0xAEA48074 */ + -2.19659774734883086467e+01, /* 0xC035F74A, 0x4CB94E14 */ + -5.80791704701737572236e+01, /* 0xC04D0A22, 0x420A1A45 */ + -3.14479470594888503854e+01, /* 0xC03F72AC, 0xA892D80F */ +}; +static const double pS3[5] = { + 3.58560338055209726349e+01, /* 0x4041ED92, 0x84077DD3 */ + 3.61513983050303863820e+02, /* 0x40769839, 0x464A7C0E */ + 1.19360783792111533330e+03, /* 0x4092A66E, 0x6D1061D6 */ + 1.12799679856907414432e+03, /* 0x40919FFC, 0xB8C39B7E */ + 1.73580930813335754692e+02, /* 0x4065B296, 0xFC379081 */ +}; + +static const double pR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + -8.87534333032526411254e-08, /* 0xBE77D316, 0xE927026D */ + -7.03030995483624743247e-02, /* 0xBFB1FF62, 0x495E1E42 */ + -1.45073846780952986357e+00, /* 0xBFF73639, 0x8A24A843 */ + -7.63569613823527770791e+00, /* 0xC01E8AF3, 0xEDAFA7F3 */ + -1.11931668860356747786e+01, /* 0xC02662E6, 0xC5246303 */ + -3.23364579351335335033e+00, /* 0xC009DE81, 0xAF8FE70F */ +}; +static const double pS2[5] = { + 2.22202997532088808441e+01, /* 0x40363865, 0x908B5959 */ + 1.36206794218215208048e+02, /* 0x4061069E, 0x0EE8878F */ + 2.70470278658083486789e+02, /* 0x4070E786, 0x42EA079B */ + 1.53875394208320329881e+02, /* 0x40633C03, 0x3AB6FAFF */ + 1.46576176948256193810e+01, /* 0x402D50B3, 0x44391809 */ +}; + +static double pzero(double x) +{ + const double *p,*q; + double_t z,r,s; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x40200000){p = pR8; q = pS8;} + else if (ix >= 0x40122E8B){p = pR5; q = pS5;} + else if (ix >= 0x4006DB6D){p = pR3; q = pS3;} + else /*ix >= 0x40000000*/ {p = pR2; q = pS2;} + z = 1.0/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4])))); + return 1.0 + r/s; +} + + +/* For x >= 8, the asymptotic expansions of qzero is + * -1/8 s + 75/1024 s^3 - ..., where s = 1/x. + * We approximate pzero by + * qzero(x) = s*(-1.25 + (R/S)) + * where R = qR0 + qR1*s^2 + qR2*s^4 + ... + qR5*s^10 + * S = 1 + qS0*s^2 + ... + qS5*s^12 + * and + * | qzero(x)/s +1.25-R/S | <= 2 ** ( -61.22) + */ +static const double qR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ + 7.32421874999935051953e-02, /* 0x3FB2BFFF, 0xFFFFFE2C */ + 1.17682064682252693899e+01, /* 0x40278952, 0x5BB334D6 */ + 5.57673380256401856059e+02, /* 0x40816D63, 0x15301825 */ + 8.85919720756468632317e+03, /* 0x40C14D99, 0x3E18F46D */ + 3.70146267776887834771e+04, /* 0x40E212D4, 0x0E901566 */ +}; +static const double qS8[6] = { + 1.63776026895689824414e+02, /* 0x406478D5, 0x365B39BC */ + 8.09834494656449805916e+03, /* 0x40BFA258, 0x4E6B0563 */ + 1.42538291419120476348e+05, /* 0x41016652, 0x54D38C3F */ + 8.03309257119514397345e+05, /* 0x412883DA, 0x83A52B43 */ + 8.40501579819060512818e+05, /* 0x4129A66B, 0x28DE0B3D */ + -3.43899293537866615225e+05, /* 0xC114FD6D, 0x2C9530C5 */ +}; + +static const double qR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + 1.84085963594515531381e-11, /* 0x3DB43D8F, 0x29CC8CD9 */ + 7.32421766612684765896e-02, /* 0x3FB2BFFF, 0xD172B04C */ + 5.83563508962056953777e+00, /* 0x401757B0, 0xB9953DD3 */ + 1.35111577286449829671e+02, /* 0x4060E392, 0x0A8788E9 */ + 1.02724376596164097464e+03, /* 0x40900CF9, 0x9DC8C481 */ + 1.98997785864605384631e+03, /* 0x409F17E9, 0x53C6E3A6 */ +}; +static const double qS5[6] = { + 8.27766102236537761883e+01, /* 0x4054B1B3, 0xFB5E1543 */ + 2.07781416421392987104e+03, /* 0x40A03BA0, 0xDA21C0CE */ + 1.88472887785718085070e+04, /* 0x40D267D2, 0x7B591E6D */ + 5.67511122894947329769e+04, /* 0x40EBB5E3, 0x97E02372 */ + 3.59767538425114471465e+04, /* 0x40E19118, 0x1F7A54A0 */ + -5.35434275601944773371e+03, /* 0xC0B4EA57, 0xBEDBC609 */ +}; + +static const double qR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ + 4.37741014089738620906e-09, /* 0x3E32CD03, 0x6ADECB82 */ + 7.32411180042911447163e-02, /* 0x3FB2BFEE, 0x0E8D0842 */ + 3.34423137516170720929e+00, /* 0x400AC0FC, 0x61149CF5 */ + 4.26218440745412650017e+01, /* 0x40454F98, 0x962DAEDD */ + 1.70808091340565596283e+02, /* 0x406559DB, 0xE25EFD1F */ + 1.66733948696651168575e+02, /* 0x4064D77C, 0x81FA21E0 */ +}; +static const double qS3[6] = { + 4.87588729724587182091e+01, /* 0x40486122, 0xBFE343A6 */ + 7.09689221056606015736e+02, /* 0x40862D83, 0x86544EB3 */ + 3.70414822620111362994e+03, /* 0x40ACF04B, 0xE44DFC63 */ + 6.46042516752568917582e+03, /* 0x40B93C6C, 0xD7C76A28 */ + 2.51633368920368957333e+03, /* 0x40A3A8AA, 0xD94FB1C0 */ + -1.49247451836156386662e+02, /* 0xC062A7EB, 0x201CF40F */ +}; + +static const double qR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + 1.50444444886983272379e-07, /* 0x3E84313B, 0x54F76BDB */ + 7.32234265963079278272e-02, /* 0x3FB2BEC5, 0x3E883E34 */ + 1.99819174093815998816e+00, /* 0x3FFFF897, 0xE727779C */ + 1.44956029347885735348e+01, /* 0x402CFDBF, 0xAAF96FE5 */ + 3.16662317504781540833e+01, /* 0x403FAA8E, 0x29FBDC4A */ + 1.62527075710929267416e+01, /* 0x403040B1, 0x71814BB4 */ +}; +static const double qS2[6] = { + 3.03655848355219184498e+01, /* 0x403E5D96, 0xF7C07AED */ + 2.69348118608049844624e+02, /* 0x4070D591, 0xE4D14B40 */ + 8.44783757595320139444e+02, /* 0x408A6645, 0x22B3BF22 */ + 8.82935845112488550512e+02, /* 0x408B977C, 0x9C5CC214 */ + 2.12666388511798828631e+02, /* 0x406A9553, 0x0E001365 */ + -5.31095493882666946917e+00, /* 0xC0153E6A, 0xF8B32931 */ +}; + +static double qzero(double x) +{ + const double *p,*q; + double_t s,r,z; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x40200000){p = qR8; q = qS8;} + else if (ix >= 0x40122E8B){p = qR5; q = qS5;} + else if (ix >= 0x4006DB6D){p = qR3; q = qS3;} + else /*ix >= 0x40000000*/ {p = qR2; q = qS2;} + z = 1.0/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5]))))); + return (-.125 + r/s)/x; +} diff --git a/lib/libc/src/musl-math/j0f.c b/lib/libc/src/musl-math/j0f.c new file mode 100644 index 0000000..fab554a --- /dev/null +++ b/lib/libc/src/musl-math/j0f.c @@ -0,0 +1,314 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_j0f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include "libm.h" + +static float pzerof(float), qzerof(float); + +static const float +invsqrtpi = 5.6418961287e-01, /* 0x3f106ebb */ +tpi = 6.3661974669e-01; /* 0x3f22f983 */ + +static float common(uint32_t ix, float x, int y0) +{ + float z,s,c,ss,cc; + /* + * j0(x) = 1/sqrt(pi) * (P(0,x)*cc - Q(0,x)*ss) / sqrt(x) + * y0(x) = 1/sqrt(pi) * (P(0,x)*ss + Q(0,x)*cc) / sqrt(x) + */ + s = sinf(x); + c = cosf(x); + if (y0) + c = -c; + cc = s+c; + if (ix < 0x7f000000) { + ss = s-c; + z = -cosf(2*x); + if (s*c < 0) + cc = z/ss; + else + ss = z/cc; + if (ix < 0x58800000) { + if (y0) + ss = -ss; + cc = pzerof(x)*cc-qzerof(x)*ss; + } + } + return invsqrtpi*cc/sqrtf(x); +} + +/* R0/S0 on [0, 2.00] */ +static const float +R02 = 1.5625000000e-02, /* 0x3c800000 */ +R03 = -1.8997929874e-04, /* 0xb947352e */ +R04 = 1.8295404516e-06, /* 0x35f58e88 */ +R05 = -4.6183270541e-09, /* 0xb19eaf3c */ +S01 = 1.5619102865e-02, /* 0x3c7fe744 */ +S02 = 1.1692678527e-04, /* 0x38f53697 */ +S03 = 5.1354652442e-07, /* 0x3509daa6 */ +S04 = 1.1661400734e-09; /* 0x30a045e8 */ + +float j0f(float x) +{ + float z,r,s; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x7f800000) + return 1/(x*x); + x = fabsf(x); + + if (ix >= 0x40000000) { /* |x| >= 2 */ + /* large ulp error near zeros */ + return common(ix, x, 0); + } + if (ix >= 0x3a000000) { /* |x| >= 2**-11 */ + /* up to 4ulp error near 2 */ + z = x*x; + r = z*(R02+z*(R03+z*(R04+z*R05))); + s = 1+z*(S01+z*(S02+z*(S03+z*S04))); + return (1+x/2)*(1-x/2) + z*(r/s); + } + if (ix >= 0x21800000) /* |x| >= 2**-60 */ + x = 0.25f*x*x; + return 1 - x; +} + +static const float +u00 = -7.3804296553e-02, /* 0xbd9726b5 */ +u01 = 1.7666645348e-01, /* 0x3e34e80d */ +u02 = -1.3818567619e-02, /* 0xbc626746 */ +u03 = 3.4745343146e-04, /* 0x39b62a69 */ +u04 = -3.8140706238e-06, /* 0xb67ff53c */ +u05 = 1.9559013964e-08, /* 0x32a802ba */ +u06 = -3.9820518410e-11, /* 0xae2f21eb */ +v01 = 1.2730483897e-02, /* 0x3c509385 */ +v02 = 7.6006865129e-05, /* 0x389f65e0 */ +v03 = 2.5915085189e-07, /* 0x348b216c */ +v04 = 4.4111031494e-10; /* 0x2ff280c2 */ + +float y0f(float x) +{ + float z,u,v; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + if ((ix & 0x7fffffff) == 0) + return -1/0.0f; + if (ix>>31) + return 0/0.0f; + if (ix >= 0x7f800000) + return 1/x; + if (ix >= 0x40000000) { /* |x| >= 2.0 */ + /* large ulp error near zeros */ + return common(ix,x,1); + } + if (ix >= 0x39000000) { /* x >= 2**-13 */ + /* large ulp error at x ~= 0.89 */ + z = x*x; + u = u00+z*(u01+z*(u02+z*(u03+z*(u04+z*(u05+z*u06))))); + v = 1+z*(v01+z*(v02+z*(v03+z*v04))); + return u/v + tpi*(j0f(x)*logf(x)); + } + return u00 + tpi*logf(x); +} + +/* The asymptotic expansions of pzero is + * 1 - 9/128 s^2 + 11025/98304 s^4 - ..., where s = 1/x. + * For x >= 2, We approximate pzero by + * pzero(x) = 1 + (R/S) + * where R = pR0 + pR1*s^2 + pR2*s^4 + ... + pR5*s^10 + * S = 1 + pS0*s^2 + ... + pS4*s^10 + * and + * | pzero(x)-1-R/S | <= 2 ** ( -60.26) + */ +static const float pR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.0000000000e+00, /* 0x00000000 */ + -7.0312500000e-02, /* 0xbd900000 */ + -8.0816707611e+00, /* 0xc1014e86 */ + -2.5706311035e+02, /* 0xc3808814 */ + -2.4852163086e+03, /* 0xc51b5376 */ + -5.2530439453e+03, /* 0xc5a4285a */ +}; +static const float pS8[5] = { + 1.1653436279e+02, /* 0x42e91198 */ + 3.8337448730e+03, /* 0x456f9beb */ + 4.0597855469e+04, /* 0x471e95db */ + 1.1675296875e+05, /* 0x47e4087c */ + 4.7627726562e+04, /* 0x473a0bba */ +}; +static const float pR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + -1.1412546255e-11, /* 0xad48c58a */ + -7.0312492549e-02, /* 0xbd8fffff */ + -4.1596107483e+00, /* 0xc0851b88 */ + -6.7674766541e+01, /* 0xc287597b */ + -3.3123129272e+02, /* 0xc3a59d9b */ + -3.4643338013e+02, /* 0xc3ad3779 */ +}; +static const float pS5[5] = { + 6.0753936768e+01, /* 0x42730408 */ + 1.0512523193e+03, /* 0x44836813 */ + 5.9789707031e+03, /* 0x45bad7c4 */ + 9.6254453125e+03, /* 0x461665c8 */ + 2.4060581055e+03, /* 0x451660ee */ +}; + +static const float pR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ + -2.5470459075e-09, /* 0xb12f081b */ + -7.0311963558e-02, /* 0xbd8fffb8 */ + -2.4090321064e+00, /* 0xc01a2d95 */ + -2.1965976715e+01, /* 0xc1afba52 */ + -5.8079170227e+01, /* 0xc2685112 */ + -3.1447946548e+01, /* 0xc1fb9565 */ +}; +static const float pS3[5] = { + 3.5856033325e+01, /* 0x420f6c94 */ + 3.6151397705e+02, /* 0x43b4c1ca */ + 1.1936077881e+03, /* 0x44953373 */ + 1.1279968262e+03, /* 0x448cffe6 */ + 1.7358093262e+02, /* 0x432d94b8 */ +}; + +static const float pR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + -8.8753431271e-08, /* 0xb3be98b7 */ + -7.0303097367e-02, /* 0xbd8ffb12 */ + -1.4507384300e+00, /* 0xbfb9b1cc */ + -7.6356959343e+00, /* 0xc0f4579f */ + -1.1193166733e+01, /* 0xc1331736 */ + -3.2336456776e+00, /* 0xc04ef40d */ +}; +static const float pS2[5] = { + 2.2220300674e+01, /* 0x41b1c32d */ + 1.3620678711e+02, /* 0x430834f0 */ + 2.7047027588e+02, /* 0x43873c32 */ + 1.5387539673e+02, /* 0x4319e01a */ + 1.4657617569e+01, /* 0x416a859a */ +}; + +static float pzerof(float x) +{ + const float *p,*q; + float_t z,r,s; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x41000000){p = pR8; q = pS8;} + else if (ix >= 0x409173eb){p = pR5; q = pS5;} + else if (ix >= 0x4036d917){p = pR3; q = pS3;} + else /*ix >= 0x40000000*/ {p = pR2; q = pS2;} + z = 1.0f/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0f+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4])))); + return 1.0f + r/s; +} + + +/* For x >= 8, the asymptotic expansions of qzero is + * -1/8 s + 75/1024 s^3 - ..., where s = 1/x. + * We approximate pzero by + * qzero(x) = s*(-1.25 + (R/S)) + * where R = qR0 + qR1*s^2 + qR2*s^4 + ... + qR5*s^10 + * S = 1 + qS0*s^2 + ... + qS5*s^12 + * and + * | qzero(x)/s +1.25-R/S | <= 2 ** ( -61.22) + */ +static const float qR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.0000000000e+00, /* 0x00000000 */ + 7.3242187500e-02, /* 0x3d960000 */ + 1.1768206596e+01, /* 0x413c4a93 */ + 5.5767340088e+02, /* 0x440b6b19 */ + 8.8591972656e+03, /* 0x460a6cca */ + 3.7014625000e+04, /* 0x471096a0 */ +}; +static const float qS8[6] = { + 1.6377603149e+02, /* 0x4323c6aa */ + 8.0983447266e+03, /* 0x45fd12c2 */ + 1.4253829688e+05, /* 0x480b3293 */ + 8.0330925000e+05, /* 0x49441ed4 */ + 8.4050156250e+05, /* 0x494d3359 */ + -3.4389928125e+05, /* 0xc8a7eb69 */ +}; + +static const float qR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + 1.8408595828e-11, /* 0x2da1ec79 */ + 7.3242180049e-02, /* 0x3d95ffff */ + 5.8356351852e+00, /* 0x40babd86 */ + 1.3511157227e+02, /* 0x43071c90 */ + 1.0272437744e+03, /* 0x448067cd */ + 1.9899779053e+03, /* 0x44f8bf4b */ +}; +static const float qS5[6] = { + 8.2776611328e+01, /* 0x42a58da0 */ + 2.0778142090e+03, /* 0x4501dd07 */ + 1.8847289062e+04, /* 0x46933e94 */ + 5.6751113281e+04, /* 0x475daf1d */ + 3.5976753906e+04, /* 0x470c88c1 */ + -5.3543427734e+03, /* 0xc5a752be */ +}; + +static const float qR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ + 4.3774099900e-09, /* 0x3196681b */ + 7.3241114616e-02, /* 0x3d95ff70 */ + 3.3442313671e+00, /* 0x405607e3 */ + 4.2621845245e+01, /* 0x422a7cc5 */ + 1.7080809021e+02, /* 0x432acedf */ + 1.6673394775e+02, /* 0x4326bbe4 */ +}; +static const float qS3[6] = { + 4.8758872986e+01, /* 0x42430916 */ + 7.0968920898e+02, /* 0x44316c1c */ + 3.7041481934e+03, /* 0x4567825f */ + 6.4604252930e+03, /* 0x45c9e367 */ + 2.5163337402e+03, /* 0x451d4557 */ + -1.4924745178e+02, /* 0xc3153f59 */ +}; + +static const float qR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + 1.5044444979e-07, /* 0x342189db */ + 7.3223426938e-02, /* 0x3d95f62a */ + 1.9981917143e+00, /* 0x3fffc4bf */ + 1.4495602608e+01, /* 0x4167edfd */ + 3.1666231155e+01, /* 0x41fd5471 */ + 1.6252708435e+01, /* 0x4182058c */ +}; +static const float qS2[6] = { + 3.0365585327e+01, /* 0x41f2ecb8 */ + 2.6934811401e+02, /* 0x4386ac8f */ + 8.4478375244e+02, /* 0x44533229 */ + 8.8293585205e+02, /* 0x445cbbe5 */ + 2.1266638184e+02, /* 0x4354aa98 */ + -5.3109550476e+00, /* 0xc0a9f358 */ +}; + +static float qzerof(float x) +{ + const float *p,*q; + float_t s,r,z; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x41000000){p = qR8; q = qS8;} + else if (ix >= 0x409173eb){p = qR5; q = qS5;} + else if (ix >= 0x4036d917){p = qR3; q = qS3;} + else /*ix >= 0x40000000*/ {p = qR2; q = qS2;} + z = 1.0f/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0f+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5]))))); + return (-.125f + r/s)/x; +} diff --git a/lib/libc/src/musl-math/j1.c b/lib/libc/src/musl-math/j1.c new file mode 100644 index 0000000..df724d1 --- /dev/null +++ b/lib/libc/src/musl-math/j1.c @@ -0,0 +1,362 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_j1.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* j1(x), y1(x) + * Bessel function of the first and second kinds of order zero. + * Method -- j1(x): + * 1. For tiny x, we use j1(x) = x/2 - x^3/16 + x^5/384 - ... + * 2. Reduce x to |x| since j1(x)=-j1(-x), and + * for x in (0,2) + * j1(x) = x/2 + x*z*R0/S0, where z = x*x; + * (precision: |j1/x - 1/2 - R0/S0 |<2**-61.51 ) + * for x in (2,inf) + * j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x1)-q1(x)*sin(x1)) + * y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1)) + * where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1) + * as follow: + * cos(x1) = cos(x)cos(3pi/4)+sin(x)sin(3pi/4) + * = 1/sqrt(2) * (sin(x) - cos(x)) + * sin(x1) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4) + * = -1/sqrt(2) * (sin(x) + cos(x)) + * (To avoid cancellation, use + * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) + * to compute the worse one.) + * + * 3 Special cases + * j1(nan)= nan + * j1(0) = 0 + * j1(inf) = 0 + * + * Method -- y1(x): + * 1. screen out x<=0 cases: y1(0)=-inf, y1(x<0)=NaN + * 2. For x<2. + * Since + * y1(x) = 2/pi*(j1(x)*(ln(x/2)+Euler)-1/x-x/2+5/64*x^3-...) + * therefore y1(x)-2/pi*j1(x)*ln(x)-1/x is an odd function. + * We use the following function to approximate y1, + * y1(x) = x*U(z)/V(z) + (2/pi)*(j1(x)*ln(x)-1/x), z= x^2 + * where for x in [0,2] (abs err less than 2**-65.89) + * U(z) = U0[0] + U0[1]*z + ... + U0[4]*z^4 + * V(z) = 1 + v0[0]*z + ... + v0[4]*z^5 + * Note: For tiny x, 1/x dominate y1 and hence + * y1(tiny) = -2/pi/tiny, (choose tiny<2**-54) + * 3. For x>=2. + * y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1)) + * where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1) + * by method mentioned above. + */ + +#include "libm.h" + +static double pone(double), qone(double); + +static const double +invsqrtpi = 5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */ +tpi = 6.36619772367581382433e-01; /* 0x3FE45F30, 0x6DC9C883 */ + +static double common(uint32_t ix, double x, int y1, int sign) +{ + double z,s,c,ss,cc; + + /* + * j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x-3pi/4)-q1(x)*sin(x-3pi/4)) + * y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x-3pi/4)+q1(x)*cos(x-3pi/4)) + * + * sin(x-3pi/4) = -(sin(x) + cos(x))/sqrt(2) + * cos(x-3pi/4) = (sin(x) - cos(x))/sqrt(2) + * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) + */ + s = sin(x); + if (y1) + s = -s; + c = cos(x); + cc = s-c; + if (ix < 0x7fe00000) { + /* avoid overflow in 2*x */ + ss = -s-c; + z = cos(2*x); + if (s*c > 0) + cc = z/ss; + else + ss = z/cc; + if (ix < 0x48000000) { + if (y1) + ss = -ss; + cc = pone(x)*cc-qone(x)*ss; + } + } + if (sign) + cc = -cc; + return invsqrtpi*cc/sqrt(x); +} + +/* R0/S0 on [0,2] */ +static const double +r00 = -6.25000000000000000000e-02, /* 0xBFB00000, 0x00000000 */ +r01 = 1.40705666955189706048e-03, /* 0x3F570D9F, 0x98472C61 */ +r02 = -1.59955631084035597520e-05, /* 0xBEF0C5C6, 0xBA169668 */ +r03 = 4.96727999609584448412e-08, /* 0x3E6AAAFA, 0x46CA0BD9 */ +s01 = 1.91537599538363460805e-02, /* 0x3F939D0B, 0x12637E53 */ +s02 = 1.85946785588630915560e-04, /* 0x3F285F56, 0xB9CDF664 */ +s03 = 1.17718464042623683263e-06, /* 0x3EB3BFF8, 0x333F8498 */ +s04 = 5.04636257076217042715e-09, /* 0x3E35AC88, 0xC97DFF2C */ +s05 = 1.23542274426137913908e-11; /* 0x3DAB2ACF, 0xCFB97ED8 */ + +double j1(double x) +{ + double z,r,s; + uint32_t ix; + int sign; + + GET_HIGH_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7ff00000) + return 1/(x*x); + if (ix >= 0x40000000) /* |x| >= 2 */ + return common(ix, fabs(x), 0, sign); + if (ix >= 0x38000000) { /* |x| >= 2**-127 */ + z = x*x; + r = z*(r00+z*(r01+z*(r02+z*r03))); + s = 1+z*(s01+z*(s02+z*(s03+z*(s04+z*s05)))); + z = r/s; + } else + /* avoid underflow, raise inexact if x!=0 */ + z = x; + return (0.5 + z)*x; +} + +static const double U0[5] = { + -1.96057090646238940668e-01, /* 0xBFC91866, 0x143CBC8A */ + 5.04438716639811282616e-02, /* 0x3FA9D3C7, 0x76292CD1 */ + -1.91256895875763547298e-03, /* 0xBF5F55E5, 0x4844F50F */ + 2.35252600561610495928e-05, /* 0x3EF8AB03, 0x8FA6B88E */ + -9.19099158039878874504e-08, /* 0xBE78AC00, 0x569105B8 */ +}; +static const double V0[5] = { + 1.99167318236649903973e-02, /* 0x3F94650D, 0x3F4DA9F0 */ + 2.02552581025135171496e-04, /* 0x3F2A8C89, 0x6C257764 */ + 1.35608801097516229404e-06, /* 0x3EB6C05A, 0x894E8CA6 */ + 6.22741452364621501295e-09, /* 0x3E3ABF1D, 0x5BA69A86 */ + 1.66559246207992079114e-11, /* 0x3DB25039, 0xDACA772A */ +}; + +double y1(double x) +{ + double z,u,v; + uint32_t ix,lx; + + EXTRACT_WORDS(ix, lx, x); + /* y1(nan)=nan, y1(<0)=nan, y1(0)=-inf, y1(inf)=0 */ + if ((ix<<1 | lx) == 0) + return -1/0.0; + if (ix>>31) + return 0/0.0; + if (ix >= 0x7ff00000) + return 1/x; + + if (ix >= 0x40000000) /* x >= 2 */ + return common(ix, x, 1, 0); + if (ix < 0x3c900000) /* x < 2**-54 */ + return -tpi/x; + z = x*x; + u = U0[0]+z*(U0[1]+z*(U0[2]+z*(U0[3]+z*U0[4]))); + v = 1+z*(V0[0]+z*(V0[1]+z*(V0[2]+z*(V0[3]+z*V0[4])))); + return x*(u/v) + tpi*(j1(x)*log(x)-1/x); +} + +/* For x >= 8, the asymptotic expansions of pone is + * 1 + 15/128 s^2 - 4725/2^15 s^4 - ..., where s = 1/x. + * We approximate pone by + * pone(x) = 1 + (R/S) + * where R = pr0 + pr1*s^2 + pr2*s^4 + ... + pr5*s^10 + * S = 1 + ps0*s^2 + ... + ps4*s^10 + * and + * | pone(x)-1-R/S | <= 2 ** ( -60.06) + */ + +static const double pr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ + 1.17187499999988647970e-01, /* 0x3FBDFFFF, 0xFFFFFCCE */ + 1.32394806593073575129e+01, /* 0x402A7A9D, 0x357F7FCE */ + 4.12051854307378562225e+02, /* 0x4079C0D4, 0x652EA590 */ + 3.87474538913960532227e+03, /* 0x40AE457D, 0xA3A532CC */ + 7.91447954031891731574e+03, /* 0x40BEEA7A, 0xC32782DD */ +}; +static const double ps8[5] = { + 1.14207370375678408436e+02, /* 0x405C8D45, 0x8E656CAC */ + 3.65093083420853463394e+03, /* 0x40AC85DC, 0x964D274F */ + 3.69562060269033463555e+04, /* 0x40E20B86, 0x97C5BB7F */ + 9.76027935934950801311e+04, /* 0x40F7D42C, 0xB28F17BB */ + 3.08042720627888811578e+04, /* 0x40DE1511, 0x697A0B2D */ +}; + +static const double pr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + 1.31990519556243522749e-11, /* 0x3DAD0667, 0xDAE1CA7D */ + 1.17187493190614097638e-01, /* 0x3FBDFFFF, 0xE2C10043 */ + 6.80275127868432871736e+00, /* 0x401B3604, 0x6E6315E3 */ + 1.08308182990189109773e+02, /* 0x405B13B9, 0x452602ED */ + 5.17636139533199752805e+02, /* 0x40802D16, 0xD052D649 */ + 5.28715201363337541807e+02, /* 0x408085B8, 0xBB7E0CB7 */ +}; +static const double ps5[5] = { + 5.92805987221131331921e+01, /* 0x404DA3EA, 0xA8AF633D */ + 9.91401418733614377743e+02, /* 0x408EFB36, 0x1B066701 */ + 5.35326695291487976647e+03, /* 0x40B4E944, 0x5706B6FB */ + 7.84469031749551231769e+03, /* 0x40BEA4B0, 0xB8A5BB15 */ + 1.50404688810361062679e+03, /* 0x40978030, 0x036F5E51 */ +}; + +static const double pr3[6] = { + 3.02503916137373618024e-09, /* 0x3E29FC21, 0xA7AD9EDD */ + 1.17186865567253592491e-01, /* 0x3FBDFFF5, 0x5B21D17B */ + 3.93297750033315640650e+00, /* 0x400F76BC, 0xE85EAD8A */ + 3.51194035591636932736e+01, /* 0x40418F48, 0x9DA6D129 */ + 9.10550110750781271918e+01, /* 0x4056C385, 0x4D2C1837 */ + 4.85590685197364919645e+01, /* 0x4048478F, 0x8EA83EE5 */ +}; +static const double ps3[5] = { + 3.47913095001251519989e+01, /* 0x40416549, 0xA134069C */ + 3.36762458747825746741e+02, /* 0x40750C33, 0x07F1A75F */ + 1.04687139975775130551e+03, /* 0x40905B7C, 0x5037D523 */ + 8.90811346398256432622e+02, /* 0x408BD67D, 0xA32E31E9 */ + 1.03787932439639277504e+02, /* 0x4059F26D, 0x7C2EED53 */ +}; + +static const double pr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + 1.07710830106873743082e-07, /* 0x3E7CE9D4, 0xF65544F4 */ + 1.17176219462683348094e-01, /* 0x3FBDFF42, 0xBE760D83 */ + 2.36851496667608785174e+00, /* 0x4002F2B7, 0xF98FAEC0 */ + 1.22426109148261232917e+01, /* 0x40287C37, 0x7F71A964 */ + 1.76939711271687727390e+01, /* 0x4031B1A8, 0x177F8EE2 */ + 5.07352312588818499250e+00, /* 0x40144B49, 0xA574C1FE */ +}; +static const double ps2[5] = { + 2.14364859363821409488e+01, /* 0x40356FBD, 0x8AD5ECDC */ + 1.25290227168402751090e+02, /* 0x405F5293, 0x14F92CD5 */ + 2.32276469057162813669e+02, /* 0x406D08D8, 0xD5A2DBD9 */ + 1.17679373287147100768e+02, /* 0x405D6B7A, 0xDA1884A9 */ + 8.36463893371618283368e+00, /* 0x4020BAB1, 0xF44E5192 */ +}; + +static double pone(double x) +{ + const double *p,*q; + double_t z,r,s; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x40200000){p = pr8; q = ps8;} + else if (ix >= 0x40122E8B){p = pr5; q = ps5;} + else if (ix >= 0x4006DB6D){p = pr3; q = ps3;} + else /*ix >= 0x40000000*/ {p = pr2; q = ps2;} + z = 1.0/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4])))); + return 1.0+ r/s; +} + +/* For x >= 8, the asymptotic expansions of qone is + * 3/8 s - 105/1024 s^3 - ..., where s = 1/x. + * We approximate pone by + * qone(x) = s*(0.375 + (R/S)) + * where R = qr1*s^2 + qr2*s^4 + ... + qr5*s^10 + * S = 1 + qs1*s^2 + ... + qs6*s^12 + * and + * | qone(x)/s -0.375-R/S | <= 2 ** ( -61.13) + */ + +static const double qr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ + -1.02539062499992714161e-01, /* 0xBFBA3FFF, 0xFFFFFDF3 */ + -1.62717534544589987888e+01, /* 0xC0304591, 0xA26779F7 */ + -7.59601722513950107896e+02, /* 0xC087BCD0, 0x53E4B576 */ + -1.18498066702429587167e+04, /* 0xC0C724E7, 0x40F87415 */ + -4.84385124285750353010e+04, /* 0xC0E7A6D0, 0x65D09C6A */ +}; +static const double qs8[6] = { + 1.61395369700722909556e+02, /* 0x40642CA6, 0xDE5BCDE5 */ + 7.82538599923348465381e+03, /* 0x40BE9162, 0xD0D88419 */ + 1.33875336287249578163e+05, /* 0x4100579A, 0xB0B75E98 */ + 7.19657723683240939863e+05, /* 0x4125F653, 0x72869C19 */ + 6.66601232617776375264e+05, /* 0x412457D2, 0x7719AD5C */ + -2.94490264303834643215e+05, /* 0xC111F969, 0x0EA5AA18 */ +}; + +static const double qr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + -2.08979931141764104297e-11, /* 0xBDB6FA43, 0x1AA1A098 */ + -1.02539050241375426231e-01, /* 0xBFBA3FFF, 0xCB597FEF */ + -8.05644828123936029840e+00, /* 0xC0201CE6, 0xCA03AD4B */ + -1.83669607474888380239e+02, /* 0xC066F56D, 0x6CA7B9B0 */ + -1.37319376065508163265e+03, /* 0xC09574C6, 0x6931734F */ + -2.61244440453215656817e+03, /* 0xC0A468E3, 0x88FDA79D */ +}; +static const double qs5[6] = { + 8.12765501384335777857e+01, /* 0x405451B2, 0xFF5A11B2 */ + 1.99179873460485964642e+03, /* 0x409F1F31, 0xE77BF839 */ + 1.74684851924908907677e+04, /* 0x40D10F1F, 0x0D64CE29 */ + 4.98514270910352279316e+04, /* 0x40E8576D, 0xAABAD197 */ + 2.79480751638918118260e+04, /* 0x40DB4B04, 0xCF7C364B */ + -4.71918354795128470869e+03, /* 0xC0B26F2E, 0xFCFFA004 */ +}; + +static const double qr3[6] = { + -5.07831226461766561369e-09, /* 0xBE35CFA9, 0xD38FC84F */ + -1.02537829820837089745e-01, /* 0xBFBA3FEB, 0x51AEED54 */ + -4.61011581139473403113e+00, /* 0xC01270C2, 0x3302D9FF */ + -5.78472216562783643212e+01, /* 0xC04CEC71, 0xC25D16DA */ + -2.28244540737631695038e+02, /* 0xC06C87D3, 0x4718D55F */ + -2.19210128478909325622e+02, /* 0xC06B66B9, 0x5F5C1BF6 */ +}; +static const double qs3[6] = { + 4.76651550323729509273e+01, /* 0x4047D523, 0xCCD367E4 */ + 6.73865112676699709482e+02, /* 0x40850EEB, 0xC031EE3E */ + 3.38015286679526343505e+03, /* 0x40AA684E, 0x448E7C9A */ + 5.54772909720722782367e+03, /* 0x40B5ABBA, 0xA61D54A6 */ + 1.90311919338810798763e+03, /* 0x409DBC7A, 0x0DD4DF4B */ + -1.35201191444307340817e+02, /* 0xC060E670, 0x290A311F */ +}; + +static const double qr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + -1.78381727510958865572e-07, /* 0xBE87F126, 0x44C626D2 */ + -1.02517042607985553460e-01, /* 0xBFBA3E8E, 0x9148B010 */ + -2.75220568278187460720e+00, /* 0xC0060484, 0x69BB4EDA */ + -1.96636162643703720221e+01, /* 0xC033A9E2, 0xC168907F */ + -4.23253133372830490089e+01, /* 0xC04529A3, 0xDE104AAA */ + -2.13719211703704061733e+01, /* 0xC0355F36, 0x39CF6E52 */ +}; +static const double qs2[6] = { + 2.95333629060523854548e+01, /* 0x403D888A, 0x78AE64FF */ + 2.52981549982190529136e+02, /* 0x406F9F68, 0xDB821CBA */ + 7.57502834868645436472e+02, /* 0x4087AC05, 0xCE49A0F7 */ + 7.39393205320467245656e+02, /* 0x40871B25, 0x48D4C029 */ + 1.55949003336666123687e+02, /* 0x40637E5E, 0x3C3ED8D4 */ + -4.95949898822628210127e+00, /* 0xC013D686, 0xE71BE86B */ +}; + +static double qone(double x) +{ + const double *p,*q; + double_t s,r,z; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x40200000){p = qr8; q = qs8;} + else if (ix >= 0x40122E8B){p = qr5; q = qs5;} + else if (ix >= 0x4006DB6D){p = qr3; q = qs3;} + else /*ix >= 0x40000000*/ {p = qr2; q = qs2;} + z = 1.0/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5]))))); + return (.375 + r/s)/x; +} diff --git a/lib/libc/src/musl-math/j1f.c b/lib/libc/src/musl-math/j1f.c new file mode 100644 index 0000000..3434c53 --- /dev/null +++ b/lib/libc/src/musl-math/j1f.c @@ -0,0 +1,310 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_j1f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include "libm.h" + +static float ponef(float), qonef(float); + +static const float +invsqrtpi = 5.6418961287e-01, /* 0x3f106ebb */ +tpi = 6.3661974669e-01; /* 0x3f22f983 */ + +static float common(uint32_t ix, float x, int y1, int sign) +{ + double z,s,c,ss,cc; + + s = sinf(x); + if (y1) + s = -s; + c = cosf(x); + cc = s-c; + if (ix < 0x7f000000) { + ss = -s-c; + z = cosf(2*x); + if (s*c > 0) + cc = z/ss; + else + ss = z/cc; + if (ix < 0x58800000) { + if (y1) + ss = -ss; + cc = ponef(x)*cc-qonef(x)*ss; + } + } + if (sign) + cc = -cc; + return invsqrtpi*cc/sqrtf(x); +} + +/* R0/S0 on [0,2] */ +static const float +r00 = -6.2500000000e-02, /* 0xbd800000 */ +r01 = 1.4070566976e-03, /* 0x3ab86cfd */ +r02 = -1.5995563444e-05, /* 0xb7862e36 */ +r03 = 4.9672799207e-08, /* 0x335557d2 */ +s01 = 1.9153760746e-02, /* 0x3c9ce859 */ +s02 = 1.8594678841e-04, /* 0x3942fab6 */ +s03 = 1.1771846857e-06, /* 0x359dffc2 */ +s04 = 5.0463624390e-09, /* 0x31ad6446 */ +s05 = 1.2354227016e-11; /* 0x2d59567e */ + +float j1f(float x) +{ + float z,r,s; + uint32_t ix; + int sign; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7f800000) + return 1/(x*x); + if (ix >= 0x40000000) /* |x| >= 2 */ + return common(ix, fabsf(x), 0, sign); + if (ix >= 0x39000000) { /* |x| >= 2**-13 */ + z = x*x; + r = z*(r00+z*(r01+z*(r02+z*r03))); + s = 1+z*(s01+z*(s02+z*(s03+z*(s04+z*s05)))); + z = 0.5f + r/s; + } else + z = 0.5f; + return z*x; +} + +static const float U0[5] = { + -1.9605709612e-01, /* 0xbe48c331 */ + 5.0443872809e-02, /* 0x3d4e9e3c */ + -1.9125689287e-03, /* 0xbafaaf2a */ + 2.3525259166e-05, /* 0x37c5581c */ + -9.1909917899e-08, /* 0xb3c56003 */ +}; +static const float V0[5] = { + 1.9916731864e-02, /* 0x3ca3286a */ + 2.0255257550e-04, /* 0x3954644b */ + 1.3560879779e-06, /* 0x35b602d4 */ + 6.2274145840e-09, /* 0x31d5f8eb */ + 1.6655924903e-11, /* 0x2d9281cf */ +}; + +float y1f(float x) +{ + float z,u,v; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + if ((ix & 0x7fffffff) == 0) + return -1/0.0f; + if (ix>>31) + return 0/0.0f; + if (ix >= 0x7f800000) + return 1/x; + if (ix >= 0x40000000) /* |x| >= 2.0 */ + return common(ix,x,1,0); + if (ix < 0x33000000) /* x < 2**-25 */ + return -tpi/x; + z = x*x; + u = U0[0]+z*(U0[1]+z*(U0[2]+z*(U0[3]+z*U0[4]))); + v = 1.0f+z*(V0[0]+z*(V0[1]+z*(V0[2]+z*(V0[3]+z*V0[4])))); + return x*(u/v) + tpi*(j1f(x)*logf(x)-1.0f/x); +} + +/* For x >= 8, the asymptotic expansions of pone is + * 1 + 15/128 s^2 - 4725/2^15 s^4 - ..., where s = 1/x. + * We approximate pone by + * pone(x) = 1 + (R/S) + * where R = pr0 + pr1*s^2 + pr2*s^4 + ... + pr5*s^10 + * S = 1 + ps0*s^2 + ... + ps4*s^10 + * and + * | pone(x)-1-R/S | <= 2 ** ( -60.06) + */ + +static const float pr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.0000000000e+00, /* 0x00000000 */ + 1.1718750000e-01, /* 0x3df00000 */ + 1.3239480972e+01, /* 0x4153d4ea */ + 4.1205184937e+02, /* 0x43ce06a3 */ + 3.8747453613e+03, /* 0x45722bed */ + 7.9144794922e+03, /* 0x45f753d6 */ +}; +static const float ps8[5] = { + 1.1420736694e+02, /* 0x42e46a2c */ + 3.6509309082e+03, /* 0x45642ee5 */ + 3.6956207031e+04, /* 0x47105c35 */ + 9.7602796875e+04, /* 0x47bea166 */ + 3.0804271484e+04, /* 0x46f0a88b */ +}; + +static const float pr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + 1.3199052094e-11, /* 0x2d68333f */ + 1.1718749255e-01, /* 0x3defffff */ + 6.8027510643e+00, /* 0x40d9b023 */ + 1.0830818176e+02, /* 0x42d89dca */ + 5.1763616943e+02, /* 0x440168b7 */ + 5.2871520996e+02, /* 0x44042dc6 */ +}; +static const float ps5[5] = { + 5.9280597687e+01, /* 0x426d1f55 */ + 9.9140142822e+02, /* 0x4477d9b1 */ + 5.3532670898e+03, /* 0x45a74a23 */ + 7.8446904297e+03, /* 0x45f52586 */ + 1.5040468750e+03, /* 0x44bc0180 */ +}; + +static const float pr3[6] = { + 3.0250391081e-09, /* 0x314fe10d */ + 1.1718686670e-01, /* 0x3defffab */ + 3.9329774380e+00, /* 0x407bb5e7 */ + 3.5119403839e+01, /* 0x420c7a45 */ + 9.1055007935e+01, /* 0x42b61c2a */ + 4.8559066772e+01, /* 0x42423c7c */ +}; +static const float ps3[5] = { + 3.4791309357e+01, /* 0x420b2a4d */ + 3.3676245117e+02, /* 0x43a86198 */ + 1.0468714600e+03, /* 0x4482dbe3 */ + 8.9081134033e+02, /* 0x445eb3ed */ + 1.0378793335e+02, /* 0x42cf936c */ +}; + +static const float pr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + 1.0771083225e-07, /* 0x33e74ea8 */ + 1.1717621982e-01, /* 0x3deffa16 */ + 2.3685150146e+00, /* 0x401795c0 */ + 1.2242610931e+01, /* 0x4143e1bc */ + 1.7693971634e+01, /* 0x418d8d41 */ + 5.0735230446e+00, /* 0x40a25a4d */ +}; +static const float ps2[5] = { + 2.1436485291e+01, /* 0x41ab7dec */ + 1.2529022980e+02, /* 0x42fa9499 */ + 2.3227647400e+02, /* 0x436846c7 */ + 1.1767937469e+02, /* 0x42eb5bd7 */ + 8.3646392822e+00, /* 0x4105d590 */ +}; + +static float ponef(float x) +{ + const float *p,*q; + float_t z,r,s; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x41000000){p = pr8; q = ps8;} + else if (ix >= 0x409173eb){p = pr5; q = ps5;} + else if (ix >= 0x4036d917){p = pr3; q = ps3;} + else /*ix >= 0x40000000*/ {p = pr2; q = ps2;} + z = 1.0f/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0f+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4])))); + return 1.0f + r/s; +} + +/* For x >= 8, the asymptotic expansions of qone is + * 3/8 s - 105/1024 s^3 - ..., where s = 1/x. + * We approximate pone by + * qone(x) = s*(0.375 + (R/S)) + * where R = qr1*s^2 + qr2*s^4 + ... + qr5*s^10 + * S = 1 + qs1*s^2 + ... + qs6*s^12 + * and + * | qone(x)/s -0.375-R/S | <= 2 ** ( -61.13) + */ + +static const float qr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.0000000000e+00, /* 0x00000000 */ + -1.0253906250e-01, /* 0xbdd20000 */ + -1.6271753311e+01, /* 0xc1822c8d */ + -7.5960174561e+02, /* 0xc43de683 */ + -1.1849806641e+04, /* 0xc639273a */ + -4.8438511719e+04, /* 0xc73d3683 */ +}; +static const float qs8[6] = { + 1.6139537048e+02, /* 0x43216537 */ + 7.8253862305e+03, /* 0x45f48b17 */ + 1.3387534375e+05, /* 0x4802bcd6 */ + 7.1965775000e+05, /* 0x492fb29c */ + 6.6660125000e+05, /* 0x4922be94 */ + -2.9449025000e+05, /* 0xc88fcb48 */ +}; + +static const float qr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + -2.0897993405e-11, /* 0xadb7d219 */ + -1.0253904760e-01, /* 0xbdd1fffe */ + -8.0564479828e+00, /* 0xc100e736 */ + -1.8366960144e+02, /* 0xc337ab6b */ + -1.3731937256e+03, /* 0xc4aba633 */ + -2.6124443359e+03, /* 0xc523471c */ +}; +static const float qs5[6] = { + 8.1276550293e+01, /* 0x42a28d98 */ + 1.9917987061e+03, /* 0x44f8f98f */ + 1.7468484375e+04, /* 0x468878f8 */ + 4.9851425781e+04, /* 0x4742bb6d */ + 2.7948074219e+04, /* 0x46da5826 */ + -4.7191835938e+03, /* 0xc5937978 */ +}; + +static const float qr3[6] = { + -5.0783124372e-09, /* 0xb1ae7d4f */ + -1.0253783315e-01, /* 0xbdd1ff5b */ + -4.6101160049e+00, /* 0xc0938612 */ + -5.7847221375e+01, /* 0xc267638e */ + -2.2824453735e+02, /* 0xc3643e9a */ + -2.1921012878e+02, /* 0xc35b35cb */ +}; +static const float qs3[6] = { + 4.7665153503e+01, /* 0x423ea91e */ + 6.7386511230e+02, /* 0x4428775e */ + 3.3801528320e+03, /* 0x45534272 */ + 5.5477290039e+03, /* 0x45ad5dd5 */ + 1.9031191406e+03, /* 0x44ede3d0 */ + -1.3520118713e+02, /* 0xc3073381 */ +}; + +static const float qr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + -1.7838172539e-07, /* 0xb43f8932 */ + -1.0251704603e-01, /* 0xbdd1f475 */ + -2.7522056103e+00, /* 0xc0302423 */ + -1.9663616180e+01, /* 0xc19d4f16 */ + -4.2325313568e+01, /* 0xc2294d1f */ + -2.1371921539e+01, /* 0xc1aaf9b2 */ +}; +static const float qs2[6] = { + 2.9533363342e+01, /* 0x41ec4454 */ + 2.5298155212e+02, /* 0x437cfb47 */ + 7.5750280762e+02, /* 0x443d602e */ + 7.3939318848e+02, /* 0x4438d92a */ + 1.5594900513e+02, /* 0x431bf2f2 */ + -4.9594988823e+00, /* 0xc09eb437 */ +}; + +static float qonef(float x) +{ + const float *p,*q; + float_t s,r,z; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x41000000){p = qr8; q = qs8;} + else if (ix >= 0x409173eb){p = qr5; q = qs5;} + else if (ix >= 0x4036d917){p = qr3; q = qs3;} + else /*ix >= 0x40000000*/ {p = qr2; q = qs2;} + z = 1.0f/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0f+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5]))))); + return (.375f + r/s)/x; +} diff --git a/lib/libc/src/musl-math/ldexp.c b/lib/libc/src/musl-math/ldexp.c new file mode 100644 index 0000000..f4d1cd6 --- /dev/null +++ b/lib/libc/src/musl-math/ldexp.c @@ -0,0 +1,6 @@ +#include <math.h> + +double ldexp(double x, int n) +{ + return scalbn(x, n); +} diff --git a/lib/libc/src/musl-math/ldexpf.c b/lib/libc/src/musl-math/ldexpf.c new file mode 100644 index 0000000..3bad5f3 --- /dev/null +++ b/lib/libc/src/musl-math/ldexpf.c @@ -0,0 +1,6 @@ +#include <math.h> + +float ldexpf(float x, int n) +{ + return scalbnf(x, n); +} diff --git a/lib/libc/src/musl-math/ldexpl.c b/lib/libc/src/musl-math/ldexpl.c new file mode 100644 index 0000000..fd145cc --- /dev/null +++ b/lib/libc/src/musl-math/ldexpl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long double ldexpl(long double x, int n) +{ + return scalbnl(x, n); +} diff --git a/lib/libc/src/musl-math/lgamma.c b/lib/libc/src/musl-math/lgamma.c new file mode 100644 index 0000000..e25ec8e --- /dev/null +++ b/lib/libc/src/musl-math/lgamma.c @@ -0,0 +1,9 @@ +#include <math.h> + +extern int __signgam; +double __lgamma_r(double, int *); + +double lgamma(double x) +{ + return __lgamma_r(x, &__signgam); +} diff --git a/lib/libc/src/musl-math/lgamma_r.c b/lib/libc/src/musl-math/lgamma_r.c new file mode 100644 index 0000000..84596a3 --- /dev/null +++ b/lib/libc/src/musl-math/lgamma_r.c @@ -0,0 +1,285 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_lgamma_r.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ +/* lgamma_r(x, signgamp) + * Reentrant version of the logarithm of the Gamma function + * with user provide pointer for the sign of Gamma(x). + * + * Method: + * 1. Argument Reduction for 0 < x <= 8 + * Since gamma(1+s)=s*gamma(s), for x in [0,8], we may + * reduce x to a number in [1.5,2.5] by + * lgamma(1+s) = log(s) + lgamma(s) + * for example, + * lgamma(7.3) = log(6.3) + lgamma(6.3) + * = log(6.3*5.3) + lgamma(5.3) + * = log(6.3*5.3*4.3*3.3*2.3) + lgamma(2.3) + * 2. Polynomial approximation of lgamma around its + * minimun ymin=1.461632144968362245 to maintain monotonicity. + * On [ymin-0.23, ymin+0.27] (i.e., [1.23164,1.73163]), use + * Let z = x-ymin; + * lgamma(x) = -1.214862905358496078218 + z^2*poly(z) + * where + * poly(z) is a 14 degree polynomial. + * 2. Rational approximation in the primary interval [2,3] + * We use the following approximation: + * s = x-2.0; + * lgamma(x) = 0.5*s + s*P(s)/Q(s) + * with accuracy + * |P/Q - (lgamma(x)-0.5s)| < 2**-61.71 + * Our algorithms are based on the following observation + * + * zeta(2)-1 2 zeta(3)-1 3 + * lgamma(2+s) = s*(1-Euler) + --------- * s - --------- * s + ... + * 2 3 + * + * where Euler = 0.5771... is the Euler constant, which is very + * close to 0.5. + * + * 3. For x>=8, we have + * lgamma(x)~(x-0.5)log(x)-x+0.5*log(2pi)+1/(12x)-1/(360x**3)+.... + * (better formula: + * lgamma(x)~(x-0.5)*(log(x)-1)-.5*(log(2pi)-1) + ...) + * Let z = 1/x, then we approximation + * f(z) = lgamma(x) - (x-0.5)(log(x)-1) + * by + * 3 5 11 + * w = w0 + w1*z + w2*z + w3*z + ... + w6*z + * where + * |w - f(z)| < 2**-58.74 + * + * 4. For negative x, since (G is gamma function) + * -x*G(-x)*G(x) = pi/sin(pi*x), + * we have + * G(x) = pi/(sin(pi*x)*(-x)*G(-x)) + * since G(-x) is positive, sign(G(x)) = sign(sin(pi*x)) for x<0 + * Hence, for x<0, signgam = sign(sin(pi*x)) and + * lgamma(x) = log(|Gamma(x)|) + * = log(pi/(|x*sin(pi*x)|)) - lgamma(-x); + * Note: one should avoid compute pi*(-x) directly in the + * computation of sin(pi*(-x)). + * + * 5. Special Cases + * lgamma(2+s) ~ s*(1-Euler) for tiny s + * lgamma(1) = lgamma(2) = 0 + * lgamma(x) ~ -log(|x|) for tiny x + * lgamma(0) = lgamma(neg.integer) = inf and raise divide-by-zero + * lgamma(inf) = inf + * lgamma(-inf) = inf (bug for bug compatible with C99!?) + * + */ + +#include "libm.h" +#include "weak_alias.h" +//#include "libc.h" + +static const double +pi = 3.14159265358979311600e+00, /* 0x400921FB, 0x54442D18 */ +a0 = 7.72156649015328655494e-02, /* 0x3FB3C467, 0xE37DB0C8 */ +a1 = 3.22467033424113591611e-01, /* 0x3FD4A34C, 0xC4A60FAD */ +a2 = 6.73523010531292681824e-02, /* 0x3FB13E00, 0x1A5562A7 */ +a3 = 2.05808084325167332806e-02, /* 0x3F951322, 0xAC92547B */ +a4 = 7.38555086081402883957e-03, /* 0x3F7E404F, 0xB68FEFE8 */ +a5 = 2.89051383673415629091e-03, /* 0x3F67ADD8, 0xCCB7926B */ +a6 = 1.19270763183362067845e-03, /* 0x3F538A94, 0x116F3F5D */ +a7 = 5.10069792153511336608e-04, /* 0x3F40B6C6, 0x89B99C00 */ +a8 = 2.20862790713908385557e-04, /* 0x3F2CF2EC, 0xED10E54D */ +a9 = 1.08011567247583939954e-04, /* 0x3F1C5088, 0x987DFB07 */ +a10 = 2.52144565451257326939e-05, /* 0x3EFA7074, 0x428CFA52 */ +a11 = 4.48640949618915160150e-05, /* 0x3F07858E, 0x90A45837 */ +tc = 1.46163214496836224576e+00, /* 0x3FF762D8, 0x6356BE3F */ +tf = -1.21486290535849611461e-01, /* 0xBFBF19B9, 0xBCC38A42 */ +/* tt = -(tail of tf) */ +tt = -3.63867699703950536541e-18, /* 0xBC50C7CA, 0xA48A971F */ +t0 = 4.83836122723810047042e-01, /* 0x3FDEF72B, 0xC8EE38A2 */ +t1 = -1.47587722994593911752e-01, /* 0xBFC2E427, 0x8DC6C509 */ +t2 = 6.46249402391333854778e-02, /* 0x3FB08B42, 0x94D5419B */ +t3 = -3.27885410759859649565e-02, /* 0xBFA0C9A8, 0xDF35B713 */ +t4 = 1.79706750811820387126e-02, /* 0x3F9266E7, 0x970AF9EC */ +t5 = -1.03142241298341437450e-02, /* 0xBF851F9F, 0xBA91EC6A */ +t6 = 6.10053870246291332635e-03, /* 0x3F78FCE0, 0xE370E344 */ +t7 = -3.68452016781138256760e-03, /* 0xBF6E2EFF, 0xB3E914D7 */ +t8 = 2.25964780900612472250e-03, /* 0x3F6282D3, 0x2E15C915 */ +t9 = -1.40346469989232843813e-03, /* 0xBF56FE8E, 0xBF2D1AF1 */ +t10 = 8.81081882437654011382e-04, /* 0x3F4CDF0C, 0xEF61A8E9 */ +t11 = -5.38595305356740546715e-04, /* 0xBF41A610, 0x9C73E0EC */ +t12 = 3.15632070903625950361e-04, /* 0x3F34AF6D, 0x6C0EBBF7 */ +t13 = -3.12754168375120860518e-04, /* 0xBF347F24, 0xECC38C38 */ +t14 = 3.35529192635519073543e-04, /* 0x3F35FD3E, 0xE8C2D3F4 */ +u0 = -7.72156649015328655494e-02, /* 0xBFB3C467, 0xE37DB0C8 */ +u1 = 6.32827064025093366517e-01, /* 0x3FE4401E, 0x8B005DFF */ +u2 = 1.45492250137234768737e+00, /* 0x3FF7475C, 0xD119BD6F */ +u3 = 9.77717527963372745603e-01, /* 0x3FEF4976, 0x44EA8450 */ +u4 = 2.28963728064692451092e-01, /* 0x3FCD4EAE, 0xF6010924 */ +u5 = 1.33810918536787660377e-02, /* 0x3F8B678B, 0xBF2BAB09 */ +v1 = 2.45597793713041134822e+00, /* 0x4003A5D7, 0xC2BD619C */ +v2 = 2.12848976379893395361e+00, /* 0x40010725, 0xA42B18F5 */ +v3 = 7.69285150456672783825e-01, /* 0x3FE89DFB, 0xE45050AF */ +v4 = 1.04222645593369134254e-01, /* 0x3FBAAE55, 0xD6537C88 */ +v5 = 3.21709242282423911810e-03, /* 0x3F6A5ABB, 0x57D0CF61 */ +s0 = -7.72156649015328655494e-02, /* 0xBFB3C467, 0xE37DB0C8 */ +s1 = 2.14982415960608852501e-01, /* 0x3FCB848B, 0x36E20878 */ +s2 = 3.25778796408930981787e-01, /* 0x3FD4D98F, 0x4F139F59 */ +s3 = 1.46350472652464452805e-01, /* 0x3FC2BB9C, 0xBEE5F2F7 */ +s4 = 2.66422703033638609560e-02, /* 0x3F9B481C, 0x7E939961 */ +s5 = 1.84028451407337715652e-03, /* 0x3F5E26B6, 0x7368F239 */ +s6 = 3.19475326584100867617e-05, /* 0x3F00BFEC, 0xDD17E945 */ +r1 = 1.39200533467621045958e+00, /* 0x3FF645A7, 0x62C4AB74 */ +r2 = 7.21935547567138069525e-01, /* 0x3FE71A18, 0x93D3DCDC */ +r3 = 1.71933865632803078993e-01, /* 0x3FC601ED, 0xCCFBDF27 */ +r4 = 1.86459191715652901344e-02, /* 0x3F9317EA, 0x742ED475 */ +r5 = 7.77942496381893596434e-04, /* 0x3F497DDA, 0xCA41A95B */ +r6 = 7.32668430744625636189e-06, /* 0x3EDEBAF7, 0xA5B38140 */ +w0 = 4.18938533204672725052e-01, /* 0x3FDACFE3, 0x90C97D69 */ +w1 = 8.33333333333329678849e-02, /* 0x3FB55555, 0x5555553B */ +w2 = -2.77777777728775536470e-03, /* 0xBF66C16C, 0x16B02E5C */ +w3 = 7.93650558643019558500e-04, /* 0x3F4A019F, 0x98CF38B6 */ +w4 = -5.95187557450339963135e-04, /* 0xBF4380CB, 0x8C0FE741 */ +w5 = 8.36339918996282139126e-04, /* 0x3F4B67BA, 0x4CDAD5D1 */ +w6 = -1.63092934096575273989e-03; /* 0xBF5AB89D, 0x0B9E43E4 */ + +/* sin(pi*x) assuming x > 2^-100, if sin(pi*x)==0 the sign is arbitrary */ +static double sin_pi(double x) +{ + int n; + + /* spurious inexact if odd int */ + x = 2.0*(x*0.5 - floor(x*0.5)); /* x mod 2.0 */ + + n = (int)(x*4.0); + n = (n+1)/2; + x -= n*0.5f; + x *= pi; + + switch (n) { + default: /* case 4: */ + case 0: return __sin(x, 0.0, 0); + case 1: return __cos(x, 0.0); + case 2: return __sin(-x, 0.0, 0); + case 3: return -__cos(x, 0.0); + } +} + +double __lgamma_r(double x, int *signgamp) +{ + union {double f; uint64_t i;} u = {x}; + double_t t,y,z,nadj,p,p1,p2,p3,q,r,w; + uint32_t ix; + int sign,i; + + /* purge off +-inf, NaN, +-0, tiny and negative arguments */ + *signgamp = 1; + sign = u.i>>63; + ix = u.i>>32 & 0x7fffffff; + if (ix >= 0x7ff00000) + return x*x; + if (ix < (0x3ff-70)<<20) { /* |x|<2**-70, return -log(|x|) */ + if(sign) { + x = -x; + *signgamp = -1; + } + return -log(x); + } + if (sign) { + x = -x; + t = sin_pi(x); + if (t == 0.0) /* -integer */ + return 1.0/(x-x); + if (t > 0.0) + *signgamp = -1; + else + t = -t; + nadj = log(pi/(t*x)); + } + + /* purge off 1 and 2 */ + if ((ix == 0x3ff00000 || ix == 0x40000000) && (uint32_t)u.i == 0) + r = 0; + /* for x < 2.0 */ + else if (ix < 0x40000000) { + if (ix <= 0x3feccccc) { /* lgamma(x) = lgamma(x+1)-log(x) */ + r = -log(x); + if (ix >= 0x3FE76944) { + y = 1.0 - x; + i = 0; + } else if (ix >= 0x3FCDA661) { + y = x - (tc-1.0); + i = 1; + } else { + y = x; + i = 2; + } + } else { + r = 0.0; + if (ix >= 0x3FFBB4C3) { /* [1.7316,2] */ + y = 2.0 - x; + i = 0; + } else if(ix >= 0x3FF3B4C4) { /* [1.23,1.73] */ + y = x - tc; + i = 1; + } else { + y = x - 1.0; + i = 2; + } + } + switch (i) { + case 0: + z = y*y; + p1 = a0+z*(a2+z*(a4+z*(a6+z*(a8+z*a10)))); + p2 = z*(a1+z*(a3+z*(a5+z*(a7+z*(a9+z*a11))))); + p = y*p1+p2; + r += (p-0.5*y); + break; + case 1: + z = y*y; + w = z*y; + p1 = t0+w*(t3+w*(t6+w*(t9 +w*t12))); /* parallel comp */ + p2 = t1+w*(t4+w*(t7+w*(t10+w*t13))); + p3 = t2+w*(t5+w*(t8+w*(t11+w*t14))); + p = z*p1-(tt-w*(p2+y*p3)); + r += tf + p; + break; + case 2: + p1 = y*(u0+y*(u1+y*(u2+y*(u3+y*(u4+y*u5))))); + p2 = 1.0+y*(v1+y*(v2+y*(v3+y*(v4+y*v5)))); + r += -0.5*y + p1/p2; + } + } else if (ix < 0x40200000) { /* x < 8.0 */ + i = (int)x; + y = x - (double)i; + p = y*(s0+y*(s1+y*(s2+y*(s3+y*(s4+y*(s5+y*s6)))))); + q = 1.0+y*(r1+y*(r2+y*(r3+y*(r4+y*(r5+y*r6))))); + r = 0.5*y+p/q; + z = 1.0; /* lgamma(1+s) = log(s) + lgamma(s) */ + switch (i) { + case 7: z *= y + 6.0; /* FALLTHRU */ + case 6: z *= y + 5.0; /* FALLTHRU */ + case 5: z *= y + 4.0; /* FALLTHRU */ + case 4: z *= y + 3.0; /* FALLTHRU */ + case 3: z *= y + 2.0; /* FALLTHRU */ + r += log(z); + break; + } + } else if (ix < 0x43900000) { /* 8.0 <= x < 2**58 */ + t = log(x); + z = 1.0/x; + y = z*z; + w = w0+z*(w1+y*(w2+y*(w3+y*(w4+y*(w5+y*w6))))); + r = (x-0.5)*(t-1.0)+w; + } else /* 2**58 <= x <= inf */ + r = x*(log(x)-1.0); + if (sign) + r = nadj - r; + return r; +} + +weak_alias(__lgamma_r, lgamma_r); diff --git a/lib/libc/src/musl-math/lgammaf.c b/lib/libc/src/musl-math/lgammaf.c new file mode 100644 index 0000000..badb6df --- /dev/null +++ b/lib/libc/src/musl-math/lgammaf.c @@ -0,0 +1,9 @@ +#include <math.h> + +extern int __signgam; +float __lgammaf_r(float, int *); + +float lgammaf(float x) +{ + return __lgammaf_r(x, &__signgam); +} diff --git a/lib/libc/src/musl-math/lgammaf_r.c b/lib/libc/src/musl-math/lgammaf_r.c new file mode 100644 index 0000000..f73e89d --- /dev/null +++ b/lib/libc/src/musl-math/lgammaf_r.c @@ -0,0 +1,220 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_lgammaf_r.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" +#include "weak_alias.h" +//#include "libc.h" + +static const float +pi = 3.1415927410e+00, /* 0x40490fdb */ +a0 = 7.7215664089e-02, /* 0x3d9e233f */ +a1 = 3.2246702909e-01, /* 0x3ea51a66 */ +a2 = 6.7352302372e-02, /* 0x3d89f001 */ +a3 = 2.0580807701e-02, /* 0x3ca89915 */ +a4 = 7.3855509982e-03, /* 0x3bf2027e */ +a5 = 2.8905137442e-03, /* 0x3b3d6ec6 */ +a6 = 1.1927076848e-03, /* 0x3a9c54a1 */ +a7 = 5.1006977446e-04, /* 0x3a05b634 */ +a8 = 2.2086278477e-04, /* 0x39679767 */ +a9 = 1.0801156895e-04, /* 0x38e28445 */ +a10 = 2.5214456400e-05, /* 0x37d383a2 */ +a11 = 4.4864096708e-05, /* 0x383c2c75 */ +tc = 1.4616321325e+00, /* 0x3fbb16c3 */ +tf = -1.2148628384e-01, /* 0xbdf8cdcd */ +/* tt = -(tail of tf) */ +tt = 6.6971006518e-09, /* 0x31e61c52 */ +t0 = 4.8383611441e-01, /* 0x3ef7b95e */ +t1 = -1.4758771658e-01, /* 0xbe17213c */ +t2 = 6.4624942839e-02, /* 0x3d845a15 */ +t3 = -3.2788541168e-02, /* 0xbd064d47 */ +t4 = 1.7970675603e-02, /* 0x3c93373d */ +t5 = -1.0314224288e-02, /* 0xbc28fcfe */ +t6 = 6.1005386524e-03, /* 0x3bc7e707 */ +t7 = -3.6845202558e-03, /* 0xbb7177fe */ +t8 = 2.2596477065e-03, /* 0x3b141699 */ +t9 = -1.4034647029e-03, /* 0xbab7f476 */ +t10 = 8.8108185446e-04, /* 0x3a66f867 */ +t11 = -5.3859531181e-04, /* 0xba0d3085 */ +t12 = 3.1563205994e-04, /* 0x39a57b6b */ +t13 = -3.1275415677e-04, /* 0xb9a3f927 */ +t14 = 3.3552918467e-04, /* 0x39afe9f7 */ +u0 = -7.7215664089e-02, /* 0xbd9e233f */ +u1 = 6.3282704353e-01, /* 0x3f2200f4 */ +u2 = 1.4549225569e+00, /* 0x3fba3ae7 */ +u3 = 9.7771751881e-01, /* 0x3f7a4bb2 */ +u4 = 2.2896373272e-01, /* 0x3e6a7578 */ +u5 = 1.3381091878e-02, /* 0x3c5b3c5e */ +v1 = 2.4559779167e+00, /* 0x401d2ebe */ +v2 = 2.1284897327e+00, /* 0x4008392d */ +v3 = 7.6928514242e-01, /* 0x3f44efdf */ +v4 = 1.0422264785e-01, /* 0x3dd572af */ +v5 = 3.2170924824e-03, /* 0x3b52d5db */ +s0 = -7.7215664089e-02, /* 0xbd9e233f */ +s1 = 2.1498242021e-01, /* 0x3e5c245a */ +s2 = 3.2577878237e-01, /* 0x3ea6cc7a */ +s3 = 1.4635047317e-01, /* 0x3e15dce6 */ +s4 = 2.6642270386e-02, /* 0x3cda40e4 */ +s5 = 1.8402845599e-03, /* 0x3af135b4 */ +s6 = 3.1947532989e-05, /* 0x3805ff67 */ +r1 = 1.3920053244e+00, /* 0x3fb22d3b */ +r2 = 7.2193557024e-01, /* 0x3f38d0c5 */ +r3 = 1.7193385959e-01, /* 0x3e300f6e */ +r4 = 1.8645919859e-02, /* 0x3c98bf54 */ +r5 = 7.7794247773e-04, /* 0x3a4beed6 */ +r6 = 7.3266842264e-06, /* 0x36f5d7bd */ +w0 = 4.1893854737e-01, /* 0x3ed67f1d */ +w1 = 8.3333335817e-02, /* 0x3daaaaab */ +w2 = -2.7777778450e-03, /* 0xbb360b61 */ +w3 = 7.9365057172e-04, /* 0x3a500cfd */ +w4 = -5.9518753551e-04, /* 0xba1c065c */ +w5 = 8.3633989561e-04, /* 0x3a5b3dd2 */ +w6 = -1.6309292987e-03; /* 0xbad5c4e8 */ + +/* sin(pi*x) assuming x > 2^-100, if sin(pi*x)==0 the sign is arbitrary */ +static float sin_pi(float x) +{ + double_t y; + int n; + + /* spurious inexact if odd int */ + x = 2*(x*0.5f - floorf(x*0.5f)); /* x mod 2.0 */ + + n = (int)(x*4); + n = (n+1)/2; + y = x - n*0.5f; + y *= 3.14159265358979323846; + switch (n) { + default: /* case 4: */ + case 0: return __sindf(y); + case 1: return __cosdf(y); + case 2: return __sindf(-y); + case 3: return -__cosdf(y); + } +} + +float __lgammaf_r(float x, int *signgamp) +{ + union {float f; uint32_t i;} u = {x}; + float t,y,z,nadj,p,p1,p2,p3,q,r,w; + uint32_t ix; + int i,sign; + + /* purge off +-inf, NaN, +-0, tiny and negative arguments */ + *signgamp = 1; + sign = u.i>>31; + ix = u.i & 0x7fffffff; + if (ix >= 0x7f800000) + return x*x; + if (ix < 0x35000000) { /* |x| < 2**-21, return -log(|x|) */ + if (sign) { + *signgamp = -1; + x = -x; + } + return -logf(x); + } + if (sign) { + x = -x; + t = sin_pi(x); + if (t == 0.0f) /* -integer */ + return 1.0f/(x-x); + if (t > 0.0f) + *signgamp = -1; + else + t = -t; + nadj = logf(pi/(t*x)); + } + + /* purge off 1 and 2 */ + if (ix == 0x3f800000 || ix == 0x40000000) + r = 0; + /* for x < 2.0 */ + else if (ix < 0x40000000) { + if (ix <= 0x3f666666) { /* lgamma(x) = lgamma(x+1)-log(x) */ + r = -logf(x); + if (ix >= 0x3f3b4a20) { + y = 1.0f - x; + i = 0; + } else if (ix >= 0x3e6d3308) { + y = x - (tc-1.0f); + i = 1; + } else { + y = x; + i = 2; + } + } else { + r = 0.0f; + if (ix >= 0x3fdda618) { /* [1.7316,2] */ + y = 2.0f - x; + i = 0; + } else if (ix >= 0x3F9da620) { /* [1.23,1.73] */ + y = x - tc; + i = 1; + } else { + y = x - 1.0f; + i = 2; + } + } + switch(i) { + case 0: + z = y*y; + p1 = a0+z*(a2+z*(a4+z*(a6+z*(a8+z*a10)))); + p2 = z*(a1+z*(a3+z*(a5+z*(a7+z*(a9+z*a11))))); + p = y*p1+p2; + r += p - 0.5f*y; + break; + case 1: + z = y*y; + w = z*y; + p1 = t0+w*(t3+w*(t6+w*(t9 +w*t12))); /* parallel comp */ + p2 = t1+w*(t4+w*(t7+w*(t10+w*t13))); + p3 = t2+w*(t5+w*(t8+w*(t11+w*t14))); + p = z*p1-(tt-w*(p2+y*p3)); + r += (tf + p); + break; + case 2: + p1 = y*(u0+y*(u1+y*(u2+y*(u3+y*(u4+y*u5))))); + p2 = 1.0f+y*(v1+y*(v2+y*(v3+y*(v4+y*v5)))); + r += -0.5f*y + p1/p2; + } + } else if (ix < 0x41000000) { /* x < 8.0 */ + i = (int)x; + y = x - (float)i; + p = y*(s0+y*(s1+y*(s2+y*(s3+y*(s4+y*(s5+y*s6)))))); + q = 1.0f+y*(r1+y*(r2+y*(r3+y*(r4+y*(r5+y*r6))))); + r = 0.5f*y+p/q; + z = 1.0f; /* lgamma(1+s) = log(s) + lgamma(s) */ + switch (i) { + case 7: z *= y + 6.0f; /* FALLTHRU */ + case 6: z *= y + 5.0f; /* FALLTHRU */ + case 5: z *= y + 4.0f; /* FALLTHRU */ + case 4: z *= y + 3.0f; /* FALLTHRU */ + case 3: z *= y + 2.0f; /* FALLTHRU */ + r += logf(z); + break; + } + } else if (ix < 0x5c800000) { /* 8.0 <= x < 2**58 */ + t = logf(x); + z = 1.0f/x; + y = z*z; + w = w0+z*(w1+y*(w2+y*(w3+y*(w4+y*(w5+y*w6))))); + r = (x-0.5f)*(t-1.0f)+w; + } else /* 2**58 <= x <= inf */ + r = x*(logf(x)-1.0f); + if (sign) + r = nadj - r; + return r; +} + +weak_alias(__lgammaf_r, lgammaf_r); diff --git a/lib/libc/src/musl-math/lgammal.c b/lib/libc/src/musl-math/lgammal.c new file mode 100644 index 0000000..f0bea36 --- /dev/null +++ b/lib/libc/src/musl-math/lgammal.c @@ -0,0 +1,361 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_lgammal.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* lgammal(x) + * Reentrant version of the logarithm of the Gamma function + * with user provide pointer for the sign of Gamma(x). + * + * Method: + * 1. Argument Reduction for 0 < x <= 8 + * Since gamma(1+s)=s*gamma(s), for x in [0,8], we may + * reduce x to a number in [1.5,2.5] by + * lgamma(1+s) = log(s) + lgamma(s) + * for example, + * lgamma(7.3) = log(6.3) + lgamma(6.3) + * = log(6.3*5.3) + lgamma(5.3) + * = log(6.3*5.3*4.3*3.3*2.3) + lgamma(2.3) + * 2. Polynomial approximation of lgamma around its + * minimun ymin=1.461632144968362245 to maintain monotonicity. + * On [ymin-0.23, ymin+0.27] (i.e., [1.23164,1.73163]), use + * Let z = x-ymin; + * lgamma(x) = -1.214862905358496078218 + z^2*poly(z) + * 2. Rational approximation in the primary interval [2,3] + * We use the following approximation: + * s = x-2.0; + * lgamma(x) = 0.5*s + s*P(s)/Q(s) + * Our algorithms are based on the following observation + * + * zeta(2)-1 2 zeta(3)-1 3 + * lgamma(2+s) = s*(1-Euler) + --------- * s - --------- * s + ... + * 2 3 + * + * where Euler = 0.5771... is the Euler constant, which is very + * close to 0.5. + * + * 3. For x>=8, we have + * lgamma(x)~(x-0.5)log(x)-x+0.5*log(2pi)+1/(12x)-1/(360x**3)+.... + * (better formula: + * lgamma(x)~(x-0.5)*(log(x)-1)-.5*(log(2pi)-1) + ...) + * Let z = 1/x, then we approximation + * f(z) = lgamma(x) - (x-0.5)(log(x)-1) + * by + * 3 5 11 + * w = w0 + w1*z + w2*z + w3*z + ... + w6*z + * + * 4. For negative x, since (G is gamma function) + * -x*G(-x)*G(x) = pi/sin(pi*x), + * we have + * G(x) = pi/(sin(pi*x)*(-x)*G(-x)) + * since G(-x) is positive, sign(G(x)) = sign(sin(pi*x)) for x<0 + * Hence, for x<0, signgam = sign(sin(pi*x)) and + * lgamma(x) = log(|Gamma(x)|) + * = log(pi/(|x*sin(pi*x)|)) - lgamma(-x); + * Note: one should avoid compute pi*(-x) directly in the + * computation of sin(pi*(-x)). + * + * 5. Special Cases + * lgamma(2+s) ~ s*(1-Euler) for tiny s + * lgamma(1)=lgamma(2)=0 + * lgamma(x) ~ -log(x) for tiny x + * lgamma(0) = lgamma(inf) = inf + * lgamma(-integer) = +-inf + * + */ + +#define _GNU_SOURCE +#include "libm.h" +#include "weak_alias.h" +//#include "libc.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +double __lgamma_r(double x, int *sg); + +long double __lgammal_r(long double x, int *sg) +{ + return __lgamma_r(x, sg); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +static const long double +pi = 3.14159265358979323846264L, + +/* lgam(1+x) = 0.5 x + x a(x)/b(x) + -0.268402099609375 <= x <= 0 + peak relative error 6.6e-22 */ +a0 = -6.343246574721079391729402781192128239938E2L, +a1 = 1.856560238672465796768677717168371401378E3L, +a2 = 2.404733102163746263689288466865843408429E3L, +a3 = 8.804188795790383497379532868917517596322E2L, +a4 = 1.135361354097447729740103745999661157426E2L, +a5 = 3.766956539107615557608581581190400021285E0L, + +b0 = 8.214973713960928795704317259806842490498E3L, +b1 = 1.026343508841367384879065363925870888012E4L, +b2 = 4.553337477045763320522762343132210919277E3L, +b3 = 8.506975785032585797446253359230031874803E2L, +b4 = 6.042447899703295436820744186992189445813E1L, +/* b5 = 1.000000000000000000000000000000000000000E0 */ + + +tc = 1.4616321449683623412626595423257213284682E0L, +tf = -1.2148629053584961146050602565082954242826E-1, /* double precision */ +/* tt = (tail of tf), i.e. tf + tt has extended precision. */ +tt = 3.3649914684731379602768989080467587736363E-18L, +/* lgam ( 1.4616321449683623412626595423257213284682E0 ) = +-1.2148629053584960809551455717769158215135617312999903886372437313313530E-1 */ + +/* lgam (x + tc) = tf + tt + x g(x)/h(x) + -0.230003726999612341262659542325721328468 <= x + <= 0.2699962730003876587373404576742786715318 + peak relative error 2.1e-21 */ +g0 = 3.645529916721223331888305293534095553827E-18L, +g1 = 5.126654642791082497002594216163574795690E3L, +g2 = 8.828603575854624811911631336122070070327E3L, +g3 = 5.464186426932117031234820886525701595203E3L, +g4 = 1.455427403530884193180776558102868592293E3L, +g5 = 1.541735456969245924860307497029155838446E2L, +g6 = 4.335498275274822298341872707453445815118E0L, + +h0 = 1.059584930106085509696730443974495979641E4L, +h1 = 2.147921653490043010629481226937850618860E4L, +h2 = 1.643014770044524804175197151958100656728E4L, +h3 = 5.869021995186925517228323497501767586078E3L, +h4 = 9.764244777714344488787381271643502742293E2L, +h5 = 6.442485441570592541741092969581997002349E1L, +/* h6 = 1.000000000000000000000000000000000000000E0 */ + + +/* lgam (x+1) = -0.5 x + x u(x)/v(x) + -0.100006103515625 <= x <= 0.231639862060546875 + peak relative error 1.3e-21 */ +u0 = -8.886217500092090678492242071879342025627E1L, +u1 = 6.840109978129177639438792958320783599310E2L, +u2 = 2.042626104514127267855588786511809932433E3L, +u3 = 1.911723903442667422201651063009856064275E3L, +u4 = 7.447065275665887457628865263491667767695E2L, +u5 = 1.132256494121790736268471016493103952637E2L, +u6 = 4.484398885516614191003094714505960972894E0L, + +v0 = 1.150830924194461522996462401210374632929E3L, +v1 = 3.399692260848747447377972081399737098610E3L, +v2 = 3.786631705644460255229513563657226008015E3L, +v3 = 1.966450123004478374557778781564114347876E3L, +v4 = 4.741359068914069299837355438370682773122E2L, +v5 = 4.508989649747184050907206782117647852364E1L, +/* v6 = 1.000000000000000000000000000000000000000E0 */ + + +/* lgam (x+2) = .5 x + x s(x)/r(x) + 0 <= x <= 1 + peak relative error 7.2e-22 */ +s0 = 1.454726263410661942989109455292824853344E6L, +s1 = -3.901428390086348447890408306153378922752E6L, +s2 = -6.573568698209374121847873064292963089438E6L, +s3 = -3.319055881485044417245964508099095984643E6L, +s4 = -7.094891568758439227560184618114707107977E5L, +s5 = -6.263426646464505837422314539808112478303E4L, +s6 = -1.684926520999477529949915657519454051529E3L, + +r0 = -1.883978160734303518163008696712983134698E7L, +r1 = -2.815206082812062064902202753264922306830E7L, +r2 = -1.600245495251915899081846093343626358398E7L, +r3 = -4.310526301881305003489257052083370058799E6L, +r4 = -5.563807682263923279438235987186184968542E5L, +r5 = -3.027734654434169996032905158145259713083E4L, +r6 = -4.501995652861105629217250715790764371267E2L, +/* r6 = 1.000000000000000000000000000000000000000E0 */ + + +/* lgam(x) = ( x - 0.5 ) * log(x) - x + LS2PI + 1/x w(1/x^2) + x >= 8 + Peak relative error 1.51e-21 +w0 = LS2PI - 0.5 */ +w0 = 4.189385332046727417803e-1L, +w1 = 8.333333333333331447505E-2L, +w2 = -2.777777777750349603440E-3L, +w3 = 7.936507795855070755671E-4L, +w4 = -5.952345851765688514613E-4L, +w5 = 8.412723297322498080632E-4L, +w6 = -1.880801938119376907179E-3L, +w7 = 4.885026142432270781165E-3L; + +/* sin(pi*x) assuming x > 2^-1000, if sin(pi*x)==0 the sign is arbitrary */ +static long double sin_pi(long double x) +{ + int n; + + /* spurious inexact if odd int */ + x *= 0.5; + x = 2.0*(x - floorl(x)); /* x mod 2.0 */ + + n = (int)(x*4.0); + n = (n+1)/2; + x -= n*0.5f; + x *= pi; + + switch (n) { + default: /* case 4: */ + case 0: return __sinl(x, 0.0, 0); + case 1: return __cosl(x, 0.0); + case 2: return __sinl(-x, 0.0, 0); + case 3: return -__cosl(x, 0.0); + } +} + +long double __lgammal_r(long double x, int *sg) { + long double t, y, z, nadj, p, p1, p2, q, r, w; + union ldshape u = {x}; + uint32_t ix = (u.i.se & 0x7fffU)<<16 | u.i.m>>48; + int sign = u.i.se >> 15; + int i; + + *sg = 1; + + /* purge off +-inf, NaN, +-0, tiny and negative arguments */ + if (ix >= 0x7fff0000) + return x * x; + if (ix < 0x3fc08000) { /* |x|<2**-63, return -log(|x|) */ + if (sign) { + *sg = -1; + x = -x; + } + return -logl(x); + } + if (sign) { + x = -x; + t = sin_pi(x); + if (t == 0.0) + return 1.0 / (x-x); /* -integer */ + if (t > 0.0) + *sg = -1; + else + t = -t; + nadj = logl(pi / (t * x)); + } + + /* purge off 1 and 2 (so the sign is ok with downward rounding) */ + if ((ix == 0x3fff8000 || ix == 0x40008000) && u.i.m == 0) { + r = 0; + } else if (ix < 0x40008000) { /* x < 2.0 */ + if (ix <= 0x3ffee666) { /* 8.99993896484375e-1 */ + /* lgamma(x) = lgamma(x+1) - log(x) */ + r = -logl(x); + if (ix >= 0x3ffebb4a) { /* 7.31597900390625e-1 */ + y = x - 1.0; + i = 0; + } else if (ix >= 0x3ffced33) { /* 2.31639862060546875e-1 */ + y = x - (tc - 1.0); + i = 1; + } else { /* x < 0.23 */ + y = x; + i = 2; + } + } else { + r = 0.0; + if (ix >= 0x3fffdda6) { /* 1.73162841796875 */ + /* [1.7316,2] */ + y = x - 2.0; + i = 0; + } else if (ix >= 0x3fff9da6) { /* 1.23162841796875 */ + /* [1.23,1.73] */ + y = x - tc; + i = 1; + } else { + /* [0.9, 1.23] */ + y = x - 1.0; + i = 2; + } + } + switch (i) { + case 0: + p1 = a0 + y * (a1 + y * (a2 + y * (a3 + y * (a4 + y * a5)))); + p2 = b0 + y * (b1 + y * (b2 + y * (b3 + y * (b4 + y)))); + r += 0.5 * y + y * p1/p2; + break; + case 1: + p1 = g0 + y * (g1 + y * (g2 + y * (g3 + y * (g4 + y * (g5 + y * g6))))); + p2 = h0 + y * (h1 + y * (h2 + y * (h3 + y * (h4 + y * (h5 + y))))); + p = tt + y * p1/p2; + r += (tf + p); + break; + case 2: + p1 = y * (u0 + y * (u1 + y * (u2 + y * (u3 + y * (u4 + y * (u5 + y * u6)))))); + p2 = v0 + y * (v1 + y * (v2 + y * (v3 + y * (v4 + y * (v5 + y))))); + r += (-0.5 * y + p1 / p2); + } + } else if (ix < 0x40028000) { /* 8.0 */ + /* x < 8.0 */ + i = (int)x; + y = x - (double)i; + p = y * (s0 + y * (s1 + y * (s2 + y * (s3 + y * (s4 + y * (s5 + y * s6)))))); + q = r0 + y * (r1 + y * (r2 + y * (r3 + y * (r4 + y * (r5 + y * (r6 + y)))))); + r = 0.5 * y + p / q; + z = 1.0; + /* lgamma(1+s) = log(s) + lgamma(s) */ + switch (i) { + case 7: + z *= (y + 6.0); /* FALLTHRU */ + case 6: + z *= (y + 5.0); /* FALLTHRU */ + case 5: + z *= (y + 4.0); /* FALLTHRU */ + case 4: + z *= (y + 3.0); /* FALLTHRU */ + case 3: + z *= (y + 2.0); /* FALLTHRU */ + r += logl(z); + break; + } + } else if (ix < 0x40418000) { /* 2^66 */ + /* 8.0 <= x < 2**66 */ + t = logl(x); + z = 1.0 / x; + y = z * z; + w = w0 + z * (w1 + y * (w2 + y * (w3 + y * (w4 + y * (w5 + y * (w6 + y * w7)))))); + r = (x - 0.5) * (t - 1.0) + w; + } else /* 2**66 <= x <= inf */ + r = x * (logl(x) - 1.0); + if (sign) + r = nadj - r; + return r; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +double __lgamma_r(double x, int *sg); + +long double __lgammal_r(long double x, int *sg) +{ + return __lgamma_r(x, sg); +} +#endif + +extern int __signgam; + +long double lgammal(long double x) +{ + return __lgammal_r(x, &__signgam); +} + +weak_alias(__lgammal_r, lgammal_r); diff --git a/lib/libc/src/musl-math/libm.h b/lib/libc/src/musl-math/libm.h new file mode 100644 index 0000000..521b3fd --- /dev/null +++ b/lib/libc/src/musl-math/libm.h @@ -0,0 +1,198 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/math_private.h */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#ifndef _LIBM_H +#define _LIBM_H + +#include <sys/types.h> +#include <stdint.h> +#include <float.h> +#include <math.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 && __BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__ +union ldshape { + long double f; + struct { + uint64_t m; + uint16_t se; + } i; +}; +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 && __BYTE_ORDER__ == __ORDER_BIG_ENDIAN__ +/* This is the m68k variant of 80-bit long double, and this definition only works + * on archs where the alignment requirement of uint64_t is <= 4. */ +union ldshape { + long double f; + struct { + uint16_t se; + uint16_t pad; + uint64_t m; + } i; +}; +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 && __BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__ +union ldshape { + long double f; + struct { + uint64_t lo; + uint32_t mid; + uint16_t top; + uint16_t se; + } i; + struct { + uint64_t lo; + uint64_t hi; + } i2; +}; +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 && __BYTE_ORDER__ == __ORDER_BIG_ENDIAN__ +union ldshape { + long double f; + struct { + uint16_t se; + uint16_t top; + uint32_t mid; + uint64_t lo; + } i; + struct { + uint64_t hi; + uint64_t lo; + } i2; +}; +#else +#error Unsupported long double representation +#endif + +#define FORCE_EVAL(x) do { \ + if (sizeof(x) == sizeof(float)) { \ + volatile float __x; \ + __x = (x); \ + } else if (sizeof(x) == sizeof(double)) { \ + volatile double __x; \ + __x = (x); \ + } else { \ + volatile long double __x; \ + __x = (x); \ + } \ +} while(0) + +/* Get two 32 bit ints from a double. */ +#define EXTRACT_WORDS(hi,lo,d) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + (hi) = __u.i >> 32; \ + (lo) = (uint32_t)__u.i; \ +} while (0) + +/* Get the more significant 32 bit int from a double. */ +#define GET_HIGH_WORD(hi,d) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + (hi) = __u.i >> 32; \ +} while (0) + +/* Get the less significant 32 bit int from a double. */ +#define GET_LOW_WORD(lo,d) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + (lo) = (uint32_t)__u.i; \ +} while (0) + +/* Set a double from two 32 bit ints. */ +#define INSERT_WORDS(d,hi,lo) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.i = ((uint64_t)(hi)<<32) | (uint32_t)(lo); \ + (d) = __u.f; \ +} while (0) + +/* Set the more significant 32 bits of a double from an int. */ +#define SET_HIGH_WORD(d,hi) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + __u.i &= 0xffffffff; \ + __u.i |= (uint64_t)(hi) << 32; \ + (d) = __u.f; \ +} while (0) + +/* Set the less significant 32 bits of a double from an int. */ +#define SET_LOW_WORD(d,lo) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + __u.i &= 0xffffffff00000000ull; \ + __u.i |= (uint32_t)(lo); \ + (d) = __u.f; \ +} while (0) + +/* Get a 32 bit int from a float. */ +#define GET_FLOAT_WORD(w,d) \ +do { \ + union {float f; uint32_t i;} __u; \ + __u.f = (d); \ + (w) = __u.i; \ +} while (0) + +/* Set a float from a 32 bit int. */ +#define SET_FLOAT_WORD(d,w) \ +do { \ + union {float f; uint32_t i;} __u; \ + __u.i = (w); \ + (d) = __u.f; \ +} while (0) + +#undef __CMPLX +#undef CMPLX +#undef CMPLXF +#undef CMPLXL + +#define __CMPLX(x, y, t) \ + ((union { _Complex t __z; t __xy[2]; }){.__xy = {(x),(y)}}.__z) + +#define CMPLX(x, y) __CMPLX(x, y, double) +#define CMPLXF(x, y) __CMPLX(x, y, float) +#define CMPLXL(x, y) __CMPLX(x, y, long double) + +#ifndef __MLIBC_ABI_ONLY + +/* fdlibm kernel functions */ + +int __rem_pio2_large(double*,double*,int,int,int); + +int __rem_pio2(double,double*); +double __sin(double,double,int); +double __cos(double,double); +double __tan(double,double,int); +double __expo2(double); +/*double complex __ldexp_cexp(double complex,int); */ + +int __rem_pio2f(float,double*); +float __sindf(double); +float __cosdf(double); +float __tandf(double,int); +float __expo2f(float); +/*float complex __ldexp_cexpf(float complex,int); */ + +int __rem_pio2l(long double, long double *); +long double __sinl(long double, long double, int); +long double __cosl(long double, long double); +long double __tanl(long double, long double, int); + +/* polynomial evaluation */ +long double __polevll(long double, const long double *, int); +long double __p1evll(long double, const long double *, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#endif diff --git a/lib/libc/src/musl-math/llrint.c b/lib/libc/src/musl-math/llrint.c new file mode 100644 index 0000000..4f583ae --- /dev/null +++ b/lib/libc/src/musl-math/llrint.c @@ -0,0 +1,8 @@ +#include <math.h> + +/* uses LLONG_MAX > 2^53, see comments in lrint.c */ + +long long llrint(double x) +{ + return rint(x); +} diff --git a/lib/libc/src/musl-math/llrintf.c b/lib/libc/src/musl-math/llrintf.c new file mode 100644 index 0000000..96949a0 --- /dev/null +++ b/lib/libc/src/musl-math/llrintf.c @@ -0,0 +1,8 @@ +#include <math.h> + +/* uses LLONG_MAX > 2^24, see comments in lrint.c */ + +long long llrintf(float x) +{ + return rintf(x); +} diff --git a/lib/libc/src/musl-math/llrintl.c b/lib/libc/src/musl-math/llrintl.c new file mode 100644 index 0000000..3449f6f --- /dev/null +++ b/lib/libc/src/musl-math/llrintl.c @@ -0,0 +1,36 @@ +#include <limits.h> +#include <fenv.h> +#include "libm.h" + + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long long llrintl(long double x) +{ + return llrint(x); +} +#elif defined(FE_INEXACT) +/* +see comments in lrint.c + +Note that if LLONG_MAX == 0x7fffffffffffffff && LDBL_MANT_DIG == 64 +then x == 2**63 - 0.5 is the only input that overflows and +raises inexact (with tonearest or upward rounding mode) +*/ +long long llrintl(long double x) +{ + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); + x = rintl(x); + if (!e && (x > LLONG_MAX || x < LLONG_MIN)) + feclearexcept(FE_INEXACT); + /* conversion */ + return x; +} +#else +long long llrintl(long double x) +{ + return rintl(x); +} +#endif diff --git a/lib/libc/src/musl-math/llround.c b/lib/libc/src/musl-math/llround.c new file mode 100644 index 0000000..4d94787 --- /dev/null +++ b/lib/libc/src/musl-math/llround.c @@ -0,0 +1,6 @@ +#include <math.h> + +long long llround(double x) +{ + return round(x); +} diff --git a/lib/libc/src/musl-math/llroundf.c b/lib/libc/src/musl-math/llroundf.c new file mode 100644 index 0000000..19eb77e --- /dev/null +++ b/lib/libc/src/musl-math/llroundf.c @@ -0,0 +1,6 @@ +#include <math.h> + +long long llroundf(float x) +{ + return roundf(x); +} diff --git a/lib/libc/src/musl-math/llroundl.c b/lib/libc/src/musl-math/llroundl.c new file mode 100644 index 0000000..2c2ee5e --- /dev/null +++ b/lib/libc/src/musl-math/llroundl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long long llroundl(long double x) +{ + return roundl(x); +} diff --git a/lib/libc/src/musl-math/log.c b/lib/libc/src/musl-math/log.c new file mode 100644 index 0000000..e61e113 --- /dev/null +++ b/lib/libc/src/musl-math/log.c @@ -0,0 +1,118 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* log(x) + * Return the logarithm of x + * + * Method : + * 1. Argument Reduction: find k and f such that + * x = 2^k * (1+f), + * where sqrt(2)/2 < 1+f < sqrt(2) . + * + * 2. Approximation of log(1+f). + * Let s = f/(2+f) ; based on log(1+f) = log(1+s) - log(1-s) + * = 2s + 2/3 s**3 + 2/5 s**5 + ....., + * = 2s + s*R + * We use a special Remez algorithm on [0,0.1716] to generate + * a polynomial of degree 14 to approximate R The maximum error + * of this polynomial approximation is bounded by 2**-58.45. In + * other words, + * 2 4 6 8 10 12 14 + * R(z) ~ Lg1*s +Lg2*s +Lg3*s +Lg4*s +Lg5*s +Lg6*s +Lg7*s + * (the values of Lg1 to Lg7 are listed in the program) + * and + * | 2 14 | -58.45 + * | Lg1*s +...+Lg7*s - R(z) | <= 2 + * | | + * Note that 2s = f - s*f = f - hfsq + s*hfsq, where hfsq = f*f/2. + * In order to guarantee error in log below 1ulp, we compute log + * by + * log(1+f) = f - s*(f - R) (if f is not too large) + * log(1+f) = f - (hfsq - s*(hfsq+R)). (better accuracy) + * + * 3. Finally, log(x) = k*ln2 + log(1+f). + * = k*ln2_hi+(f-(hfsq-(s*(hfsq+R)+k*ln2_lo))) + * Here ln2 is split into two floating point number: + * ln2_hi + ln2_lo, + * where n*ln2_hi is always exact for |n| < 2000. + * + * Special cases: + * log(x) is NaN with signal if x < 0 (including -INF) ; + * log(+INF) is +INF; log(0) is -INF with signal; + * log(NaN) is that NaN with no signal. + * + * Accuracy: + * according to an error analysis, the error is always less than + * 1 ulp (unit in the last place). + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include <math.h> +#include <stdint.h> + +static const double +ln2_hi = 6.93147180369123816490e-01, /* 3fe62e42 fee00000 */ +ln2_lo = 1.90821492927058770002e-10, /* 3dea39ef 35793c76 */ +Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ +Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ +Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ +Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ +Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ +Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ +Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + +double log(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t hfsq,f,s,z,R,w,t1,t2,dk; + uint32_t hx; + int k; + + hx = u.i>>32; + k = 0; + if (hx < 0x00100000 || hx>>31) { + if (u.i<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (hx>>31) + return (x-x)/0.0; /* log(-#) = NaN */ + /* subnormal number, scale x up */ + k -= 54; + x *= 0x1p54; + u.f = x; + hx = u.i>>32; + } else if (hx >= 0x7ff00000) { + return x; + } else if (hx == 0x3ff00000 && u.i<<32 == 0) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + hx += 0x3ff00000 - 0x3fe6a09e; + k += (int)(hx>>20) - 0x3ff; + hx = (hx&0x000fffff) + 0x3fe6a09e; + u.i = (uint64_t)hx<<32 | (u.i&0xffffffff); + x = u.f; + + f = x - 1.0; + hfsq = 0.5*f*f; + s = f/(2.0+f); + z = s*s; + w = z*z; + t1 = w*(Lg2+w*(Lg4+w*Lg6)); + t2 = z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + R = t2 + t1; + dk = k; + return s*(hfsq+R) + dk*ln2_lo - hfsq + f + dk*ln2_hi; +} diff --git a/lib/libc/src/musl-math/log10.c b/lib/libc/src/musl-math/log10.c new file mode 100644 index 0000000..8102687 --- /dev/null +++ b/lib/libc/src/musl-math/log10.c @@ -0,0 +1,101 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log10.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * Return the base 10 logarithm of x. See log.c for most comments. + * + * Reduce x to 2^k (1+f) and calculate r = log(1+f) - f + f*f/2 + * as in log.c, then combine and scale in extra precision: + * log10(x) = (f - f*f/2 + r)/log(10) + k*log10(2) + */ + +#include <math.h> +#include <stdint.h> + +static const double +ivln10hi = 4.34294481878168880939e-01, /* 0x3fdbcb7b, 0x15200000 */ +ivln10lo = 2.50829467116452752298e-11, /* 0x3dbb9438, 0xca9aadd5 */ +log10_2hi = 3.01029995663611771306e-01, /* 0x3FD34413, 0x509F6000 */ +log10_2lo = 3.69423907715893078616e-13, /* 0x3D59FEF3, 0x11F12B36 */ +Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ +Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ +Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ +Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ +Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ +Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ +Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + +double log10(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t hfsq,f,s,z,R,w,t1,t2,dk,y,hi,lo,val_hi,val_lo; + uint32_t hx; + int k; + + hx = u.i>>32; + k = 0; + if (hx < 0x00100000 || hx>>31) { + if (u.i<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (hx>>31) + return (x-x)/0.0; /* log(-#) = NaN */ + /* subnormal number, scale x up */ + k -= 54; + x *= 0x1p54; + u.f = x; + hx = u.i>>32; + } else if (hx >= 0x7ff00000) { + return x; + } else if (hx == 0x3ff00000 && u.i<<32 == 0) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + hx += 0x3ff00000 - 0x3fe6a09e; + k += (int)(hx>>20) - 0x3ff; + hx = (hx&0x000fffff) + 0x3fe6a09e; + u.i = (uint64_t)hx<<32 | (u.i&0xffffffff); + x = u.f; + + f = x - 1.0; + hfsq = 0.5*f*f; + s = f/(2.0+f); + z = s*s; + w = z*z; + t1 = w*(Lg2+w*(Lg4+w*Lg6)); + t2 = z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + R = t2 + t1; + + /* See log2.c for details. */ + /* hi+lo = f - hfsq + s*(hfsq+R) ~ log(1+f) */ + hi = f - hfsq; + u.f = hi; + u.i &= (uint64_t)-1<<32; + hi = u.f; + lo = f - hi - hfsq + s*(hfsq+R); + + /* val_hi+val_lo ~ log10(1+f) + k*log10(2) */ + val_hi = hi*ivln10hi; + dk = k; + y = dk*log10_2hi; + val_lo = dk*log10_2lo + (lo+hi)*ivln10lo + lo*ivln10hi; + + /* + * Extra precision in for adding y is not strictly needed + * since there is no very large cancellation near x = sqrt(2) or + * x = 1/sqrt(2), but we do it anyway since it costs little on CPUs + * with some parallelism and it reduces the error for many args. + */ + w = y + val_hi; + val_lo += (y - w) + val_hi; + val_hi = w; + + return val_lo + val_hi; +} diff --git a/lib/libc/src/musl-math/log10f.c b/lib/libc/src/musl-math/log10f.c new file mode 100644 index 0000000..9ca2f01 --- /dev/null +++ b/lib/libc/src/musl-math/log10f.c @@ -0,0 +1,77 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log10f.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in log10.c. + */ + +#include <math.h> +#include <stdint.h> + +static const float +ivln10hi = 4.3432617188e-01, /* 0x3ede6000 */ +ivln10lo = -3.1689971365e-05, /* 0xb804ead9 */ +log10_2hi = 3.0102920532e-01, /* 0x3e9a2080 */ +log10_2lo = 7.9034151668e-07, /* 0x355427db */ +/* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ +Lg1 = 0xaaaaaa.0p-24, /* 0.66666662693 */ +Lg2 = 0xccce13.0p-25, /* 0.40000972152 */ +Lg3 = 0x91e9ee.0p-25, /* 0.28498786688 */ +Lg4 = 0xf89e26.0p-26; /* 0.24279078841 */ + +float log10f(float x) +{ + union {float f; uint32_t i;} u = {x}; + float_t hfsq,f,s,z,R,w,t1,t2,dk,hi,lo; + uint32_t ix; + int k; + + ix = u.i; + k = 0; + if (ix < 0x00800000 || ix>>31) { /* x < 2**-126 */ + if (ix<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (ix>>31) + return (x-x)/0.0f; /* log(-#) = NaN */ + /* subnormal number, scale up x */ + k -= 25; + x *= 0x1p25f; + u.f = x; + ix = u.i; + } else if (ix >= 0x7f800000) { + return x; + } else if (ix == 0x3f800000) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + ix += 0x3f800000 - 0x3f3504f3; + k += (int)(ix>>23) - 0x7f; + ix = (ix&0x007fffff) + 0x3f3504f3; + u.i = ix; + x = u.f; + + f = x - 1.0f; + s = f/(2.0f + f); + z = s*s; + w = z*z; + t1= w*(Lg2+w*Lg4); + t2= z*(Lg1+w*Lg3); + R = t2 + t1; + hfsq = 0.5f*f*f; + + hi = f - hfsq; + u.f = hi; + u.i &= 0xfffff000; + hi = u.f; + lo = f - hi - hfsq + s*(hfsq+R); + dk = k; + return dk*log10_2lo + (lo+hi)*ivln10lo + lo*ivln10hi + hi*ivln10hi + dk*log10_2hi; +} diff --git a/lib/libc/src/musl-math/log10l.c b/lib/libc/src/musl-math/log10l.c new file mode 100644 index 0000000..63dcc28 --- /dev/null +++ b/lib/libc/src/musl-math/log10l.c @@ -0,0 +1,191 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_log10l.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Common logarithm, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, log10l(); + * + * y = log10l( x ); + * + * + * DESCRIPTION: + * + * Returns the base 10 logarithm of x. + * + * The argument is separated into its exponent and fractional + * parts. If the exponent is between -1 and +1, the logarithm + * of the fraction is approximated by + * + * log(1+x) = x - 0.5 x**2 + x**3 P(x)/Q(x). + * + * Otherwise, setting z = 2(x-1)/x+1), + * + * log(x) = z + z**3 P(z)/Q(z). + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE 0.5, 2.0 30000 9.0e-20 2.6e-20 + * IEEE exp(+-10000) 30000 6.0e-20 2.3e-20 + * + * In the tests over the interval exp(+-10000), the logarithms + * of the random arguments were uniformly distributed over + * [-10000, +10000]. + * + * ERROR MESSAGES: + * + * log singularity: x = 0; returns MINLOG + * log domain: x < 0; returns MINLOG + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double log10l(long double x) +{ + return log10(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* Coefficients for log(1+x) = x - x**2/2 + x**3 P(x)/Q(x) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.2e-22 + */ +static const long double P[] = { + 4.9962495940332550844739E-1L, + 1.0767376367209449010438E1L, + 7.7671073698359539859595E1L, + 2.5620629828144409632571E2L, + 4.2401812743503691187826E2L, + 3.4258224542413922935104E2L, + 1.0747524399916215149070E2L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0,*/ + 2.3479774160285863271658E1L, + 1.9444210022760132894510E2L, + 7.7952888181207260646090E2L, + 1.6911722418503949084863E3L, + 2.0307734695595183428202E3L, + 1.2695660352705325274404E3L, + 3.2242573199748645407652E2L, +}; + +/* Coefficients for log(x) = z + z^3 P(z^2)/Q(z^2), + * where z = 2(x-1)/(x+1) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.16e-22 + */ +static const long double R[4] = { + 1.9757429581415468984296E-3L, +-7.1990767473014147232598E-1L, + 1.0777257190312272158094E1L, +-3.5717684488096787370998E1L, +}; +static const long double S[4] = { +/* 1.00000000000000000000E0L,*/ +-2.6201045551331104417768E1L, + 1.9361891836232102174846E2L, +-4.2861221385716144629696E2L, +}; +/* log10(2) */ +#define L102A 0.3125L +#define L102B -1.1470004336018804786261e-2L +/* log10(e) */ +#define L10EA 0.5L +#define L10EB -6.5705518096748172348871e-2L + +#define SQRTH 0.70710678118654752440L + +long double log10l(long double x) +{ + long double y, z; + int e; + + if (isnan(x)) + return x; + if(x <= 0.0) { + if(x == 0.0) + return -1.0 / (x*x); + return (x - x) / 0.0; + } + if (x == INFINITY) + return INFINITY; + /* separate mantissa from exponent */ + /* Note, frexp is used so that denormal numbers + * will be handled properly. + */ + x = frexpl(x, &e); + + /* logarithm using log(x) = z + z**3 P(z)/Q(z), + * where z = 2(x-1)/x+1) + */ + if (e > 2 || e < -2) { + if (x < SQRTH) { /* 2(2x-1)/(2x+1) */ + e -= 1; + z = x - 0.5; + y = 0.5 * z + 0.5; + } else { /* 2 (x-1)/(x+1) */ + z = x - 0.5; + z -= 0.5; + y = 0.5 * x + 0.5; + } + x = z / y; + z = x*x; + y = x * (z * __polevll(z, R, 3) / __p1evll(z, S, 3)); + goto done; + } + + /* logarithm using log(1+x) = x - .5x**2 + x**3 P(x)/Q(x) */ + if (x < SQRTH) { + e -= 1; + x = 2.0*x - 1.0; + } else { + x = x - 1.0; + } + z = x*x; + y = x * (z * __polevll(x, P, 6) / __p1evll(x, Q, 7)); + y = y - 0.5*z; + +done: + /* Multiply log of fraction by log10(e) + * and base 2 exponent by log10(2). + * + * ***CAUTION*** + * + * This sequence of operations is critical and it may + * be horribly defeated by some compiler optimizers. + */ + z = y * (L10EB); + z += x * (L10EB); + z += e * (L102B); + z += y * (L10EA); + z += x * (L10EA); + z += e * (L102A); + return z; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double log10l(long double x) +{ + return log10(x); +} +#endif diff --git a/lib/libc/src/musl-math/log1p.c b/lib/libc/src/musl-math/log1p.c new file mode 100644 index 0000000..0097134 --- /dev/null +++ b/lib/libc/src/musl-math/log1p.c @@ -0,0 +1,122 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_log1p.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* double log1p(double x) + * Return the natural logarithm of 1+x. + * + * Method : + * 1. Argument Reduction: find k and f such that + * 1+x = 2^k * (1+f), + * where sqrt(2)/2 < 1+f < sqrt(2) . + * + * Note. If k=0, then f=x is exact. However, if k!=0, then f + * may not be representable exactly. In that case, a correction + * term is need. Let u=1+x rounded. Let c = (1+x)-u, then + * log(1+x) - log(u) ~ c/u. Thus, we proceed to compute log(u), + * and add back the correction term c/u. + * (Note: when x > 2**53, one can simply return log(x)) + * + * 2. Approximation of log(1+f): See log.c + * + * 3. Finally, log1p(x) = k*ln2 + log(1+f) + c/u. See log.c + * + * Special cases: + * log1p(x) is NaN with signal if x < -1 (including -INF) ; + * log1p(+INF) is +INF; log1p(-1) is -INF with signal; + * log1p(NaN) is that NaN with no signal. + * + * Accuracy: + * according to an error analysis, the error is always less than + * 1 ulp (unit in the last place). + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + * + * Note: Assuming log() return accurate answer, the following + * algorithm can be used to compute log1p(x) to within a few ULP: + * + * u = 1+x; + * if(u==1.0) return x ; else + * return log(u)*(x/(u-1.0)); + * + * See HP-15C Advanced Functions Handbook, p.193. + */ + +#include "libm.h" + +static const double +ln2_hi = 6.93147180369123816490e-01, /* 3fe62e42 fee00000 */ +ln2_lo = 1.90821492927058770002e-10, /* 3dea39ef 35793c76 */ +Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ +Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ +Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ +Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ +Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ +Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ +Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + +double log1p(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t hfsq,f,c,s,z,R,w,t1,t2,dk; + uint32_t hx,hu; + int k; + + hx = u.i>>32; + k = 1; + if (hx < 0x3fda827a || hx>>31) { /* 1+x < sqrt(2)+ */ + if (hx >= 0xbff00000) { /* x <= -1.0 */ + if (x == -1) + return x/0.0; /* log1p(-1) = -inf */ + return (x-x)/0.0; /* log1p(x<-1) = NaN */ + } + if (hx<<1 < 0x3ca00000<<1) { /* |x| < 2**-53 */ + /* underflow if subnormal */ + if ((hx&0x7ff00000) == 0) + FORCE_EVAL((float)x); + return x; + } + if (hx <= 0xbfd2bec4) { /* sqrt(2)/2- <= 1+x < sqrt(2)+ */ + k = 0; + c = 0; + f = x; + } + } else if (hx >= 0x7ff00000) + return x; + if (k) { + u.f = 1 + x; + hu = u.i>>32; + hu += 0x3ff00000 - 0x3fe6a09e; + k = (int)(hu>>20) - 0x3ff; + /* correction term ~ log(1+x)-log(u), avoid underflow in c/u */ + if (k < 54) { + c = k >= 2 ? 1-(u.f-x) : x-(u.f-1); + c /= u.f; + } else + c = 0; + /* reduce u into [sqrt(2)/2, sqrt(2)] */ + hu = (hu&0x000fffff) + 0x3fe6a09e; + u.i = (uint64_t)hu<<32 | (u.i&0xffffffff); + f = u.f - 1; + } + hfsq = 0.5*f*f; + s = f/(2.0+f); + z = s*s; + w = z*z; + t1 = w*(Lg2+w*(Lg4+w*Lg6)); + t2 = z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + R = t2 + t1; + dk = k; + return s*(hfsq+R) + (dk*ln2_lo+c) - hfsq + f + dk*ln2_hi; +} diff --git a/lib/libc/src/musl-math/log1pf.c b/lib/libc/src/musl-math/log1pf.c new file mode 100644 index 0000000..23985c3 --- /dev/null +++ b/lib/libc/src/musl-math/log1pf.c @@ -0,0 +1,77 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_log1pf.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +ln2_hi = 6.9313812256e-01, /* 0x3f317180 */ +ln2_lo = 9.0580006145e-06, /* 0x3717f7d1 */ +/* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ +Lg1 = 0xaaaaaa.0p-24, /* 0.66666662693 */ +Lg2 = 0xccce13.0p-25, /* 0.40000972152 */ +Lg3 = 0x91e9ee.0p-25, /* 0.28498786688 */ +Lg4 = 0xf89e26.0p-26; /* 0.24279078841 */ + +float log1pf(float x) +{ + union {float f; uint32_t i;} u = {x}; + float_t hfsq,f,c,s,z,R,w,t1,t2,dk; + uint32_t ix,iu; + int k; + + ix = u.i; + k = 1; + if (ix < 0x3ed413d0 || ix>>31) { /* 1+x < sqrt(2)+ */ + if (ix >= 0xbf800000) { /* x <= -1.0 */ + if (x == -1) + return x/0.0f; /* log1p(-1)=+inf */ + return (x-x)/0.0f; /* log1p(x<-1)=NaN */ + } + if (ix<<1 < 0x33800000<<1) { /* |x| < 2**-24 */ + /* underflow if subnormal */ + if ((ix&0x7f800000) == 0) + FORCE_EVAL(x*x); + return x; + } + if (ix <= 0xbe95f619) { /* sqrt(2)/2- <= 1+x < sqrt(2)+ */ + k = 0; + c = 0; + f = x; + } + } else if (ix >= 0x7f800000) + return x; + if (k) { + u.f = 1 + x; + iu = u.i; + iu += 0x3f800000 - 0x3f3504f3; + k = (int)(iu>>23) - 0x7f; + /* correction term ~ log(1+x)-log(u), avoid underflow in c/u */ + if (k < 25) { + c = k >= 2 ? 1-(u.f-x) : x-(u.f-1); + c /= u.f; + } else + c = 0; + /* reduce u into [sqrt(2)/2, sqrt(2)] */ + iu = (iu&0x007fffff) + 0x3f3504f3; + u.i = iu; + f = u.f - 1; + } + s = f/(2.0f + f); + z = s*s; + w = z*z; + t1= w*(Lg2+w*Lg4); + t2= z*(Lg1+w*Lg3); + R = t2 + t1; + hfsq = 0.5f*f*f; + dk = k; + return s*(hfsq+R) + (dk*ln2_lo+c) - hfsq + f + dk*ln2_hi; +} diff --git a/lib/libc/src/musl-math/log1pl.c b/lib/libc/src/musl-math/log1pl.c new file mode 100644 index 0000000..141b5f0 --- /dev/null +++ b/lib/libc/src/musl-math/log1pl.c @@ -0,0 +1,177 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/s_log1pl.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Relative error logarithm + * Natural logarithm of 1+x, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, log1pl(); + * + * y = log1pl( x ); + * + * + * DESCRIPTION: + * + * Returns the base e (2.718...) logarithm of 1+x. + * + * The argument 1+x is separated into its exponent and fractional + * parts. If the exponent is between -1 and +1, the logarithm + * of the fraction is approximated by + * + * log(1+x) = x - 0.5 x^2 + x^3 P(x)/Q(x). + * + * Otherwise, setting z = 2(x-1)/x+1), + * + * log(x) = z + z^3 P(z)/Q(z). + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE -1.0, 9.0 100000 8.2e-20 2.5e-20 + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double log1pl(long double x) +{ + return log1p(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* Coefficients for log(1+x) = x - x^2 / 2 + x^3 P(x)/Q(x) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 2.32e-20 + */ +static const long double P[] = { + 4.5270000862445199635215E-5L, + 4.9854102823193375972212E-1L, + 6.5787325942061044846969E0L, + 2.9911919328553073277375E1L, + 6.0949667980987787057556E1L, + 5.7112963590585538103336E1L, + 2.0039553499201281259648E1L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0,*/ + 1.5062909083469192043167E1L, + 8.3047565967967209469434E1L, + 2.2176239823732856465394E2L, + 3.0909872225312059774938E2L, + 2.1642788614495947685003E2L, + 6.0118660497603843919306E1L, +}; + +/* Coefficients for log(x) = z + z^3 P(z^2)/Q(z^2), + * where z = 2(x-1)/(x+1) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.16e-22 + */ +static const long double R[4] = { + 1.9757429581415468984296E-3L, +-7.1990767473014147232598E-1L, + 1.0777257190312272158094E1L, +-3.5717684488096787370998E1L, +}; +static const long double S[4] = { +/* 1.00000000000000000000E0L,*/ +-2.6201045551331104417768E1L, + 1.9361891836232102174846E2L, +-4.2861221385716144629696E2L, +}; +static const long double C1 = 6.9314575195312500000000E-1L; +static const long double C2 = 1.4286068203094172321215E-6L; + +#define SQRTH 0.70710678118654752440L + +long double log1pl(long double xm1) +{ + long double x, y, z; + int e; + + if (isnan(xm1)) + return xm1; + if (xm1 == INFINITY) + return xm1; + if (xm1 == 0.0) + return xm1; + + x = xm1 + 1.0; + + /* Test for domain errors. */ + if (x <= 0.0) { + if (x == 0.0) + return -1/(x*x); /* -inf with divbyzero */ + return 0/0.0f; /* nan with invalid */ + } + + /* Separate mantissa from exponent. + Use frexp so that denormal numbers will be handled properly. */ + x = frexpl(x, &e); + + /* logarithm using log(x) = z + z^3 P(z)/Q(z), + where z = 2(x-1)/x+1) */ + if (e > 2 || e < -2) { + if (x < SQRTH) { /* 2(2x-1)/(2x+1) */ + e -= 1; + z = x - 0.5; + y = 0.5 * z + 0.5; + } else { /* 2 (x-1)/(x+1) */ + z = x - 0.5; + z -= 0.5; + y = 0.5 * x + 0.5; + } + x = z / y; + z = x*x; + z = x * (z * __polevll(z, R, 3) / __p1evll(z, S, 3)); + z = z + e * C2; + z = z + x; + z = z + e * C1; + return z; + } + + /* logarithm using log(1+x) = x - .5x**2 + x**3 P(x)/Q(x) */ + if (x < SQRTH) { + e -= 1; + if (e != 0) + x = 2.0 * x - 1.0; + else + x = xm1; + } else { + if (e != 0) + x = x - 1.0; + else + x = xm1; + } + z = x*x; + y = x * (z * __polevll(x, P, 6) / __p1evll(x, Q, 6)); + y = y + e * C2; + z = y - 0.5 * z; + z = z + x; + z = z + e * C1; + return z; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double log1pl(long double x) +{ + return log1p(x); +} +#endif diff --git a/lib/libc/src/musl-math/log2.c b/lib/libc/src/musl-math/log2.c new file mode 100644 index 0000000..0aafad4 --- /dev/null +++ b/lib/libc/src/musl-math/log2.c @@ -0,0 +1,122 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * Return the base 2 logarithm of x. See log.c for most comments. + * + * Reduce x to 2^k (1+f) and calculate r = log(1+f) - f + f*f/2 + * as in log.c, then combine and scale in extra precision: + * log2(x) = (f - f*f/2 + r)/log(2) + k + */ + +#include <math.h> +#include <stdint.h> + +static const double +ivln2hi = 1.44269504072144627571e+00, /* 0x3ff71547, 0x65200000 */ +ivln2lo = 1.67517131648865118353e-10, /* 0x3de705fc, 0x2eefa200 */ +Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ +Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ +Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ +Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ +Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ +Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ +Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + +double log2(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t hfsq,f,s,z,R,w,t1,t2,y,hi,lo,val_hi,val_lo; + uint32_t hx; + int k; + + hx = u.i>>32; + k = 0; + if (hx < 0x00100000 || hx>>31) { + if (u.i<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (hx>>31) + return (x-x)/0.0; /* log(-#) = NaN */ + /* subnormal number, scale x up */ + k -= 54; + x *= 0x1p54; + u.f = x; + hx = u.i>>32; + } else if (hx >= 0x7ff00000) { + return x; + } else if (hx == 0x3ff00000 && u.i<<32 == 0) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + hx += 0x3ff00000 - 0x3fe6a09e; + k += (int)(hx>>20) - 0x3ff; + hx = (hx&0x000fffff) + 0x3fe6a09e; + u.i = (uint64_t)hx<<32 | (u.i&0xffffffff); + x = u.f; + + f = x - 1.0; + hfsq = 0.5*f*f; + s = f/(2.0+f); + z = s*s; + w = z*z; + t1 = w*(Lg2+w*(Lg4+w*Lg6)); + t2 = z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + R = t2 + t1; + + /* + * f-hfsq must (for args near 1) be evaluated in extra precision + * to avoid a large cancellation when x is near sqrt(2) or 1/sqrt(2). + * This is fairly efficient since f-hfsq only depends on f, so can + * be evaluated in parallel with R. Not combining hfsq with R also + * keeps R small (though not as small as a true `lo' term would be), + * so that extra precision is not needed for terms involving R. + * + * Compiler bugs involving extra precision used to break Dekker's + * theorem for spitting f-hfsq as hi+lo, unless double_t was used + * or the multi-precision calculations were avoided when double_t + * has extra precision. These problems are now automatically + * avoided as a side effect of the optimization of combining the + * Dekker splitting step with the clear-low-bits step. + * + * y must (for args near sqrt(2) and 1/sqrt(2)) be added in extra + * precision to avoid a very large cancellation when x is very near + * these values. Unlike the above cancellations, this problem is + * specific to base 2. It is strange that adding +-1 is so much + * harder than adding +-ln2 or +-log10_2. + * + * This uses Dekker's theorem to normalize y+val_hi, so the + * compiler bugs are back in some configurations, sigh. And I + * don't want to used double_t to avoid them, since that gives a + * pessimization and the support for avoiding the pessimization + * is not yet available. + * + * The multi-precision calculations for the multiplications are + * routine. + */ + + /* hi+lo = f - hfsq + s*(hfsq+R) ~ log(1+f) */ + hi = f - hfsq; + u.f = hi; + u.i &= (uint64_t)-1<<32; + hi = u.f; + lo = f - hi - hfsq + s*(hfsq+R); + + val_hi = hi*ivln2hi; + val_lo = (lo+hi)*ivln2lo + lo*ivln2hi; + + /* spadd(val_hi, val_lo, y), except for not using double_t: */ + y = k; + w = y + val_hi; + val_lo += (y - w) + val_hi; + val_hi = w; + + return val_lo + val_hi; +} diff --git a/lib/libc/src/musl-math/log2f.c b/lib/libc/src/musl-math/log2f.c new file mode 100644 index 0000000..b3e305f --- /dev/null +++ b/lib/libc/src/musl-math/log2f.c @@ -0,0 +1,74 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log2f.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in log2.c. + */ + +#include <math.h> +#include <stdint.h> + +static const float +ivln2hi = 1.4428710938e+00, /* 0x3fb8b000 */ +ivln2lo = -1.7605285393e-04, /* 0xb9389ad4 */ +/* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ +Lg1 = 0xaaaaaa.0p-24, /* 0.66666662693 */ +Lg2 = 0xccce13.0p-25, /* 0.40000972152 */ +Lg3 = 0x91e9ee.0p-25, /* 0.28498786688 */ +Lg4 = 0xf89e26.0p-26; /* 0.24279078841 */ + +float log2f(float x) +{ + union {float f; uint32_t i;} u = {x}; + float_t hfsq,f,s,z,R,w,t1,t2,hi,lo; + uint32_t ix; + int k; + + ix = u.i; + k = 0; + if (ix < 0x00800000 || ix>>31) { /* x < 2**-126 */ + if (ix<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (ix>>31) + return (x-x)/0.0f; /* log(-#) = NaN */ + /* subnormal number, scale up x */ + k -= 25; + x *= 0x1p25f; + u.f = x; + ix = u.i; + } else if (ix >= 0x7f800000) { + return x; + } else if (ix == 0x3f800000) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + ix += 0x3f800000 - 0x3f3504f3; + k += (int)(ix>>23) - 0x7f; + ix = (ix&0x007fffff) + 0x3f3504f3; + u.i = ix; + x = u.f; + + f = x - 1.0f; + s = f/(2.0f + f); + z = s*s; + w = z*z; + t1= w*(Lg2+w*Lg4); + t2= z*(Lg1+w*Lg3); + R = t2 + t1; + hfsq = 0.5f*f*f; + + hi = f - hfsq; + u.f = hi; + u.i &= 0xfffff000; + hi = u.f; + lo = f - hi - hfsq + s*(hfsq+R); + return (lo+hi)*ivln2lo + lo*ivln2hi + hi*ivln2hi + k; +} diff --git a/lib/libc/src/musl-math/log2l.c b/lib/libc/src/musl-math/log2l.c new file mode 100644 index 0000000..722b451 --- /dev/null +++ b/lib/libc/src/musl-math/log2l.c @@ -0,0 +1,182 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_log2l.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Base 2 logarithm, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, log2l(); + * + * y = log2l( x ); + * + * + * DESCRIPTION: + * + * Returns the base 2 logarithm of x. + * + * The argument is separated into its exponent and fractional + * parts. If the exponent is between -1 and +1, the (natural) + * logarithm of the fraction is approximated by + * + * log(1+x) = x - 0.5 x**2 + x**3 P(x)/Q(x). + * + * Otherwise, setting z = 2(x-1)/x+1), + * + * log(x) = z + z**3 P(z)/Q(z). + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE 0.5, 2.0 30000 9.8e-20 2.7e-20 + * IEEE exp(+-10000) 70000 5.4e-20 2.3e-20 + * + * In the tests over the interval exp(+-10000), the logarithms + * of the random arguments were uniformly distributed over + * [-10000, +10000]. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double log2l(long double x) +{ + return log2(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* Coefficients for ln(1+x) = x - x**2/2 + x**3 P(x)/Q(x) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.2e-22 + */ +static const long double P[] = { + 4.9962495940332550844739E-1L, + 1.0767376367209449010438E1L, + 7.7671073698359539859595E1L, + 2.5620629828144409632571E2L, + 4.2401812743503691187826E2L, + 3.4258224542413922935104E2L, + 1.0747524399916215149070E2L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0,*/ + 2.3479774160285863271658E1L, + 1.9444210022760132894510E2L, + 7.7952888181207260646090E2L, + 1.6911722418503949084863E3L, + 2.0307734695595183428202E3L, + 1.2695660352705325274404E3L, + 3.2242573199748645407652E2L, +}; + +/* Coefficients for log(x) = z + z^3 P(z^2)/Q(z^2), + * where z = 2(x-1)/(x+1) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.16e-22 + */ +static const long double R[4] = { + 1.9757429581415468984296E-3L, +-7.1990767473014147232598E-1L, + 1.0777257190312272158094E1L, +-3.5717684488096787370998E1L, +}; +static const long double S[4] = { +/* 1.00000000000000000000E0L,*/ +-2.6201045551331104417768E1L, + 1.9361891836232102174846E2L, +-4.2861221385716144629696E2L, +}; +/* log2(e) - 1 */ +#define LOG2EA 4.4269504088896340735992e-1L + +#define SQRTH 0.70710678118654752440L + +long double log2l(long double x) +{ + long double y, z; + int e; + + if (isnan(x)) + return x; + if (x == INFINITY) + return x; + if (x <= 0.0) { + if (x == 0.0) + return -1/(x*x); /* -inf with divbyzero */ + return 0/0.0f; /* nan with invalid */ + } + + /* separate mantissa from exponent */ + /* Note, frexp is used so that denormal numbers + * will be handled properly. + */ + x = frexpl(x, &e); + + /* logarithm using log(x) = z + z**3 P(z)/Q(z), + * where z = 2(x-1)/x+1) + */ + if (e > 2 || e < -2) { + if (x < SQRTH) { /* 2(2x-1)/(2x+1) */ + e -= 1; + z = x - 0.5; + y = 0.5 * z + 0.5; + } else { /* 2 (x-1)/(x+1) */ + z = x - 0.5; + z -= 0.5; + y = 0.5 * x + 0.5; + } + x = z / y; + z = x*x; + y = x * (z * __polevll(z, R, 3) / __p1evll(z, S, 3)); + goto done; + } + + /* logarithm using log(1+x) = x - .5x**2 + x**3 P(x)/Q(x) */ + if (x < SQRTH) { + e -= 1; + x = 2.0*x - 1.0; + } else { + x = x - 1.0; + } + z = x*x; + y = x * (z * __polevll(x, P, 6) / __p1evll(x, Q, 7)); + y = y - 0.5*z; + +done: + /* Multiply log of fraction by log2(e) + * and base 2 exponent by 1 + * + * ***CAUTION*** + * + * This sequence of operations is critical and it may + * be horribly defeated by some compiler optimizers. + */ + z = y * LOG2EA; + z += x * LOG2EA; + z += y; + z += x; + z += e; + return z; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double log2l(long double x) +{ + return log2(x); +} +#endif diff --git a/lib/libc/src/musl-math/logb.c b/lib/libc/src/musl-math/logb.c new file mode 100644 index 0000000..7f8bdfa --- /dev/null +++ b/lib/libc/src/musl-math/logb.c @@ -0,0 +1,17 @@ +#include <math.h> + +/* +special cases: + logb(+-0) = -inf, and raise divbyzero + logb(+-inf) = +inf + logb(nan) = nan +*/ + +double logb(double x) +{ + if (!isfinite(x)) + return x * x; + if (x == 0) + return -1/(x*x); + return ilogb(x); +} diff --git a/lib/libc/src/musl-math/logbf.c b/lib/libc/src/musl-math/logbf.c new file mode 100644 index 0000000..a0a0b5e --- /dev/null +++ b/lib/libc/src/musl-math/logbf.c @@ -0,0 +1,10 @@ +#include <math.h> + +float logbf(float x) +{ + if (!isfinite(x)) + return x * x; + if (x == 0) + return -1/(x*x); + return ilogbf(x); +} diff --git a/lib/libc/src/musl-math/logbl.c b/lib/libc/src/musl-math/logbl.c new file mode 100644 index 0000000..962973a --- /dev/null +++ b/lib/libc/src/musl-math/logbl.c @@ -0,0 +1,16 @@ +#include <math.h> +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double logbl(long double x) +{ + return logb(x); +} +#else +long double logbl(long double x) +{ + if (!isfinite(x)) + return x * x; + if (x == 0) + return -1/(x*x); + return ilogbl(x); +} +#endif diff --git a/lib/libc/src/musl-math/logf.c b/lib/libc/src/musl-math/logf.c new file mode 100644 index 0000000..52230a1 --- /dev/null +++ b/lib/libc/src/musl-math/logf.c @@ -0,0 +1,69 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_logf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include <math.h> +#include <stdint.h> + +static const float +ln2_hi = 6.9313812256e-01, /* 0x3f317180 */ +ln2_lo = 9.0580006145e-06, /* 0x3717f7d1 */ +/* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ +Lg1 = 0xaaaaaa.0p-24, /* 0.66666662693 */ +Lg2 = 0xccce13.0p-25, /* 0.40000972152 */ +Lg3 = 0x91e9ee.0p-25, /* 0.28498786688 */ +Lg4 = 0xf89e26.0p-26; /* 0.24279078841 */ + +float logf(float x) +{ + union {float f; uint32_t i;} u = {x}; + float_t hfsq,f,s,z,R,w,t1,t2,dk; + uint32_t ix; + int k; + + ix = u.i; + k = 0; + if (ix < 0x00800000 || ix>>31) { /* x < 2**-126 */ + if (ix<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (ix>>31) + return (x-x)/0.0f; /* log(-#) = NaN */ + /* subnormal number, scale up x */ + k -= 25; + x *= 0x1p25f; + u.f = x; + ix = u.i; + } else if (ix >= 0x7f800000) { + return x; + } else if (ix == 0x3f800000) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + ix += 0x3f800000 - 0x3f3504f3; + k += (int)(ix>>23) - 0x7f; + ix = (ix&0x007fffff) + 0x3f3504f3; + u.i = ix; + x = u.f; + + f = x - 1.0f; + s = f/(2.0f + f); + z = s*s; + w = z*z; + t1= w*(Lg2+w*Lg4); + t2= z*(Lg1+w*Lg3); + R = t2 + t1; + hfsq = 0.5f*f*f; + dk = k; + return s*(hfsq+R) + dk*ln2_lo - hfsq + f + dk*ln2_hi; +} diff --git a/lib/libc/src/musl-math/logl.c b/lib/libc/src/musl-math/logl.c new file mode 100644 index 0000000..5d53659 --- /dev/null +++ b/lib/libc/src/musl-math/logl.c @@ -0,0 +1,175 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_logl.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Natural logarithm, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, logl(); + * + * y = logl( x ); + * + * + * DESCRIPTION: + * + * Returns the base e (2.718...) logarithm of x. + * + * The argument is separated into its exponent and fractional + * parts. If the exponent is between -1 and +1, the logarithm + * of the fraction is approximated by + * + * log(1+x) = x - 0.5 x**2 + x**3 P(x)/Q(x). + * + * Otherwise, setting z = 2(x-1)/(x+1), + * + * log(x) = log(1+z/2) - log(1-z/2) = z + z**3 P(z)/Q(z). + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE 0.5, 2.0 150000 8.71e-20 2.75e-20 + * IEEE exp(+-10000) 100000 5.39e-20 2.34e-20 + * + * In the tests over the interval exp(+-10000), the logarithms + * of the random arguments were uniformly distributed over + * [-10000, +10000]. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double logl(long double x) +{ + return log(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* Coefficients for log(1+x) = x - x**2/2 + x**3 P(x)/Q(x) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 2.32e-20 + */ +static const long double P[] = { + 4.5270000862445199635215E-5L, + 4.9854102823193375972212E-1L, + 6.5787325942061044846969E0L, + 2.9911919328553073277375E1L, + 6.0949667980987787057556E1L, + 5.7112963590585538103336E1L, + 2.0039553499201281259648E1L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0,*/ + 1.5062909083469192043167E1L, + 8.3047565967967209469434E1L, + 2.2176239823732856465394E2L, + 3.0909872225312059774938E2L, + 2.1642788614495947685003E2L, + 6.0118660497603843919306E1L, +}; + +/* Coefficients for log(x) = z + z^3 P(z^2)/Q(z^2), + * where z = 2(x-1)/(x+1) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.16e-22 + */ +static const long double R[4] = { + 1.9757429581415468984296E-3L, +-7.1990767473014147232598E-1L, + 1.0777257190312272158094E1L, +-3.5717684488096787370998E1L, +}; +static const long double S[4] = { +/* 1.00000000000000000000E0L,*/ +-2.6201045551331104417768E1L, + 1.9361891836232102174846E2L, +-4.2861221385716144629696E2L, +}; +static const long double C1 = 6.9314575195312500000000E-1L; +static const long double C2 = 1.4286068203094172321215E-6L; + +#define SQRTH 0.70710678118654752440L + +long double logl(long double x) +{ + long double y, z; + int e; + + if (isnan(x)) + return x; + if (x == INFINITY) + return x; + if (x <= 0.0) { + if (x == 0.0) + return -1/(x*x); /* -inf with divbyzero */ + return 0/0.0f; /* nan with invalid */ + } + + /* separate mantissa from exponent */ + /* Note, frexp is used so that denormal numbers + * will be handled properly. + */ + x = frexpl(x, &e); + + /* logarithm using log(x) = z + z**3 P(z)/Q(z), + * where z = 2(x-1)/(x+1) + */ + if (e > 2 || e < -2) { + if (x < SQRTH) { /* 2(2x-1)/(2x+1) */ + e -= 1; + z = x - 0.5; + y = 0.5 * z + 0.5; + } else { /* 2 (x-1)/(x+1) */ + z = x - 0.5; + z -= 0.5; + y = 0.5 * x + 0.5; + } + x = z / y; + z = x*x; + z = x * (z * __polevll(z, R, 3) / __p1evll(z, S, 3)); + z = z + e * C2; + z = z + x; + z = z + e * C1; + return z; + } + + /* logarithm using log(1+x) = x - .5x**2 + x**3 P(x)/Q(x) */ + if (x < SQRTH) { + e -= 1; + x = 2.0*x - 1.0; + } else { + x = x - 1.0; + } + z = x*x; + y = x * (z * __polevll(x, P, 6) / __p1evll(x, Q, 6)); + y = y + e * C2; + z = y - 0.5*z; + /* Note, the sum of above terms does not exceed x/4, + * so it contributes at most about 1/4 lsb to the error. + */ + z = z + x; + z = z + e * C1; /* This sum has an error of 1/2 lsb. */ + return z; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double logl(long double x) +{ + return log(x); +} +#endif diff --git a/lib/libc/src/musl-math/lrint.c b/lib/libc/src/musl-math/lrint.c new file mode 100644 index 0000000..bdca8b7 --- /dev/null +++ b/lib/libc/src/musl-math/lrint.c @@ -0,0 +1,46 @@ +#include <limits.h> +#include <fenv.h> +#include "libm.h" + +/* +If the result cannot be represented (overflow, nan), then +lrint raises the invalid exception. + +Otherwise if the input was not an integer then the inexact +exception is raised. + +C99 is a bit vague about whether inexact exception is +allowed to be raised when invalid is raised. +(F.9 explicitly allows spurious inexact exceptions, F.9.6.5 +does not make it clear if that rule applies to lrint, but +IEEE 754r 7.8 seems to forbid spurious inexact exception in +the ineger conversion functions) + +So we try to make sure that no spurious inexact exception is +raised in case of an overflow. + +If the bit size of long > precision of double, then there +cannot be inexact rounding in case the result overflows, +otherwise LONG_MAX and LONG_MIN can be represented exactly +as a double. +*/ + +#if LONG_MAX < 1U<<53 && defined(FE_INEXACT) +long lrint(double x) +{ + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); + x = rint(x); + if (!e && (x > LONG_MAX || x < LONG_MIN)) + feclearexcept(FE_INEXACT); + /* conversion */ + return x; +} +#else +long lrint(double x) +{ + return rint(x); +} +#endif diff --git a/lib/libc/src/musl-math/lrintf.c b/lib/libc/src/musl-math/lrintf.c new file mode 100644 index 0000000..ca0b6a4 --- /dev/null +++ b/lib/libc/src/musl-math/lrintf.c @@ -0,0 +1,8 @@ +#include <math.h> + +/* uses LONG_MAX > 2^24, see comments in lrint.c */ + +long lrintf(float x) +{ + return rintf(x); +} diff --git a/lib/libc/src/musl-math/lrintl.c b/lib/libc/src/musl-math/lrintl.c new file mode 100644 index 0000000..b2a8106 --- /dev/null +++ b/lib/libc/src/musl-math/lrintl.c @@ -0,0 +1,36 @@ +#include <limits.h> +#include <fenv.h> +#include "libm.h" + + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long lrintl(long double x) +{ + return lrint(x); +} +#elif defined(FE_INEXACT) +/* +see comments in lrint.c + +Note that if LONG_MAX == 0x7fffffffffffffff && LDBL_MANT_DIG == 64 +then x == 2**63 - 0.5 is the only input that overflows and +raises inexact (with tonearest or upward rounding mode) +*/ +long lrintl(long double x) +{ + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); + x = rintl(x); + if (!e && (x > LONG_MAX || x < LONG_MIN)) + feclearexcept(FE_INEXACT); + /* conversion */ + return x; +} +#else +long lrintl(long double x) +{ + return rintl(x); +} +#endif diff --git a/lib/libc/src/musl-math/lround.c b/lib/libc/src/musl-math/lround.c new file mode 100644 index 0000000..b8b7954 --- /dev/null +++ b/lib/libc/src/musl-math/lround.c @@ -0,0 +1,6 @@ +#include <math.h> + +long lround(double x) +{ + return round(x); +} diff --git a/lib/libc/src/musl-math/lroundf.c b/lib/libc/src/musl-math/lroundf.c new file mode 100644 index 0000000..c4707e7 --- /dev/null +++ b/lib/libc/src/musl-math/lroundf.c @@ -0,0 +1,6 @@ +#include <math.h> + +long lroundf(float x) +{ + return roundf(x); +} diff --git a/lib/libc/src/musl-math/lroundl.c b/lib/libc/src/musl-math/lroundl.c new file mode 100644 index 0000000..094fdf6 --- /dev/null +++ b/lib/libc/src/musl-math/lroundl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long lroundl(long double x) +{ + return roundl(x); +} diff --git a/lib/libc/src/musl-math/modf.c b/lib/libc/src/musl-math/modf.c new file mode 100644 index 0000000..1c8a1db --- /dev/null +++ b/lib/libc/src/musl-math/modf.c @@ -0,0 +1,34 @@ +#include "libm.h" + +double modf(double x, double *iptr) +{ + union {double f; uint64_t i;} u = {x}; + uint64_t mask; + int e = (int)(u.i>>52 & 0x7ff) - 0x3ff; + + /* no fractional part */ + if (e >= 52) { + *iptr = x; + if (e == 0x400 && u.i<<12 != 0) /* nan */ + return x; + u.i &= 1ULL<<63; + return u.f; + } + + /* no integral part*/ + if (e < 0) { + u.i &= 1ULL<<63; + *iptr = u.f; + return x; + } + + mask = -1ULL>>12>>e; + if ((u.i & mask) == 0) { + *iptr = x; + u.i &= 1ULL<<63; + return u.f; + } + u.i &= ~mask; + *iptr = u.f; + return x - u.f; +} diff --git a/lib/libc/src/musl-math/modff.c b/lib/libc/src/musl-math/modff.c new file mode 100644 index 0000000..639514e --- /dev/null +++ b/lib/libc/src/musl-math/modff.c @@ -0,0 +1,34 @@ +#include "libm.h" + +float modff(float x, float *iptr) +{ + union {float f; uint32_t i;} u = {x}; + uint32_t mask; + int e = (int)(u.i>>23 & 0xff) - 0x7f; + + /* no fractional part */ + if (e >= 23) { + *iptr = x; + if (e == 0x80 && u.i<<9 != 0) { /* nan */ + return x; + } + u.i &= 0x80000000; + return u.f; + } + /* no integral part */ + if (e < 0) { + u.i &= 0x80000000; + *iptr = u.f; + return x; + } + + mask = 0x007fffff>>e; + if ((u.i & mask) == 0) { + *iptr = x; + u.i &= 0x80000000; + return u.f; + } + u.i &= ~mask; + *iptr = u.f; + return x - u.f; +} diff --git a/lib/libc/src/musl-math/modfl.c b/lib/libc/src/musl-math/modfl.c new file mode 100644 index 0000000..a47b192 --- /dev/null +++ b/lib/libc/src/musl-math/modfl.c @@ -0,0 +1,53 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double modfl(long double x, long double *iptr) +{ + double d; + long double r; + + r = modf(x, &d); + *iptr = d; + return r; +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double modfl(long double x, long double *iptr) +{ + union ldshape u = {x}; + int e = (u.i.se & 0x7fff) - 0x3fff; + int s = u.i.se >> 15; + long double absx; + long double y; + + /* no fractional part */ + if (e >= LDBL_MANT_DIG-1) { + *iptr = x; + if (isnan(x)) + return x; + return s ? -0.0 : 0.0; + } + + /* no integral part*/ + if (e < 0) { + *iptr = s ? -0.0 : 0.0; + return x; + } + + /* raises spurious inexact */ + absx = s ? -x : x; + y = absx + toint - toint - absx; + if (y == 0) { + *iptr = x; + return s ? -0.0 : 0.0; + } + if (y > 0) + y -= 1; + if (s) + y = -y; + *iptr = x + y; + return -y; +} +#endif diff --git a/lib/libc/src/musl-math/nan.c b/lib/libc/src/musl-math/nan.c new file mode 100644 index 0000000..9e0826c --- /dev/null +++ b/lib/libc/src/musl-math/nan.c @@ -0,0 +1,6 @@ +#include <math.h> + +double nan(const char *s) +{ + return NAN; +} diff --git a/lib/libc/src/musl-math/nanf.c b/lib/libc/src/musl-math/nanf.c new file mode 100644 index 0000000..752ce54 --- /dev/null +++ b/lib/libc/src/musl-math/nanf.c @@ -0,0 +1,6 @@ +#include <math.h> + +float nanf(const char *s) +{ + return NAN; +} diff --git a/lib/libc/src/musl-math/nanl.c b/lib/libc/src/musl-math/nanl.c new file mode 100644 index 0000000..969af56 --- /dev/null +++ b/lib/libc/src/musl-math/nanl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long double nanl(const char *s) +{ + return NAN; +} diff --git a/lib/libc/src/musl-math/nearbyint.c b/lib/libc/src/musl-math/nearbyint.c new file mode 100644 index 0000000..f4e8aac --- /dev/null +++ b/lib/libc/src/musl-math/nearbyint.c @@ -0,0 +1,20 @@ +#include <fenv.h> +#include <math.h> + +/* nearbyint is the same as rint, but it must not raise the inexact exception */ + +double nearbyint(double x) +{ +#ifdef FE_INEXACT + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); +#endif + x = rint(x); +#ifdef FE_INEXACT + if (!e) + feclearexcept(FE_INEXACT); +#endif + return x; +} diff --git a/lib/libc/src/musl-math/nearbyintf.c b/lib/libc/src/musl-math/nearbyintf.c new file mode 100644 index 0000000..092e9ff --- /dev/null +++ b/lib/libc/src/musl-math/nearbyintf.c @@ -0,0 +1,18 @@ +#include <fenv.h> +#include <math.h> + +float nearbyintf(float x) +{ +#ifdef FE_INEXACT + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); +#endif + x = rintf(x); +#ifdef FE_INEXACT + if (!e) + feclearexcept(FE_INEXACT); +#endif + return x; +} diff --git a/lib/libc/src/musl-math/nearbyintl.c b/lib/libc/src/musl-math/nearbyintl.c new file mode 100644 index 0000000..8285249 --- /dev/null +++ b/lib/libc/src/musl-math/nearbyintl.c @@ -0,0 +1,26 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double nearbyintl(long double x) +{ + return nearbyint(x); +} +#else +#include <fenv.h> +long double nearbyintl(long double x) +{ +#ifdef FE_INEXACT + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); +#endif + x = rintl(x); +#ifdef FE_INEXACT + if (!e) + feclearexcept(FE_INEXACT); +#endif + return x; +} +#endif diff --git a/lib/libc/src/musl-math/nextafter.c b/lib/libc/src/musl-math/nextafter.c new file mode 100644 index 0000000..ab5795a --- /dev/null +++ b/lib/libc/src/musl-math/nextafter.c @@ -0,0 +1,31 @@ +#include "libm.h" + +double nextafter(double x, double y) +{ + union {double f; uint64_t i;} ux={x}, uy={y}; + uint64_t ax, ay; + int e; + + if (isnan(x) || isnan(y)) + return x + y; + if (ux.i == uy.i) + return y; + ax = ux.i & -1ULL/2; + ay = uy.i & -1ULL/2; + if (ax == 0) { + if (ay == 0) + return y; + ux.i = (uy.i & 1ULL<<63) | 1; + } else if (ax > ay || ((ux.i ^ uy.i) & 1ULL<<63)) + ux.i--; + else + ux.i++; + e = ux.i >> 52 & 0x7ff; + /* raise overflow if ux.f is infinite and x is finite */ + if (e == 0x7ff) + FORCE_EVAL(x+x); + /* raise underflow if ux.f is subnormal or zero */ + if (e == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} diff --git a/lib/libc/src/musl-math/nextafterf.c b/lib/libc/src/musl-math/nextafterf.c new file mode 100644 index 0000000..75a09f7 --- /dev/null +++ b/lib/libc/src/musl-math/nextafterf.c @@ -0,0 +1,30 @@ +#include "libm.h" + +float nextafterf(float x, float y) +{ + union {float f; uint32_t i;} ux={x}, uy={y}; + uint32_t ax, ay, e; + + if (isnan(x) || isnan(y)) + return x + y; + if (ux.i == uy.i) + return y; + ax = ux.i & 0x7fffffff; + ay = uy.i & 0x7fffffff; + if (ax == 0) { + if (ay == 0) + return y; + ux.i = (uy.i & 0x80000000) | 1; + } else if (ax > ay || ((ux.i ^ uy.i) & 0x80000000)) + ux.i--; + else + ux.i++; + e = ux.i & 0x7f800000; + /* raise overflow if ux.f is infinite and x is finite */ + if (e == 0x7f800000) + FORCE_EVAL(x+x); + /* raise underflow if ux.f is subnormal or zero */ + if (e == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} diff --git a/lib/libc/src/musl-math/nextafterl.c b/lib/libc/src/musl-math/nextafterl.c new file mode 100644 index 0000000..37e858f --- /dev/null +++ b/lib/libc/src/musl-math/nextafterl.c @@ -0,0 +1,75 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double nextafterl(long double x, long double y) +{ + return nextafter(x, y); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +long double nextafterl(long double x, long double y) +{ + union ldshape ux, uy; + + if (isnan(x) || isnan(y)) + return x + y; + if (x == y) + return y; + ux.f = x; + if (x == 0) { + uy.f = y; + ux.i.m = 1; + ux.i.se = uy.i.se & 0x8000; + } else if ((x < y) == !(ux.i.se & 0x8000)) { + ux.i.m++; + if (ux.i.m << 1 == 0) { + ux.i.m = 1ULL << 63; + ux.i.se++; + } + } else { + if (ux.i.m << 1 == 0) { + ux.i.se--; + if (ux.i.se) + ux.i.m = 0; + } + ux.i.m--; + } + /* raise overflow if ux is infinite and x is finite */ + if ((ux.i.se & 0x7fff) == 0x7fff) + return x + x; + /* raise underflow if ux is subnormal or zero */ + if ((ux.i.se & 0x7fff) == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +long double nextafterl(long double x, long double y) +{ + union ldshape ux, uy; + + if (isnan(x) || isnan(y)) + return x + y; + if (x == y) + return y; + ux.f = x; + if (x == 0) { + uy.f = y; + ux.i.lo = 1; + ux.i.se = uy.i.se & 0x8000; + } else if ((x < y) == !(ux.i.se & 0x8000)) { + ux.i2.lo++; + if (ux.i2.lo == 0) + ux.i2.hi++; + } else { + if (ux.i2.lo == 0) + ux.i2.hi--; + ux.i2.lo--; + } + /* raise overflow if ux is infinite and x is finite */ + if ((ux.i.se & 0x7fff) == 0x7fff) + return x + x; + /* raise underflow if ux is subnormal or zero */ + if ((ux.i.se & 0x7fff) == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} +#endif diff --git a/lib/libc/src/musl-math/nexttoward.c b/lib/libc/src/musl-math/nexttoward.c new file mode 100644 index 0000000..827ee5c --- /dev/null +++ b/lib/libc/src/musl-math/nexttoward.c @@ -0,0 +1,42 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +double nexttoward(double x, long double y) +{ + return nextafter(x, y); +} +#else +double nexttoward(double x, long double y) +{ + union {double f; uint64_t i;} ux = {x}; + int e; + + if (isnan(x) || isnan(y)) + return x + y; + if (x == y) + return y; + if (x == 0) { + ux.i = 1; + if (signbit(y)) + ux.i |= 1ULL<<63; + } else if (x < y) { + if (signbit(x)) + ux.i--; + else + ux.i++; + } else { + if (signbit(x)) + ux.i++; + else + ux.i--; + } + e = ux.i>>52 & 0x7ff; + /* raise overflow if ux.f is infinite and x is finite */ + if (e == 0x7ff) + FORCE_EVAL(x+x); + /* raise underflow if ux.f is subnormal or zero */ + if (e == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} +#endif diff --git a/lib/libc/src/musl-math/nexttowardf.c b/lib/libc/src/musl-math/nexttowardf.c new file mode 100644 index 0000000..bbf172f --- /dev/null +++ b/lib/libc/src/musl-math/nexttowardf.c @@ -0,0 +1,35 @@ +#include "libm.h" + +float nexttowardf(float x, long double y) +{ + union {float f; uint32_t i;} ux = {x}; + uint32_t e; + + if (isnan(x) || isnan(y)) + return x + y; + if (x == y) + return y; + if (x == 0) { + ux.i = 1; + if (signbit(y)) + ux.i |= 0x80000000; + } else if (x < y) { + if (signbit(x)) + ux.i--; + else + ux.i++; + } else { + if (signbit(x)) + ux.i++; + else + ux.i--; + } + e = ux.i & 0x7f800000; + /* raise overflow if ux.f is infinite and x is finite */ + if (e == 0x7f800000) + FORCE_EVAL(x+x); + /* raise underflow if ux.f is subnormal or zero */ + if (e == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} diff --git a/lib/libc/src/musl-math/nexttowardl.c b/lib/libc/src/musl-math/nexttowardl.c new file mode 100644 index 0000000..67a6340 --- /dev/null +++ b/lib/libc/src/musl-math/nexttowardl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long double nexttowardl(long double x, long double y) +{ + return nextafterl(x, y); +} diff --git a/lib/libc/src/musl-math/pow.c b/lib/libc/src/musl-math/pow.c new file mode 100644 index 0000000..3ddc1b6 --- /dev/null +++ b/lib/libc/src/musl-math/pow.c @@ -0,0 +1,328 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_pow.c */ +/* + * ==================================================== + * Copyright (C) 2004 by Sun Microsystems, Inc. All rights reserved. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* pow(x,y) return x**y + * + * n + * Method: Let x = 2 * (1+f) + * 1. Compute and return log2(x) in two pieces: + * log2(x) = w1 + w2, + * where w1 has 53-24 = 29 bit trailing zeros. + * 2. Perform y*log2(x) = n+y' by simulating muti-precision + * arithmetic, where |y'|<=0.5. + * 3. Return x**y = 2**n*exp(y'*log2) + * + * Special cases: + * 1. (anything) ** 0 is 1 + * 2. 1 ** (anything) is 1 + * 3. (anything except 1) ** NAN is NAN + * 4. NAN ** (anything except 0) is NAN + * 5. +-(|x| > 1) ** +INF is +INF + * 6. +-(|x| > 1) ** -INF is +0 + * 7. +-(|x| < 1) ** +INF is +0 + * 8. +-(|x| < 1) ** -INF is +INF + * 9. -1 ** +-INF is 1 + * 10. +0 ** (+anything except 0, NAN) is +0 + * 11. -0 ** (+anything except 0, NAN, odd integer) is +0 + * 12. +0 ** (-anything except 0, NAN) is +INF, raise divbyzero + * 13. -0 ** (-anything except 0, NAN, odd integer) is +INF, raise divbyzero + * 14. -0 ** (+odd integer) is -0 + * 15. -0 ** (-odd integer) is -INF, raise divbyzero + * 16. +INF ** (+anything except 0,NAN) is +INF + * 17. +INF ** (-anything except 0,NAN) is +0 + * 18. -INF ** (+odd integer) is -INF + * 19. -INF ** (anything) = -0 ** (-anything), (anything except odd integer) + * 20. (anything) ** 1 is (anything) + * 21. (anything) ** -1 is 1/(anything) + * 22. (-anything) ** (integer) is (-1)**(integer)*(+anything**integer) + * 23. (-anything except 0 and inf) ** (non-integer) is NAN + * + * Accuracy: + * pow(x,y) returns x**y nearly rounded. In particular + * pow(integer,integer) + * always returns the correct integer provided it is + * representable. + * + * Constants : + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "libm.h" + +static const double +bp[] = {1.0, 1.5,}, +dp_h[] = { 0.0, 5.84962487220764160156e-01,}, /* 0x3FE2B803, 0x40000000 */ +dp_l[] = { 0.0, 1.35003920212974897128e-08,}, /* 0x3E4CFDEB, 0x43CFD006 */ +two53 = 9007199254740992.0, /* 0x43400000, 0x00000000 */ +huge = 1.0e300, +tiny = 1.0e-300, +/* poly coefs for (3/2)*(log(x)-2s-2/3*s**3 */ +L1 = 5.99999999999994648725e-01, /* 0x3FE33333, 0x33333303 */ +L2 = 4.28571428578550184252e-01, /* 0x3FDB6DB6, 0xDB6FABFF */ +L3 = 3.33333329818377432918e-01, /* 0x3FD55555, 0x518F264D */ +L4 = 2.72728123808534006489e-01, /* 0x3FD17460, 0xA91D4101 */ +L5 = 2.30660745775561754067e-01, /* 0x3FCD864A, 0x93C9DB65 */ +L6 = 2.06975017800338417784e-01, /* 0x3FCA7E28, 0x4A454EEF */ +P1 = 1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */ +P2 = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */ +P3 = 6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */ +P4 = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */ +P5 = 4.13813679705723846039e-08, /* 0x3E663769, 0x72BEA4D0 */ +lg2 = 6.93147180559945286227e-01, /* 0x3FE62E42, 0xFEFA39EF */ +lg2_h = 6.93147182464599609375e-01, /* 0x3FE62E43, 0x00000000 */ +lg2_l = -1.90465429995776804525e-09, /* 0xBE205C61, 0x0CA86C39 */ +ovt = 8.0085662595372944372e-017, /* -(1024-log2(ovfl+.5ulp)) */ +cp = 9.61796693925975554329e-01, /* 0x3FEEC709, 0xDC3A03FD =2/(3ln2) */ +cp_h = 9.61796700954437255859e-01, /* 0x3FEEC709, 0xE0000000 =(float)cp */ +cp_l = -7.02846165095275826516e-09, /* 0xBE3E2FE0, 0x145B01F5 =tail of cp_h*/ +ivln2 = 1.44269504088896338700e+00, /* 0x3FF71547, 0x652B82FE =1/ln2 */ +ivln2_h = 1.44269502162933349609e+00, /* 0x3FF71547, 0x60000000 =24b 1/ln2*/ +ivln2_l = 1.92596299112661746887e-08; /* 0x3E54AE0B, 0xF85DDF44 =1/ln2 tail*/ + +double pow(double x, double y) +{ + double z,ax,z_h,z_l,p_h,p_l; + double y1,t1,t2,r,s,t,u,v,w; + int32_t i,j,k,yisint,n; + int32_t hx,hy,ix,iy; + uint32_t lx,ly; + + EXTRACT_WORDS(hx, lx, x); + EXTRACT_WORDS(hy, ly, y); + ix = hx & 0x7fffffff; + iy = hy & 0x7fffffff; + + /* x**0 = 1, even if x is NaN */ + if ((iy|ly) == 0) + return 1.0; + /* 1**y = 1, even if y is NaN */ + if (hx == 0x3ff00000 && lx == 0) + return 1.0; + /* NaN if either arg is NaN */ + if (ix > 0x7ff00000 || (ix == 0x7ff00000 && lx != 0) || + iy > 0x7ff00000 || (iy == 0x7ff00000 && ly != 0)) + return x + y; + + /* determine if y is an odd int when x < 0 + * yisint = 0 ... y is not an integer + * yisint = 1 ... y is an odd int + * yisint = 2 ... y is an even int + */ + yisint = 0; + if (hx < 0) { + if (iy >= 0x43400000) + yisint = 2; /* even integer y */ + else if (iy >= 0x3ff00000) { + k = (iy>>20) - 0x3ff; /* exponent */ + if (k > 20) { + uint32_t j = ly>>(52-k); + if ((j<<(52-k)) == ly) + yisint = 2 - (j&1); + } else if (ly == 0) { + uint32_t j = iy>>(20-k); + if ((j<<(20-k)) == iy) + yisint = 2 - (j&1); + } + } + } + + /* special value of y */ + if (ly == 0) { + if (iy == 0x7ff00000) { /* y is +-inf */ + if (((ix-0x3ff00000)|lx) == 0) /* (-1)**+-inf is 1 */ + return 1.0; + else if (ix >= 0x3ff00000) /* (|x|>1)**+-inf = inf,0 */ + return hy >= 0 ? y : 0.0; + else /* (|x|<1)**+-inf = 0,inf */ + return hy >= 0 ? 0.0 : -y; + } + if (iy == 0x3ff00000) { /* y is +-1 */ + if (hy >= 0) + return x; + y = 1/x; +#if FLT_EVAL_METHOD!=0 + { + union {double f; uint64_t i;} u = {y}; + uint64_t i = u.i & -1ULL/2; + if (i>>52 == 0 && (i&(i-1))) + FORCE_EVAL((float)y); + } +#endif + return y; + } + if (hy == 0x40000000) /* y is 2 */ + return x*x; + if (hy == 0x3fe00000) { /* y is 0.5 */ + if (hx >= 0) /* x >= +0 */ + return sqrt(x); + } + } + + ax = fabs(x); + /* special value of x */ + if (lx == 0) { + if (ix == 0x7ff00000 || ix == 0 || ix == 0x3ff00000) { /* x is +-0,+-inf,+-1 */ + z = ax; + if (hy < 0) /* z = (1/|x|) */ + z = 1.0/z; + if (hx < 0) { + if (((ix-0x3ff00000)|yisint) == 0) { + z = (z-z)/(z-z); /* (-1)**non-int is NaN */ + } else if (yisint == 1) + z = -z; /* (x<0)**odd = -(|x|**odd) */ + } + return z; + } + } + + s = 1.0; /* sign of result */ + if (hx < 0) { + if (yisint == 0) /* (x<0)**(non-int) is NaN */ + return (x-x)/(x-x); + if (yisint == 1) /* (x<0)**(odd int) */ + s = -1.0; + } + + /* |y| is huge */ + if (iy > 0x41e00000) { /* if |y| > 2**31 */ + if (iy > 0x43f00000) { /* if |y| > 2**64, must o/uflow */ + if (ix <= 0x3fefffff) + return hy < 0 ? huge*huge : tiny*tiny; + if (ix >= 0x3ff00000) + return hy > 0 ? huge*huge : tiny*tiny; + } + /* over/underflow if x is not close to one */ + if (ix < 0x3fefffff) + return hy < 0 ? s*huge*huge : s*tiny*tiny; + if (ix > 0x3ff00000) + return hy > 0 ? s*huge*huge : s*tiny*tiny; + /* now |1-x| is tiny <= 2**-20, suffice to compute + log(x) by x-x^2/2+x^3/3-x^4/4 */ + t = ax - 1.0; /* t has 20 trailing zeros */ + w = (t*t)*(0.5 - t*(0.3333333333333333333333-t*0.25)); + u = ivln2_h*t; /* ivln2_h has 21 sig. bits */ + v = t*ivln2_l - w*ivln2; + t1 = u + v; + SET_LOW_WORD(t1, 0); + t2 = v - (t1-u); + } else { + double ss,s2,s_h,s_l,t_h,t_l; + n = 0; + /* take care subnormal number */ + if (ix < 0x00100000) { + ax *= two53; + n -= 53; + GET_HIGH_WORD(ix,ax); + } + n += ((ix)>>20) - 0x3ff; + j = ix & 0x000fffff; + /* determine interval */ + ix = j | 0x3ff00000; /* normalize ix */ + if (j <= 0x3988E) /* |x|<sqrt(3/2) */ + k = 0; + else if (j < 0xBB67A) /* |x|<sqrt(3) */ + k = 1; + else { + k = 0; + n += 1; + ix -= 0x00100000; + } + SET_HIGH_WORD(ax, ix); + + /* compute ss = s_h+s_l = (x-1)/(x+1) or (x-1.5)/(x+1.5) */ + u = ax - bp[k]; /* bp[0]=1.0, bp[1]=1.5 */ + v = 1.0/(ax+bp[k]); + ss = u*v; + s_h = ss; + SET_LOW_WORD(s_h, 0); + /* t_h=ax+bp[k] High */ + t_h = 0.0; + SET_HIGH_WORD(t_h, ((ix>>1)|0x20000000) + 0x00080000 + (k<<18)); + t_l = ax - (t_h-bp[k]); + s_l = v*((u-s_h*t_h)-s_h*t_l); + /* compute log(ax) */ + s2 = ss*ss; + r = s2*s2*(L1+s2*(L2+s2*(L3+s2*(L4+s2*(L5+s2*L6))))); + r += s_l*(s_h+ss); + s2 = s_h*s_h; + t_h = 3.0 + s2 + r; + SET_LOW_WORD(t_h, 0); + t_l = r - ((t_h-3.0)-s2); + /* u+v = ss*(1+...) */ + u = s_h*t_h; + v = s_l*t_h + t_l*ss; + /* 2/(3log2)*(ss+...) */ + p_h = u + v; + SET_LOW_WORD(p_h, 0); + p_l = v - (p_h-u); + z_h = cp_h*p_h; /* cp_h+cp_l = 2/(3*log2) */ + z_l = cp_l*p_h+p_l*cp + dp_l[k]; + /* log2(ax) = (ss+..)*2/(3*log2) = n + dp_h + z_h + z_l */ + t = (double)n; + t1 = ((z_h + z_l) + dp_h[k]) + t; + SET_LOW_WORD(t1, 0); + t2 = z_l - (((t1 - t) - dp_h[k]) - z_h); + } + + /* split up y into y1+y2 and compute (y1+y2)*(t1+t2) */ + y1 = y; + SET_LOW_WORD(y1, 0); + p_l = (y-y1)*t1 + y*t2; + p_h = y1*t1; + z = p_l + p_h; + EXTRACT_WORDS(j, i, z); + if (j >= 0x40900000) { /* z >= 1024 */ + if (((j-0x40900000)|i) != 0) /* if z > 1024 */ + return s*huge*huge; /* overflow */ + if (p_l + ovt > z - p_h) + return s*huge*huge; /* overflow */ + } else if ((j&0x7fffffff) >= 0x4090cc00) { /* z <= -1075 */ // FIXME: instead of abs(j) use unsigned j + if (((j-0xc090cc00)|i) != 0) /* z < -1075 */ + return s*tiny*tiny; /* underflow */ + if (p_l <= z - p_h) + return s*tiny*tiny; /* underflow */ + } + /* + * compute 2**(p_h+p_l) + */ + i = j & 0x7fffffff; + k = (i>>20) - 0x3ff; + n = 0; + if (i > 0x3fe00000) { /* if |z| > 0.5, set n = [z+0.5] */ + n = j + (0x00100000>>(k+1)); + k = ((n&0x7fffffff)>>20) - 0x3ff; /* new k for n */ + t = 0.0; + SET_HIGH_WORD(t, n & ~(0x000fffff>>k)); + n = ((n&0x000fffff)|0x00100000)>>(20-k); + if (j < 0) + n = -n; + p_h -= t; + } + t = p_l + p_h; + SET_LOW_WORD(t, 0); + u = t*lg2_h; + v = (p_l-(t-p_h))*lg2 + t*lg2_l; + z = u + v; + w = v - (z-u); + t = z*z; + t1 = z - t*(P1+t*(P2+t*(P3+t*(P4+t*P5)))); + r = (z*t1)/(t1-2.0) - (w + z*w); + z = 1.0 - (r-z); + GET_HIGH_WORD(j, z); + j += n<<20; + if ((j>>20) <= 0) /* subnormal output */ + z = scalbn(z,n); + else + SET_HIGH_WORD(z, j); + return s*z; +} diff --git a/lib/libc/src/musl-math/powf.c b/lib/libc/src/musl-math/powf.c new file mode 100644 index 0000000..427c896 --- /dev/null +++ b/lib/libc/src/musl-math/powf.c @@ -0,0 +1,259 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_powf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +bp[] = {1.0, 1.5,}, +dp_h[] = { 0.0, 5.84960938e-01,}, /* 0x3f15c000 */ +dp_l[] = { 0.0, 1.56322085e-06,}, /* 0x35d1cfdc */ +two24 = 16777216.0, /* 0x4b800000 */ +huge = 1.0e30, +tiny = 1.0e-30, +/* poly coefs for (3/2)*(log(x)-2s-2/3*s**3 */ +L1 = 6.0000002384e-01, /* 0x3f19999a */ +L2 = 4.2857143283e-01, /* 0x3edb6db7 */ +L3 = 3.3333334327e-01, /* 0x3eaaaaab */ +L4 = 2.7272811532e-01, /* 0x3e8ba305 */ +L5 = 2.3066075146e-01, /* 0x3e6c3255 */ +L6 = 2.0697501302e-01, /* 0x3e53f142 */ +P1 = 1.6666667163e-01, /* 0x3e2aaaab */ +P2 = -2.7777778450e-03, /* 0xbb360b61 */ +P3 = 6.6137559770e-05, /* 0x388ab355 */ +P4 = -1.6533901999e-06, /* 0xb5ddea0e */ +P5 = 4.1381369442e-08, /* 0x3331bb4c */ +lg2 = 6.9314718246e-01, /* 0x3f317218 */ +lg2_h = 6.93145752e-01, /* 0x3f317200 */ +lg2_l = 1.42860654e-06, /* 0x35bfbe8c */ +ovt = 4.2995665694e-08, /* -(128-log2(ovfl+.5ulp)) */ +cp = 9.6179670095e-01, /* 0x3f76384f =2/(3ln2) */ +cp_h = 9.6191406250e-01, /* 0x3f764000 =12b cp */ +cp_l = -1.1736857402e-04, /* 0xb8f623c6 =tail of cp_h */ +ivln2 = 1.4426950216e+00, /* 0x3fb8aa3b =1/ln2 */ +ivln2_h = 1.4426879883e+00, /* 0x3fb8aa00 =16b 1/ln2*/ +ivln2_l = 7.0526075433e-06; /* 0x36eca570 =1/ln2 tail*/ + +float powf(float x, float y) +{ + float z,ax,z_h,z_l,p_h,p_l; + float y1,t1,t2,r,s,sn,t,u,v,w; + int32_t i,j,k,yisint,n; + int32_t hx,hy,ix,iy,is; + + GET_FLOAT_WORD(hx, x); + GET_FLOAT_WORD(hy, y); + ix = hx & 0x7fffffff; + iy = hy & 0x7fffffff; + + /* x**0 = 1, even if x is NaN */ + if (iy == 0) + return 1.0f; + /* 1**y = 1, even if y is NaN */ + if (hx == 0x3f800000) + return 1.0f; + /* NaN if either arg is NaN */ + if (ix > 0x7f800000 || iy > 0x7f800000) + return x + y; + + /* determine if y is an odd int when x < 0 + * yisint = 0 ... y is not an integer + * yisint = 1 ... y is an odd int + * yisint = 2 ... y is an even int + */ + yisint = 0; + if (hx < 0) { + if (iy >= 0x4b800000) + yisint = 2; /* even integer y */ + else if (iy >= 0x3f800000) { + k = (iy>>23) - 0x7f; /* exponent */ + j = iy>>(23-k); + if ((j<<(23-k)) == iy) + yisint = 2 - (j & 1); + } + } + + /* special value of y */ + if (iy == 0x7f800000) { /* y is +-inf */ + if (ix == 0x3f800000) /* (-1)**+-inf is 1 */ + return 1.0f; + else if (ix > 0x3f800000) /* (|x|>1)**+-inf = inf,0 */ + return hy >= 0 ? y : 0.0f; + else /* (|x|<1)**+-inf = 0,inf */ + return hy >= 0 ? 0.0f: -y; + } + if (iy == 0x3f800000) /* y is +-1 */ + return hy >= 0 ? x : 1.0f/x; + if (hy == 0x40000000) /* y is 2 */ + return x*x; + if (hy == 0x3f000000) { /* y is 0.5 */ + if (hx >= 0) /* x >= +0 */ + return sqrtf(x); + } + + ax = fabsf(x); + /* special value of x */ + if (ix == 0x7f800000 || ix == 0 || ix == 0x3f800000) { /* x is +-0,+-inf,+-1 */ + z = ax; + if (hy < 0) /* z = (1/|x|) */ + z = 1.0f/z; + if (hx < 0) { + if (((ix-0x3f800000)|yisint) == 0) { + z = (z-z)/(z-z); /* (-1)**non-int is NaN */ + } else if (yisint == 1) + z = -z; /* (x<0)**odd = -(|x|**odd) */ + } + return z; + } + + sn = 1.0f; /* sign of result */ + if (hx < 0) { + if (yisint == 0) /* (x<0)**(non-int) is NaN */ + return (x-x)/(x-x); + if (yisint == 1) /* (x<0)**(odd int) */ + sn = -1.0f; + } + + /* |y| is huge */ + if (iy > 0x4d000000) { /* if |y| > 2**27 */ + /* over/underflow if x is not close to one */ + if (ix < 0x3f7ffff8) + return hy < 0 ? sn*huge*huge : sn*tiny*tiny; + if (ix > 0x3f800007) + return hy > 0 ? sn*huge*huge : sn*tiny*tiny; + /* now |1-x| is tiny <= 2**-20, suffice to compute + log(x) by x-x^2/2+x^3/3-x^4/4 */ + t = ax - 1; /* t has 20 trailing zeros */ + w = (t*t)*(0.5f - t*(0.333333333333f - t*0.25f)); + u = ivln2_h*t; /* ivln2_h has 16 sig. bits */ + v = t*ivln2_l - w*ivln2; + t1 = u + v; + GET_FLOAT_WORD(is, t1); + SET_FLOAT_WORD(t1, is & 0xfffff000); + t2 = v - (t1-u); + } else { + float s2,s_h,s_l,t_h,t_l; + n = 0; + /* take care subnormal number */ + if (ix < 0x00800000) { + ax *= two24; + n -= 24; + GET_FLOAT_WORD(ix, ax); + } + n += ((ix)>>23) - 0x7f; + j = ix & 0x007fffff; + /* determine interval */ + ix = j | 0x3f800000; /* normalize ix */ + if (j <= 0x1cc471) /* |x|<sqrt(3/2) */ + k = 0; + else if (j < 0x5db3d7) /* |x|<sqrt(3) */ + k = 1; + else { + k = 0; + n += 1; + ix -= 0x00800000; + } + SET_FLOAT_WORD(ax, ix); + + /* compute s = s_h+s_l = (x-1)/(x+1) or (x-1.5)/(x+1.5) */ + u = ax - bp[k]; /* bp[0]=1.0, bp[1]=1.5 */ + v = 1.0f/(ax+bp[k]); + s = u*v; + s_h = s; + GET_FLOAT_WORD(is, s_h); + SET_FLOAT_WORD(s_h, is & 0xfffff000); + /* t_h=ax+bp[k] High */ + is = ((ix>>1) & 0xfffff000) | 0x20000000; + SET_FLOAT_WORD(t_h, is + 0x00400000 + (k<<21)); + t_l = ax - (t_h - bp[k]); + s_l = v*((u - s_h*t_h) - s_h*t_l); + /* compute log(ax) */ + s2 = s*s; + r = s2*s2*(L1+s2*(L2+s2*(L3+s2*(L4+s2*(L5+s2*L6))))); + r += s_l*(s_h+s); + s2 = s_h*s_h; + t_h = 3.0f + s2 + r; + GET_FLOAT_WORD(is, t_h); + SET_FLOAT_WORD(t_h, is & 0xfffff000); + t_l = r - ((t_h - 3.0f) - s2); + /* u+v = s*(1+...) */ + u = s_h*t_h; + v = s_l*t_h + t_l*s; + /* 2/(3log2)*(s+...) */ + p_h = u + v; + GET_FLOAT_WORD(is, p_h); + SET_FLOAT_WORD(p_h, is & 0xfffff000); + p_l = v - (p_h - u); + z_h = cp_h*p_h; /* cp_h+cp_l = 2/(3*log2) */ + z_l = cp_l*p_h + p_l*cp+dp_l[k]; + /* log2(ax) = (s+..)*2/(3*log2) = n + dp_h + z_h + z_l */ + t = (float)n; + t1 = (((z_h + z_l) + dp_h[k]) + t); + GET_FLOAT_WORD(is, t1); + SET_FLOAT_WORD(t1, is & 0xfffff000); + t2 = z_l - (((t1 - t) - dp_h[k]) - z_h); + } + + /* split up y into y1+y2 and compute (y1+y2)*(t1+t2) */ + GET_FLOAT_WORD(is, y); + SET_FLOAT_WORD(y1, is & 0xfffff000); + p_l = (y-y1)*t1 + y*t2; + p_h = y1*t1; + z = p_l + p_h; + GET_FLOAT_WORD(j, z); + if (j > 0x43000000) /* if z > 128 */ + return sn*huge*huge; /* overflow */ + else if (j == 0x43000000) { /* if z == 128 */ + if (p_l + ovt > z - p_h) + return sn*huge*huge; /* overflow */ + } else if ((j&0x7fffffff) > 0x43160000) /* z < -150 */ // FIXME: check should be (uint32_t)j > 0xc3160000 + return sn*tiny*tiny; /* underflow */ + else if (j == 0xc3160000) { /* z == -150 */ + if (p_l <= z-p_h) + return sn*tiny*tiny; /* underflow */ + } + /* + * compute 2**(p_h+p_l) + */ + i = j & 0x7fffffff; + k = (i>>23) - 0x7f; + n = 0; + if (i > 0x3f000000) { /* if |z| > 0.5, set n = [z+0.5] */ + n = j + (0x00800000>>(k+1)); + k = ((n&0x7fffffff)>>23) - 0x7f; /* new k for n */ + SET_FLOAT_WORD(t, n & ~(0x007fffff>>k)); + n = ((n&0x007fffff)|0x00800000)>>(23-k); + if (j < 0) + n = -n; + p_h -= t; + } + t = p_l + p_h; + GET_FLOAT_WORD(is, t); + SET_FLOAT_WORD(t, is & 0xffff8000); + u = t*lg2_h; + v = (p_l-(t-p_h))*lg2 + t*lg2_l; + z = u + v; + w = v - (z - u); + t = z*z; + t1 = z - t*(P1+t*(P2+t*(P3+t*(P4+t*P5)))); + r = (z*t1)/(t1-2.0f) - (w+z*w); + z = 1.0f - (r - z); + GET_FLOAT_WORD(j, z); + j += n<<23; + if ((j>>23) <= 0) /* subnormal output */ + z = scalbnf(z, n); + else + SET_FLOAT_WORD(z, j); + return sn*z; +} diff --git a/lib/libc/src/musl-math/powl.c b/lib/libc/src/musl-math/powl.c new file mode 100644 index 0000000..5b6da07 --- /dev/null +++ b/lib/libc/src/musl-math/powl.c @@ -0,0 +1,522 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_powl.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* powl.c + * + * Power function, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, z, powl(); + * + * z = powl( x, y ); + * + * + * DESCRIPTION: + * + * Computes x raised to the yth power. Analytically, + * + * x**y = exp( y log(x) ). + * + * Following Cody and Waite, this program uses a lookup table + * of 2**-i/32 and pseudo extended precision arithmetic to + * obtain several extra bits of accuracy in both the logarithm + * and the exponential. + * + * + * ACCURACY: + * + * The relative error of pow(x,y) can be estimated + * by y dl ln(2), where dl is the absolute error of + * the internally computed base 2 logarithm. At the ends + * of the approximation interval the logarithm equal 1/32 + * and its relative error is about 1 lsb = 1.1e-19. Hence + * the predicted relative error in the result is 2.3e-21 y . + * + * Relative error: + * arithmetic domain # trials peak rms + * + * IEEE +-1000 40000 2.8e-18 3.7e-19 + * .001 < x < 1000, with log(x) uniformly distributed. + * -1000 < y < 1000, y uniformly distributed. + * + * IEEE 0,8700 60000 6.5e-18 1.0e-18 + * 0.99 < x < 1.01, 0 < y < 8700, uniformly distributed. + * + * + * ERROR MESSAGES: + * + * message condition value returned + * pow overflow x**y > MAXNUM INFINITY + * pow underflow x**y < 1/MAXNUM 0.0 + * pow domain x<0 and y noninteger 0.0 + * + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double powl(long double x, long double y) +{ + return pow(x, y); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 + +/* Table size */ +#define NXT 32 + +/* log(1+x) = x - .5x^2 + x^3 * P(z)/Q(z) + * on the domain 2^(-1/32) - 1 <= x <= 2^(1/32) - 1 + */ +static const long double P[] = { + 8.3319510773868690346226E-4L, + 4.9000050881978028599627E-1L, + 1.7500123722550302671919E0L, + 1.4000100839971580279335E0L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0L,*/ + 5.2500282295834889175431E0L, + 8.4000598057587009834666E0L, + 4.2000302519914740834728E0L, +}; +/* A[i] = 2^(-i/32), rounded to IEEE long double precision. + * If i is even, A[i] + B[i/2] gives additional accuracy. + */ +static const long double A[33] = { + 1.0000000000000000000000E0L, + 9.7857206208770013448287E-1L, + 9.5760328069857364691013E-1L, + 9.3708381705514995065011E-1L, + 9.1700404320467123175367E-1L, + 8.9735453750155359320742E-1L, + 8.7812608018664974155474E-1L, + 8.5930964906123895780165E-1L, + 8.4089641525371454301892E-1L, + 8.2287773907698242225554E-1L, + 8.0524516597462715409607E-1L, + 7.8799042255394324325455E-1L, + 7.7110541270397041179298E-1L, + 7.5458221379671136985669E-1L, + 7.3841307296974965571198E-1L, + 7.2259040348852331001267E-1L, + 7.0710678118654752438189E-1L, + 6.9195494098191597746178E-1L, + 6.7712777346844636413344E-1L, + 6.6261832157987064729696E-1L, + 6.4841977732550483296079E-1L, + 6.3452547859586661129850E-1L, + 6.2092890603674202431705E-1L, + 6.0762367999023443907803E-1L, + 5.9460355750136053334378E-1L, + 5.8186242938878875689693E-1L, + 5.6939431737834582684856E-1L, + 5.5719337129794626814472E-1L, + 5.4525386633262882960438E-1L, + 5.3357020033841180906486E-1L, + 5.2213689121370692017331E-1L, + 5.1094857432705833910408E-1L, + 5.0000000000000000000000E-1L, +}; +static const long double B[17] = { + 0.0000000000000000000000E0L, + 2.6176170809902549338711E-20L, +-1.0126791927256478897086E-20L, + 1.3438228172316276937655E-21L, + 1.2207982955417546912101E-20L, +-6.3084814358060867200133E-21L, + 1.3164426894366316434230E-20L, +-1.8527916071632873716786E-20L, + 1.8950325588932570796551E-20L, + 1.5564775779538780478155E-20L, + 6.0859793637556860974380E-21L, +-2.0208749253662532228949E-20L, + 1.4966292219224761844552E-20L, + 3.3540909728056476875639E-21L, +-8.6987564101742849540743E-22L, +-1.2327176863327626135542E-20L, + 0.0000000000000000000000E0L, +}; + +/* 2^x = 1 + x P(x), + * on the interval -1/32 <= x <= 0 + */ +static const long double R[] = { + 1.5089970579127659901157E-5L, + 1.5402715328927013076125E-4L, + 1.3333556028915671091390E-3L, + 9.6181291046036762031786E-3L, + 5.5504108664798463044015E-2L, + 2.4022650695910062854352E-1L, + 6.9314718055994530931447E-1L, +}; + +#define MEXP (NXT*16384.0L) +/* The following if denormal numbers are supported, else -MEXP: */ +#define MNEXP (-NXT*(16384.0L+64.0L)) +/* log2(e) - 1 */ +#define LOG2EA 0.44269504088896340735992L + +#define F W +#define Fa Wa +#define Fb Wb +#define G W +#define Ga Wa +#define Gb u +#define H W +#define Ha Wb +#define Hb Wb + +static const long double MAXLOGL = 1.1356523406294143949492E4L; +static const long double MINLOGL = -1.13994985314888605586758E4L; +static const long double LOGE2L = 6.9314718055994530941723E-1L; +static const long double huge = 0x1p10000L; +/* XXX Prevent gcc from erroneously constant folding this. */ +static const volatile long double twom10000 = 0x1p-10000L; + +static long double reducl(long double); +static long double powil(long double, int); + +long double powl(long double x, long double y) +{ + /* double F, Fa, Fb, G, Ga, Gb, H, Ha, Hb */ + int i, nflg, iyflg, yoddint; + long e; + volatile long double z=0; + long double w=0, W=0, Wa=0, Wb=0, ya=0, yb=0, u=0; + + /* make sure no invalid exception is raised by nan comparision */ + if (isnan(x)) { + if (!isnan(y) && y == 0.0) + return 1.0; + return x; + } + if (isnan(y)) { + if (x == 1.0) + return 1.0; + return y; + } + if (x == 1.0) + return 1.0; /* 1**y = 1, even if y is nan */ + if (x == -1.0 && !isfinite(y)) + return 1.0; /* -1**inf = 1 */ + if (y == 0.0) + return 1.0; /* x**0 = 1, even if x is nan */ + if (y == 1.0) + return x; + if (y >= LDBL_MAX) { + if (x > 1.0 || x < -1.0) + return INFINITY; + if (x != 0.0) + return 0.0; + } + if (y <= -LDBL_MAX) { + if (x > 1.0 || x < -1.0) + return 0.0; + if (x != 0.0 || y == -INFINITY) + return INFINITY; + } + if (x >= LDBL_MAX) { + if (y > 0.0) + return INFINITY; + return 0.0; + } + + w = floorl(y); + + /* Set iyflg to 1 if y is an integer. */ + iyflg = 0; + if (w == y) + iyflg = 1; + + /* Test for odd integer y. */ + yoddint = 0; + if (iyflg) { + ya = fabsl(y); + ya = floorl(0.5 * ya); + yb = 0.5 * fabsl(w); + if( ya != yb ) + yoddint = 1; + } + + if (x <= -LDBL_MAX) { + if (y > 0.0) { + if (yoddint) + return -INFINITY; + return INFINITY; + } + if (y < 0.0) { + if (yoddint) + return -0.0; + return 0.0; + } + } + nflg = 0; /* (x<0)**(odd int) */ + if (x <= 0.0) { + if (x == 0.0) { + if (y < 0.0) { + if (signbit(x) && yoddint) + /* (-0.0)**(-odd int) = -inf, divbyzero */ + return -1.0/0.0; + /* (+-0.0)**(negative) = inf, divbyzero */ + return 1.0/0.0; + } + if (signbit(x) && yoddint) + return -0.0; + return 0.0; + } + if (iyflg == 0) + return (x - x) / (x - x); /* (x<0)**(non-int) is NaN */ + /* (x<0)**(integer) */ + if (yoddint) + nflg = 1; /* negate result */ + x = -x; + } + /* (+integer)**(integer) */ + if (iyflg && floorl(x) == x && fabsl(y) < 32768.0) { + w = powil(x, (int)y); + return nflg ? -w : w; + } + + /* separate significand from exponent */ + x = frexpl(x, &i); + e = i; + + /* find significand in antilog table A[] */ + i = 1; + if (x <= A[17]) + i = 17; + if (x <= A[i+8]) + i += 8; + if (x <= A[i+4]) + i += 4; + if (x <= A[i+2]) + i += 2; + if (x >= A[1]) + i = -1; + i += 1; + + /* Find (x - A[i])/A[i] + * in order to compute log(x/A[i]): + * + * log(x) = log( a x/a ) = log(a) + log(x/a) + * + * log(x/a) = log(1+v), v = x/a - 1 = (x-a)/a + */ + x -= A[i]; + x -= B[i/2]; + x /= A[i]; + + /* rational approximation for log(1+v): + * + * log(1+v) = v - v**2/2 + v**3 P(v) / Q(v) + */ + z = x*x; + w = x * (z * __polevll(x, P, 3) / __p1evll(x, Q, 3)); + w = w - 0.5*z; + + /* Convert to base 2 logarithm: + * multiply by log2(e) = 1 + LOG2EA + */ + z = LOG2EA * w; + z += w; + z += LOG2EA * x; + z += x; + + /* Compute exponent term of the base 2 logarithm. */ + w = -i; + w /= NXT; + w += e; + /* Now base 2 log of x is w + z. */ + + /* Multiply base 2 log by y, in extended precision. */ + + /* separate y into large part ya + * and small part yb less than 1/NXT + */ + ya = reducl(y); + yb = y - ya; + + /* (w+z)(ya+yb) + * = w*ya + w*yb + z*y + */ + F = z * y + w * yb; + Fa = reducl(F); + Fb = F - Fa; + + G = Fa + w * ya; + Ga = reducl(G); + Gb = G - Ga; + + H = Fb + Gb; + Ha = reducl(H); + w = (Ga + Ha) * NXT; + + /* Test the power of 2 for overflow */ + if (w > MEXP) + return huge * huge; /* overflow */ + if (w < MNEXP) + return twom10000 * twom10000; /* underflow */ + + e = w; + Hb = H - Ha; + + if (Hb > 0.0) { + e += 1; + Hb -= 1.0/NXT; /*0.0625L;*/ + } + + /* Now the product y * log2(x) = Hb + e/NXT. + * + * Compute base 2 exponential of Hb, + * where -0.0625 <= Hb <= 0. + */ + z = Hb * __polevll(Hb, R, 6); /* z = 2**Hb - 1 */ + + /* Express e/NXT as an integer plus a negative number of (1/NXT)ths. + * Find lookup table entry for the fractional power of 2. + */ + if (e < 0) + i = 0; + else + i = 1; + i = e/NXT + i; + e = NXT*i - e; + w = A[e]; + z = w * z; /* 2**-e * ( 1 + (2**Hb-1) ) */ + z = z + w; + z = scalbnl(z, i); /* multiply by integer power of 2 */ + + if (nflg) + z = -z; + return z; +} + + +/* Find a multiple of 1/NXT that is within 1/NXT of x. */ +static long double reducl(long double x) +{ + long double t; + + t = x * NXT; + t = floorl(t); + t = t / NXT; + return t; +} + +/* + * Positive real raised to integer power, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, powil(); + * int n; + * + * y = powil( x, n ); + * + * + * DESCRIPTION: + * + * Returns argument x>0 raised to the nth power. + * The routine efficiently decomposes n as a sum of powers of + * two. The desired power is a product of two-to-the-kth + * powers of x. Thus to compute the 32767 power of x requires + * 28 multiplications instead of 32767 multiplications. + * + * + * ACCURACY: + * + * Relative error: + * arithmetic x domain n domain # trials peak rms + * IEEE .001,1000 -1022,1023 50000 4.3e-17 7.8e-18 + * IEEE 1,2 -1022,1023 20000 3.9e-17 7.6e-18 + * IEEE .99,1.01 0,8700 10000 3.6e-16 7.2e-17 + * + * Returns MAXNUM on overflow, zero on underflow. + */ + +static long double powil(long double x, int nn) +{ + long double ww, y; + long double s; + int n, e, sign, lx; + + if (nn == 0) + return 1.0; + + if (nn < 0) { + sign = -1; + n = -nn; + } else { + sign = 1; + n = nn; + } + + /* Overflow detection */ + + /* Calculate approximate logarithm of answer */ + s = x; + s = frexpl( s, &lx); + e = (lx - 1)*n; + if ((e == 0) || (e > 64) || (e < -64)) { + s = (s - 7.0710678118654752e-1L) / (s + 7.0710678118654752e-1L); + s = (2.9142135623730950L * s - 0.5 + lx) * nn * LOGE2L; + } else { + s = LOGE2L * e; + } + + if (s > MAXLOGL) + return huge * huge; /* overflow */ + + if (s < MINLOGL) + return twom10000 * twom10000; /* underflow */ + /* Handle tiny denormal answer, but with less accuracy + * since roundoff error in 1.0/x will be amplified. + * The precise demarcation should be the gradual underflow threshold. + */ + if (s < -MAXLOGL+2.0) { + x = 1.0/x; + sign = -sign; + } + + /* First bit of the power */ + if (n & 1) + y = x; + else + y = 1.0; + + ww = x; + n >>= 1; + while (n) { + ww = ww * ww; /* arg to the 2-to-the-kth power */ + if (n & 1) /* if that bit is set, then include in product */ + y *= ww; + n >>= 1; + } + + if (sign < 0) + y = 1.0/y; + return y; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double powl(long double x, long double y) +{ + return pow(x, y); +} +#endif diff --git a/lib/libc/src/musl-math/remainder.c b/lib/libc/src/musl-math/remainder.c new file mode 100644 index 0000000..e4abcd7 --- /dev/null +++ b/lib/libc/src/musl-math/remainder.c @@ -0,0 +1,11 @@ +#include <math.h> +#include "weak_alias.h" +//#include "libc.h" + +double remainder(double x, double y) +{ + int q; + return remquo(x, y, &q); +} + +weak_alias(remainder, drem); diff --git a/lib/libc/src/musl-math/remainderf.c b/lib/libc/src/musl-math/remainderf.c new file mode 100644 index 0000000..e1fcdaa --- /dev/null +++ b/lib/libc/src/musl-math/remainderf.c @@ -0,0 +1,11 @@ +#include <math.h> +#include "weak_alias.h" +//#include "libc.h" + +float remainderf(float x, float y) +{ + int q; + return remquof(x, y, &q); +} + +weak_alias(remainderf, dremf); diff --git a/lib/libc/src/musl-math/remainderl.c b/lib/libc/src/musl-math/remainderl.c new file mode 100644 index 0000000..2a13c1d --- /dev/null +++ b/lib/libc/src/musl-math/remainderl.c @@ -0,0 +1,15 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double remainderl(long double x, long double y) +{ + return remainder(x, y); +} +#else +long double remainderl(long double x, long double y) +{ + int q; + return remquol(x, y, &q); +} +#endif diff --git a/lib/libc/src/musl-math/remquo.c b/lib/libc/src/musl-math/remquo.c new file mode 100644 index 0000000..59d5ad5 --- /dev/null +++ b/lib/libc/src/musl-math/remquo.c @@ -0,0 +1,82 @@ +#include <math.h> +#include <stdint.h> + +double remquo(double x, double y, int *quo) +{ + union {double f; uint64_t i;} ux = {x}, uy = {y}; + int ex = ux.i>>52 & 0x7ff; + int ey = uy.i>>52 & 0x7ff; + int sx = ux.i>>63; + int sy = uy.i>>63; + uint32_t q; + uint64_t i; + uint64_t uxi = ux.i; + + *quo = 0; + if (uy.i<<1 == 0 || isnan(y) || ex == 0x7ff) + return (x*y)/(x*y); + if (ux.i<<1 == 0) + return x; + + /* normalize x and y */ + if (!ex) { + for (i = uxi<<12; i>>63 == 0; ex--, i <<= 1); + uxi <<= -ex + 1; + } else { + uxi &= -1ULL >> 12; + uxi |= 1ULL << 52; + } + if (!ey) { + for (i = uy.i<<12; i>>63 == 0; ey--, i <<= 1); + uy.i <<= -ey + 1; + } else { + uy.i &= -1ULL >> 12; + uy.i |= 1ULL << 52; + } + + q = 0; + if (ex < ey) { + if (ex+1 == ey) + goto end; + return x; + } + + /* x mod y */ + for (; ex > ey; ex--) { + i = uxi - uy.i; + if (i >> 63 == 0) { + uxi = i; + q++; + } + uxi <<= 1; + q <<= 1; + } + i = uxi - uy.i; + if (i >> 63 == 0) { + uxi = i; + q++; + } + if (uxi == 0) + ex = -60; + else + for (; uxi>>52 == 0; uxi <<= 1, ex--); +end: + /* scale result and decide between |x| and |x|-|y| */ + if (ex > 0) { + uxi -= 1ULL << 52; + uxi |= (uint64_t)ex << 52; + } else { + uxi >>= -ex + 1; + } + ux.i = uxi; + x = ux.f; + if (sy) + y = -y; + if (ex == ey || (ex+1 == ey && (2*x > y || (2*x == y && q%2)))) { + x -= y; + q++; + } + q &= 0x7fffffff; + *quo = sx^sy ? -(int)q : (int)q; + return sx ? -x : x; +} diff --git a/lib/libc/src/musl-math/remquof.c b/lib/libc/src/musl-math/remquof.c new file mode 100644 index 0000000..2f41ff7 --- /dev/null +++ b/lib/libc/src/musl-math/remquof.c @@ -0,0 +1,82 @@ +#include <math.h> +#include <stdint.h> + +float remquof(float x, float y, int *quo) +{ + union {float f; uint32_t i;} ux = {x}, uy = {y}; + int ex = ux.i>>23 & 0xff; + int ey = uy.i>>23 & 0xff; + int sx = ux.i>>31; + int sy = uy.i>>31; + uint32_t q; + uint32_t i; + uint32_t uxi = ux.i; + + *quo = 0; + if (uy.i<<1 == 0 || isnan(y) || ex == 0xff) + return (x*y)/(x*y); + if (ux.i<<1 == 0) + return x; + + /* normalize x and y */ + if (!ex) { + for (i = uxi<<9; i>>31 == 0; ex--, i <<= 1); + uxi <<= -ex + 1; + } else { + uxi &= -1U >> 9; + uxi |= 1U << 23; + } + if (!ey) { + for (i = uy.i<<9; i>>31 == 0; ey--, i <<= 1); + uy.i <<= -ey + 1; + } else { + uy.i &= -1U >> 9; + uy.i |= 1U << 23; + } + + q = 0; + if (ex < ey) { + if (ex+1 == ey) + goto end; + return x; + } + + /* x mod y */ + for (; ex > ey; ex--) { + i = uxi - uy.i; + if (i >> 31 == 0) { + uxi = i; + q++; + } + uxi <<= 1; + q <<= 1; + } + i = uxi - uy.i; + if (i >> 31 == 0) { + uxi = i; + q++; + } + if (uxi == 0) + ex = -30; + else + for (; uxi>>23 == 0; uxi <<= 1, ex--); +end: + /* scale result and decide between |x| and |x|-|y| */ + if (ex > 0) { + uxi -= 1U << 23; + uxi |= (uint32_t)ex << 23; + } else { + uxi >>= -ex + 1; + } + ux.i = uxi; + x = ux.f; + if (sy) + y = -y; + if (ex == ey || (ex+1 == ey && (2*x > y || (2*x == y && q%2)))) { + x -= y; + q++; + } + q &= 0x7fffffff; + *quo = sx^sy ? -(int)q : (int)q; + return sx ? -x : x; +} diff --git a/lib/libc/src/musl-math/remquol.c b/lib/libc/src/musl-math/remquol.c new file mode 100644 index 0000000..9b065c0 --- /dev/null +++ b/lib/libc/src/musl-math/remquol.c @@ -0,0 +1,124 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double remquol(long double x, long double y, int *quo) +{ + return remquo(x, y, quo); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double remquol(long double x, long double y, int *quo) +{ + union ldshape ux = {x}, uy = {y}; + int ex = ux.i.se & 0x7fff; + int ey = uy.i.se & 0x7fff; + int sx = ux.i.se >> 15; + int sy = uy.i.se >> 15; + uint32_t q; + + *quo = 0; + if (y == 0 || isnan(y) || ex == 0x7fff) + return (x*y)/(x*y); + if (x == 0) + return x; + + /* normalize x and y */ + if (!ex) { + ux.i.se = ex; + ux.f *= 0x1p120f; + ex = ux.i.se - 120; + } + if (!ey) { + uy.i.se = ey; + uy.f *= 0x1p120f; + ey = uy.i.se - 120; + } + + q = 0; + if (ex >= ey) { + /* x mod y */ +#if LDBL_MANT_DIG == 64 + uint64_t i, mx, my; + mx = ux.i.m; + my = uy.i.m; + for (; ex > ey; ex--) { + i = mx - my; + if (mx >= my) { + mx = 2*i; + q++; + q <<= 1; + } else if (2*mx < mx) { + mx = 2*mx - my; + q <<= 1; + q++; + } else { + mx = 2*mx; + q <<= 1; + } + } + i = mx - my; + if (mx >= my) { + mx = i; + q++; + } + if (mx == 0) + ex = -120; + else + for (; mx >> 63 == 0; mx *= 2, ex--); + ux.i.m = mx; +#elif LDBL_MANT_DIG == 113 + uint64_t hi, lo, xhi, xlo, yhi, ylo; + xhi = (ux.i2.hi & -1ULL>>16) | 1ULL<<48; + yhi = (uy.i2.hi & -1ULL>>16) | 1ULL<<48; + xlo = ux.i2.lo; + ylo = ux.i2.lo; + for (; ex > ey; ex--) { + hi = xhi - yhi; + lo = xlo - ylo; + if (xlo < ylo) + hi -= 1; + if (hi >> 63 == 0) { + xhi = 2*hi + (lo>>63); + xlo = 2*lo; + q++; + } else { + xhi = 2*xhi + (xlo>>63); + xlo = 2*xlo; + } + q <<= 1; + } + hi = xhi - yhi; + lo = xlo - ylo; + if (xlo < ylo) + hi -= 1; + if (hi >> 63 == 0) { + xhi = hi; + xlo = lo; + q++; + } + if ((xhi|xlo) == 0) + ex = -120; + else + for (; xhi >> 48 == 0; xhi = 2*xhi + (xlo>>63), xlo = 2*xlo, ex--); + ux.i2.hi = xhi; + ux.i2.lo = xlo; +#endif + } + + /* scale result and decide between |x| and |x|-|y| */ + if (ex <= 0) { + ux.i.se = ex + 120; + ux.f *= 0x1p-120f; + } else + ux.i.se = ex; + x = ux.f; + if (sy) + y = -y; + if (ex == ey || (ex+1 == ey && (2*x > y || (2*x == y && q%2)))) { + x -= y; + q++; + } + q &= 0x7fffffff; + *quo = sx^sy ? -(int)q : (int)q; + return sx ? -x : x; +} +#endif diff --git a/lib/libc/src/musl-math/rint.c b/lib/libc/src/musl-math/rint.c new file mode 100644 index 0000000..fbba390 --- /dev/null +++ b/lib/libc/src/musl-math/rint.c @@ -0,0 +1,28 @@ +#include <float.h> +#include <math.h> +#include <stdint.h> + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const double_t toint = 1/EPS; + +double rint(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i>>52 & 0x7ff; + int s = u.i>>63; + double_t y; + + if (e >= 0x3ff+52) + return x; + if (s) + y = x - toint + toint; + else + y = x + toint - toint; + if (y == 0) + return s ? -0.0 : 0; + return y; +} diff --git a/lib/libc/src/musl-math/rintf.c b/lib/libc/src/musl-math/rintf.c new file mode 100644 index 0000000..9047688 --- /dev/null +++ b/lib/libc/src/musl-math/rintf.c @@ -0,0 +1,30 @@ +#include <float.h> +#include <math.h> +#include <stdint.h> + +#if FLT_EVAL_METHOD==0 +#define EPS FLT_EPSILON +#elif FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const float_t toint = 1/EPS; + +float rintf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = u.i>>23 & 0xff; + int s = u.i>>31; + float_t y; + + if (e >= 0x7f+23) + return x; + if (s) + y = x - toint + toint; + else + y = x + toint - toint; + if (y == 0) + return s ? -0.0f : 0.0f; + return y; +} diff --git a/lib/libc/src/musl-math/rintl.c b/lib/libc/src/musl-math/rintl.c new file mode 100644 index 0000000..374327d --- /dev/null +++ b/lib/libc/src/musl-math/rintl.c @@ -0,0 +1,29 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double rintl(long double x) +{ + return rint(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double rintl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + int s = u.i.se >> 15; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1) + return x; + if (s) + y = x - toint + toint; + else + y = x + toint - toint; + if (y == 0) + return 0*x; + return y; +} +#endif diff --git a/lib/libc/src/musl-math/round.c b/lib/libc/src/musl-math/round.c new file mode 100644 index 0000000..130d58d --- /dev/null +++ b/lib/libc/src/musl-math/round.c @@ -0,0 +1,35 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const double_t toint = 1/EPS; + +double round(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i >> 52 & 0x7ff; + double_t y; + + if (e >= 0x3ff+52) + return x; + if (u.i >> 63) + x = -x; + if (e < 0x3ff-1) { + /* raise inexact if x!=0 */ + FORCE_EVAL(x + toint); + return 0*u.f; + } + y = x + toint - toint - x; + if (y > 0.5) + y = y + x - 1; + else if (y <= -0.5) + y = y + x + 1; + else + y = y + x; + if (u.i >> 63) + y = -y; + return y; +} diff --git a/lib/libc/src/musl-math/roundf.c b/lib/libc/src/musl-math/roundf.c new file mode 100644 index 0000000..e8210af --- /dev/null +++ b/lib/libc/src/musl-math/roundf.c @@ -0,0 +1,36 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==0 +#define EPS FLT_EPSILON +#elif FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const float_t toint = 1/EPS; + +float roundf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = u.i >> 23 & 0xff; + float_t y; + + if (e >= 0x7f+23) + return x; + if (u.i >> 31) + x = -x; + if (e < 0x7f-1) { + FORCE_EVAL(x + toint); + return 0*u.f; + } + y = x + toint - toint - x; + if (y > 0.5f) + y = y + x - 1; + else if (y <= -0.5f) + y = y + x + 1; + else + y = y + x; + if (u.i >> 31) + y = -y; + return y; +} diff --git a/lib/libc/src/musl-math/roundl.c b/lib/libc/src/musl-math/roundl.c new file mode 100644 index 0000000..f4ff682 --- /dev/null +++ b/lib/libc/src/musl-math/roundl.c @@ -0,0 +1,37 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double roundl(long double x) +{ + return round(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double roundl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1) + return x; + if (u.i.se >> 15) + x = -x; + if (e < 0x3fff-1) { + FORCE_EVAL(x + toint); + return 0*u.f; + } + y = x + toint - toint - x; + if (y > 0.5) + y = y + x - 1; + else if (y <= -0.5) + y = y + x + 1; + else + y = y + x; + if (u.i.se >> 15) + y = -y; + return y; +} +#endif diff --git a/lib/libc/src/musl-math/scalb.c b/lib/libc/src/musl-math/scalb.c new file mode 100644 index 0000000..efe69e6 --- /dev/null +++ b/lib/libc/src/musl-math/scalb.c @@ -0,0 +1,35 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_scalb.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * scalb(x, fn) is provide for + * passing various standard test suite. One + * should use scalbn() instead. + */ + +#define _GNU_SOURCE +#include <math.h> + +double scalb(double x, double fn) +{ + if (isnan(x) || isnan(fn)) + return x*fn; + if (!isfinite(fn)) { + if (fn > 0.0) + return x*fn; + else + return x/(-fn); + } + if (rint(fn) != fn) return (fn-fn)/(fn-fn); + if ( fn > 65000.0) return scalbn(x, 65000); + if (-fn > 65000.0) return scalbn(x,-65000); + return scalbn(x,(int)fn); +} diff --git a/lib/libc/src/musl-math/scalbf.c b/lib/libc/src/musl-math/scalbf.c new file mode 100644 index 0000000..f44ed5b --- /dev/null +++ b/lib/libc/src/musl-math/scalbf.c @@ -0,0 +1,32 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_scalbf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include <math.h> + +float scalbf(float x, float fn) +{ + if (isnan(x) || isnan(fn)) return x*fn; + if (!isfinite(fn)) { + if (fn > 0.0f) + return x*fn; + else + return x/(-fn); + } + if (rintf(fn) != fn) return (fn-fn)/(fn-fn); + if ( fn > 65000.0f) return scalbnf(x, 65000); + if (-fn > 65000.0f) return scalbnf(x,-65000); + return scalbnf(x,(int)fn); +} diff --git a/lib/libc/src/musl-math/scalbln.c b/lib/libc/src/musl-math/scalbln.c new file mode 100644 index 0000000..4fb3d06 --- /dev/null +++ b/lib/libc/src/musl-math/scalbln.c @@ -0,0 +1,12 @@ +#include <limits.h> +#include <math.h> +#include "libm.h" + +double scalbln(double x, long n) +{ + if (n > INT_MAX) + n = INT_MAX; + else if (n < INT_MIN) + n = INT_MIN; + return scalbn(x, n); +} diff --git a/lib/libc/src/musl-math/scalblnf.c b/lib/libc/src/musl-math/scalblnf.c new file mode 100644 index 0000000..b6bdeed --- /dev/null +++ b/lib/libc/src/musl-math/scalblnf.c @@ -0,0 +1,12 @@ +#include <limits.h> +#include <math.h> +#include "libm.h" + +float scalblnf(float x, long n) +{ + if (n > INT_MAX) + n = INT_MAX; + else if (n < INT_MIN) + n = INT_MIN; + return scalbnf(x, n); +} diff --git a/lib/libc/src/musl-math/scalblnl.c b/lib/libc/src/musl-math/scalblnl.c new file mode 100644 index 0000000..b1a0f7f --- /dev/null +++ b/lib/libc/src/musl-math/scalblnl.c @@ -0,0 +1,20 @@ +#include <limits.h> +#include <math.h> +#include <float.h> +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double scalblnl(long double x, long n) +{ + return scalbln(x, n); +} +#else +long double scalblnl(long double x, long n) +{ + if (n > INT_MAX) + n = INT_MAX; + else if (n < INT_MIN) + n = INT_MIN; + return scalbnl(x, n); +} +#endif diff --git a/lib/libc/src/musl-math/scalbn.c b/lib/libc/src/musl-math/scalbn.c new file mode 100644 index 0000000..182f561 --- /dev/null +++ b/lib/libc/src/musl-math/scalbn.c @@ -0,0 +1,33 @@ +#include <math.h> +#include <stdint.h> + +double scalbn(double x, int n) +{ + union {double f; uint64_t i;} u; + double_t y = x; + + if (n > 1023) { + y *= 0x1p1023; + n -= 1023; + if (n > 1023) { + y *= 0x1p1023; + n -= 1023; + if (n > 1023) + n = 1023; + } + } else if (n < -1022) { + /* make sure final n < -53 to avoid double + rounding in the subnormal range */ + y *= 0x1p-1022 * 0x1p53; + n += 1022 - 53; + if (n < -1022) { + y *= 0x1p-1022 * 0x1p53; + n += 1022 - 53; + if (n < -1022) + n = -1022; + } + } + u.i = (uint64_t)(0x3ff+n)<<52; + x = y * u.f; + return x; +} diff --git a/lib/libc/src/musl-math/scalbnf.c b/lib/libc/src/musl-math/scalbnf.c new file mode 100644 index 0000000..a5ad208 --- /dev/null +++ b/lib/libc/src/musl-math/scalbnf.c @@ -0,0 +1,31 @@ +#include <math.h> +#include <stdint.h> + +float scalbnf(float x, int n) +{ + union {float f; uint32_t i;} u; + float_t y = x; + + if (n > 127) { + y *= 0x1p127f; + n -= 127; + if (n > 127) { + y *= 0x1p127f; + n -= 127; + if (n > 127) + n = 127; + } + } else if (n < -126) { + y *= 0x1p-126f * 0x1p24f; + n += 126 - 24; + if (n < -126) { + y *= 0x1p-126f * 0x1p24f; + n += 126 - 24; + if (n < -126) + n = -126; + } + } + u.i = (uint32_t)(0x7f+n)<<23; + x = y * u.f; + return x; +} diff --git a/lib/libc/src/musl-math/scalbnl.c b/lib/libc/src/musl-math/scalbnl.c new file mode 100644 index 0000000..db44dab --- /dev/null +++ b/lib/libc/src/musl-math/scalbnl.c @@ -0,0 +1,36 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double scalbnl(long double x, int n) +{ + return scalbn(x, n); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double scalbnl(long double x, int n) +{ + union ldshape u; + + if (n > 16383) { + x *= 0x1p16383L; + n -= 16383; + if (n > 16383) { + x *= 0x1p16383L; + n -= 16383; + if (n > 16383) + n = 16383; + } + } else if (n < -16382) { + x *= 0x1p-16382L * 0x1p113L; + n += 16382 - 113; + if (n < -16382) { + x *= 0x1p-16382L * 0x1p113L; + n += 16382 - 113; + if (n < -16382) + n = -16382; + } + } + u.f = 1.0; + u.i.se = 0x3fff + n; + return x * u.f; +} +#endif diff --git a/lib/libc/src/musl-math/signgam.c b/lib/libc/src/musl-math/signgam.c new file mode 100644 index 0000000..3a5b9f7 --- /dev/null +++ b/lib/libc/src/musl-math/signgam.c @@ -0,0 +1,5 @@ +#include <math.h> +#include "weak_alias.h" +//#include "libc.h" + +int signgam = 0; diff --git a/lib/libc/src/musl-math/significand.c b/lib/libc/src/musl-math/significand.c new file mode 100644 index 0000000..40d9aa9 --- /dev/null +++ b/lib/libc/src/musl-math/significand.c @@ -0,0 +1,7 @@ +#define _GNU_SOURCE +#include <math.h> + +double significand(double x) +{ + return scalbn(x, -ilogb(x)); +} diff --git a/lib/libc/src/musl-math/significandf.c b/lib/libc/src/musl-math/significandf.c new file mode 100644 index 0000000..8a697e1 --- /dev/null +++ b/lib/libc/src/musl-math/significandf.c @@ -0,0 +1,7 @@ +#define _GNU_SOURCE +#include <math.h> + +float significandf(float x) +{ + return scalbnf(x, -ilogbf(x)); +} diff --git a/lib/libc/src/musl-math/sin.c b/lib/libc/src/musl-math/sin.c new file mode 100644 index 0000000..055e215 --- /dev/null +++ b/lib/libc/src/musl-math/sin.c @@ -0,0 +1,78 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_sin.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* sin(x) + * Return sine function of x. + * + * kernel function: + * __sin ... sine function on [-pi/4,pi/4] + * __cos ... cose function on [-pi/4,pi/4] + * __rem_pio2 ... argument reduction routine + * + * Method. + * Let S,C and T denote the sin, cos and tan respectively on + * [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 + * in [-pi/4 , +pi/4], and let n = k mod 4. + * We have + * + * n sin(x) cos(x) tan(x) + * ---------------------------------------------------------- + * 0 S C T + * 1 C -S -1/T + * 2 -S -C T + * 3 -C S -1/T + * ---------------------------------------------------------- + * + * Special cases: + * Let trig be any of sin, cos, or tan. + * trig(+-INF) is NaN, with signals; + * trig(NaN) is that NaN; + * + * Accuracy: + * TRIG(x) returns trig(x) nearly rounded + */ + +#include "libm.h" + +double sin(double x) +{ + double y[2]; + uint32_t ix; + unsigned n; + + /* High word of x. */ + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* |x| ~< pi/4 */ + if (ix <= 0x3fe921fb) { + if (ix < 0x3e500000) { /* |x| < 2**-26 */ + /* raise inexact if x != 0 and underflow if subnormal*/ + FORCE_EVAL(ix < 0x00100000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __sin(x, 0.0, 0); + } + + /* sin(Inf or NaN) is NaN */ + if (ix >= 0x7ff00000) + return x - x; + + /* argument reduction needed */ + n = __rem_pio2(x, y); + switch (n&3) { + case 0: return __sin(y[0], y[1], 1); + case 1: return __cos(y[0], y[1]); + case 2: return -__sin(y[0], y[1], 1); + default: + return -__cos(y[0], y[1]); + } +} diff --git a/lib/libc/src/musl-math/sincos.c b/lib/libc/src/musl-math/sincos.c new file mode 100644 index 0000000..35b2d92 --- /dev/null +++ b/lib/libc/src/musl-math/sincos.c @@ -0,0 +1,69 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_sin.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include "libm.h" + +void sincos(double x, double *sin, double *cos) +{ + double y[2], s, c; + uint32_t ix; + unsigned n; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* |x| ~< pi/4 */ + if (ix <= 0x3fe921fb) { + /* if |x| < 2**-27 * sqrt(2) */ + if (ix < 0x3e46a09e) { + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00100000 ? x/0x1p120f : x+0x1p120f); + *sin = x; + *cos = 1.0; + return; + } + *sin = __sin(x, 0.0, 0); + *cos = __cos(x, 0.0); + return; + } + + /* sincos(Inf or NaN) is NaN */ + if (ix >= 0x7ff00000) { + *sin = *cos = x - x; + return; + } + + /* argument reduction needed */ + n = __rem_pio2(x, y); + s = __sin(y[0], y[1], 1); + c = __cos(y[0], y[1]); + switch (n&3) { + case 0: + *sin = s; + *cos = c; + break; + case 1: + *sin = c; + *cos = -s; + break; + case 2: + *sin = -s; + *cos = -c; + break; + case 3: + default: + *sin = -c; + *cos = s; + break; + } +} diff --git a/lib/libc/src/musl-math/sincosf.c b/lib/libc/src/musl-math/sincosf.c new file mode 100644 index 0000000..f8ca723 --- /dev/null +++ b/lib/libc/src/musl-math/sincosf.c @@ -0,0 +1,117 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_sinf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include "libm.h" + +/* Small multiples of pi/2 rounded to double precision. */ +static const double +s1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ +s2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ +s3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ +s4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + +void sincosf(float x, float *sin, float *cos) +{ + double y; + float_t s, c; + uint32_t ix; + unsigned n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + /* |x| ~<= pi/4 */ + if (ix <= 0x3f490fda) { + /* |x| < 2**-12 */ + if (ix < 0x39800000) { + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00100000 ? x/0x1p120f : x+0x1p120f); + *sin = x; + *cos = 1.0f; + return; + } + *sin = __sindf(x); + *cos = __cosdf(x); + return; + } + + /* |x| ~<= 5*pi/4 */ + if (ix <= 0x407b53d1) { + if (ix <= 0x4016cbe3) { /* |x| ~<= 3pi/4 */ + if (sign) { + *sin = -__cosdf(x + s1pio2); + *cos = __sindf(x + s1pio2); + } else { + *sin = __cosdf(s1pio2 - x); + *cos = __sindf(s1pio2 - x); + } + return; + } + /* -sin(x+c) is not correct if x+c could be 0: -0 vs +0 */ + *sin = -__sindf(sign ? x + s2pio2 : x - s2pio2); + *cos = -__cosdf(sign ? x + s2pio2 : x - s2pio2); + return; + } + + /* |x| ~<= 9*pi/4 */ + if (ix <= 0x40e231d5) { + if (ix <= 0x40afeddf) { /* |x| ~<= 7*pi/4 */ + if (sign) { + *sin = __cosdf(x + s3pio2); + *cos = -__sindf(x + s3pio2); + } else { + *sin = -__cosdf(x - s3pio2); + *cos = __sindf(x - s3pio2); + } + return; + } + *sin = __sindf(sign ? x + s4pio2 : x - s4pio2); + *cos = __cosdf(sign ? x + s4pio2 : x - s4pio2); + return; + } + + /* sin(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) { + *sin = *cos = x - x; + return; + } + + /* general argument reduction needed */ + n = __rem_pio2f(x, &y); + s = __sindf(y); + c = __cosdf(y); + switch (n&3) { + case 0: + *sin = s; + *cos = c; + break; + case 1: + *sin = c; + *cos = -s; + break; + case 2: + *sin = -s; + *cos = -c; + break; + case 3: + default: + *sin = -c; + *cos = s; + break; + } +} diff --git a/lib/libc/src/musl-math/sincosl.c b/lib/libc/src/musl-math/sincosl.c new file mode 100644 index 0000000..d3ac1c4 --- /dev/null +++ b/lib/libc/src/musl-math/sincosl.c @@ -0,0 +1,60 @@ +#define _GNU_SOURCE +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +void sincosl(long double x, long double *sin, long double *cos) +{ + double sind, cosd; + sincos(x, &sind, &cosd); + *sin = sind; + *cos = cosd; +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +void sincosl(long double x, long double *sin, long double *cos) +{ + union ldshape u = {x}; + unsigned n; + long double y[2], s, c; + + u.i.se &= 0x7fff; + if (u.i.se == 0x7fff) { + *sin = *cos = x - x; + return; + } + if (u.f < M_PI_4) { + if (u.i.se < 0x3fff - LDBL_MANT_DIG) { + /* raise underflow if subnormal */ + if (u.i.se == 0) FORCE_EVAL(x*0x1p-120f); + *sin = x; + /* raise inexact if x!=0 */ + *cos = 1.0 + x; + return; + } + *sin = __sinl(x, 0, 0); + *cos = __cosl(x, 0); + return; + } + n = __rem_pio2l(x, y); + s = __sinl(y[0], y[1], 1); + c = __cosl(y[0], y[1]); + switch (n & 3) { + case 0: + *sin = s; + *cos = c; + break; + case 1: + *sin = c; + *cos = -s; + break; + case 2: + *sin = -s; + *cos = -c; + break; + case 3: + default: + *sin = -c; + *cos = s; + break; + } +} +#endif diff --git a/lib/libc/src/musl-math/sinf.c b/lib/libc/src/musl-math/sinf.c new file mode 100644 index 0000000..64e39f5 --- /dev/null +++ b/lib/libc/src/musl-math/sinf.c @@ -0,0 +1,76 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_sinf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* Small multiples of pi/2 rounded to double precision. */ +static const double +s1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ +s2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ +s3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ +s4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + +float sinf(float x) +{ + double y; + uint32_t ix; + int n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00800000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __sindf(x); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix <= 0x4016cbe3) { /* |x| ~<= 3pi/4 */ + if (sign) + return -__cosdf(x + s1pio2); + else + return __cosdf(x - s1pio2); + } + return __sindf(sign ? -(x + s2pio2) : -(x - s2pio2)); + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix <= 0x40afeddf) { /* |x| ~<= 7*pi/4 */ + if (sign) + return __cosdf(x + s3pio2); + else + return -__cosdf(x - s3pio2); + } + return __sindf(sign ? x + s4pio2 : x - s4pio2); + } + + /* sin(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x - x; + + /* general argument reduction needed */ + n = __rem_pio2f(x, &y); + switch (n&3) { + case 0: return __sindf(y); + case 1: return __cosdf(y); + case 2: return __sindf(-y); + default: + return -__cosdf(y); + } +} diff --git a/lib/libc/src/musl-math/sinh.c b/lib/libc/src/musl-math/sinh.c new file mode 100644 index 0000000..00022c4 --- /dev/null +++ b/lib/libc/src/musl-math/sinh.c @@ -0,0 +1,39 @@ +#include "libm.h" + +/* sinh(x) = (exp(x) - 1/exp(x))/2 + * = (exp(x)-1 + (exp(x)-1)/exp(x))/2 + * = x + x^3/6 + o(x^5) + */ +double sinh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + uint32_t w; + double t, h, absx; + + h = 0.5; + if (u.i >> 63) + h = -h; + /* |x| */ + u.i &= (uint64_t)-1/2; + absx = u.f; + w = u.i >> 32; + + /* |x| < log(DBL_MAX) */ + if (w < 0x40862e42) { + t = expm1(absx); + if (w < 0x3ff00000) { + if (w < 0x3ff00000 - (26<<20)) + /* note: inexact and underflow are raised by expm1 */ + /* note: this branch avoids spurious underflow */ + return x; + return h*(2*t - t*t/(t+1)); + } + /* note: |x|>log(0x1p26)+eps could be just h*exp(x) */ + return h*(t + t/(t+1)); + } + + /* |x| > log(DBL_MAX) or nan */ + /* note: the result is stored to handle overflow */ + t = 2*h*__expo2(absx); + return t; +} diff --git a/lib/libc/src/musl-math/sinhf.c b/lib/libc/src/musl-math/sinhf.c new file mode 100644 index 0000000..6ad19ea --- /dev/null +++ b/lib/libc/src/musl-math/sinhf.c @@ -0,0 +1,31 @@ +#include "libm.h" + +float sinhf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + uint32_t w; + float t, h, absx; + + h = 0.5; + if (u.i >> 31) + h = -h; + /* |x| */ + u.i &= 0x7fffffff; + absx = u.f; + w = u.i; + + /* |x| < log(FLT_MAX) */ + if (w < 0x42b17217) { + t = expm1f(absx); + if (w < 0x3f800000) { + if (w < 0x3f800000 - (12<<23)) + return x; + return h*(2*t - t*t/(t+1)); + } + return h*(t + t/(t+1)); + } + + /* |x| > logf(FLT_MAX) or nan */ + t = 2*h*__expo2f(absx); + return t; +} diff --git a/lib/libc/src/musl-math/sinhl.c b/lib/libc/src/musl-math/sinhl.c new file mode 100644 index 0000000..b305d4d --- /dev/null +++ b/lib/libc/src/musl-math/sinhl.c @@ -0,0 +1,43 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double sinhl(long double x) +{ + return sinh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +long double sinhl(long double x) +{ + union ldshape u = {x}; + unsigned ex = u.i.se & 0x7fff; + long double h, t, absx; + + h = 0.5; + if (u.i.se & 0x8000) + h = -h; + /* |x| */ + u.i.se = ex; + absx = u.f; + + /* |x| < log(LDBL_MAX) */ + if (ex < 0x3fff+13 || (ex == 0x3fff+13 && u.i.m>>32 < 0xb17217f7)) { + t = expm1l(absx); + if (ex < 0x3fff) { + if (ex < 0x3fff-32) + return x; + return h*(2*t - t*t/(1+t)); + } + return h*(t + t/(t+1)); + } + + /* |x| > log(LDBL_MAX) or nan */ + t = expl(0.5*absx); + return h*t*t; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double sinhl(long double x) +{ + return sinh(x); +} +#endif diff --git a/lib/libc/src/musl-math/sinl.c b/lib/libc/src/musl-math/sinl.c new file mode 100644 index 0000000..9c0b16e --- /dev/null +++ b/lib/libc/src/musl-math/sinl.c @@ -0,0 +1,41 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double sinl(long double x) +{ + return sin(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double sinl(long double x) +{ + union ldshape u = {x}; + unsigned n; + long double y[2], hi, lo; + + u.i.se &= 0x7fff; + if (u.i.se == 0x7fff) + return x - x; + if (u.f < M_PI_4) { + if (u.i.se < 0x3fff - LDBL_MANT_DIG/2) { + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(u.i.se == 0 ? x*0x1p-120f : x+0x1p120f); + return x; + } + return __sinl(x, 0.0, 0); + } + n = __rem_pio2l(x, y); + hi = y[0]; + lo = y[1]; + switch (n & 3) { + case 0: + return __sinl(hi, lo, 1); + case 1: + return __cosl(hi, lo); + case 2: + return -__sinl(hi, lo, 1); + case 3: + default: + return -__cosl(hi, lo); + } +} +#endif diff --git a/lib/libc/src/musl-math/sqrt.c b/lib/libc/src/musl-math/sqrt.c new file mode 100644 index 0000000..b277567 --- /dev/null +++ b/lib/libc/src/musl-math/sqrt.c @@ -0,0 +1,185 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_sqrt.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* sqrt(x) + * Return correctly rounded sqrt. + * ------------------------------------------ + * | Use the hardware sqrt if you have one | + * ------------------------------------------ + * Method: + * Bit by bit method using integer arithmetic. (Slow, but portable) + * 1. Normalization + * Scale x to y in [1,4) with even powers of 2: + * find an integer k such that 1 <= (y=x*2^(2k)) < 4, then + * sqrt(x) = 2^k * sqrt(y) + * 2. Bit by bit computation + * Let q = sqrt(y) truncated to i bit after binary point (q = 1), + * i 0 + * i+1 2 + * s = 2*q , and y = 2 * ( y - q ). (1) + * i i i i + * + * To compute q from q , one checks whether + * i+1 i + * + * -(i+1) 2 + * (q + 2 ) <= y. (2) + * i + * -(i+1) + * If (2) is false, then q = q ; otherwise q = q + 2 . + * i+1 i i+1 i + * + * With some algebric manipulation, it is not difficult to see + * that (2) is equivalent to + * -(i+1) + * s + 2 <= y (3) + * i i + * + * The advantage of (3) is that s and y can be computed by + * i i + * the following recurrence formula: + * if (3) is false + * + * s = s , y = y ; (4) + * i+1 i i+1 i + * + * otherwise, + * -i -(i+1) + * s = s + 2 , y = y - s - 2 (5) + * i+1 i i+1 i i + * + * One may easily use induction to prove (4) and (5). + * Note. Since the left hand side of (3) contain only i+2 bits, + * it does not necessary to do a full (53-bit) comparison + * in (3). + * 3. Final rounding + * After generating the 53 bits result, we compute one more bit. + * Together with the remainder, we can decide whether the + * result is exact, bigger than 1/2ulp, or less than 1/2ulp + * (it will never equal to 1/2ulp). + * The rounding mode can be detected by checking whether + * huge + tiny is equal to huge, and whether huge - tiny is + * equal to huge for some floating point number "huge" and "tiny". + * + * Special cases: + * sqrt(+-0) = +-0 ... exact + * sqrt(inf) = inf + * sqrt(-ve) = NaN ... with invalid signal + * sqrt(NaN) = NaN ... with invalid signal for signaling NaN + */ + +#include "libm.h" + +static const double tiny = 1.0e-300; + +double sqrt(double x) +{ + double z; + int32_t sign = (int)0x80000000; + int32_t ix0,s0,q,m,t,i; + uint32_t r,t1,s1,ix1,q1; + + EXTRACT_WORDS(ix0, ix1, x); + + /* take care of Inf and NaN */ + if ((ix0&0x7ff00000) == 0x7ff00000) { + return x*x + x; /* sqrt(NaN)=NaN, sqrt(+inf)=+inf, sqrt(-inf)=sNaN */ + } + /* take care of zero */ + if (ix0 <= 0) { + if (((ix0&~sign)|ix1) == 0) + return x; /* sqrt(+-0) = +-0 */ + if (ix0 < 0) + return (x-x)/(x-x); /* sqrt(-ve) = sNaN */ + } + /* normalize x */ + m = ix0>>20; + if (m == 0) { /* subnormal x */ + while (ix0 == 0) { + m -= 21; + ix0 |= (ix1>>11); + ix1 <<= 21; + } + for (i=0; (ix0&0x00100000) == 0; i++) + ix0<<=1; + m -= i - 1; + ix0 |= ix1>>(32-i); + ix1 <<= i; + } + m -= 1023; /* unbias exponent */ + ix0 = (ix0&0x000fffff)|0x00100000; + if (m & 1) { /* odd m, double x to make it even */ + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + } + m >>= 1; /* m = [m/2] */ + + /* generate sqrt(x) bit by bit */ + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + q = q1 = s0 = s1 = 0; /* [q,q1] = sqrt(x) */ + r = 0x00200000; /* r = moving bit from right to left */ + + while (r != 0) { + t = s0 + r; + if (t <= ix0) { + s0 = t + r; + ix0 -= t; + q += r; + } + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + r >>= 1; + } + + r = sign; + while (r != 0) { + t1 = s1 + r; + t = s0; + if (t < ix0 || (t == ix0 && t1 <= ix1)) { + s1 = t1 + r; + if ((t1&sign) == sign && (s1&sign) == 0) + s0++; + ix0 -= t; + if (ix1 < t1) + ix0--; + ix1 -= t1; + q1 += r; + } + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + r >>= 1; + } + + /* use floating add to find out rounding direction */ + if ((ix0|ix1) != 0) { + z = 1.0 - tiny; /* raise inexact flag */ + if (z >= 1.0) { + z = 1.0 + tiny; + if (q1 == (uint32_t)0xffffffff) { + q1 = 0; + q++; + } else if (z > 1.0) { + if (q1 == (uint32_t)0xfffffffe) + q++; + q1 += 2; + } else + q1 += q1 & 1; + } + } + ix0 = (q>>1) + 0x3fe00000; + ix1 = q1>>1; + if (q&1) + ix1 |= sign; + ix0 += m << 20; + INSERT_WORDS(z, ix0, ix1); + return z; +} diff --git a/lib/libc/src/musl-math/sqrtf.c b/lib/libc/src/musl-math/sqrtf.c new file mode 100644 index 0000000..28cb4ad --- /dev/null +++ b/lib/libc/src/musl-math/sqrtf.c @@ -0,0 +1,84 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_sqrtf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float tiny = 1.0e-30; + +float sqrtf(float x) +{ + float z; + int32_t sign = (int)0x80000000; + int32_t ix,s,q,m,t,i; + uint32_t r; + + GET_FLOAT_WORD(ix, x); + + /* take care of Inf and NaN */ + if ((ix&0x7f800000) == 0x7f800000) + return x*x + x; /* sqrt(NaN)=NaN, sqrt(+inf)=+inf, sqrt(-inf)=sNaN */ + + /* take care of zero */ + if (ix <= 0) { + if ((ix&~sign) == 0) + return x; /* sqrt(+-0) = +-0 */ + if (ix < 0) + return (x-x)/(x-x); /* sqrt(-ve) = sNaN */ + } + /* normalize x */ + m = ix>>23; + if (m == 0) { /* subnormal x */ + for (i = 0; (ix&0x00800000) == 0; i++) + ix<<=1; + m -= i - 1; + } + m -= 127; /* unbias exponent */ + ix = (ix&0x007fffff)|0x00800000; + if (m&1) /* odd m, double x to make it even */ + ix += ix; + m >>= 1; /* m = [m/2] */ + + /* generate sqrt(x) bit by bit */ + ix += ix; + q = s = 0; /* q = sqrt(x) */ + r = 0x01000000; /* r = moving bit from right to left */ + + while (r != 0) { + t = s + r; + if (t <= ix) { + s = t+r; + ix -= t; + q += r; + } + ix += ix; + r >>= 1; + } + + /* use floating add to find out rounding direction */ + if (ix != 0) { + z = 1.0f - tiny; /* raise inexact flag */ + if (z >= 1.0f) { + z = 1.0f + tiny; + if (z > 1.0f) + q += 2; + else + q += q & 1; + } + } + ix = (q>>1) + 0x3f000000; + ix += m << 23; + SET_FLOAT_WORD(z, ix); + return z; +} diff --git a/lib/libc/src/musl-math/sqrtl.c b/lib/libc/src/musl-math/sqrtl.c new file mode 100644 index 0000000..83a8f80 --- /dev/null +++ b/lib/libc/src/musl-math/sqrtl.c @@ -0,0 +1,7 @@ +#include <math.h> + +long double sqrtl(long double x) +{ + /* FIXME: implement in C, this is for LDBL_MANT_DIG == 64 only */ + return sqrt(x); +} diff --git a/lib/libc/src/musl-math/tan.c b/lib/libc/src/musl-math/tan.c new file mode 100644 index 0000000..9c724a4 --- /dev/null +++ b/lib/libc/src/musl-math/tan.c @@ -0,0 +1,70 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_tan.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* tan(x) + * Return tangent function of x. + * + * kernel function: + * __tan ... tangent function on [-pi/4,pi/4] + * __rem_pio2 ... argument reduction routine + * + * Method. + * Let S,C and T denote the sin, cos and tan respectively on + * [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 + * in [-pi/4 , +pi/4], and let n = k mod 4. + * We have + * + * n sin(x) cos(x) tan(x) + * ---------------------------------------------------------- + * 0 S C T + * 1 C -S -1/T + * 2 -S -C T + * 3 -C S -1/T + * ---------------------------------------------------------- + * + * Special cases: + * Let trig be any of sin, cos, or tan. + * trig(+-INF) is NaN, with signals; + * trig(NaN) is that NaN; + * + * Accuracy: + * TRIG(x) returns trig(x) nearly rounded + */ + +#include "libm.h" + +double tan(double x) +{ + double y[2]; + uint32_t ix; + unsigned n; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* |x| ~< pi/4 */ + if (ix <= 0x3fe921fb) { + if (ix < 0x3e400000) { /* |x| < 2**-27 */ + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00100000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __tan(x, 0.0, 0); + } + + /* tan(Inf or NaN) is NaN */ + if (ix >= 0x7ff00000) + return x - x; + + /* argument reduction */ + n = __rem_pio2(x, y); + return __tan(y[0], y[1], n&1); +} diff --git a/lib/libc/src/musl-math/tanf.c b/lib/libc/src/musl-math/tanf.c new file mode 100644 index 0000000..aba1977 --- /dev/null +++ b/lib/libc/src/musl-math/tanf.c @@ -0,0 +1,64 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_tanf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* Small multiples of pi/2 rounded to double precision. */ +static const double +t1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ +t2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ +t3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ +t4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + +float tanf(float x) +{ + double y; + uint32_t ix; + unsigned n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00800000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __tandf(x, 0); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix <= 0x4016cbe3) /* |x| ~<= 3pi/4 */ + return __tandf((sign ? x+t1pio2 : x-t1pio2), 1); + else + return __tandf((sign ? x+t2pio2 : x-t2pio2), 0); + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix <= 0x40afeddf) /* |x| ~<= 7*pi/4 */ + return __tandf((sign ? x+t3pio2 : x-t3pio2), 1); + else + return __tandf((sign ? x+t4pio2 : x-t4pio2), 0); + } + + /* tan(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x - x; + + /* argument reduction */ + n = __rem_pio2f(x, &y); + return __tandf(y, n&1); +} diff --git a/lib/libc/src/musl-math/tanh.c b/lib/libc/src/musl-math/tanh.c new file mode 100644 index 0000000..20d6dbc --- /dev/null +++ b/lib/libc/src/musl-math/tanh.c @@ -0,0 +1,45 @@ +#include "libm.h" + +/* tanh(x) = (exp(x) - exp(-x))/(exp(x) + exp(-x)) + * = (exp(2*x) - 1)/(exp(2*x) - 1 + 2) + * = (1 - exp(-2*x))/(exp(-2*x) - 1 + 2) + */ +double tanh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + uint32_t w; + int sign; + double_t t; + + /* x = |x| */ + sign = u.i >> 63; + u.i &= (uint64_t)-1/2; + x = u.f; + w = u.i >> 32; + + if (w > 0x3fe193ea) { + /* |x| > log(3)/2 ~= 0.5493 or nan */ + if (w > 0x40340000) { + /* |x| > 20 or nan */ + /* note: this branch avoids raising overflow */ + t = 1 - 0/x; + } else { + t = expm1(2*x); + t = 1 - 2/(t+2); + } + } else if (w > 0x3fd058ae) { + /* |x| > log(5/3)/2 ~= 0.2554 */ + t = expm1(2*x); + t = t/(t+2); + } else if (w >= 0x00100000) { + /* |x| >= 0x1p-1022, up to 2ulp error in [0.1,0.2554] */ + t = expm1(-2*x); + t = -t/(t+2); + } else { + /* |x| is subnormal */ + /* note: the branch above would not raise underflow in [0x1p-1023,0x1p-1022) */ + FORCE_EVAL((float)x); + t = x; + } + return sign ? -t : t; +} diff --git a/lib/libc/src/musl-math/tanhf.c b/lib/libc/src/musl-math/tanhf.c new file mode 100644 index 0000000..10636fb --- /dev/null +++ b/lib/libc/src/musl-math/tanhf.c @@ -0,0 +1,39 @@ +#include "libm.h" + +float tanhf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + uint32_t w; + int sign; + float t; + + /* x = |x| */ + sign = u.i >> 31; + u.i &= 0x7fffffff; + x = u.f; + w = u.i; + + if (w > 0x3f0c9f54) { + /* |x| > log(3)/2 ~= 0.5493 or nan */ + if (w > 0x41200000) { + /* |x| > 10 */ + t = 1 + 0/x; + } else { + t = expm1f(2*x); + t = 1 - 2/(t+2); + } + } else if (w > 0x3e82c578) { + /* |x| > log(5/3)/2 ~= 0.2554 */ + t = expm1f(2*x); + t = t/(t+2); + } else if (w >= 0x00800000) { + /* |x| >= 0x1p-126 */ + t = expm1f(-2*x); + t = -t/(t+2); + } else { + /* |x| is subnormal */ + FORCE_EVAL(x*x); + t = x; + } + return sign ? -t : t; +} diff --git a/lib/libc/src/musl-math/tanhl.c b/lib/libc/src/musl-math/tanhl.c new file mode 100644 index 0000000..4e1aa9f --- /dev/null +++ b/lib/libc/src/musl-math/tanhl.c @@ -0,0 +1,48 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double tanhl(long double x) +{ + return tanh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +long double tanhl(long double x) +{ + union ldshape u = {x}; + unsigned ex = u.i.se & 0x7fff; + unsigned sign = u.i.se & 0x8000; + uint32_t w; + long double t; + + /* x = |x| */ + u.i.se = ex; + x = u.f; + w = u.i.m >> 32; + + if (ex > 0x3ffe || (ex == 0x3ffe && w > 0x8c9f53d5)) { + /* |x| > log(3)/2 ~= 0.5493 or nan */ + if (ex >= 0x3fff+5) { + /* |x| >= 32 */ + t = 1 + 0/(x + 0x1p-120f); + } else { + t = expm1l(2*x); + t = 1 - 2/(t+2); + } + } else if (ex > 0x3ffd || (ex == 0x3ffd && w > 0x82c577d4)) { + /* |x| > log(5/3)/2 ~= 0.2554 */ + t = expm1l(2*x); + t = t/(t+2); + } else { + /* |x| is small */ + t = expm1l(-2*x); + t = -t/(t+2); + } + return sign ? -t : t; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double tanhl(long double x) +{ + return tanh(x); +} +#endif diff --git a/lib/libc/src/musl-math/tanl.c b/lib/libc/src/musl-math/tanl.c new file mode 100644 index 0000000..6af0671 --- /dev/null +++ b/lib/libc/src/musl-math/tanl.c @@ -0,0 +1,29 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double tanl(long double x) +{ + return tan(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double tanl(long double x) +{ + union ldshape u = {x}; + long double y[2]; + unsigned n; + + u.i.se &= 0x7fff; + if (u.i.se == 0x7fff) + return x - x; + if (u.f < M_PI_4) { + if (u.i.se < 0x3fff - LDBL_MANT_DIG/2) { + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(u.i.se == 0 ? x*0x1p-120f : x+0x1p120f); + return x; + } + return __tanl(x, 0, 0); + } + n = __rem_pio2l(x, y); + return __tanl(y[0], y[1], n&1); +} +#endif diff --git a/lib/libc/src/musl-math/tgamma.c b/lib/libc/src/musl-math/tgamma.c new file mode 100644 index 0000000..28f6e0f --- /dev/null +++ b/lib/libc/src/musl-math/tgamma.c @@ -0,0 +1,222 @@ +/* +"A Precision Approximation of the Gamma Function" - Cornelius Lanczos (1964) +"Lanczos Implementation of the Gamma Function" - Paul Godfrey (2001) +"An Analysis of the Lanczos Gamma Approximation" - Glendon Ralph Pugh (2004) + +approximation method: + + (x - 0.5) S(x) +Gamma(x) = (x + g - 0.5) * ---------------- + exp(x + g - 0.5) + +with + a1 a2 a3 aN +S(x) ~= [ a0 + ----- + ----- + ----- + ... + ----- ] + x + 1 x + 2 x + 3 x + N + +with a0, a1, a2, a3,.. aN constants which depend on g. + +for x < 0 the following reflection formula is used: + +Gamma(x)*Gamma(-x) = -pi/(x sin(pi x)) + +most ideas and constants are from boost and python +*/ +#include "libm.h" + +static const double pi = 3.141592653589793238462643383279502884; + +/* sin(pi x) with x > 0x1p-100, if sin(pi*x)==0 the sign is arbitrary */ +static double sinpi(double x) +{ + int n; + + /* argument reduction: x = |x| mod 2 */ + /* spurious inexact when x is odd int */ + x = x * 0.5; + x = 2 * (x - floor(x)); + + /* reduce x into [-.25,.25] */ + n = 4 * x; + n = (n+1)/2; + x -= n * 0.5; + + x *= pi; + switch (n) { + default: /* case 4 */ + case 0: + return __sin(x, 0, 0); + case 1: + return __cos(x, 0); + case 2: + return __sin(-x, 0, 0); + case 3: + return -__cos(x, 0); + } +} + +#define N 12 +//static const double g = 6.024680040776729583740234375; +static const double gmhalf = 5.524680040776729583740234375; +static const double Snum[N+1] = { + 23531376880.410759688572007674451636754734846804940, + 42919803642.649098768957899047001988850926355848959, + 35711959237.355668049440185451547166705960488635843, + 17921034426.037209699919755754458931112671403265390, + 6039542586.3520280050642916443072979210699388420708, + 1439720407.3117216736632230727949123939715485786772, + 248874557.86205415651146038641322942321632125127801, + 31426415.585400194380614231628318205362874684987640, + 2876370.6289353724412254090516208496135991145378768, + 186056.26539522349504029498971604569928220784236328, + 8071.6720023658162106380029022722506138218516325024, + 210.82427775157934587250973392071336271166969580291, + 2.5066282746310002701649081771338373386264310793408, +}; +static const double Sden[N+1] = { + 0, 39916800, 120543840, 150917976, 105258076, 45995730, 13339535, + 2637558, 357423, 32670, 1925, 66, 1, +}; +/* n! for small integer n */ +static const double fact[] = { + 1, 1, 2, 6, 24, 120, 720, 5040.0, 40320.0, 362880.0, 3628800.0, 39916800.0, + 479001600.0, 6227020800.0, 87178291200.0, 1307674368000.0, 20922789888000.0, + 355687428096000.0, 6402373705728000.0, 121645100408832000.0, + 2432902008176640000.0, 51090942171709440000.0, 1124000727777607680000.0, +}; + +/* S(x) rational function for positive x */ +static double S(double x) +{ + double_t num = 0, den = 0; + int i; + + /* to avoid overflow handle large x differently */ + if (x < 8) + for (i = N; i >= 0; i--) { + num = num * x + Snum[i]; + den = den * x + Sden[i]; + } + else + for (i = 0; i <= N; i++) { + num = num / x + Snum[i]; + den = den / x + Sden[i]; + } + return num/den; +} + +double tgamma(double x) +{ + union {double f; uint64_t i;} u = {x}; + double absx, y; + double_t dy, z, r; + uint32_t ix = u.i>>32 & 0x7fffffff; + int sign = u.i>>63; + + /* special cases */ + if (ix >= 0x7ff00000) + /* tgamma(nan)=nan, tgamma(inf)=inf, tgamma(-inf)=nan with invalid */ + return x + INFINITY; + if (ix < (0x3ff-54)<<20) + /* |x| < 2^-54: tgamma(x) ~ 1/x, +-0 raises div-by-zero */ + return 1/x; + + /* integer arguments */ + /* raise inexact when non-integer */ + if (x == floor(x)) { + if (sign) + return 0/0.0; + if (x <= sizeof fact/sizeof *fact) + return fact[(int)x - 1]; + } + + /* x >= 172: tgamma(x)=inf with overflow */ + /* x =< -184: tgamma(x)=+-0 with underflow */ + if (ix >= 0x40670000) { /* |x| >= 184 */ + if (sign) { + FORCE_EVAL((float)(0x1p-126/x)); + if (floor(x) * 0.5 == floor(x * 0.5)) + return 0; + return -0.0; + } + x *= 0x1p1023; + return x; + } + + absx = sign ? -x : x; + + /* handle the error of x + g - 0.5 */ + y = absx + gmhalf; + if (absx > gmhalf) { + dy = y - absx; + dy -= gmhalf; + } else { + dy = y - gmhalf; + dy -= absx; + } + + z = absx - 0.5; + r = S(absx) * exp(-y); + if (x < 0) { + /* reflection formula for negative x */ + /* sinpi(absx) is not 0, integers are already handled */ + r = -pi / (sinpi(absx) * absx * r); + dy = -dy; + z = -z; + } + r += dy * (gmhalf+0.5) * r / y; + z = pow(y, 0.5*z); + y = r * z * z; + return y; +} + +#if 0 +double __lgamma_r(double x, int *sign) +{ + double r, absx; + + *sign = 1; + + /* special cases */ + if (!isfinite(x)) + /* lgamma(nan)=nan, lgamma(+-inf)=inf */ + return x*x; + + /* integer arguments */ + if (x == floor(x) && x <= 2) { + /* n <= 0: lgamma(n)=inf with divbyzero */ + /* n == 1,2: lgamma(n)=0 */ + if (x <= 0) + return 1/0.0; + return 0; + } + + absx = fabs(x); + + /* lgamma(x) ~ -log(|x|) for tiny |x| */ + if (absx < 0x1p-54) { + *sign = 1 - 2*!!signbit(x); + return -log(absx); + } + + /* use tgamma for smaller |x| */ + if (absx < 128) { + x = tgamma(x); + *sign = 1 - 2*!!signbit(x); + return log(fabs(x)); + } + + /* second term (log(S)-g) could be more precise here.. */ + /* or with stirling: (|x|-0.5)*(log(|x|)-1) + poly(1/|x|) */ + r = (absx-0.5)*(log(absx+gmhalf)-1) + (log(S(absx)) - (gmhalf+0.5)); + if (x < 0) { + /* reflection formula for negative x */ + x = sinpi(absx); + *sign = 2*!!signbit(x) - 1; + r = log(pi/(fabs(x)*absx)) - r; + } + return r; +} + +weak_alias(__lgamma_r, lgamma_r); +#endif diff --git a/lib/libc/src/musl-math/tgammaf.c b/lib/libc/src/musl-math/tgammaf.c new file mode 100644 index 0000000..b4ca51c --- /dev/null +++ b/lib/libc/src/musl-math/tgammaf.c @@ -0,0 +1,6 @@ +#include <math.h> + +float tgammaf(float x) +{ + return tgamma(x); +} diff --git a/lib/libc/src/musl-math/tgammal.c b/lib/libc/src/musl-math/tgammal.c new file mode 100644 index 0000000..5336c5b --- /dev/null +++ b/lib/libc/src/musl-math/tgammal.c @@ -0,0 +1,281 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_tgammal.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Gamma function + * + * + * SYNOPSIS: + * + * long double x, y, tgammal(); + * + * y = tgammal( x ); + * + * + * DESCRIPTION: + * + * Returns gamma function of the argument. The result is + * correctly signed. + * + * Arguments |x| <= 13 are reduced by recurrence and the function + * approximated by a rational function of degree 7/8 in the + * interval (2,3). Large arguments are handled by Stirling's + * formula. Large negative arguments are made positive using + * a reflection formula. + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE -40,+40 10000 3.6e-19 7.9e-20 + * IEEE -1755,+1755 10000 4.8e-18 6.5e-19 + * + * Accuracy for large arguments is dominated by error in powl(). + * + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double tgammal(long double x) +{ + return tgamma(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* +tgamma(x+2) = tgamma(x+2) P(x)/Q(x) +0 <= x <= 1 +Relative error +n=7, d=8 +Peak error = 1.83e-20 +Relative error spread = 8.4e-23 +*/ +static const long double P[8] = { + 4.212760487471622013093E-5L, + 4.542931960608009155600E-4L, + 4.092666828394035500949E-3L, + 2.385363243461108252554E-2L, + 1.113062816019361559013E-1L, + 3.629515436640239168939E-1L, + 8.378004301573126728826E-1L, + 1.000000000000000000009E0L, +}; +static const long double Q[9] = { +-1.397148517476170440917E-5L, + 2.346584059160635244282E-4L, +-1.237799246653152231188E-3L, +-7.955933682494738320586E-4L, + 2.773706565840072979165E-2L, +-4.633887671244534213831E-2L, +-2.243510905670329164562E-1L, + 4.150160950588455434583E-1L, + 9.999999999999999999908E-1L, +}; + +/* +static const long double P[] = { +-3.01525602666895735709e0L, +-3.25157411956062339893e1L, +-2.92929976820724030353e2L, +-1.70730828800510297666e3L, +-7.96667499622741999770e3L, +-2.59780216007146401957e4L, +-5.99650230220855581642e4L, +-7.15743521530849602425e4L +}; +static const long double Q[] = { + 1.00000000000000000000e0L, +-1.67955233807178858919e1L, + 8.85946791747759881659e1L, + 5.69440799097468430177e1L, +-1.98526250512761318471e3L, + 3.31667508019495079814e3L, + 1.60577839621734713377e4L, +-2.97045081369399940529e4L, +-7.15743521530849602412e4L +}; +*/ +#define MAXGAML 1755.455L +/*static const long double LOGPI = 1.14472988584940017414L;*/ + +/* Stirling's formula for the gamma function +tgamma(x) = sqrt(2 pi) x^(x-.5) exp(-x) (1 + 1/x P(1/x)) +z(x) = x +13 <= x <= 1024 +Relative error +n=8, d=0 +Peak error = 9.44e-21 +Relative error spread = 8.8e-4 +*/ +static const long double STIR[9] = { + 7.147391378143610789273E-4L, +-2.363848809501759061727E-5L, +-5.950237554056330156018E-4L, + 6.989332260623193171870E-5L, + 7.840334842744753003862E-4L, +-2.294719747873185405699E-4L, +-2.681327161876304418288E-3L, + 3.472222222230075327854E-3L, + 8.333333333333331800504E-2L, +}; + +#define MAXSTIR 1024.0L +static const long double SQTPI = 2.50662827463100050242E0L; + +/* 1/tgamma(x) = z P(z) + * z(x) = 1/x + * 0 < x < 0.03125 + * Peak relative error 4.2e-23 + */ +static const long double S[9] = { +-1.193945051381510095614E-3L, + 7.220599478036909672331E-3L, +-9.622023360406271645744E-3L, +-4.219773360705915470089E-2L, + 1.665386113720805206758E-1L, +-4.200263503403344054473E-2L, +-6.558780715202540684668E-1L, + 5.772156649015328608253E-1L, + 1.000000000000000000000E0L, +}; + +/* 1/tgamma(-x) = z P(z) + * z(x) = 1/x + * 0 < x < 0.03125 + * Peak relative error 5.16e-23 + * Relative error spread = 2.5e-24 + */ +static const long double SN[9] = { + 1.133374167243894382010E-3L, + 7.220837261893170325704E-3L, + 9.621911155035976733706E-3L, +-4.219773343731191721664E-2L, +-1.665386113944413519335E-1L, +-4.200263503402112910504E-2L, + 6.558780715202536547116E-1L, + 5.772156649015328608727E-1L, +-1.000000000000000000000E0L, +}; + +static const long double PIL = 3.1415926535897932384626L; + +/* Gamma function computed by Stirling's formula. + */ +static long double stirf(long double x) +{ + long double y, w, v; + + w = 1.0/x; + /* For large x, use rational coefficients from the analytical expansion. */ + if (x > 1024.0) + w = (((((6.97281375836585777429E-5L * w + + 7.84039221720066627474E-4L) * w + - 2.29472093621399176955E-4L) * w + - 2.68132716049382716049E-3L) * w + + 3.47222222222222222222E-3L) * w + + 8.33333333333333333333E-2L) * w + + 1.0; + else + w = 1.0 + w * __polevll(w, STIR, 8); + y = expl(x); + if (x > MAXSTIR) { /* Avoid overflow in pow() */ + v = powl(x, 0.5L * x - 0.25L); + y = v * (v / y); + } else { + y = powl(x, x - 0.5L) / y; + } + y = SQTPI * y * w; + return y; +} + +long double tgammal(long double x) +{ + long double p, q, z; + + if (!isfinite(x)) + return x + INFINITY; + + q = fabsl(x); + if (q > 13.0) { + if (x < 0.0) { + p = floorl(q); + z = q - p; + if (z == 0) + return 0 / z; + if (q > MAXGAML) { + z = 0; + } else { + if (z > 0.5) { + p += 1.0; + z = q - p; + } + z = q * sinl(PIL * z); + z = fabsl(z) * stirf(q); + z = PIL/z; + } + if (0.5 * p == floorl(q * 0.5)) + z = -z; + } else if (x > MAXGAML) { + z = x * 0x1p16383L; + } else { + z = stirf(x); + } + return z; + } + + z = 1.0; + while (x >= 3.0) { + x -= 1.0; + z *= x; + } + while (x < -0.03125L) { + z /= x; + x += 1.0; + } + if (x <= 0.03125L) + goto small; + while (x < 2.0) { + z /= x; + x += 1.0; + } + if (x == 2.0) + return z; + + x -= 2.0; + p = __polevll(x, P, 7); + q = __polevll(x, Q, 8); + z = z * p / q; + return z; + +small: + /* z==1 if x was originally +-0 */ + if (x == 0 && z != 1) + return x / x; + if (x < 0.0) { + x = -x; + q = z / (x * __polevll(x, SN, 8)); + } else + q = z / (x * __polevll(x, S, 8)); + return q; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double tgammal(long double x) +{ + return tgamma(x); +} +#endif diff --git a/lib/libc/src/musl-math/trunc.c b/lib/libc/src/musl-math/trunc.c new file mode 100644 index 0000000..d13711b --- /dev/null +++ b/lib/libc/src/musl-math/trunc.c @@ -0,0 +1,19 @@ +#include "libm.h" + +double trunc(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = (int)(u.i >> 52 & 0x7ff) - 0x3ff + 12; + uint64_t m; + + if (e >= 52 + 12) + return x; + if (e < 12) + e = 1; + m = -1ULL >> e; + if ((u.i & m) == 0) + return x; + FORCE_EVAL(x + 0x1p120f); + u.i &= ~m; + return u.f; +} diff --git a/lib/libc/src/musl-math/truncf.c b/lib/libc/src/musl-math/truncf.c new file mode 100644 index 0000000..1a7d03c --- /dev/null +++ b/lib/libc/src/musl-math/truncf.c @@ -0,0 +1,19 @@ +#include "libm.h" + +float truncf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = (int)(u.i >> 23 & 0xff) - 0x7f + 9; + uint32_t m; + + if (e >= 23 + 9) + return x; + if (e < 9) + e = 1; + m = -1U >> e; + if ((u.i & m) == 0) + return x; + FORCE_EVAL(x + 0x1p120f); + u.i &= ~m; + return u.f; +} diff --git a/lib/libc/src/musl-math/truncl.c b/lib/libc/src/musl-math/truncl.c new file mode 100644 index 0000000..f07b193 --- /dev/null +++ b/lib/libc/src/musl-math/truncl.c @@ -0,0 +1,34 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double truncl(long double x) +{ + return trunc(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double truncl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + int s = u.i.se >> 15; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1) + return x; + if (e <= 0x3fff-1) { + FORCE_EVAL(x + 0x1p120f); + return x*0; + } + /* y = int(|x|) - |x|, where int(|x|) is an integer neighbor of |x| */ + if (s) + x = -x; + y = x + toint - toint - x; + if (y > 0) + y -= 1; + x += y; + return s ? -x : x; +} +#endif diff --git a/lib/libc/src/musl-math/weak_alias.h b/lib/libc/src/musl-math/weak_alias.h new file mode 100644 index 0000000..785f9d1 --- /dev/null +++ b/lib/libc/src/musl-math/weak_alias.h @@ -0,0 +1,7 @@ +#ifndef _WEAK_ALIAS_H +#define _WEAK_ALIAS_H + +#define weak_alias(name, alias_to) \ + extern __typeof (name) alias_to __attribute__((__weak__, __alias__(#name))); + +#endif diff --git a/lib/libc/src/posix/getopt.c b/lib/libc/src/posix/getopt.c new file mode 100644 index 0000000..d3cd530 --- /dev/null +++ b/lib/libc/src/posix/getopt.c @@ -0,0 +1,100 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <unistd.h> +#include <stdbool.h> +#include <string.h> +#include <stdio.h> + +char *optarg; +int optind, opterr, optopt; + +int +getopt(int argc, char *argv[], const char *optstring) +{ + size_t optstr_len; + char *arg; + bool has_arg = false; + + if (argc == 0 || optstring == NULL) { + opterr = -EINVAL; + return -1; + } + + if (optind >= argc) { + return -1; + } + + arg = argv[optind]; + optstr_len = strlen(optstring); + + /* Non option argument? */ + if (arg[0] != '-') { + return -1; + } + + /* + * We will look through each possible flag/option + * in the optstring and match it against our arg. + */ + for (size_t i = 0; i < optstr_len; ++i) { + if (arg[1] != optstring[i]) { + continue; + } + + /* + * If this option has a ':' right next to it, + * it also has an argument. + */ + if (i < optstr_len - 1) { + if (optstring[i + 1] == ':') { + has_arg = true; + } + } + + break; + } + + /* + * Handle cases where the option has an argument + * with it (-opt=arg) + */ + if (has_arg && optind < argc ) { + if (arg[2] != '=') { + opterr = -EINVAL; + return -1; + } + optarg = &arg[3]; + ++optind; + } + + ++optind; + return arg[1]; +} diff --git a/lib/libc/src/stdio/fclose.c b/lib/libc/src/stdio/fclose.c new file mode 100644 index 0000000..7628973 --- /dev/null +++ b/lib/libc/src/stdio/fclose.c @@ -0,0 +1,48 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/errno.h> +#include <stdlib.h> +#include <stdio.h> +#include <unistd.h> + +int +fclose(FILE *stream) +{ + int retval; + + if (stream == NULL) { + return -EBADF; + } + + retval = close(stream->fd); + free(stream); + return retval; +} diff --git a/lib/libc/src/stdio/fgetc.c b/lib/libc/src/stdio/fgetc.c new file mode 100644 index 0000000..2ed8496 --- /dev/null +++ b/lib/libc/src/stdio/fgetc.c @@ -0,0 +1,55 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> +#include <stdint.h> + +extern size_t __stdio_read(void *__restrict ptr, size_t size, FILE *__restrict stream); + +int +fgetc(FILE *stream) +{ + uint16_t val; + + if (stream == NULL) { + return EOF; + } + + if (__stdio_read(&val, sizeof(val), stream) != sizeof(val)) { + return EOF; + } + + return (int)val; +} + +int +getchar(void) +{ + return fgetc(stdin); +} diff --git a/lib/libc/src/stdio/fgets.c b/lib/libc/src/stdio/fgets.c new file mode 100644 index 0000000..fdaad84 --- /dev/null +++ b/lib/libc/src/stdio/fgets.c @@ -0,0 +1,73 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> +#include <stdint.h> + +extern size_t __stdio_read(void *__restrict ptr, size_t size, FILE *__restrict stream); + +char * +fgets(char *__restrict s, int size, FILE *__restrict stream) +{ + size_t count; + uint8_t tmp; + int idx = 0; + char c; + + if (stream == NULL) { + return NULL; + } + + for (;;) { + count = __stdio_read(&tmp, sizeof(tmp), stream); + if (count <= 0 && idx == 0) { + s[idx] = '\0'; + return NULL; + } + if (count <= 0 && idx > 0) { + s[idx] = '\0'; + break; + } + + c = (char)tmp; + s[idx++] = c; + + if (c == '\n') { + s[idx] = '\0'; + break; + } + + /* Did we read the entire line? */ + if (idx >= size - 1) { + return s; + } + } + + return s; +} diff --git a/lib/libc/src/stdio/file.c b/lib/libc/src/stdio/file.c new file mode 100644 index 0000000..5c84c35 --- /dev/null +++ b/lib/libc/src/stdio/file.c @@ -0,0 +1,36 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> + +int +fileno(FILE *stream) +{ + return stream->fd; +} diff --git a/lib/libc/src/stdio/fopen.c b/lib/libc/src/stdio/fopen.c new file mode 100644 index 0000000..efeb577 --- /dev/null +++ b/lib/libc/src/stdio/fopen.c @@ -0,0 +1,74 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <stdio.h> +#include <string.h> +#include <stdlib.h> +#include <fcntl.h> + +FILE * +fopen(const char *__restrict path, const char *__restrict mode) +{ + FILE *fhand; + int fd; + mode_t seal = 0; + + if (path == NULL || mode == NULL) { + return NULL; + } + + /* Create the seal from mode string */ + if (strcmp(mode, "r") == 0) { + seal |= O_RDONLY; + } else if (strcmp(mode, "w") == 0) { + seal |= (O_WRONLY | O_CREAT); + } else if (strcmp(mode, "r+") == 0) { + seal |= O_RDWR; + } else if (strcmp(mode, "rb") == 0) { + seal |= O_RDONLY; + } else { + return NULL; + } + + /* Try to open the file descriptor */ + fd = open(path, seal); + if (fd < 0) { + return NULL; + } + + fhand = malloc(sizeof(*fhand)); + if (fhand == NULL) { + return NULL; + } + + fhand->fd = fd; + fhand->buf_mode = _IONBF; + return fhand; +} diff --git a/lib/libc/src/stdio/fputc.c b/lib/libc/src/stdio/fputc.c new file mode 100644 index 0000000..6ac7aac --- /dev/null +++ b/lib/libc/src/stdio/fputc.c @@ -0,0 +1,55 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> + +extern size_t __stdio_write(const void *__restrict ptr, size_t size, FILE *__restrict stream); + +int +fputc(int c, FILE *stream) +{ + unsigned char val; + + if (stream == NULL) { + return EOF; + } + + val = (unsigned char)c; + if (__stdio_write(&val, sizeof(val), stream) != sizeof(val)) { + return EOF; + } + + return (int)val; +} + +int +putchar(int c) +{ + return fputc(c, stdout); +} diff --git a/lib/libc/src/stdio/fputs.c b/lib/libc/src/stdio/fputs.c new file mode 100644 index 0000000..357fd52 --- /dev/null +++ b/lib/libc/src/stdio/fputs.c @@ -0,0 +1,68 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> +#include <string.h> + +extern size_t __stdio_write(const void *__restrict ptr, size_t size, FILE *__restrict stream); + +int +fputs(const char *__restrict s, FILE *__restrict stream) +{ + size_t len; + + if (s == NULL || stream == NULL) { + return EOF; + } + + len = strlen(s); + if (len < 1) { + return 0; + } + + if (__stdio_write(s, sizeof(char) * len, stream) != (sizeof(char) * len)) { + return EOF; + } + + return 0; +} + +int +puts(const char *s) +{ + if (fputs(s, stdout) < 0) { + return EOF; + } + + if (fputc('\n', stdout) != '\n') { + return EOF; + } + + return 0; +} diff --git a/lib/libc/src/stdio/fread.c b/lib/libc/src/stdio/fread.c new file mode 100644 index 0000000..036962d --- /dev/null +++ b/lib/libc/src/stdio/fread.c @@ -0,0 +1,61 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> +#include <unistd.h> + +size_t +__stdio_read(void *__restrict ptr, size_t size, FILE *__restrict stream) +{ + ssize_t count; + + if (stream->buf_mode == _IONBF) { + if ((count = read(stream->fd, ptr, size)) < 0) { + return 0; + } + + return count; + } + + /* + * TODO: Implement more buffering modes. + */ + + return 0; +} + +size_t +fread(void *__restrict ptr, size_t size, size_t n, FILE *__restrict stream) +{ + if (ptr == NULL || stream == NULL || (size * n) == 0) { + return 0; + } + + return __stdio_read(ptr, size * n, stream); +} diff --git a/lib/libc/src/stdio/fseek.c b/lib/libc/src/stdio/fseek.c new file mode 100644 index 0000000..b783081 --- /dev/null +++ b/lib/libc/src/stdio/fseek.c @@ -0,0 +1,42 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <stdio.h> +#include <unistd.h> + +int +fseek(FILE *stream, long offset, int whence) +{ + if (stream == NULL) { + return -EINVAL; + } + + return lseek(stream->fd, offset, whence); +} diff --git a/lib/libc/src/stdio/ftell.c b/lib/libc/src/stdio/ftell.c new file mode 100644 index 0000000..aa0f608 --- /dev/null +++ b/lib/libc/src/stdio/ftell.c @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> +#include <unistd.h> + +long +ftell(FILE *stream) +{ + return lseek(stream->fd, 0, SEEK_CUR); +} diff --git a/lib/libc/src/stdio/fwrite.c b/lib/libc/src/stdio/fwrite.c new file mode 100644 index 0000000..660034e --- /dev/null +++ b/lib/libc/src/stdio/fwrite.c @@ -0,0 +1,61 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> +#include <unistd.h> + +size_t +__stdio_write(const void *__restrict ptr, size_t size, FILE *__restrict stream) +{ + ssize_t count; + + if (stream->buf_mode == _IONBF) { + if ((count = write(stream->fd, ptr, size)) < 0) { + return 0; + } + + return count; + } + + /* + * TODO: Implement more buffering modes. + */ + + return 0; +} + +size_t +fwrite(const void *__restrict ptr, size_t size, size_t n, FILE *__restrict stream) +{ + if (ptr == NULL || stream == NULL || (size * n) == 0) { + return 0; + } + + return __stdio_write(ptr, size * n, stream); +} diff --git a/lib/libc/src/stdio/init.c b/lib/libc/src/stdio/init.c new file mode 100644 index 0000000..5982d59 --- /dev/null +++ b/lib/libc/src/stdio/init.c @@ -0,0 +1,62 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> +#include <fcntl.h> + +FILE *stdin; +FILE *stdout; +FILE *stderr; + +static FILE cin, cout, cerr; + +int +__libc_stdio_init(void) +{ + int cfd; + + if ((cfd = open("/dev/console", O_RDWR)) < 0) { + return cfd; + } + + cin.buf_mode = _IONBF; + cin.fd = cfd; + + cout.buf_mode = _IONBF; + cout.fd = cfd; + + cerr.buf_mode = _IONBF; + cerr.fd = cfd; + + stdout = &cout; + stdin = &cin; + stderr = &cerr; + + return 0; +} diff --git a/lib/libc/src/stdio/snprintf.c b/lib/libc/src/stdio/snprintf.c new file mode 100644 index 0000000..2387950 --- /dev/null +++ b/lib/libc/src/stdio/snprintf.c @@ -0,0 +1,63 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <stdio.h> +#include <stddef.h> +#include <unistd.h> + +/* TODO FIXME: Use stdarg.h */ +#define __va_start(ap, fmt) __builtin_va_start(ap, fmt) +#define __va_end(ap) __builtin_va_end(ap) + +int +snprintf(char *s, size_t size, const char *fmt, ...) +{ + va_list ap; + int ret; + + __va_start(ap, fmt); + ret = vsnprintf(s, size, fmt, ap); + __va_end(ap); + return ret; +} + +int +printf(const char *__restrict fmt, ...) +{ + char buf[512]; + va_list ap; + int ret; + + __va_start(ap, fmt); + ret = vsnprintf(buf, sizeof(buf), fmt, ap); + write(stdout->fd, buf, ret); + __va_end(ap); + return ret; +} diff --git a/lib/libc/src/stdio/vsnprintf.c b/lib/libc/src/stdio/vsnprintf.c new file mode 100644 index 0000000..0e3d268 --- /dev/null +++ b/lib/libc/src/stdio/vsnprintf.c @@ -0,0 +1,145 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <stdio.h> +#include <stddef.h> +#include <string.h> + +/* TODO FIXME: Use stdarg.h */ +#define __va_arg(ap, type) __builtin_va_arg(ap, type) + +static inline void +printc(char *buf, size_t size, size_t *off, char c) +{ + if (*off < size - 1) { + buf[(*off)++] = c; + } + buf[*off] = 0; +} + +static void +printstr(char *buf, size_t size, size_t *off, const char *s) +{ + while (*off < size - 1 && *s != '\0') { + buf[(*off)++] = *(s)++; + } + buf[*off] = 0; +} + +int +vsnprintf(char *s, size_t size, const char *fmt, va_list ap) +{ + size_t tmp_len, num_len, off = 0; + ssize_t num = 0; + char c, c1, num_buf[256] = {0}; + const char *tmp_str; + uint8_t pad_width = 0; + + while (off < (size - 1)) { + while (*fmt && *fmt != '%') { + printc(s, size, &off, *fmt++); + } + if (*(fmt)++ == '\0' || off == size - 1) { + return off; + } + + /* + * Handle a case where we have "%0N". For example: + * "%04d" + */ + if (*fmt == '0') { + ++fmt; + while (*fmt >= '0' && *fmt <= '9') { + pad_width = pad_width * 10 + (*fmt - '0'); + ++fmt; + } + } + + c = *fmt++; + switch (c) { + case '%': + printc(s, size, &off, c); + break; + case 'c': + c1 = (char )__va_arg(ap, int); + printc(s, size, &off, c1); + break; + case 'd': + num = __va_arg(ap, int); + itoa(num, num_buf, 10); + + if (pad_width > 0) { + num_len = strlen(num_buf); + for (size_t i = num_len; i < pad_width; ++i) + printc(s, size, &off, '0'); + pad_width = 0; + } + printstr(s, size, &off, num_buf); + break; + case 'p': + num = __va_arg(ap, uint64_t); + itoa(num, num_buf, 16); + tmp_len = strlen(num_buf); + + /* Add '0x' prefix */ + printc(s, size, &off, '0'); + printc(s, size, &off, 'x'); + /* + * Now we pad this. + * + * XXX TODO: This assumes 64-bits, should be + * cleaned up. + */ + for (size_t i = 0; i < 18 - tmp_len; ++i) { + printc(s, size, &off, '0'); + } + printstr(s, size, &off, num_buf + 2); + break; + case 'x': + num = __va_arg(ap, uint64_t); + itoa(num, num_buf, 16); + tmp_len = strlen(num_buf); + if (pad_width > 0) { + num_len = strlen(num_buf); + for (size_t i = num_len; i < pad_width; ++i) + printc(s, size, &off, '0'); + pad_width = 0; + } + printstr(s, size, &off, num_buf + 2); + break; + case 's': + tmp_str = __va_arg(ap, const char *); + printstr(s, size, &off, tmp_str); + break; + } + } + + return 0; +} diff --git a/lib/libc/src/stdlib/_Exit.c b/lib/libc/src/stdlib/_Exit.c new file mode 100644 index 0000000..e975381 --- /dev/null +++ b/lib/libc/src/stdlib/_Exit.c @@ -0,0 +1,38 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/syscall.h> +#include <stdlib.h> + +__dead void +_Exit(int status) +{ + syscall(SYS_exit, status); + __builtin_unreachable(); +} diff --git a/lib/libc/src/stdlib/abort.c b/lib/libc/src/stdlib/abort.c new file mode 100644 index 0000000..bc0a491 --- /dev/null +++ b/lib/libc/src/stdlib/abort.c @@ -0,0 +1,40 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdlib.h> + +__dead void +abort(void) +{ + /* + * TODO: Call SIGABRT handler here. + */ + + _Exit(EXIT_FAILURE); +} diff --git a/lib/libc/src/stdlib/exit.c b/lib/libc/src/stdlib/exit.c new file mode 100644 index 0000000..e5adfac --- /dev/null +++ b/lib/libc/src/stdlib/exit.c @@ -0,0 +1,40 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdlib.h> + +__dead void +exit(int status) +{ + /* + * TODO: Call atexit() handlers and do cleanup here. + */ + + _Exit(status); +} diff --git a/lib/libc/src/stdlib/malloc.c b/lib/libc/src/stdlib/malloc.c new file mode 100644 index 0000000..4f25c24 --- /dev/null +++ b/lib/libc/src/stdlib/malloc.c @@ -0,0 +1,219 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/mman.h> +#include <sys/param.h> +#include <sys/cdefs.h> +#include <stdlib.h> +#include <stddef.h> +#include <stdatomic.h> +#include <stdio.h> +#include <stdbool.h> +#include <string.h> + +#define HEAP_SIZE 0x1001A8 +#define HEAP_MAGIC 0x05306A /* "OSMORA" :~) */ +#define HEAP_ALIGN 4 +#define HEAP_PROT PROT_READ | PROT_WRITE +#define BYTE_PTR(PTR) ((char *)(PTR)) +#define HEAP_NEXT(BLOCKP, SIZE) \ + PTR_OFFSET((BLOCKP), sizeof(struct mem_block) + (SIZE)) + +struct __aligned(HEAP_ALIGN) mem_block { + uint32_t magic; + uint32_t size; + uint8_t allocated : 1; + struct mem_block *next; +}; + +static struct mem_block *mem_head; +static struct mem_block *mem_tail; + +/* + * The size of the heap including data on the heap + * as well as the sizes of their respective block + * headers. + */ +static ssize_t heap_len = 0; +static off_t heap_pos = 0; + +/* + * During the initial state of malloc() when the C library + * first starts up. We can assume that there is zero fragmentation + * in our heap pool. This allows us to initially allocate memory + * by bumping a pointer which is O(1). During this state, even after + * any calls to free(), we can assume that there is more memory ahead + * of us that is free (due to the initial zero-fragmentation). However, + * once we've reached the end of the pool, if any memory has been previously + * freed (indicated by heap_len > 0), we can wrap the tail and start allocating + * in a best-fit fashion as we can assume that the heap is now fragmented. + */ +static bool wrap = false; + +void __malloc_mem_init(void); + +/* + * Terminate program abnormally due to any heap + * errors. + * + * TODO: Raise SIGABRT instead of using _Exit() + */ +__dead static void +__heap_abort(const char *str) +{ + printf(str); + _Exit(1); + __builtin_unreachable(); +} + +/* + * Find a free block + * + * TODO: This is currently a first-fit style + * routine. This should be best-fit instead + * as it doesn't waste memory. + */ +static struct mem_block * +malloc_find_free(size_t size) +{ + struct mem_block *cur = mem_head; + + while (cur != NULL) { + if (cur->size >= size) { + return cur; + } + + cur = cur->next; + } + + return NULL; +} + +void * +malloc(size_t size) +{ + struct mem_block *next_block; + struct mem_block *tail; + size_t inc_len = 0; + + size = ALIGN_UP(size, HEAP_ALIGN); + inc_len = sizeof(*next_block) + size; + + if (heap_len < 0) { + heap_len = 0; + } + + if (heap_len < 0) { + heap_len = 0; + return NULL; + } + + /* Any memory left to allocate? */ + if ((heap_len + inc_len) >= HEAP_SIZE) { + return NULL; + } + + if (heap_pos >= HEAP_SIZE - inc_len) { + wrap = true; + mem_tail = mem_head; + } + + tail = wrap ? malloc_find_free(size) : mem_tail; + if (tail == NULL) { + return NULL; + } + + next_block = mem_tail; + mem_tail = HEAP_NEXT(mem_tail, size); + mem_tail->next = NULL; + + next_block->next = mem_tail; + next_block->size = size; + next_block->allocated = 1; + next_block->magic = HEAP_MAGIC; + + heap_len += inc_len; + heap_pos += inc_len; + return PTR_OFFSET(next_block, sizeof(*next_block)); +} + +void * +realloc(void *ptr, size_t size) +{ + struct mem_block *blk; + void *new_buf; + + blk = PTR_NOFFSET(ptr, sizeof(*blk)); + if (blk->magic != HEAP_MAGIC) { + __heap_abort("realloc: bad realloc block detected\n"); + } + if (!blk->allocated) { + __heap_abort("realloc: bad realloc\n"); + } + + new_buf = malloc(size); + memcpy(new_buf, ptr, blk->size); + free(ptr); + return new_buf; +} + +void +free(void *ptr) +{ + struct mem_block *blk; + + blk = PTR_NOFFSET(ptr, sizeof(*blk)); + if (blk->magic != HEAP_MAGIC) { + __heap_abort("free: bad free block detected\n"); + } + if (!blk->allocated) { + __heap_abort("free: double free detected\n"); + } + + blk->allocated = 0; + heap_len -= (blk->size + sizeof(*blk)); + if (heap_len < 0) { + heap_len = 0; + } +} + +void +__malloc_mem_init(void) +{ + mem_head = mmap(NULL, HEAP_SIZE, HEAP_PROT, MAP_ANON, 0, 0); + if (mem_head == NULL) { + __heap_abort("__malloc_mem_init: mem_head is NULL, out of memory\n"); + } + + mem_head->size = 0; + mem_head->next = NULL; + mem_head->allocated = 0; + mem_tail = mem_head; +} diff --git a/lib/libc/src/stdlib/rand.c b/lib/libc/src/stdlib/rand.c new file mode 100644 index 0000000..838ba5f --- /dev/null +++ b/lib/libc/src/stdlib/rand.c @@ -0,0 +1,45 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdlib.h> + +static unsigned int r_seed = 0x9E3779B9; + +void +srand(unsigned int r) +{ + r_seed = r; +} + +int +rand(void) +{ + r_seed = (r_seed >> 0x01U) ^ (-(r_seed & 0x01U) & 0xB400U); + return r_seed; +} diff --git a/lib/libc/src/string/atoi.c b/lib/libc/src/string/atoi.c new file mode 100644 index 0000000..920e561 --- /dev/null +++ b/lib/libc/src/string/atoi.c @@ -0,0 +1,51 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <string.h> + +#define IS_DIGIT(C) ((C >= '0' && C <= '9')) + +int +atoi(const char *s) +{ + int n, sign; + + while (*s == ' ') { + ++s; + } + + sign = (*s == '-') ? -1 : 1; + if (*s == '+' || *s == '-') { + s++; + } + for (n = 0; IS_DIGIT(*s); ++s) { + n = 10 * n + (*s - '0'); + } + return sign * n; +} diff --git a/lib/libc/src/string/itoa.c b/lib/libc/src/string/itoa.c new file mode 100644 index 0000000..cfce406 --- /dev/null +++ b/lib/libc/src/string/itoa.c @@ -0,0 +1,134 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <string.h> +#include <stdbool.h> + +static char * +itoa_base10_convert(int64_t value, char *buf) +{ + size_t i; + uint8_t tmp; + bool is_negative; + + i = 0; + is_negative = false; + + if (value == 0) { + buf[i++] = '0'; + buf[i++] = '\0'; + return buf; + } + + if (value < 0) { + /* Easier to handle positive numbers */ + value *= -1; + is_negative = true; + } + + while (value > 0) { + buf[i++] = '0' + (value % 10); + value /= 10; + } + + if (is_negative) { + buf[i++] = '-'; + } + + buf[i--] = '\0'; + + /* Result is in reverse */ + for (int j = 0; j < i; ++j, --i) { + tmp = buf[j]; + buf[j] = buf[i]; + buf[i] = tmp; + } + + return buf; +} + +static char * +itoa_convert_base16(uint64_t n, char *buffer) +{ + bool pad; + uint8_t nibble; + uint8_t i, j, tmp; + const char *ascii_nums = "0123456789ABCDEF"; + + i = 0; + pad = false; + + if (n == 0) { + /* Zero, no need to parse */ + memcpy(buffer, "0x00\0", 5); + return buffer; + } + /* If one digit, pad out 2 later */ + if (n < 0x10) { + pad = true; + } + + while (n > 0) { + nibble = (uint8_t)n & 0x0F; + nibble = ascii_nums[nibble]; + buffer[i++] = nibble; + n >>= 4; /* Fetch next nibble */ + } + + if (pad) { + buffer[i++] = '0'; + } + + /* Add "0x" prefix */ + buffer[i++] = 'x'; + buffer[i++] = '0'; + buffer[i--] = '\0'; + + /* Unreverse the result */ + for (j = 0; j < i; ++j, --i) { + tmp = buffer[j]; + buffer[j] = buffer[i]; + buffer[i] = tmp; + } + return buffer; +} + +char * +itoa(int64_t value, char *buf, int base) +{ + switch (base) { + case 10: + return itoa_base10_convert(value, buf); + case 16: + return itoa_convert_base16(value, buf); + default: + return NULL; + } +} diff --git a/lib/libc/src/string/memcpy.c b/lib/libc/src/string/memcpy.c new file mode 100644 index 0000000..a9bcbe9 --- /dev/null +++ b/lib/libc/src/string/memcpy.c @@ -0,0 +1,40 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <string.h> + +void * +memcpy(void *dest, const void *src, size_t n) +{ + for (size_t i = 0; i < n; ++i) { + ((char *)dest)[i] = ((char *)src)[i]; + } + + return dest; +} diff --git a/lib/libc/src/string/strdup.c b/lib/libc/src/string/strdup.c new file mode 100644 index 0000000..e5b0910 --- /dev/null +++ b/lib/libc/src/string/strdup.c @@ -0,0 +1,51 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <string.h> +#include <stdlib.h> + +char * +strdup(const char *s) +{ + char *new_s; + size_t s_len; + + if (s == NULL) { + return NULL; + } + + s_len = strlen(s); + new_s = malloc(s_len + 1); + if (new_s == NULL) { + return NULL; + } + + memcpy(new_s, s, s_len); + return new_s; +} diff --git a/lib/libc/src/string/strtok.c b/lib/libc/src/string/strtok.c new file mode 100644 index 0000000..f01dcd6 --- /dev/null +++ b/lib/libc/src/string/strtok.c @@ -0,0 +1,82 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <string.h> + +static char * +__strtok(char *s, const char *delim, char **last) +{ + const char *spanp; + char *tok; + int c, sc; + + if (s == NULL && (s = *last) == NULL) { + return NULL; + } + +cont: + c = *s++; + for (spanp = delim; (sc = *spanp++) != 0;) { + if (c == sc) + goto cont; + } + + if (c == 0) { + *last = NULL; + return NULL; + } + + tok = s - 1; + + /* Scan tokens */ + for (;;) { + c = *s++; + spanp = delim; + do { + if ((sc = *spanp++) == c) { + if (c == 0) + s = NULL; + else + s[-1] = '\0'; + *last = s; + return (tok); + } + } while (sc != 0); + } + + __builtin_unreachable(); +} + +char * +strtok(char *s, const char *delim) +{ + static char *last; + + return __strtok(s, delim, &last); +} diff --git a/lib/libc/src/unistd/access.c b/lib/libc/src/unistd/access.c new file mode 100644 index 0000000..0aeb030 --- /dev/null +++ b/lib/libc/src/unistd/access.c @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/syscall.h> +#include <unistd.h> + +int +access(const char *path, int mode) +{ + return syscall(SYS_access, (uintptr_t)path, mode); +} diff --git a/lib/libc/src/unistd/dup.c b/lib/libc/src/unistd/dup.c new file mode 100644 index 0000000..887fdc6 --- /dev/null +++ b/lib/libc/src/unistd/dup.c @@ -0,0 +1,44 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <unistd.h> + +int +dup(int fd) +{ + /* TODO: STUB */ + return -1; +} + +int +dup2(int fd, int fd1) +{ + /* TODO: STUB */ + return -1; +} diff --git a/lib/libc/src/unistd/fork.c b/lib/libc/src/unistd/fork.c new file mode 100644 index 0000000..970072e --- /dev/null +++ b/lib/libc/src/unistd/fork.c @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <unistd.h> + +pid_t +fork(void) +{ + /* TODO */ + return -1; +} diff --git a/lib/libc/src/unistd/getcwd.c b/lib/libc/src/unistd/getcwd.c new file mode 100644 index 0000000..641a49b --- /dev/null +++ b/lib/libc/src/unistd/getcwd.c @@ -0,0 +1,52 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <unistd.h> + +char * +getcwd(char *buf, size_t size) +{ + if (buf == NULL) { + return NULL; + } + + /* TODO: STUB */ + return NULL; +} + +char * +getwd(char *pathname) +{ + if (pathname == NULL) { + return NULL; + } + + /* TODO: STUB */ + return NULL; +} diff --git a/lib/libc/src/unistd/getlogin.c b/lib/libc/src/unistd/getlogin.c new file mode 100644 index 0000000..dd74261 --- /dev/null +++ b/lib/libc/src/unistd/getlogin.c @@ -0,0 +1,109 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <stdlib.h> +#include <unistd.h> +#include <stdio.h> +#include <string.h> + +#define UNKNOWN_USER "unknown" + +static char *ucache = NULL; + +static int +match_entry(uid_t uid, char *entry) +{ + char uidstr[16]; + char *username = NULL; + char *p; + size_t len; + uint8_t row = 0; + + if (itoa(uid, uidstr, 10) == NULL) { + return -1; + } + + p = strtok(entry, ":"); + if (p == NULL) { + return -1; + } + + while (p != NULL) { + switch (row) { + case 0: + username = p; + break; + case 2: + /* + * If the user ID matches, we'll cache the + * username. + */ + if (strcmp(uidstr, p) == 0) { + ucache = strdup(username); + return 0; + } + break; + } + + p = strtok(NULL, ":"); + ++row; + } + + return -1; +} + +char * +getlogin(void) +{ + FILE *fp; + char entry[256]; + int retval; + uid_t uid = getuid(); + + /* Get the user from the cache */ + if (ucache != NULL) { + return ucache; + } + + fp = fopen("/etc/passwd", "r"); + if (fp == NULL) { + return UNKNOWN_USER; + } + + while (fgets(entry, sizeof(entry), fp) != NULL) { + if (match_entry(uid, entry) == 0) { + fclose(fp); + return ucache; + } + } + + fclose(fp); + return UNKNOWN_USER; +} diff --git a/lib/libc/src/unistd/getpid.c b/lib/libc/src/unistd/getpid.c new file mode 100644 index 0000000..5770495 --- /dev/null +++ b/lib/libc/src/unistd/getpid.c @@ -0,0 +1,43 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/syscall.h> +#include <unistd.h> + +pid_t +getpid(void) +{ + return syscall(SYS_getpid); +} + +pid_t +getppid(void) +{ + return syscall(SYS_getppid); +} diff --git a/lib/libc/src/unistd/getuid.c b/lib/libc/src/unistd/getuid.c new file mode 100644 index 0000000..644faa5 --- /dev/null +++ b/lib/libc/src/unistd/getuid.c @@ -0,0 +1,38 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/syscall.h> +#include <unistd.h> + +uid_t +getuid(void) +{ + return syscall(SYS_getuid); +} diff --git a/lib/libc/src/unistd/hostname.c b/lib/libc/src/unistd/hostname.c new file mode 100644 index 0000000..60df9a0 --- /dev/null +++ b/lib/libc/src/unistd/hostname.c @@ -0,0 +1,125 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/sysctl.h> +#include <unistd.h> + +/* + * Internal helper to grab a sysctl + * variable. + * + * @name: Name definition of sysctl variable + * @buf: Buffer to read data in + * @buflen: Length of buffer + * + * Returns zero on success, otherwise a less than + * zero value. + */ +static int +__sysctl_get(int name, char *buf, size_t buflen) +{ + struct sysctl_args args; + int error; + + args.name = &name; + args.nlen = 1; + args.oldp = buf; + args.oldlenp = &buflen; + args.newp = NULL; + args.newlen = 0; + + if ((error = sysctl(&args)) != 0) { + return -1; + } + + return 0; +} + +/* + * Internal helper to set a sysctl + * variable. + * + * @name: Name definition of sysctl variable + * @buf: Buffer with data to set + * @buflen: Length of buffer + * + * Returns zero on success, otherwise a less than + * zero value. + */ +static int +__sysctl_set(int name, const char *buf, size_t buflen) +{ + struct sysctl_args args; + int error; + + args.name = &name; + args.nlen = 1; + args.oldp = NULL; + args.oldlenp = NULL; + args.newp = (void *)buf; + args.newlen = buflen; + + if ((error = sysctl(&args)) != 0) { + return -1; + } + + return 0; +} + +/* + * Get the system hostname + * + * @name: Buffer to read name into + * @size: Length of name to read + */ +int +gethostname(char *name, size_t size) +{ + if (name == NULL || size == 0) { + return -1; + } + + return __sysctl_get(KERN_HOSTNAME, name, size); +} + +/* + * Set the system hostname + * + * @name: Name to set + * @size: Size of name to set + */ +int +sethostname(const char *name, size_t size) +{ + if (name == NULL || size == 0) { + return -1; + } + + return __sysctl_set(KERN_HOSTNAME, name, size); +} diff --git a/lib/libc/src/unistd/lseek.c b/lib/libc/src/unistd/lseek.c new file mode 100644 index 0000000..d99b0f0 --- /dev/null +++ b/lib/libc/src/unistd/lseek.c @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/syscall.h> +#include <unistd.h> + +off_t +lseek(int fildes, off_t offset, int whence) +{ + return syscall(SYS_lseek, fildes, offset, whence); +} diff --git a/lib/libc/src/unistd/setuid.c b/lib/libc/src/unistd/setuid.c new file mode 100644 index 0000000..218f1f1 --- /dev/null +++ b/lib/libc/src/unistd/setuid.c @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/syscall.h> +#include <unistd.h> + +int +setuid(uid_t new) +{ + return syscall(SYS_setuid, new); +} diff --git a/lib/libc/src/unistd/symlink.c b/lib/libc/src/unistd/symlink.c new file mode 100644 index 0000000..2ad24ca --- /dev/null +++ b/lib/libc/src/unistd/symlink.c @@ -0,0 +1,53 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <unistd.h> + +int +symlink(const char *target, const char *linkpath) +{ + if (target == NULL || linkpath == NULL) { + return -EINVAL; + } + + /* TODO: STUB */ + return -1; +} + +int +synlinkat(const char *target, int newdirfd, const char *linkpath) +{ + if (target == NULL || linkpath == NULL) { + return -EINVAL; + } + + /* TODO: STUB */ + return -1; +} diff --git a/lib/libc/src/unistd/sysconf.c b/lib/libc/src/unistd/sysconf.c new file mode 100644 index 0000000..43fab01 --- /dev/null +++ b/lib/libc/src/unistd/sysconf.c @@ -0,0 +1,42 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <unistd.h> + +extern uint64_t __libc_auxv[_AT_MAX]; + +int +sysconf(int name) +{ + if (name >= _AT_MAX) { + return -1; + } + + return __libc_auxv[name]; +} diff --git a/lib/libc/src/unistd/unlink.c b/lib/libc/src/unistd/unlink.c new file mode 100644 index 0000000..3de0796 --- /dev/null +++ b/lib/libc/src/unistd/unlink.c @@ -0,0 +1,53 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <unistd.h> + +int +unlink(const char *path) +{ + if (path == NULL) { + return -EINVAL; + } + + /* TODO: STUB */ + return -1; +} + +int +unlinkat(int dirfd, const char *pathname, int flags) +{ + if (pathname == NULL || dirfd < 0) { + return -EINVAL; + } + + /* TODO: STUB */ + return -1; +} diff --git a/lib/libgfx/Makefile b/lib/libgfx/Makefile new file mode 100644 index 0000000..12fdd9a --- /dev/null +++ b/lib/libgfx/Makefile @@ -0,0 +1,29 @@ +CFLAGS = -c -fno-stack-protector -nostdlib -static \ + -Iinclude/ -I$(USRDIR)/include/ +CFILES = $(shell find src/ -name "*.c") +OBJ = $(CFILES:.c=.o) + +all: headers $(OBJ) build/libgfx.a + echo $(USRDIR) + mv build/libgfx.a $(USRDIR)/lib/ + cp -r include/ $(USRDIR)/include/ + +build/libgfx.a: + mkdir -p build/ + ar rcs build/libgfx.a $(OBJ) + +%.o: %.c + $(CC) $(CFLAGS) -Iinclude/ $< -o $@ + +.PHONY: headers +headers: + cp -rf include/* $(USRDIR)/include/ + +.PHONY: +build/: + mkdir -p build/ + +.PHONY: clean +clean: + rm -f $(OBJ) + rm -rf build/ diff --git a/lib/libgfx/include/libgfx/draw.h b/lib/libgfx/include/libgfx/draw.h new file mode 100644 index 0000000..4140593 --- /dev/null +++ b/lib/libgfx/include/libgfx/draw.h @@ -0,0 +1,133 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _LIBGFX_DRAW_H_ +#define _LIBGFX_DRAW_H_ + +#include <stdint.h> +#include <libgfx/gfx.h> + +/* Shape types */ +#define SHAPE_SQUARE 0x00000000 +#define SHAPE_SQUARE_BORDER 0x00000001 + +/* Basic color defines */ +#define GFX_BLACK 0x000000 +#define GFX_RED 0xFF0000 +#define GFX_GREEN 0x00FF00 +#define GFX_BLUE 0x0000FF +#define GFX_WHITE 0xFFFFFF +#define GFX_PURPLE 0x800080 +#define GFX_YELLOW 0xFFFF00 +#define GFX_DARK 0x1D2021 +#define GFX_AQUA 0x427B58 + +/* + * Default shape initializer, something that + * works and can be tweaked. The idea of this + * is so that shapes may be set up like so: + * + * -- + * struct gfx_shape blah = GFX_SHAPE_DEFAULT; + * + * blah.width = width; + * blah.heiht = height; + * ... + * -- + */ +#define GFX_SHAPE_DEFAULT \ + { \ + .type = SHAPE_SQUARE, \ + .color = 0x00FF00, \ + .x = 0, \ + .y = 0, \ + .width = 50, \ + .height = 50, \ + } + +/* + * Generic shape representation + * + * @type: Shape type (see SHAPE_*) + * @color: Color of the shape + * @x: X position of the shape + * @y: Y position of the shape + * @width: Shape width + * @height: Shape height + */ +struct gfx_shape { + uint32_t type; + color_t color; + scrpos_t x; + scrpos_t y; + dimm_t width; + dimm_t height; +}; + +/* + * A point or single pixel that + * may be plotted onto the screen. + * + * @x,y: Position of the point on the screen + * @rgb: Color of the point (RGB) + */ +struct gfx_point { + scrpos_t x, y; + color_t rgb; +}; + +/* + * Represents a rectangular region on + * the screen. + * + * @x,y: Position of this region on the screen + * @width: Region width + * @heght: Region height + */ +struct gfx_region { + scrpos_t x, y; + dimm_t width; + dimm_t height; +}; + +int gfx_draw_shape(struct gfx_ctx *ctx, const struct gfx_shape *shape); +int gfx_plot_point(struct gfx_ctx *ctx, const struct gfx_point *point); + +int gfx_copy_region(struct gfx_ctx *ctx, struct gfx_region *r, scrpos_t x, scrpos_t y); +color_t gfx_get_pix(struct gfx_ctx *ctx, uint32_t x, uint32_t y); + +__always_inline static inline size_t +gfx_io_index(struct gfx_ctx *ctx, scrpos_t x, scrpos_t y) +{ + struct fbattr fbdev = ctx->fbdev; + + return x + y * (fbdev.pitch / 4); +} + +#endif /* !_LIBGFX_DRAW_H_ */ diff --git a/lib/libgfx/include/libgfx/gfx.h b/lib/libgfx/include/libgfx/gfx.h new file mode 100644 index 0000000..67a1006 --- /dev/null +++ b/lib/libgfx/include/libgfx/gfx.h @@ -0,0 +1,74 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _LIBGFX_H_ +#define _LIBGFX_H_ + +#include <sys/fbdev.h> +#include <stdint.h> +#include <stdio.h> + +#define gfx_log(fmt, ...) printf( "libgfx: " fmt, ##__VA_ARGS__) + +/* + * Represents a 32-bit pixel value. + * + * 24:16 15:8 7:0 + * +-----------------+ + * | R | B | B | + * +-----------------+ + */ +typedef uint32_t pixel_t; +typedef pixel_t color_t; + +/* + * Represents cartesian x/y values + */ +typedef uint32_t cartpos_t; +typedef cartpos_t scrpos_t; +typedef cartpos_t dimm_t; /* Dimensions */ + +/* + * Graphics context for libgfx + * + * @fbdev: Framebuffer attributes + * @io: Framebuffer pointer + * @fbfd: Framebuffer file descriptor + */ +struct gfx_ctx { + struct fbattr fbdev; + size_t fb_size; + pixel_t *io; + int fbfd; +}; + +int gfx_init(struct gfx_ctx *res); +void gfx_cleanup(struct gfx_ctx *ctx); + +#endif /* !_LIBGFX_H_ */ diff --git a/lib/libgfx/src/draw.c b/lib/libgfx/src/draw.c new file mode 100644 index 0000000..4df64a8 --- /dev/null +++ b/lib/libgfx/src/draw.c @@ -0,0 +1,282 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <stdint.h> +#include <libgfx/gfx.h> +#include <libgfx/draw.h> + +/* + * See if a pixel is within the bounds of + * the screen. + * + * @ctx: Graphics context pointer + * @x: X position to check + * @y: Y position to check + * + * Returns 0 if within bounds, otherwise + * a negative value. + */ +static int +gfx_pixel_bounds(struct gfx_ctx *ctx, uint32_t x, uint32_t y) +{ + scrpos_t scr_width, scr_height; + struct fbattr fbdev; + + if (ctx == NULL) { + return -1; + } + + /* Grab screen dimensions */ + fbdev = ctx->fbdev; + scr_width = fbdev.width; + scr_height = fbdev.height; + + if (x >= scr_width || y >= scr_height) { + return -1; + } + + return 0; +} + +/* + * Draw a classic square onto the screen. + * + * @ctx: Graphics context + * @shape: Square to draw + */ +static int +gfx_draw_square(struct gfx_ctx *ctx, const struct gfx_shape *shape) +{ + struct fbattr fbdev; + struct gfx_point p; + off_t idx; + scrpos_t x, y; + + if (ctx == NULL || shape == NULL) { + return -EINVAL; + } + + for (x = shape->x; x < shape->x + shape->width; ++x) { + for (y = shape->y; y < shape->y + shape->height; ++y) { + p.x = x; + p.y = y; + p.rgb = shape->color; + gfx_plot_point(ctx, &p); + } + } + return 0; +} + +/* + * Draw a bordered square onto the screen. + * + * @ctx: Graphics context pointer + * @shape: Bordered square to draw + */ +static int +gfx_draw_bsquare(struct gfx_ctx *ctx, const struct gfx_shape *shape) +{ + struct gfx_point p; + scrpos_t x_i, y_i; + scrpos_t x_f, y_f; + scrpos_t x, y; + + if (ctx == NULL || shape == NULL) { + return -EINVAL; + } + + x_i = shape->x; + y_i = shape->y; + x_f = shape->x + shape->width; + y_f = shape->y + shape->height; + + /* + * Draw an unfilled square. + * + * If we are at the `y_i' or `y_f' position, draw + * pixels from 'x_i' to 'x_f'. If we are away + * from the `y_i' position, draw two pixels, + * one at `x_i' and the other at `x_f' for that + * current 'y' value. + */ + for (y = y_i; y < y_f; ++y) { + for (x = x_i; x < x_f; ++x) { + p.x = x; + p.y = y; + p.rgb = shape->color; + + /* Origin y, draw entire width */ + if (y == y_i || y == y_f - 1) { + gfx_plot_point(ctx, &p); + continue; + } + + p.x = x_i; + gfx_plot_point(ctx, &p); + + p.x = x_f - 1; + gfx_plot_point(ctx, &p); + } + } + + return 0; +} + +/* + * Plot a single pixel (aka point) onto + * the screen. + * + * @ctx: The graphics context pointer + * @point: Point to plot + * + * Returns 0 on success, otherwise a less + * than zero value. + */ +int +gfx_plot_point(struct gfx_ctx *ctx, const struct gfx_point *point) +{ + uint32_t index; + + if (ctx == NULL || point == NULL) { + return -EINVAL; + } + + /* + * Is this even a valid point on the screen for + * us to plot on? + */ + if (gfx_pixel_bounds(ctx, point->x, point->y) < 0) { + return -1; + } + + /* Plot it !! */ + index = gfx_io_index(ctx, point->x, point->y); + ctx->io[index] = point->rgb; + return 0; +} + +/* + * Grab the RGB value of a single pixel on + * the scren. + * + * @ctx: Graphics context pointer + * @x: X position to sample + * @y: Y position to sample + */ +color_t +gfx_get_pix(struct gfx_ctx *ctx, uint32_t x, uint32_t y) +{ + const color_t ERROR_COLOR = GFX_BLACK; + uint32_t index; + + /* The 'ctx' argument is required */ + if (ctx == NULL) { + return ERROR_COLOR; + } + + /* Are we within bounds of the screen */ + if (gfx_pixel_bounds(ctx, x, y) < 0) { + return ERROR_COLOR; + } + + index = gfx_io_index(ctx, x, y); + return ctx->io[index]; +} + +/* + * Draw a shape onto the screen + * + * @ctx: libgfx graphics context + * @shape: Shape to draw + * + * Returns 0 on success, otherwise a less than zero + * value on failure. + * + * All error codes follow POSIX errno. However if the value + * is -1, the requested shape to be drawn is not valid. + */ +int +gfx_draw_shape(struct gfx_ctx *ctx, const struct gfx_shape *shape) +{ + if (ctx == NULL || shape == NULL) { + return -EINVAL; + } + + switch (shape->type) { + case SHAPE_SQUARE: + return gfx_draw_square(ctx, shape); + case SHAPE_SQUARE_BORDER: + return gfx_draw_bsquare(ctx, shape); + } + + return -1; +} + +/* + * Copy a region on one part of a screen to + * another part of a screen. + * + * @ctx: Graphics context pointer + * @r: Region to copy + * @x: X position for copy dest + * @y: Y position for copy dest + */ +int +gfx_copy_region(struct gfx_ctx *ctx, struct gfx_region *r, scrpos_t x, scrpos_t y) +{ + struct gfx_point point; + color_t pixel; + scrpos_t src_cx, src_cy; + dimm_t w, h; + + if (ctx == NULL || r == NULL) { + return -EINVAL; + } + + w = r->width; + h = r->height; + + for (int xoff = 0; xoff < w; ++xoff) { + for (int yoff = 0; yoff < h; ++yoff) { + /* Source position */ + src_cx = r->x + xoff; + src_cy = r->y + yoff; + + /* Plot the new pixel */ + pixel = gfx_get_pix(ctx, src_cx, src_cy); + point.x = x + xoff; + point.y = y + yoff; + point.rgb = pixel; + gfx_plot_point(ctx, &point); + } + } + + return 0; +} diff --git a/lib/libgfx/src/gfx.c b/lib/libgfx/src/gfx.c new file mode 100644 index 0000000..90dcb79 --- /dev/null +++ b/lib/libgfx/src/gfx.c @@ -0,0 +1,97 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <sys/mman.h> +#include <sys/fbdev.h> +#include <stdio.h> +#include <unistd.h> +#include <fcntl.h> +#include <libgfx/gfx.h> + +/* + * Initialize the libgfx context + * + * @res: Context pointer to be initialized + */ +int +gfx_init(struct gfx_ctx *res) +{ + struct fbattr attr; + int fd, prot; + + if (res == NULL) { + return -EINVAL; + } + + /* Get framebuffer attributes */ + fd = open("/ctl/fb0/attr", O_RDONLY); + if (fd < 0) { + gfx_log("could not open '/ctl/fb0/attr"); + return fd; + } + + read(fd, &attr, sizeof(attr)); + close(fd); + res->fbdev = attr; + + /* Open the framebuffer file */ + res->fbfd = open("/dev/fb0", O_RDWR); + if (res->fbfd < 0) { + gfx_log("could not open '/dev/fb0'\n"); + return res->fbfd; + } + + /* Map the framebuffer into memory */ + prot = PROT_READ | PROT_WRITE; + res->fb_size = attr.height * attr.pitch; + res->io = mmap(NULL, res->fb_size, prot, MAP_SHARED, res->fbfd, 0); + + /* Did the mmap() call work? */ + if (res->io == NULL) { + gfx_log("could not map framebuffer\n"); + close(res->fbfd); + return -1; + } + + return 0; +} + +/* + * Cleanup all state and free the gfx + * context. + */ +void +gfx_cleanup(struct gfx_ctx *ctx) +{ + if (ctx->io != NULL) + munmap(ctx->io, ctx->fb_size); + if (ctx->fbfd > 0) + close(ctx->fbfd); +} diff --git a/lib/liboda/Makefile b/lib/liboda/Makefile new file mode 100644 index 0000000..5b4022c --- /dev/null +++ b/lib/liboda/Makefile @@ -0,0 +1,29 @@ +CFLAGS = -c -fno-stack-protector -nostdlib -static \ + -Iinclude/ -I$(USRDIR)/include/ +CFILES = $(shell find src/ -name "*.c") +OBJ = $(CFILES:.c=.o) + +all: headers $(OBJ) build/liboda.a + echo $(USRDIR) + mv build/liboda.a $(USRDIR)/lib/ + cp -r include/ $(USRDIR)/include/ + +build/liboda.a: + mkdir -p build/ + ar rcs build/liboda.a $(OBJ) + +%.o: %.c + $(CC) $(CFLAGS) -Iinclude/ $< -o $@ + +.PHONY: headers +headers: + cp -rf include/* $(USRDIR)/include/ + +.PHONY: +build/: + mkdir -p build/ + +.PHONY: clean +clean: + rm -f $(OBJ) + rm -rf build/ diff --git a/lib/liboda/include/liboda/input.h b/lib/liboda/include/liboda/input.h new file mode 100644 index 0000000..c74a304 --- /dev/null +++ b/lib/liboda/include/liboda/input.h @@ -0,0 +1,74 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef LIBODA_INPUT_H +#define LIBODA_INPUT_H + +#include <stdint.h> +#include <stddef.h> + +/* + * Macros to help extract scancode and + * character + */ +#define ODA_SCANCODE(KEY) ((KEY) >> 8) +#define ODA_KEYCHAR(KEY) ((char )(KEY) & 0xFF) + +/* + * Key defines + */ +#define ODA_KEY_OTHER 0x0000 +#define ODA_KEY_ESCAPE 0x0001 +#define ODA_KEY_TAB 0x0002 +#define ODA_KEY_BACKSPACE 0x0003 + +/* + * Represents a key press + * + * @type: Key types (see ODA_KEY_*) + * @scancode: Scancode + * @ch: Character + */ +struct oda_key { + uint16_t type; + uint8_t scancode; + char ch; +}; + +/* + * ODA keyboard object for managing keyboard + * input. + */ +struct oda_kbd { + int(*handle_keyev)(struct oda_kbd *kbd, struct oda_key *key); +}; + +int oda_kbd_dispatch(struct oda_kbd *kbd); + +#endif /* !LIBODA_INPUT_H */ diff --git a/lib/liboda/include/liboda/oda.h b/lib/liboda/include/liboda/oda.h new file mode 100644 index 0000000..9d96f2f --- /dev/null +++ b/lib/liboda/include/liboda/oda.h @@ -0,0 +1,128 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef LIBODA_ODA_H +#define LIBODA_ODA_H 1 + +#include <sys/queue.h> +#include <stdint.h> +#include <stddef.h> +#include <liboda/types.h> +#include <libgfx/gfx.h> +#include <libgfx/draw.h> + +/* + * ODA representation of a window. + * + * @wid: Window ID (identifies the window) + * @surface: Window surface descriptor + * @session: Session this window belongs to + */ +struct oda_window { + odawid_t wid; + struct gfx_shape surface; + struct oda_state *session; + TAILQ_ENTRY(oda_window) link; +}; + +/* + * ODA session + * + * @winq: Window queue + * @gctx: Graphics context + * @cookie: State cookie (ODA_COOKIE) + */ +struct oda_state { + TAILQ_HEAD(, oda_window) winq; + struct gfx_ctx gctx; + uint32_t cookie; +}; + +/* + * ODA window attributes. Arguments to be + * passed to oda_window_new() + * + * @session: Current ODA session / state + * @parent: Window parent (NULL for root) + * @pg: Background color (0xRRGGBB) + * @x,y: Window position + * @w,h: Window width [w] and height [h] + */ +struct oda_wattr { + struct oda_state *session; + struct oda_window *parent; + odacolor_t bg; + odapos_t x, y; + odadimm_t w, h; +}; + +/* + * Arguments for oda_movewin() are stored + * within this structure to minimize the + * number of arguments within the function + * signature. + * + * @wp: Window to be moved + * @to_x: X position to move window to + * @to_y: Y position to move window to + */ +struct oda_movewin { + struct oda_window *wp; + odapos_t to_x; + odapos_t to_y; +}; + +/* + * A pixel point that can be plotted + * onto a window. + * + * @x,y: Point position + * @rgb: Color (RGB) + * @window: Window this will be plotted to + * + * Just set x, y, the color (rgb) then point it + * to a window! + */ +struct oda_point { + odapos_t x, y; + odacolor_t rgb; + struct oda_window *window; +}; + +int oda_reqwin(struct oda_wattr *params, struct oda_window **res); +int oda_termwin(struct oda_state *state, struct oda_window *win); + +int oda_plotwin(struct oda_state *state, const struct oda_point *point); +int oda_movewin(struct oda_state *state, struct oda_movewin *params); +int oda_start_win(struct oda_state *state, struct oda_window *win); + +int oda_init(struct oda_state *res); +int oda_shutdown(struct oda_state *state); + +#endif /* !LIBODA_ODA_H */ diff --git a/lib/liboda/include/liboda/odavar.h b/lib/liboda/include/liboda/odavar.h new file mode 100644 index 0000000..d2dbe2e --- /dev/null +++ b/lib/liboda/include/liboda/odavar.h @@ -0,0 +1,59 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef LIBODA_ODAVAR_H +#define LIBODA_ODAVAR_H + +#include <sys/param.h> +#include <sys/errno.h> +#include <liboda/oda.h> + +/* + * Default window attributes + */ +#define DEFAULT_WIN_HEIGHT 200 +#define DEFAULT_WIN_WIDTH 150 + +/* + * Verify that ODA structures have been properly + * initialized before usage to prevent undefined + * behaviour. + */ +#define ODA_COOKIE 0xFAFECAD + +/* + * Verify an ODA cookie - internal usage + */ +__always_inline static inline int +oda_cookie_verify(struct oda_state *state) +{ + return (state->cookie == ODA_COOKIE) ? 0 : -EFAULT; +} + +#endif /* !LIBODA_ODAVAR_H */ diff --git a/lib/liboda/include/liboda/types.h b/lib/liboda/include/liboda/types.h new file mode 100644 index 0000000..ec12330 --- /dev/null +++ b/lib/liboda/include/liboda/types.h @@ -0,0 +1,41 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef LIBODA_TYPE_H +#define LIBODA_TYPE_H + +#include <stdint.h> + +typedef uint32_t odapos_t; /* X/Y positions */ +typedef uint32_t odapix_t; /* RGB pixel */ +typedef odapix_t odacolor_t; /* RGB color */ +typedef uint32_t odadimm_t; /* Dimensions */ +typedef uint32_t odawid_t; /* Window ID */ + +#endif /* !LIBODA_TYPE_H */ diff --git a/lib/liboda/src/input.c b/lib/liboda/src/input.c new file mode 100644 index 0000000..797a9d4 --- /dev/null +++ b/lib/liboda/src/input.c @@ -0,0 +1,88 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/ascii.h> +#include <sys/errno.h> +#include <sys/param.h> +#include <liboda/oda.h> +#include <liboda/input.h> +#include <stdint.h> +#include <stdio.h> + +/* + * Convert key scancode/char values to fixed + * ODA key constants + */ +static inline uint16_t +oda_map_key(const struct oda_key *key) +{ + uint16_t type = ODA_KEY_OTHER; + + switch (key->ch) { + case ASCII_ESC: + type = ODA_KEY_ESCAPE; + break; + case ASCII_HT: + type = ODA_KEY_TAB; + break; + case ASCII_BS: + type = ODA_KEY_BACKSPACE; + break; + } + + return type; +} + +/* + * Dispatch keyboard events. This is typically + * called in an event loop so that keyboard events + * are handled per iteration. + * + * @kbd: Keyboard to monitor + */ +int +oda_kbd_dispatch(struct oda_kbd *kbd) +{ + struct oda_key key; + int input; + + if (kbd == NULL) { + return -EINVAL; + } + + /* Attempt to grab the input */ + if ((input = getchar()) < 0) { + return -EAGAIN; + } + + key.scancode = ODA_SCANCODE(input); + key.ch = ODA_KEYCHAR(input); + key.type = oda_map_key(&key); + return kbd->handle_keyev(kbd, &key); +} diff --git a/lib/liboda/src/oda.c b/lib/liboda/src/oda.c new file mode 100644 index 0000000..0eef523 --- /dev/null +++ b/lib/liboda/src/oda.c @@ -0,0 +1,77 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <stdio.h> +#include <libgfx/gfx.h> +#include <liboda/oda.h> +#include <liboda/odavar.h> + +#define oda_log(fmt, ...) printf("oda: " fmt, ##__VA_ARGS__) + +/* + * Initialize the OSMORA Display Architecture + * (ODA) library. + * + * @res: Initialized ODA state result + * + * Returns 0 on success, otherwise a less than + * zero value. + */ +int +oda_init(struct oda_state *res) +{ + int error; + + /* Ensure the argument is valid */ + if (res == NULL) { + return -EINVAL; + } + + /* + * If this state has already been initialized, + * assume programmer error / undefined behaviour + * and let them know. + */ + if (oda_cookie_verify(res) == 0) { + oda_log("oda_init: 'res' already initialized\n"); + return -EBUSY; + } + + /* Initialize the graphics context */ + error = gfx_init(&res->gctx); + if (error != 0) { + oda_log("oda_init: could not init graphics context\n"); + return error; + } + + TAILQ_INIT(&res->winq); + res->cookie = ODA_COOKIE; + return 0; +} diff --git a/lib/liboda/src/window.c b/lib/liboda/src/window.c new file mode 100644 index 0000000..216b106 --- /dev/null +++ b/lib/liboda/src/window.c @@ -0,0 +1,461 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <sys/queue.h> +#include <stdlib.h> +#include <string.h> +#include <liboda/oda.h> +#include <liboda/odavar.h> +#include <liboda/types.h> +#include <libgfx/gfx.h> +#include <libgfx/draw.h> + +/* + * The window cache is used to reduce how many + * calls to malloc() and free() are made during + * window creation and destruction. + */ +static TAILQ_HEAD(, oda_window) wcache; +static uint32_t wcache_cookie = 0; +static odawid_t next_wid = 1; + +/* + * Pop a window from the window cache. + * Returns NULL there are no more windows. + */ +static struct oda_window * +oda_window_pop(void) +{ + struct oda_window *wdp; + + if (wcache_cookie != ODA_COOKIE) { + TAILQ_INIT(&wcache); + wcache_cookie = ODA_COOKIE; + return NULL; + } + + wdp = TAILQ_FIRST(&wcache); + TAILQ_REMOVE(&wcache, wdp, link); + return wdp; +} + +/* + * Place a window into the window cache. + */ +static void +oda_window_cache(struct oda_window *wdp) +{ + /* Ensure arg is valid */ + if (wdp == NULL) { + return; + } + + if (wcache_cookie != ODA_COOKIE) { + TAILQ_INIT(&wcache); + wcache_cookie = ODA_COOKIE; + } + + TAILQ_INSERT_TAIL(&wcache, wdp, link); +} + +/* + * Allocate an ODP window + * + * Returns NULL on failure + */ +static struct oda_window * +oda_window_alloc(void) +{ + struct oda_window *wdp; + + /* + * First check if there are any entries + * we can grab from the window cache. + */ + wdp = oda_window_pop(); + if (wdp != NULL) { + return wdp; + } + + /* Allocate a new window */ + wdp = malloc(sizeof(*wdp)); + if (wdp == NULL) { + return NULL; + } + + memset(wdp, 0, sizeof(*wdp)); + wdp->wid = next_wid++; + return wdp; +} + +/* + * Release a given ODA window descriptor + * + * @wdp: Window to free + */ +static void +oda_window_release(struct oda_state *state, struct oda_window *wdp) +{ + if (wdp == NULL) { + return; + } + + /* + * It is probably a good idea to ensure previous + * state other than the old window ID is reset + * and zeroed. + */ + wdp->session = NULL; + memset(&wdp->surface, 0, sizeof(wdp->surface)); + + /* + * Now we can remove this window from the list + * of windows we are tracking and add it to the + * cache. + */ + TAILQ_REMOVE(&state->winq, wdp, link); + oda_window_cache(wdp); +} + +/* + * Check if a point is within the bounds of + * a surface. + * + * @wp: Surface to check with point + * @point: Point to check with surface + * + * Returns 0 if the check has passed, + * otherwise a less than zero value. + */ +static int +oda_check_point(struct oda_window *wp, struct oda_point *point) +{ + struct gfx_shape *surf; + scrpos_t win_startx; + scrpos_t win_starty; + scrpos_t win_endx; + scrpos_t win_endy; + + /* Compute start positions */ + surf = &wp->surface; + win_startx = surf->x; + win_starty = surf->y; + + /* Compute end positions */ + win_endx = surf->x + surf->width; + win_endy = surf->y + surf->height; + + /* Check X bounds */ + if (point->x < win_startx || point->x > win_endx) { + return -1; + } + + /* Check Y bounds */ + if (point->y < win_starty || point->y > win_endy) { + return -1; + } + + /* All good */ + return 0; +} + +/* + * Clean up after ourselves and release + * each entry of the wcache. + * + * Returns 0 on success. + */ +static int +oda_free_wcache(void) +{ + struct oda_window *wdp, *next; + + if (wcache_cookie != ODA_COOKIE) { + return -1; + } + + /* + * Go through each entry and call free() + * on them. + */ + wdp = TAILQ_FIRST(&wcache); + while (wdp != NULL) { + next = TAILQ_NEXT(wdp, link); + free(wdp); + wdp = next; + } + return 0; +} + +/* + * Plot a pixel onto a window + * + * @state: ODA state pointer + * @point: Point to plot + * + * Returns 0 on success, otherwise a less than + * zero value. + * + * XXX: The x/y params in the 'point' argument must be + * relative to the start of the window. In other words, + * (0,0) refers to the top left corner of the window. + */ +int +oda_plotwin(struct oda_state *state, const struct oda_point *point) +{ + struct gfx_point pixel; + struct oda_point point_new; + struct oda_window *window; + struct gfx_shape *surf; + odapos_t plotx, ploty; + int error; + + if (state == NULL || point == NULL) { + return -EINVAL; + } + + /* Validate cookie */ + if ((error = oda_cookie_verify(state)) != 0) { + return error; + } + + /* Try to grab the window */ + if ((window = point->window) == NULL) { + return -EINVAL; + } + + surf = &window->surface; + plotx = surf->x + point->x; + ploty = surf->y + point->y; + + /* + * We are going to need to transform the coordinates + * as they are supposed to be coming in relative to + * the window bounds, e.g., (0,0) being the top left + * corner of a window. + */ + point_new = *point; + point_new.x = plotx; + point_new.y = ploty; + + /* Initialize the pixel to plot */ + pixel.x = plotx; + pixel.y = ploty; + pixel.rgb = point->rgb; + + /* Is the point within bounds? */ + error = oda_check_point(window, &point_new); + if (error < 0) { + return error; + } + + gfx_plot_point(&state->gctx, &pixel); + return 0; +} + +/* + * Request a window from the OSMORA Display + * Architecture (ODA). + * + * @params: Arguments + * @res: Resulting pointer for new window + * + * Returns 0 on success, otherwise a less than + * zero value. + */ +int +oda_reqwin(struct oda_wattr *params, struct oda_window **res) +{ + struct oda_window *wp; + struct gfx_shape *surf; + struct oda_state *session; + int error; + + if (params == NULL || res == NULL) { + return -EINVAL; + } + + /* Try to grab the current session */ + if ((session = params->session) == NULL) { + return -EIO; + } + + /* Verify that cookie! */ + if ((error = oda_cookie_verify(session)) != 0) { + return error; + } + + /* Allocate a new window */ + wp = oda_window_alloc(); + if (wp == NULL) { + return -ENOMEM; + } + + /* Initialize the window */ + memset(wp, 0, sizeof(*wp)); + wp->session = session; + TAILQ_INSERT_TAIL(&session->winq, wp, link); + + /* Fix up width/height params */ + if (params->w == 0) + params->w = DEFAULT_WIN_WIDTH; + if (params->h == 0) + params->h = DEFAULT_WIN_HEIGHT; + + /* Initialize the window surface */ + surf = &wp->surface; + surf->color = params->bg; + surf->x = params->x; + surf->y = params->y; + surf->width = params->w; + surf->height = params->h; + surf->type = SHAPE_SQUARE; + *res = wp; + return 0; +} + +/* + * Move a window to a new position on the + * screen. + * + * @state: ODA state pointer + * @params: Arguments to this function + */ +int +oda_movewin(struct oda_state *state, struct oda_movewin *params) +{ + struct oda_window *win; + struct gfx_shape *wsurf; + struct gfx_region r; + odadimm_t w, h; + odapos_t x, y, x_f, y_f; + odapos_t to_x, to_y; + uint32_t i = 0; + int error; + + /* Make sure arguments are valid */ + if (state == NULL || params == NULL) { + return -EINVAL; + } + + /* We need the window */ + if ((win = params->wp) == NULL) { + return -EINVAL; + } + + /* Verify state cookie */ + if ((error = oda_cookie_verify(state)) != 0) { + return error; + } + + wsurf = &win->surface; + to_x = params->to_x; + to_y = params->to_y; + + r.x = wsurf->x; + r.y = wsurf->y; + r.width = wsurf->width; + r.height = wsurf->height; + + /* + * We will copy the window to the new location and + * fill where the old window was with GFX_BLACK. + * + * TODO: Handle overlapping of windows + */ + gfx_copy_region(&state->gctx, &r, to_x, to_y); + wsurf->x = to_x; + wsurf->y = to_y; + return 0; +} + +/* + * Register a window into the current ODA state. + * Everytime a compositor requests a window, we + * must keep track of it. + * + * @state: ODA state pointer + * @win: Pointer of window to register + */ +int +oda_start_win(struct oda_state *state, struct oda_window *win) +{ + int error; + + if (state == NULL || win == NULL) { + return -EINVAL; + } + + /* Make sure the state is valid */ + if ((error = oda_cookie_verify(state)) != 0) { + return error; + } + + gfx_draw_shape(&state->gctx, &win->surface); + return 0; +} + +/* + * Terminate a running window + * + * @state: ODA state pointer + * @win: Win pointer + * + * Returns 0 on success, otherwise a less than + * zero value. + * + * TODO: Cleanup screen + */ +int +oda_termwin(struct oda_state *state, struct oda_window *win) +{ + int error; + + if (state == NULL || win == NULL) { + return -EINVAL; + } + + /* Validate the cookie */ + if ((error = oda_cookie_verify(state)) != 0) { + return error; + } + + oda_window_release(state, win); + return 0; +} + +/* + * Shutdown the ODA library + */ +int +oda_shutdown(struct oda_state *state) +{ + return oda_free_wcache(); +} diff --git a/rc/init.rc b/rc/init.rc new file mode 100644 index 0000000..6979a06 --- /dev/null +++ b/rc/init.rc @@ -0,0 +1,9 @@ +@ +@ /usr/rc/init.rc +@ --------------- +@ Hyra userspace startup script +@ + +/usr/sbin/inject +beep 500 30 +beep 650 30 diff --git a/share/docs/hw/et131x.txt b/share/docs/hw/et131x.txt new file mode 100644 index 0000000..43d7c4f --- /dev/null +++ b/share/docs/hw/et131x.txt @@ -0,0 +1,215 @@ +-------------------------------------- +Unofficial ET131X datasheet. If Agere +doesn't give you shit, OSMORA will + +Author: Ian Marco Moffett +-------------------------------------- + +-- PCI information + +VENDOR ID: 0x11C1 (Agere) +Device ID: 0xED00 + +The ET131X exposes its register interface through +PCI BAR 0. + +-- Device register map (register set list) +| +++ GLOBAL REGS (GLOBAL): + // JAGCore register map (offset BAR[0] + 0x0000) + TX_queue_start_addr [dword] (BAR[0] + 0x0000) + TX_queue_end_addr [dword] (BAR[0] + 0x0004) + RX_queue_start_addr [dword] (BAR[0] + 0x0008) + RX_queue_end_addr [dword] (BAR[0] + 0x000C) + PM_CSR [dword] (BAR[0] + 0x0010) + unused [dword] (BAR[0] + 0x0014) + int_status [dword] (BAR[0] + 0x0018) + int_mask [dword] (BAR[0] + 0x001C) + int_alias_clr_en [dword] (BAR[0] + 0x0020) + int_status_alias [dword] (BAR[0] + 0x0024) + sw_reset [dword] (BAR[0] + 0x0028) + slv_timer [dword] (BAR[0] + 0x002C) + msi_config [dword] (BAR[0] + 0x0030) + loopback [dword] (BAR[0] + 0x0034) + watchdog_timer [dword] (BAR[0] + 0x0038) + ---------------------------------------- + NOTES: + [REGISTER INFORMATION] + - TX_queue_start_addr: + Address of transmit queue start in internal RAM. + - TX_queue_end_addr: + Address of transmit queue end in internal RAM. + - RX_queue_start_addr: + Address of receive queue start in internal RAM. + - RX_queue_end_addr: + Address of receive queue end in internal RAM. + - PM_CSR: + Power management control/status register. + - unused: + Not used, leave alone. + - int_status: + Interrupt status register. + - int_mask: + Interrupt mask register + - int_alias_clr_en: + ???? + - int_status_alias: + ???? + - slv_timer: + ???? - for some sort of timeout + - loopback: + Loopback control register + [0x00000001] -> LOOP MAC + [0x00000002] -> LOOP DMA + - watchdog_timer: + Watchdog timer regieter (nanoseconds) +| [0] -> DISABLED +++ MAC REGISTERS (MAC_REGS): + // JAGCore MAC registers (offset BAR[0] + 0x5000) + cfg1 [dword] (BAR[0] + 0x5000) + cfg2 [dword] (BAR[0] + 0x5004) + ipg [dword] (BAR[0] + 0x5008) + hfdp [dword] (BAR[0] + 0x500C) + max_fm_len [dword] (BAR[0] + 0x5010) + reserved1 [dword] (BAR[0] + 0x5014) + reserved2 [dword] (BAR[0] + 0x5018) + mac_test [dword] (BAR[0] + 0x501C) + mii_mgmt_cfg [dword] (BAR[0] + 0x5020) + mii_mgmt_cmd [dword] (BAR[0] + 0x5024) + mii_mgmt_addr [dword] (BAR[0] + 0x5028) + mii_mgmt_ctrl [dword] (BAR[0] + 0x502C) + mii_mgmt_stat [dword] (BAR[0] + 0x5030) + mii_mgmt_indicator [dword] (BAR[0] + 0x5034) + if_ctrl [dword] (BAR[0] + 0x5038) + if_stat [dword] (BAR[0] + 0x503C) + station_addr1 [dword] (BAR[0] + 0x5040) + station_addr2 [dword] (BAR[0] + 0x5044) + NOTES: + [REGISTER INFORMATION] + - cfg1: + First MAC configuration register. + - cfg2: + Second MAC configuration register. + - ipg: + MAC Interpacket Gap configuration register. + - hfdp: + MAC Half Duplex configuration register. + - max_fm_len: + Max packet length (bytes) sent through MAC without + truncation. + - mac_test: + MAC test registers + - mii_mgmt_cfg: + MAC MII Management Config register. + - mii_mgmt_cmd: + MAC MII Management Command register. + - mii_mgmt_ctrl: + MAC MII Management Control register. + - mii_mgmt_stat: + MAC MII Management Status register. + - mii_mgmt_indicator: + MAC MII Management Indicator register. + - if_ctrl: + MAC interface control register. + - station_addr1: + First MAC station address register. + - station_addr2: + Second MAC station address register. + [BITS] + ------------------------------------- + @ cfg1: + [bits 0]: TX enable + [bits 1]: Syncd TX enable + [bits 2]: RX enable + [bits 3]: Syncd TX enable + [bits 4]: TX flow + [bits 5]: RX flow + [bits 7:6]: Reserved + [bits 8]: Loopback + [bits 15:9]: Reserved + [bits 16]: Reset TX func + [bits 17]: Reset RX func + [bits 18]: Reset TX MC + [bits 19]: Reset RX MC + [bits 29:20]: Reserved + [bits 30]: Sim reset + [bits 31]: Soft reset + @ cfg2: + [bits 0]: Full-duplex + [bits 1]: CRC enable + [bits 2]: Pad CRC + [bits 3]: Unused (undefined) + [bits 4]: Length check + [bits 5]: Huge frame + [bits 7:6]: Reserved + [bits 9:8]: Interface mode + [bits 11:10]: Reserved + [bits 15:12]: Preamble + [bits 31:16]: Reserved + @ ipg: + [bits 7:0]: B2B IPG + [bits 15:8]: Minimum IFG enforce + [bits 22:16]: Non B2B IPG 2 + [bits 23]: Unused (undefined) + [bits 30:24]: Non B2B IPG 1 + [bits 31]: Reserved + @ hfdp: + [bits 9:0]: Collision window + [bits 11:10]: Reserved + [bits 15:12]: Re-transmit max + [bits 16]: Excess defer + [bits 17]: No backoff + [bits 18]: BP no backoff + [bits 19]: Alt BEB enable [1] + [bits 23-20]: Alt BEB trunc [1] + [bits 31-24]: Reserved + | + ++ [1]: BEB refers to Binary Exponential Backoff which is + a method to mitigate collisions by doubling the TX + backoff window (throttling TX rate) per collision. + ------------------------------------- + + +------------------------------------------------------------------ +ET131X REGISTER SPACE NOTES: +------------------------------------------------------------------ +[Padding]: + Each register set exists within a 4096 byte region and some + register sets do not fully span that full length. Therefore + when defining the register space within a struct, one must + be sure to account for such gaps by including 'n' bytes of + padding after each register set. Where 'n' is how many bytes + left to fully span 4096 bytes in other words, '4096 - regset_len'. + +------------------------------------------------------------------ +SOFTWARE RESET PROCCESS: +------------------------------------------------------------------ +#define MAC_CFG1_SOFTRST 0x80000000 /* Soft reset */ +#define MAC_CFG1_SIMRST 0x40000000 /* SIM reset */ +#define MAC_CFG1_RESET_RXMC 0x00080000 /* RX MC reset */ +#define MAC_CFG1_RESET_TXMC 0x00040000 /* TX MC reset */ +#define MAC_CFG1_RESET_RXFUNC 0x00020000 /* RX func reset */ +#define MAC_CFG1_RESET_TXFUNC 0x00010000 /* TX func reset */ +#define GBL_RESET_ALL 0x007F /* Global reset */ +------------------------------------------------------------------ +To perform a software reset, one must write the value of MAC_CFG1_SOFTRST, +MAC_CFG1_SIMRST, MAC_CFG1_RESET_RXMC, MAC_CFG1_RESET_TXMC, MAC_CFG1_RESET_RXFUNC, +and MAC_CFG1_RESET_TXMC combined together with a bitwise OR to the 'cfg1' register +of the 'MAC_REGS' register set. + +This results in the MAC core (aka JAGCore) resetting all internal state +and being brought to halt. + +Once the MAC core is reset, you must be sure to also reset the rest of the card, +(I know, just when you thought you were done). This may be done by writing the +value of GBL_RESET_ALL to the 'sw_reset' register of the 'GLOBAL' register set. +This results in the reset of further state such as state machines for TX DMA, RX DMA, +MAC TX, MAC RX, etc cetera. + +To ensure the TX/RX paths of the MAC core are in a known state, one +must write the value of MAC_CFG1_RESET_RXMC, MAC_CFG1_RESET_TXMC, MAC_CFG1_RESET_RXFUNC, +and MAC_CFG1_RESET_TXMC combined together with a bitwise OR to the 'cfg1' register +of the 'MAC_REGS' register set. + +And finally, you must also make sure the 'cfg1' register of the 'MAC_REGS' register +set is also in a known state by clearing it to 0x00000000. diff --git a/share/docs/kernel/ctlfs.md b/share/docs/kernel/ctlfs.md new file mode 100644 index 0000000..3087f60 --- /dev/null +++ b/share/docs/kernel/ctlfs.md @@ -0,0 +1,125 @@ +# The Hyra control filesystem (ctlfs) + +Written by Ian M. Moffett + +## Rationale + +Historically, Operating Systems of the Unix family typically relied +on syscalls like ``ioctl()`` or similar to perform operations (e.g., making calls through a driver) +via some file descriptor. Let's say for example, one wanted to acquire the framebuffer +dimensions of a given framebuffer device. To start, they'd acquire a file descriptor +by calling ``open()`` or similar on it. Then they'd make their ``ioctl()`` call. + +```c +int fd = ...; + +ioctl(fd, IOCTL_FBINFO, &fb_info); +... +``` + +While this works fine and is relatively simple to use from the user's +perspective, it is very clunky when you pop the hood and peer into the +inner-workings of it within the kernel. The number of possible requests +that can be passed through a file descriptor can grow quite rapidly which +can require really large switch statements within the drivers that implement +an ``ioctl()`` interface. + +## Replacing ``ioctl()`` + +Hyra provides ctlfs, an abstract in-memory filesystem designed for +setting/getting various kernel / driver parameters and state via +the filesystem API. The control filesystem consists of several +instances of two fundamentals: "control nodes" and "control entries". + +### Control nodes + +Control nodes are simply directories within the ``/ctl`` root. For example, +console specific control files are in the ``/ctl/console`` node. + +### Control entries + +Control entries are simply files within specific control nodes. For example +console features may be find in the ``consfeat`` entry of the ``console`` node +(i.e., ``/ctl/console/consfeat``). + +See ``sys/include/sys/console.h`` and ``sys/fs/ctlfs.h`` for more +information. + +## The ctlfs API + +The Hyra kernel provides an API for subsystems and drivers +to create their own ctlfs entries and nodes. This may be found +in sys/include/fs/ctlfs.h + +### Control operations + +Each control entry must define their own set of +"control operations" described by the ``ctlops`` structure: + +```c +struct ctlops { + int(*read)(struct ctlfs_dev *cdp, struct sio_txn *sio); + int(*write)(struct ctlfs_dev *cdp, struct sio_txn *sio); + ... +}; +``` + +NOTE: Callbacks defined as ``NULL`` will be +ignored and unused. + +## "Meow World": Creating a ctlfs entry + +```c +#include <sys/types.h> +#include <sys/sio.h> +#include <fs/ctlfs.h> + +static const struct ctlops meow_ctl; + +/* + * Ctlfs read callback - this will be called + * when "/ctl/meow/hii" is read. + */ +static int +ctl_meow_read(struct ctlfs_dev *cdp, struct sio_txn *sio) +{ + char data[] = "Meow World!"" + + /* Clamp the input length */ + if (sio->len > sizeof(data)) { + sio->len = sizeof(data) + } + + /* End of the data? */ + if ((sio->offset + sio->len) > sizeof(data)) { + return 0; + } + + /* Copy the data and return the length */ + memcpy(sio->buf, &data[sio->offset], sio->len); + return sio->len; +} + +static int +foo_init(void) +{ + char ctlname[] = "meow"; + struct ctlfs_dev ctl; + + /* + * Here we create the "/ctl/meow" node. + */ + ctl.mode = 0444; + ctl.devname = devname; + ctlfs_create_node(devname, &ctl); + + ctl.ops = &fb_size_ctl; + ctlfs_create_entry("attr", &ctl); + return 0; +} + +static const struct ctlops meow_ctl = { + .read = ctl_meow_read, + .write = NULL, +}; +``` diff --git a/share/docs/kernel/disk.txt b/share/docs/kernel/disk.txt new file mode 100644 index 0000000..4b7f6e5 --- /dev/null +++ b/share/docs/kernel/disk.txt @@ -0,0 +1,49 @@ +======================================= + Device filesystem (/dev) interface +======================================= + + USER + / \ + /dev/sd0, /dev/sd1 + / \ + namei() namei() + / \ + vop() vop() + / \ + driver driver + / \ + HARD DRIVE 0 HARD DRIVE 1 + +======================================= + Hyra disk engine framework +======================================= + USER + | + HDEI [ hyra disk-engine interface: like disk_io() ] + kernel -- | + HDE [ hyra disk engine: drives the core disk logic ] + | + HDF [ hyra disk framework (core logic) ] + / \ + HARD DRIVE 0 HARD DRIVE 1 + + + [DRIVER] <-> [DISK ENGINE] + ^ + | + V + [ SLS / FILESYSTEM] + ^ + | + V + [USER] + + + NOTES: + + - Unix filesystem-like strucuture with indirection + for orthogonally persistent objects + + - Explicit storage lifetime (i.e., persistent or ephemeral) + during allocation at a page-level granularity + diff --git a/share/docs/lib/liboda.md b/share/docs/lib/liboda.md new file mode 100644 index 0000000..e5345a4 --- /dev/null +++ b/share/docs/lib/liboda.md @@ -0,0 +1,229 @@ +# The OSMORA Display Architecture (ODA) + +Written by Ian M. Moffett + +## Introduction + +The OSMORA Display Architecture (ODA) is a protocol describing how +a compositor should create and manage graphical windows. A graphical +session in Hyra consists of a compositor, window management system and +management of user input. + +There are many existing display architectures out there. Take for instace, the X11 +protocol. X11 for example, has the concept of an "X server" in which window managers +or certain graphical programs would connect to as a means of performing interprocess +communication (IPC). The idea is that X will service graphics related requests from +the window manager or compositor. + +While this works just fine, the highly centralized nature of X11 or similar protocols +may complicate the flexibility of the graphics stack. On the other hand with ODA, a +compositor links with the ODA library and becomes the server for window managers running +on the system. The idea of ODA is to minimize complexity while preserving flexibility. + +Additionally, the compositor should provide its own API for use by window management +software. + +## Scope + +This document serves to describe common OSMORA Display Architecture (ODA) concepts +as well as providing basic example C sources showcasing how compositors and window +managers may interface with the described APIs for various needs. + +## Terminology + +### OSMORA Display Architecture (ODA): + +OSMORA protocol defining common interfaces for C2W and +W2C interactions. + +### Compositor to window (C2W): + +Describes the direction of communication originating from +a compositor and directed towards a specific window: + +``COMPOSITOR -> WINDOW`` + +### Window to compositor (W2C): + +Describes the direction of communication originating from +a specific window to a compositor running on the system: + +``WINDOW -> COMPOSITOR`` + +## Architecture + +``` ++-------------+ +| LIBGFX | ++-------------+ + ^ + | linked with libgfx + V ++-------------+ +| COMPOSITOR | ++-------------+ <---+ signal + | | | | + | | | | c2w: <winop: e.g., close> + | | | | w2c: <winop to accept: e.g., close> + WIN WIN WIN <---+ +``` + +### C2W signal flow: + +``` +-- CLOSE SIGNAL EXAMPLE -- + +WINDOW RECEIVES CLOSE SIGNAL + | + ECHO BACK TO COMPOSITOR + | + YES ---+--- NO + | | + | V + | nothing happens + | + V + window is destroyed by compositor +``` + +## Libgfx + +The Hyra userspace includes ``libgfx`` which is a low-level graphics library aimed +to facilitate drawing on the screen and performing various graphical operations while +decoupling from the concept of compositors, windows and the ODA as a whole. In other words, +libgfx has no knowledge of anything outside of the framebuffer and itself. + +The following is an example of how one may draw a yellow square at +x/y (30,0): + +```c +#include <libgfx/gfx.h> /* Common routines/defs */ +#include <libgfx/draw.h> /* Drawing related routines/defs */ + +int +main(void) +{ + struct gfx_ctx ctx; + struct gfx_shape sh = GFX_SHAPE_DEFAULT; + int error; + + /* Set the x/y and color */ + sh.x = 30; + sh.y = 0; + sh.color = GFX_YELLOW + + error = gfx_init(&ctx); + if (error < 0) { + printf("gfx_init returned %d\n", error); + return error; + } + + /* Draw the square and cleanup */ + gfx_draw_shape(&ctx, &sh); + gfx_cleanup(&ctx); + return 0; +} +``` + +## Liboda + +The Hyra userspace includes the ``liboda`` library which includes various +interfaces conforming to the OSMORA Display Architecture (ODA). + +### Linking a compositor with liboda + +In order for an ODA compliant compositor to reference library +symbols for ``liboda``, it should use the following linker flags: + +``... -loda -logfx`` + +### ODA Session + +For the ODA library to keep track of state, it relies on an ``oda_state`` +structure defined in ``liboda/oda.h``. Additionally, in order for any ODA +library calls to be made, the compositor must initialize the library with +``oda_init()`` like in the following example: + +```c +#include <liboda/oda.h> + +struct oda_state state; +int error; + +/* Returns 0 on success */ +error = oda_init(&state); +... +``` + +Upon failure of ``oda_init()`` a negative POSIX errno value +is returned (see ``sys/errno.h``). + +### Using liboda to request windows + +A compositor may request windows from the ODA by using +``oda_reqwin()`` like in the following example: + +```c +#include <liboda/oda.h> + +... +struct oda_wattr wattr; +struct oda_state state; + +... + +wattr.session = &state; +wattr.parent = NULL; +wattr.bg = GFX_YELLOW; +wattr.x = 200; +wattr.y = 150; +wattr.w = 120; +wattr.h = 300; + +/* Returns 0 on success */ +error = oda_reqwin(&wattr, &win); +``` + +Arguments passed to ``oda_reqwin()`` are first stored in a ``struct oda_wattr`` +structure to minimize the number of parameters used in the function signature. + +Upon failure of ``oda_reqwin()`` a negative POSIX errno value +is returned (see ``sys/errno.h``). + +### Input management + +The liboda library additionally provides an input API that facilitates +management of user input (e.g., keyboard). + +(See ``liboda/input.h``) + +#### The ``oda_key`` structure + +ODA provides a standard description of keys received from a keyboard +device. Keyboard input is represented by the ``oda_key`` structure shown +below: + +```c +struct oda_key { + uint16_t type; + uint8_t scancode; + char ch; + ... +}; +``` + +The ``type`` field describes the key type, valid key types can be +found within the ``ODA_KEY_*`` definitions in ``liboda/input.h``. + +The ``scancode`` field contains the raw keyboard scancode received +from the device. + +The ``ch`` field contains the ASCII representation of the input received +from the device. + +#### The ``oda_kbd`` structure + +ODA represents keyboard devices through the ``oda_kbd`` structure found +in ``liboda/input.h``. This structure contains callbacks that are set up +by the compositor to be invoked when their respective keyboard related +event occurs. diff --git a/share/man/man1/beep.1 b/share/man/man1/beep.1 new file mode 100644 index 0000000..9905952 --- /dev/null +++ b/share/man/man1/beep.1 @@ -0,0 +1,45 @@ +.\" Copyright (c) 2025 Ian Marco Moffett and the Osmora Team. +.\" All rights reserved. +.\" +.\" Redistribution and use in source and binary forms, with or without +.\" modification, are permitted provided that the following conditions are met: +.\" +.\" 1. Redistributions of source code must retain the above copyright notice, +.\" this list of conditions and the following disclaimer. +.\" 2. Redistributions in binary form must reproduce the above copyright +.\" notice, this list of conditions and the following disclaimer in the +.\" documentation and/or other materials provided with the distribution. +.\" 3. Neither the name of Hyra nor the names of its +.\" contributors may be used to endorse or promote products derived from +.\" this software without specific prior written permission. +.\" +.\" THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +.\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +.\" IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +.\" ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE +.\" LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR +.\" CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF +.\" SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +.\" INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +.\" CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) +.\" ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE +.\" POSSIBILITY OF SUCH DAMAGE. +.Dd Jul 17 2025 +.Dt BEEP 1 +.Os HYRA +.Sh NAME +.Nm beep - beep the speaker +.Sh SYNOPSIS +beep [freq] [duration] + +.Sh DESCRIPTION + +The +.Nm +command beeps the PC speaker at a given frequency ('freq') in hertz for +a given duration ('duration') in milliseconds. This can be useful scripts +that notify the user or just for fun! Just beware that it can get very annoying +very fast! + +.Sh AUTHORS +.An Ian Moffett Aq Mt ian@osmora.org diff --git a/share/man/man1/cat.1 b/share/man/man1/cat.1 new file mode 100644 index 0000000..1759407 --- /dev/null +++ b/share/man/man1/cat.1 @@ -0,0 +1,52 @@ +.\" Copyright (c) 2025 Ian Marco Moffett and the Osmora Team. +.\" All rights reserved. +.\" +.\" Redistribution and use in source and binary forms, with or without +.\" modification, are permitted provided that the following conditions are met: +.\" +.\" 1. Redistributions of source code must retain the above copyright notice, +.\" this list of conditions and the following disclaimer. +.\" 2. Redistributions in binary form must reproduce the above copyright +.\" notice, this list of conditions and the following disclaimer in the +.\" documentation and/or other materials provided with the distribution. +.\" 3. Neither the name of Hyra nor the names of its +.\" contributors may be used to endorse or promote products derived from +.\" this software without specific prior written permission. +.\" +.\" THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +.\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +.\" IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +.\" ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE +.\" LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR +.\" CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF +.\" SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +.\" INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +.\" CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) +.\" ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE +.\" POSSIBILITY OF SUCH DAMAGE. +.Dd Aug 6 2025 +.Dt CAT 1 +.Os HYRA +.Sh NAME +.Nm cat - concatenate files and print to standard output +.Sh SYNOPSIS +cat [FILE] ... + +.Sh DESCRIPTION + +The +.Nm +command can be used concatenate files or simply write their contents +to standard output. + +.Bd -literal +[-n]: Number each line +[-b]: Number each non-blank line +.Ed + +.Sh SEE ALSO + +mex(1) + +.Sh AUTHORS +.An Ian Moffett Aq Mt ian@osmora.org diff --git a/share/man/man1/echo.1 b/share/man/man1/echo.1 new file mode 100644 index 0000000..6adf192 --- /dev/null +++ b/share/man/man1/echo.1 @@ -0,0 +1,47 @@ +.\" Copyright (c) 2025 Ian Marco Moffett and the Osmora Team. +.\" All rights reserved. +.\" +.\" Redistribution and use in source and binary forms, with or without +.\" modification, are permitted provided that the following conditions are met: +.\" +.\" 1. Redistributions of source code must retain the above copyright notice, +.\" this list of conditions and the following disclaimer. +.\" 2. Redistributions in binary form must reproduce the above copyright +.\" notice, this list of conditions and the following disclaimer in the +.\" documentation and/or other materials provided with the distribution. +.\" 3. Neither the name of Hyra nor the names of its +.\" contributors may be used to endorse or promote products derived from +.\" this software without specific prior written permission. +.\" +.\" THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +.\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +.\" IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +.\" ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE +.\" LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR +.\" CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF +.\" SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +.\" INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +.\" CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) +.\" ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE +.\" POSSIBILITY OF SUCH DAMAGE. +.Dd Jul 17 2025 +.Dt ECHO 1 +.Os HYRA +.Sh NAME +.Nm echo - print a line of text +.Sh SYNOPSIS +echo [STRING] + +.Sh DESCRIPTION + +The +.Nm +command displays a given string to the console. Used within scripts for logging +information or debugging. An example usage of this command is: + +.Bd -literal +echo MEOWWWW !!! +.Ed + +.Sh AUTHORS +.An Ian Moffett Aq Mt ian@osmora.org diff --git a/share/man/man1/mex.1 b/share/man/man1/mex.1 new file mode 100644 index 0000000..8d19752 --- /dev/null +++ b/share/man/man1/mex.1 @@ -0,0 +1,48 @@ +.\" Copyright (c) 2025 Ian Marco Moffett and the Osmora Team. +.\" All rights reserved. +.\" +.\" Redistribution and use in source and binary forms, with or without +.\" modification, are permitted provided that the following conditions are met: +.\" +.\" 1. Redistributions of source code must retain the above copyright notice, +.\" this list of conditions and the following disclaimer. +.\" 2. Redistributions in binary form must reproduce the above copyright +.\" notice, this list of conditions and the following disclaimer in the +.\" documentation and/or other materials provided with the distribution. +.\" 3. Neither the name of Hyra nor the names of its +.\" contributors may be used to endorse or promote products derived from +.\" this software without specific prior written permission. +.\" +.\" THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +.\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +.\" IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +.\" ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE +.\" LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR +.\" CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF +.\" SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +.\" INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +.\" CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) +.\" ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE +.\" POSSIBILITY OF SUCH DAMAGE. +.Dd Jul 17 2025 +.Dt MEX 1 +.Os HYRA +.Sh NAME +.Nm mex - perform a hexdump on a file +.Sh SYNOPSIS +mex [ /path/to/file ] + +.Sh DESCRIPTION + +The +.Nm +command dumps the bytes of a given file (specified by a path) in +base-16 (hexadecimal) representation. It is useful for debugging, +binary analysis, and satisfying ones nagging curiosity. + +.Sh SEE ALSO + +cat(1) + +.Sh AUTHORS +.An Ian Moffett Aq Mt ian@osmora.org diff --git a/share/man/man1/nerve.1 b/share/man/man1/nerve.1 new file mode 100644 index 0000000..8f2d19e --- /dev/null +++ b/share/man/man1/nerve.1 @@ -0,0 +1,73 @@ +.\" Copyright (c) 2025 Ian Marco Moffett and the Osmora Team. +.\" All rights reserved. +.\" +.\" Redistribution and use in source and binary forms, with or without +.\" modification, are permitted provided that the following conditions are met: +.\" +.\" 1. Redistributions of source code must retain the above copyright notice, +.\" this list of conditions and the following disclaimer. +.\" 2. Redistributions in binary form must reproduce the above copyright +.\" notice, this list of conditions and the following disclaimer in the +.\" documentation and/or other materials provided with the distribution. +.\" 3. Neither the name of Hyra nor the names of its +.\" contributors may be used to endorse or promote products derived from +.\" this software without specific prior written permission. +.\" +.\" THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +.\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +.\" IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +.\" ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE +.\" LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR +.\" CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF +.\" SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +.\" INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +.\" CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) +.\" ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE +.\" POSSIBILITY OF SUCH DAMAGE. +.Dd Jul 18 2025 +.Dt NERVE 1 +.Os HYRA +.Sh NAME +.Nm nerve - interact with control files +.Sh SYNOPSIS +nerve <verb> [ .. payload for pokes ..] + +verb 'poke': Poke a nerve + +verb 'peek': Peek at a nerve + +nerve ending 'consattr': Console attributes + +nerve ending 'consfeat': Console features + +.Sh DESCRIPTION + +The +.Nm +command can be used to modify system attributes and behaviour through various +nerve endings (e.g., control files, et cetera). To drive a nerve, one must provide +a verb (describing an operation) as well as a payload. An example of this command +is moving the cursor position to the HOME (0, 0) position: + +.Bd -literal +nerve poke consattr 0 0 + / / / / + verb nerve [x] [y] +.Ed + +A nerve may also be peeked at by using the 'peek' verb. Here is an example of the usage +of this verb: + +.Bd -literal +nerve peek consfeat + / / + verb nerve + +output: + ansi_esc=1 + show_curs=0 + ... +.Ed + +.Sh AUTHORS +.An Ian Moffett Aq Mt ian@osmora.org diff --git a/share/man/man1/osh.1 b/share/man/man1/osh.1 new file mode 100644 index 0000000..1b2744c --- /dev/null +++ b/share/man/man1/osh.1 @@ -0,0 +1,83 @@ +.\" Copyright (c) 2025 Ian Marco Moffett and the Osmora Team. +.\" All rights reserved. +.\" +.\" Redistribution and use in source and binary forms, with or without +.\" modification, are permitted provided that the following conditions are met: +.\" +.\" 1. Redistributions of source code must retain the above copyright notice, +.\" this list of conditions and the following disclaimer. +.\" 2. Redistributions in binary form must reproduce the above copyright +.\" notice, this list of conditions and the following disclaimer in the +.\" documentation and/or other materials provided with the distribution. +.\" 3. Neither the name of Hyra nor the names of its +.\" contributors may be used to endorse or promote products derived from +.\" this software without specific prior written permission. +.\" +.\" THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +.\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +.\" IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +.\" ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE +.\" LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR +.\" CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF +.\" SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +.\" INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +.\" CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) +.\" ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE +.\" POSSIBILITY OF SUCH DAMAGE. +.Dd Aug 2 2025 +.Dt OSH 1 +.Os HYRA +.Sh NAME +.Nm osh - OSMORA shell +.Sh SYNOPSIS +osh [optional file] + +.Sh DESCRIPTION + +OSH is a simple shell interpreter that is capable of executing commands +from the user via stdin or a shell script file passed as an argument. + +.Sh COMMENTS +OSH supports the use of comments (i.e., pieces of text ignored by the shell) +denoted by '@'. The following is an example of using comments: + +.Bd -literal +echo hello !! @ Echos the text "hello !!" +.Ed + +.Sh DEFINITIONS +OSH defines "control operators" as any character(s) reserved by OSH for +representing specific operations (e.g., background jobs, command repetition, etc): + +The +.Ft '&' +control operator is used after a command or binary path +in order to run the executable as a background job, allowing +the shell to continue immediately. Here is an example of running "sleep" in the background: +.Bd -literal +-- +@ +@ Usually this will hang the shell for 5 +@ seconds until sleep wakes up. However, +@ when we postpend '&', the shell executes +@ 'sleep' as a background job and continues +@ as usual. +@ +sleep 5 & +-- +.Ed + +The +.Ft '!!' +control operator is used to repeat the most recently used +command. This is simply written by itself like this: + +.Bd -literal +-- +echo "hewwo" @ Echo "hewwo" +!! @ Do it again... +-- +.Ed + +.Sh AUTHORS +.An Ian Moffett Aq Mt ian@osmora.org diff --git a/share/man/man2/exit.2 b/share/man/man2/exit.2 new file mode 100644 index 0000000..8342f50 --- /dev/null +++ b/share/man/man2/exit.2 @@ -0,0 +1,55 @@ +.\" Copyright (c) 2025 Ian Marco Moffett and the Osmora Team. +.\" All rights reserved. +.\" +.\" Redistribution and use in source and binary forms, with or without +.\" modification, are permitted provided that the following conditions are met: +.\" +.\" 1. Redistributions of source code must retain the above copyright notice, +.\" this list of conditions and the following disclaimer. +.\" 2. Redistributions in binary form must reproduce the above copyright +.\" notice, this list of conditions and the following disclaimer in the +.\" documentation and/or other materials provided with the distribution. +.\" 3. Neither the name of Hyra nor the names of its +.\" contributors may be used to endorse or promote products derived from +.\" this software without specific prior written permission. +.\" +.\" THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +.\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +.\" IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +.\" ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE +.\" LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR +.\" CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF +.\" SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +.\" INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +.\" CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) +.\" ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE +.\" POSSIBILITY OF SUCH DAMAGE. +.Dd Jul 17 2025 +.Dt EXIT 2 +.Os HYRA +.Sh NAME +.Nm exit, _Exit +.Sh SYNOPSIS +#include <stdlib.h> + +[[noreturn]] void exit(int status) + +[[noreturn]] void _Exit(int status) + +.Sh DESCRIPTION + +The exit() function terminates the calling process while calling exit +handlers and performing libc specific cleanups. On the other hand, the +_Exit() function terminates the calling process *immediately* bypassing +internal libc exit routines and cleanup hooks. + +The value +.Ft status[7:0] +is returned to the parent process to indicate the reason of process termination. + +.Sh RETURN VALUE + +These functions do not return + +.Sh AUTHORS +.An Ian Moffett Aq Mt ian@osmora.org diff --git a/share/man/man9/kconf.9 b/share/man/man9/kconf.9 new file mode 100644 index 0000000..0257e9b --- /dev/null +++ b/share/man/man9/kconf.9 @@ -0,0 +1,81 @@ +.\" Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. +.\" All rights reserved. +.\" +.\" Redistribution and use in source and binary forms, with or without +.\" modification, are permitted provided that the following conditions are met: +.\" +.\" 1. Redistributions of source code must retain the above copyright notice, +.\" this list of conditions and the following disclaimer. +.\" 2. Redistributions in binary form must reproduce the above copyright +.\" notice, this list of conditions and the following disclaimer in the +.\" documentation and/or other materials provided with the distribution. +.\" 3. Neither the name of Hyra nor the names of its +.\" contributors may be used to endorse or promote products derived from +.\" this software without specific prior written permission. +.\" +.\" THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +.\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +.\" IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +.\" ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE +.\" LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR +.\" CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF +.\" SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +.\" INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +.\" CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) +.\" ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE +.\" POSSIBILITY OF SUCH DAMAGE. +.Dd Jun 7 2025 +.Dt KCONF 9 +.Os Hyra +.Sh NAME +.Nm kconf - Hyra kernel configuration +.Sh SYNOPSIS +GENERIC configuration: +.Ft sys/arch/<arch>/conf/GENERIC + +Kconf sources: +.Ft tools/kconf/ + +.Sh DESCRIPTION + +Hyra provides the kconf format for kernel configuration by allowing +the user to create defines that represent yes/no options and fixed values. + +Running kconf on a configuration file results in define flags (-D__KEY=val) to +be generated so that they may be passed to the compiler of choice. + +The +.Ft option +keyword allows users to define an option that +can either be yes or no. For example, the following +may be used to create an option "FOO" to be set to "yes": + +.Ft option FOO yes + +This will be given to the kernel as __FOO, for yes/no options the value +of either 1 (yes) or 0 will be given. + +Similarly, a user may create a define that holds a fixed value +by using the +.Ft setval +keyword. + +For example, the following may be used to create an option +"MEOW" set to 0xCA7F00D: + +.Ft setval MEOW 0xCA7F00D + +These options can be read within the kernel by checking if +the define exists and potentially falling back to a default +value if not. This example shows how "MEOW" can be read: + +.Bd -literal +#if defined(__MEOW) /* Option is prefixed with "__" */ +#define MEOW __MEOW +#else +#define MEOW 0 +#endif /* __MEOW */ +.Ed + +.Sh AUTHORS +.An Ian Moffett Aq Mt ian@osmora.org diff --git a/share/man/man9/mmio.9 b/share/man/man9/mmio.9 index 7833cb0..4ede196 100644 --- a/share/man/man9/mmio.9 +++ b/share/man/man9/mmio.9 @@ -59,5 +59,8 @@ argument can be either a physical address or virtual address; however, it is recommended to use virtual addresses for the sake of consistency. +.Sh SEE ALSO +.Xr vm_map 9, + .Sh AUTHORS .An Ian Moffett Aq Mt ian@osmora.org diff --git a/share/man/man9/vm.9 b/share/man/man9/vm.9 new file mode 100644 index 0000000..7601a45 --- /dev/null +++ b/share/man/man9/vm.9 @@ -0,0 +1,46 @@ +.\" Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. +.\" All rights reserved. +.\" +.\" Redistribution and use in source and binary forms, with or without +.\" modification, are permitted provided that the following conditions are met: +.\" +.\" 1. Redistributions of source code must retain the above copyright notice, +.\" this list of conditions and the following disclaimer. +.\" 2. Redistributions in binary form must reproduce the above copyright +.\" notice, this list of conditions and the following disclaimer in the +.\" documentation and/or other materials provided with the distribution. +.\" 3. Neither the name of Hyra nor the names of its +.\" contributors may be used to endorse or promote products derived from +.\" this software without specific prior written permission. +.\" +.\" THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +.\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +.\" IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +.\" ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE +.\" LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR +.\" CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF +.\" SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +.\" INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +.\" CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) +.\" ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE +.\" POSSIBILITY OF SUCH DAMAGE. +.Dd Jun 6 2024 +.Dt VM 9 +.Os Hyra +.Sh NAME +.Nm vm - hyra virtual memory subsystem +.Sh SYNOPSIS +.In vm/vm.h + +.Sh DESCRIPTION +The Hyra virtual memory subsystem is a crucial subsystem within the +kernel. This subsystem facilitates machine independent management of +per-process virtual address spaces and has many frameworks within that +allow abstractions over various things such as pages, memory mapping, and +objects. + +.Sh AUTHORS +.An Ian Moffett Aq Mt ian@osmora.org + +.Sh SEE ALSO +.Xr vm_map 9 diff --git a/share/man/man9/vm_map.9 b/share/man/man9/vm_map.9 new file mode 100644 index 0000000..9c5a3f6 --- /dev/null +++ b/share/man/man9/vm_map.9 @@ -0,0 +1,97 @@ +.\" Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. +.\" All rights reserved. +.\" +.\" Redistribution and use in source and binary forms, with or without +.\" modification, are permitted provided that the following conditions are met: +.\" +.\" 1. Redistributions of source code must retain the above copyright notice, +.\" this list of conditions and the following disclaimer. +.\" 2. Redistributions in binary form must reproduce the above copyright +.\" notice, this list of conditions and the following disclaimer in the +.\" documentation and/or other materials provided with the distribution. +.\" 3. Neither the name of Hyra nor the names of its +.\" contributors may be used to endorse or promote products derived from +.\" this software without specific prior written permission. +.\" +.\" THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +.\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +.\" IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +.\" ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE +.\" LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR +.\" CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF +.\" SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS +.\" INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN +.\" CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) +.\" ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE +.\" POSSIBILITY OF SUCH DAMAGE. +.Dd Jun 6 2024 +.Dt VM_MAP 9 +.Os Hyra +.Sh NAME +.Nm vm_map - create/destory a virtual memory mapping +.Sh SYNOPSIS +.In vm/map.h + +.Ft int +.Fn vm_map "struct vas vas" "vaddr_t va" "paddr_t pa" "vm_prot_t prot" "size_t count" + +.Ft int +.Fn vm_unmap "struct vas vas" "vaddr_t va" "size_t count" + +.Sh DESCRIPTION + +The Hyra virtual memory mapping framework provides a machine independent +interface for mapping and unmapping pages to respective page frames. + +The +.Fn vm_map +function creates a virtual to physical memory mapping. + +The +.Fa vas +argument specifies the virtual address space for the mapping +to be created within. + +The +.Fa va +argument specifies the virtual address to be mapped. + +The +.Fa pa +argument specifies the physical address that +.Fa va +is to be mapped to. + +The +.Fa prot +argument specifies the virtual memory protection flags. + +The +.Fa count +argument specifies the number of bytes to be mapped which +is to be aligned to the machine's page size. + +The +.Fn vm_unmap +function destroys a virtual to physical memory mapping. + +The +.Fa vas +argument specifies the virtual address space for the mapping +to be destroyed within. + + +The +.Fa va +argument specifies the virtual address to be unmapped. + +The +.Fa count +argument specifies the number of bytes to be unmapped which +is to be aligned to the machine's page size. + +.Sh AUTHORS +.An Ian Moffett Aq Mt ian@osmora.org + +.Sh SEE ALSO +.Xr vm_map 9 diff --git a/share/misc/tmpfs b/share/misc/tmpfs new file mode 100644 index 0000000..38eac22 --- /dev/null +++ b/share/misc/tmpfs @@ -0,0 +1,15 @@ +---------------------------------------------------- +| Readable + writable in-memory filesystem (tmpfs) | ++--------------------------------------------------+ +| Author: Ian Marco Moffett | ++--------------------------------------------------+ + +------------------------------------------------------------------------------ + + [d] /tmp/ -> [next] -> foo.txt -> [next] -> bar.txt + \ + +> /tmp/noises/ -> [next] -> mrow.txt -> [next] -> squeak.txt + \ + +> /tmp/noises1/ -> [next] -> bark.bin -> [next] -> wrff.txt + +------------------------------------------------------------------------------ diff --git a/sys/arch/aarch64/aarch64/exception.c b/sys/arch/aarch64/aarch64/exception.c new file mode 100644 index 0000000..d6f1f97 --- /dev/null +++ b/sys/arch/aarch64/aarch64/exception.c @@ -0,0 +1,128 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/syslog.h> +#include <sys/param.h> +#include <sys/cdefs.h> +#include <machine/cdefs.h> +#include <machine/exception.h> + +#define pr_trace(fmt, ...) kprintf("exception: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) + +static inline void +log_esr_class(uint8_t class) +{ + switch (class) { + case EC_WF: + pr_error("trapped WF\n"); + break; + case EC_MCRMRC: + pr_error("trapped MCR/MRC\n"); + break; + case EC_MCRRC: + pr_trace("trapped MCRR/MRRC\n"); + break; + case EC_LDCSTC: + pr_error("trapped LDC/STC\n"); + break; + case EC_SVE: + pr_trace("trapped SVE/SIMD/FP operation\n"); + break; + case EC_BRE: + pr_error("ibt: bad branch target\n"); + break; + case EC_ILLX: + pr_error("illegal execution state\n"); + break; + case EC_SVC64: + /* TODO */ + pr_error("supervisor call (TODO)!!\n"); + break; + case EC_PCALIGN: + pr_error("PC alignment fault\n"); + break; + case EC_DABORT: + case EC_EDABORT: + pr_error("data abort\n"); + break; + case EC_SPALIGN: + pr_error("SP alignment fault\n"); + break; + case EC_SERR: + pr_error("system error\n"); + break; + default: + pr_error("unknown exception\n"); + } +} + +static void +regdump(struct trapframe *tf, uint64_t elr) +{ + kprintf(OMIT_TIMESTAMP + "X0=%p X1=%p X2=%p\n" + "X3=%p X4=%p X5=%p\n" + "X6=%p X7=%p X8=%p\n" + "X9=%p X10=%p X11=%p\n" + "X12=%p X13=%p X14=%p\n" + "X15=%p X16=%p X17=%p\n" + "X18=%p X19=%p X20=%p\n" + "X21=%p X22=%p X23=%p\n" + "X24=%p X25=%p X26=%p\n" + "X27=%p X28=%p X29=%p\n" + "X30=%p\n" + "ELR=%p\n", + tf->x0, tf->x1, tf->x2, tf->x3, + tf->x4, tf->x5, tf->x6, tf->x7, + tf->x8, tf->x9, tf->x10, tf->x11, + tf->x12, tf->x13, tf->x14, tf->x15, + tf->x16, tf->x17, tf->x18, tf->x19, + tf->x20, tf->x21, tf->x22, tf->x23, + tf->x24, tf->x25, tf->x26, tf->x27, + tf->x28, tf->x29, tf->x30, elr); +} + +/* + * Handle an exception + * + * @esr: Copy of the Exception Syndrome Register + */ +void +handle_exception(struct trapframe *tf) +{ + uint8_t class; + + class = (tf->esr >> 26) & 0x3F; + log_esr_class(class); + regdump(tf, tf->elr); + for (;;) { + md_hlt(); + } +} diff --git a/sys/arch/aarch64/aarch64/intr.c b/sys/arch/aarch64/aarch64/intr.c new file mode 100644 index 0000000..5fd2439 --- /dev/null +++ b/sys/arch/aarch64/aarch64/intr.c @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <machine/intr.h> + +void * +intr_register(const char *name, const struct intr_hand *ih) +{ + /* TODO: Stub */ + return NULL; +} diff --git a/sys/arch/aarch64/aarch64/locore.S b/sys/arch/aarch64/aarch64/locore.S new file mode 100644 index 0000000..a95475c --- /dev/null +++ b/sys/arch/aarch64/aarch64/locore.S @@ -0,0 +1,35 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + + .text + .globl md_cpu_init +md_cpu_init: + ldr x0, =__vectab + msr vbar_el1, x0 + ret diff --git a/sys/arch/aarch64/aarch64/machdep.c b/sys/arch/aarch64/aarch64/machdep.c index 7c21e62..9a96cbb 100644 --- a/sys/arch/aarch64/aarch64/machdep.c +++ b/sys/arch/aarch64/aarch64/machdep.c @@ -31,15 +31,11 @@ #include <sys/panic.h> #include <machine/cpu.h> #include <machine/sync.h> +#include <machine/board.h> struct cpu_info g_bsp_ci = {0}; -void -cpu_startup(struct cpu_info *ci) -{ - /* TODO: STUB */ - return; -} +void md_cpu_init(void); void cpu_halt_others(void) @@ -76,6 +72,13 @@ md_sync_all(void) return 0; } +void +cpu_halt_all(void) +{ + /* TODO: Stub */ + for (;;); +} + /* * Get the descriptor for the currently * running processor. @@ -85,6 +88,24 @@ this_cpu(void) { struct cpu_info *ci; - __ASMV("mrs %0, tpidr_el0" : "=r" (ci)); + __ASMV("mrs %0, tpidr_el1" : "=r" (ci)); return ci; } + +void +cpu_startup(struct cpu_info *ci) +{ + ci->self = ci; + __ASMV("msr tpidr_el1, %0" :: "r" (ci)); + md_cpu_init(); +} + +void +md_get_board(struct board_info *res) +{ + uint64_t midr_el1; + + __ASMV("mrs %0, midr_el1" : "=r" (midr_el1)); + res->partno = (midr_el1 >> 4) & 0xFFF; + res->implementer = (midr_el1 >> 24) & 0xFF; +} diff --git a/sys/arch/aarch64/aarch64/pmap.c b/sys/arch/aarch64/aarch64/pmap.c index b5ebda9..870ef80 100644 --- a/sys/arch/aarch64/aarch64/pmap.c +++ b/sys/arch/aarch64/aarch64/pmap.c @@ -28,35 +28,274 @@ */ #include <sys/types.h> +#include <sys/cdefs.h> +#include <sys/param.h> +#include <sys/panic.h> #include <machine/vas.h> #include <vm/pmap.h> +#include <vm/physmem.h> +#include <vm/vm.h> + +/* Memory types for MAIR_ELx */ +#define MT_NORMAL 0x00 +#define MT_NORMAL_UC 0x02 +#define MT_DEVICE 0x03 + +/* Memory attributes */ +#define MEM_DEV_NGNRNE 0x00 +#define MEM_DEV_NVNRE 0x04 +#define MEM_NORMAL_UC 0x44 +#define MEM_NORMAL 0xFF + +#define MT_ATTR(idx, attr) ((attr) << (8 * (idx))) + +/* + * Descriptor bits for page table entries + * + * @PTE_VALID: Must be set to be valid + * @PTE_TABLE: Table (1), block (0) + * @PTE_USER: User access allowed + * @PTE_READONLY: Read-only + * @PTE_ISH: Inner sharable + * @PTE_AF: Accessed flag + * @PTE_XN: Execute never + */ +#define PTE_ADDR_MASK 0x0000FFFFFFFFF000 +#define PTE_VALID BIT(0) +#define PTE_TABLE BIT(1) +#define PTE_USER BIT(6) +#define PTE_READONLY BIT(7) +#define PTE_ISH (3 << 8) +#define PTE_AF BIT(10) +#define PTE_XN BIT(54) + +/* + * Write the EL1 Memory Attribute Indirection + * Register. + * + * @val: Value to write + * + * XXX: Refer to the ARMv8 Reference Manual section + * D7.2.70 + */ +static inline void +mair_el1_write(uint64_t val) +{ + __ASMV("msr mair_el1, %0" + : + : "r" (val) + : "memory" + ); +} + +static inline void +tlb_flush(vaddr_t va) +{ + __ASMV( + "tlbi vaae1is, %0\n" + "dsb ish\n" + "isb\n" + : + : "r" (va >> 12) + : "memory" + ); +} + +static uint64_t +pmap_prot_to_pte(vm_prot_t prot) +{ + uint64_t pte_flags = 0; + + pte_flags |= (PTE_VALID | PTE_TABLE | PTE_AF); + pte_flags |= (PTE_XN | PTE_READONLY | PTE_ISH); + + if (ISSET(prot, PROT_WRITE)) + pte_flags &= ~PTE_READONLY; + if (ISSET(prot, PROT_EXEC)) + pte_flags &= ~PTE_XN; + if (ISSET(prot, PROT_USER)) + pte_flags |= PTE_USER; + + return pte_flags; +} + +/* + * Returns an index for a specific page map + * label based on an input address. + */ +static size_t +pmap_level_idx(vaddr_t ia, uint8_t level) +{ + switch (level) { + case 0: return (ia >> 39) & 0x1FF; + case 1: return (ia >> 30) & 0x1FF; + case 2: return (ia >> 21) & 0x1FF; + case 3: return (ia >> 12) & 0x1FF; + default: panic("pmap_level_idx: bad index\n"); + } + + __builtin_unreachable(); +} + +/* + * Extract a level from a pagemap + * + * @level: Current pagemap level + * @ia: Input virtual address + * @pmap: Current level to extract from + * @alloc: Set to true to allocate new entries + * + * XXX: `level_idx' can be grabbed with pmap_level_idx(). + */ +static uintptr_t * +pmap_extract(uint8_t level, vaddr_t ia, vaddr_t *pmap, bool alloc) +{ + uintptr_t next, level_alloc; + uint8_t idx; + + if (pmap == NULL) { + return NULL; + } + + idx = pmap_level_idx(ia, level); + next = pmap[idx]; + + if (ISSET(next, PTE_VALID)) { + next = next & PTE_ADDR_MASK; + return PHYS_TO_VIRT(next); + } + + /* + * Nothing to grab at this point, we'll need to + * allocate our own entry. However, if we are + * told not to allocate anything, just return + * NULL. + */ + if (!alloc) { + return NULL; + } + + level_alloc = vm_alloc_frame(1); + if (level_alloc == 0) { + return NULL; + } + + pmap[idx] = (level_alloc | PTE_VALID | PTE_USER | PTE_TABLE); + return PHYS_TO_VIRT(level_alloc); +} + +/* + * Get the lowest pagemap table referring to a 4 KiB + * frame. + * + * @ttrb: Translation table base to use + * @ia: Input virtual address + * @alloc: If true, allocate new pagemap entries as needed + * @res: Result goes here + */ +static int +pmap_get_tbl(paddr_t ttbrn, vaddr_t ia, bool alloc, uintptr_t **res) +{ + vaddr_t *root; + uintptr_t *l1, *l2, *l3; + + root = PHYS_TO_VIRT(ttbrn); + + l1 = pmap_extract(0, ia, root, alloc); + if (l1 == NULL) { + return -1; + } + + l2 = pmap_extract(1, ia, l1, alloc); + if (l2 == NULL) { + return -1; + } + + l3 = pmap_extract(2, ia, l2, alloc); + if (l3 == NULL) { + return -1; + } + + *res = l3; + return 0; +} struct vas pmap_read_vas(void) { - /* TODO: STUB */ struct vas vas = {0}; + + __ASMV( + "mrs %0, ttbr0_el1\n" + "mrs %1, ttbr1_el1\n" + : "=r" (vas.ttbr0_el1), + "=r" (vas.ttbr1_el1) + : + : "memory" + ); + return vas; } void pmap_switch_vas(struct vas vas) { - /* TODO: STUB */ + __ASMV( + "msr ttbr0_el1, %0\n" + "msr ttbr1_el1, %1\n" + : + : "r" (vas.ttbr0_el1), + "r" (vas.ttbr1_el1) + : "memory" + ); return; } int pmap_map(struct vas vas, vaddr_t va, paddr_t pa, vm_prot_t prot) { - /* TODO: STUB */ + paddr_t ttbrn = vas.ttbr0_el1; + uint64_t pte_flags; + uintptr_t *tbl; + int error; + + if (va >= VM_HIGHER_HALF) { + ttbrn = vas.ttbr1_el1; + } + + if ((error = pmap_get_tbl(ttbrn, va, true, &tbl)) < 0) { + return error; + } + if (__unlikely(tbl == NULL)) { + return -1; + } + + pte_flags = pmap_prot_to_pte(prot); + tbl[pmap_level_idx(va, 3)] = pa | pte_flags; + tlb_flush(va); return 0; } int pmap_unmap(struct vas vas, vaddr_t va) { - /* TODO: STUB */ + paddr_t ttbrn = vas.ttbr0_el1; + uintptr_t *tbl; + int error; + + if (va >= VM_HIGHER_HALF) { + ttbrn = vas.ttbr1_el1; + } + + if ((error = pmap_get_tbl(ttbrn, va, true, &tbl)) < 0) { + return error; + } + if (__unlikely(tbl == NULL)) { + return -1; + } + + tbl[pmap_level_idx(va, 3)] = 0; + tlb_flush(va); return 0; } @@ -66,3 +305,36 @@ pmap_destroy_vas(struct vas vas) /* TODO: STUB */ return; } + +bool +pmap_is_clean(struct vas vas, vaddr_t va) +{ + /* TODO: STUB */ + return false; +} + +void +pmap_mark_clean(struct vas vas, vaddr_t va) +{ + /* TODO: STUB */ + return; +} + +int +pmap_set_cache(struct vas vas, vaddr_t va, int type) +{ + /* TODO: STUB */ + return 0; +} + +int +pmap_init(void) +{ + uint64_t mair; + + mair = MT_ATTR(MT_NORMAL, MEM_NORMAL) | + MT_ATTR(MT_NORMAL_UC, MEM_NORMAL_UC) | + MT_ATTR(MT_DEVICE, MEM_DEV_NGNRNE); + mair_el1_write(mair); + return 0; +} diff --git a/sys/arch/aarch64/aarch64/proc_machdep.c b/sys/arch/aarch64/aarch64/proc_machdep.c index 97902e5..cc58af9 100644 --- a/sys/arch/aarch64/aarch64/proc_machdep.c +++ b/sys/arch/aarch64/aarch64/proc_machdep.c @@ -37,17 +37,17 @@ * @ip: Instruction pointer. */ int -md_fork(struct proc *p, struct proc *parent, uintptr_t ip) +md_spawn(struct proc *p, struct proc *parent, uintptr_t ip) { /* TODO: STUB */ return 0; } -void +uintptr_t md_td_stackinit(struct proc *td, void *stack_top, struct exec_prog *prog) { /* TODO: STUB */ - return; + return 0; } void diff --git a/sys/arch/aarch64/aarch64/reboot.c b/sys/arch/aarch64/aarch64/reboot.c index 6d82133..372012a 100644 --- a/sys/arch/aarch64/aarch64/reboot.c +++ b/sys/arch/aarch64/aarch64/reboot.c @@ -30,9 +30,25 @@ #include <sys/reboot.h> #include <sys/param.h> +/* + * Typically the reset vector is at address 0 but this can + * be remapped if the vendor is feeling silly. + */ +void(*g_cpu_reboot)(void) = NULL; + void cpu_reboot(int method) { - /* TODO: STUB */ + g_cpu_reboot(); for (;;); } + +/* + * arg0: Method bits + */ +scret_t +sys_reboot(struct syscall_args *scargs) +{ + cpu_reboot(scargs->arg0); + __builtin_unreachable(); +} diff --git a/sys/arch/aarch64/aarch64/vector.S b/sys/arch/aarch64/aarch64/vector.S new file mode 100644 index 0000000..c8f77ca --- /dev/null +++ b/sys/arch/aarch64/aarch64/vector.S @@ -0,0 +1,96 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <machine/frameasm.h> + +// Vector table entries are aligned at 128 bytes +// giving us 32 exception entries +.macro ventry label + .align 7 + b \label +.endm + + .text +x_sync_elx: + PUSH_XFRAME(TRAPNO_XSYNC) // Synchronous: sp+top @ X0 + bl handle_exception // Handle the exception + POP_XFRAME() // Pop the trapframe +1: hlt #0 // TODO + b 1b + +x_irq_elx: + PUSH_XFRAME(TRAPNO_XIRQ) // IRQ: sp+top @ X0 + bl handle_exception // Handle the exception + POP_XFRAME() // Pop the trapframe +1: hlt #0 // TODO + b 1b + +x_fiq_elx: + PUSH_XFRAME(TRAPNO_XFIQ) // FIQ: sp+top @ X0 + bl handle_exception // Handle the exception + POP_XFRAME() // Pop the trapframe +1: hlt #0 + b 1b + +x_serr_elx: + PUSH_XFRAME(TRAPNO_XSERR) // SERR: sp+top @ X0 + bl handle_exception // Handle the exception + POP_XFRAME() // Pop the trapframe +1: hlt #0 // TODO + b 1b + +x_unimpl: +1: hlt #0 + b 1b + + .align 11 // Table aligned @ 2 KiB + .globl __vectab +__vectab: + // From current EL (w/ SP_EL0) + ventry x_sync_elx + ventry x_irq_elx + ventry x_fiq_elx + ventry x_serr_elx + + // From current EL (w/ SP_ELx > 0) + ventry x_sync_elx + ventry x_irq_elx + ventry x_fiq_elx + ventry x_serr_elx + + // Lower EL with faulting code in AARCH64 + ventry x_sync_elx + ventry x_irq_elx + ventry x_fiq_elx + ventry x_serr_elx + + ventry x_unimpl + ventry x_unimpl + ventry x_unimpl + ventry x_unimpl diff --git a/sys/arch/aarch64/conf/GENERIC b/sys/arch/aarch64/conf/GENERIC index 5691685..702a248 100644 --- a/sys/arch/aarch64/conf/GENERIC +++ b/sys/arch/aarch64/conf/GENERIC @@ -1,5 +1,3 @@ // Kernel options -option SERIAL_DEBUG yes - -// Kernel constants -setval SCHED_NQUEUE 4 +option SERIAL_DEBUG yes // Enable kmsg serial logging +option USER_KMSG yes // Show kmsg in user consoles diff --git a/sys/arch/aarch64/conf/link.ld b/sys/arch/aarch64/conf/link.ld index c64cec3..2aa8c93 100644 --- a/sys/arch/aarch64/conf/link.ld +++ b/sys/arch/aarch64/conf/link.ld @@ -40,6 +40,12 @@ SECTIONS __drivers_init_end = .; } :rodata + .drivers.defer : { + __driversd_init_start = .; + *(.drivers.defer .drivers.defer) + __driversd_init_end = .; + } :rodata + /* Move to the next memory page for .data */ . += CONSTANT(MAXPAGESIZE); diff --git a/sys/arch/aarch64/pci/pci_machdep.c b/sys/arch/aarch64/pci/pci_machdep.c index fa92165..8de6cc9 100644 --- a/sys/arch/aarch64/pci/pci_machdep.c +++ b/sys/arch/aarch64/pci/pci_machdep.c @@ -30,20 +30,6 @@ #include <sys/types.h> #include <dev/pci/pci.h> -pcireg_t -pci_readl(struct pci_device *dev, uint32_t offset) -{ - /* TODO: STUB */ - return 0; -} - -void -pci_writel(struct pci_device *dev, uint32_t offset, pcireg_t val) -{ - /* TODO: STUB */ - return; -} - /* * Map a BAR into kernel memory. * diff --git a/sys/arch/amd64/amd64/gdt.c b/sys/arch/amd64/amd64/gdt.c index a8fe54d..40d8f48 100644 --- a/sys/arch/amd64/amd64/gdt.c +++ b/sys/arch/amd64/amd64/gdt.c @@ -29,50 +29,70 @@ #include <machine/gdt.h> -struct gdt_entry g_gdt_data[256] = { +/* + * The GDT should be cache line aligned, since it is accessed every time a + * segment selector is reloaded + */ +__cacheline_aligned struct gdt_entry g_gdt_data[GDT_ENTRY_COUNT] = { /* Null */ {0}, - /* Kernel code (0x8) */ + /* Kernel code (0x08) */ { - .limit = 0x0000, - .base_low = 0x0000, - .base_mid = 0x00, - .access = 0x9A, - .granularity = 0x20, - .base_hi = 0x00 + .limit = 0x0000, + .base_low = 0x0000, + .base_mid = 0x00, + .attributes = GDT_ATTRIBUTE_64BIT_CODE | GDT_ATTRIBUTE_PRESENT | + GDT_ATTRIBUTE_DPL0 | GDT_ATTRIBUTE_NONSYSTEM | + GDT_ATTRIBUTE_EXECUTABLE | GDT_ATTRIBUTE_READABLE, + .base_hi = 0x00 }, /* Kernel data (0x10) */ { - .limit = 0x0000, - .base_low = 0x0000, - .base_mid = 0x00, - .access = 0x92, - .granularity = 0x00, - .base_hi = 0x00 + .limit = 0x0000, + .base_low = 0x0000, + .base_mid = 0x00, + .attributes = GDT_ATTRIBUTE_PRESENT | GDT_ATTRIBUTE_DPL0 | + GDT_ATTRIBUTE_NONSYSTEM | GDT_ATTRIBUTE_WRITABLE, + .base_hi = 0x00 }, /* User code (0x18) */ { - .limit = 0x0000, - .base_low = 0x0000, - .base_mid = 0x00, - .access = 0xFA, - .granularity = 0xAF, - .base_hi = 0x00 + .limit = 0x0000, + .base_low = 0x0000, + .base_mid = 0x00, + .attributes = GDT_ATTRIBUTE_64BIT_CODE | GDT_ATTRIBUTE_PRESENT | + GDT_ATTRIBUTE_DPL3 | GDT_ATTRIBUTE_NONSYSTEM | + GDT_ATTRIBUTE_EXECUTABLE | GDT_ATTRIBUTE_READABLE, + .base_hi = 0x00 }, /* User data (0x20) */ { - .limit = 0x0000, - .base_low = 0x0000, - .base_mid = 0x00, - .access = 0xF2, - .granularity = 0x00, - .base_hi = 0x00 + .limit = 0x0000, + .base_low = 0x0000, + .base_mid = 0x00, + .attributes = GDT_ATTRIBUTE_PRESENT | GDT_ATTRIBUTE_DPL3 | + GDT_ATTRIBUTE_NONSYSTEM | GDT_ATTRIBUTE_WRITABLE, + .base_hi = 0x00 }, - /* TSS segment (0x28) */ - {0} + /* + * TSS segment (0x28) + * + * NOTE: 64-bit TSS descriptors are 16 bytes, equivalent to the size of two + * regular descriptor entries. + * See Intel SPG 3/25 Section 9.2.3 - TSS Descriptor in 64-bit mode. + */ + {0}, {0} +}; + +/* Verify that the GDT is of the correct size */ +__static_assert(sizeof(g_gdt_data) == (8 * GDT_ENTRY_COUNT)); + +const struct gdtr g_gdtr = { + .limit = sizeof(g_gdt_data) - 1, + .offset = (uintptr_t)&g_gdt_data[0] }; diff --git a/sys/arch/amd64/amd64/hpet.c b/sys/arch/amd64/amd64/hpet.c index 1670546..9191bee 100644 --- a/sys/arch/amd64/amd64/hpet.c +++ b/sys/arch/amd64/amd64/hpet.c @@ -47,6 +47,7 @@ #define CAP_CLK_PERIOD(caps) (caps >> 32) #define FSEC_PER_SECOND 1000000000000000ULL +#define NSEC_PER_SECOND 1000000000ULL #define USEC_PER_SECOND 1000000ULL static void *hpet_base = NULL; @@ -135,6 +136,20 @@ hpet_time_usec(void) } static size_t +hpet_time_nsec(void) +{ + uint64_t period, freq, caps; + uint64_t counter; + + caps = hpet_read(HPET_REG_CAPS); + period = CAP_CLK_PERIOD(caps); + freq = FSEC_PER_SECOND / period; + + counter = hpet_read(HPET_REG_MAIN_COUNTER); + return (counter * NSEC_PER_SECOND) / freq; +} + +static size_t hpet_time_sec(void) { return hpet_time_usec() / USEC_PER_SECOND; @@ -180,7 +195,9 @@ hpet_init(void) timer.usleep = hpet_usleep; timer.nsleep = hpet_nsleep; timer.get_time_usec = hpet_time_usec; + timer.get_time_nsec = hpet_time_nsec; timer.get_time_sec = hpet_time_sec; + timer.flags = TIMER_MONOTONIC; register_timer(TIMER_GP, &timer); return 0; } diff --git a/sys/arch/amd64/amd64/intr.c b/sys/arch/amd64/amd64/intr.c index c31ee3c..c44c88e 100644 --- a/sys/arch/amd64/amd64/intr.c +++ b/sys/arch/amd64/amd64/intr.c @@ -31,12 +31,19 @@ #include <sys/param.h> #include <sys/errno.h> #include <sys/panic.h> +#include <sys/cdefs.h> +#include <sys/syslog.h> #include <machine/intr.h> #include <machine/cpu.h> #include <machine/asm.h> +#include <machine/ioapic.h> #include <vm/dynalloc.h> +#include <string.h> -static struct intr_entry *intrs[256] = {0}; +#define pr_trace(fmt, ...) kprintf("intr: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) + +struct intr_hand *g_intrs[256] = {0}; int splraise(uint8_t s) @@ -67,35 +74,70 @@ splx(uint8_t s) ci->ipl = s; } -int -intr_alloc_vector(const char *name, uint8_t priority) +void * +intr_register(const char *name, const struct intr_hand *ih) { - size_t vec = MAX(priority << IPL_SHIFT, 0x20); - struct intr_entry *intr; + uint32_t vec = MAX(ih->priority << IPL_SHIFT, 0x20); + struct intr_hand *ih_new; + struct intr_data *idp_new; + const struct intr_data *idp; + size_t name_len; /* Sanity check */ - if (vec > NELEM(intrs)) { - return -1; + if (vec > NELEM(g_intrs) || name == NULL) { + return NULL; + } + + ih_new = dynalloc(sizeof(*ih_new)); + if (ih_new == NULL) { + pr_error("could not allocate new interrupt handler\n"); + return NULL; } /* * Try to allocate an interrupt vector. An IPL is made up * of 4 bits so there can be 16 vectors per IPL. + * + * XXX: Vector 0x20 is reserved for the Hyra scheduler and + * vectors 0x21 to 0x21 + N_IPIVEC are reserved for + * inter-processor interrupts. */ for (int i = vec; i < vec + 16; ++i) { - if (intrs[i] != NULL) { + if (g_intrs[i] != NULL || i < 0x24) { continue; } - intr = dynalloc(sizeof(*intr)); - if (intr == NULL) { - return -ENOMEM; + /* Allocate memory for the name */ + name_len = strlen(name) + 1; + ih_new->name = dynalloc(name_len); + if (ih_new->name == NULL) { + dynfree(ih_new); + pr_trace("could not allocate interrupt name\n"); + return NULL; } - intr->priority = priority; - intrs[i] = intr; - return i; + memcpy(ih_new->name, name, name_len); + idp_new = &ih_new->data; + idp = &ih->data; + + /* Pass the interrupt data */ + idp_new->ihp = ih_new; + idp_new->data_u64 = idp->data_u64; + + /* Setup the new intr_hand */ + ih_new->func = ih->func; + ih_new->priority = ih->priority; + ih_new->irq = ih->irq; + ih_new->vector = i; + ih_new->nintr = 0; + g_intrs[i] = ih_new; + + if (ih->irq >= 0) { + ioapic_set_vec(ih->irq, i); + ioapic_irq_unmask(ih->irq); + } + return ih_new; } - return -1; + return NULL; } diff --git a/sys/arch/amd64/amd64/ipi.c b/sys/arch/amd64/amd64/ipi.c new file mode 100644 index 0000000..b44a9ac --- /dev/null +++ b/sys/arch/amd64/amd64/ipi.c @@ -0,0 +1,190 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/errno.h> +#include <sys/syslog.h> +#include <sys/param.h> +#include <sys/panic.h> +#include <sys/spinlock.h> +#include <machine/cpu.h> +#include <machine/idt.h> +#include <machine/ipi.h> +#include <machine/lapic.h> +#include <vm/dynalloc.h> +#include <string.h> + +void ipi_isr(void); +void halt_isr(void); + +void __ipi_handle_common(void); + +#define pr_trace(fmt, ...) kprintf("ipi: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) + +#define COOKIE 0x7E0A +#define MAX_IPI 32 + +/* For the global state of the subsystem */ +static uint32_t cookie = 0; + +static struct cpu_ipi ipi_list[MAX_IPI]; +static uint8_t ipi_count = 0; +static struct spinlock lock; + +/* + * Allocate an IPI that can be sent to other + * cores on the CPU. This is the core logic + * and contains *no* locks. One should be + * using the md_ipi_alloc() function instead. + * + * Returns the allocated IPI identifier on succes, + * otherwise a less than zero value is returned. + */ +static int +__ipi_alloc(struct cpu_ipi **res) +{ + struct cpu_ipi *ipip; + + if (ipi_count >= MAX_IPI) { + return -EAGAIN; + } + + ipip = &ipi_list[ipi_count]; + ipip->cookie = COOKIE; + ipip->id = ipi_count++; + ipip->handler = NULL; + *res = ipip; + return ipip->id; +} + +/* + * Common IPI routine, called from vector.S + * + * XXX: Internal usage only + */ +void +__ipi_handle_common(void) +{ + struct cpu_ipi *ipip; + struct cpu_info *ci = this_cpu(); + ipi_pend_t pending = 0; + + if (cookie != COOKIE) { + pr_trace("[warn]: got spurious ipi\n"); + return; + } + + if (ci == NULL) { + pr_error("could not get current CPU\n"); + return; + } + + if (ipi_count == 0) { + pr_error("no registered IPIs\n"); + return; + } + + /* Attempt to find a handler */ + pending = ci->ipi_pending; + for (int i = 0; i < ipi_count; ++i) { + ipip = &ipi_list[i]; + if (ISSET(pending, BIT(i))) { + ipip->handler(ipip); + ci->ipi_pending &= ~BIT(i); + } + } + + /* We are done dispatching IPIs */ + ci->ipi_dispatch = 0; +} + +/* + * Send one or more IPIs to a specific + * processor after caller sets bits in + * the `ci->ipi_pending' field + * + * @ci: Processor to send IPI(s) to + * @ipi: IPIs to send + */ +int +md_ipi_send(struct cpu_info *ci, ipi_pend_t ipi) +{ + uint32_t apic_id = 0; + + if (ci != NULL) { + /* + * We are already dispatching IPIs, we don't + * want to find ourselves in interrupt hell. + */ + if (ci->ipi_dispatch) { + return -EAGAIN; + } + + apic_id = ci->apicid; + } + + ci->ipi_dispatch = 1; + ci->ipi_pending |= BIT(ipi); + + /* Send it through on the bus */ + lapic_send_ipi( + apic_id, + IPI_SHORTHAND_NONE, + IPI_VECTOR + ); + return 0; +} + +/* + * IPI allocation interface with + * locking. + */ +int +md_ipi_alloc(struct cpu_ipi **res) +{ + int retval; + + spinlock_acquire(&lock); + retval = __ipi_alloc(res); + spinlock_release(&lock); + return retval; +} + +/* + * Initialize the IPI thunks + */ +void +md_ipi_init(void) +{ + /* Initialize the IPI vectors */ + idt_set_desc(IPI_VECTOR, IDT_INT_GATE, ISR(ipi_isr), 0); + idt_set_desc(HALT_VECTOR, IDT_INT_GATE, ISR(halt_isr), 0); + cookie = COOKIE; +} diff --git a/sys/arch/amd64/amd64/lapic.c b/sys/arch/amd64/amd64/lapic.c index 70d36a5..ceb5428 100644 --- a/sys/arch/amd64/amd64/lapic.c +++ b/sys/arch/amd64/amd64/lapic.c @@ -340,7 +340,7 @@ lapic_init(void) /* Allocate a vector if needed */ if (lapic_timer_vec == 0) { - lapic_timer_vec = intr_alloc_vector("lapictmr", IPL_CLOCK); + lapic_timer_vec = (IPL_CLOCK << IPL_SHIFT) | 0x20; idt_set_desc(lapic_timer_vec, IDT_INT_GATE, ISR(lapic_tmr_isr), IST_SCHED); } @@ -364,5 +364,6 @@ lapic_init(void) lapic_timer.name = "LAPIC_INTEGRATED_TIMER"; lapic_timer.stop = lapic_timer_stop; lapic_timer.oneshot_us = lapic_timer_oneshot_us; + lapic_timer.flags = 0; register_timer(TIMER_SCHED, &lapic_timer); } diff --git a/sys/arch/amd64/amd64/lapic_intr.S b/sys/arch/amd64/amd64/lapic_intr.S index 5ae8f39..1413660 100644 --- a/sys/arch/amd64/amd64/lapic_intr.S +++ b/sys/arch/amd64/amd64/lapic_intr.S @@ -33,6 +33,6 @@ .globl lapic_tmr_isr INTRENTRY(lapic_tmr_isr, handle_lapic_tmr) handle_lapic_tmr: - call sched_switch // Context switch per every timer IRQ + call md_sched_switch // Context switch per every timer IRQ call lapic_eoi // Done! Signal that we finished to the Local APIC retq diff --git a/sys/arch/amd64/amd64/machdep.c b/sys/arch/amd64/amd64/machdep.c index 4a885fa..60c37bf 100644 --- a/sys/arch/amd64/amd64/machdep.c +++ b/sys/arch/amd64/amd64/machdep.c @@ -42,7 +42,25 @@ #include <machine/uart.h> #include <machine/sync.h> #include <machine/intr.h> +#include <machine/ipi.h> +#include <machine/cdefs.h> #include <machine/isa/i8042var.h> +#include <dev/cons/cons.h> +#include <string.h> + +/* + * This defines the max number of frames + * we will pass while walking the callstack + * in md_backtrace() + */ +#define MAX_FRAME_DEPTH 16 + +#define pr_trace(fmt, ...) kprintf("cpu: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) +#define pr_trace_bsp(...) \ + if (!bsp_init) { \ + pr_trace(__VA_ARGS__); \ + } #if defined(__SPECTRE_IBRS) #define SPECTRE_IBRS __SPECTRE_IBRS @@ -50,46 +68,86 @@ #define SPECTRE_IBRS 0 #endif -static uint8_t halt_vector = 0; +#if defined(__CPU_SMEP) +#define CPU_SMEP __CPU_SMEP +#else +#define CPU_SMEP 0 +#endif + +#if defined(__CPU_UMIP) +#define CPU_UMIP __CPU_UMIP +#else +#define CPU_UMIP 0 +#endif int ibrs_enable(void); +int simd_init(void); void syscall_isr(void); +void pin_isr_load(void); struct cpu_info g_bsp_ci = {0}; -static struct gdtr bsp_gdtr = { - .limit = sizeof(struct gdt_entry) * 256 - 1, - .offset = (uintptr_t)&g_gdt_data[0] -}; +static struct cpu_ipi *tlb_ipi; +static struct spinlock ipi_lock = {0}; +static bool bsp_init = false; -__attribute__((__interrupt__)) -static void -cpu_halt_isr(void *p) +static int +tlb_shootdown_handler(struct cpu_ipi *ipi) { - __ASMV("cli; hlt"); - __builtin_unreachable(); + struct cpu_info *ci; + int ipl; + + /* + * Get the current CPU and check if we even + * need a shootdown. If `tlb_shootdown' is + * unset, this is not for us. + */ + ci = this_cpu(); + if (!ci->tlb_shootdown) { + return -1; + } + + ipl = splraise(IPL_HIGH); + __invlpg(ci->shootdown_va); + + ci->shootdown_va = 0; + ci->tlb_shootdown = 0; + splx(ipl); + return 0; } static void -setup_vectors(void) +setup_vectors(struct cpu_info *ci) { - if (halt_vector == 0) { - halt_vector = intr_alloc_vector("cpu-halt", IPL_HIGH); + union tss_stack scstack; + union tss_stack dfstack; + + /* Try to allocate a syscall stack */ + if (tss_alloc_stack(&scstack, DEFAULT_PAGESIZE) != 0) { + panic("failed to allocate syscall stack\n"); } + /* Try to allocate a double fault stack */ + if (tss_alloc_stack(&dfstack, DEFAULT_PAGESIZE) != 0) { + panic("failed to allocate double fault stack\n"); + } + + tss_update_ist(ci, scstack, IST_SYSCALL); + tss_update_ist(ci, dfstack, IST_DBFLT); + idt_set_desc(0x0, IDT_TRAP_GATE, ISR(arith_err), 0); idt_set_desc(0x2, IDT_TRAP_GATE, ISR(nmi), 0); idt_set_desc(0x3, IDT_TRAP_GATE, ISR(breakpoint_handler), 0); idt_set_desc(0x4, IDT_TRAP_GATE, ISR(overflow), 0); idt_set_desc(0x5, IDT_TRAP_GATE, ISR(bound_range), 0); idt_set_desc(0x6, IDT_TRAP_GATE, ISR(invl_op), 0); - idt_set_desc(0x8, IDT_TRAP_GATE, ISR(double_fault), 0); + idt_set_desc(0x8, IDT_TRAP_GATE, ISR(double_fault), IST_DBFLT); idt_set_desc(0xA, IDT_TRAP_GATE, ISR(invl_tss), 0); idt_set_desc(0xB, IDT_TRAP_GATE, ISR(segnp), 0); idt_set_desc(0xC, IDT_TRAP_GATE, ISR(ss_fault), 0); idt_set_desc(0xD, IDT_TRAP_GATE, ISR(general_prot), 0); idt_set_desc(0xE, IDT_TRAP_GATE, ISR(page_fault), 0); - idt_set_desc(0x80, IDT_USER_INT_GATE, ISR(syscall_isr), 0); - idt_set_desc(halt_vector, IDT_INT_GATE, ISR(cpu_halt_isr), 0); + idt_set_desc(0x80, IDT_USER_INT_GATE, ISR(syscall_isr), IST_SYSCALL); + pin_isr_load(); } static inline void @@ -97,7 +155,7 @@ init_tss(struct cpu_info *ci) { struct tss_desc *desc; - desc = (struct tss_desc *)&g_gdt_data[GDT_TSS]; + desc = (struct tss_desc *)&g_gdt_data[GDT_TSS_INDEX]; write_tss(ci, desc); tss_load(); } @@ -133,45 +191,267 @@ backtrace_addr_to_name(uintptr_t addr, off_t *off) return NULL; } +static void +enable_simd(void) +{ + int retval; + + if ((retval = simd_init()) < 0) { + pr_trace_bsp("SIMD not supported\n"); + } + + if (retval == 1) { + pr_trace_bsp("SSE enabled but not AVX\n"); + } +} + +static void +init_ipis(void) +{ + int error; + + if (bsp_init) { + return; + } + + spinlock_acquire(&ipi_lock); + error = md_ipi_alloc(&tlb_ipi); + if (error < 0) { + pr_error("md_ipi_alloc: returned %d\n", error); + panic("failed to init TLB IPI\n"); + } + + tlb_ipi->handler = tlb_shootdown_handler; + + /* + * Some IPIs must have very specific IDs + * so that they are standard and usable + * throughout the rest of the sytem. + */ + if (tlb_ipi->id != IPI_TLB) + panic("expected IPI_TLB for TLB IPI\n"); + + spinlock_release(&ipi_lock); +} + +static void +cpu_get_vendor(struct cpu_info *ci) +{ + uint32_t unused, ebx, ecx, edx; + char vendor_str[13]; + + /* + * This CPUID returns a 12 byte CPU vendor string + * that we'll put together and use to detect the vendor. + */ + CPUID(0, unused, ebx, ecx, edx); + + /* Dword 0 */ + vendor_str[0] = ebx & 0xFF; + vendor_str[1] = (ebx >> 8) & 0xFF; + vendor_str[2] = (ebx >> 16) & 0xFF; + vendor_str[3] = (ebx >> 24) & 0xFF; + + /* Dword 1 */ + vendor_str[4] = edx & 0xFF; + vendor_str[5] = (edx >> 8) & 0xFF; + vendor_str[6] = (edx >> 16) & 0xFF; + vendor_str[7] = (edx >> 24) & 0xFF; + + /* Dword 2 */ + vendor_str[8] = ecx & 0xFF; + vendor_str[9] = (ecx >> 8) & 0xFF; + vendor_str[10] = (ecx >> 16) & 0xFF; + vendor_str[11] = (ecx >> 24) & 0xFF; + vendor_str[12] = '\0'; + + /* Is this an AMD CPU? */ + if (strcmp(vendor_str, "AuthenticAMD") == 0) { + ci->vendor = CPU_VENDOR_AMD; + return; + } + + /* Is this an Intel CPU? */ + if (strcmp(vendor_str, "GenuineIntel") == 0) { + ci->vendor = CPU_VENDOR_INTEL; + return; + } + + /* + * Some buggy Intel CPUs report the string "GenuineIotel" + * instead of "GenuineIntel". This is rare but we should + * still handle it as it can happen. Probably a good idea + * to log it so the user can know about their rare CPU + * quirk and brag to their friends :~) + */ + if (strcmp(vendor_str, "GenuineIotel") == 0) { + pr_trace_bsp("vendor_str=%s\n", vendor_str); + pr_trace_bsp("detected vendor string quirk\n"); + ci->vendor = CPU_VENDOR_INTEL; + return; + } + + ci->vendor = CPU_VENDOR_OTHER; +} + +static void +cpu_get_info(struct cpu_info *ci) +{ + uint32_t unused, eax, ebx, ecx, edx; + uint8_t ext_model, ext_family; + + /* Get the vendor information */ + cpu_get_vendor(ci); + + /* Extended features */ + CPUID(0x07, unused, ebx, ecx, unused); + if (ISSET(ebx, BIT(7))) + ci->feat |= CPU_FEAT_SMEP; + if (ISSET(ebx, BIT(20))) + ci->feat |= CPU_FEAT_SMAP; + if (ISSET(ecx, BIT(2))) + ci->feat |= CPU_FEAT_UMIP; + + /* + * Processor power management information bits as well + * as bits describing RAS capabilities + */ + CPUID(0x80000007, unused, unused, unused, edx); + if (ISSET(edx, BIT(8))) + ci->feat |= CPU_FEAT_TSCINV; + + /* + * Processor info and feature bits + */ + CPUID(0x01, eax, unused, unused, unused); + ci->model = (eax >> 4) & 0xF; + ci->family = (eax >> 8) & 0xF; + + /* + * If the family ID is 15 then the actual family + * ID is the sum of the extended family and the + * family ID fields. + */ + if (ci->family == 0xF) { + ext_family = (eax >> 20) & 0xFF; + ci->family += ext_family; + } + + /* + * If the family has the value of either 6 or 15, + * then the extended model number would be used. + * Slap them together if this is the case. + */ + if (ci->family == 6 || ci->family == 15) { + ext_model = (eax >> 16) & 0xF; + ci->model |= (ext_model << 4); + } +} + +/* + * The CR4.UMIP bit prevents user programs from + * executing instructions related to accessing + * system memory structures. This should be enabled + * by default if supported. + */ +static void +cpu_enable_umip(void) +{ + struct cpu_info *ci = this_cpu(); + uint64_t cr4; + + if (!CPU_UMIP) { + pr_trace_bsp("UMIP not configured\n"); + return; + } + + if (ISSET(ci->feat, CPU_FEAT_UMIP)) { + cr4 = amd64_read_cr4(); + cr4 |= CR4_UMIP; + amd64_write_cr4(cr4); + } +} + +void +cpu_shootdown_tlb(vaddr_t va) +{ + uint32_t ncpu = cpu_count(); + struct cpu_info *cip; + + for (uint32_t i = 0; i < ncpu; ++i) { + cip = cpu_get(i); + if (cip == NULL) { + break; + } + + spinlock_acquire(&cip->lock); + cip->shootdown_va = va; + cip->tlb_shootdown = 1; + md_ipi_send(cip, IPI_TLB); + spinlock_release(&cip->lock); + } +} + void md_backtrace(void) { - uintptr_t *rbp; - uintptr_t rip; + uintptr_t *rbp = NULL; + uintptr_t rip, tmp; off_t off; const char *name; + char line[256]; + uint8_t n = 0; __ASMV("mov %%rbp, %0" : "=r" (rbp) :: "memory"); while (1) { + if (n >= MAX_FRAME_DEPTH) { + break; + } + + /* End of callstack */ + if (rbp == NULL) { + break; + } + rip = rbp[1]; rbp = (uintptr_t *)rbp[0]; - name = backtrace_addr_to_name(rip, &off); - if (rbp == NULL) + /* + * RBP should be aligned on an 8-byte + * boundary... Don't trust this state + * anymore if it is not. + */ + tmp = (uintptr_t)rbp; + if ((tmp & (8 - 1)) != 0) { + break; + } + + /* + * This is not a valid value, get out + * of this loop!! + */ + if (rip == 0) { break; - if (name == NULL) - name = "???"; + } - kprintf(OMIT_TIMESTAMP "%p @ <%s+0x%x>\n", rip, name, off); + name = backtrace_addr_to_name(rip, &off); + snprintf(line, sizeof(line), "%p @ <%s+0x%x>\n", rip, name, off); + cons_putstr(&g_root_scr, line, strlen(line)); + ++n; } } void cpu_halt_all(void) { - /* - * If we have no current 'cpu_info' structure set, - * we can't send IPIs, so just assume only the current - * processor is the only one active, clear interrupts - * then halt it. - */ - if (rdmsr(IA32_GS_BASE) == 0) { - __ASMV("cli; hlt"); - } + lapic_send_ipi( + 0, + IPI_SHORTHAND_ALL, + HALT_VECTOR + ); - /* Send IPI to all cores */ - lapic_send_ipi(0, IPI_SHORTHAND_ALL, halt_vector); - for (;;); + __ASMV("cli; hlt"); + __builtin_unreachable(); } /* @@ -181,12 +461,11 @@ cpu_halt_all(void) void cpu_halt_others(void) { - if (rdmsr(IA32_GS_BASE) == 0) { - __ASMV("cli; hlt"); - } - - /* Send IPI to all cores */ - lapic_send_ipi(0, IPI_SHORTHAND_OTHERS, halt_vector); + lapic_send_ipi( + 0, + IPI_SHORTHAND_OTHERS, + HALT_VECTOR + ); } void @@ -210,6 +489,10 @@ this_cpu(void) { struct cpu_info *ci; + if (rdmsr(IA32_GS_BASE) == 0) { + return NULL; + } + /* * This might look crazy but we are just leveraging the "m" * constraint to add the offset of the self field within @@ -236,17 +519,74 @@ md_sync_all(void) } void +cpu_enable_smep(void) +{ + struct cpu_info *ci; + uint64_t cr4; + + /* Don't bother if not enabled */ + if (!CPU_SMEP) { + return; + } + + ci = this_cpu(); + if (!ISSET(ci->feat, CPU_FEAT_SMEP)) { + pr_trace_bsp("SMEP not supported\n"); + return; + } + + cr4 = amd64_read_cr4(); + cr4 |= BIT(20); /* CR4.SMEP */ + amd64_write_cr4(cr4); +} + +void +cpu_disable_smep(void) +{ + struct cpu_info *ci; + uint64_t cr4; + + if (!CPU_SMEP) { + return; + } + + ci = this_cpu(); + if (!ISSET(ci->feat, CPU_FEAT_SMEP)) { + return; + } + + cr4 = amd64_read_cr4(); + cr4 &= ~BIT(20); /* CR4.SMEP */ + amd64_write_cr4(cr4); +} + +void cpu_startup(struct cpu_info *ci) { ci->self = ci; - gdt_load(&bsp_gdtr); + ci->feat = 0; + gdt_load(); idt_load(); - setup_vectors(); wrmsr(IA32_GS_BASE, (uintptr_t)ci); - init_tss(ci); + + setup_vectors(ci); + md_ipi_init(); + init_ipis(); + try_mitigate_spectre(); + ci->online = 1; + ci->preempt = 1; + + cpu_get_info(ci); + cpu_enable_smep(); + cpu_enable_umip(); + enable_simd(); lapic_init(); + + if (!bsp_init) { + bsp_init = true; + } } diff --git a/sys/arch/amd64/amd64/mp.c b/sys/arch/amd64/amd64/mp.c index 22561d7..43830ba 100644 --- a/sys/arch/amd64/amd64/mp.c +++ b/sys/arch/amd64/amd64/mp.c @@ -29,7 +29,10 @@ #include <sys/types.h> #include <sys/limine.h> +#include <sys/limits.h> +#include <sys/systm.h> #include <sys/syslog.h> +#include <sys/proc.h> #include <sys/spinlock.h> #include <sys/sched.h> #include <sys/atomic.h> @@ -40,40 +43,95 @@ #define pr_trace(fmt, ...) kprintf("cpu_mp: " fmt, ##__VA_ARGS__) +extern struct proc g_proc0; static volatile struct limine_smp_request g_smp_req = { .id = LIMINE_SMP_REQUEST, .revision = 0 }; -static volatile uint32_t ncpu_up = 0; +static volatile uint32_t ncpu_up = 1; +static struct cpu_info *ci_list[CPU_MAX]; +static struct spinlock ci_list_lock = {0}; static void ap_trampoline(struct limine_smp_info *si) { struct cpu_info *ci; + struct proc *idle; ci = dynalloc(sizeof(*ci)); __assert(ci != NULL); memset(ci, 0, sizeof(*ci)); cpu_startup(ci); + spinlock_acquire(&ci_list_lock); + ci_list[ncpu_up] = ci; + + ci->id = ncpu_up; + spawn(&g_proc0, sched_enter, NULL, 0, &idle); + proc_pin(idle, ci->id); + + spinlock_release(&ci_list_lock); + atomic_inc_int(&ncpu_up); sched_enter(); while (1); } +struct cpu_info * +cpu_get(uint32_t index) +{ + if (index >= ncpu_up) { + return NULL; + } + + return ci_list[index]; +} + +/* + * Grab the CPU stat structured of a specified + * processor + * + * @cpu_index: CPU index number + */ +struct sched_cpu * +cpu_get_stat(uint32_t cpu_index) +{ + struct cpu_info *ci; + + if ((ci = cpu_get(cpu_index)) == NULL) { + return NULL; + } + + return &ci->stat; +} + +uint32_t +cpu_count(void) +{ + return ncpu_up; +} + void mp_bootstrap_aps(struct cpu_info *ci) { struct limine_smp_response *resp = g_smp_req.response; struct limine_smp_info **cpus; + struct proc *idle; size_t cpu_init_counter; + uint32_t ncpu; /* Should not happen */ __assert(resp != NULL); cpus = resp->cpus; - cpu_init_counter = resp->cpu_count - 1; + ncpu = resp->cpu_count; + cpu_init_counter = ncpu - 1; + ci_list[0] = ci; + + /* Pin an idle thread to the BSP */ + spawn(&g_proc0, sched_enter, NULL, 0, &idle); + proc_pin(idle, 0); if (resp->cpu_count == 1) { pr_trace("CPU has 1 core, no APs to bootstrap...\n"); @@ -91,5 +149,6 @@ mp_bootstrap_aps(struct cpu_info *ci) } /* Wait for all cores to be ready */ - while (ncpu_up < cpu_init_counter); + while ((ncpu_up - 1) < cpu_init_counter); + cpu_report_count(ncpu_up); } diff --git a/sys/arch/amd64/amd64/pmap.c b/sys/arch/amd64/amd64/pmap.c index 2e62a4b..6c6bfcd 100644 --- a/sys/arch/amd64/amd64/pmap.c +++ b/sys/arch/amd64/amd64/pmap.c @@ -33,6 +33,8 @@ #include <sys/errno.h> #include <machine/tlb.h> #include <machine/vas.h> +#include <machine/cpu.h> +#include <machine/cdefs.h> #include <vm/pmap.h> #include <vm/physmem.h> #include <vm/vm.h> @@ -52,7 +54,7 @@ #define PTE_PCD BIT(4) /* Page-level cache disable */ #define PTE_ACC BIT(5) /* Accessed */ #define PTE_DIRTY BIT(6) /* Dirty (written-to page) */ -#define PTE_PAT BIT(7) +#define PTE_PS BIT(7) /* Page size */ #define PTE_GLOBAL BIT(8) #define PTE_NX BIT(63) /* Execute-disable */ @@ -112,6 +114,16 @@ pmap_extract(uint8_t level, vaddr_t va, vaddr_t *pmap, bool alloc) return NULL; } + /* + * TODO: Support huge pages... For now, don't let the + * bootloader fuck us up with their pre-kernel + * mappings and tell huge pages to get the fuck. + * + */ + if (ISSET(pmap[idx], PTE_PS)) { + pmap[idx] = 0; + } + if (ISSET(pmap[idx], PTE_P)) { next = (pmap[idx] & PTE_ADDR_MASK); return PHYS_TO_VIRT(next); @@ -176,14 +188,15 @@ done: * @vas: Virtual address space. * @va: Target virtual address. * @val: Value to write. + * @alloc: True to alloc new paging entries. */ static int -pmap_update_tbl(struct vas vas, vaddr_t va, uint64_t val) +pmap_update_tbl(struct vas vas, vaddr_t va, uint64_t val, bool alloc) { uintptr_t *tbl; int status; - if ((status = pmap_get_tbl(vas, va, true, &tbl)) != 0) { + if ((status = pmap_get_tbl(vas, va, alloc, &tbl)) != 0) { return status; } @@ -266,19 +279,21 @@ pmap_map(struct vas vas, vaddr_t va, paddr_t pa, vm_prot_t prot) { uint32_t flags = pmap_prot_to_pte(prot); - return pmap_update_tbl(vas, va, (pa | flags)); + return pmap_update_tbl(vas, va, (pa | flags), true); } int pmap_unmap(struct vas vas, vaddr_t va) { - return pmap_update_tbl(vas, va, 0); + return pmap_update_tbl(vas, va, 0, false); } int pmap_set_cache(struct vas vas, vaddr_t va, int type) { uintptr_t *tbl; + uint32_t flags; + paddr_t pa; int status; size_t idx; @@ -286,20 +301,62 @@ pmap_set_cache(struct vas vas, vaddr_t va, int type) return status; idx = pmap_get_level_index(1, va); + pa = tbl[idx] & PTE_ADDR_MASK; + flags = tbl[idx] & ~PTE_ADDR_MASK; /* Set the caching policy */ switch (type) { case VM_CACHE_UC: - tbl[idx] |= PTE_PCD; - tbl[idx] &= ~PTE_PWT; + flags |= PTE_PCD; + flags &= ~PTE_PWT; break; case VM_CACHE_WT: - tbl[idx] &= ~PTE_PCD; - tbl[idx] |= PTE_PWT; + flags &= ~PTE_PCD; + flags |= PTE_PWT; break; default: return -EINVAL; } + return pmap_update_tbl(vas, va, (pa | flags), false); +} + +bool +pmap_is_clean(struct vas vas, vaddr_t va) +{ + uintptr_t *tbl; + int status; + size_t idx; + + if ((status = pmap_get_tbl(vas, va, false, &tbl)) != 0) + return status; + + idx = pmap_get_level_index(1, va); + return ISSET(tbl[idx], PTE_DIRTY) == 0; +} + +void +pmap_mark_clean(struct vas vas, vaddr_t va) +{ + uintptr_t *tbl; + int status; + size_t idx; + + if ((status = pmap_get_tbl(vas, va, false, &tbl)) != 0) + return; + + idx = pmap_get_level_index(1, va); + tbl[idx] &= ~PTE_DIRTY; + + if (cpu_count() > 1) { + cpu_shootdown_tlb(va); + } else { + __invlpg(va); + } +} + +int +pmap_init(void) +{ return 0; } diff --git a/sys/arch/amd64/amd64/proc_machdep.c b/sys/arch/amd64/amd64/proc_machdep.c index 9579b7e..82b4e4f 100644 --- a/sys/arch/amd64/amd64/proc_machdep.c +++ b/sys/arch/amd64/amd64/proc_machdep.c @@ -32,6 +32,8 @@ #include <sys/param.h> #include <sys/errno.h> #include <sys/exec.h> +#include <sys/sched.h> +#include <sys/schedvar.h> #include <machine/frame.h> #include <machine/gdt.h> #include <machine/cpu.h> @@ -40,7 +42,7 @@ #include <vm/map.h> #include <string.h> -void +uintptr_t md_td_stackinit(struct proc *td, void *stack_top, struct exec_prog *prog) { uintptr_t *sp = stack_top; @@ -97,6 +99,7 @@ md_td_stackinit(struct proc *td, void *stack_top, struct exec_prog *prog) STACK_PUSH(sp, argc); tfp = &td->tf; tfp->rsp = (uintptr_t)sp - VM_HIGHER_HALF; + return tfp->rsp; } void @@ -123,24 +126,31 @@ md_td_kick(struct proc *td) { struct trapframe *tfp; struct cpu_info *ci; + uint16_t ds = USER_DS | 3; tfp = &td->tf; ci = this_cpu(); ci->curtd = td; + td->flags &= ~PROC_KTD; __ASMV( - "push %0\n" + "mov %0, %%rax\n" "push %1\n" - "pushf\n" "push %2\n" "push %3\n" + "push %%rax\n" + "push %4\n" + "test $3, %%ax\n" + "jz 1f\n" "lfence\n" "swapgs\n" - "iretq" + "1:\n" + " iretq" : - : "i" (USER_DS | 3), + : "r" (tfp->cs), + "r" (ds), "r" (tfp->rsp), - "i" (USER_CS | 3), + "m" (tfp->rflags), "r" (tfp->rip) ); @@ -162,6 +172,7 @@ md_spawn(struct proc *p, struct proc *parent, uintptr_t ip) struct pcb *pcbp; uint8_t rpl = 0; int error; + vm_prot_t prot = PROT_READ | PROT_WRITE; tfp = &p->tf; @@ -201,12 +212,117 @@ md_spawn(struct proc *p, struct proc *parent, uintptr_t ip) */ if (rpl == 0) { stack_base += VM_HIGHER_HALF; + p->flags |= PROC_KTD; } else { - vm_map(pcbp->addrsp, stack_base, stack_base, - PROT_READ | PROT_WRITE | PROT_USER, PROC_STACK_PAGES); + prot |= PROT_USER; + vm_map(pcbp->addrsp, stack_base, stack_base, prot, PROC_STACK_PAGES); } p->stack_base = stack_base; tfp->rsp = ALIGN_DOWN((stack_base + PROC_STACK_SIZE) - 1, 16); return 0; } + +/* + * Save thread state and enqueue it back into one + * of the ready queues. + */ +static void +sched_save_td(struct proc *td, struct trapframe *tf) +{ + /* + * Save trapframe to process structure only + * if PROC_EXEC is not set. + */ + if (!ISSET(td->flags, PROC_EXEC)) { + memcpy(&td->tf, tf, sizeof(td->tf)); + } + + sched_enqueue_td(td); +} + +static void +sched_switch_to(struct trapframe *tf, struct proc *td) +{ + struct cpu_info *ci; + struct sched_cpu *cpustat; + struct pcb *pcbp; + + ci = this_cpu(); + + if (tf != NULL) { + memcpy(tf, &td->tf, sizeof(*tf)); + } + + /* Update stats */ + cpustat = &ci->stat; + atomic_inc_64(&cpustat->nswitch); + + ci->curtd = td; + pcbp = &td->pcb; + pmap_switch_vas(pcbp->addrsp); +} + +/* + * Enable or disable preemption on the current + * processor + * + * @enable: Enable preemption if true + */ +void +sched_preempt_set(bool enable) +{ + struct cpu_info *ci = this_cpu(); + + if (ci == NULL) { + return; + } + + ci->preempt = enable; +} + +bool +sched_preemptable(void) +{ + struct cpu_info *ci = this_cpu(); + + if (ci == NULL) { + return false; + } + + return ci->preempt; +} + +/* + * Perform a context switch. + */ +void +md_sched_switch(struct trapframe *tf) +{ + struct proc *next_td, *td; + struct cpu_info *ci; + + ci = this_cpu(); + if (!ci->preempt) { + sched_oneshot(false); + return; + } + + td = ci->curtd; + mi_sched_switch(td); + + if (td != NULL) { + if (td->pid == 0) + return; + + sched_save_td(td, tf); + } + + if ((next_td = sched_dequeue_td()) == NULL) { + sched_oneshot(false); + return; + } + + sched_switch_to(tf, next_td); + sched_oneshot(false); +} diff --git a/sys/arch/amd64/amd64/reboot.c b/sys/arch/amd64/amd64/reboot.c index d47a352..8ebe15e 100644 --- a/sys/arch/amd64/amd64/reboot.c +++ b/sys/arch/amd64/amd64/reboot.c @@ -34,9 +34,49 @@ #include <machine/cpu.h> #include <dev/acpi/acpi.h> +static void +cpu_reset_intel(struct cpu_info *ci) +{ + /* + * Ivy bridge processors and their panther point chipsets + * (family 6) can be reset through special PCH reset control + * registers + */ + if (ci->family == 6) { + outb(0xCF9, 3 << 1); + } +} + +/* + * Attempt to reboot the system, we do this in many + * stages of escalation. If a reset via the i8042 + * controller fails and we are on an Intel processor, + * attempt a chipset specific reset. If that somehow fails + * as well, just smack the cpu with a NULL IDTR as well + * as an INT $0x0 + */ +static void +__cpu_reset(struct cpu_info *ci) +{ + /* Try via the i8042 */ + outb(0x64, 0xFE); + + /* Something went wrong if we are here */ + if (ci == NULL) { + return; + } + + if (ci->vendor == CPU_VENDOR_INTEL) { + cpu_reset_intel(ci); + } +} + void cpu_reboot(int method) { + struct cpu_info *ci = this_cpu(); + uint32_t *__dmmy = NULL; + if (ISSET(method, REBOOT_POWEROFF)) { acpi_sleep(ACPI_SLEEP_S5); } @@ -45,10 +85,9 @@ cpu_reboot(int method) cpu_halt_all(); } - /* Pulse the reset line until the machine goes down */ - for (;;) { - outb(0x64, 0xFE); - } + __cpu_reset(ci); + asm volatile("lgdt %0; int $0x0" :: "m" (__dmmy)); + __builtin_unreachable(); } /* diff --git a/sys/arch/amd64/amd64/simd.S b/sys/arch/amd64/amd64/simd.S new file mode 100644 index 0000000..23fe461 --- /dev/null +++ b/sys/arch/amd64/amd64/simd.S @@ -0,0 +1,76 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + + .text + .globl simd_init +simd_init: + /* + * Enable SIMD, if SSE and AVX is supported, + * a value of zero is returned. If SSE is + * supported yet AVX is not, a value of one + * is returned. However, if none are supported, + * this routine returns -1. + */ + + // Do we support SSE? + mov $1, %eax + cpuid + bt $25, %edx + jnc .sse_not_sup + + mov %cr0, %rax // Old CR0 -> EAX + and $0xFFFB, %ax // Disable co-processor emulation + or $0x02, %ax // Enable co-processor monitoring + mov %rax, %cr0 // Update CR0 with new flags + + mov %cr4, %rax // Old CR4 -> EAX + or $0x200, %ax // Enable FXSAVE/FXRSTOR + or $0x400, %ax // Enable SIMD FP exceptions + mov %rax, %cr4 // Update CR4 with new flags + + mov $1, %eax // LEAF 1 + cpuid // Bit 28 of ECX indicates AVX support + mov $3, %eax // We need to check two bits + shl $27, %eax // Which are ECX.OSXSAVE and ECX.AVX + test %eax, %ecx // Are XSAVE and AVX supported? + jnc .avx_not_sup // Nope, just continue + + // Enable AVX + xor %rcx, %rcx // Select XCR0 + xgetbv // Load extended control register + or $0x07, %eax // Set AVX + SSE bits + xsetbv // Store new flags + xor %rax, %rax // Everything is good + retq // Return back to caller (RETURN) +.sse_not_sup: + mov $-1, %rax + retq +.avx_not_sup: + mov $1, %rax + retq diff --git a/sys/arch/amd64/amd64/trap.c b/sys/arch/amd64/amd64/trap.c index 6492a29..7d9df3f 100644 --- a/sys/arch/amd64/amd64/trap.c +++ b/sys/arch/amd64/amd64/trap.c @@ -60,6 +60,17 @@ static const char *trap_type[] = { [TRAP_SS] = "stack-segment fault" }; +/* Page-fault flags */ +static const char pf_flags[] = { + 'p', /* Present */ + 'w', /* Write */ + 'u', /* User */ + 'r', /* Reserved write */ + 'x', /* Instruction fetch */ + 'k', /* Protection key violation */ + 's' /* Shadow stack access */ +}; + static inline uintptr_t pf_faultaddr(void) { @@ -69,7 +80,24 @@ pf_faultaddr(void) } static void -regdump(struct trapframe *tf) +pf_code(uint64_t error_code) +{ + char tab[8] = { + '-', '-', '-', + '-', '-', '-', + '-', '\0' + }; + + for (int i = 0; i < 7; ++i) { + if (ISSET(error_code, BIT(i))) { + tab[i] = pf_flags[i]; + } + } + kprintf("code=[%s]\n", tab); +} + +__dead static void +trap_fatal(struct trapframe *tf) { uintptr_t cr3, cr2 = pf_faultaddr(); @@ -79,11 +107,17 @@ regdump(struct trapframe *tf) : "memory" ); - kprintf(OMIT_TIMESTAMP + if (tf->trapno == TRAP_PAGEFLT) { + pf_code(tf->error_code); + } + + panic("got fatal trap (%s)\n\n" + "-- DUMPING PROCESSOR STATE --\n" "RAX=%p RCX=%p RDX=%p\n" "RBX=%p RSI=%p RDI=%p\n" "RFL=%p CR2=%p CR3=%p\n" - "RBP=%p RSP=%p RIP=%p\n", + "RBP=%p RSP=%p RIP=%p\n\n", + trap_type[tf->trapno], tf->rax, tf->rcx, tf->rdx, tf->rbx, tf->rsi, tf->rdi, tf->rflags, cr2, cr3, @@ -94,6 +128,7 @@ static void trap_user(struct trapframe *tf) { struct proc *td = this_td(); + uintptr_t fault_addr; sigset_t sigset; sigemptyset(&sigset); @@ -101,17 +136,22 @@ trap_user(struct trapframe *tf) switch (tf->trapno) { case TRAP_PROTFLT: case TRAP_PAGEFLT: + if (tf->trapno == TRAP_PAGEFLT) { + pf_code(tf->error_code); + } sigaddset(&sigset, SIGSEGV); break; case TRAP_ARITH_ERR: sigaddset(&sigset, SIGFPE); break; default: - kprintf("got unknown user trap %d\n", tf->trapno); - sigaddset(&sigset, SIGKILL); + panic("got unknown user trap %d\n", tf->trapno); break; } + fault_addr = pf_faultaddr(); + proc_coredump(td, fault_addr); + /* * Send the signal then flush the signal queue right * away as these types of events are critical. @@ -141,8 +181,6 @@ trap_syscall(struct trapframe *tf) void trap_handler(struct trapframe *tf) { - splraise(IPL_HIGH); - if (tf->trapno >= NELEM(trap_type)) { panic("got unknown trap %d\n", tf->trapno); } @@ -155,6 +193,6 @@ trap_handler(struct trapframe *tf) return; } - regdump(tf); - panic("fatal trap - halting\n"); + trap_fatal(tf); + __builtin_unreachable(); } diff --git a/sys/arch/amd64/amd64/tsc.c b/sys/arch/amd64/amd64/tsc.c new file mode 100644 index 0000000..2111cd0 --- /dev/null +++ b/sys/arch/amd64/amd64/tsc.c @@ -0,0 +1,109 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <sys/types.h> +#include <sys/param.h> +#include <sys/cdefs.h> +#include <sys/driver.h> +#include <sys/syslog.h> +#include <machine/tsc.h> +#include <machine/asm.h> +#include <machine/cpuid.h> + +/* See kconf(9) */ +#if defined(__USER_TSC) +#define USER_TSC __USER_TSC +#else +#define USER_TSC 0 +#endif /* __USER_TSC */ + +#define pr_trace(fmt, ...) kprintf("tsc: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) + +static uint64_t tsc_i = 0; + +uint64_t +rdtsc_rel(void) +{ + return rdtsc() - tsc_i; +} + +/* + * Check if the TSC and RDTSC instruction is + * supported on the current CPU. + * + * Returns zero if supported, otherwise a less + * than zero value is returned. + */ +static int +tsc_check(void) +{ + uint32_t edx, unused; + + CPUID(1, unused, unused, unused, edx); + if (ISSET(edx, BIT(4))) { + return 0; + } + + return -ENOTSUP; +} + +static int +tsc_init(void) +{ + uint64_t cr4; + int error; + + /* Is the TSC even supported? */ + if ((error = tsc_check()) != 0) { + pr_error("TSC not supported by machine\n"); + return error; + } + + cr4 = amd64_read_cr4(); + tsc_i = rdtsc(); + pr_trace("initial count @ %d\n", rdtsc_rel()); + + /* + * If we USER_TSC is configured to "yes" then + * we'll need to enable the 'rdtsc' instruction + * in user mode. + */ + if (!USER_TSC) { + cr4 &= ~CR4_TSD; + } else { + cr4 |= CR4_TSD; + } + + amd64_write_cr4(cr4); + return 0; +} + +DRIVER_EXPORT(tsc_init, "x86-tsc"); diff --git a/sys/arch/amd64/amd64/uart.c b/sys/arch/amd64/amd64/uart.c index 429aa57..ea88d3c 100644 --- a/sys/arch/amd64/amd64/uart.c +++ b/sys/arch/amd64/amd64/uart.c @@ -115,4 +115,3 @@ uart_init(void) outb(UART_REG_MCR, UART_MCR_DTR); return 0; } - diff --git a/sys/arch/amd64/amd64/vector.S b/sys/arch/amd64/amd64/vector.S new file mode 100644 index 0000000..62bed1b --- /dev/null +++ b/sys/arch/amd64/amd64/vector.S @@ -0,0 +1,221 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <machine/frameasm.h> + +#define IDT_INT_GATE 0x8E + +.macro IDT_SET_VEC vec, sym + mov $\vec, %rdi + mov $IDT_INT_GATE, %rsi + lea \sym(%rip), %rdx + xor %rcx, %rcx + call idt_set_desc +.endm + + .text + ALIGN_TEXT +ioapic_common_func: + xor %rcx, %rcx // Clear counter +.walk: // Walk the handlers + lea g_intrs(%rip), %rbx // Grab table to RBX + lea (%rbx, %rcx, 8), %rbx // g_intrs + (8 * rcx) + mov (%rbx), %rdx // Grab the intr_hand + or %rdx, %rdx // No more? + jz 1f // Nope, return + + mov (%rdx), %rbx // intr_hand.func + add $16, %rdx // Get interrupt data + mov %rdx, %rdi // Pass the interrupt data + push %rcx // Save our counter + push %rdx + call *%rbx // Call the handler + pop %rdx + pop %rcx // Restore our counter + or %rax, %rax // Was it theirs? (RET >= 1) + jnz handled // Yes, we are done. +1: inc %rcx // Next + cmp $256, %rcx // Did we reach the end? + jl .walk // Nope, keep going + jmp done // Out of entries +handled: + sub $8, %rdx + addq $1, (%rdx) +done: + call lapic_eoi + retq + + .globl pin_isr_load +pin_isr_load: + IDT_SET_VEC 37, ioapic_edge_0 + IDT_SET_VEC 38, ioapic_edge_1 + IDT_SET_VEC 39, ioapic_edge_2 + IDT_SET_VEC 40, ioapic_edge_3 + IDT_SET_VEC 41, ioapic_edge_4 + IDT_SET_VEC 42, ioapic_edge_5 + IDT_SET_VEC 43, ioapic_edge_6 + IDT_SET_VEC 44, ioapic_edge_7 + IDT_SET_VEC 45, ioapic_edge_8 + IDT_SET_VEC 46, ioapic_edge_9 + IDT_SET_VEC 47, ioapic_edge_10 + IDT_SET_VEC 48, ioapic_edge_11 + IDT_SET_VEC 49, ioapic_edge_12 + IDT_SET_VEC 50, ioapic_edge_13 + IDT_SET_VEC 51, ioapic_edge_14 + IDT_SET_VEC 52, ioapic_edge_15 + IDT_SET_VEC 53, ioapic_edge_16 + IDT_SET_VEC 54, ioapic_edge_17 + IDT_SET_VEC 55, ioapic_edge_18 + IDT_SET_VEC 56, ioapic_edge_19 + IDT_SET_VEC 57, ioapic_edge_20 + IDT_SET_VEC 58, ioapic_edge_21 + IDT_SET_VEC 59, ioapic_edge_22 + IDT_SET_VEC 60, ioapic_edge_23 + IDT_SET_VEC 61, ioapic_edge_24 + IDT_SET_VEC 62, ioapic_edge_25 + IDT_SET_VEC 63, ioapic_edge_26 + IDT_SET_VEC 64, ioapic_edge_27 + IDT_SET_VEC 65, ioapic_edge_28 + IDT_SET_VEC 66, ioapic_edge_29 + IDT_SET_VEC 67, ioapic_edge_30 + IDT_SET_VEC 68, ioapic_edge_31 + IDT_SET_VEC 69, ioapic_edge_32 + IDT_SET_VEC 70, ioapic_edge_33 + IDT_SET_VEC 71, ioapic_edge_34 + IDT_SET_VEC 72, ioapic_edge_35 + IDT_SET_VEC 73, ioapic_edge_36 + IDT_SET_VEC 74, ioapic_edge_37 + IDT_SET_VEC 75, ioapic_edge_38 + IDT_SET_VEC 76, ioapic_edge_39 + IDT_SET_VEC 77, ioapic_edge_40 + IDT_SET_VEC 78, ioapic_edge_41 + IDT_SET_VEC 79, ioapic_edge_42 + IDT_SET_VEC 80, ioapic_edge_43 + IDT_SET_VEC 81, ioapic_edge_44 + IDT_SET_VEC 82, ioapic_edge_45 + IDT_SET_VEC 83, ioapic_edge_46 + IDT_SET_VEC 84, ioapic_edge_47 + IDT_SET_VEC 85, ioapic_edge_48 + IDT_SET_VEC 86, ioapic_edge_49 + IDT_SET_VEC 87, ioapic_edge_50 + IDT_SET_VEC 88, ioapic_edge_51 + IDT_SET_VEC 89, ioapic_edge_52 + IDT_SET_VEC 90, ioapic_edge_53 + IDT_SET_VEC 91, ioapic_edge_54 + IDT_SET_VEC 92, ioapic_edge_55 + IDT_SET_VEC 93, ioapic_edge_56 + IDT_SET_VEC 94, ioapic_edge_57 + IDT_SET_VEC 95, ioapic_edge_58 + IDT_SET_VEC 96, ioapic_edge_59 + IDT_SET_VEC 97, ioapic_edge_60 + IDT_SET_VEC 98, ioapic_edge_61 + IDT_SET_VEC 99, ioapic_edge_62 + IDT_SET_VEC 100, ioapic_edge_63 + ret + + .globl ipi_isr +INTRENTRY(ipi_isr, ipi_trampoline) + call ipi_trampoline + retq + + .globl halt_isr +INTRENTRY(halt_isr, halt_trampoline) +halt_trampoline: + cli + hlt + +ipi_trampoline: + call __ipi_handle_common + retq + +/* I/O APIC edge ISRs */ +INTRENTRY(ioapic_edge_0, ioapic_common_func) +INTRENTRY(ioapic_edge_1, ioapic_common_func) +INTRENTRY(ioapic_edge_2, ioapic_common_func) +INTRENTRY(ioapic_edge_3, ioapic_common_func) +INTRENTRY(ioapic_edge_4, ioapic_common_func) +INTRENTRY(ioapic_edge_5, ioapic_common_func) +INTRENTRY(ioapic_edge_6, ioapic_common_func) +INTRENTRY(ioapic_edge_7, ioapic_common_func) +INTRENTRY(ioapic_edge_8, ioapic_common_func) +INTRENTRY(ioapic_edge_9, ioapic_common_func) +INTRENTRY(ioapic_edge_10, ioapic_common_func) +INTRENTRY(ioapic_edge_11, ioapic_common_func) +INTRENTRY(ioapic_edge_12, ioapic_common_func) +INTRENTRY(ioapic_edge_13, ioapic_common_func) +INTRENTRY(ioapic_edge_14, ioapic_common_func) +INTRENTRY(ioapic_edge_15, ioapic_common_func) +INTRENTRY(ioapic_edge_16, ioapic_common_func) +INTRENTRY(ioapic_edge_17, ioapic_common_func) +INTRENTRY(ioapic_edge_18, ioapic_common_func) +INTRENTRY(ioapic_edge_19, ioapic_common_func) +INTRENTRY(ioapic_edge_20, ioapic_common_func) +INTRENTRY(ioapic_edge_21, ioapic_common_func) +INTRENTRY(ioapic_edge_22, ioapic_common_func) +INTRENTRY(ioapic_edge_23, ioapic_common_func) +INTRENTRY(ioapic_edge_24, ioapic_common_func) +INTRENTRY(ioapic_edge_25, ioapic_common_func) +INTRENTRY(ioapic_edge_26, ioapic_common_func) +INTRENTRY(ioapic_edge_27, ioapic_common_func) +INTRENTRY(ioapic_edge_28, ioapic_common_func) +INTRENTRY(ioapic_edge_29, ioapic_common_func) +INTRENTRY(ioapic_edge_30, ioapic_common_func) +INTRENTRY(ioapic_edge_31, ioapic_common_func) +INTRENTRY(ioapic_edge_32, ioapic_common_func) +INTRENTRY(ioapic_edge_33, ioapic_common_func) +INTRENTRY(ioapic_edge_34, ioapic_common_func) +INTRENTRY(ioapic_edge_35, ioapic_common_func) +INTRENTRY(ioapic_edge_36, ioapic_common_func) +INTRENTRY(ioapic_edge_37, ioapic_common_func) +INTRENTRY(ioapic_edge_38, ioapic_common_func) +INTRENTRY(ioapic_edge_39, ioapic_common_func) +INTRENTRY(ioapic_edge_40, ioapic_common_func) +INTRENTRY(ioapic_edge_41, ioapic_common_func) +INTRENTRY(ioapic_edge_42, ioapic_common_func) +INTRENTRY(ioapic_edge_43, ioapic_common_func) +INTRENTRY(ioapic_edge_44, ioapic_common_func) +INTRENTRY(ioapic_edge_45, ioapic_common_func) +INTRENTRY(ioapic_edge_46, ioapic_common_func) +INTRENTRY(ioapic_edge_47, ioapic_common_func) +INTRENTRY(ioapic_edge_48, ioapic_common_func) +INTRENTRY(ioapic_edge_49, ioapic_common_func) +INTRENTRY(ioapic_edge_50, ioapic_common_func) +INTRENTRY(ioapic_edge_51, ioapic_common_func) +INTRENTRY(ioapic_edge_52, ioapic_common_func) +INTRENTRY(ioapic_edge_53, ioapic_common_func) +INTRENTRY(ioapic_edge_54, ioapic_common_func) +INTRENTRY(ioapic_edge_55, ioapic_common_func) +INTRENTRY(ioapic_edge_56, ioapic_common_func) +INTRENTRY(ioapic_edge_57, ioapic_common_func) +INTRENTRY(ioapic_edge_58, ioapic_common_func) +INTRENTRY(ioapic_edge_59, ioapic_common_func) +INTRENTRY(ioapic_edge_60, ioapic_common_func) +INTRENTRY(ioapic_edge_61, ioapic_common_func) +INTRENTRY(ioapic_edge_62, ioapic_common_func) +INTRENTRY(ioapic_edge_63, ioapic_common_func) diff --git a/sys/arch/amd64/conf/GENERIC b/sys/arch/amd64/conf/GENERIC index db3ce4c..6bf3af5 100644 --- a/sys/arch/amd64/conf/GENERIC +++ b/sys/arch/amd64/conf/GENERIC @@ -1,10 +1,14 @@ +// // Kernel options -option SPECTRE_IBRS no -option SERIAL_DEBUG yes - -// Kernel constants -setval SCHED_NQUEUE 4 - -// Console attributes -setval CONSOLE_BG 0x000000 -setval CONSOLE_FG 0x009800 +// +// XXX: Indirect branch restricted speculation (SPECTRE_IBRS) +// is disabled by default as it can lead to significant +// performance degradation. +// +option SPECTRE_IBRS no // Enable the IBRS CPU feature +option SERIAL_DEBUG yes // Enable kmsg serial logging +option CPU_UMIP yes // Enable User-mode Instruction Prevention +option USER_KMSG no // Show kmsg in user consoles +option USER_TSC no // Enable 'rdtsc' in user mode +option CPU_SMEP yes // Supervisor Memory Exec Protection +option I8042_POLL yes // Use polling for the i8042 diff --git a/sys/arch/amd64/conf/link.ld b/sys/arch/amd64/conf/link.ld index 9c47a81..a43824f 100644 --- a/sys/arch/amd64/conf/link.ld +++ b/sys/arch/amd64/conf/link.ld @@ -29,6 +29,12 @@ SECTIONS __drivers_init_end = .; } :rodata + .drivers.defer : { + __driversd_init_start = .; + *(.drivers.defer .drivers.defer) + __driversd_init_end = .; + } :rodata + . += CONSTANT(MAXPAGESIZE); .data : { diff --git a/sys/arch/amd64/isa/i8042.c b/sys/arch/amd64/isa/i8042.c index 53679aa..095f1f4 100644 --- a/sys/arch/amd64/isa/i8042.c +++ b/sys/arch/amd64/isa/i8042.c @@ -33,12 +33,14 @@ #include <sys/syslog.h> #include <sys/spinlock.h> #include <sys/param.h> +#include <sys/ascii.h> #include <sys/proc.h> #include <sys/reboot.h> #include <sys/queue.h> #include <dev/acpi/acpi.h> #include <dev/timer.h> #include <dev/cons/cons.h> +#include <dev/dmi/dmi.h> #include <machine/cpu.h> #include <machine/pio.h> #include <machine/isa/i8042var.h> @@ -51,6 +53,13 @@ #include <string.h> #include <assert.h> +/* From kconf(9) */ +#if !defined(__I8042_POLL) +#define I8042_POLL 0 +#else +#define I8042_POLL __I8042_POLL +#endif + #define KEY_REP_MAX 2 #define pr_trace(fmt, ...) kprintf("i8042: " fmt, ##__VA_ARGS__) @@ -58,7 +67,28 @@ #define IO_NOP() inb(0x80) -static struct spinlock data_lock; +struct i8042_databuf { + uint8_t data[8]; + size_t len; +}; + +/* + * This table allows the lookup of extended + * scancode bytes. + * + * XXX: Excludes the 0xE0 byte + */ +static struct i8042_databuf i8042_etab[] = { + [ I8042_XSC_ENDPR] = { + .data = { 0x4F }, + .len = 1 + }, + [I8042_XSC_ENDRL] = { + .data = { 0xCF }, + .len = 1 + } +}; + static struct spinlock isr_lock; static bool shift_key = false; static bool capslock = false; @@ -68,12 +98,13 @@ static struct proc polltd; static struct timer tmr; static bool is_init = false; +static void i8042_ibuf_wait(void); static int dev_send(bool aux, uint8_t data); static int i8042_kb_getc(uint8_t sc, char *chr); -static void i8042_drain(void); +static void i8042_drain(struct i8042_databuf *res); static char keytab[] = { - '\0', '\0', '1', '2', '3', '4', '5', '6', '7', '8', '9', '0', + '\0', '\x1B', '1', '2', '3', '4', '5', '6', '7', '8', '9', '0', '-', '=', '\b', '\t', 'q', 'w', 'e', 'r', 't', 'y', 'u', 'i', 'o', 'p', '[', ']', '\n', '\0', 'a', 's', 'd', 'f', 'g', 'h', 'j', 'k', 'l', ';', '\'', '`', '\0', '\\', 'z', 'x', 'c', 'v', @@ -103,54 +134,56 @@ kbd_set_leds(uint8_t mask) dev_send(false, mask); } -/* - * Poll the i8042 status register - * - * @bits: Status bits. - * @pollset: True to poll if set - */ -static int -i8042_statpoll(uint8_t bits, bool pollset) +static void +i8042_obuf_wait(void) { - size_t usec_start, usec; - size_t elapsed_msec; - uint8_t val; - bool tmp; + uint8_t status; - usec_start = tmr.get_time_usec(); for (;;) { - val = inb(I8042_STATUS); - tmp = (pollset) ? ISSET(val, bits) : !ISSET(val, bits); - usec = tmr.get_time_usec(); - elapsed_msec = (usec - usec_start) / 1000; - - IO_NOP(); - - /* If tmp is set, the register updated in time */ - if (tmp) { - break; + status = inb(I8042_STATUS); + if (ISSET(status, I8042_OBUFF)) { + return; } + } +} - /* Exit with an error if we timeout */ - if (elapsed_msec > I8042_DELAY) { - return -ETIME; +static void +i8042_ibuf_wait(void) +{ + uint8_t status; + + for (;;) { + status = inb(I8042_STATUS); + if (!ISSET(status, I8042_IBUFF)) { + return; } } - - return val; } /* * Drain i8042 internal data registers. + * + * @res: Pointer for read data to be buffered to + * + * XXX: The 'res' argument is NULLable */ static void -i8042_drain(void) +i8042_drain(struct i8042_databuf *res) { - spinlock_acquire(&data_lock); while (ISSET(inb(I8042_STATUS), I8042_OBUFF)) { - inb(I8042_DATA); + if (res == NULL) { + inb(I8042_DATA); + continue; + } + + if (res->len >= sizeof(res->data)) { + pr_error("data recieved from i8042 is too big\n"); + break; + } + + res->data[res->len++] = inb(I8042_DATA); + tmr.msleep(10); } - spinlock_release(&data_lock); } /* @@ -162,34 +195,47 @@ i8042_drain(void) static void i8042_write(uint16_t port, uint8_t val) { - i8042_statpoll(I8042_IBUFF, false); + i8042_ibuf_wait(); outb(port, val); } /* - * Read the i8042 config register + * Read from an i8042 register. + * + * @port: I/O port + */ +static uint8_t +i8042_read(uint16_t port) +{ + i8042_obuf_wait(); + return inb(port); +} + +/* + * Read the i8042 controller configuration + * byte. */ static uint8_t i8042_read_conf(void) { - i8042_drain(); + uint8_t conf; + i8042_write(I8042_CMD, I8042_GET_CONFB); - i8042_statpoll(I8042_OBUFF, true); - return inb(I8042_DATA); + i8042_obuf_wait(); + conf = i8042_read(I8042_DATA); + return conf; } /* - * Write the i8042 config register + * Write a new value to the i8042 controller + * configuration byte. */ static void -i8042_write_conf(uint8_t value) +i8042_write_conf(uint8_t conf) { - i8042_drain(); - i8042_statpoll(I8042_IBUFF, false); i8042_write(I8042_CMD, I8042_SET_CONFB); - i8042_statpoll(I8042_IBUFF, false); - i8042_write(I8042_DATA, value); - i8042_drain(); + i8042_ibuf_wait(); + i8042_write(I8042_DATA, conf); } /* @@ -205,14 +251,13 @@ dev_send(bool aux, uint8_t data) i8042_write(I8042_CMD, I8042_PORT1_SEND); } - i8042_statpoll(I8042_IBUFF, false); i8042_write(I8042_DATA, data); - i8042_statpoll(I8042_OBUFF, true); + i8042_obuf_wait(); return inb(I8042_DATA); } -void -i8042_kb_event(void) +static int +i8042_kb_event(void *sp) { struct cpu_info *ci; struct cons_input input; @@ -232,45 +277,103 @@ i8042_kb_event(void) input.chr = c; cons_ibuf_push(&g_root_scr, input); done: - ci->irq_mask &= CPU_IRQ(1); + ci->irq_mask &= ~CPU_IRQ(1); spinlock_release(&isr_lock); - lapic_eoi(); + return 1; /* handled */ } static void i8042_en_intr(void) { + struct intr_hand ih; uint8_t conf; - int vec; - - i8042_write(I8042_CMD, I8042_DISABLE_PORT0); - vec = intr_alloc_vector("i8042-kb", IPL_BIO); - idt_set_desc(vec, IDT_INT_GATE, ISR(i8042_kb_isr), IST_HW_IRQ); - ioapic_set_vec(KB_IRQ, vec); - ioapic_irq_unmask(KB_IRQ); + ih.func = i8042_kb_event; + ih.priority = IPL_BIO; + ih.irq = KB_IRQ; + intr_register("i8042-kb", &ih); - /* Setup config bits */ + /* + * Enable the clock of PS/2 port 0 and tell + * the controller that we are accepting + * interrupts. + */ conf = i8042_read_conf(); + conf &= ~I8042_PORT0_CLK; conf |= I8042_PORT0_INTR; - conf &= ~I8042_PORT1_INTR; i8042_write_conf(conf); +} - i8042_write(I8042_CMD, I8042_ENABLE_PORT0); +/* + * Toggle the capslock and LED + */ +static void +capslock_toggle(void) +{ + /* + * In case we are holding the caps lock button down, + * we don't want it to be spam toggled as that would + * be pretty strange looking and probably annoying. + */ + if (!capslock_released) { + return; + } + + capslock_released = false; + capslock = !capslock; + + if (!capslock) { + kbd_set_leds(0); + } else { + kbd_set_leds(I8042_LED_CAPS); + } } +/* + * Dump extended data buffer + * + * @buf: Data + */ static void -esckey_reboot(void) +i8042_ext_dump(struct i8042_databuf *buf) { - syslock(); - kprintf(OMIT_TIMESTAMP "** Machine going down for a reboot\f"); + if (buf == NULL) { + return; + } + + for (int i = 0; i < buf->len; ++i) { + kprintf(OMIT_TIMESTAMP "%x", buf->data[i]); + } + + kprintf(OMIT_TIMESTAMP "\n"); +} - for (size_t i = 0; i < 3; ++i) { - kprintf(OMIT_TIMESTAMP ".\f"); - tmr.msleep(1000); +/* + * Used internally by i8042_kb_getc() to acquire + * a key from an extended scancode + * + * @buf: Scancode buf + * @chr: Char res + * + * Returns the extended scancode type on success, + * otherwise a less than zero value (see I8042_XSC_*) + */ +static int +i8042_kb_getxc(struct i8042_databuf *buf, char *chr) +{ + size_t nelem = NELEM(i8042_etab); + struct i8042_databuf *buf_tmp; + size_t len; + + for (int i = 0; i < nelem; ++i) { + buf_tmp = &i8042_etab[i]; + len = buf_tmp->len; + if (memcmp(buf->data, buf_tmp->data, len) == 0) { + return i; + } } - cpu_reboot(0); + return -1; } /* @@ -285,31 +388,16 @@ static int i8042_kb_getc(uint8_t sc, char *chr) { bool release = ISSET(sc, BIT(7)); + struct i8042_databuf buf = {0}; + int x_type; switch (sc) { - /* Left alt [press] */ - case 0x38: - esckey_reboot(); - break; + case 0x76: + *chr = ASCII_ESC; + return 0; /* Caps lock [press] */ case 0x3A: - /* - * In case we are holding the caps lock button down, - * we don't want it to be spam toggled as that would - * be pretty strange looking and probably annoying. - */ - if (!capslock_released) { - return -EAGAIN; - } - - capslock_released = false; - capslock = !capslock; - - if (!capslock) { - kbd_set_leds(0); - } else { - kbd_set_leds(I8042_LED_CAPS); - } + capslock_toggle(); return -EAGAIN; /* Caps lock [release] */ case 0xBA: @@ -326,6 +414,26 @@ i8042_kb_getc(uint8_t sc, char *chr) shift_key = false; } return -EAGAIN; + /* Extended byte */ + case 0xE0: + /* + * Most keyboards have extended scancodes which + * consist of multiple bytes to represent certain + * special keys. We'll need to give the controller + * about 10 ms to refill its buffer. + */ + tmr.msleep(10); + i8042_drain(&buf); + x_type = i8042_kb_getxc(&buf, chr); + + /* Did we implement it? */ + if (x_type < 0) { + pr_error("unknown xsc: "); + i8042_ext_dump(&buf); + return -EAGAIN; + } + + return -1; } if (release) { @@ -346,43 +454,30 @@ i8042_kb_getc(uint8_t sc, char *chr) return 0; } -static void -i8042_sync_loop(void) -{ - /* Wake up the bus */ - outb(I8042_DATA, 0x00); - i8042_drain(); - - for (;;) { - i8042_sync(); - md_pause(); - } -} - /* * Grabs a key from the keyboard, used typically * for syncing the machine however can be used - * to bypass IRQs in case of buggy EC. + * to bypass IRQs to prevent lost bytes. */ void i8042_sync(void) { static struct spinlock lock; struct cons_input input; - uint8_t data; + uint8_t data, status; char c; if (spinlock_try_acquire(&lock)) { return; } - if (ISSET(quirks, I8042_HOSTILE) && is_init) { - if (i8042_statpoll(I8042_OBUFF, true) < 0) { - /* No data ready */ + if (is_init) { + status = inb(I8042_STATUS); + if (!ISSET(status, I8042_OBUFF)) { goto done; } - data = inb(I8042_DATA); + data = inb(I8042_DATA); if (i8042_kb_getc(data, &c) == 0) { input.scancode = data; input.chr = c; @@ -399,9 +494,20 @@ i8042_quirk(int mask) quirks |= mask; } +static void +i8042_sync_loop(void) +{ + for (;;) { + i8042_obuf_wait(); + i8042_sync(); + } +} + static int i8042_init(void) { + const char *prodver = NULL; + /* Try to request a general purpose timer */ if (req_timer(TIMER_GP, &tmr) != TMRR_SUCCESS) { pr_error("failed to fetch general purpose timer\n"); @@ -420,6 +526,9 @@ i8042_init(void) return -ENODEV; } + i8042_write(I8042_CMD, I8042_DISABLE_PORT0); + i8042_write(I8042_CMD, I8042_DISABLE_PORT1); + /* * On some thinkpads, e.g., the T420s, the EC implementing * the i8042 logic likes to play cop and throw NMIs at us @@ -427,26 +536,33 @@ i8042_init(void) * etc... As of now, treat the i8042 like a fucking bomb * if this bit is set. */ - if (strcmp(acpi_oemid(), "LENOVO") == 0) { + if ((prodver = dmi_prodver()) == NULL) { + prodver = "None"; + } + if (strcmp(prodver, "ThinkPad T420s") == 0) { quirks |= I8042_HOSTILE; - pr_trace("lenovo device, assuming hostile\n"); + pr_trace("ThinkPad T420s detected, assuming hostile\n"); pr_trace("disabling irq 1, polling as fallback\n"); - spawn(&polltd, i8042_sync_loop, NULL, 0, NULL); } - if (!ISSET(quirks, I8042_HOSTILE)) { + /* + * If the i8042 has the hostile quirk or we are + * configured to poll for events, spawn the polling + * thread. + */ + if (!ISSET(quirks, I8042_HOSTILE) && !I8042_POLL) { /* Enable interrupts */ - i8042_drain(); + i8042_drain(NULL); i8042_en_intr(); + } else if (ISSET(quirks, I8042_HOSTILE) || I8042_POLL) { + spawn(&polltd, i8042_sync_loop, NULL, 0, NULL); + pr_trace("polling events\n"); } - if (dev_send(false, 0xFF) == 0xFC) { - pr_error("kbd self test failure\n"); - return -EIO; - } - + i8042_write(I8042_CMD, I8042_ENABLE_PORT0); + i8042_drain(NULL); is_init = true; return 0; } -DRIVER_EXPORT(i8042_init); +DRIVER_EXPORT(i8042_init, "i8042"); diff --git a/sys/arch/amd64/isa/mc1468.c b/sys/arch/amd64/isa/mc1468.c new file mode 100644 index 0000000..1f3ae1d --- /dev/null +++ b/sys/arch/amd64/isa/mc1468.c @@ -0,0 +1,281 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/param.h> +#include <sys/time.h> +#include <sys/driver.h> +#include <sys/device.h> +#include <sys/syslog.h> +#include <fs/devfs.h> +#include <machine/pio.h> +#include <machine/cdefs.h> +#include <string.h> + +#define MC1468_REGSEL 0x70 +#define MC1468_DATA 0x71 + +/* Register A flags */ +#define MC1468_UPDATING BIT(7) + +/* Register B flags */ +#define MC1468_DAYSAVE BIT(1) +#define MC1468_CLOCK24 BIT(2) + +static struct cdevsw mc1468_cdevsw; + +static uint8_t +bin_dabble(uint8_t bin) +{ + uint8_t retval = 0; + uint8_t nibble; + + for (int i = 7; i >= 0; --i) { + retval <<= 1; + if (bin & (1 << i)) { + retval |= 1; + } + + for (int j = 0; j < 2; ++j) { + nibble = retval & (retval >> (4 * nibble)) & 0x0F; + if (nibble >= 5) { + retval += 0x03 << (4 * nibble); + } + } + } + + return retval; +} + +/* + * Read a byte from an MC1468XX register. + */ +static uint8_t +mc1468_read(uint8_t reg) +{ + outb(MC1468_REGSEL, reg); + return inb(MC1468_DATA); +} + +/* + * Write a byte to the MC1468XX register. + */ +static void +mc1468_write(uint8_t reg, uint8_t val) +{ + outb(MC1468_REGSEL, reg); + outb(MC1468_DATA, val); +} + +/* + * Returns true if the MC1468XX is updating + * its time registers. + */ +static bool +mc1468_updating(void) +{ + uint8_t reg_b; + + reg_b = mc1468_read(0xB); + return ISSET(reg_b, MC1468_UPDATING) != 0; +} + +/* + * Check if date `a' and date `b' are synced. + * Used to make sure a bogus date caused by a + * read right before an MC1468XX register + * update doesn't occur. + */ +static bool +mc1468_date_synced(struct date *a, struct date *b) +{ + if (a->year != b->year) + return false; + if (a->month != b->month) + return false; + if (a->day != b->day) + return false; + if (a->sec != b->sec) + return false; + if (a->min != b->min) + return false; + if (a->hour != b->hour) + return false; + + return true; +} + +/* + * Sometimes the clock chip may encode the + * date in binary-coded-decimal. This function + * converts a date in BCD format to plain binary. + */ +static void +mc1468_bcd_conv(struct date *dp) +{ + dp->year = (dp->year & 0x0F) + ((dp->year / 16) * 10); + dp->month = (dp->month & 0x0F) + ((dp->month / 16) * 10); + dp->day = (dp->day & 0x0F) + ((dp->day / 16) * 10); + dp->sec = (dp->sec & 0x0F) + ((dp->sec / 16) * 10); + dp->min = (dp->min & 0x0F) + ((dp->min / 16) * 10); + dp->hour = (dp->hour & 0x0F) + (((dp->hour & 0x70) / 16) * 10); + dp->hour |= dp->hour & 0x80; +} + +/* + * Read the time for the clock without syncing + * it up. + * + * XXX: Please use mc1468_get_date() instead as + * this function may return inconsistent + * values if not used correctly. + */ +static void +__mc1468_get_time(struct date *dp) +{ + dp->year = mc1468_read(0x09); + dp->month = mc1468_read(0x08); + dp->day = mc1468_read(0x07); + dp->sec = mc1468_read(0x00); + dp->min = mc1468_read(0x02); + dp->hour = mc1468_read(0x04); +} + +/* + * Write a new time/date to the chip. + */ +static void +mc1468_set_date(const struct date *dp) +{ + while (mc1468_updating()) { + md_pause(); + } + + mc1468_write(0x08, bin_dabble(dp->month)); + mc1468_write(0x07, bin_dabble(dp->day)); + mc1468_write(0x04, bin_dabble(dp->hour)); + mc1468_write(0x02, bin_dabble(dp->min)); + mc1468_write(0x00, bin_dabble(dp->sec)); +} + +static int +mc1468_get_date(struct date *dp) +{ + struct date date_cur, date_last; + uint8_t reg_b = mc1468_read(0x0B); + + while (mc1468_updating()) { + __mc1468_get_time(&date_last); + } + + /* + * Get the current date and time. + * + * XXX: The date and time returned by __mc1468_get_time() + * may at times be out of sync, read it twice to + * make sure everything is synced up. + */ + do { + while (mc1468_updating()) { + md_pause(); + } + __mc1468_get_time(&date_last); + date_cur.year = date_last.year; + date_cur.month = date_last.month; + date_cur.day = date_last.day; + date_cur.sec = date_last.sec; + date_cur.min = date_last.min; + date_cur.hour = date_last.hour; + } while (!mc1468_date_synced(&date_cur, &date_last)); + + /* Is this in BCD? */ + if (!ISSET(reg_b, 0x04)) { + mc1468_bcd_conv(&date_cur); + } + + /* 24-hour mode? */ + if (ISSET(reg_b, MC1468_CLOCK24)) { + date_cur.hour = ((date_cur.hour & 0x7F) + 12) % 24; + } + + date_cur.year += 2000; + *dp = date_cur; + return 0; +} + +static int +mc1468_dev_read(dev_t dev, struct sio_txn *sio, int flags) +{ + struct date d; + size_t len = sizeof(d); + + if (sio->len > len) { + sio->len = len; + } + + mc1468_get_date(&d); + memcpy(sio->buf, &d, sio->len); + return sio->len; +} + +static int +mc1468_dev_write(dev_t dev, struct sio_txn *sio, int flags) +{ + struct date d; + size_t len = sizeof(d); + + if (sio->len > len) { + sio->len = len; + } + + memcpy(&d, sio->buf, sio->len); + mc1468_set_date(&d); + return sio->len; +} + +static int +mc1468_init(void) +{ + char devname[] = "rtc"; + devmajor_t major; + dev_t dev; + + major = dev_alloc_major(); + dev = dev_alloc(major); + dev_register(major, dev, &mc1468_cdevsw); + devfs_create_entry(devname, major, dev, 0444); + return 0; +} + +static struct cdevsw mc1468_cdevsw = { + .read = mc1468_dev_read, + .write = mc1468_dev_write, +}; + +DRIVER_EXPORT(mc1468_init, "mc1468"); diff --git a/sys/arch/amd64/isa/spkr.c b/sys/arch/amd64/isa/spkr.c index b1bd2a2..c96e5f9 100644 --- a/sys/arch/amd64/isa/spkr.c +++ b/sys/arch/amd64/isa/spkr.c @@ -30,14 +30,60 @@ #include <sys/cdefs.h> #include <sys/errno.h> #include <sys/param.h> +#include <sys/device.h> +#include <sys/driver.h> +#include <fs/devfs.h> #include <dev/timer.h> #include <machine/isa/spkr.h> #include <machine/isa/i8254.h> #include <machine/pio.h> +#include <string.h> #define DIVIDEND 1193180 #define CTRL_PORT 0x61 +static struct cdevsw beep_cdevsw; + +/* + * Write to the pcspkr + * + * Bits 15:0 - frequency (hz) + * Bits 31:16 - duration (msec) + */ +static int +dev_write(dev_t dev, struct sio_txn *sio, int flags) +{ + uint32_t payload = 0; + uint16_t hz; + uint16_t duration; + size_t len = sizeof(payload); + + if (sio->len < len) { + return -EINVAL; + } + + memcpy(&payload, sio->buf, len); + hz = payload & 0xFFFF; + duration = (payload >> 16) & 0xFFFF; + pcspkr_tone(hz, duration); + return sio->len; +} + +static int +beep_init(void) +{ + char devname[] = "beep"; + devmajor_t major; + dev_t dev; + + /* Register the device here */ + major = dev_alloc_major(); + dev = dev_alloc(major); + dev_register(major, dev, &beep_cdevsw); + devfs_create_entry(devname, major, dev, 0666); + return 0; +} + int pcspkr_tone(uint16_t freq, uint32_t msec) { @@ -67,3 +113,10 @@ pcspkr_tone(uint16_t freq, uint32_t msec) outb(CTRL_PORT, tmp & ~3); return 0; } + +static struct cdevsw beep_cdevsw = { + .read = noread, + .write = dev_write +}; + +DRIVER_EXPORT(beep_init, "pcspkr"); diff --git a/sys/arch/amd64/pci/pci_machdep.c b/sys/arch/amd64/pci/pci_machdep.c index 43065b0..5b49a78 100644 --- a/sys/arch/amd64/pci/pci_machdep.c +++ b/sys/arch/amd64/pci/pci_machdep.c @@ -33,6 +33,7 @@ #include <sys/mmio.h> #include <dev/pci/pci.h> #include <dev/pci/pciregs.h> +#include <machine/pci/pci.h> #include <machine/pio.h> #include <machine/bus.h> #include <machine/cpu.h> @@ -73,8 +74,8 @@ pci_get_barreg(struct pci_device *dev, uint8_t bar) } } -pcireg_t -pci_readl(struct pci_device *dev, uint32_t offset) +__weak pcireg_t +md_pci_readl(struct pci_device *dev, uint32_t offset) { uint32_t address; @@ -83,8 +84,8 @@ pci_readl(struct pci_device *dev, uint32_t offset) return inl(0xCFC) >> ((offset & 3) * 8); } -void -pci_writel(struct pci_device *dev, uint32_t offset, pcireg_t val) +__weak void +md_pci_writel(struct pci_device *dev, uint32_t offset, pcireg_t val) { uint32_t address; @@ -163,6 +164,7 @@ pci_enable_msix(struct pci_device *dev, const struct msi_intr *intr) { volatile uint64_t *tbl; struct cpu_info *ci; + struct intr_hand ih, *ih_res; uint32_t data, msg_ctl; uint64_t msg_addr, tmp; uint16_t tbl_off; @@ -184,9 +186,14 @@ pci_enable_msix(struct pci_device *dev, const struct msi_intr *intr) tbl = (void *)((dev->bar[bir] & PCI_BAR_MEMMASK) + MMIO_OFFSET); tbl = (void *)((char *)tbl + tbl_off); - /* Get the vector and setup handler */ - vector = intr_alloc_vector(intr->name, IPL_BIO); - idt_set_desc(vector, IDT_INT_GATE, ISR(intr->handler), 0); + ih.func = intr->handler; + ih.priority = IPL_BIO; + ih.irq = -1; + ih_res = intr_register(intr->name, &ih); + if (ih_res == NULL) { + return -EIO; + } + vector = ih_res->vector; /* * Setup the message data at bits 95:64 of the message diff --git a/sys/conf/GENERIC b/sys/conf/GENERIC new file mode 100644 index 0000000..a8e4620 --- /dev/null +++ b/sys/conf/GENERIC @@ -0,0 +1,10 @@ +// Kernel options +option PANIC_SCR no // Clear screen on panic + +// Kernel constants +setval SCHED_NQUEUE 4 // Number of scheduler queues (for MLFQ) +setval DISK_MAX 16 // Maximum disks to be registered + +// Console attributes +setval CONSOLE_BG 0x000000 +setval CONSOLE_FG 0xB57614 diff --git a/sys/crypto/chacha20.c b/sys/crypto/chacha20.c new file mode 100644 index 0000000..5c979a2 --- /dev/null +++ b/sys/crypto/chacha20.c @@ -0,0 +1,97 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <crypto/chacha20.h> + +static const char sigma[16] = "expand 32-byte k"; + +void chacha20_init(uint32_t state[16], const uint8_t key[32], + const uint8_t nonce[12], uint32_t counter) +{ + state[0] = ((uint32_t *)sigma)[0]; + state[1] = ((uint32_t *)sigma)[1]; + state[2] = ((uint32_t *)sigma)[2]; + state[3] = ((uint32_t *)sigma)[3]; + + for (int i = 0; i < 8; ++i) { + state[4 + i] = ((uint32_t *)key)[i]; + } + + state[12] = counter; + state[13] = ((uint32_t *)nonce)[0]; + state[14] = ((uint32_t *)nonce)[1]; + state[15] = ((uint32_t *)nonce)[2]; +} + +void +chacha20_block(uint32_t state[16], uint8_t out[64]) +{ + uint32_t x[16]; + memcpy(x, state, sizeof(x)); + + for (int i = 0; i < 10; i++) { + + QR(x[0], x[4], x[8], x[12]); + QR(x[1], x[5], x[9], x[13]); + QR(x[2], x[6], x[10], x[14]); + QR(x[3], x[7], x[11], x[15]); + + QR(x[0], x[5], x[10], x[15]); + QR(x[1], x[6], x[11], x[12]); + QR(x[2], x[7], x[8], x[13]); + QR(x[3], x[4], x[9], x[14]); + } + + for (int i = 0; i < 16; ++i) { + x[i] += state[i]; + ((uint32_t *)out)[i] = x[i]; + } + + state[12]++; +} + +void +chacha20_encrypt(uint32_t state[16], uint8_t *in, + uint8_t *out, size_t len) +{ + uint8_t block[64]; + size_t offset = 0; + + while (len > 0) { + chacha20_block(state, block); + size_t n = len > 64 ? 64 : len; + + for (size_t i = 0; i < n; ++i) { + out[offset + i] = in ? in[offset + i] ^ block[i] : block[i]; + } + + offset += n; + len -= n; + } +} diff --git a/sys/crypto/siphash.c b/sys/crypto/siphash.c new file mode 100644 index 0000000..5df2ad2 --- /dev/null +++ b/sys/crypto/siphash.c @@ -0,0 +1,114 @@ +/* <MIT License> + Copyright (c) 2013 Marek Majkowski <marek@popcount.org> + + Permission is hereby granted, free of charge, to any person obtaining a copy + of this software and associated documentation files (the "Software"), to deal + in the Software without restriction, including without limitation the rights + to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + copies of the Software, and to permit persons to whom the Software is + furnished to do so, subject to the following conditions: + + The above copyright notice and this permission notice shall be included in + all copies or substantial portions of the Software. + + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + THE SOFTWARE. + </MIT License> + + Original location: + https://github.com/majek/csiphash/ + + Solution inspired by code from: + Samuel Neves (supercop/crypto_auth/siphash24/little) + djb (supercop/crypto_auth/siphash24/little2) + Jean-Philippe Aumasson (https://131002.net/siphash/siphash24.c) +*/ + +#include <crypto/siphash.h> +#include <stdint.h> + +#if defined(__BYTE_ORDER__) && defined(__ORDER_LITTLE_ENDIAN__) && \ + __BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__ +# define _le64toh(x) ((uint64_t)(x)) +#elif defined(_WIN32) +/* Windows is always little endian, unless you're on xbox360 + http://msdn.microsoft.com/en-us/library/b0084kay(v=vs.80).aspx */ +# define _le64toh(x) ((uint64_t)(x)) +#elif defined(__APPLE__) +# include <libkern/OSByteOrder.h> +# define _le64toh(x) OSSwapLittleToHostInt64(x) +#else + +/* See: http://sourceforge.net/p/predef/wiki/Endianness/ */ +# if defined(__FreeBSD__) || defined(__NetBSD__) || defined(__OpenBSD__) +# include <sys/endian.h> +# else +# include <endian.h> +# endif +# if defined(__BYTE_ORDER) && defined(__LITTLE_ENDIAN) && \ + __BYTE_ORDER == __LITTLE_ENDIAN +# define _le64toh(x) ((uint64_t)(x)) +# else +# define _le64toh(x) le64toh(x) +# endif + +#endif + +#define ROTATE(x, b) (uint64_t)( ((x) << (b)) | ( (x) >> (64 - (b))) ) + +#define HALF_ROUND(a,b,c,d,s,t) \ + a += b; c += d; \ + b = ROTATE(b, s) ^ a; \ + d = ROTATE(d, t) ^ c; \ + a = ROTATE(a, 32); + +#define DOUBLE_ROUND(v0,v1,v2,v3) \ + HALF_ROUND(v0,v1,v2,v3,13,16); \ + HALF_ROUND(v2,v1,v0,v3,17,21); \ + HALF_ROUND(v0,v1,v2,v3,13,16); \ + HALF_ROUND(v2,v1,v0,v3,17,21); + +uint64_t siphash24(const void *src, unsigned long src_sz, const char key[16]) { + const uint64_t *_key = (uint64_t *)key; + uint64_t k0 = _le64toh(_key[0]); + uint64_t k1 = _le64toh(_key[1]); + uint64_t b = (uint64_t)src_sz << 56; + const uint64_t *in = (uint64_t*)src; + + uint64_t v0 = k0 ^ 0x736f6d6570736575ULL; + uint64_t v1 = k1 ^ 0x646f72616e646f6dULL; + uint64_t v2 = k0 ^ 0x6c7967656e657261ULL; + uint64_t v3 = k1 ^ 0x7465646279746573ULL; + + while (src_sz >= 8) { + uint64_t mi = _le64toh(*in); + in += 1; src_sz -= 8; + v3 ^= mi; + DOUBLE_ROUND(v0,v1,v2,v3); + v0 ^= mi; + } + + uint64_t t = 0; uint8_t *pt = (uint8_t *)&t; uint8_t *m = (uint8_t *)in; + switch (src_sz) { + case 7: pt[6] = m[6]; + case 6: pt[5] = m[5]; + case 5: pt[4] = m[4]; + case 4: *((uint32_t*)&pt[0]) = *((uint32_t*)&m[0]); break; + case 3: pt[2] = m[2]; + case 2: pt[1] = m[1]; + case 1: pt[0] = m[0]; + } + b |= _le64toh(t); + + v3 ^= b; + DOUBLE_ROUND(v0,v1,v2,v3); + v0 ^= b; v2 ^= 0xff; + DOUBLE_ROUND(v0,v1,v2,v3); + DOUBLE_ROUND(v0,v1,v2,v3); + return (v0 ^ v1) ^ (v2 ^ v3); +} diff --git a/sys/dev/acpi/uacpi.c b/sys/dev/acpi/uacpi.c index 7dbcb35..6c2bf50 100644 --- a/sys/dev/acpi/uacpi.c +++ b/sys/dev/acpi/uacpi.c @@ -32,6 +32,8 @@ #include <sys/param.h> #include <sys/syslog.h> #include <sys/panic.h> +#include <sys/proc.h> +#include <sys/queue.h> #include <dev/timer.h> #include <uacpi/kernel_api.h> #include <uacpi/platform/arch_helpers.h> @@ -41,10 +43,10 @@ #include <machine/cdefs.h> #include <machine/pio.h> #include <machine/cpu.h> +#include <machine/intr.h> #if defined(__x86_64__) #include <machine/idt.h> #include <machine/ioapic.h> -#include <machine/intr.h> #endif /* __x86_64__ */ #include <dev/acpi/uacpi.h> #include <dev/acpi/acpi.h> @@ -53,22 +55,96 @@ #include <vm/vm.h> #include <string.h> +#define pr_trace(fmt, ...) kprintf("acpi: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) + typedef struct { uacpi_io_addr base; uacpi_size length; } io_range_t; +struct uacpi_work { + uacpi_work_handler hand; + uacpi_handle ctx; + TAILQ_ENTRY(uacpi_work) link; +}; + +uacpi_status +uacpi_kernel_schedule_work(uacpi_work_type type, uacpi_work_handler h, uacpi_handle ctx); + +extern struct proc g_proc0; + +static struct proc *event_td; +static TAILQ_HEAD(, uacpi_work) acpi_gpe_eventq; +static TAILQ_HEAD(, uacpi_work) acpi_notify_eventq; + /* - * TODO: Schedule a system shutdown + * Dispatch ACPI general purpose events from + * hardware. */ -static uacpi_interrupt_ret -power_button_handler(uacpi_handle ctx) +static void +uacpi_gpe_dispatch(void) +{ + struct uacpi_work *work; + + work = TAILQ_FIRST(&acpi_gpe_eventq); + if (work == NULL) { + return; + } + + work->hand(work->ctx); + TAILQ_REMOVE(&acpi_gpe_eventq, work, link); + dynfree(work); +} + +/* + * Dispatch ACPI general notify events. + */ +static void +uacpi_notify_dispatch(void) +{ + struct uacpi_work *work; + + work = TAILQ_FIRST(&acpi_notify_eventq); + if (work == NULL) { + return; + } + + work->hand(work->ctx); + TAILQ_REMOVE(&acpi_gpe_eventq, work, link); + dynfree(work); +} + +static void +uacpi_event_td(void) +{ + for (;;) { + uacpi_gpe_dispatch(); + uacpi_notify_dispatch(); + sched_yield(); + } +} + +static void +shutdown(uacpi_handle ctx) { - md_intoff(); kprintf("power button pressed\n"); kprintf("halting machine...\n"); cpu_halt_all(); - return UACPI_INTERRUPT_HANDLED; +} + +static uacpi_interrupt_ret +power_button_handler(uacpi_handle ctx) +{ + md_intoff(); + uacpi_kernel_schedule_work(UACPI_WORK_GPE_EXECUTION, shutdown, NULL); + md_inton(); + + for (;;) { + md_hlt(); + } + + __builtin_unreachable(); } void * @@ -259,17 +335,16 @@ uacpi_status uacpi_kernel_install_interrupt_handler(uacpi_u32 irq, uacpi_interrupt_handler fn, uacpi_handle ctx, uacpi_handle *out_irq_handle) { - int vec; + struct intr_hand ih; + + ih.func = (void *)fn; + ih.priority = IPL_HIGH; + ih.irq = irq; + if (intr_register("acpi", &ih) == NULL) { + return UACPI_STATUS_INTERNAL_ERROR; + } -#if defined(__x86_64__) - vec = intr_alloc_vector("acpi", IPL_HIGH); - idt_set_desc(vec, IDT_INT_GATE, ISR(fn), IST_HW_IRQ); - ioapic_set_vec(irq, vec); - ioapic_irq_unmask(irq); return UACPI_STATUS_OK; -#else - return UACPI_STATUS_UNIMPLEMENTED; -#endif /* __x86_64__ */ } uacpi_status @@ -279,9 +354,28 @@ uacpi_kernel_uninstall_interrupt_handler([[maybe_unused]] uacpi_interrupt_handle } uacpi_status -uacpi_kernel_schedule_work(uacpi_work_type, uacpi_work_handler, uacpi_handle ctx) +uacpi_kernel_schedule_work(uacpi_work_type type, uacpi_work_handler h, uacpi_handle ctx) { - return UACPI_STATUS_UNIMPLEMENTED; + struct uacpi_work *work; + + work = dynalloc(sizeof(*work)); + if (work == NULL) { + return UACPI_STATUS_OUT_OF_MEMORY; + } + + work->hand = h; + work->ctx = ctx; + + switch (type) { + case UACPI_WORK_GPE_EXECUTION: + TAILQ_INSERT_TAIL(&acpi_gpe_eventq, work, link); + break; + case UACPI_WORK_NOTIFICATION: + TAILQ_INSERT_TAIL(&acpi_notify_eventq, work, link); + break; + } + + return 0; } uacpi_status @@ -514,9 +608,18 @@ uacpi_u64 uacpi_kernel_get_nanoseconds_since_boot(void) { static uacpi_u64 time = 0; + static struct timer tmr = {0}; + tmrr_status_t tmr_error; + + if (time == 0) { + tmr_error = req_timer(TIMER_GP, &tmr); + if (tmr_error != TMRR_SUCCESS) { + time += 1000000; + return time; + } + } - /* TODO */ - time += 1000000; + time = tmr.get_time_nsec(); return time; } @@ -533,25 +636,25 @@ uacpi_init(void) ret = uacpi_initialize(0); if (uacpi_unlikely_error(ret)) { - kprintf("uacpi init error: %s\n", uacpi_status_to_string(ret)); + pr_error("uacpi init error: %s\n", uacpi_status_to_string(ret)); return -1; } ret = uacpi_namespace_load(); if (uacpi_unlikely_error(ret)) { - kprintf("uacpi namespace load error: %s\n", uacpi_status_to_string(ret)); + pr_error("uacpi namespace load error: %s\n", uacpi_status_to_string(ret)); return -1; } ret = uacpi_namespace_initialize(); if (uacpi_unlikely_error(ret)) { - kprintf("uacpi namespace init error: %s\n", uacpi_status_to_string(ret)); + pr_error("uacpi namespace init error: %s\n", uacpi_status_to_string(ret)); return -1; } ret = uacpi_finalize_gpe_initialization(); if (uacpi_unlikely_error(ret)) { - kprintf("uacpi GPE init error: %s\n", uacpi_status_to_string(ret)); + pr_error("uacpi GPE init error: %s\n", uacpi_status_to_string(ret)); return -1; } @@ -561,11 +664,14 @@ uacpi_init(void) ); if (uacpi_unlikely_error(ret)) { - kprintf("failed to install power button event: %s\n", + pr_error("failed to install power button event: %s\n", uacpi_status_to_string(ret) ); return -1; } + TAILQ_INIT(&acpi_gpe_eventq); + TAILQ_INIT(&acpi_notify_eventq); + spawn(&g_proc0, uacpi_event_td, NULL, 0, &event_td); return 0; } diff --git a/sys/dev/acpi/uacpi/event.c b/sys/dev/acpi/uacpi/event.c index 0c58372..62412ac 100644 --- a/sys/dev/acpi/uacpi/event.c +++ b/sys/dev/acpi/uacpi/event.c @@ -1054,7 +1054,6 @@ static uacpi_status create_gpe_block( */ reg->base_idx = base_idx + (i * EVENTS_PER_GPE_REGISTER); - tmp_gas.address = address + i; ret = uacpi_map_gas_noalloc(&tmp_gas, ®->status); if (uacpi_unlikely_error(ret)) diff --git a/sys/dev/acpi/uacpi/resources.c b/sys/dev/acpi/uacpi/resources.c index a9bcb82..f1a25ec 100644 --- a/sys/dev/acpi/uacpi/resources.c +++ b/sys/dev/acpi/uacpi/resources.c @@ -602,7 +602,6 @@ static uacpi_size aml_size_for_serial_connection( #define ARG1(value) .f2.arg1 = (value) #define ARG2(value) .f3.arg2 = (value) - static const struct uacpi_resource_convert_instruction convert_irq_to_native[] = { OP(PACKED_ARRAY_16, AML_F(irq, irq_mask), NATIVE_F(irq, irqs), ARG2(NATIVE_O(irq, num_irqs))), diff --git a/sys/dev/acpi/uacpi/tables.c b/sys/dev/acpi/uacpi/tables.c index df7d7b9..3314fd1 100644 --- a/sys/dev/acpi/uacpi/tables.c +++ b/sys/dev/acpi/uacpi/tables.c @@ -1211,7 +1211,6 @@ static void gas_init_system_io( gas->access_size = 0; } - struct register_description { uacpi_size offset, xoffset; uacpi_size length_offset; diff --git a/sys/dev/acpi/uacpi/utilities.c b/sys/dev/acpi/uacpi/utilities.c index c7ca20a..059c574 100644 --- a/sys/dev/acpi/uacpi/utilities.c +++ b/sys/dev/acpi/uacpi/utilities.c @@ -963,7 +963,6 @@ static uacpi_iteration_decision find_one_device( return ctx->cb(ctx->user, node, depth); } - uacpi_status uacpi_find_devices_at( uacpi_namespace_node *parent, const uacpi_char *const *hids, uacpi_iteration_callback cb, void *user diff --git a/sys/dev/cons/cons.c b/sys/dev/cons/cons.c index b89727f..0bb33b1 100644 --- a/sys/dev/cons/cons.c +++ b/sys/dev/cons/cons.c @@ -37,6 +37,7 @@ #include <dev/cons/font.h> #include <dev/cons/cons.h> #include <fs/devfs.h> +#include <fs/ctlfs.h> #include <vm/dynalloc.h> #include <string.h> @@ -44,7 +45,7 @@ cons_draw_cursor((SCR), (SCR)->bg) #define SHOW_CURSOR(SCR) \ - cons_draw_cursor((SCR), (SCR)->fg) + cons_draw_cursor((SCR), rgb_invert((SCR)->bg)) /* Console background from kconf */ #if defined(__CONSOLE_BG) @@ -62,10 +63,27 @@ struct cons_screen g_root_scr = {0}; static struct cdevsw cons_cdevsw; +static struct ctlops cons_feat_ctl; +static struct ctlops cons_attr_ctl; static void cons_draw_cursor(struct cons_screen *scr, uint32_t color); static int cons_handle_special(struct cons_screen *scr, char c); -static void cons_clear_scr(struct cons_screen *scr, uint32_t bg); + +static uint32_t +rgb_invert(uint32_t rgb) +{ + uint8_t r, g, b; + uint32_t ret; + + r = (rgb >> 16) & 0xFF; + g = (rgb >> 8) & 0xFF; + b = rgb & 0xFF; + + ret = (255 - r) << 16; + ret |= (255 - g) << 8; + ret |= 255 - b; + return ret; +} /* * Render a character onto the screen. @@ -91,9 +109,9 @@ cons_draw_char(struct cons_screen *scr, struct cons_char ch) y = ch.y; for (uint32_t cy = 0; cy < FONT_HEIGHT; ++cy) { + idx = fbdev_get_index(&scr->fbdev, x + (FONT_WIDTH - 1), y + cy); for (uint32_t cx = 0; cx < FONT_WIDTH; ++cx) { - idx = fbdev_get_index(&scr->fbdev, x + (FONT_WIDTH - 1) - cx, y + cy); - scr->fb_mem[idx] = ISSET(glyph[cy], BIT(cx)) ? ch.fg : ch.bg; + scr->fb_mem[idx--] = ISSET(glyph[cy], BIT(cx)) ? ch.fg : ch.bg; } } } @@ -158,6 +176,17 @@ cons_handle_special(struct cons_screen *scr, char c) } switch (c) { + case ASCII_HT: + HIDE_CURSOR(scr); + scr->curs_col += 4; + scr->ch_col += 4; + if (scr->ch_col >= scr->ncols - 1) { + cons_handle_special(scr, '\n'); + } + SHOW_CURSOR(scr); + return 0; + case ASCII_NUL: + return 0; case ASCII_BS: bp = scr->ob[scr->ch_row]; if (bp->head > bp->tail) { @@ -165,27 +194,21 @@ cons_handle_special(struct cons_screen *scr, char c) } HIDE_CURSOR(scr); - --scr->ch_col; - --scr->curs_col; + if (scr->ch_col > 0 && scr->curs_col > 0) { + --scr->ch_col; + --scr->curs_col; + } SHOW_CURSOR(scr); return 0; case ASCII_LF: - HIDE_CURSOR(scr); - /* Are we past screen width? */ if (scr->ch_row >= scr->nrows - 1) { cons_clear_scr(scr, scr->bg); - cons_flush(scr); - scr->ch_col = 0; - scr->ch_row = 0; - - /* Update cursor */ - scr->curs_row = 0; - scr->curs_col = 0; - SHOW_CURSOR(scr); return 0; } + HIDE_CURSOR(scr); + /* Make a newline */ cons_flush(scr); ++scr->ch_row; @@ -212,8 +235,14 @@ cons_handle_special(struct cons_screen *scr, char c) static void cons_draw_cursor(struct cons_screen *scr, uint32_t color) { + struct console_feat *featp; size_t idx; + featp = &scr->feat; + if (!featp->show_curs) { + color = scr->bg; + } + /* Past screen width? */ if (scr->curs_col >= scr->ncols) { scr->curs_col = 0; @@ -221,9 +250,9 @@ cons_draw_cursor(struct cons_screen *scr, uint32_t color) } for (uint32_t cy = 0; cy < FONT_HEIGHT; ++cy) { + idx = fbdev_get_index(&scr->fbdev, scr->curs_col * FONT_WIDTH, (scr->curs_row * FONT_HEIGHT) + cy); for (uint32_t cx = 0; cx < FONT_WIDTH; ++cx) { - idx = fbdev_get_index(&scr->fbdev, (scr->curs_col * FONT_WIDTH) + cx, (scr->curs_row * FONT_HEIGHT) + cy); - scr->fb_mem[idx] = color; + scr->fb_mem[idx++] = color; } } } @@ -234,34 +263,88 @@ cons_draw_cursor(struct cons_screen *scr, uint32_t color) * @scr: Screen to clear. * @bg: Color to clear it to. */ -static void +void cons_clear_scr(struct cons_screen *scr, uint32_t bg) { struct fbdev fbdev = scr->fbdev; - struct cons_buf *bp; + + cons_flush(scr); + HIDE_CURSOR(scr); + + scr->ch_col = 0; + scr->ch_row = 0; + scr->curs_col = 0; + scr->curs_row = 0; for (size_t i = 0; i < fbdev.height * fbdev.pitch; ++i) { scr->fb_mem[i] = bg; } - bp = scr->ob[scr->nrows - 1]; - bp->flags |= CONS_BUF_CLEAN; + SHOW_CURSOR(scr); + } /* - * Character device function. + * Quickly put a character on the screen. + * XXX: Does not acquire the screen's lock or show/hide the cursor. + * + * @scr: Screen. + * @c: Character to draw. */ -static int -dev_write(dev_t dev, struct sio_txn *sio, int flags) +static void +cons_fast_putch(struct cons_screen *scr, char c) { - char *p; + struct cons_char cc; + struct cons_buf *bp; + int ansi; + + ansi = ansi_feed(&scr->ansi_s, c); + if (ansi > 0) { + c = ASCII_NUL; + } else if (ansi < 0) { + c = ASCII_NUL; + } + + /* Handle specials */ + if (cons_handle_special(scr, c) == 0) { + return; + } + + /* Create a new character */ + cc.c = c; + cc.fg = scr->fg; + cc.bg = scr->bg; + cc.x = scr->ch_col * FONT_WIDTH; + cc.y = scr->ch_row * FONT_HEIGHT; + + /* Push our new character */ + bp = scr->ob[scr->ch_row]; + bp->flags &= ~CONS_BUF_CLEAN; + cons_obuf_push(bp, cc); + ++scr->ch_col; - p = sio->buf; + /* Check screen bounds */ + if (cc.x >= (scr->ncols * FONT_WIDTH) - 1) { + scr->ch_col = 0; + ++scr->ch_row; + } - for (size_t i = 0; i < sio->len; ++i) { - cons_putch(&g_root_scr, p[i]); + ++scr->curs_col; + if (scr->curs_col > scr->ncols - 1) { + scr->curs_col = 0; + if (scr->curs_row < scr->nrows) + ++scr->curs_row; } +} +/* + * Character device function. + */ +static int +dev_write(dev_t dev, struct sio_txn *sio, int flags) +{ + cons_attach(); + cons_putstr(&g_root_scr, sio->buf, sio->len); cons_flush(&g_root_scr); return sio->len; } @@ -272,6 +355,7 @@ dev_write(dev_t dev, struct sio_txn *sio, int flags) static int dev_read(dev_t dev, struct sio_txn *sio, int flags) { + struct cons_screen *scr = &g_root_scr; struct cons_input input; uint8_t *p; int retval; @@ -285,12 +369,12 @@ dev_read(dev_t dev, struct sio_txn *sio, int flags) return -EFAULT; } - retval = cons_ibuf_pop(&g_root_scr, &input); + retval = cons_ibuf_pop(scr, &input); if (retval < 0) { return -EAGAIN; } - spinlock_acquire(&g_root_scr.lock); + cons_attach(); for (;;) { /* Buffer too small */ if (n == 0) { @@ -302,12 +386,11 @@ dev_read(dev_t dev, struct sio_txn *sio, int flags) n -= 2; /* Try to get the next byte */ - retval = cons_ibuf_pop(&g_root_scr, &input); + retval = cons_ibuf_pop(scr, &input); if (retval < 0) { break; } } - spinlock_release(&g_root_scr.lock); return sio->len; } @@ -338,6 +421,195 @@ cons_init_bufs(struct cons_screen *scr) return 0; } +static int +ctl_feat_read(struct ctlfs_dev *cdp, struct sio_txn *sio) +{ + struct cons_screen *scr = &g_root_scr; + struct console_feat *featp; + + if (sio->buf == NULL || sio->len == 0) { + return -EINVAL; + } + + featp = &scr->feat; + if (sio->len > sizeof(*featp)) { + sio->len = sizeof(*featp); + } + + memcpy(sio->buf, featp, sio->len); + return sio->len; +} + +static int +ctl_feat_write(struct ctlfs_dev *cdp, struct sio_txn *sio) +{ + struct cons_screen *scr = &g_root_scr; + struct console_feat *featp, oldfeat; + + featp = &scr->feat; + oldfeat = *featp; + if (sio->len > sizeof(*featp)) { + sio->len = sizeof(*featp); + } + + memcpy(featp, sio->buf, sio->len); + + /* + * If we are suddenly trying to reset the cursor + * status, redraw it. + */ + if (featp->show_curs != oldfeat.show_curs) { + if (featp->show_curs == 0) { + HIDE_CURSOR(scr); + } else { + SHOW_CURSOR(scr); + } + } + return sio->len; +} + +static int +ctl_attr_read(struct ctlfs_dev *cdp, struct sio_txn *sio) +{ + struct cons_screen *scr = &g_root_scr; + struct console_attr *attrp; + + if (sio->buf == NULL || sio->len == 0) { + return -EINVAL; + } + + attrp = &scr->attr; + if (sio->len > sizeof(*attrp)) { + sio->len = sizeof(*attrp); + } + + memcpy(sio->buf, attrp, sio->len); + return sio->len; +} + +static int +ctl_attr_write(struct ctlfs_dev *cdp, struct sio_txn *sio) +{ + struct cons_screen *scr = &g_root_scr; + struct console_attr *attrp; + + attrp = &scr->attr; + if (sio->len > sizeof(*attrp)) { + sio->len = sizeof(*attrp); + } + + spinlock_acquire(&scr->lock); + HIDE_CURSOR(scr); + memcpy(attrp, sio->buf, sio->len); + + /* Clip the x/y positions */ + if (attrp->cursor_x >= scr->ncols) + attrp->cursor_x = scr->ncols - FONT_WIDTH; + if (attrp->cursor_y >= scr->nrows) + attrp->cursor_y = scr->nrows - FONT_HEIGHT; + + /* Update cursor */ + scr->curs_col = attrp->cursor_x; + scr->curs_row = attrp->cursor_y; + scr->ch_col = attrp->cursor_x; + scr->ch_row = attrp->cursor_y; + SHOW_CURSOR(scr); + + spinlock_release(&scr->lock); + return sio->len; +} + +/* + * Detach the currently running process from the + * console. + */ +int +cons_detach(void) +{ + struct cons_screen *scr; + + scr = &g_root_scr; + if (scr->atproc == NULL) { + return 0; + } + if (scr->atproc_lock == NULL) { + return 0; + } + + scr = &g_root_scr; + scr->atproc = NULL; + mutex_release(scr->atproc_lock); + return 0; +} + +/* + * Attach the current process to the + * console. + */ +int +cons_attach(void) +{ + struct cons_screen *scr; + struct proc *td, *atproc; + + td = this_td(); + if (td == NULL) { + return -1; + } + + scr = &g_root_scr; + if (scr->atproc_lock == NULL) { + return 0; + } + + scr = &g_root_scr; + atproc = scr->atproc; + + if (atproc != NULL) { + if (atproc->pid == td->pid) { + return 0; + } + + /* + * Do not release this here as we want + * any other process that tries to attach + * to wait. + */ + mutex_acquire(scr->atproc_lock, 0); + } + + scr->atproc = td; + return 0; +} + +/* + * Reset console color. + */ +void +cons_reset_color(struct cons_screen *scr) +{ + g_root_scr.fg = CONSOLE_FG; + g_root_scr.bg = CONSOLE_BG; +} + +void +cons_update_color(struct cons_screen *scr, uint32_t fg, uint32_t bg) +{ + scr->fg = fg; + scr->bg = bg; +} + +void +cons_reset_cursor(struct cons_screen *scr) +{ + HIDE_CURSOR(scr); + scr->ch_col = 0; + scr->ch_row = 0; + scr->curs_col = 0; + scr->curs_row = 0; + SHOW_CURSOR(scr); +} + /* * Put a character on the screen. * @@ -347,47 +619,37 @@ cons_init_bufs(struct cons_screen *scr) int cons_putch(struct cons_screen *scr, char c) { - struct cons_buf *bp; - struct cons_char cc; - size_t max_width; - spinlock_acquire(&scr->lock); + HIDE_CURSOR(scr); - /* Handle specials */ - if (cons_handle_special(scr, c) == 0) { - goto done; - } + cons_fast_putch(scr, c); - HIDE_CURSOR(scr); + SHOW_CURSOR(scr); + spinlock_release(&scr->lock); + return 0; +} - /* Create a new character */ - cc.c = c; - cc.fg = scr->fg; - cc.bg = scr->bg; - cc.x = scr->ch_col * FONT_WIDTH; - cc.y = scr->ch_row * FONT_HEIGHT; +/* + * Put a string on the screen. + * + * @scr: Screen. + * @s: String to draw. + * @l: Length of s. + */ +int +cons_putstr(struct cons_screen *scr, const char *s, size_t len) +{ + const char *p = s; - /* Push our new character */ - bp = scr->ob[scr->ch_row]; - bp->flags &= ~CONS_BUF_CLEAN; - cons_obuf_push(bp, cc); - ++scr->ch_col; + spinlock_acquire(&scr->lock); + HIDE_CURSOR(scr); - /* Check screen bounds */ - max_width = scr->ncols * FONT_WIDTH; - if (cc.x >= max_width - 1) { - scr->ch_col = 0; - ++scr->ch_row; + while (len--) { + cons_fast_putch(scr, *p); + ++p; } - ++scr->curs_col; - if (scr->curs_col > scr->ncols - 1) { - scr->curs_col = 0; - if (scr->curs_row < scr->nrows) - ++scr->curs_row; - } SHOW_CURSOR(scr); -done: spinlock_release(&scr->lock); return 0; } @@ -396,7 +658,11 @@ void cons_init(void) { struct fbdev fbdev = fbdev_get(); + struct console_feat *featp; + featp = &g_root_scr.feat; + featp->ansi_esc = 1; + featp->show_curs = 1; g_root_scr.ch_col = 0; g_root_scr.ch_row = 0; g_root_scr.fg = CONSOLE_FG; @@ -405,6 +671,8 @@ cons_init(void) g_root_scr.nrows = fbdev.height / FONT_HEIGHT; g_root_scr.ncols = fbdev.width / FONT_WIDTH; g_root_scr.fbdev = fbdev; + g_root_scr.atproc = NULL; + g_root_scr.atproc_lock = NULL; memset(&g_root_scr.lock, 0, sizeof(g_root_scr.lock)); cons_init_bufs(&g_root_scr); SHOW_CURSOR(&g_root_scr); @@ -417,6 +685,7 @@ void cons_expose(void) { static int once = 0; + struct ctlfs_dev ctl; char devname[] = "console"; devmajor_t major; dev_t dev; @@ -426,11 +695,28 @@ cons_expose(void) return; } + /* Init the attached proc mutex lock */ + g_root_scr.atproc_lock = mutex_new("console0"); + /* Register the device here */ major = dev_alloc_major(); dev = dev_alloc(major); dev_register(major, dev, &cons_cdevsw); devfs_create_entry(devname, major, dev, 0444); + + /* Register feat ctl */ + ctl.mode = 0666; + ctlfs_create_node(devname, &ctl); + ctl.devname = devname; + ctl.ops = &cons_feat_ctl; + ctlfs_create_entry("feat", &ctl); + + /* Register attr ctl */ + ctl.mode = 0666; + ctlfs_create_node(devname, &ctl); + ctl.devname = devname; + ctl.ops = &cons_attr_ctl; + ctlfs_create_entry("attr", &ctl); once ^= 1; } @@ -438,3 +724,13 @@ static struct cdevsw cons_cdevsw = { .read = dev_read, .write = dev_write }; + +static struct ctlops cons_feat_ctl = { + .read = ctl_feat_read, + .write = ctl_feat_write +}; + +static struct ctlops cons_attr_ctl = { + .read = ctl_attr_read, + .write = ctl_attr_write +}; diff --git a/sys/dev/cons/cons_ansi.c b/sys/dev/cons/cons_ansi.c new file mode 100644 index 0000000..bd78d9a --- /dev/null +++ b/sys/dev/cons/cons_ansi.c @@ -0,0 +1,189 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/cdefs.h> +#include <sys/console.h> +#include <dev/cons/cons.h> +#include <dev/cons/ansi.h> +#include <string.h> + +__always_inline static inline bool +is_valid_color(int c) +{ + return c >= '0' && c <= '7'; +} + +static inline void +ansi_reset(struct ansi_state *statep) +{ + memset(statep, 0, sizeof(*statep)); +} + +/* + * Feed a byte into the ANSI escape sequence + * state machine. + * + * @statep: State machine pointer. + * @c: Byte to feed. + * + * On success, `c' is returned. On failure, + * 0 is returned. Values less than 0 indicate + * success with console attributes updated + * (ANSI_UPDATE_*). + */ +int +ansi_feed(struct ansi_state *statep, char c) +{ + struct cons_screen *scr = &g_root_scr; + struct console_feat *featp; + + /* Standard colors */ + static uint32_t colortab[] = { + ANSI_BLACK, ANSI_RED, + ANSI_GREEN, ANSI_YELLOW, + ANSI_BLUE, ANSI_MAGENTA, + ANSI_CYAN, ANSI_WHITE + }; + + featp = &scr->feat; + if (!featp->ansi_esc) { + return 0; + } + + /* + * Handle the control sequence introducer + * bytes. + */ + switch (statep->csi) { + case 0: /* '\033' */ + if (c != '\033') { + return 0; + } + statep->csi = 1; + statep->prev = c; + return c; + case 1: /* '[' */ + if (c != '[') { + ansi_reset(statep); + return 0; + } + statep->csi = 2; + statep->prev = c; + return c; + case 2: + if (c == '2') { + statep->csi = 3; + statep->prev = c; + return c; + } + break; + case 3: + /* Did we get '\033[2J' ? */ + if (statep->prev == '2' && c == 'J') { + cons_clear_scr(scr, g_root_scr.bg); + ansi_reset(statep); + return ANSI_UPDATE_CURSOR; + } + break; + } + + if (!statep->set_fg && !statep->set_bg) { + /* Reset attributes? */ + if (statep->reset_color) { + ansi_reset(statep); + cons_reset_color(scr); + return ANSI_UPDATE_COLOR; + } + + /* Mark attributes to be reset? */ + if (c == '0') { + statep->reset_color = 1; + statep->prev = c; + return c; + } + + /* Expect foreground */ + if (c != '3') { + ansi_reset(statep); + return 0; + } + statep->set_fg = 1; + statep->prev = c; + return c; + } + + if (statep->set_fg && c != ';') { + /* Make sure this is valid */ + if (!is_valid_color(c)) { + ansi_reset(statep); + return 0; + } + + /* Set the foreground */ + statep->fg = colortab[c - '0']; + statep->set_bg = 1; + statep->set_fg = 0; + statep->prev = c; + return c; + } + + if (statep->set_bg) { + if (c == ';') { + statep->prev = c; + return c; + } + + /* Expect '4' after ';' */ + if (statep->prev == ';' && c != '4') { + ansi_reset(statep); + return 0; + } + + if (c == 'm') { + cons_update_color(scr, statep->fg, statep->bg); + ansi_reset(statep); + return ANSI_UPDATE_COLOR; + } + + /* Make sure this is valid */ + if (!is_valid_color(c)) { + ansi_reset(statep); + return 0; + } + + /* Set the background */ + statep->bg = colortab[c - '0']; + statep->prev = c; + return c; + } + + ansi_reset(statep); + return 0; +} diff --git a/sys/dev/dcdr/cache.c b/sys/dev/dcdr/cache.c index c44c8ea..33f977e 100644 --- a/sys/dev/dcdr/cache.c +++ b/sys/dev/dcdr/cache.c @@ -126,6 +126,20 @@ struct dcd * dcdr_cachein(struct dcdr *dcdr, void *block, off_t lba) { struct dcd *dcd, *tmp; + struct dcdr_lookup check; + int status; + + /* + * If there is already a block within this + * DCDR, then we simply need to copy the + * new data into the old DCD. + */ + status = dcdr_lookup(dcdr, lba, &check); + if (status == 0) { + dcd = check.dcd_res; + memcpy(dcd->block, block, dcdr->bsize); + return dcd; + } dcd = dynalloc(sizeof(*dcd)); if (dcd == NULL) { diff --git a/sys/dev/dmi/dmi.c b/sys/dev/dmi/dmi.c new file mode 100644 index 0000000..73a9ab7 --- /dev/null +++ b/sys/dev/dmi/dmi.c @@ -0,0 +1,306 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/limine.h> +#include <sys/errno.h> +#include <sys/param.h> +#include <sys/driver.h> +#include <sys/cdefs.h> +#include <sys/syslog.h> +#include <dev/dmi/dmi.h> +#include <dev/dmi/dmivar.h> +#include <dev/acpi/tables.h> +#include <fs/ctlfs.h> +#include <string.h> + +#define DMI_BIOS_INFO 0 +#define DMI_SYSTEM_INFO 1 +#define DMI_PROCESSOR_INFO 4 +#define DMI_END_OF_TABLE 127 + +/* String offsets */ +#define BIOSINFO_VENDOR 0x01 +#define SYSINFO_PRODUCT 0x02 +#define SYSINFO_VERSION 0x03 +#define SYSINFO_FAMILY 0x06 +#define PROCINFO_MANUFACT 0x02 +#define PROCINFO_VERSION 0x03 +#define PROCINFO_PARTNO 0x06 + +static struct limine_smbios_request smbios_req = { + .id = LIMINE_SMBIOS_REQUEST, + .revision = 0 +}; + +/* DMI/SMBIOS structure header */ +struct __packed dmi_shdr { + uint8_t type; + uint8_t length; + uint16_t handle; +} *hdrs[DMI_END_OF_TABLE + 1]; + +/* + * Grab a structure header from a type + * + * @type: A DMI structure type to find + * + * Returns NULL if not found. + */ +static inline struct dmi_shdr * +dmi_shdr(uint8_t type) +{ + struct dmi_shdr *hdr; + + hdr = hdrs[type]; + if (hdr == NULL) { + return NULL; + } + + return hdr; +} + +/* + * Grab a string from the DMI/SMBIOS formatted + * section. + * + * @hdr: DMI header to lookup string index + * @index: 1-based string index + * + * See section 6.1.3 of the DTMF SMBIOS Reference + * Specification + */ +static const char * +dmi_str_index(struct dmi_shdr *hdr, uint8_t index) +{ + const char *strdata = PTR_OFFSET(hdr, hdr->length); + + for (uint8_t i = 1; *strdata != '\0'; ++i) { + if (i == index) { + return strdata; + } + + strdata += strlen(strdata) + 1; + } + + return NULL; +} + +/* + * Get the DMI/SMBIOS structure size from a + * header. + */ +static size_t +dmi_struct_size(struct dmi_shdr *hdr) +{ + const char *strdata; + size_t i = 1; + + strdata = PTR_OFFSET(hdr, hdr->length); + while (strdata[i - 1] != '\0' || strdata[i] != '\0') { + ++i; + } + + return hdr->length + i + 1; +} + +/* + * Get the vendor string from the DMI/SMBIOS BIOS + * info structure + * + * Returns NULL if not found. + */ +const char * +dmi_vendor(void) +{ + struct dmi_shdr *hdr; + + if ((hdr = dmi_shdr(DMI_BIOS_INFO)) == NULL) { + return NULL; + } + + return dmi_str_index(hdr, BIOSINFO_VENDOR); +} + +/* + * Return the product string from the DMI/SMBIOS System + * Info structure + * + * Returns NULL if not found. + */ +const char * +dmi_product(void) +{ + struct dmi_shdr *hdr; + + if ((hdr = dmi_shdr(DMI_SYSTEM_INFO)) == NULL) { + return NULL; + } + + return dmi_str_index(hdr, SYSINFO_PRODUCT); +} + +/* + * Return the product version from the DMI/SMBIOS + * System Info structure + * + * Returns NULL if not found + */ +const char * +dmi_prodver(void) +{ + struct dmi_shdr *hdr; + + if ((hdr = dmi_shdr(DMI_SYSTEM_INFO)) == NULL) { + return NULL; + } + + return dmi_str_index(hdr, SYSINFO_VERSION); +} + +/* + * Return the product family from the DMI/SMBIOS + * System Info structure + * + * Returns NULL if not found + */ +const char * +dmi_prodfam(void) +{ + struct dmi_shdr *hdr; + + if ((hdr = dmi_shdr(DMI_SYSTEM_INFO)) == NULL) { + return NULL; + } + + return dmi_str_index(hdr, SYSINFO_FAMILY); +} + +/* + * Return the CPU manufacturer string from the + * DMI/SMBIOS Processor Info structure + * + * Returns NULL if not found + */ +const char * +dmi_cpu_manufact(void) +{ + struct dmi_shdr *hdr; + + if ((hdr = dmi_shdr(DMI_PROCESSOR_INFO)) == NULL) { + return NULL; + } + + return dmi_str_index(hdr, PROCINFO_MANUFACT); +} + +/* + * Return the CPU version string from the + * DMI/SMBIOS Processor Info structure + * + * Returns NULL if not found + */ +const char * +dmi_cpu_version(void) +{ + struct dmi_shdr *hdr; + + if ((hdr = dmi_shdr(DMI_PROCESSOR_INFO)) == NULL) { + return NULL; + } + + return dmi_str_index(hdr, PROCINFO_VERSION); +} + +static void +dmi_init_ctl(void) +{ + struct ctlfs_dev ctl; + char ctlname[] = "dmi"; + + /* Create '/ctl/dmi/board' */ + ctl.mode = 0444; + ctlfs_create_node(ctlname, &ctl); + ctl.devname = ctlname; + ctl.ops = &g_ctl_board_ident; + ctlfs_create_entry("board", &ctl); +} + +static int +dmi_init(void) +{ + struct dmi_entry32 *entry32 = NULL; + struct limine_smbios_response *resp = smbios_req.response; + struct dmi_entry64 *entry64 = NULL; + struct dmi_shdr *hdr = NULL; + size_t scount = 0, smax_len = 0; + size_t nbytes = 0, cur_nbytes = 0; + + if (resp == NULL) { + return -ENODEV; + } + if (resp->entry_32 == 0 && resp->entry_64 == 0) { + return -ENODEV; + } + + if (resp->entry_64 != 0) { + entry64 = (void *)resp->entry_64; + hdr = PHYS_TO_VIRT(entry64->addr); + smax_len = entry64->max_size; + } else if (resp->entry_32 != 0) { + entry32 = (void *)(uint64_t)resp->entry_32; + hdr = PHYS_TO_VIRT((uint64_t)entry32->addr); + scount = entry32->nstruct; + } else { + return -ENODEV; + } + + memset(hdrs, 0, sizeof(hdrs)); + for (size_t i = 0; i < scount; ++i) { + if (hdr->type == DMI_END_OF_TABLE) { + break; + } + + if (hdr->type < NELEM(hdrs)) { + hdrs[hdr->type] = hdr; + } + cur_nbytes = dmi_struct_size(hdr); + if (smax_len > 0 && (nbytes + cur_nbytes) >= smax_len) { + break; + } + + nbytes += cur_nbytes; + hdr = PTR_OFFSET(hdr, cur_nbytes); + } + + dmi_init_ctl(); + return 0; +} + +DRIVER_EXPORT(dmi_init, "dmi"); diff --git a/sys/dev/dmi/dmi_board.c b/sys/dev/dmi/dmi_board.c new file mode 100644 index 0000000..23709bd --- /dev/null +++ b/sys/dev/dmi/dmi_board.c @@ -0,0 +1,104 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/errno.h> +#include <sys/dmi.h> +#include <dev/dmi/dmi.h> +#include <dev/dmi/dmivar.h> +#include <fs/ctlfs.h> +#include <string.h> + +extern struct ctlops ctl_cpu_ident; + +static int +board_ctl_read(struct ctlfs_dev *cdp, struct sio_txn *sio) +{ + struct dmi_board board; + const char *cpu_manuf, *prodver; + const char *product, *vendor; + const char *cpu_ver, *p; + size_t len; + + if (cdp == NULL || sio == NULL) { + return -EINVAL; + } + /* Cannot copy zero bytes */ + if (sio->len == 0) { + return -EINVAL; + } + + /* Check offset and clamp length */ + if (sio->offset >= sizeof(board)) { + return 0; + } + if ((sio->offset + sio->len) > sizeof(board)) { + sio->len = sizeof(board); + } + + memset(&board, 0, sizeof(board)); + cpu_ver = dmi_cpu_version(); + if (cpu_ver != NULL) { + len = strlen(cpu_ver); + memcpy(board.cpu_version, cpu_ver, len); + } + + prodver = dmi_prodver(); + if (prodver != NULL) { + len = strlen(prodver); + memcpy(board.version, prodver, len); + } + + cpu_manuf = dmi_cpu_manufact(); + if (cpu_manuf != NULL) { + len = strlen(cpu_manuf); + memcpy(board.cpu_manuf, cpu_manuf, len); + } + + product = dmi_product(); + if (product != NULL) { + len = strlen(product); + memcpy(board.product, product, len); + } + + vendor = dmi_vendor(); + if (vendor != NULL) { + len = strlen(vendor); + memcpy(board.vendor, vendor, len); + } + + p = (char *)&board; + memcpy(sio->buf, &p[sio->offset], sio->len); + return sio->len; +} + +struct ctlops g_ctl_board_ident = { + .read = board_ctl_read, + .write = NULL +}; diff --git a/sys/dev/ic/ahci.c b/sys/dev/ic/ahci.c index 8b72cde..d994ef1 100644 --- a/sys/dev/ic/ahci.c +++ b/sys/dev/ic/ahci.c @@ -36,15 +36,18 @@ #include <sys/param.h> #include <sys/bitops.h> #include <sys/mmio.h> +#include <sys/disk.h> #include <dev/pci/pci.h> #include <dev/pci/pciregs.h> #include <dev/timer.h> #include <dev/ic/ahcivar.h> #include <dev/ic/ahciregs.h> +#include <dev/dcdr/cache.h> #include <fs/devfs.h> #include <fs/ctlfs.h> #include <vm/dynalloc.h> #include <vm/physmem.h> +#include <machine/cdefs.h> #include <string.h> #define pr_trace(fmt, ...) kprintf("ahci: " fmt, ##__VA_ARGS__) @@ -55,6 +58,20 @@ static struct bdevsw ahci_bdevsw; static struct hba_device *devs; static struct pci_device *ahci_dev; static struct timer tmr; +static struct ahci_hba g_hba; +static struct driver_var __driver_var; + +#define MODEL_LEN 40 /* Model number length */ +#define SERIAL_LEN 20 /* Serial number length */ + +/* + * Simplified structure containing certain + * information from device identity. + */ +struct dev_info { + char model[MODEL_LEN]; + char serial[SERIAL_LEN]; +}; /* * Poll register to have 'bits' set/unset. @@ -94,6 +111,18 @@ ahci_poll_reg(volatile uint32_t *reg, uint32_t bits, bool pollset) return 0; } +static struct hba_device * +ahci_get_dev(dev_t dev) +{ + for (int i = 0; i < devs_max; ++i) { + if (devs[i].dev == dev) { + return &devs[i]; + } + } + + return NULL; +} + /* * Allocate a command slot for a port on * the HBA. @@ -103,7 +132,6 @@ ahci_alloc_cmdslot(struct ahci_hba *hba, struct hba_port *port) { uint32_t slotlist; - slotlist = port->ci | port->sact; slotlist = mmio_read32(&port->ci); slotlist |= mmio_read32(&port->sact); @@ -166,35 +194,50 @@ ahci_hba_reset(struct ahci_hba *hba) /* * Dump identify structure for debugging * purposes. + * + * Returns a pointer to a 'dev_info' structure + * on success, otherwise a value of NULL is returned + * on failure. */ -static void -ahci_dump_identity(struct ata_identity *identity) +static int +ahci_dump_identity(struct ata_identity *identity, struct dev_info *res) { - char serial_number[20]; - char model_number[40]; char tmp; - memcpy(serial_number, identity->serial_number, sizeof(serial_number)); - memcpy(model_number, identity->model_number, sizeof(model_number)); + if (res == NULL) { + return -EINVAL; + } - serial_number[sizeof(serial_number) - 1] = '\0'; - model_number[sizeof(model_number) - 1] = '\0'; + /* Copy the data, might be big endian */ + memcpy( + res->serial, + identity->serial_number, + SERIAL_LEN + ); + memcpy( + res->model, + identity->model_number, + sizeof(res->model) + ); + + res->serial[SERIAL_LEN - 1] = '\0'; + res->model[MODEL_LEN - 1] = '\0'; /* Fixup endianess for serial number */ - for (size_t i = 0; i < sizeof(serial_number); i += 2) { - tmp = serial_number[i]; - serial_number[i] = serial_number[i + 1]; - serial_number[i + 1] = tmp; + for (size_t i = 0; i < SERIAL_LEN; i += 2) { + tmp = res->serial[i]; + res->serial[i] = res->serial[i + 1]; + res->serial[i + 1] = tmp; } /* Fixup endianess for model number */ - for (size_t i = 0; i < sizeof(model_number); i += 2) { - tmp = model_number[i]; - model_number[i] = model_number[i + 1]; - model_number[i + 1] = tmp; + for (size_t i = 0; i < MODEL_LEN; i += 2) { + tmp = res->model[i]; + res->model[i] = res->model[i + 1]; + res->model[i + 1] = tmp; } - pr_trace("model number: %s\n", model_number); + return 0; } /* @@ -315,59 +358,77 @@ hba_port_chkerr(struct hba_port *port) static int hba_port_reset(struct ahci_hba *hba, struct hba_port *port) { - uint32_t sctl, ssts; - uint8_t det, ipm; - int error; + uint32_t sctl, ssts, cmd; + uint8_t det, ipm, spd; + uint32_t elapsed = 0; + + sctl = mmio_read32(&port->sctl); /* - * The port must not be in an idle state when a - * COMRESET is sent over the interface as some - * chipsets do not know how to handle this... - * - * After bringing up the port, send a COMRESET - * over the interface for roughly ~2ms. + * Transmit a COMRESET to the device. If the HBA + * supports staggered spin-up, we'll need to set + * the PxCMD.SUD bit as well. */ - hba_port_start(port); - sctl = mmio_read32(&port->sctl); sctl = (sctl & ~0x0F) | AHCI_DET_COMRESET; mmio_write32(&port->sctl, sctl); + if (hba->sss) { + cmd = mmio_read32(&port->cmd); + cmd |= AHCI_PXCMD_SUD; + mmio_write32(&port->cmd, cmd); + } /* * Wait for the link to become reestablished * between the port and the HBA. */ - tmr.msleep(300); + tmr.msleep(8); sctl &= ~AHCI_DET_COMRESET; mmio_write32(&port->sctl, sctl); - /* - * Now we'll need to grab some power management - * and detection flags as the port must have - * a device present along with an active - * interface. - */ - ssts = mmio_read32(&port->ssts); - det = AHCI_PXSCTL_DET(ssts); - ipm = AHCI_PXSSTS_IPM(ssts); + for (;;) { + if (elapsed >= AHCI_TIMEOUT) { + break; + } + ssts = mmio_read32(&port->ssts); + det = AHCI_PXSSTS_DET(ssts); + if (det == AHCI_DET_COMM) { + break; + } - /* If there is no device, fake success */ - if (det == AHCI_DET_NULL) { - return 0; + tmr.msleep(10); + elapsed += 10; } + ipm = AHCI_PXSSTS_IPM(ssts); + spd = AHCI_PXSSTS_SPD(ssts); + + if (det == AHCI_DET_PRESENT) { + pr_error("SATA link timeout\n"); + return -EAGAIN; + } if (det != AHCI_DET_COMM) { - pr_trace("failed to establish link\n"); return -EAGAIN; } + /* + * Ensure the interface is in an active + * state. + */ if (ipm != AHCI_IPM_ACTIVE) { - pr_trace("device interface not active\n"); + pr_error("device interface not active\n"); return -EAGAIN; } - if ((error = hba_port_stop(port)) < 0) { - pr_trace("failed to stop port\n"); - return error; + switch (spd) { + case AHCI_SPD_GEN1: + pr_trace("SATA link rate @ ~1.5 Gb/s\n"); + break; + case AHCI_SPD_GEN2: + pr_trace("SATA link rate @ ~3 Gb/s\n"); + break; + case AHCI_SPD_GEN3: + pr_trace("SATA link rate @ ~6 Gb/s\n"); + break; } return 0; @@ -416,12 +477,15 @@ ahci_submit_cmd(struct ahci_hba *hba, struct hba_port *port, uint8_t slot) * SATA device. */ static int -ahci_identify(struct ahci_hba *hba, struct hba_port *port) +ahci_identify(struct ahci_hba *hba, struct hba_device *dp) { paddr_t base, buf; + struct dev_info dev_info; + struct hba_port *port; struct ahci_cmd_hdr *cmdhdr; struct ahci_cmdtab *cmdtbl; struct ahci_fis_h2d *fis; + uint16_t *p; int cmdslot, status; buf = vm_alloc_frame(1); @@ -430,6 +494,7 @@ ahci_identify(struct ahci_hba *hba, struct hba_port *port) return -ENOMEM; } + port = dp->io; cmdslot = ahci_alloc_cmdslot(hba, port); if (cmdslot < 0) { pr_trace("failed to alloc cmdslot\n"); @@ -460,7 +525,13 @@ ahci_identify(struct ahci_hba *hba, struct hba_port *port) goto done; } - ahci_dump_identity(PHYS_TO_VIRT(buf)); + ahci_dump_identity(PHYS_TO_VIRT(buf), &dev_info); + p = (uint16_t *)PHYS_TO_VIRT(buf); + dp->nlba = (p[61] << 16) | p[60]; + + pr_trace("max block size: %d\n", dp->nlba); + pr_trace("model number: %s\n", dev_info.model); + pr_trace("serial number: %s\n", dev_info.serial); done: vm_free_frame(buf, 1); return status; @@ -470,7 +541,7 @@ done: * Send a read/write command to a SATA drive * * @hba: Host bus adapter of target port - * @port: Port to send over + * @dev: Device to send over * @sio: System I/O descriptor * @write: If true, data pointed to by `sio` will be written * @@ -480,14 +551,21 @@ done: * - The `offset` field in `sio` is the LBA address. */ static int -ahci_sata_rw(struct ahci_hba *hba, struct hba_port *port, struct sio_txn *sio, +ahci_sata_rw(struct ahci_hba *hba, struct hba_device *dev, struct sio_txn *sio, bool write) { paddr_t base, buf; + char *p, *dest; + bool dcdr_hit = false; + struct hba_port *port; + struct dcdr_lookup dcd_lookup; + struct dcd *dcd; struct ahci_cmd_hdr *cmdhdr; struct ahci_cmdtab *cmdtbl; struct ahci_fis_h2d *fis; int cmdslot, status; + size_t nblocks, cur_lba; + size_t len; if (sio == NULL) { return -EINVAL; @@ -496,6 +574,60 @@ ahci_sata_rw(struct ahci_hba *hba, struct hba_port *port, struct sio_txn *sio, return -EINVAL; } + port = dev->io; + + /* + * Compute how many blocks can be cached. + * + * XXX: We do not want to fill the entire DCDR + * with a single drive read to reduce the + * frequency of DCDR evictions. + * + * TODO: We should also take advantage of logical + * block coalescing. + */ + nblocks = sio->len; + if (nblocks >= AHCI_DCDR_CAP) { + nblocks = AHCI_DCDR_CAP / 2; + } + + /* + * If we are reading the drive, see if we have + * anything in the cache. + * + * XXX: If there is a break in the cache and we + * have a miss inbetween, other DCDs are + * ignored. Wonder how we can mitigate + * fragmentation. + */ + cur_lba = sio->offset; + len = sio->len; + for (size_t i = 0; i < nblocks && !write; ++i) { + status = dcdr_lookup(dev->dcdr, cur_lba, &dcd_lookup); + if (status != 0) { + break; + } + if (len == 0) { + break; + } + + dcdr_hit = true; + dcd = dcd_lookup.dcd_res; + + /* Hit, copy the cached data */ + dest = &((char *)sio->buf)[i * 512]; + p = dcd->block; + memcpy(dest, p, 512); + + ++cur_lba; + --len; + } + + /* Did we get everything already? */ + if (len == 0) { + return 0; + } + buf = VIRT_TO_PHYS(sio->buf); cmdslot = ahci_alloc_cmdslot(hba, port); if (cmdslot < 0) { @@ -524,22 +656,32 @@ ahci_sata_rw(struct ahci_hba *hba, struct hba_port *port, struct sio_txn *sio, fis->device = (1 << 6); /* LBA */ /* Setup LBA */ - fis->lba0 = sio->offset & 0xFF; - fis->lba1 = (sio->offset >> 8) & 0xFF; - fis->lba2 = (sio->offset >> 16) & 0xFF; - fis->lba3 = (sio->offset >> 24) & 0xFF; - fis->lba4 = (sio->offset >> 32) & 0xFF; - fis->lba5 = (sio->offset >> 40) & 0xFF; + fis->lba0 = cur_lba & 0xFF; + fis->lba1 = (cur_lba >> 8) & 0xFF; + fis->lba2 = (cur_lba >> 16) & 0xFF; + fis->lba3 = (cur_lba >> 24) & 0xFF; + fis->lba4 = (cur_lba >> 32) & 0xFF; + fis->lba5 = (cur_lba >> 40) & 0xFF; /* Setup count */ - fis->countl = sio->len & 0xFF; - fis->counth = (sio->len >> 8) & 0xFF; + fis->countl = len & 0xFF; + fis->counth = (len >> 8) & 0xFF; - pr_trace("SUBMIT: RIGHT!\n"); if ((status = ahci_submit_cmd(hba, port, cmdslot)) != 0) { return status; } + /* Don't cache again on hit */ + if (!write && dcdr_hit) { + return 0; + } + + /* Cache our read */ + for (size_t i = 0; i < nblocks; ++i) { + cur_lba = sio->offset + i; + p = sio->buf; + dcdr_cachein(dev->dcdr, &p[i * 512], cur_lba); + } return 0; } @@ -549,7 +691,6 @@ sata_dev_rw(dev_t dev, struct sio_txn *sio, bool write) const size_t BSIZE = 512; struct sio_txn wr_sio; struct hba_device *devp; - struct ahci_hba *hba; size_t block_count, len; off_t block_off, read_off; char *buf; @@ -561,11 +702,11 @@ sata_dev_rw(dev_t dev, struct sio_txn *sio, bool write) if (sio->len == 0 || sio->buf == NULL) { return -EINVAL; } - if (dev >= devs_max) { + if (dev > devs_max) { return -ENODEV; } - devp = &devs[dev]; + devp = ahci_get_dev(dev); if (__unlikely(devp == NULL)) { return -ENODEV; } @@ -595,14 +736,14 @@ sata_dev_rw(dev_t dev, struct sio_txn *sio, bool write) wr_sio.buf = buf; wr_sio.len = block_count; wr_sio.offset = block_off; - status = ahci_sata_rw(hba, devp->io, &wr_sio, write); + status = ahci_sata_rw(&g_hba, devp, &wr_sio, write); if (status == 0 && !write) { read_off = sio->offset & (BSIZE - 1); memcpy(sio->buf, buf + read_off, sio->len); } dynfree(buf); - return status; + return sio->len; } /* @@ -611,10 +752,99 @@ sata_dev_rw(dev_t dev, struct sio_txn *sio, bool write) static int ahci_dev_read(dev_t dev, struct sio_txn *sio, int flags) { + while (DRIVER_DEFERRED()) { + md_pause(); + } + return sata_dev_rw(dev, sio, false); } /* + * Device interface write + */ +static int +ahci_dev_write(dev_t dev, struct sio_txn *sio, int flags) +{ + while (DRIVER_DEFERRED()) { + md_pause(); + } + + return sata_dev_rw(dev, sio, true); +} + +/* + * Device interface number of blocks + */ +static int +ahci_dev_bsize(dev_t dev) +{ + struct hba_device *dp; + + while (DRIVER_DEFERRED()) { + md_pause(); + } + + if ((dp = ahci_get_dev(dev)) == NULL) { + return -ENODEV; + } + + return dp->nlba; +} + +/* + * Register a block device connected to an HBA port + * to the rest of the system. + * + * @dp: Device pointer + * @hba: HBA this device belongs to + * + * Returns zero on success, otherwise a less than + * zero value is returned. + */ +static int +ahci_register(struct hba_device *dp, struct ahci_hba *hba) +{ + struct ctlfs_dev dev; + char devname[128]; + int error; + + if (hba->major == 0) { + hba->major = dev_alloc_major(); + } + + dp->dev = dev_alloc(hba->major); + snprintf(devname, sizeof(devname), "sd%d", dp->dev); + + /* Register the device */ + dev_register(hba->major, dp->dev, &ahci_bdevsw); + pr_trace("drive @ /dev/%s\n", devname); + + /* Register a control node */ + dev.mode = 0444; + ctlfs_create_node(devname, &dev); + pr_trace("drive control @ /ctl/%s/\n", devname); + + /* Register control files */ + dev.devname = devname; + dev.ops = &g_sata_bsize_ops; + ctlfs_create_entry("bsize", &dev); + + error = devfs_create_entry(devname, hba->major, dp->dev, 060444); + if (error < 0) { + pr_error("failed to create devfs entry\n"); + return error; + } + + snprintf(devname, sizeof(devname), "SATA drive %d", dp->dev); + error = disk_add(devname, dp->dev, &ahci_bdevsw, 0); + if (error < 0) { + pr_error("failed to add disk \"%s\"\n", devname); + return 1; + } + return 0; +} + +/* * Initialize a drive on an HBA port * * @hba: HBA descriptor @@ -623,33 +853,23 @@ ahci_dev_read(dev_t dev, struct sio_txn *sio, int flags) static int ahci_init_port(struct ahci_hba *hba, uint32_t portno) { - char devname[128]; struct hba_memspace *abar = hba->io; struct hba_port *port; struct hba_device *dp; - struct ctlfs_dev dev; size_t clen, pagesz; - uint32_t lo, hi, ssts; - uint8_t det; + uint32_t lo, hi, sig; paddr_t fra, cmdlist, tmp; int error; pagesz = DEFAULT_PAGESIZE; port = &abar->ports[portno]; - /* Is anything on the port? */ - ssts = mmio_read32(&port->ssts); - det = AHCI_PXSCTL_DET(ssts); - switch (det) { - case AHCI_DET_NULL: - /* No device attached */ - return 0; - case AHCI_DET_PRESENT: - if ((error = hba_port_reset(hba, port)) < 0) { - pr_trace("failed to reset port %d\n", portno); - return error; - } - break; + if ((error = hba_port_reset(hba, port)) < 0) { + return error; + } + sig = mmio_read32(&port->sig); + if (sig == ATAPI_SIG) { + return -ENOTSUP; } pr_trace("found device @ port %d\n", portno); @@ -658,6 +878,12 @@ ahci_init_port(struct ahci_hba *hba, uint32_t portno) dp->hba = hba; dp->dev = portno; + dp->dcdr = dcdr_alloc(512, AHCI_DCDR_CAP); + if (dp->dcdr == NULL) { + pr_error("failed to alloc dcdr\n"); + return -ENOMEM; + } + /* Allocate a command list */ clen = ALIGN_UP(hba->nslots * AHCI_CMDENTRY_SIZE, pagesz); clen /= pagesz; @@ -677,8 +903,6 @@ ahci_init_port(struct ahci_hba *hba, uint32_t portno) } dp->fra = PHYS_TO_VIRT(fra); - memset(dp->cmdlist, 0, clen * pagesz); - memset(dp->fra, 0, pagesz); /* Write the command list */ lo = cmdlist & 0xFFFFFFFF; @@ -697,7 +921,6 @@ ahci_init_port(struct ahci_hba *hba, uint32_t portno) tmp = vm_alloc_frame(1); dp->cmdlist[i].prdtl = 1; dp->cmdlist[i].ctba = tmp; - memset(PHYS_TO_VIRT(tmp), 0, pagesz); } mmio_write32(&port->serr, 0xFFFFFFFF); @@ -712,28 +935,8 @@ ahci_init_port(struct ahci_hba *hba, uint32_t portno) return error; } - ahci_identify(hba, port); - - if (hba->major == 0) { - hba->major = dev_alloc_major(); - } - dp->dev = dev_alloc(hba->major); - snprintf(devname, sizeof(devname), "sd%d", dp->dev); - - /* Register the device */ - dev_register(hba->major, dp->dev, &ahci_bdevsw); - pr_trace("drive @ /dev/%s\n", devname); - - /* Register a control node */ - dev.mode = 0444; - ctlfs_create_node(devname, &dev); - pr_trace("drive control @ /ctl/%s/\n", devname); - - /* Register control files */ - dev.devname = devname; - dev.ops = &g_sata_bsize_ops; - ctlfs_create_entry("bsize", &dev); - return devfs_create_entry(devname, hba->major, dp->dev, 0444); + ahci_identify(hba, dp); + return ahci_register(dp, hba); } /* @@ -841,10 +1044,9 @@ ahci_init(void) { struct pci_lookup lookup; int status; - struct ahci_hba hba; void *abar_vap = NULL; - hba.major = 0; + g_hba.major = 0; lookup.pci_class = 0x01; lookup.pci_subclass = 0x06; @@ -890,14 +1092,15 @@ ahci_init(void) } ahci_init_pci(); - hba.io = (struct hba_memspace*)abar_vap; - ahci_hba_init(&hba); + g_hba.io = (struct hba_memspace*)abar_vap; + ahci_hba_init(&g_hba); return 0; } static struct bdevsw ahci_bdevsw = { .read = ahci_dev_read, - .write = nowrite + .write = ahci_dev_write, + .bsize = ahci_dev_bsize }; -DRIVER_EXPORT(ahci_init); +DRIVER_EXPORT(ahci_init, "ahci"); diff --git a/sys/dev/ic/nvme.c b/sys/dev/ic/nvme.c index 704fdec..c65d7e0 100644 --- a/sys/dev/ic/nvme.c +++ b/sys/dev/ic/nvme.c @@ -309,6 +309,35 @@ nvme_poll_submit_cmd(struct nvme_queue *q, struct nvme_cmd cmd) return 0; } +/* + * Get NVMe log page + * + * @ctrl: NVMe controller to target + * @buf: Data buffer + * @lid: Log identifier + * @len: Length (in bytes) + */ +static int +nvme_get_logpage(struct nvme_ctrl *ctrl, void *buf, uint8_t lid, uint32_t len) +{ + struct nvme_cmd cmd = {0}; + struct nvme_get_logpage_cmd *cmdp; + + if (!is_4k_aligned(buf)) { + return -1; + } + + cmdp = &cmd.get_logpage; + cmdp->opcode = NVME_OP_GET_LOGPAGE; + cmdp->nsid = 0xFFFFFFFF; + cmdp->lid = lid; + cmdp->numdl = len / 4; + cmdp->numdu = 0; + cmdp->prp1 = VIRT_TO_PHYS(buf); + cmdp->prp2 = 0; + return nvme_poll_submit_cmd(&ctrl->adminq, cmd); +} + static int nvme_identify(struct nvme_ctrl *ctrl, void *buf, uint32_t nsid, uint8_t cns) { @@ -470,6 +499,12 @@ nvme_dev_read(dev_t dev, struct sio_txn *sio, int flags) return nvme_dev_rw(dev, sio, false); } +static int +nvme_dev_write(dev_t dev, struct sio_txn *sio, int flags) +{ + return nvme_dev_rw(dev, sio, true); +} + /* * Initializes an NVMe namespace. * @@ -543,6 +578,7 @@ nvme_init_ctrl(struct nvme_bar *bar) uint16_t mqes; uint8_t *nsids; struct nvme_ctrl ctrl = { .bar = bar }; + struct nvme_smart_data *smart; struct nvme_queue *adminq; struct nvme_id *id; @@ -566,14 +602,21 @@ nvme_init_ctrl(struct nvme_bar *bar) return error; } + smart = dynalloc_memalign(sizeof(*smart), 0x1000); + if (smart == NULL) { + return -ENOMEM; + } + id = dynalloc_memalign(sizeof(*id), 0x1000); if (id == NULL) { + dynfree(smart); return -ENOMEM; } nsids = dynalloc_memalign(0x1000, 0x1000); if (nsids == NULL) { dynfree(id); + dynfree(smart); return -ENOMEM; } @@ -581,6 +624,18 @@ nvme_init_ctrl(struct nvme_bar *bar) nvme_log_ctrl_id(id); nvme_identify(&ctrl, nsids, 0, ID_CNS_NSID_LIST); + /* + * Attempt to read some SMART data but don't bother + * if it fails in any way. + */ + error = nvme_get_logpage(&ctrl, smart, NVME_LOGPAGE_SMART, sizeof(*smart)); + if (error == 0) { + if (smart->temp != 0 && smart->temp > 283) + pr_trace("temp: %d K\n", smart->temp); + + pr_trace("%d%% used\n", smart->percent_used); + } + ctrl.sqes = id->sqes >> 4; ctrl.cqes = id->cqes >> 4; @@ -607,6 +662,7 @@ nvme_init_ctrl(struct nvme_bar *bar) dynfree(id); dynfree(nsids); + dynfree(smart); return 0; } @@ -659,7 +715,7 @@ nvme_init(void) static struct bdevsw nvme_bdevsw = { .read = nvme_dev_read, - .write = nowrite + .write = nvme_dev_write }; -DRIVER_EXPORT(nvme_init); +DRIVER_EXPORT(nvme_init, "nvme"); diff --git a/sys/dev/pci/pci.c b/sys/dev/pci/pci.c index d59f68f..140a363 100644 --- a/sys/dev/pci/pci.c +++ b/sys/dev/pci/pci.c @@ -32,15 +32,32 @@ #include <sys/syslog.h> #include <sys/errno.h> #include <sys/spinlock.h> +#include <sys/mmio.h> #include <dev/pci/pci.h> #include <dev/pci/pciregs.h> +#include <dev/acpi/acpi.h> +#include <dev/acpi/tables.h> +#include <machine/pci/pci.h> #include <vm/dynalloc.h> +#include <vm/vm.h> #include <lib/assert.h> #define pr_trace(fmt, ...) kprintf("pci: " fmt, ##__VA_ARGS__) static TAILQ_HEAD(, pci_device) device_list; static struct spinlock devlist_lock = {0}; +static struct acpi_mcfg *mcfg; + +struct cam_hook { + /* PCI CAM */ + pcireg_t(*cam_readl)(struct pci_device *dev, uint32_t off); + void(*cam_writel)(struct pci_device *dev, uint32_t off, pcireg_t val); + + /* PCIe ECAM */ + pcireg_t(*ecam_readl)(struct pci_device *dev, uint32_t off); + void(*ecam_writel)(struct pci_device *dev, uint32_t off, pcireg_t val); + void *ecam_base[1]; +} cam_hook = { NULL }; static bool pci_dev_exists(uint8_t bus, uint8_t slot, uint8_t func) @@ -123,6 +140,9 @@ pci_set_device_info(struct pci_device *dev) dev->prog_if = PCIREG_PROGIF(classrev); dev->hdr_type = (uint8_t)pci_readl(dev, PCIREG_HDRTYPE); + /* This is a PCIe device if it has CAP ID of 0x10 */ + dev->pci_express = pci_get_cap(dev, 0x10) != 0; + /* Set type-specific data */ switch (dev->hdr_type & ~BIT(7)) { case PCI_HDRTYPE_NORMAL: @@ -151,6 +171,53 @@ pci_set_device_info(struct pci_device *dev) static void pci_scan_bus(uint8_t bus); +static inline vaddr_t +pcie_ecam_addr(struct pci_device *dev) +{ + vaddr_t base = (vaddr_t)cam_hook.ecam_base[0]; + + base += dev->bus << 20 | + dev->slot << 15 | + dev->func << 12; + return base; +} + +static pcireg_t +pcie_ecam_readl(struct pci_device *dev, uint32_t offset) +{ + vaddr_t address; + + address = pcie_ecam_addr(dev); + address += (offset & ~3); + return mmio_read32((void *)address); +} + +static void +pcie_ecam_writel(struct pci_device *dev, uint32_t offset, pcireg_t val) +{ + vaddr_t address; + + address = pcie_ecam_addr(dev); + address += (offset & ~3); + mmio_write32((void *)address, val); +} + +static int +pcie_init(struct acpi_mcfg_base *base) +{ + void *iobase; + + pr_trace("[group %02d] @ bus [%02d - %02d]\n", base->seg_grpno, + base->bus_start, base->bus_end); + pr_trace("ecam @ %p\n", base->base_pa); + + iobase = PHYS_TO_VIRT(base->base_pa); + cam_hook.ecam_base[0] = iobase; + cam_hook.ecam_writel = pcie_ecam_writel; + cam_hook.ecam_readl = pcie_ecam_readl; + return 0; +} + /* * Attempt to register a device. * @@ -264,7 +331,6 @@ pci_get_device(struct pci_lookup lookup, uint16_t lookup_type) return NULL; } - void pci_add_device(struct pci_device *dev) { @@ -273,12 +339,45 @@ pci_add_device(struct pci_device *dev) spinlock_release(&devlist_lock); } +pcireg_t +pci_readl(struct pci_device *dev, uint32_t offset) +{ + bool have_ecam = cam_hook.ecam_readl != NULL; + + if (dev->pci_express && have_ecam) { + return cam_hook.ecam_readl(dev, offset); + } + + return cam_hook.cam_readl(dev, offset); +} + +void +pci_writel(struct pci_device *dev, uint32_t offset, pcireg_t val) +{ + bool have_ecam = cam_hook.ecam_writel != NULL; + + if (dev->pci_express && have_ecam) { + cam_hook.ecam_writel(dev, offset, val); + return; + } + + cam_hook.cam_writel(dev, offset, val); +} + int pci_init(void) { size_t ndev; TAILQ_INIT(&device_list); + mcfg = acpi_query("MCFG"); + if (mcfg != NULL) { + pcie_init(&mcfg->base[0]); + } + + cam_hook.cam_readl = md_pci_readl; + cam_hook.cam_writel = md_pci_writel; + /* Recursively scan bus 0 */ pci_scan_bus(0); ndev = TAILQ_NELEM(&device_list); diff --git a/sys/dev/phy/e1000.c b/sys/dev/phy/e1000.c new file mode 100644 index 0000000..41a2a27 --- /dev/null +++ b/sys/dev/phy/e1000.c @@ -0,0 +1,358 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/driver.h> +#include <sys/errno.h> +#include <sys/syslog.h> +#include <sys/mmio.h> +#include <dev/phy/e1000regs.h> +#include <dev/pci/pci.h> +#include <dev/pci/pciregs.h> +#include <dev/timer.h> +#include <net/if_var.h> +#include <string.h> + +#define pr_trace(fmt, ...) kprintf("e1000: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) + +#define E1000_VENDOR 0x8086 +#define E1000_DEVICE 0x100E +#define E1000_TIMEOUT 500 /* In msec */ + +static struct timer tmr; +static struct pci_device *e1000; +static struct netif netif; + +struct e1000_nic { + void *vap; + uint8_t has_eeprom : 1; + uint16_t eeprom_size; + uint16_t io_port; +}; + +static int +e1000_poll_reg(volatile uint32_t *reg, uint32_t bits, bool pollset) +{ + size_t usec_start, usec; + size_t elapsed_msec; + uint32_t val; + bool tmp; + + usec_start = tmr.get_time_usec(); + + for (;;) { + val = mmio_read32(reg); + tmp = (pollset) ? ISSET(val, bits) : !ISSET(val, bits); + + usec = tmr.get_time_usec(); + elapsed_msec = (usec - usec_start) / 1000; + + /* If tmp is set, the register updated in time */ + if (tmp) { + break; + } + + /* Exit with an error if we timeout */ + if (elapsed_msec > E1000_TIMEOUT) { + return -ETIME; + } + } + + return 0; +} + +/* + * Query information about any EEPROMs for diagnostic + * purposes. + * + * TODO: Some wacky older chips don't show their presence + * too easily, we could fallback to microwire / SPI + * bit banging to see if it responds to us manually + * clocking a dummy read operation in. + */ +static void +eeprom_query(struct e1000_nic *np) +{ + uint16_t size_bits = 1024; + uint32_t eecd, *eecd_p; + const char *typestr = "microwire"; + + eecd_p = PTR_OFFSET(np->vap, E1000_EECD); + + /* + * First we should check if there is an EEPROM + * on-board as if not, there is nothing we can do + * here. + */ + eecd = mmio_read32(eecd_p); + if (!ISSET(eecd, E1000_EECD_PRES)) { + return; + } + + np->has_eeprom = 1; + if (ISSET(eecd, E1000_EECD_TYPE)) { + typestr = "SPI"; + } + if (ISSET(eecd, E1000_EECD_SIZE)) { + size_bits = 4096; + } + + np->eeprom_size = size_bits; + pr_trace("%d-bit %s EEPROM detected\n", size_bits, typestr); +} + +/* + * If there is no EEPROM, we can still read + * the MAC address through the Receive address + * registers + * + * XXX: This is typically only used as a fallback. + * + * Returns a less than zero value if an ethernet + * address is not found, which would be kind of + * not good. + * + * @np: NIC descriptor + * @addr: Pointer to MAC address data + */ +static int +e1000_read_recvaddr(struct e1000_nic *np, struct netif_addr *addr) +{ + const uint32_t RECVADDR_OFF = 0x5400; + uint32_t tmp; + uint32_t *dword_p; + + dword_p = PTR_OFFSET(np->vap, RECVADDR_OFF); + + if (dword_p[0] == 0) { + pr_error("bad hwaddr in recvaddr\n"); + return -ENOTSUP; + } + + /* DWORD 0 */ + tmp = mmio_read32(&dword_p[0]); + addr->data[0] = tmp & 0xFF; + addr->data[1] = (tmp >> 8) & 0xFF; + addr->data[2] = (tmp >> 16) & 0xFF; + addr->data[3] = (tmp >> 24) & 0xFF; + + /* DWORD 1 */ + tmp = mmio_read32(&dword_p[1]); + addr->data[4] = tmp & 0xFF; + addr->data[5] = (tmp >> 8) & 0xFF; + return 0; +} + +/* + * Read 16-bytes from the NIC's on-board EEPROM. + * + * XXX: This should only be used if the caller is + * certain that the NIC has an EEPROM + * + * @addr: EEPROM address to read from + * + * A returned value of 0xFFFF should be seen as invalid. + */ +static uint16_t +eeprom_readw(struct e1000_nic *np, uint8_t addr) +{ + uint32_t eerd, *eerd_p; + int error; + + if (!np->has_eeprom) { + pr_error("e1000_read_eeprom: EEPROM not present\n"); + return 0xFFFF; + } + + eerd_p = PTR_OFFSET(np->vap, E1000_EERD); + eerd = (addr << 8) | E1000_EERD_START; + mmio_write32(eerd_p, eerd); + + error = e1000_poll_reg(eerd_p, E1000_EERD_DONE, true); + if (error < 0) { + pr_error("e1000_read_eeprom: timeout\n"); + return 0xFFFF; + } + + eerd = mmio_read32(eerd_p); + return (eerd >> 16) & 0xFFFF; +} + +/* + * Read the MAC address from the NICs EEPROM. + * + * XXX: This should usually work, however if the NIC does + * not have an on-board EEPROM, this will fail. In such + * cases, e1000_read_recvaddr() can be called instead. + * + * @np: NIC descriptor + * @addr: Pointer to MAC address data + */ +static int +e1000_read_macaddr(struct e1000_nic *np, struct netif_addr *addr) +{ + uint16_t eeprom_word; + + if (!np->has_eeprom) { + pr_trace("EEPROM not present, trying recvaddr\n"); + return e1000_read_recvaddr(np, addr); + } + + /* Word 0 */ + eeprom_word = eeprom_readw(np, E1000_HWADDR0); + addr->data[0] = (eeprom_word & 0xFF); + addr->data[1] = (eeprom_word >> 8) & 0xFF; + + /* Word 1 */ + eeprom_word = eeprom_readw(np, E1000_HWADDR1); + addr->data[2] = (eeprom_word & 0xFF); + addr->data[3] = (eeprom_word >> 8) & 0xFF; + + /* Word 2 */ + eeprom_word = eeprom_readw(np, E1000_HWADDR2); + addr->data[4] = (eeprom_word & 0xFF); + addr->data[5] = (eeprom_word >> 8) & 0xFF; + return 0; +} + +/* + * Reset the entire E1000 + */ +static int +e1000_reset(struct e1000_nic *np) +{ + uint32_t ctl, *ctl_p; + int error; + + ctl_p = PTR_OFFSET(np->vap, E1000_CTL); + ctl = mmio_read32(&ctl_p); + ctl |= E1000_CTL_RST; + mmio_write32(&ctl_p, ctl); + + error = e1000_poll_reg(ctl_p, E1000_CTL_RST, false); + if (error < 0) { + pr_error("reset timeout\n"); + return error; + } + + return 0; +} + +/* + * Initialize an E1000(e) chip + */ +static int +e1000_chip_init(struct e1000_nic *np) +{ + struct netif_addr *addr = &netif.addr; + int error; + + /* + * To ensure that BIOS/UEFI or whatever firmware got us + * here didn't fuck anything up in the process or at the + * very least, put the controller in a seemingly alright + * state that gives us a suprise screwing in the future, + * we'll reset everything to its default startup state. + * + * Better safe than sorry... + */ + if ((error = e1000_reset(np)) < 0) { + return error; + } + + eeprom_query(np); + if ((error = e1000_read_macaddr(np, addr)) < 0) { + return error; + } + + pr_trace("MAC address: %x:%x:%x:%x:%x:%x\n", + (uint64_t)addr->data[0], (uint64_t)addr->data[1], + (uint64_t)addr->data[2], (uint64_t)addr->data[3], + (uint64_t)addr->data[4], (uint64_t)addr->data[5]); + + return 0; +} + +/* + * Enables PCI specific bits like bus mastering (for DMA) + * as well as MMIO. + */ +static void +e1000_init_pci(void) +{ + uint32_t tmp; + + tmp = pci_readl(e1000, PCIREG_CMDSTATUS); + tmp |= (PCI_BUS_MASTERING | PCI_MEM_SPACE); + pci_writel(e1000, PCIREG_CMDSTATUS, tmp); +} + +static int +e1000_init(void) +{ + struct pci_lookup lookup; + struct e1000_nic nic; + int status; + + lookup.vendor_id = E1000_VENDOR; + lookup.device_id = E1000_DEVICE; + e1000 = pci_get_device(lookup, PCI_DEVICE_ID | PCI_VENDOR_ID); + if (e1000 == NULL) { + return -ENODEV; + } + + /* Get a GP timer */ + if (req_timer(TIMER_GP, &tmr) != TMRR_SUCCESS) { + pr_error("failed to fetch general purpose timer\n"); + return -ENODEV; + } + + /* We need msleep() */ + if (tmr.msleep == NULL) { + pr_error("general purpose timer has no msleep()\n"); + return -ENODEV; + } + + memset(&nic, 0, sizeof(nic)); + pr_trace("e1000 at pci%d:%x.%x.%d\n", + e1000->bus, e1000->device_id, e1000->func, + e1000->slot); + + if ((status = pci_map_bar(e1000, 0, &nic.vap)) != 0) { + pr_error("failed to map BAR0\n"); + return status; + } + + e1000_init_pci(); + e1000_chip_init(&nic); + return 0; +} + +DRIVER_EXPORT(e1000_init, "e1000"); diff --git a/sys/dev/phy/et131x.c b/sys/dev/phy/et131x.c new file mode 100644 index 0000000..d7764ae --- /dev/null +++ b/sys/dev/phy/et131x.c @@ -0,0 +1,338 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* + * This driver is the product of reverse engineering + * work done by Ian Marco Moffett and the OSMORA team. + * + * Please refer to share/docs/hw/et131x.txt + */ + +#include <sys/types.h> +#include <sys/driver.h> +#include <sys/errno.h> +#include <sys/syslog.h> +#include <sys/mmio.h> +#include <dev/pci/pci.h> +#include <dev/pci/pciregs.h> +#include <dev/phy/et131xregs.h> +#include <dev/timer.h> +#include <net/if_var.h> + +#define VENDOR_ID 0x11C1 /* Agere */ +#define DEVICE_ID 0xED00 + +#define pr_trace(fmt, ...) kprintf("et131x: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) + +/* + * The ET131X has 1024 words of internal RAM used to + * store/buffer packet data before reception or transmission. + * The card allows us to decide how large the TX/RX buffers would + * be split up. We split the RX/TX 50/50 as a nice balanced default. + * Might need to later adjust based on various system needs + * (e.g., heavy TX or RX) to avoid thrashing any of the buffers. + * + */ +#define INTERNAL_MEMSIZE 1024 /* In words */ +#define INTERNAL_MEM_RXOFF 0x1FF /* 50/50 split */ + +/* Helpful constants */ +#define ETHERFRAME_LEN 1518 /* Length of ethernet frame */ +#define ETHER_FCS_LEN 4 /* Length of frame check seq */ +#define RX_MEM_END 0x2BC + +struct netcard { + struct et131x_iospace *io; +}; + +static struct pci_device *dev; +static struct netcard g_card; +static struct timer tmr; + +/* + * Software reset the ET131X + * + * @io: Register space + */ +static void +et131x_soft_reset(struct netcard *card) +{ + struct et131x_iospace *io = card->io; + uint32_t tmp; + + tmp = ( + MAC_CFG1_RESET_TXMC | + MAC_CFG1_RESET_RXMC | + MAC_CFG1_RESET_TXFUNC | + MAC_CFG1_RESET_RXFUNC | + MAC_CFG1_SOFTRST | + MAC_CFG1_SIMRST + ); + + /* + * Reset the MAC core, bring it down. After that, + * we perform a global reset to bring the whole + * chip down. + */ + mmio_write32(&io->mac.cfg1, tmp); + mmio_write32(&io->global.sw_reset, GBL_RESET_ALL); + + /* + * Reset the MAC again for good measure, but + * this time a little softer. We already slammed + * the poor thing. + */ + tmp &= ~(MAC_CFG1_SOFTRST | MAC_CFG1_SIMRST); + mmio_write32(&io->mac.cfg1, tmp); + mmio_write32(&io->mac.cfg1, 0); +} + +/* + * Write to the PHY through MII + * + * @io: Register space + * @addr: PHY address + * @reg: PHY register + * @v: Value to write + */ +static int +et131x_mii_write(struct netcard *card, uint8_t addr, uint8_t reg, uint16_t v) +{ + struct et131x_iospace *io = card->io; + uint16_t mii_addr; + uint32_t tmp, mgmt_addr_old; + uint32_t mgmt_cmd_old; + uint8_t ndelay = 0; + int retval = 0; + + /* Save MII management regs state */ + mgmt_cmd_old = mmio_read32(&io->mac.mii_mgmt_cmd); + mgmt_addr_old = mmio_read32(&io->mac.mii_mgmt_addr); + mii_addr = MAC_MII_ADDR(addr, reg); + + /* + * Stop any transactions that are currently + * happening on the MDIO bus and prepare the + * write. + */ + mmio_write32(&io->mac.mii_mgmt_cmd, 0); + mmio_write32(&io->mac.mii_mgmt_addr, mii_addr); + mmio_write32(&io->mac.mii_mgmt_ctrl, v); + + for (;;) { + tmr.usleep(50); + ++ndelay; + + tmp = mmio_read32(&io->mac.mii_mgmt_indicator); + if (!ISSET(tmp, MAC_MGMT_BUSY)) + break; + if (ndelay >= 50) + break; + } + + if (ndelay >= 50) { + pr_error("could not write PHY reg %x (status=%x)\n", reg, tmp); + retval = -EIO; + goto done; + } + +done: + /* Stop operations and restore state */ + mmio_write32(&io->mac.mii_mgmt_cmd, 0); + mmio_write32(&io->mac.mii_mgmt_addr, mgmt_addr_old); + mmio_write32(&io->mac.mii_mgmt_cmd, mgmt_cmd_old); + return retval; +} + +/* + * Initialize PCI related things for the + * chip. + */ +static void +et131x_init_pci(void) +{ + uint32_t tmp; + + /* Enable bus mastering and MMIO */ + tmp = pci_readl(dev, PCIREG_CMDSTATUS); + tmp |= (PCI_BUS_MASTERING | PCI_MEM_SPACE); + pci_writel(dev, PCIREG_CMDSTATUS, tmp); +} + +/* + * Blink both LEDs of the card + * + * @io: Register space + * @count: Number of times to blink + * @delay: Millisecond delay between blinks + */ +static void +et131x_blink(struct netcard *card, uint32_t count, uint16_t delay) +{ + uint16_t on_val; + + on_val = (LED_ON << LED_LINK_SHIFT); + on_val |= (LED_ON << LED_TXRX_SHIFT); + for (uint32_t i = 0; i < count; ++i) { + et131x_mii_write(card, 0, PHY_LED2, on_val); + tmr.msleep(delay); + et131x_mii_write(card, 0, PHY_LED2, LED_ALL_OFF); + tmr.msleep(delay); + } +} + +/* + * Initialize the MAC into a functional + * state. + * + * @io: Register space. + */ +static void +et131x_mac_init(struct netcard *card) +{ + struct et131x_iospace *io = card->io; + struct mac_regs *mac = &io->mac; + struct global_regs *global = &io->global; + struct netif_addr addr; + uint32_t ipg_tmp, tmp; + + /* + * Okay so we need to reset the card so it doesn't + * do undefined bullshit. God forbid we get undefined + * behaviour without having a fucking official datasheet. + * Most would end themselves right then and there. + * + * Now, after we've done that, we must ensure that any + * packets larger than ETHERFRAME_LEN are truncated by + * the MAC. Again, something like an internal buffer + * overrun during TX/RX would be quite fucking horrible. + * + * We also want to clear the MAC interface control and MII + * clock to ensure it is in a known state. + */ + et131x_soft_reset(card); + mmio_write32(&mac->max_fm_len, ETHERFRAME_LEN); + mmio_write32(&mac->if_ctrl, 0); + mmio_write32(&mac->mii_mgmt_cfg, MAC_MIIMGMT_CLK_RST); + + /* + * Split the RX/TX memory 50/50, put the internal RX + * buffer right at the start into the first half, and + * the TX buffer right after the RX buffer. + */ + mmio_write32(&global->rxq_start, 0); + mmio_write32(&global->rxq_end, RX_MEM_END); + mmio_write32(&global->txq_start, RX_MEM_END + 1); + mmio_write32(&global->txq_end, INTERNAL_MEMSIZE - 1); + + /* Disable loopbacks, watchdog timer, clear MSI config */ + mmio_write32(&global->loopback, 0); + mmio_write32(&global->msi_config, 0); + mmio_write32(&global->watchdog_timer, 0); + + /* + * Set up half duplex config + * + * - BEB trunc (0xA) + * - Excess defer + * - Re-transmit (0xF) + * - Collision window + */ + mmio_write32(&mac->hfdp, 0x00A1F037); + + /* + * Setup the MAC interpacket gap register + * + * - IPG1 (0x38) + * - IPG2 (0x58) + * - B2B (0x60) + */ + ipg_tmp = ((0x50 << 8) | 0x38005860); + mmio_write32(&mac->ipg, ipg_tmp); + + /* MAC address dword 0 */ + tmp = pci_readl(dev, PCI_MAC_ADDRESS); + addr.data[0] = tmp & 0xFF; + addr.data[1] = (tmp >> 8) & 0xFF; + addr.data[2] = (tmp >> 16) & 0xFF; + addr.data[3] = (tmp >> 24) & 0xFF; + + /* MAC address word 1 */ + tmp = pci_readl(dev, PCI_MAC_ADDRESS + 4); + addr.data[4] = tmp & 0xFF; + addr.data[5] = (tmp >> 8) & 0xFF; + + /* Print out the MAC address */ + pr_trace("MAC address: %x:%x:%x:%x:%x:%x\n", + (uint64_t)addr.data[0], (uint64_t)addr.data[1], + (uint64_t)addr.data[2], (uint64_t)addr.data[3], + (uint64_t)addr.data[4], (uint64_t)addr.data[5]); +} + +static int +et131x_init(void) +{ + struct pci_lookup lookup; + int error; + + lookup.vendor_id = VENDOR_ID; + lookup.device_id = DEVICE_ID; + dev = pci_get_device(lookup, PCI_VENDOR_ID | PCI_DEVICE_ID); + if (dev == NULL) { + return -ENODEV; + } + + pr_trace("Agere ET1310 Ethernet ctl <phy? at pci%d:%x.%x.%d>\n", + dev->bus, dev->device_id, dev->func, + dev->slot); + + /* Try to request a general purpose timer */ + if (req_timer(TIMER_GP, &tmr) != TMRR_SUCCESS) { + pr_error("failed to fetch general purpose timer\n"); + return -ENODEV; + } + + /* Ensure it has get_time_usec() */ + if (tmr.usleep == NULL) { + pr_error("general purpose timer has no usleep()\n"); + return -ENODEV; + } + + if ((error = pci_map_bar(dev, 0, (void *)&g_card.io)) != 0) { + return error; + } + + et131x_init_pci(); + et131x_mac_init(&g_card); + et131x_blink(&g_card, 4, 150); + return 0; +} + +DRIVER_DEFER(et131x_init, "et131x"); diff --git a/sys/dev/phy/rt8139.c b/sys/dev/phy/rtl.c index ab8a6c0..d096d1a 100644 --- a/sys/dev/phy/rt8139.c +++ b/sys/dev/phy/rtl.c @@ -30,31 +30,30 @@ #include <sys/types.h> #include <sys/errno.h> #include <sys/syslog.h> +#include <sys/spinlock.h> #include <sys/driver.h> #include <sys/device.h> #include <dev/pci/pci.h> -#include <dev/phy/rt8139.h> +#include <dev/phy/rtl.h> #include <dev/timer.h> #include <dev/pci/pciregs.h> -#include <net/if_ether.h> +#include <net/netbuf.h> +#include <net/if_var.h> #include <vm/physmem.h> +#include <vm/dynalloc.h> #include <vm/vm.h> #include <machine/pio.h> +#include <machine/intr.h> #include <string.h> -/* TODO: Make this smoother */ -#if defined(__x86_64__) -#include <machine/intr.h> -#include <machine/ioapic.h> -#include <machine/lapic.h> -#include <machine/idt.h> -#endif +#define IFNAME "rt0" -#define pr_trace(fmt, ...) kprintf("rt8139: " fmt, ##__VA_ARGS__) +#define pr_trace(fmt, ...) kprintf("rt81xx: " fmt, ##__VA_ARGS__) #define pr_error(...) pr_trace(__VA_ARGS__) #define RX_BUF_SIZE 3 /* In pages */ #define RX_REAL_BUF_SIZE 8192 /* In bytes */ +#define TXQ_ENTRIES 4 #define RX_PTR_MASK (~3) @@ -65,12 +64,26 @@ #define HAVE_PIO 0 #endif /* _MACHINE_HAVE_PIO */ +static struct spinlock netif_lock; +static struct netbuf netif_buf[TXQ_ENTRIES]; static struct pci_device *dev; +static struct netif netif; static struct timer tmr; -static struct etherdev wire; +static uint32_t tx_ptr = 0; +static uint32_t netif_enq_ptr = 0; static uint16_t ioport; static paddr_t rxbuf, txbuf; +/* TXAD regs */ +static uint16_t tsads[TXQ_ENTRIES] = { + RT_TXAD_N(0), RT_TXAD_N(4), + RT_TXAD_N(8), RT_TXAD_N(12) +}; +static uint16_t tsds[TXQ_ENTRIES] = { + RT_TXSTATUS_N(0), RT_TXSTATUS_N(4), + RT_TXSTATUS_N(8), RT_TXSTATUS_N(8) +}; + /* * Write to an RTL8139 register * @@ -159,53 +172,112 @@ rt_poll(uint8_t reg, uint8_t size, uint32_t bits, bool pollset) return val; } -#if defined(__x86_64__) -__isr static void -rt8139_pin_irq(void *sp) +static int +rt_tx(void *packet, size_t len) +{ + static uint32_t tx_ptr = 0; + void *tx_data; + paddr_t tx_pa; + + tx_data = dynalloc(len); + if (tx_data == NULL) { + return -ENOMEM; + } + + memcpy(tx_data, packet, len); + tx_pa = VIRT_TO_PHYS(tx_data); + rt_write(tsads[tx_ptr], 4, tx_pa); + rt_write(tsds[tx_ptr++], 4, len); + if (tx_ptr > TXQ_ENTRIES - 1) { + tx_ptr = 0; + } + return 0; +} + +static void +__rt81xx_tx_start(struct netif *nifp) +{ + struct netbuf *dest; + int error; + + for (int i = 0; i < netif_enq_ptr; ++i) { + dest = &netif_buf[i]; + error = rt_tx(dest->data, dest->len); + if (error < 0) { + pr_error("tx_start fail @queue %d (errno=%d)\n", i, error); + } + } +} + +static void +rt81xx_tx_start(struct netif *nifp) +{ + spinlock_acquire(&netif_lock); + __rt81xx_tx_start(nifp); + spinlock_release(&netif_lock); +} + +static int +rt81xx_tx_enq(struct netif *nifp, struct netbuf *nbp, void *data) +{ + struct netbuf *dest; + + spinlock_acquire(&netif_lock); + dest = &netif_buf[netif_enq_ptr++]; + memcpy(dest, nbp, sizeof(*dest)); + + if (netif_enq_ptr > TXQ_ENTRIES - 1) { + __rt81xx_tx_start(nifp); + netif_enq_ptr = 0; + } + spinlock_release(&netif_lock); + return 0; +} + +static int +rt81xx_intr(void *sp) { - static uint32_t packet_ptr = 0; uint16_t len; uint16_t *p; uint16_t status; status = rt_read(RT_INTRSTATUS, 2); - p = (uint16_t *)(rxbuf + packet_ptr); + p = (uint16_t *)(rxbuf + tx_ptr); len = *(p + 1); /* Length after header */ p += 2; /* Points to data now */ - if (status & RT_TOK) { - return; + if (!ISSET(status, RT_TOK | RT_ROK)) { + return 0; + } + + if (ISSET(status, RT_TOK)) { + pr_trace("sent packet\n"); + return 1; } /* Update rxbuf offset in CAPR */ - packet_ptr = (packet_ptr + len + 4 + 3) & RX_PTR_MASK; - if (packet_ptr > RX_REAL_BUF_SIZE) { - packet_ptr -= RX_REAL_BUF_SIZE; + tx_ptr = (tx_ptr + len + 4 + 3) & RX_PTR_MASK; + if (tx_ptr > RX_REAL_BUF_SIZE) { + tx_ptr -= RX_REAL_BUF_SIZE; } - rt_write(RT_RXBUFTAIL, 2, packet_ptr - 0x10); + rt_write(RT_RXBUFTAIL, 2, tx_ptr - 0x10); rt_write(RT_INTRSTATUS, 2, RT_ACKW); - lapic_eoi(); + return 1; /* handled */ } static int -rtl8139_irq_init(void) +rt81xx_irq_init(void) { - int vec; + struct intr_hand ih; - vec = intr_alloc_vector("rt8139", IPL_BIO); - if (vec < 0) { - return vec; + ih.func = rt81xx_intr; + ih.priority = IPL_BIO; + ih.irq = dev->irq_line; + if (intr_register("rt81xx", &ih) == NULL) { + return -EIO; } - - /* Map interrupt vector to IRQ */ - idt_set_desc(vec, IDT_INT_GATE, ISR(rt8139_pin_irq), 0); - ioapic_set_vec(dev->irq_line, vec); - ioapic_irq_unmask(dev->irq_line); return 0; } -#else -#define rtl8139_irq_init(...) -ENOTSUP -#endif static void rt_init_pci(void) @@ -221,6 +293,7 @@ rt_init_pci(void) static int rt_init_mac(void) { + struct netif_addr *addr = &netif.addr; uint8_t conf; uint32_t tmp; int error; @@ -256,20 +329,20 @@ rt_init_mac(void) /* MAC address dword 0 */ tmp = rt_read(RT_IDR0, 4); - wire.mac_addr[0] = tmp & 0xFF; - wire.mac_addr[1] = (tmp >> 8) & 0xFF; - wire.mac_addr[2] = (tmp >> 16) & 0xFF; - wire.mac_addr[3] = (tmp >> 24) & 0xFF; + addr->data[0] = tmp & 0xFF; + addr->data[1] = (tmp >> 8) & 0xFF; + addr->data[2] = (tmp >> 16) & 0xFF; + addr->data[3] = (tmp >> 24) & 0xFF; /* MAC address word 1 */ tmp = rt_read(RT_IDR2, 4); - wire.mac_addr[4] = (tmp >> 16) & 0xFF; - wire.mac_addr[5] = (tmp >> 24) & 0xFF; + addr->data[4] = (tmp >> 16) & 0xFF; + addr->data[5] = (tmp >> 24) & 0xFF; pr_trace("MAC address: %x:%x:%x:%x:%x:%x\n", - (uint64_t)wire.mac_addr[0], (uint64_t)wire.mac_addr[1], - (uint64_t)wire.mac_addr[2], (uint64_t)wire.mac_addr[3], - (uint64_t)wire.mac_addr[4], (uint64_t)wire.mac_addr[5]); + (uint64_t)addr->data[0], (uint64_t)addr->data[1], + (uint64_t)addr->data[2], (uint64_t)addr->data[3], + (uint64_t)addr->data[4], (uint64_t)addr->data[5]); /* * Alright, now we don't want those EEM bits @@ -293,6 +366,11 @@ rt_init_mac(void) return -ENOMEM; } + memcpy(netif.name, IFNAME, strlen(IFNAME) + 1); + netif.tx_enq = rt81xx_tx_enq; + netif.tx_start = rt81xx_tx_start; + netif_add(&netif); + /* * Configure the chip: * @@ -310,19 +388,17 @@ rt_init_mac(void) * - Enable interrupts through ROK/TOK * - Enable RX state machines * - * TODO: Support TX - * */ - rtl8139_irq_init(); + rt81xx_irq_init(); rt_write(RT_RXBUF, 4, rxbuf); rt_write(RT_RXCONFIG, 4, RT_AB | RT_AM | RT_APM | RT_AAP); rt_write(RT_INTRMASK, 2, RT_ROK | RT_TOK); - rt_write(RT_CHIPCMD, 1, RT_RE); + rt_write(RT_CHIPCMD, 1, RT_RE | RT_TE); return 0; } static int -rt813l_init(void) +rt81xx_init(void) { struct pci_lookup lookup; @@ -364,4 +440,4 @@ rt813l_init(void) return rt_init_mac(); } -DRIVER_EXPORT(rt813l_init); +DRIVER_DEFER(rt81xx_init, "rtl81xx"); diff --git a/sys/dev/random/entropy.c b/sys/dev/random/entropy.c new file mode 100644 index 0000000..4e723a4 --- /dev/null +++ b/sys/dev/random/entropy.c @@ -0,0 +1,55 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdint.h> +#include <string.h> +#include <dev/random/entropy.h> +#include <crypto/siphash.h> + +void +mix_entropy(struct entropy_pool *ep, const uint8_t *input, + size_t input_len, uint32_t input_entropy_bits) +{ + char key[16] = {0,1,2,3,4,5,6,7,8,9,0xa,0xb,0xc,0xd,0xe,0xf}; + uint64_t hash_result; + uint8_t buffer[ENTROPY_POOL_SIZE + input_len]; + memcpy(buffer, ep->pool, ENTROPY_POOL_SIZE); + memcpy(buffer + ENTROPY_POOL_SIZE, input, input_len); + + hash_result = siphash24(buffer, sizeof(buffer), key); + + for (int i = 0; i < 8; ++i) { + ep->pool[i] ^= (hash_result >> (i * 8)) & 0xFF; + } + + ep->entropy_bits += input_entropy_bits; + if (ep->entropy_bits > ENTROPY_POOL_SIZE * 8) { + ep->entropy_bits = ENTROPY_POOL_SIZE * 8; + } +} diff --git a/sys/dev/random/random.c b/sys/dev/random/random.c new file mode 100644 index 0000000..9bca719 --- /dev/null +++ b/sys/dev/random/random.c @@ -0,0 +1,88 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/sio.h> +#include <sys/device.h> +#include <sys/driver.h> +#include <dev/random/entropy.h> +#include <crypto/chacha20.h> +#include <crypto/siphash.h> +#include <fs/devfs.h> +#include <string.h> + +static struct cdevsw random_cdevsw; +static struct entropy_pool entropy; + +uint8_t key[32] = {0}; +uint8_t nonce[12] = {0}; +uint32_t state[16]; +uint32_t tsc; + +static inline uint64_t +read_tsc(void) +{ + uint32_t lo, hi; + __asm__ volatile ("rdtsc" : "=a"(lo), "=d"(hi)); + return ((uint64_t)hi << 32) | lo; +} + +static int +random_read(dev_t dev, struct sio_txn *sio, int flags) +{ + tsc = read_tsc(); + mix_entropy(&entropy, (uint8_t *)&tsc, sizeof(tsc), 1); + + chacha20_init(state, entropy.pool, nonce, 0); + chacha20_encrypt(state, NULL, sio->buf, sio->len); + + return sio->len; +} + +static int +random_init(void) +{ + char devname[] = "random"; + devmajor_t major; + dev_t dev; + + /* Register the device here */ + major = dev_alloc_major(); + dev = dev_alloc(major); + dev_register(major, dev, &random_cdevsw); + devfs_create_entry(devname, major, dev, 0444); + + return 0; +} + +static struct cdevsw random_cdevsw = { + .read = random_read, + .write = nowrite +}; + +DRIVER_EXPORT(random_init, "random"); diff --git a/sys/dev/usb/xhci.c b/sys/dev/usb/xhci.c index d68f98e..e14cb44 100644 --- a/sys/dev/usb/xhci.c +++ b/sys/dev/usb/xhci.c @@ -37,6 +37,7 @@ #include <dev/usb/xhciregs.h> #include <dev/usb/xhcivar.h> #include <dev/pci/pci.h> +#include <dev/pci/pciregs.h> #include <dev/acpi/acpi.h> #include <vm/physmem.h> #include <vm/dynalloc.h> @@ -56,10 +57,11 @@ static struct pci_device *hci_dev; static struct timer tmr; -__attribute__((__interrupt__)) static void -xhci_common_isr(void *sf) +static int +xhci_intr(void *sf) { pr_trace("received xHCI interrupt (via PCI MSI-X)\n"); + return 1; /* handled */ } /* @@ -69,11 +71,16 @@ xhci_common_isr(void *sf) static inline uint32_t * xhci_get_portsc(struct xhci_hc *hc, uint8_t portno) { - if (portno > hc->maxports) { - portno = hc->maxports; + if (portno >= hc->maxports) { + return NULL; + } + + /* Zero based */ + if (portno > 0) { + --portno; } - return PTR_OFFSET(hc->opregs, 0x400 + (0x10 * (portno - 1))); + return PTR_OFFSET(hc->opregs, 0x400 + (0x10 * portno)); } static int @@ -174,6 +181,7 @@ xhci_init_scratchpads(struct xhci_hc *hc) struct xhci_caps *caps = XHCI_CAPS(hc->base); uint16_t max_bufs_lo, max_bufs_hi; uint16_t max_bufs; + size_t len; uintptr_t *bufarr, tmp; max_bufs_lo = XHCI_MAX_SP_LO(caps->hcsparams1); @@ -187,8 +195,9 @@ xhci_init_scratchpads(struct xhci_hc *hc) return 0; } - pr_trace("using %d pages for xHC scratchpads\n"); - bufarr = dynalloc_memalign(sizeof(uintptr_t)*max_bufs, 0x1000); + len = sizeof(uint64_t) * max_bufs; + pr_trace("using %d bytes for xHC scratchpads\n", len); + bufarr = dynalloc_memalign(len, 0x1000); if (bufarr == NULL) { pr_error("failed to allocate scratchpad buffer array\n"); return -1; @@ -196,12 +205,12 @@ xhci_init_scratchpads(struct xhci_hc *hc) for (size_t i = 0; i < max_bufs; ++i) { tmp = vm_alloc_frame(1); - memset(PHYS_TO_VIRT(tmp), 0, 0x1000); if (tmp == 0) { /* TODO: Shutdown, free memory */ pr_error("failed to fill scratchpad buffer array\n"); return -1; } + memset(PHYS_TO_VIRT(tmp), 0, 0x1000); bufarr[i] = tmp; } @@ -217,7 +226,7 @@ xhci_alloc_dcbaa(struct xhci_hc *hc) { size_t size; - size = sizeof(uintptr_t) * hc->maxslots; + size = sizeof(uintptr_t) * (hc->maxslots + 1); hc->dcbaap = dynalloc_memalign(size, 0x1000); __assert(hc->dcbaap != NULL); return VIRT_TO_PHYS(hc->dcbaap); @@ -232,7 +241,7 @@ xhci_init_msix(struct xhci_hc *hc) struct msi_intr intr; intr.name = "xHCI MSI-X"; - intr.handler = xhci_common_isr; + intr.handler = xhci_intr; return pci_enable_msix(hci_dev, &intr); } @@ -254,7 +263,7 @@ xhci_init_evring(struct xhci_hc *hc) memset(segtab, 0, DEFAULT_PAGESIZE); /* Set the size of the event ring segment table */ - erst_size = PTR_OFFSET(runtime, 0x28); + erst_size = PTR_OFFSET(runtime, XHCI_RT_ERSTSZ); mmio_write32(erst_size, 1); /* Allocate the event ring segment */ @@ -264,24 +273,24 @@ xhci_init_evring(struct xhci_hc *hc) /* setup the event ring segment */ segtab->base = VIRT_TO_PHYS(tmp_p); - segtab->base = ((uintptr_t)segtab->base) + (2 * 4096) & ~0xF; + segtab->base = ((uintptr_t)segtab->base); segtab->size = XHCI_EVRING_LEN; /* Setup the event ring dequeue pointer */ - erdp = PTR_OFFSET(runtime, 0x38); + erdp = PTR_OFFSET(runtime, XHCI_RT_ERDP); mmio_write64(erdp, segtab->base); /* Point ERSTBA to our event ring segment */ - erstba = PTR_OFFSET(runtime, 0x30); + erstba = PTR_OFFSET(runtime, XHCI_RT_ERSTBA); mmio_write64(erstba, VIRT_TO_PHYS(segtab)); hc->evring = PHYS_TO_VIRT(segtab->base); /* Setup interrupt moderation */ - imod = PTR_OFFSET(runtime, 0x24); + imod = PTR_OFFSET(runtime, XHCI_RT_IMOD); mmio_write32(imod, XHCI_IMOD_DEFAULT); /* Enable interrupts */ - iman = PTR_OFFSET(runtime, 0x20); + iman = PTR_OFFSET(runtime, XHCI_RT_IMAN); tmp = mmio_read32(iman); mmio_write32(iman, tmp | XHCI_IMAN_IE); } @@ -331,6 +340,13 @@ xhci_reset(struct xhci_hc *hc) return error; } + /* Wait longer if the xHC is not ready */ + error = xhci_poll32(&opregs->usbsts, USBSTS_CNR, false); + if (error < 0) { + pr_error("xhci_reset: xHC ready wait timeout\n"); + return error; + } + return 0; } @@ -368,13 +384,33 @@ xhci_start_hc(struct xhci_hc *hc) /* Don't start up if we are already running */ usbcmd = mmio_read32(&opregs->usbcmd); if (ISSET(usbcmd, USBCMD_RUN)) - return -EBUSY; + return 0; usbcmd |= USBCMD_RUN; mmio_write32(&opregs->usbcmd, usbcmd); return 0; } +/* + * Stop and bring down the host controller. + * Returns 0 on success. + */ +static int +xhci_stop_hc(struct xhci_hc *hc) +{ + struct xhci_opregs *opregs = hc->opregs; + uint32_t usbcmd; + + /* Don't continue if we aren't running */ + usbcmd = mmio_read32(&opregs->usbcmd); + if (!ISSET(usbcmd, USBCMD_RUN)) + return 0; + + usbcmd &= ~USBCMD_RUN; + mmio_write32(&opregs->usbcmd, usbcmd); + return 0; +} + static int xhci_init_ports(struct xhci_hc *hc) { @@ -384,6 +420,9 @@ xhci_init_ports(struct xhci_hc *hc) for (size_t i = 1; i < hc->maxports; ++i) { portsc_p = xhci_get_portsc(hc, i); + if (portsc_p == NULL) { + continue; + } portsc = mmio_read32(portsc_p); /* @@ -457,8 +496,15 @@ xhci_init_hc(struct xhci_hc *hc) return -1; } + pr_trace("stopping xHC chip...\n"); + if ((error = xhci_stop_hc(hc)) != 0) { + pr_error("run/stop timeout\n"); + return error; + } + pr_trace("resetting xHC chip...\n"); if ((error = xhci_reset(hc)) != 0) { + pr_error("reset timeout\n"); return error; } @@ -495,6 +541,16 @@ xhci_init_hc(struct xhci_hc *hc) return 0; } +static void +xhci_init_pci(void) +{ + uint32_t tmp; + + tmp = pci_readl(hci_dev, PCIREG_CMDSTATUS); + tmp |= (PCI_BUS_MASTERING | PCI_MEM_SPACE); + pci_writel(hci_dev, PCIREG_CMDSTATUS, tmp); +} + static int xhci_init(void) { @@ -527,7 +583,8 @@ xhci_init(void) return -ENODEV; } + xhci_init_pci(); return xhci_init_hc(&xhc); } -DRIVER_EXPORT(xhci_init); +DRIVER_EXPORT(xhci_init, "xhci"); diff --git a/sys/dev/video/fbdev.c b/sys/dev/video/fbdev.c index f21c769..f58a813 100644 --- a/sys/dev/video/fbdev.c +++ b/sys/dev/video/fbdev.c @@ -28,17 +28,65 @@ */ #include <sys/types.h> +#include <sys/errno.h> #include <sys/limine.h> +#include <sys/device.h> +#include <sys/driver.h> +#include <sys/fbdev.h> #include <dev/video/fbdev.h> +#include <fs/devfs.h> +#include <fs/ctlfs.h> +#include <vm/vm.h> +#include <string.h> #define FRAMEBUFFER \ framebuffer_req.response->framebuffers[0] +static struct cdevsw fb_cdevsw; +static const struct ctlops fb_size_ctl; static volatile struct limine_framebuffer_request framebuffer_req = { .id = LIMINE_FRAMEBUFFER_REQUEST, .revision = 0 }; +static paddr_t +fbdev_mmap(dev_t dev, size_t size, off_t off, int flags) +{ + size_t max_bounds; + + max_bounds = FRAMEBUFFER->pitch * FRAMEBUFFER->height; + if ((off + size) > max_bounds) { + return 0; + } + + return VIRT_TO_PHYS(FRAMEBUFFER->address); +} + +static int +ctl_attr_read(struct ctlfs_dev *cdp, struct sio_txn *sio) +{ + struct fbattr attr; + size_t len = sizeof(attr); + + if (sio == NULL) { + return -EINVAL; + } + if (sio->buf == NULL) { + return -EINVAL; + } + + if (len > sio->len) { + len = sio->len; + } + + attr.width = FRAMEBUFFER->width; + attr.height = FRAMEBUFFER->height; + attr.pitch = FRAMEBUFFER->pitch; + attr.bpp = FRAMEBUFFER->bpp; + memcpy(sio->buf, &attr, len); + return len; +} + struct fbdev fbdev_get(void) { @@ -51,3 +99,39 @@ fbdev_get(void) ret.bpp = FRAMEBUFFER->bpp; return ret; } + +static int +fbdev_init(void) +{ + struct ctlfs_dev ctl; + char devname[] = "fb0"; + devmajor_t major; + dev_t dev; + + /* Register the device here */ + major = dev_alloc_major(); + dev = dev_alloc(major); + dev_register(major, dev, &fb_cdevsw); + devfs_create_entry(devname, major, dev, 0444); + + /* Register control files */ + ctl.mode = 0444; + ctlfs_create_node(devname, &ctl); + ctl.devname = devname; + ctl.ops = &fb_size_ctl; + ctlfs_create_entry("attr", &ctl); + return 0; +} + +static struct cdevsw fb_cdevsw = { + .read = noread, + .write = nowrite, + .mmap = fbdev_mmap +}; + +static const struct ctlops fb_size_ctl = { + .read = ctl_attr_read, + .write = NULL, +}; + +DRIVER_EXPORT(fbdev_init, "fbdev"); diff --git a/sys/fs/ctlfs.c b/sys/fs/ctlfs.c index efbf448..b86fa0a 100644 --- a/sys/fs/ctlfs.c +++ b/sys/fs/ctlfs.c @@ -234,6 +234,35 @@ ctlfs_lookup(struct vop_lookup_args *args) return 0; } +static int +ctlfs_get_ops(struct vnode *vp, struct ctlfs_entry **enpres, + const struct ctlops **iopres) +{ + const struct ctlops *iop; + struct ctlfs_entry *enp; + + if (enpres == NULL || iopres == NULL) { + return -EINVAL; + } + + if ((enp = vp->data) == NULL) { + pr_error("no vnode data for ctlfs entry\n"); + return -EIO; + } + if (enp->magic != CTLFS_ENTRY_MAG) { + pr_error("ctlfs entry has bad magic\n"); + return -EIO; + } + if ((iop = enp->io) == NULL) { + pr_error("no i/o ops for ctlfs entry\n"); + return -EIO; + } + + *enpres = enp; + *iopres = iop; + return 0; +} + /* * Create a ctlfs node (directory) within the * root fs. @@ -344,18 +373,10 @@ ctlfs_read(struct vnode *vp, struct sio_txn *sio) const struct ctlops *iop; struct ctlfs_entry *enp; struct ctlfs_dev dev; + int error; - if ((enp = vp->data) == NULL) { - pr_error("no vnode data for ctlfs entry\n"); - return -EIO; - } - if (enp->magic != CTLFS_ENTRY_MAG) { - pr_error("ctlfs entry has bad magic\n"); - return -EIO; - } - if ((iop = enp->io) == NULL) { - pr_error("no i/o ops for ctlfs entry\n"); - return -EIO; + if ((error = ctlfs_get_ops(vp, &enp, &iop)) < 0) { + return error; } if (iop->read == NULL) { pr_trace("no read op for ctlfs entry\n"); @@ -368,28 +389,40 @@ ctlfs_read(struct vnode *vp, struct sio_txn *sio) return iop->read(&dev, sio); } +/* + * Write a control file + * + * Args passed to driver: + * - ctlfs_dev.ctlname + * - ctlfs_dev.iop + * - ctlfs_dev.mode + */ static int -ctlfs_reclaim(struct vnode *vp) +ctlfs_write(struct vnode *vp, struct sio_txn *sio) { - struct ctlfs_hdr *hp; + const struct ctlops *iop; + struct ctlfs_entry *enp; + struct ctlfs_dev dev; + int error; - if (vp->data == NULL) { - return 0; + if ((error = ctlfs_get_ops(vp, &enp, &iop)) < 0) { + return error; } - - /* Ensure the magic is correct */ - hp = vp->data; - switch (hp->magic) { - case CTLFS_NODE_MAG: - case CTLFS_ENTRY_MAG: - dynfree(hp->name); - break; - default: - pr_error("reclaim: bad magic in vp\n"); - break; + if (iop->write == NULL) { + pr_trace("no write op for ctlfs entry\n"); + return -EIO; } - dynfree(vp->data); + dev.ctlname = enp->name; + dev.ops = iop; + dev.mode = enp->mode; + return iop->write(&dev, sio); +} + +static int +ctlfs_reclaim(struct vnode *vp) +{ + vp->data = NULL; return 0; } @@ -397,8 +430,9 @@ static const struct vops ctlfs_vops = { .lookup = ctlfs_lookup, .read = ctlfs_read, .getattr = NULL, - .write = NULL, - .reclaim = ctlfs_reclaim + .write = ctlfs_write, + .reclaim = ctlfs_reclaim, + .create = NULL }; const struct vfsops g_ctlfs_vfsops = { diff --git a/sys/fs/devfs.c b/sys/fs/devfs.c index 024239d..3bd1b11 100644 --- a/sys/fs/devfs.c +++ b/sys/fs/devfs.c @@ -30,6 +30,8 @@ #include <sys/types.h> #include <sys/vnode.h> #include <sys/errno.h> +#include <sys/stat.h> +#include <sys/syslog.h> #include <sys/mount.h> #include <sys/device.h> #include <fs/devfs.h> @@ -37,6 +39,7 @@ #include <string.h> struct devfs_node { + struct devstat stat; char *name; uint8_t is_block : 1; mode_t mode; @@ -126,6 +129,8 @@ devfs_lookup(struct vop_lookup_args *args) vp->data = dnp; vp->vops = &g_devfs_vops; + vp->major = dnp->major; + vp->dev = dnp->dev; *args->vpp = vp; return 0; } @@ -136,6 +141,8 @@ devfs_getattr(struct vop_getattr_args *args) struct vnode *vp; struct vattr *attr; struct devfs_node *dnp; + struct bdevsw *bdev; + size_t size = 0; vp = args->vp; if ((dnp = vp->data) == NULL) { @@ -145,6 +152,13 @@ devfs_getattr(struct vop_getattr_args *args) return -EIO; } + if (dnp->is_block) { + bdev = dev_get(dnp->major, dnp->dev); + if (bdev->bsize != NULL) { + size = bdev->bsize(dnp->dev); + } + } + /* * Set stat attributes from device node structure * found within vnode data. @@ -153,20 +167,13 @@ devfs_getattr(struct vop_getattr_args *args) * size is hardwired to 0. */ attr->mode = dnp->mode; - attr->size = 0; + attr->size = size; return 0; } static int devfs_reclaim(struct vnode *vp) { - struct devfs_node *dnp; - - if ((dnp = vp->data) != NULL) { - dynfree(dnp->name); - dynfree(vp->data); - } - vp->data = NULL; return 0; } @@ -175,6 +182,7 @@ static int devfs_read(struct vnode *vp, struct sio_txn *sio) { struct devfs_node *dnp; + struct devstat *statp; void *devsw; if ((dnp = vp->data) == NULL) @@ -185,6 +193,9 @@ devfs_read(struct vnode *vp, struct sio_txn *sio) if (!dnp->is_block) return cdevsw_read(devsw, dnp->dev, sio); + statp = &dnp->stat; + ++statp->nreads; + /* Block device */ return bdevsw_read(devsw, dnp->dev, sio); } @@ -193,6 +204,7 @@ static int devfs_write(struct vnode *vp, struct sio_txn *sio) { struct devfs_node *dnp; + struct devstat *statp; void *devsw; if ((dnp = vp->data) == NULL) @@ -204,6 +216,9 @@ devfs_write(struct vnode *vp, struct sio_txn *sio) return cdevsw_write(devsw, dnp->dev, sio); } + statp = &dnp->stat; + ++statp->nwrites; + /* Block device */ return bdevsw_write(devsw, dnp->dev, sio); } @@ -228,6 +243,24 @@ devfs_init(struct fs_info *fip) return 0; } +int +devfs_devstat(struct vnode *vp, struct devstat *res) +{ + struct devfs_node *dnp; + + if ((dnp = vp->data) == NULL) { + return -EIO; + } + + /* Not supported on char devices */ + if (!dnp->is_block) { + return -ENOTSUP; + } + + *res = dnp->stat; + return 0; +} + /* * Create an entry within devfs. * @@ -240,6 +273,7 @@ int devfs_create_entry(const char *name, devmajor_t major, dev_t dev, mode_t mode) { struct devfs_node *dnp; + struct devstat *statp; size_t name_len; dnp = dynalloc(sizeof(*dnp)); @@ -253,9 +287,13 @@ devfs_create_entry(const char *name, devmajor_t major, dev_t dev, mode_t mode) return -ENOMEM; } + statp = &dnp->stat; + statp->nwrites = 0; + statp->nreads = 0; + memcpy(dnp->name, name, name_len); dnp->name[name_len] = '\0'; - + dnp->is_block = ISSET(mode, S_IFBLK) ? 1 : 0; dnp->major = major; dnp->dev = dev; dnp->mode = mode; @@ -268,7 +306,8 @@ const struct vops g_devfs_vops = { .reclaim = devfs_reclaim, .read = devfs_read, .write = devfs_write, - .getattr = devfs_getattr + .getattr = devfs_getattr, + .create = NULL }; const struct vfsops g_devfs_vfsops = { diff --git a/sys/fs/initramfs.c b/sys/fs/initramfs.c index b12a64b..beb2e84 100644 --- a/sys/fs/initramfs.c +++ b/sys/fs/initramfs.c @@ -61,12 +61,16 @@ struct initramfs_node { * @magic: Header magic ("OMAR") * @len: Length of the file * @namelen: Length of the filename + * @rev: OMAR revision + * @mode: File permissions */ struct __packed omar_hdr { char magic[4]; uint8_t type; uint8_t namelen; uint32_t len; + uint8_t rev; + uint32_t mode; }; static volatile struct limine_module_request mod_req = { @@ -140,7 +144,7 @@ initramfs_get_file(const char *path, struct initramfs_node *res) p += hdr->namelen; if (strcmp(namebuf, path) == 0) { - node.mode = 0700; + node.mode = hdr->mode; node.size = hdr->len; node.data = (void *)p; *res = node; @@ -223,6 +227,8 @@ initramfs_read(struct vnode *vp, struct sio_txn *sio) return -EIO; if (sio->buf == NULL) return -EIO; + if (sio->len > n->size) + sio->len = n->size; src = n->data; dest = sio->buf; @@ -277,7 +283,8 @@ const struct vops g_initramfs_vops = { .read = initramfs_read, .write = NULL, .reclaim = initramfs_reclaim, - .getattr = initramfs_getattr + .getattr = initramfs_getattr, + .create = NULL, }; const struct vfsops g_initramfs_vfsops = { diff --git a/sys/fs/tmpfs.c b/sys/fs/tmpfs.c new file mode 100644 index 0000000..4fd9e85 --- /dev/null +++ b/sys/fs/tmpfs.c @@ -0,0 +1,430 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/mount.h> +#include <sys/errno.h> +#include <sys/syslog.h> +#include <sys/types.h> +#include <sys/cdefs.h> +#include <sys/param.h> +#include <sys/panic.h> +#include <sys/vnode.h> +#include <vm/dynalloc.h> +#include <vm/vm_obj.h> +#include <vm/vm_page.h> +#include <vm/vm_pager.h> +#include <fs/tmpfs.h> +#include <string.h> + +#define ROOT_RPATH "/tmp" +#define TMPFS_BSIZE DEFAULT_PAGESIZE + +#define pr_trace(fmt, ...) kprintf("tmpfs: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) + +static TAILQ_HEAD(, tmpfs_node) root; + +/* + * Generate a vnode for a specific tmpfs + * node. + */ +static int +tmpfs_ref(struct tmpfs_node *np) +{ + struct vnode *vp = NULL; + int retval = 0; + + if (np->vp == NULL) { + spinlock_acquire(&np->lock); + retval = vfs_alloc_vnode(&vp, np->type); + np->vp = vp; + spinlock_release(&np->lock); + } + + if (vp != NULL) { + vp->data = np; + vp->vops = &g_tmpfs_vops; + } + + return retval; +} + +/* + * Perform lookup within the tmpfs namespace + * + * XXX: This operations is serialized + * TODO: Support multiple directories (only fs root now) + * + * @rpath: /tmp/ relative path to lookup + * @res: The result is written here (must NOT be NULL) + */ +static int +tmpfs_do_lookup(const char *rpath, struct tmpfs_node **res) +{ + struct tmpfs_node *cnp; + struct tmpfs_node *dirent; + int error = 0; + + /* + * If the directory is the node that we are + * looking for, return it. But if it is not + * and it is empty then there is nothing + * we can do. + */ + cnp = TAILQ_FIRST(&root); + if (strcmp(cnp->rpath, rpath) == 0) { + *res = cnp; + return 0; + } + if (TAILQ_NELEM(&cnp->dirents) == 0) { + return -ENOENT; + } + + /* + * Go through each tmpfs dirent to see if we can + * find the file we are looking for. + */ + spinlock_acquire(&cnp->lock); + dirent = TAILQ_FIRST(&cnp->dirents); + while (dirent != NULL) { + if (strcmp(dirent->rpath, rpath) == 0) { + break; + } + + dirent = TAILQ_NEXT(dirent, link); + } + + spinlock_release(&cnp->lock); + if (dirent == NULL) { + return -ENOENT; + } + + if ((error = tmpfs_ref(dirent)) != 0) { + return error; + } + + *res = dirent; + return 0; +} + +/* + * TMPFS lookup callback for the VFS + * + * Takes some arguments and returns a vnode + * in args->vpp + */ +static int +tmpfs_lookup(struct vop_lookup_args *args) +{ + struct tmpfs_node *np; + int error; + + if (args == NULL) { + return -EINVAL; + } + if (args->name == NULL) { + return -EINVAL; + } + + /* + * Attempt to find the node we want, if it already + * has a vnode attached to it then that's something we + * want. However we should allocate a new vnode if we + * need to. + */ + error = tmpfs_do_lookup(args->name, &np); + if (error != 0) { + return error; + } + + *args->vpp = np->vp; + return 0; +} + +/* + * TMPFS create callback for the VFS + * + * Creates a new TMPFS node + */ +static int +tmpfs_create(struct vop_create_args *args) +{ + const char *pcp = args->path; /* Stay away from boat, kids */ + struct vnode *dirvp; + struct tmpfs_node *np; + struct tmpfs_node *root_np; + int error; + + /* Validate inputs */ + if (args == NULL) + return -EINVAL; + if (pcp == NULL) + return -EIO; + if ((dirvp = args->dirvp) == NULL) + return -EIO; + + /* Remove the leading "/tmp/" */ + pcp += sizeof(ROOT_RPATH); + if (*pcp == '\0') { + return -ENOENT; + } + + np = dynalloc(sizeof(*np)); + if (np == NULL) { + return -ENOMEM; + } + + memset(np, 0, sizeof(*np)); + + /* + * TODO: Support multiple directories. + * + * XXX: We currently only create a TMPFS_REG node as + * to keep things initially simple. + */ + root_np = TAILQ_FIRST(&root); + np->dirvp = dirvp; + np->type = TMPFS_REG; + np->real_size = 0; + np->mode = 0700; + memcpy(np->rpath, pcp, strlen(pcp) + 1); + TAILQ_INSERT_TAIL(&root_np->dirents, np, link); + + if ((error = tmpfs_ref(np)) != 0) { + return error; + } + + *args->vpp = np->vp; + return 0; +} + +/* + * TMPFS write callback for VFS + * + * Node buffers are orthogonally managed. That is, each + * node has their own respective data buffers. When + * writing to a node, we need to take into account of the + * length of the buffer. This value may need to expanded as + * well as more pages allocated if the amount of bytes to + * be written exceeds it. + */ +static int +tmpfs_write(struct vnode *vp, struct sio_txn *sio) +{ + struct tmpfs_node *np; + off_t res_off; + uint8_t *buf; + + if (sio->buf == NULL || sio->len == 0) { + return -EINVAL; + } + + /* This should not happen but you never know */ + if ((np = vp->data) == NULL) { + return -EIO; + } + + /* Is this even a regular file? */ + if (np->type != VREG) { + return -EISDIR; + } + + spinlock_acquire(&np->lock); + + /* + * If the residual byte count is zero, we need to + * allocate a new page to be used. However if this + * fails we'll throw back an -ENOMEM. + */ + if (np->len == 0) { + np->data = dynalloc(TMPFS_BSIZE); + if (np->data == NULL) { + spinlock_release(&np->lock); + return -ENOMEM; + } + np->len += TMPFS_BSIZE; + } + + /* + * Bring up the real size if we are writing + * more bytes. + */ + res_off = sio->offset + sio->len; + if (res_off > np->real_size) { + np->real_size = res_off; + } + + /* + * If the length to be written exceeds the residual byte + * count. We will try to expand the buffer by the page + * size. However, if this fails, we will split the write + * into a suitable size that does not overflow what we + * have left. + */ + if (res_off > np->len) { + np->data = dynrealloc(np->data, (sio->offset + sio->len)); + if (np->data == NULL) { + sio->len = np->len; + } else { + np->len = sio->offset + sio->len; + } + } + + buf = np->data; + memcpy(&buf[sio->offset], sio->buf, sio->len); + spinlock_release(&np->lock); + return sio->len; +} + +/* + * TMPFS read callback for VFS + */ +static int +tmpfs_read(struct vnode *vp, struct sio_txn *sio) +{ + struct tmpfs_node *np; + uint8_t *buf; + + if (sio->buf == NULL || sio->len == 0) { + return -EINVAL; + } + + /* This should not happen but you never know */ + if ((np = vp->data) == NULL) { + return -EIO; + } + + /* + * The node data is only allocated during writes, if + * we read this file before a write was ever done to it, + * np->data will be NULL. We must handle this. + */ + if (np->data == NULL) { + return 0; + } + + /* Is this even a regular file? */ + if (np->type != VREG) { + return -EISDIR; + } + + spinlock_acquire(&np->lock); + + if (sio->offset > np->real_size) { + return -EINVAL; + } + + buf = np->data; + memcpy(sio->buf, &buf[sio->offset], sio->len); + spinlock_release(&np->lock); + return sio->len; +} + +/* + * TMPFS get attribute callback for VFS + */ +static int +tmpfs_getattr(struct vop_getattr_args *args) +{ + struct vnode *vp; + struct tmpfs_node *np; + struct vattr attr; + + if ((vp = args->vp) == NULL) { + return -EIO; + } + if ((np = vp->data) == NULL) { + return -EIO; + } + + memset(&attr, VNOVAL, sizeof(attr)); + attr.size = np->real_size; + attr.mode = np->mode; + *args->res = attr; + return 0; +} + +static int +tmpfs_reclaim(struct vnode *vp) +{ + struct tmpfs_node *np; + + if ((np = vp->data) == NULL) { + return 0; + } + + np->vp = NULL; + return 0; +} + +static int +tmpfs_init(struct fs_info *fip) +{ + struct tmpfs_node *np; + struct vnode *vp; + struct mount *mp; + int error; + + /* Grab ourselves a new vnode for /tmp */ + if ((error = vfs_alloc_vnode(&vp, VDIR)) != 0) { + return error; + } + + vp->vops = &g_tmpfs_vops; + mp = vfs_alloc_mount(vp, fip); + vfs_name_mount(mp, "tmp"); + TAILQ_INSERT_TAIL(&g_mountlist, mp, mnt_list); + + /* Pre-allocate the first entry */ + if ((np = dynalloc(sizeof(*np))) == NULL) { + return -ENOMEM; + } + + TAILQ_INIT(&root); + memset(np, 0, sizeof(*np)); + + memcpy(np->rpath, ROOT_RPATH, sizeof(ROOT_RPATH)); + np->type = TMPFS_DIR; + TAILQ_INIT(&np->dirents); + TAILQ_INSERT_TAIL(&root, np, link); + return 0; +} + +const struct vops g_tmpfs_vops = { + .lookup = tmpfs_lookup, + .getattr = tmpfs_getattr, + .read = tmpfs_read, + .write = tmpfs_write, + .reclaim = tmpfs_reclaim, + .create = tmpfs_create, +}; + +const struct vfsops g_tmpfs_vfsops = { + .init = tmpfs_init +}; diff --git a/sys/include/arch/aarch64/board.h b/sys/include/arch/aarch64/board.h new file mode 100644 index 0000000..bba421f --- /dev/null +++ b/sys/include/arch/aarch64/board.h @@ -0,0 +1,51 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _MACHINE_BOARD_H_ +#define _MACHINE_BOARD_H_ + +/* Board implementer */ +#define BOARD_ARM_LIMITED 0x41 /* ARM Limited */ +#define BOARD_BROADCOM 0x42 /* Broadcom corp */ +#define BOARD_CAVIUM 0x43 /* Calvium Inc */ +#define BOARD_DIGITAL_EQUIP 0x44 /* Digital Equipment Corporation */ +#define BOARD_FUJITSU 0x46 /* Fujitsu Ltd */ + +/* + * Board information, contains a part number + * and an implementer number. + */ +struct board_info { + uint8_t implementer; + uint16_t partno : 12; +}; + +void md_get_board(struct board_info *res); + +#endif /* !_MACHINE_BOARD_H_ */ diff --git a/sys/include/arch/aarch64/cdefs.h b/sys/include/arch/aarch64/cdefs.h index a22c436..aaf8649 100644 --- a/sys/include/arch/aarch64/cdefs.h +++ b/sys/include/arch/aarch64/cdefs.h @@ -36,5 +36,6 @@ #define md_pause() __ASMV("yield") #define md_intoff() __ASMV("msr daifset, #2") #define md_inton() __ASMV("msr daifclr, #2") +#define md_hlt() __ASMV("hlt #0") #endif /* !_AARCH64_CDEFS_H_ */ diff --git a/sys/include/arch/aarch64/cpu.h b/sys/include/arch/aarch64/cpu.h index 2f62d95..8c2d837 100644 --- a/sys/include/arch/aarch64/cpu.h +++ b/sys/include/arch/aarch64/cpu.h @@ -39,6 +39,7 @@ struct cpu_info { struct cpu_info *self; }; +__dead void cpu_halt_all(void); void cpu_startup(struct cpu_info *ci); void cpu_halt_others(void); diff --git a/sys/include/arch/aarch64/exception.h b/sys/include/arch/aarch64/exception.h new file mode 100644 index 0000000..9e89c81 --- /dev/null +++ b/sys/include/arch/aarch64/exception.h @@ -0,0 +1,54 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _MACHINE_EXCEPTION_H_ +#define _MACHINE_EXCEPTION_H_ + +#include <sys/types.h> +#include <machine/frame.h> + +/* Exception class */ +#define EC_UNKNOWN 0x00 /* Unknown type */ +#define EC_WF 0x01 /* Trapped WF instruction */ +#define EC_MCRMRC 0x03 /* Trapped MCR/MRC */ +#define EC_MCRRC 0x04 /* Trapped MCRR/MRRC */ +#define EC_LDCSTC 0x06 /* Trapped LDC/STC */ +#define EC_SVE 0x07 /* Trapped SVE/SIMD/FP op */ +#define EC_BRE 0x0D /* Branch target exception */ +#define EC_ILLX 0x0E /* Illegal execution state */ +#define EC_SVC64 0x15 /* AARCH64 SVC */ +#define EC_PCALIGN 0x22 /* PC alignment fault */ +#define EC_DABORT 0x24 /* Data abort (w/o ELx change) */ +#define EC_EDABORT 0x25 /* Data abort (w/ ELx change) */ +#define EC_SPALIGN 0x26 /* SP alignment fault */ +#define EC_SERR 0x2F /* System error (what the fuck!) */ + +void handle_exception(struct trapframe *tf); + +#endif /* !_MACHINE_EXCEPTION_H_ */ diff --git a/sys/include/arch/aarch64/frame.h b/sys/include/arch/aarch64/frame.h index fa4d33d..143f4d0 100644 --- a/sys/include/arch/aarch64/frame.h +++ b/sys/include/arch/aarch64/frame.h @@ -31,43 +31,10 @@ #define _MACHINE_FRAME_H_ #include <sys/types.h> +#include <sys/cdefs.h> typedef uint64_t lreg_t; - -/* General purpose registers */ -struct gpregs { - lreg_t x0; - lreg_t x1; - lreg_t x2; - lreg_t x3; - lreg_t x4; - lreg_t x5; - lreg_t x6; - lreg_t x7; - lreg_t x8; - lreg_t x9; - lreg_t x10; - lreg_t x11; - lreg_t x12; - lreg_t x13; - lreg_t x14; - lreg_t x15; - lreg_t x16; - lreg_t x17; - lreg_t x18; - lreg_t x19; - lreg_t x20; - lreg_t x21; - lreg_t x22; - lreg_t x23; - lreg_t x24; - lreg_t x25; - lreg_t x26; - lreg_t x27; - lreg_t x28; - lreg_t x29; - lreg_t x30; -}; +typedef uint64_t frament_t; /* Stack regs */ struct sregs { @@ -83,14 +50,41 @@ struct pstat { lreg_t spsr_el3; }; -struct trapframe { - struct gpregs gp; - struct sregs stack; - struct pstat status; - lreg_t elr_el1; - lreg_t elr_el2; - lreg_t elr_el3; - lreg_t pc; +struct __aligned(16) trapframe { + lreg_t x30; + lreg_t x29; + lreg_t x28; + lreg_t x27; + lreg_t x26; + lreg_t x25; + lreg_t x24; + lreg_t x23; + lreg_t x22; + lreg_t x21; + lreg_t x20; + lreg_t x19; + lreg_t x18; + lreg_t x17; + lreg_t x16; + lreg_t x15; + lreg_t x14; + lreg_t x13; + lreg_t x12; + lreg_t x11; + lreg_t x10; + lreg_t x9; + lreg_t x8; + lreg_t x7; + lreg_t x6; + lreg_t x5; + lreg_t x4; + lreg_t x3; + lreg_t x2; + lreg_t x1; + lreg_t x0; + lreg_t elr; + lreg_t esr; + frament_t trapno; }; #define TF_IP(TFP) ((TFP)->pc) diff --git a/sys/include/arch/aarch64/frameasm.h b/sys/include/arch/aarch64/frameasm.h new file mode 100644 index 0000000..ca7f81a --- /dev/null +++ b/sys/include/arch/aarch64/frameasm.h @@ -0,0 +1,89 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _MACHINE_FRAMEASM_H_ +#define _MACHINE_FRAMEASM_H_ + +/* XXX: Must be 16-byte aligned!!! */ +#define XFRAME_STACK_SIZE (38 * 8) + +/* Trap numbers */ +#define TRAPNO_UNKNOWN #0 +#define TRAPNO_XSYNC #1 /* Synchronous */ +#define TRAPNO_XIRQ #2 /* IRQ */ +#define TRAPNO_XFIQ #3 /* FIQ */ +#define TRAPNO_XSERR #4 /* System error */ + +#define PUSH_XFRAME(TRAPNO) \ + sub sp, sp, #XFRAME_STACK_SIZE ; \ + stp x30, x29, [sp, #(0 * 8)] ; \ + stp x28, x27, [sp, #(2 * 8)] ; \ + stp x26, x25, [sp, #(4 * 8)] ; \ + stp x24, x23, [sp, #(6 * 8)] ; \ + stp x22, x21, [sp, #(8 * 8)] ; \ + stp x20, x19, [sp, #(10 * 8)] ; \ + stp x18, x17, [sp, #(12 * 8)] ; \ + stp x16, x15, [sp, #(14 * 8)] ; \ + stp x14, x13, [sp, #(16 * 8)] ; \ + stp x12, x11, [sp, #(18 * 8)] ; \ + stp x10, x9, [sp, #(20 * 8)] ; \ + stp x8, x7, [sp, #(22 * 8)] ; \ + stp x6, x5, [sp, #(24 * 8)] ; \ + stp x4, x3, [sp, #(26 * 8)] ; \ + stp x2, x1, [sp, #(28 * 8)] ; \ + str x0, [sp, #(30 * 8)] ; \ + ; \ + mrs x0, elr_el1 ; \ + str x0, [sp, #(31 * 8)] ; \ + mrs x0, esr_el1 ; \ + str x0, [sp, #(32 * 8)] ; \ + mov x0, TRAPNO ; \ + str x0, [sp, #(33 * 8)] ; \ + mov x0, sp + +#define POP_XFRAME() \ + ldr x0, [sp, #(30 * 8)] ; \ + ldp x2, x1, [sp, #(28 * 8)] ; \ + ldp x4, x3, [sp, #(26 * 8)] ; \ + ldp x6, x5, [sp, #(24 * 8)] ; \ + ldp x8, x7, [sp, #(22 * 8)] ; \ + ldp x10, x9, [sp, #(20 * 8)] ; \ + ldp x12, x11, [sp, #(18 * 8)] ; \ + ldp x14, x13, [sp, #(16 * 8)] ; \ + ldp x16, x15, [sp, #(14 * 8)] ; \ + ldp x18, x17, [sp, #(12 * 8)] ; \ + ldp x20, x19, [sp, #(10 * 8)] ; \ + ldp x22, x21, [sp, #(8 * 8)] ; \ + ldp x24, x23, [sp, #(6 * 8)] ; \ + ldp x26, x25, [sp, #(4 * 8)] ; \ + ldp x28, x27, [sp, #(2 * 8)] ; \ + ldp x30, x29, [sp, #(0 * 8)] ; \ + add sp, sp, #XFRAME_STACK_SIZE + +#endif /* !_MACHINE_FRAMEASM_H_ */ diff --git a/sys/include/arch/aarch64/intr.h b/sys/include/arch/aarch64/intr.h new file mode 100644 index 0000000..b85564f --- /dev/null +++ b/sys/include/arch/aarch64/intr.h @@ -0,0 +1,57 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _MACHINE_INTR_H_ +#define _MACHINE_INTR_H_ + +#include <sys/types.h> + +/* + * Interrupt priority levels + */ +#define IPL_NONE 0 /* Don't defer anything */ +#define IPL_BIO 1 /* Block I/O */ +#define IPL_CLOCK 2 /* Clock */ +#define IPL_HIGH 3 /* Defer everything */ + +struct intr_entry { + int priority; +}; + +struct intr_hand { + int(*func)(void *); + char *name; + int priority; + int irq; + int vector; +}; + +void *intr_register(const char *name, const struct intr_hand *ih); + +#endif /* !_MACHINE_INTR_H_ */ diff --git a/sys/include/arch/aarch64/param.h b/sys/include/arch/aarch64/param.h new file mode 100644 index 0000000..c074ffb --- /dev/null +++ b/sys/include/arch/aarch64/param.h @@ -0,0 +1,35 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _AARCH64_PARAM_H_ +#define _AARCH64_PARAM_H_ + +#define M_WORD_SIZE 4 + +#endif /* !_AARCH64_PARAM_H_ */ diff --git a/sys/include/arch/aarch64/pci/pci.h b/sys/include/arch/aarch64/pci/pci.h new file mode 100644 index 0000000..189a423 --- /dev/null +++ b/sys/include/arch/aarch64/pci/pci.h @@ -0,0 +1,40 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _MACHINE_PCI_H_ +#define _MACHINE_PCI_H_ + +#include <sys/types.h> +#include <sys/cdefs.h> +#include <dev/pci/pci.h> + +__weak pcireg_t md_pci_readl(struct pci_device *dev, uint32_t off); +__weak void md_pci_writel(struct pci_device *dev, uint32_t off, pcireg_t val); + +#endif /* !_MACHINE_PCI_H_ */ diff --git a/sys/include/arch/aarch64/pio.h b/sys/include/arch/aarch64/pio.h index 4aaeece..41f07fb 100644 --- a/sys/include/arch/aarch64/pio.h +++ b/sys/include/arch/aarch64/pio.h @@ -39,5 +39,4 @@ #define outw(...) __nothing #define outl(...) __nothing - #endif /* _MACHINE_PIO_H_ */ diff --git a/sys/include/arch/amd64/asm.h b/sys/include/arch/amd64/asm.h index 8d2c812..aca49d2 100644 --- a/sys/include/arch/amd64/asm.h +++ b/sys/include/arch/amd64/asm.h @@ -34,6 +34,16 @@ #include <sys/param.h> #include <machine/msr.h> +/* CR4 bits */ +#define CR4_TSD BIT(2) /* Timestamp disable */ +#define CR4_DE BIT(3) /* Debugging extensions */ +#define CR4_PSE BIT(4) /* Page size extensions */ +#define CR4_PCE BIT(8) /* Performance monitoring counter enable */ +#define CR4_UMIP BIT(11) /* User mode instruction prevention */ +#define CR4_LA57 BIT(12) /* Level 5 paging enable */ +#define CR4_VMXE BIT(13) /* Virtual machine extensions enable */ +#define CR4_SMXE BIT(14) /* Safer mode extensions enable */ + /* * Contains information for the current * core. Stored in %GS. diff --git a/sys/include/arch/amd64/bus.h b/sys/include/arch/amd64/bus.h index 00cb3ba..25088b4 100644 --- a/sys/include/arch/amd64/bus.h +++ b/sys/include/arch/amd64/bus.h @@ -36,13 +36,7 @@ struct bus_resource; -/* - * Hyra assumes that the bootloader uses PDE[256] for some - * higher half mappings. To avoid conflicts with those mappings, - * this offset is used to start device memory at PDE[257]. This - * will give us more than enough space. - */ -#define MMIO_OFFSET (VM_HIGHER_HALF + 0x8000000000) +#define MMIO_OFFSET VM_HIGHER_HALF /* Resource signature size max */ #define RSIG_MAX 16 diff --git a/sys/include/arch/amd64/cdefs.h b/sys/include/arch/amd64/cdefs.h index 256fd8b..d038a15 100644 --- a/sys/include/arch/amd64/cdefs.h +++ b/sys/include/arch/amd64/cdefs.h @@ -31,7 +31,7 @@ #define _AMD64_CDEFS_H_ #include <sys/cdefs.h> -#include <machine/sync.h> +#include <machine/cpu.h> /* * Please use CLI wisely, it is a good idea to use @@ -41,5 +41,15 @@ #define md_pause() __ASMV("rep; nop") /* (F3 90) PAUSE */ #define md_intoff() __ASMV("cli") /* Clear interrupts */ #define md_inton() __ASMV("sti") /* Enable interrupts */ +#define md_hlt() cpu_halt() /* Halt the processor */ + +/* + * AMD64 specific defines + */ +#define __invlpg(VA) \ + __ASMV("invlpg %0" \ + : \ + : "m" ((VA)) \ + : "memory") #endif /* !_AMD64_CDEFS_H_ */ diff --git a/sys/include/arch/amd64/cpu.h b/sys/include/arch/amd64/cpu.h index dd753b7..5adff29 100644 --- a/sys/include/arch/amd64/cpu.h +++ b/sys/include/arch/amd64/cpu.h @@ -33,18 +33,48 @@ #include <sys/types.h> #include <sys/cdefs.h> #include <sys/proc.h> +#include <sys/sched.h> +#include <sys/spinlock.h> #include <machine/tss.h> +#include <machine/cdefs.h> +#include <machine/intr.h> #define CPU_IRQ(IRQ_N) (BIT((IRQ_N)) & 0xFF) +/* Feature bits */ +#define CPU_FEAT_SMAP BIT(0) +#define CPU_FEAT_SMEP BIT(1) +#define CPU_FEAT_UMIP BIT(2) +#define CPU_FEAT_TSCINV BIT(3) /* TSC invariant */ + +/* CPU vendors */ +#define CPU_VENDOR_OTHER 0x00000000 +#define CPU_VENDOR_INTEL 0x00000001 +#define CPU_VENDOR_AMD 0x00000002 + +typedef uint32_t ipi_pend_t; + struct cpu_info { uint32_t apicid; + uint32_t feat; + uint32_t vendor; /* Vendor (see CPU_VENDOR_*) */ + uint8_t preempt : 1; /* CPU is preemptable */ + uint8_t ipi_dispatch : 1; /* 1: IPIs being dispatched */ + ipi_pend_t ipi_pending; + uint8_t id; /* MI Logical ID */ + uint8_t model : 4; /* CPU model number */ + uint8_t family : 4; /* CPU family ID */ uint8_t has_x2apic : 1; + uint8_t tlb_shootdown : 1; + uint8_t online : 1; /* CPU online */ uint8_t ipl; size_t lapic_tmr_freq; uint8_t irq_mask; + vaddr_t shootdown_va; + struct sched_cpu stat; struct tss_entry *tss; struct proc *curtd; + struct spinlock lock; struct cpu_info *self; }; @@ -52,9 +82,32 @@ __dead void cpu_halt_all(void); void cpu_halt_others(void); void cpu_startup(struct cpu_info *ci); +void cpu_enable_smep(void); +void cpu_disable_smep(void); + +struct cpu_info *cpu_get(uint32_t index); +struct sched_cpu *cpu_get_stat(uint32_t cpu_index); + +uint32_t cpu_count(void); +void cpu_shootdown_tlb(vaddr_t va); + struct cpu_info *this_cpu(void); void mp_bootstrap_aps(struct cpu_info *ci); extern struct cpu_info g_bsp_ci; +__always_inline static inline void +cpu_halt(void) +{ + struct cpu_info *ci = this_cpu(); + + if (ci != NULL) + ci->online = 0; + + __ASMV("hlt"); + + if (ci != NULL) + ci->online = 1; +} + #endif /* !_MACHINE_CPU_H_ */ diff --git a/sys/include/arch/amd64/frameasm.h b/sys/include/arch/amd64/frameasm.h index c6316a5..4dc075e 100644 --- a/sys/include/arch/amd64/frameasm.h +++ b/sys/include/arch/amd64/frameasm.h @@ -30,6 +30,8 @@ #ifndef _MACHINE_FRAMEASM_H_ #define _MACHINE_FRAMEASM_H_ +#define ALIGN_TEXT .align 8, 0x90 + /* * If the interrupt has an error code, this macro shall * be used to create the trapframe. diff --git a/sys/include/arch/amd64/gdt.h b/sys/include/arch/amd64/gdt.h index 55666a7..0c5faf1 100644 --- a/sys/include/arch/amd64/gdt.h +++ b/sys/include/arch/amd64/gdt.h @@ -4,18 +4,48 @@ #include <sys/types.h> #include <sys/cdefs.h> +#define GDT_TSS_INDEX 5 +#define GDT_ENTRY_COUNT 7 + +/* Segment selectors */ #define KERNEL_CS 0x08 #define KERNEL_DS 0x10 -#define USER_CS 0x18 -#define USER_DS 0x20 -#define GDT_TSS 5 +#define USER_CS 0x18 +#define USER_DS 0x20 + +/* + * Bit definitions for regular segment descriptors + * + * See Intel SPG 3/25 Section 3.4.5 - Segment Descriptors + */ + +#define GDT_ATTRIBUTE_ACCESSED BIT(0) /* Accessed */ +#define GDT_ATTRIBUTE_EXECUTABLE BIT(3) /* Executable */ +#define GDT_ATTRIBUTE_NONSYSTEM BIT(4) /* Code/data */ +#define GDT_ATTRIBUTE_PRESENT BIT(7) /* Present */ +#define GDT_ATTRIBUTE_64BIT_CODE BIT(13) /* 64-bit code */ +#define GDT_ATTRIBUTE_32BIT BIT(14) /* 32-bit code/data */ +#define GDT_ATTRIBUTE_GRANULARITY BIT(15) /* 4KiB limit granularity */ + +/* Attributes for executable segments */ +#define GDT_ATTRIBUTE_READABLE BIT(1) /* Readable */ +#define GDT_ATTRIBUTE_CONFORMING BIT(2) /* Conforming */ + +/* Attributes for non-executable segments */ +#define GDT_ATTRIBUTE_WRITABLE BIT(1) /* Writable */ +#define GDT_ATTRIBUTE_EXPANDS_DOWN BIT(2) /* See SPG 3/25 Section 6.8.1 */ + +/* DPL (Descriptor Privilege Level) specifier */ +#define GDT_ATTRIBUTE_DPL0 0 +#define GDT_ATTRIBUTE_DPL1 (1 << 5) +#define GDT_ATTRIBUTE_DPL2 (2 << 5) +#define GDT_ATTRIBUTE_DPL3 (3 << 5) struct __packed gdt_entry { uint16_t limit; uint16_t base_low; uint8_t base_mid; - uint8_t access; - uint8_t granularity; + uint16_t attributes; uint8_t base_hi; }; @@ -24,27 +54,28 @@ struct __packed gdtr { uintptr_t offset; }; +extern struct gdt_entry g_gdt_data[GDT_ENTRY_COUNT]; +extern const struct gdtr g_gdtr; + __always_inline static inline void -gdt_load(struct gdtr *gdtr) +gdt_load(void) { __ASMV("lgdt %0\n" - "push $8\n" /* Push CS */ - "lea 1f(%%rip), %%rax\n" /* Load 1 label address into RAX */ - "push %%rax\n" /* Push the return address (label 1) */ - "lretq\n" /* Far return to update CS */ + "push %1\n" /* Push code segment selector */ + "lea 1f(%%rip), %%rax\n" /* Load label 1 address into RAX */ + "push %%rax\n" /* Push return address (label 1) */ + "lretq\n" /* Far return to update CS */ "1:\n" - " mov $0x10, %%eax\n" - " mov %%eax, %%ds\n" - " mov %%eax, %%es\n" - " mov %%eax, %%fs\n" - " mov %%eax, %%gs\n" - " mov %%eax, %%ss\n" + " mov %2, %%ax\n" /* Load data segment selectors */ + " mov %%ax, %%ds\n" + " mov %%ax, %%es\n" + " mov %%ax, %%fs\n" + " mov %%ax, %%gs\n" + " mov %%ax, %%ss\n" : - : "m" (*gdtr) + : "m" (g_gdtr), "i"(KERNEL_CS), "i"(KERNEL_DS) : "rax", "memory" ); } -extern struct gdt_entry g_gdt_data[256]; - #endif /* !AMD64_GDT_H_ */ diff --git a/sys/include/arch/amd64/intr.h b/sys/include/arch/amd64/intr.h index c643945..6e011fa 100644 --- a/sys/include/arch/amd64/intr.h +++ b/sys/include/arch/amd64/intr.h @@ -35,6 +35,8 @@ #define IST_SCHED 1U #define IST_HW_IRQ 2U #define IST_SW_INT 3U +#define IST_SYSCALL 4U +#define IST_DBFLT 5U /* Upper 4 bits of interrupt vector */ #define IPL_SHIFT 4 @@ -47,11 +49,65 @@ #define IPL_CLOCK 2 /* Clock */ #define IPL_HIGH 3 /* Defer everything */ -struct intr_entry { +#define N_IPIVEC 4 /* Number of vectors reserved for IPIs */ +#define IPI_PER_VEC 16 /* Max IPIs per vector */ + +struct intr_hand; + +/* + * Contains information passed to driver + * + * @ihp: Interrupt handler + * @data: Driver specific data + */ +struct intr_data { + struct intr_hand *ihp; + union { + void *data; + uint64_t data_u64; + }; +}; + +/* + * Interrupt handler + * + * [r]: Required for intr_register() + * [o]: Not required for intr_register() + * [v]: Returned by intr_register() + * [i]: Internal + * + * @func: The actual handler [r] + * @data: Interrupt data [o/v] + * @nintr: Number of times it fired [o] + * @name: Interrupt name [v] + * @priority: Interrupt priority [r] + * @irq: Interrupt request number [o] + * @vector: Interrupt vector [v] + * + * XXX: `name' must be null terminated ('\0') + * + * XXX: `irq` can be set to -1 for MSI/MSI-X + * interrupts. + * + * XXX: `func` must be the first field in this + * structure so that it may be called through + * assembly. + * + * XXX: `ist' should usually be set to -1 but can be + * used if an interrupt requires its own stack. + */ +struct intr_hand { + int(*func)(void *); + size_t nintr; + struct intr_data data; + char *name; int priority; + int irq; + int vector; }; -int intr_alloc_vector(const char *name, uint8_t priority); +void *intr_register(const char *name, const struct intr_hand *ih); + int splraise(uint8_t s); void splx(uint8_t s); diff --git a/sys/include/arch/amd64/ipi.h b/sys/include/arch/amd64/ipi.h new file mode 100644 index 0000000..48243e7 --- /dev/null +++ b/sys/include/arch/amd64/ipi.h @@ -0,0 +1,67 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _MACHINE_IPI_H_ +#define _MACHINE_IPI_H_ + +#include <sys/types.h> +#include <machine/cpu.h> +#include <machine/lapic.h> + +/* + * IPI_VECTOR is the main vector used for all misc + * IPIs, the HALT_VECTOR is used to slam the system + * to a screetching halt. + */ +#define IPI_VECTOR 0x21 +#define HALT_VECTOR 0x22 + +/* Fixed IPI IDs */ +#define IPI_TLB 0 + +/* + * Represents an interprocessor interrupt + * handler. + * + * @cookie: Used to verifying an instance + * @id: IPI ID (identifies the IPI) + * @mask: If set, IPIs are ignored + * @handler: Handler routine + */ +struct cpu_ipi { + uint16_t cookie; + uint8_t id; + int(*handler)(struct cpu_ipi *ipi); +}; + +int md_ipi_alloc(struct cpu_ipi **res); +int md_ipi_send(struct cpu_info *ci, ipi_pend_t ipi); +void md_ipi_init(void); + +#endif /* !_MACHINE_IPI_H_ */ diff --git a/sys/include/arch/amd64/isa/i8042var.h b/sys/include/arch/amd64/isa/i8042var.h index ebd96ad..9619920 100644 --- a/sys/include/arch/amd64/isa/i8042var.h +++ b/sys/include/arch/amd64/isa/i8042var.h @@ -74,6 +74,10 @@ #define I8042_LED_NUM BIT(1) #define I8042_LED_CAPS BIT(2) +/* Extended scancode types */ +#define I8042_XSC_ENDPR 0 /* End pressed */ +#define I8042_XSC_ENDRL 1 /* End released */ + /* Quirks */ #define I8042_HOSTILE BIT(0) /* If EC likes throwing NMIs */ @@ -82,7 +86,5 @@ void i8042_quirk(int mask); /* Internal - do not use */ void i8042_sync(void); -void i8042_kb_isr(void); -void i8042_kb_event(void); #endif /* _I8042VAR_H_ */ diff --git a/sys/include/arch/amd64/param.h b/sys/include/arch/amd64/param.h new file mode 100644 index 0000000..6ea3fca --- /dev/null +++ b/sys/include/arch/amd64/param.h @@ -0,0 +1,35 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _AMD64_PARAM_H_ +#define _AMD64_PARAM_H_ + +#define M_WORD_SIZE 8 + +#endif /* !_AMD64_PARAM_H_ */ diff --git a/sys/include/arch/amd64/pci/pci.h b/sys/include/arch/amd64/pci/pci.h new file mode 100644 index 0000000..189a423 --- /dev/null +++ b/sys/include/arch/amd64/pci/pci.h @@ -0,0 +1,40 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _MACHINE_PCI_H_ +#define _MACHINE_PCI_H_ + +#include <sys/types.h> +#include <sys/cdefs.h> +#include <dev/pci/pci.h> + +__weak pcireg_t md_pci_readl(struct pci_device *dev, uint32_t off); +__weak void md_pci_writel(struct pci_device *dev, uint32_t off, pcireg_t val); + +#endif /* !_MACHINE_PCI_H_ */ diff --git a/sys/include/arch/amd64/tsc.h b/sys/include/arch/amd64/tsc.h new file mode 100644 index 0000000..d9eed4f --- /dev/null +++ b/sys/include/arch/amd64/tsc.h @@ -0,0 +1,55 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _MACHINE_TSC_H_ +#define _MACHINE_TSC_H_ + +#include <sys/types.h> +#include <sys/cdefs.h> +#include <sys/param.h> + +uint64_t rdtsc_rel(void); + +__always_inline static inline uint64_t +rdtsc(void) +{ + uint32_t lo, hi; + + __ASMV( + "rdtsc" + : "=d" (hi), + "=a" (lo) + : + : "memory" + ); + + return COMBINE32(hi, lo); +} + +#endif /* !_MACHINE_TSC_H_ */ diff --git a/sys/include/crypto/chacha20.h b/sys/include/crypto/chacha20.h new file mode 100644 index 0000000..267b13c --- /dev/null +++ b/sys/include/crypto/chacha20.h @@ -0,0 +1,46 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdint.h> +#include <stddef.h> +#include <string.h> + +#define ROTL(a,b) (((a) << (b)) | ((a) >> (32 - (b)))) + +#define QR(a,b,c,d) \ + a += b; d ^= a; d = ROTL(d, 16); \ + c += d; b ^= c; b = ROTL(b, 12); \ + a += b; d ^= a; d = ROTL(d, 8); \ + c += d; b ^= c; b = ROTL(b, 7); + +void chacha20_init(uint32_t state[16], const uint8_t key[32], + const uint8_t nonce[12], uint32_t counter); + +void chacha20_block(uint32_t state[16], uint8_t out[64]); +void chacha20_encrypt(uint32_t state[16], uint8_t *in, uint8_t *out, size_t len); diff --git a/sys/include/crypto/siphash.h b/sys/include/crypto/siphash.h new file mode 100644 index 0000000..ecabb4a --- /dev/null +++ b/sys/include/crypto/siphash.h @@ -0,0 +1,34 @@ +/* <MIT License> + Copyright (c) 2013 Marek Majkowski <marek@popcount.org> + + Permission is hereby granted, free of charge, to any person obtaining a copy + of this software and associated documentation files (the "Software"), to deal + in the Software without restriction, including without limitation the rights + to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + copies of the Software, and to permit persons to whom the Software is + furnished to do so, subject to the following conditions: + + The above copyright notice and this permission notice shall be included in + all copies or substantial portions of the Software. + + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + THE SOFTWARE. + </MIT License> + + Original location: + https://github.com/majek/csiphash/ + + Solution inspired by code from: + Samuel Neves (supercop/crypto_auth/siphash24/little) + djb (supercop/crypto_auth/siphash24/little2) + Jean-Philippe Aumasson (https://131002.net/siphash/siphash24.c) +*/ + +#include <stdint.h> + +uint64_t siphash24(const void *src, unsigned long src_sz, const char k[16]); diff --git a/sys/include/dev/acpi/tables.h b/sys/include/dev/acpi/tables.h index 5215c86..d31cbe0 100644 --- a/sys/include/dev/acpi/tables.h +++ b/sys/include/dev/acpi/tables.h @@ -118,6 +118,43 @@ struct __packed acpi_gas { uint64_t address; }; +/* + * ACPI Address Space ID definitions for GAS + * + * See section 5.2.3.2 of the ACPI software programming + * manual. + * + * XXX: 0x0B->0x7E is reserved as well as 0x80->0xBF + * and 0xC0->0xFF is OEM defined. Values other than + * the ones specified below are either garbage or + * OEM specific values. + */ +#define ACPI_GAS_SYSMEM 0x00 /* System memory space */ +#define ACPI_GAS_SYSIO 0x01 /* System I/O space */ +#define ACPI_GAS_PCICONF 0x02 /* PCI configuration space */ +#define ACPI_GAS_EC 0x03 /* Embedded controller */ +#define ACPI_GAS_SMBUS 0x04 /* System management bus */ +#define ACPI_GAS_CMOS 0x05 /* System CMOS */ +#define ACPI_GAS_PCIBAR 0x06 /* PCI BAR target */ +#define ACPI_GAS_IPMI 0x07 /* IPMI (sensor monitoring) */ +#define ACPI_GAS_GPIO 0x08 /* General Purpose I/O */ +#define ACPI_GAS_GSBUS 0x09 /* GenericSerialBus */ +#define ACPI_GAS_PLATCOM 0x0A /* Platform Communications Channel */ + +/* + * ACPI address size definitions for GAS + * + * See section 5.2.3.2 of the ACPI software programming + * manual. + * + * This is really retarded Intel and Microsoft, thank you. + */ +#define ACPI_GAS_UNDEF 0 /* Undefined (legacy reasons) */ +#define ACPI_GAS_BYTE 1 /* Byte access */ +#define ACPI_GAS_WORD 2 /* Word access */ +#define ACPI_GAS_DWORD 3 /* Dword access */ +#define ACPI_GAS_QWORD 4 /* Qword access */ + struct __packed acpi_hpet { struct acpi_header hdr; uint8_t hardware_rev_id; @@ -132,4 +169,65 @@ struct __packed acpi_hpet { uint8_t page_protection; }; +/* + * PCIe / ACPI MCFG base address description + * table. + * + * @base_pa: Enhanced configuration base [physical] + * @seg_grpno: PCI segment group number + * @bus_start: Host bridge bus start + * @bus_end: Host bridge bus end + */ +struct __packed acpi_mcfg_base { + uint64_t base_pa; + uint16_t seg_grpno; + uint8_t bus_start; + uint8_t bus_end; + uint32_t reserved; +}; + +/* + * PCIe / ACPI MCFG structure + * + * @hdr: ACPI header + * @reserved: Do not use + * @base: ECAM MMIO address list + */ +struct __packed acpi_mcfg { + struct acpi_header hdr; + uint32_t reserved[2]; + struct acpi_mcfg_base base[1]; +}; + +struct __packed dmi_entry32 { + char signature[4]; /* _SM_ */ + uint8_t checksum; /* Sum of table bytes */ + uint8_t length; /* Length of entry table */ + uint8_t major; /* DMI major */ + uint8_t minor; /* DMI minor */ + uint16_t max_size; /* Max structure size */ + uint8_t rev; /* Entry revision */ + char fmt_area[5]; /* Formatted area */ + char isignature[5]; /* Intermediate signature */ + uint8_t ichecksum; /* Intermediate checksum */ + uint16_t table_len; /* Length of SMBIOS structure table */ + uint32_t addr; /* 32-bit physical start of SMBIOS structure table */ + uint16_t nstruct; /* Total number of structures */ + uint8_t bcd_rev; +}; + +struct __packed dmi_entry64 { + char signature[5]; /* _SM_ */ + uint8_t checksum; /* Sum of table bytes */ + uint8_t length; /* Length of entry table */ + uint8_t major; /* DMI major */ + uint8_t minor; /* DMI minor */ + uint8_t docrev; + uint8_t entry_rev; + uint8_t reserved; + uint16_t max_size; /* Max structure size */ + uint16_t padding; + uint64_t addr; /* 64-bit physical address */ +}; + #endif /* _ACPI_TABLES_H_ */ diff --git a/sys/include/dev/acpi/uacpi/uacpi/internal/namespace.h b/sys/include/dev/acpi/uacpi/uacpi/internal/namespace.h index 369c5a4..045e402 100644 --- a/sys/include/dev/acpi/uacpi/uacpi/internal/namespace.h +++ b/sys/include/dev/acpi/uacpi/uacpi/internal/namespace.h @@ -42,7 +42,6 @@ void uacpi_deinitialize_namespace(void); uacpi_namespace_node *uacpi_namespace_node_alloc(uacpi_object_name name); void uacpi_namespace_node_unref(uacpi_namespace_node *node); - uacpi_status uacpi_namespace_node_type_unlocked( const uacpi_namespace_node *node, uacpi_object_type *out_type ); diff --git a/sys/include/dev/acpi/uacpi/uacpi/platform/config.h b/sys/include/dev/acpi/uacpi/uacpi/platform/config.h index dff043f..b594338 100644 --- a/sys/include/dev/acpi/uacpi/uacpi/platform/config.h +++ b/sys/include/dev/acpi/uacpi/uacpi/platform/config.h @@ -67,7 +67,6 @@ UACPI_BUILD_BUG_ON_WITH_MSG( */ // #define UACPI_SIZED_FREES - /* * Makes uacpi_kernel_alloc_zeroed mandatory to implement by the host, uACPI * will not provide a default implementation if this is enabled. diff --git a/sys/include/dev/acpi/uacpi/uacpi/utilities.h b/sys/include/dev/acpi/uacpi/uacpi/utilities.h index dfc41c3..d7042e9 100644 --- a/sys/include/dev/acpi/uacpi/uacpi/utilities.h +++ b/sys/include/dev/acpi/uacpi/uacpi/utilities.h @@ -128,7 +128,6 @@ uacpi_status uacpi_eval_cls(uacpi_namespace_node*, uacpi_id_string **out_id); */ uacpi_status uacpi_eval_uid(uacpi_namespace_node*, uacpi_id_string **out_uid); - // uacpi_namespace_node_info->flags #define UACPI_NS_NODE_INFO_HAS_ADR (1 << 0) #define UACPI_NS_NODE_INFO_HAS_HID (1 << 1) diff --git a/sys/include/dev/cons/ansi.h b/sys/include/dev/cons/ansi.h new file mode 100644 index 0000000..7a336d1 --- /dev/null +++ b/sys/include/dev/cons/ansi.h @@ -0,0 +1,75 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _CONS_ANSI_H_ +#define _CONS_ANSI_H_ + +#include <sys/types.h> +#include <sys/cdefs.h> +#include <sys/param.h> + +/* ANSI colors */ +#define ANSI_BLACK 0x000000 +#define ANSI_RED 0xAA0000 +#define ANSI_GREEN 0x00AA00 +#define ANSI_BLUE 0x00007F +#define ANSI_YELLOW 0xAA5500 +#define ANSI_MAGENTA 0xAA00AA +#define ANSI_CYAN 0x00AAAA +#define ANSI_WHITE 0xAAAAAA + +/* ANSI_FEED update codes */ +#define ANSI_UPDATE_COLOR -1 +#define ANSI_UPDATE_CURSOR -2 + +/* + * ANSI parser state machine. + * + * @prev: Previous char + * @csi: Encountered control seq introducer + * @reset_color: 1 if color is to be reset + * @set_fg: 1 if fg is being set + * @set_bg: 1 if bg is being set + * @fg: Foreground color + * @bg: Background color + * @flags: State flags + */ +struct ansi_state { + char prev; + uint8_t csi : 2; + uint8_t reset_color : 1; + uint8_t set_fg : 1; + uint8_t set_bg : 1; + uint32_t fg; + uint32_t bg; +}; + +int ansi_feed(struct ansi_state *statep, char c); + +#endif /* !_CONS_ANSI_H_ */ diff --git a/sys/include/dev/cons/cons.h b/sys/include/dev/cons/cons.h index 3569c52..7c4e41a 100644 --- a/sys/include/dev/cons/cons.h +++ b/sys/include/dev/cons/cons.h @@ -32,8 +32,12 @@ #include <sys/types.h> #include <sys/spinlock.h> +#include <sys/proc.h> +#include <sys/mutex.h> +#include <sys/console.h> #include <dev/video/fbdev.h> #include <dev/cons/consvar.h> +#include <dev/cons/ansi.h> struct cons_char { char c; @@ -45,6 +49,11 @@ struct cons_char { struct cons_screen { struct fbdev fbdev; + struct ansi_state ansi_s; + struct console_feat feat; /* Features */ + struct console_attr attr; /* Attributes */ + struct proc *atproc; /* Attached proc */ + struct mutex *atproc_lock; uint32_t fg; uint32_t bg; @@ -54,17 +63,25 @@ struct cons_screen { uint32_t ncols; uint32_t ch_col; /* Current col */ uint32_t ch_row; /* Current row */ - uint32_t curs_col; /* Cursor col */ - uint32_t curs_row; /* Cursor row */ struct cons_buf *ib; /* Input buffer */ struct cons_buf **ob; /* Output buffers */ struct cons_char last_chr; struct spinlock lock; }; +#define curs_col attr.cursor_x +#define curs_row attr.cursor_y + void cons_init(void); void cons_expose(void); +void cons_update_color(struct cons_screen *scr, uint32_t fg, uint32_t bg); +void cons_clear_scr(struct cons_screen *scr, uint32_t bg); +void cons_reset_color(struct cons_screen *scr); +void cons_reset_cursor(struct cons_screen *scr); +int cons_attach(void); +int cons_detach(void); int cons_putch(struct cons_screen *scr, char c); +int cons_putstr(struct cons_screen *scr, const char *s, size_t len); extern struct cons_screen g_root_scr; diff --git a/sys/include/dev/dmi/dmi.h b/sys/include/dev/dmi/dmi.h new file mode 100644 index 0000000..8b7030c --- /dev/null +++ b/sys/include/dev/dmi/dmi.h @@ -0,0 +1,42 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _DMI_DMI_H_ +#define _DMI_DMI_H_ + +#include <sys/types.h> + +const char *dmi_vendor(void); +const char *dmi_prodver(void); +const char *dmi_prodfam(void); +const char *dmi_product(void); +const char *dmi_cpu_manufact(void); +const char *dmi_cpu_version(void); + +#endif /* !_DMI_DMI_H_ */ diff --git a/sys/include/dev/dmi/dmivar.h b/sys/include/dev/dmi/dmivar.h new file mode 100644 index 0000000..e5da92f --- /dev/null +++ b/sys/include/dev/dmi/dmivar.h @@ -0,0 +1,41 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _DEV_DMIVAR_H_ +#define _DEV_DMIVAR_H_ + +#include <sys/types.h> +#include <sys/sio.h> +#include <fs/ctlfs.h> + +extern struct ctlops g_ctl_board_ident; + +int dmi_board_ctl_read(struct ctlfs_dev *cdp, struct sio_txn *sio); + +#endif /* !_DEV_DMIVAR_H_ */ diff --git a/sys/include/dev/ic/ahciregs.h b/sys/include/dev/ic/ahciregs.h index f959a1e..232b41e 100644 --- a/sys/include/dev/ic/ahciregs.h +++ b/sys/include/dev/ic/ahciregs.h @@ -88,6 +88,7 @@ struct hba_memspace { */ #define AHCI_PXSSTS_DET(SSTS) (SSTS & 0xF) #define AHCI_PXSSTS_IPM(SSTS) ((SSTS >> 8) & 0xF) +#define AHCI_PXSSTS_SPD(SSTS) ((SSTS >> 4) & 0xF) /* * Port SATA control bits @@ -100,6 +101,7 @@ struct hba_memspace { * See section 3.3.7 of the AHCI spec. */ #define AHCI_PXCMD_ST BIT(0) /* Start */ +#define AHCI_PXCMD_SUD BIT(1) /* Spin-up device */ #define AHCI_PXCMD_FRE BIT(4) /* FIS Receive Enable */ #define AHCI_PXCMD_FR BIT(14) /* FIS Receive Running */ #define AHCI_PXCMD_CR BIT(15) /* Command List Running */ @@ -137,6 +139,9 @@ struct hba_memspace { #define AHCI_DET_PRESENT 1 /* Device present (no PHY comm) */ #define AHCI_DET_COMM 3 /* Device present and phy comm established */ #define AHCI_IPM_ACTIVE 1 +#define AHCI_SPD_GEN1 1 /* 1.5 Gb/s */ +#define AHCI_SPD_GEN2 2 /* 3 Gb/s */ +#define AHCI_SPD_GEN3 3 /* 6 Gb/s */ /* * PxSERR bits @@ -158,6 +163,8 @@ struct hba_memspace { #define AHCI_DIAG_T BIT(24) /* Transport state transition error */ #define AHCI_DIAG_F BIT(25) /* Unknown FIS type */ +#define ATAPI_SIG 0xEB140101 + /* * Device detection initialization values * See section 3.3.11 of the AHCI spec. diff --git a/sys/include/dev/ic/ahcivar.h b/sys/include/dev/ic/ahcivar.h index fa24812..67f2efe 100644 --- a/sys/include/dev/ic/ahcivar.h +++ b/sys/include/dev/ic/ahcivar.h @@ -33,9 +33,12 @@ #include <sys/param.h> #include <sys/types.h> #include <sys/device.h> +#include <dev/dcdr/cache.h> #include <dev/ic/ahciregs.h> #include <fs/ctlfs.h> +#define AHCI_DCDR_CAP 16 + struct ahci_cmd_hdr; extern const struct ctlops g_sata_bsize_ops; @@ -93,6 +96,7 @@ struct ahci_hba { * @io: Memory mapped port registers * @hba: HBA descriptor * @cmdlist: Command list [p] + * @nlba: Max number of addressable blocks * @fra: FIS receive area [p] * @dev: Device minor number. */ @@ -100,6 +104,8 @@ struct hba_device { struct hba_port *io; struct ahci_hba *hba; struct ahci_cmd_hdr *cmdlist; + struct dcdr *dcdr; + uint32_t nlba; void *fra; dev_t dev; }; diff --git a/sys/include/dev/ic/nvmevar.h b/sys/include/dev/ic/nvmevar.h index eab8b52..f361d0a 100644 --- a/sys/include/dev/ic/nvmevar.h +++ b/sys/include/dev/ic/nvmevar.h @@ -31,9 +31,11 @@ #define _IC_NVMEVAR_H_ #include <sys/types.h> +#include <sys/cdefs.h> /* Admin commands */ #define NVME_OP_CREATE_IOSQ 0x01 +#define NVME_OP_GET_LOGPAGE 0x02 #define NVME_OP_CREATE_IOCQ 0x05 #define NVME_OP_IDENTIFY 0x06 @@ -45,6 +47,67 @@ #define NVME_OP_WRITE 0x01 #define NVME_OP_READ 0x02 +/* Log page identifiers */ +#define NVME_LOGPAGE_SMART 0x02 + +/* + * S.M.A.R.T health / information log + * + * See section 5.16.1.3, figure 207 of the + * NVMe base spec (rev 2.0a) + * + * @cwarn: Critical warning + * @temp: Composite tempature (kelvin) + * @avail_spare: Available spare (in percentage) + * @avail_spare_thr: Available spare threshold + * @percent_used: Estimate NVMe life used percentage + * @end_cwarn: Endurance group critical warning summary + * @data_units_read: Number of 512 byte data units read + * @data_units_written: Number of 512 byte data units written + * @host_reads: Number of host read commands completed + * @host_writes: Number of host write commands completed + * @ctrl_busy_time: Controller busy time + * @power_cycles: Number of power cycles + * @power_on_hours: Number of power on hours + * @unsafe_shutdowns: Number of unsafe shutdowns + * @media_errors: Media and data integrity errors + * @n_errlog_entries: Number of error log info entries + * @warning_temp_time: Warning composite tempature time + * @critical_comp_time: Critical composite tempature time + * @temp_sensor: Tempature sensor <n> data + * @temp1_trans_cnt: Tempature 1 transition count + * @temp2_trans_cnt: Tempature 2 transition count + * @temp1_total_time: Total time for tempature 1 + * @temp2_total_time: Total time for tempature 2 + */ +struct __packed nvme_smart_data { + uint8_t cwarn; + uint16_t temp; + uint8_t avail_spare; + uint8_t avail_spare_thr; + uint8_t percent_used; + uint8_t end_cwarn; + uint8_t reserved[25]; + uint8_t data_units_read[16]; + uint8_t data_units_written[16]; + uint8_t host_reads[16]; + uint8_t host_writes[16]; + uint8_t ctrl_busy_time[16]; + uint8_t power_cycles[16]; + uint8_t power_on_hours[16]; + uint8_t unsafe_shutdowns[16]; + uint8_t media_errors[16]; + uint8_t n_errlog_entries[16]; + uint32_t warning_temp_time; + uint32_t critical_comp_time; + uint16_t temp_sensor[8]; + uint32_t temp1_trans_cnt; + uint32_t temp2_trans_cnt; + uint32_t temp1_total_time; + uint32_t temp2_total_time; + uint8_t reserved1[280]; +}; + struct nvme_identify_cmd { uint8_t opcode; uint8_t flags; @@ -98,6 +161,26 @@ struct nvme_create_iosq_cmd { uint64_t unused3[2]; }; +/* Get log page */ +struct nvme_get_logpage_cmd { + uint8_t opcode; + uint8_t flags; + uint16_t cid; + uint32_t nsid; + uint64_t unused[2]; + uint64_t prp1; + uint64_t prp2; + uint8_t lid; + uint8_t lsp; + uint16_t numdl; + uint16_t numdu; + uint16_t lsi; + uint64_t lpo; + uint8_t unused1[3]; + uint8_t csi; + uint32_t unused2; +}; + /* Read/write */ struct nvme_rw_cmd { uint8_t opcode; @@ -117,12 +200,12 @@ struct nvme_rw_cmd { uint16_t appmask; }; - struct nvme_cmd { union { struct nvme_identify_cmd identify; struct nvme_create_iocq_cmd create_iocq; struct nvme_create_iosq_cmd create_iosq; + struct nvme_get_logpage_cmd get_logpage; struct nvme_rw_cmd rw; }; }; diff --git a/sys/include/dev/mii/mii.h b/sys/include/dev/mii/mii.h new file mode 100644 index 0000000..5d77281 --- /dev/null +++ b/sys/include/dev/mii/mii.h @@ -0,0 +1,57 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _DEV_MII_H_ +#define _DEV_MII_H_ + +#include <sys/param.h> + +/* + * MII registers + */ +#define MII_BMCR 0x00 /* Basic Mode Config */ +#define MII_BMSR 0x01 /* Basic Mode Status */ +#define MII_PHYID 0x02 /* MII PHY identifier 1 */ +#define MII_PHYID2 0x03 /* MII PHY identifier 2 */ +#define MII_ADVER 0x04 /* Auto-negotiation advertisement */ +#define MII_LPA 0x05 /* Link parter abilities */ +#define MII_EXPAN 0x06 /* Auto-negotiation expansion */ +#define MII_ESTATUS 0x0F /* Extended status register */ +#define MII_IRQ 0x1B /* Interrupt control/status */ + +/* + * MII BMCR bits + */ +#define MII_BMCR_RST BIT(15) /* PHY reset */ +#define MII_BCMR_LOOP BIT(14) /* Loopback mode enable */ +#define MII_BMCR_ANEN BIT(12) /* Auto-negotiation enable */ +#define MII_PWR_DOWN BIT(11) /* Power down PHY */ +#define MII_ISOLATE BIT(10) /* Electrically isolate PHY from MII */ + +#endif /* !_DEV_MII_H_ */ diff --git a/sys/include/dev/pci/pci.h b/sys/include/dev/pci/pci.h index de6d8fb..144b500 100644 --- a/sys/include/dev/pci/pci.h +++ b/sys/include/dev/pci/pci.h @@ -62,6 +62,7 @@ struct pci_device { uint8_t pci_subclass; uint8_t prog_if; uint8_t hdr_type; + uint8_t pci_express : 1; uint8_t pri_bus; uint8_t sec_bus; @@ -75,7 +76,7 @@ struct pci_device { struct msi_intr { const char *name; - void(*handler)(void *); + int(*handler)(void *); }; pcireg_t pci_readl(struct pci_device *dev, uint32_t offset); diff --git a/sys/include/dev/phy/e1000regs.h b/sys/include/dev/phy/e1000regs.h new file mode 100644 index 0000000..7caceee --- /dev/null +++ b/sys/include/dev/phy/e1000regs.h @@ -0,0 +1,119 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _PHY_E1000_REGS_H_ +#define _PHY_E1000_REGS_H_ + +#include <sys/types.h> +#include <sys/param.h> + +/* + * E1000 register offsets + * + * XXX: Notes about reserve fields: + * + * - The `EERD' register is reserved and should NOT be touched + * for the 82544GC/EI card. + * + * - The `FLA' register is only usable for the 82541xx and + * 82547GI/EI cards, this is reserved and should NOT be + * touched on any other cards. + * + * - The `TXCW' and `RXCW' registers are reserved and should NOT + * be touched for the 82540EP/EM, 82541xx and 82547GI/EI cards. + * + * - The `LEDCTL' register is reserved and should NOT be touched + * for the 82544GC/EI card. + */ +#define E1000_CTL 0x00000 /* Control register */ +#define E1000_STATUS 0x00008 /* Status register */ +#define E1000_EECD 0x00010 /* EEPROM/flash control and data register */ +#define E1000_EERD 0x00014 /* EEPROM/flash read register */ +#define E1000_FLA 0x0001C /* EEPROM/flash read register */ +#define E1000_CTRL_EXT 0x00018 /* Extended device control register */ +#define E1000_MDIC 0x00020 /* PHY management data interface control register */ +#define E1000_FCAL 0x00028 /* Flow control low register */ +#define E1000_FCAH 0x0002C /* Flow control high register */ +#define E1000_FCT 0x00030 /* Flow control type register */ +#define E1000_VET 0x00038 /* VLAN ethertype register */ +#define E1000_FCTTV 0x00170 /* Flow control transmit timer value register */ +#define E1000_TXCW 0x00178 /* Transmit config word register */ +#define E1000_RXCW 0x00180 /* Receive config word register */ +#define E1000_LEDCTL 0x00E00 /* LED control register */ + +/* + * Device control register (`ctl') bits + * + * See section 13.4.1 of the PCI/PCI-X Intel Gigabit + * Ethernet Controllers spec + * + * XXX: Notes about reserved bits: + * + * - The CTL.LRST bit is reserved and should NOT be touched + * for the 82540EP/EM, 82541xx, or 82547GI/EI cards. + */ +#define E1000_CTL_FD BIT(0) /* Full-duplex */ +#define E1000_CTL_LRST BIT(3) /* Link-reset */ +#define E1000_CTL_RST BIT(26) /* Device reset */ + +/* + * EEPROM/flash control and data register (`eecd') + * bits + * + * See section 13.4.3 of the PCI/PCI-X Intel Gigabit + * Ethernet controller spec + */ +#define E1000_EECD_SK BIT(0) /* EEPROM clock input */ +#define E1000_EECD_CS BIT(1) /* EEPROM chip select */ +#define E1000_EECD_DI BIT(2) /* EEPROM data input */ +#define E1000_EECD_DO BIT(3) /* EEPROM data output */ +#define E1000_EECD_FWE BIT(4) /* EEPROM flash write enable ctl (4:5) */ +#define E1000_EECD_REQ BIT(6) /* Request EEPROM access */ +#define E1000_EECD_GNT BIT(7) /* Grant EEPROM access */ +#define E1000_EECD_PRES BIT(8) /* EEPROM present */ +#define E1000_EECD_SIZE BIT(9) /* EEPROM size (1024-bit [0], 4096-bit [1]) */ +#define E1000_EECD_TYPE BIT(13) /* EEPROM type (microwire [0], SPI [1]) */ + +/* + * EEPROM read (`eerd') register bits + * + * See section 13.4.4 of the PCI/PCI-X Intel Gigabit + * Ethernet controller spec + */ +#define E1000_EERD_START BIT(0) /* Start read */ +#define E1000_EERD_DONE BIT(4) /* EEPROM read finished */ + +/* + * EEPROM word addresses + */ +#define E1000_HWADDR0 0x00 /* Word 0 */ +#define E1000_HWADDR1 0x01 /* Word 1 */ +#define E1000_HWADDR2 0x02 /* Word 2 */ + +#endif /* !_PHY_E1000_REGS_H_ */ diff --git a/sys/include/dev/phy/et131xregs.h b/sys/include/dev/phy/et131xregs.h new file mode 100644 index 0000000..1f8bfcb --- /dev/null +++ b/sys/include/dev/phy/et131xregs.h @@ -0,0 +1,275 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* + * Please refer to share/docs/hw/et131x.txt + */ + +#ifndef _PHYS_ET131XREGS_H_ +#define _PHYS_ET131XREGS_H_ + +#include <sys/types.h> + +#define MAC_CFG1_SOFTRST 0x80000000 /* Soft reset */ +#define MAC_CFG1_SIMRST 0x40000000 /* SIM reset */ +#define MAC_CFG1_RESET_RXMC 0x00080000 /* RX MC reset */ +#define MAC_CFG1_RESET_TXMC 0x00040000 /* TX MC reset */ +#define MAC_CFG1_RESET_RXFUNC 0x00020000 /* RX func reset */ +#define MAC_CFG1_RESET_TXFUNC 0x00010000 /* TX func reset */ + +#define PAD_N(N, NAME) uint8_t (NAME)[(N)] + +/* + * ET131X global registers + */ +struct global_regs { + uint32_t txq_start; + uint32_t txq_end; + uint32_t rxq_start; + uint32_t rxq_end; + uint32_t pm_csr; + uint32_t unused; + uint32_t istat; + uint32_t imask; + uint32_t ialias_clr_en; + uint32_t istat_alias; + uint32_t sw_reset; + uint32_t slv_timer; + uint32_t msi_config; + uint32_t loopback; + uint32_t watchdog_timer; +}; + +/* + * ET131X TX DMA registers + */ +struct txdma_regs { + uint32_t csr; + uint32_t pr_base_hi; + uint32_t pr_base_lo; + uint32_t pr_num_des; + uint32_t txq_wr_addr; + uint32_t txq_wr_addr_ext; + uint32_t txq_rd_addr; + uint32_t dma_wb_base_hi; + uint32_t dma_wb_base_lo; + uint32_t service_request; + uint32_t service_complete; + uint32_t cache_rd_index; + uint32_t cache_wr_index; + uint32_t tx_dma_error; + uint32_t des_abort_cnt; + uint32_t payload_abort_cnt; + uint32_t wb_abort_cnt; + uint32_t des_timeout_cnt; + uint32_t payload_timeout_cnt; + uint32_t wb_timeout_cnt; + uint32_t des_error_cnt; + uint32_t payload_err_cnt; + uint32_t wb_error_cnt; + uint32_t dropped_tlp_cnt; + uint32_t new_service_complete; + uint32_t ether_pkt_cnt; +}; + +/* + * ET131X RX DMA registers + */ +struct rxdma_regs { + uint32_t csr; + uint32_t dma_wb_base_lo; + uint32_t dma_wb_base_hi; + uint32_t num_pkt_done; + uint32_t max_pkt_time; + uint32_t rxq_rd_addr; + uint32_t rxq_rd_addr_ext; + uint32_t rxq_wr_addr; + uint32_t psr_base_lo; + uint32_t psr_base_hi; + uint32_t psr_num_des; + uint32_t psr_avail_offset; + uint32_t psr_full_offset; + uint32_t psr_access_index; + uint32_t psr_min_des; + uint32_t fbr0_base_lo; + uint32_t fbr0_base_hi; + uint32_t fbr0_num_des; + uint32_t fbr0_avail_offset; + uint32_t fbr0_full_offset; + uint32_t fbr0_rd_index; + uint32_t fbr0_min_des; + uint32_t fbr1_base_lo; + uint32_t fbr1_base_hi; + uint32_t fbr1_num_des; + uint32_t fbr1_avail_offset; + uint32_t fbr1_full_offset; + uint32_t fbr1_rd_index; + uint32_t fbr1_min_des; +}; + +/* + * ET131X TX MAC registers + */ +struct txmac_regs { + uint32_t ctl; + uint32_t shadow_ptr; + uint32_t err_cnt; + uint32_t max_fill; + uint32_t cf_param; + uint32_t tx_test; + uint32_t err; + uint32_t err_int; + uint32_t bp_ctrl; +}; + +/* + * ET131X RX MAC registers + */ +struct rxmac_regs { + uint32_t ctrl; + uint32_t crc0; + uint32_t crc12; + uint32_t crc34; + uint32_t sa_lo; + uint32_t sa_hi; + uint32_t mask0_word0; + uint32_t mask0_word1; + uint32_t mask0_word2; + uint32_t mask0_word3; + uint32_t mask1_word0; + uint32_t mask1_word1; + uint32_t mask1_word2; + uint32_t mask1_word3; + uint32_t mask2_word0; + uint32_t mask2_word1; + uint32_t mask2_word2; + uint32_t mask2_word3; + uint32_t mask3_word0; + uint32_t mask3_word1; + uint32_t mask3_word2; + uint32_t mask3_word3; + uint32_t mask4_word0; + uint32_t mask4_word1; + uint32_t mask4_word2; + uint32_t mask4_word3; + uint32_t uni_pf_addr1; + uint32_t uni_pf_addr2; + uint32_t uni_pf_addr3; + uint32_t multi_hash1; + uint32_t multi_hash2; + uint32_t multi_hash3; + uint32_t multi_hash4; + uint32_t pf_ctrl; + uint32_t mcif_ctrl_max_seg; + uint32_t mcif_water_mark; + uint32_t rxq_diag; + uint32_t space_avail; + uint32_t mif_ctrl; + uint32_t err_reg; +}; + +struct mac_regs { + uint32_t cfg1; + uint32_t cfg2; + uint32_t ipg; + uint32_t hfdp; + uint32_t max_fm_len; + uint32_t rsv1; + uint32_t rsv2; + uint32_t mac_test; + uint32_t mii_mgmt_cfg; + uint32_t mii_mgmt_cmd; + uint32_t mii_mgmt_addr; + uint32_t mii_mgmt_ctrl; + uint32_t mii_mgmt_stat; + uint32_t mii_mgmt_indicator; + uint32_t if_ctrl; + uint32_t if_stat; + uint32_t station_addr_1; + uint32_t station_addr_2; +}; + +/* Global reset */ +#define GBL_RESET_ALL 0x007F + +/* MII management address */ +#define MAC_MII_ADDR(PHY, REG) ((PHY) << 8 | (REG)) + +/* MAC management indications */ +#define MAC_MGMT_BUSY 0x00000001 +#define MAC_MGMT_WAIT 0x00000005 + +/* MAC management config values */ +#define MAC_MIIMGMT_CLK_RST 0x00007 + +/* LED register defines */ +#define PHY_LED2 0x1C + +/* PCI config space offsets */ +#define PCI_EEPROM_STATUS 0xB2 +#define PCI_MAC_ADDRESS 0xA4 + +/* + * LED control register 2 values + */ +#define LED_BLINK 0xD +#define LED_ON 0xE +#define LED_OFF 0xF +#define LED_ALL_OFF 0xFFFF + +/* + * LED register bit-shift constants + * + * Bits [3:0]: 100BASE-T LED + * Bits [7:4]: 100BASE-TX LED + * Bits [11:8]: TX/RX LED + * Bits [15:12]: Link LED + */ +#define LED_TXRX_SHIFT 8 +#define LED_LINK_SHIFT 12 + +struct et131x_iospace { +#define _IO_PAD(NAME, REGSET) uint8_t NAME[4096 - sizeof(struct REGSET)] + struct global_regs global; + _IO_PAD(global_pad, global_regs); + struct txdma_regs txdma; + _IO_PAD(txdma_pad, txdma_regs); + struct rxdma_regs rxdma; + _IO_PAD(rxdma_pad, rxdma_regs); + struct txmac_regs txmac; + _IO_PAD(txmac_pad, txmac_regs); + struct rxmac_regs rxmac; + _IO_PAD(rxmac_pad, rxmac_regs); + struct mac_regs mac; + _IO_PAD(mac_pad, mac_regs); + /* ... TODO - add more */ +#undef _IO_PAD +}; + +#endif /* !_PHYS_ET131XREGS_H_ */ diff --git a/sys/include/dev/phy/rt8139.h b/sys/include/dev/phy/rtl.h index 21c7d54..f3178d0 100644 --- a/sys/include/dev/phy/rt8139.h +++ b/sys/include/dev/phy/rtl.h @@ -71,6 +71,9 @@ #define RT_AS_LPAR 0x68 /* Auto-negotiation link partner reg (16 bits) */ #define RT_AS_EXPANSION 0x6A /* Auto-negotiation expansion reg (16 bits) */ +#define RT_TXAD_N(N) (RT_TXADDR0 + (N)) +#define RT_TXSTATUS_N(N) (RT_TXSTATUS0 + ((N))) + /* Command register bits */ #define RT_BUFEN BIT(0) /* Buffer empty */ #define RT_TE BIT(2) /* Transmitter enable */ diff --git a/sys/include/dev/random/entropy.h b/sys/include/dev/random/entropy.h new file mode 100644 index 0000000..34d86df --- /dev/null +++ b/sys/include/dev/random/entropy.h @@ -0,0 +1,40 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdint.h> + +#define ENTROPY_POOL_SIZE 32 + +struct entropy_pool { + uint8_t pool[ENTROPY_POOL_SIZE]; + uint32_t entropy_bits; +}; + +void mix_entropy(struct entropy_pool *ep, const uint8_t *input, + size_t input_len, uint32_t input_entropy_bits); diff --git a/sys/include/dev/timer.h b/sys/include/dev/timer.h index e54adcc..2ca6d62 100644 --- a/sys/include/dev/timer.h +++ b/sys/include/dev/timer.h @@ -31,11 +31,15 @@ #define _DEV_TIMER_H_ #include <sys/types.h> +#include <sys/param.h> /* Timer IDs */ #define TIMER_SCHED 0x00000000U /* Scheduler reserved timer */ #define TIMER_GP 0x00000001U /* General purpose timer */ +/* Timer flags */ +#define TIMER_MONOTONIC BIT(0) + /* Number of timer IDs, adjust when adding timer IDs */ #define TIMER_ID_COUNT 2 @@ -69,6 +73,7 @@ struct timer { const char *name; /* e.g "HPET" */ size_t(*calibrate)(void); /* Returns frequency, 0 for unspecified */ size_t(*get_time_usec)(void); /* Time since init (microseconds) */ + size_t(*get_time_nsec)(void); /* Time since init (nanoseconds) */ size_t(*get_time_sec)(void); /* Time since init (seconds) */ int(*msleep)(size_t ms); int(*usleep)(size_t us); @@ -78,6 +83,7 @@ struct timer { void(*oneshot_ms)(size_t ms); void(*oneshot_us)(size_t ms); void(*stop)(void); + uint8_t flags; }; tmrr_status_t register_timer(timer_id_t id, const struct timer *tmr); diff --git a/sys/include/dev/usb/xhciregs.h b/sys/include/dev/usb/xhciregs.h index 69515e4..cafd7c9 100644 --- a/sys/include/dev/usb/xhciregs.h +++ b/sys/include/dev/usb/xhciregs.h @@ -77,6 +77,7 @@ struct xhci_opregs { /* USBSTS bits */ #define USBSTS_HCH BIT(0) /* HC halted */ +#define USBSTS_CNR BIT(11) /* Controller not ready */ /* CAPS.HCSPARAMS1 fields */ #define XHCI_MAXSLOTS(HCSPARAMS1) (HCSPARAMS1 & 0xFF) @@ -98,6 +99,13 @@ struct xhci_opregs { #define XHCI_RTS(BASE, RTSOFF) PTR_OFFSET(BASE, RTSOFF) #define XHCI_CMD_DB(BASE, DBOFF) PTR_OFFSET(BASE, DBOFF) +/* Runtime register offsets */ +#define XHCI_RT_IMAN 0x20 +#define XHCI_RT_IMOD 0x24 +#define XHCI_RT_ERSTSZ 0x28 +#define XHCI_RT_ERSTBA 0x30 +#define XHCI_RT_ERDP 0x38 + /* Support protocol cap fields */ #define XHCI_PROTO_ID(PROTO) (PROTO & 0xFF) #define XHCI_PROTO_MINOR(PROTO) ((PROTO >> 16) & 0xFF) diff --git a/sys/include/dev/video/fbdev.h b/sys/include/dev/video/fbdev.h index c80fd92..c9fec94 100644 --- a/sys/include/dev/video/fbdev.h +++ b/sys/include/dev/video/fbdev.h @@ -52,5 +52,6 @@ fbdev_get_index(const struct fbdev *fbdev, uint32_t x, uint32_t y) } struct fbdev fbdev_get(void); +void fbdev_init_dev(void); #endif /* !_DEV_FBDEV_H_ */ diff --git a/sys/include/fs/ctlfs.h b/sys/include/fs/ctlfs.h index 90f42f0..29ae358 100644 --- a/sys/include/fs/ctlfs.h +++ b/sys/include/fs/ctlfs.h @@ -42,12 +42,10 @@ struct ctlops { /* * Ctlfs op arguments * - * @devname: Device name. - * @major: Device major - * @minor: Device minor. - * @mode: Access flags. * @devname [1]: Device name (node name) * @ctlname: [1]: Control name (node entry name) + * @ops: Callbacks / fs hooks + * @mode: Access flags. */ struct ctlfs_dev { union { diff --git a/sys/include/fs/devfs.h b/sys/include/fs/devfs.h index 012c2eb..51b0b45 100644 --- a/sys/include/fs/devfs.h +++ b/sys/include/fs/devfs.h @@ -33,9 +33,11 @@ #include <sys/vnode.h> #include <sys/types.h> #include <sys/device.h> +#include <sys/devstat.h> extern const struct vops g_devfs_vops; int devfs_create_entry(const char *name, devmajor_t major, dev_t dev, mode_t mode); +int devfs_devstat(struct vnode *vp, struct devstat *res); #endif /* !_FS_DEVFS_H_ */ diff --git a/sys/include/fs/tmpfs.h b/sys/include/fs/tmpfs.h new file mode 100644 index 0000000..acb5256 --- /dev/null +++ b/sys/include/fs/tmpfs.h @@ -0,0 +1,77 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _FS_TMPFS_H_ +#define _FS_TMPFS_H_ + +#include <sys/types.h> +#include <sys/limits.h> +#include <sys/vnode.h> +#include <sys/queue.h> +#include <sys/spinlock.h> +#include <vm/vm_obj.h> + +extern const struct vops g_tmpfs_vops; + +/* Tmpfs node types */ +#define TMPFS_NONE (VNON) /* No type */ +#define TMPFS_REG (VREG) /* Regular file [f] */ +#define TMPFS_DIR (VDIR) /* Directory [d] */ + +struct tmpfs_node; + +/* + * A tmpfs node represents an object within the + * tmpfs namespace such as a file, directory, etc. + * + * @rpath: /tmp/ relative path (for lookups) + * @type: The tmpfs node type [one-to-one to vtype] + * @len: Length of buffer + * @real_size: Actual size of file + * @data: The backing file data + * @mode: File permissions + * @dirvp: Vnode of the parent node + * @vp: Vnode of the current node + * @lock: Lock protecting this node + */ +struct tmpfs_node { + char rpath[PATH_MAX]; + uint8_t type; + size_t len; + size_t real_size; + void *data; + mode_t mode; + struct vnode *dirvp; + struct vnode *vp; + struct spinlock lock; + TAILQ_HEAD(, tmpfs_node) dirents; + TAILQ_ENTRY(tmpfs_node) link; +}; + +#endif /* !_FS_TMPFS_H_ */ diff --git a/sys/include/lib/crc32.h b/sys/include/lib/crc32.h new file mode 100644 index 0000000..a7e5eeb --- /dev/null +++ b/sys/include/lib/crc32.h @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _LIB_CRC32_H_ +#define _LIB_CRC32_H_ + +#include <sys/types.h> + +uint32_t crc32(const void *data, size_t len); + +#endif diff --git a/sys/include/lib/string.h b/sys/include/lib/string.h index c09e6f4..3255ae5 100644 --- a/sys/include/lib/string.h +++ b/sys/include/lib/string.h @@ -35,6 +35,7 @@ size_t strlen(const char *s); char *itoa(int64_t value, char *buf, int base); +char *strdup(const char *s); int vsnprintf(char *s, size_t size, const char *fmt, va_list ap); int snprintf(char *s, size_t size, const char *fmt, ...); diff --git a/sys/include/net/ethertypes.h b/sys/include/net/ethertypes.h new file mode 100644 index 0000000..753ea10 --- /dev/null +++ b/sys/include/net/ethertypes.h @@ -0,0 +1,36 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _NET_ETHERTYPES_H_ +#define _NET_ETHERTYPES_H_ + +#define ETHERTYPE_IPV4 0x0800 +#define ETHERTYPE_ARP 0x0806 + +#endif /* !_NET_ETHERTYPES_H_ */ diff --git a/sys/include/net/if_arp.h b/sys/include/net/if_arp.h new file mode 100644 index 0000000..cbfb2fe --- /dev/null +++ b/sys/include/net/if_arp.h @@ -0,0 +1,51 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _NETINET_IF_ARP_H_ +#define _NETINET_IF_ARP_H_ + +#include <sys/types.h> +#include <net/ethertypes.h> + +/* ARP hardware types */ +#define ARP_HWTYPE_ETHER 1 + +/* ARP operation types */ +#define ARP_REQUEST 1 +#define ARP_REPLY 2 + +struct arp_hdr { + uint16_t hw_type; /* See ARP_HWTYPE_* */ + uint16_t proto_type; /* See ETHERTYPE_* */ + uint8_t hw_len; /* See ETHER_ADDR_LEN */ + uint8_t proto_len; /* Protocol address length */ + uint16_t op_type; /* See operation types above */ +}; + +#endif /* !_NETINET_IF_ARP_H_ */ diff --git a/sys/include/net/if_var.h b/sys/include/net/if_var.h new file mode 100644 index 0000000..e032ff4 --- /dev/null +++ b/sys/include/net/if_var.h @@ -0,0 +1,82 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _NET_IF_VAR_H_ +#define _NET_IF_VAR_H_ + +#include <sys/queue.h> +#include <sys/types.h> +#include <net/if.h> +#include <net/netbuf.h> + +#define NETIF_ADDR_LEN 32 /* In bytes */ + +/* Return values for netif hooks */ +#define NETIF_ENQ_OK 0 /* Enqueued */ +#define NETIF_ENQ_FLUSHED 1 /* Internal queue flushed */ + +/* Interface types */ +#define NETIF_TYPE_ANY 0 /* Any type */ +#define NETIF_TYPE_WIRE 1 /* Ethernet */ + +/* + * Represents the address of a network + * interface. + * + * @data: Raw address bytes + */ +struct netif_addr { + uint8_t data[NETIF_ADDR_LEN]; +}; + +/* + * Represents a network interface + * + * @name: Interface name + * @type: Interface type (see NETIF_TYPE*) + * @tx_enq: Enqueue a packet + * @tx_start: Start a packet + * + * XXX: tx_enq() returns 0 on success and 1 if a flush was needed + * and the packets have been transmitted. Less than zero values + * indicate failure. + */ +struct netif { + char name[IFNAMESIZ]; + uint8_t type; + TAILQ_ENTRY(netif) link; + struct netif_addr addr; + int(*tx_enq)(struct netif *nifp, struct netbuf *nbp, void *data); + void(*tx_start)(struct netif *nifp); +}; + +void netif_add(struct netif *nifp); +int netif_lookup(const char *name, uint8_t type, struct netif **res); + +#endif /* !_NET_IF_VAR_H_ */ diff --git a/sys/include/net/netbuf.h b/sys/include/net/netbuf.h new file mode 100644 index 0000000..7067370 --- /dev/null +++ b/sys/include/net/netbuf.h @@ -0,0 +1,42 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _NET_NETBUF_H_ +#define _NET_NETBUF_H_ + +#include <sys/types.h> + +#define NETBUF_LEN 256 + +struct netbuf { + char data[NETBUF_LEN]; + size_t len; +}; + +#endif /* !_NET_NETBUF_H_ */ diff --git a/sys/include/netinet/if_ether.h b/sys/include/netinet/if_ether.h new file mode 100644 index 0000000..d3dc9b7 --- /dev/null +++ b/sys/include/netinet/if_ether.h @@ -0,0 +1,56 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _NETINET_IF_ETHER_H_ +#define _NETINET_IF_ETHER_H_ + +#include <sys/types.h> +#include <net/if_arp.h> +#include <net/if_var.h> + +#define ETHER_ADDR_LEN 6 + +struct ether_arp { + struct arp_hdr hdr; + uint8_t sha[ETHER_ADDR_LEN]; + uint8_t spa[4]; + uint8_t tha[ETHER_ADDR_LEN]; + uint8_t tpa[4]; +}; + +struct ether_frame { + uint8_t ether_daddr[ETHER_ADDR_LEN]; + uint8_t ether_saddr[ETHER_ADDR_LEN]; + uint16_t ether_type; +}; + +int arp_request(struct netif *nifp, uint8_t *sproto, uint8_t *tproto); +int arp_reply(struct netif *netif, uint8_t *sproto, uint8_t *tproto); + +#endif /* !_NETINET_IF_ETHER_H_ */ diff --git a/sys/include/sys/atomic.h b/sys/include/sys/atomic.h index f61bf62..d9b3bde 100644 --- a/sys/include/sys/atomic.h +++ b/sys/include/sys/atomic.h @@ -30,6 +30,8 @@ #ifndef _SYS_ATOMIC_H_ #define _SYS_ATOMIC_H_ +#include <sys/types.h> + static inline unsigned long atomic_add_long_nv(volatile unsigned long *p, unsigned long v) { @@ -42,6 +44,12 @@ atomic_add_int_nv(volatile unsigned int *p, unsigned int v) return __sync_add_and_fetch(p, v); } +static inline unsigned int +atomic_add_64_nv(volatile uint64_t *p, unsigned int v) +{ + return __sync_add_and_fetch(p, v); +} + static inline unsigned long atomic_sub_long_nv(volatile unsigned long *p, unsigned long v) { @@ -55,6 +63,12 @@ atomic_sub_int_nv(volatile unsigned int *p, unsigned int v) } static inline unsigned int +atomic_sub_64_nv(volatile uint64_t *p, unsigned int v) +{ + return __sync_sub_and_fetch(p, v); +} + +static inline unsigned int atomic_load_int_nv(volatile unsigned int *p, unsigned int v) { return __atomic_load_n(p, v); @@ -66,6 +80,12 @@ atomic_load_long_nv(volatile unsigned long *p, unsigned int v) return __atomic_load_n(p, v); } +static inline unsigned int +atomic_load_64_nv(volatile uint64_t *p, unsigned int v) +{ + return __atomic_load_n(p, v); +} + static inline void atomic_store_int_nv(volatile unsigned int *p, int nv, unsigned int v) { @@ -78,20 +98,30 @@ atomic_store_long_nv(volatile unsigned long *p, long nv, unsigned int v) __atomic_store_n(p, nv, v); } +static inline void +atomic_store_64_nv(volatile uint64_t *p, long nv, unsigned int v) +{ + __atomic_store_n(p, nv, v); +} + /* Atomic increment (and fetch) operations */ #define atomic_inc_long(P) atomic_add_long_nv((P), 1) #define atomic_inc_int(P) atomic_add_int_nv((P), 1) +#define atomic_inc_64(P) atomic_add_64_nv((P), 1) /* Atomic decrement (and fetch) operations */ #define atomic_dec_long(P) atomic_sub_long_nv((P), 1) #define atomic_dec_int(P) atomic_sub_int_nv((P), 1) +#define atomic_dec_64(P) atomic_sub_64_nv((P), 1) /* Atomic load operations */ #define atomic_load_int(P) atomic_load_int_nv((P), __ATOMIC_SEQ_CST) #define atomic_load_long(P) atomic_load_long_nv((P), __ATOMIC_SEQ_CST) +#define atomic_load_64(P) atomic_load_64_nv((P), __ATOMIC_SEQ_CST) /* Atomic store operations */ #define atomic_store_int(P, NV) atomic_store_int_nv((P), (NV), __ATOMIC_SEQ_CST) #define atomic_store_long(P, NV) atomic_store_long_nv((P), (NV), __ATOMIC_SEQ_CST) +#define atomic_store_64(P, NV) atomic_store_64_nv((P), (NV), __ATOMIC_SEQ_CST) #endif /* !_SYS_ATOMIC_H_ */ diff --git a/sys/include/sys/cdefs.h b/sys/include/sys/cdefs.h index 61106fa..725193e 100644 --- a/sys/include/sys/cdefs.h +++ b/sys/include/sys/cdefs.h @@ -42,7 +42,9 @@ #define __dead __attribute__((__noreturn__)) #define __cold __attribute__((__cold__)) #define __dead_cold __attribute__((__noreturn__, __cold__)) +#define __aligned(n) __attribute__((__aligned__((n)))) #define __unused __attribute__((__unused__)) +#define __used __attribute__((__used__)) #define __nothing ((void)0) #define __likely(exp) __builtin_expect(((exp) != 0), 1) #define __unlikely(exp) __builtin_expect(((exp) != 0), 0) diff --git a/sys/include/sys/console.h b/sys/include/sys/console.h new file mode 100644 index 0000000..d0b89a8 --- /dev/null +++ b/sys/include/sys/console.h @@ -0,0 +1,57 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_CONSOLE_H_ +#define _SYS_CONSOLE_H_ + +#include <sys/types.h> + +/* + * Console features + * + * @ansi_esc: If 1, ANSI escape codes are enabled + * @show_curs: If 1, show the cursor + */ +struct console_feat { + uint8_t ansi_esc : 1; + uint8_t show_curs : 1; +}; + +/* + * Console attributes + * + * @cursor_x: Cursor x position + * @cursor_y: Cursor y position + */ +struct console_attr { + uint32_t cursor_x; + uint32_t cursor_y; +}; + +#endif /* !_SYS_CONSOLE_H_ */ diff --git a/sys/include/sys/device.h b/sys/include/sys/device.h index f5f92ad..04b66fc 100644 --- a/sys/include/sys/device.h +++ b/sys/include/sys/device.h @@ -36,21 +36,28 @@ #include <sys/queue.h> #include <sys/proc.h> #include <sys/sio.h> +#include <vm/vm_obj.h> typedef uint8_t devmajor_t; /* Device operation typedefs */ typedef int(*dev_read_t)(dev_t, struct sio_txn *, int); typedef int(*dev_write_t)(dev_t, struct sio_txn *, int); +typedef int(*dev_bsize_t)(dev_t); struct cdevsw { int(*read)(dev_t dev, struct sio_txn *sio, int flags); int(*write)(dev_t dev, struct sio_txn *sio, int flags); + paddr_t(*mmap)(dev_t dev, size_t size, off_t off, int flags); + + /* Private */ + struct vm_object vmobj; }; struct bdevsw { int(*read)(dev_t dev, struct sio_txn *sio, int flags); int(*write)(dev_t dev, struct sio_txn *sio, int flags); + int(*bsize)(dev_t dev); }; void *dev_get(devmajor_t major, dev_t dev); @@ -61,10 +68,12 @@ int dev_register(devmajor_t major, dev_t dev, void *devsw); int dev_noread(void); int dev_nowrite(void); +int dev_nobsize(void); /* Device operation stubs */ #define noread ((dev_read_t)dev_noread) #define nowrite ((dev_write_t)dev_nowrite) +#define nobsize ((dev_bsize_t)dev_nobsize) #endif /* _KERNEL */ #endif /* !_SYS_DEVICE_H_ */ diff --git a/sys/include/sys/devstat.h b/sys/include/sys/devstat.h new file mode 100644 index 0000000..91af30f --- /dev/null +++ b/sys/include/sys/devstat.h @@ -0,0 +1,46 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_DEVSTAT_H_ +#define _SYS_DEVSTAT_H_ + +#include <sys/types.h> + +/* + * Stats for block devices + * + * @nwrites: Number of writes total + * @nreads: Number of reads total + */ +struct devstat { + size_t nwrites; + size_t nreads; +}; + +#endif /* !_SYS_DEVSTAT_H_ */ diff --git a/sys/include/sys/disk.h b/sys/include/sys/disk.h new file mode 100644 index 0000000..4ad068b --- /dev/null +++ b/sys/include/sys/disk.h @@ -0,0 +1,211 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_DISK_H_ +#define _SYS_DISK_H_ + +#include <sys/syscall.h> +#include <sys/queue.h> +#include <sys/device.h> +#include <sys/cdefs.h> +#include <sys/types.h> +#include <sys/limits.h> +#include <sys/cdefs.h> +#if defined(_KERNEL) +#include <dev/dcdr/cache.h> +#endif /* _KERNEL */ + +#define DISK_NAME_MAX 64 + +/* + * V_BSIZE is the virtual block size in bytes used + * by the disk framework. The virtual block size is a + * multiple of the hardware block size and defines + * how many bytes a virtual block is made up of. + * + * A virtual block is simply a unit specific to + * the disk framework that represents multiple + * hardware disk blocks. + */ +#if defined(__V_BSIZE) +#define V_BSIZE __V_BSIZE +#else +#define V_BSIZE 4096 +#endif /* __V_BSIZE */ + +/* Sanitize the silly human's input */ +_Static_assert(V_BSIZE > 512, "V_BSIZE must be > 512"); +_Static_assert((V_BSIZE & 1) == 0, "V_BSIZE must be a power of two"); + +#define DISK_PRIMARY 0 /* ID of primary disk */ + +/* + * To prevent unlikely cases of unintended disk + * operations (e.g., read, write, etc), we store + * a cookie within each set of parameters. + * + * Requests whose bundle of parameters have no valid + * cookie shall be rejected by us. + */ +#define DISK_PARAM_COOKIE 0xD1531001 + +/* Valid disk operations */ +#define DISK_IO_READ 0x00 /* Read data from the disk */ +#define DISK_IO_WRITE 0x01 /* Write data to disk */ +#define DISK_IO_QUERY 0x02 /* Query disk information */ + +/* + * A disk identifier is a zero-based index into + * the disk registry. + */ +typedef uint16_t diskid_t; + +/* + * Block offset / LBA + */ +typedef off_t blkoff_t; + +/* + * Disk operations may be requested by user + * programs by using a disk operation code. + */ +typedef uint8_t diskop_t; + +/* + * Describes basic disk information + * + * @block_size: Hardware block size + * @vblock_size: Virtual block size + * @n_block: Number of blocks total + */ +struct disk_info { + uint32_t block_size; + uint32_t vblock_size; + size_t n_block; +}; + +/* + * The disk metadata structure contains information + * describing the disk. It is used for Hyra's pbuf + * (persistent buffers / sls) support. This structure + * is to be stored at the very last sector of the drive. + * + * @canary: Boot canary to verify persistent instance + * @info: Disk attributes + */ +struct disk_root { + uint32_t canary; + struct disk_info info; +}; + +/* + * A disk I/O parameter contains information + * that is passed from a user application to + * the kernel for specific operations. + * + * @buf: User-side pointer to data buffer + * @size: Size of data buffer in bytes + * @cookie: Used to prevent unintended operations + * @blk: Disk block offset + * @u_buf: Used by the kernel to keep track of user buffer + */ +struct disk_param { + void *buf; + size_t size; + uint32_t cookie; + blkoff_t blk; +#if defined(_KERNEL) + void *u_buf; +#endif +}; + +/* + * Helper used to initialize disk I/O parameters. + * This is used by the user to initialize a declared + * set of parameters. + * + * @buf: Buffer to operate on + * @blk: Disk block to operate on + * @size: Operation size in bytes (block-aligned) + * @res: Pointer to params to be initialized + */ +__always_inline static inline void +disk_param_init(void *buf, blkoff_t blk, size_t size, struct disk_param *res) +{ + if (res != NULL) { + res->buf = buf; + res->blk = blk; + res->size = size; + res->cookie = DISK_PARAM_COOKIE; + } +} + +/* + * User side disk API + */ +#if !defined(_KERNEL) +ssize_t __disk_io(diskid_t id, diskop_t op, const struct disk_param *param); +#endif /* !_KERNEL */ + +/* Common disk operations */ +int disk_query(diskid_t id, struct disk_info *res); +ssize_t disk_read(diskid_t id, blkoff_t blk, void *buf, size_t len); +ssize_t disk_write(diskid_t id, blkoff_t blk, const void *buf, size_t len); + +#if defined(_KERNEL) +/* + * Represents a block storage device + * + * @name: Name of disk + * @cookie: Used internally to ensure validity + * @bsize: Hardware block size (defaults to 512 bytes) + * @dev: Device minor + * @id: Disk ID (zero-based index) + * @bdev: Block device operations + * @link: TAILQ link + */ +struct disk { + char name[DISK_NAME_MAX]; + uint32_t cookie; + uint16_t bsize; + dev_t dev; + diskid_t id; + const struct bdevsw *bdev; + TAILQ_ENTRY(disk) link; +}; + +void *disk_buf_alloc(diskid_t id, size_t len); +void disk_buf_free(void *p); + +int disk_add(const char *name, dev_t dev, const struct bdevsw *bdev, int flags); +int disk_get_id(diskid_t id, struct disk **res); + +scret_t sys_disk(struct syscall_args *scargs); +#endif /* _KERNEL */ +#endif /* !_SYS_DISK_H_ */ diff --git a/sys/include/sys/disklabel.h b/sys/include/sys/disklabel.h new file mode 100644 index 0000000..895c35e --- /dev/null +++ b/sys/include/sys/disklabel.h @@ -0,0 +1,48 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_DISKLABEL_H_ +#define _SYS_DISKLABEL_H_ + +#include <sys/types.h> + +#define DISK_MAG 0x4F445421UL /* "ODT!" */ + +/* + * Represents a disk table. + * + * @magic: Magic number (`DISK_MAG') + * @sect_size: Disk sector size + */ +struct disklabel { + uint32_t magic; + uint32_t sect_size; +}; + +#endif /* !_SYS_DISKLABEL_H_ */ diff --git a/sys/include/sys/dmi.h b/sys/include/sys/dmi.h new file mode 100644 index 0000000..a21cff6 --- /dev/null +++ b/sys/include/sys/dmi.h @@ -0,0 +1,63 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_DMI_H_ +#define _SYS_DMI_H_ + +#if defined(_KERNEL) +#include <sys/types.h> +#else +#include <stdint.h> +#include <stddef.h> +#endif /* _KERNEL */ + +/* + * Provides board information through + * DMI. + * + * @cpu_version: CPU version string + * @cpu_manuf: CPU manufacturer string + * @product: Board product string + * @vendor: Board vendor string + * @version: Product version string + * + * If index 0 of any of the strings contain + * '\0', then they are unsupported/unused. + * + * XXX: Strings are null terminated + */ +struct dmi_board { + char cpu_version[64]; + char cpu_manuf[32]; + char product[32]; + char vendor[32]; + char version[32]; +}; + +#endif /* !_SYS_DMI_H_ */ diff --git a/sys/include/sys/driver.h b/sys/include/sys/driver.h index 05c40fa..e10021a 100644 --- a/sys/include/sys/driver.h +++ b/sys/include/sys/driver.h @@ -31,27 +31,94 @@ #define _SYS_DRIVER_H_ #include <sys/cdefs.h> +#include <sys/proc.h> +#include <sys/types.h> #if defined(_KERNEL) +/* Variable driver data */ +struct driver_var { + uint8_t deferred : 1; +}; + struct driver { int(*init)(void); + const char *name; + struct driver_var *data; }; +extern struct proc g_proc0; + +/* Early (high priority) drivers */ extern char __drivers_init_start[]; extern char __drivers_init_end[]; -#define DRIVER_EXPORT(INIT) \ +/* Deferred (low priority) drivers */ +extern char __driversd_init_start[]; +extern char __driversd_init_end[]; + +#define DRIVER_EXPORT(INIT, NAME) \ + static struct driver_var __driver_var = { \ + .deferred = 0 \ + }; \ + \ __attribute__((used, section(".drivers"))) \ static struct driver __driver_desc = { \ .init = INIT, \ + .data = &__driver_var, \ + .name = NAME \ } +/* + * Some drivers are not required to start up + * early for proper system operation and may + * be deferred to start at a later time. + * + * Examples of such (deferrable) drivers include code + * that waits for I/O (e.g., disks, network cards, + * et cetera). This allows for faster boot times + * as only *required* drivers are started before + * everything else. + * + * Drivers that wish to be deferred may export themselves + * via the DRIVER_DEFER() macro. The DRIVER_DEFERRED() + * macro gives the value of 1 if the current driver + * context has yet to be initialized. The driver may + * use this to defer requests for I/O. + */ +#define DRIVER_DEFER(INIT, NAME) \ + static struct driver_var __driver_var = { \ + .deferred = 1 \ + }; \ + \ + __attribute__((used, section(".drivers.defer"))) \ + static struct driver __driver_desc = { \ + .init = INIT, \ + .data = &__driver_var, \ + .name = NAME \ + } + +#define DRIVER_DEFERRED() __driver_var.deferred + #define DRIVERS_INIT() \ for (struct driver *__d = (struct driver *)__drivers_init_start; \ (uintptr_t)__d < (uintptr_t)__drivers_init_end; ++__d) \ { \ + if (driver_blacklist_check((__d)->name)) { \ + continue; \ + } \ __d->init(); \ } + +#define DRIVERS_SCHED() \ + spawn(&g_proc0, __driver_init_td, NULL, 0, NULL) + +/* Driver blacklist framework */ +int driver_blacklist(const char *name); +int driver_blacklist_check(const char *name); +void driver_blacklist_init(void); + +void __driver_init_td(void); + #endif /* _KERNEL */ #endif /* !_SYS_DRIVER_H_ */ diff --git a/sys/include/sys/elf.h b/sys/include/sys/elf.h index af5f6d6..76c6d43 100644 --- a/sys/include/sys/elf.h +++ b/sys/include/sys/elf.h @@ -496,4 +496,70 @@ typedef struct { Elf64_Xword sh_entsize; /* Entry size if section holds table */ } Elf64_Shdr; +/* Special section indices. */ + +#define SHN_UNDEF 0 /* Undefined section */ +#define SHN_LORESERVE 0xff00 /* Start of reserved indices */ +#define SHN_LOPROC 0xff00 /* Start of processor-specific */ +#define SHN_BEFORE 0xff00 /* Order section before all others + (Solaris). */ +#define SHN_AFTER 0xff01 /* Order section after all others + (Solaris). */ +#define SHN_HIPROC 0xff1f /* End of processor-specific */ +#define SHN_LOOS 0xff20 /* Start of OS-specific */ +#define SHN_HIOS 0xff3f /* End of OS-specific */ +#define SHN_ABS 0xfff1 /* Associated symbol is absolute */ +#define SHN_COMMON 0xfff2 /* Associated symbol is common */ +#define SHN_XINDEX 0xffff /* Index is in extra table. */ +#define SHN_HIRESERVE 0xffff /* End of reserved indices */ + +/* Legal values for sh_type (section type). */ + +#define SHT_NULL 0 /* Section header table entry unused */ +#define SHT_PROGBITS 1 /* Program data */ +#define SHT_SYMTAB 2 /* Symbol table */ +#define SHT_STRTAB 3 /* String table */ +#define SHT_RELA 4 /* Relocation entries with addends */ +#define SHT_HASH 5 /* Symbol hash table */ +#define SHT_DYNAMIC 6 /* Dynamic linking information */ +#define SHT_NOTE 7 /* Notes */ +#define SHT_NOBITS 8 /* Program space with no data (bss) */ +#define SHT_REL 9 /* Relocation entries, no addends */ +#define SHT_SHLIB 10 /* Reserved */ +#define SHT_DYNSYM 11 /* Dynamic linker symbol table */ +#define SHT_INIT_ARRAY 14 /* Array of constructors */ +#define SHT_FINI_ARRAY 15 /* Array of destructors */ +#define SHT_PREINIT_ARRAY 16 /* Array of pre-constructors */ +#define SHT_GROUP 17 /* Section group */ +#define SHT_SYMTAB_SHNDX 18 /* Extended section indeces */ +#define SHT_NUM 19 /* Number of defined types. */ +#define SHT_LOOS 0x60000000 /* Start OS-specific. */ +#define SHT_CHECKSUM 0x6ffffff8 /* Checksum for DSO content. */ +#define SHT_LOSUNW 0x6ffffffa /* Sun-specific low bound. */ +#define SHT_SUNW_move 0x6ffffffa +#define SHT_SUNW_COMDAT 0x6ffffffb +#define SHT_SUNW_syminfo 0x6ffffffc +#define SHT_HISUNW 0x6fffffff /* Sun-specific high bound. */ +#define SHT_HIOS 0x6fffffff /* End OS-specific type */ +#define SHT_LOPROC 0x70000000 /* Start of processor-specific */ +#define SHT_HIPROC 0x7fffffff /* End of processor-specific */ +#define SHT_LOUSER 0x80000000 /* Start of application-specific */ +#define SHT_HIUSER 0x8fffffff /* End of application-specific */ + +/* Legal values for sh_flags (section flags). */ + +#define SHF_WRITE (1 << 0) /* Writable */ +#define SHF_ALLOC (1 << 1) /* Occupies memory during execution */ +#define SHF_EXECINSTR (1 << 2) /* Executable */ +#define SHF_MERGE (1 << 4) /* Might be merged */ +#define SHF_STRINGS (1 << 5) /* Contains nul-terminated strings */ +#define SHF_INFO_LINK (1 << 6) /* `sh_info' contains SHT index */ +#define SHF_LINK_ORDER (1 << 7) /* Preserve order after combining */ +#define SHF_OS_NONCONFORMING (1 << 8) /* Non-standard OS specific handling + required */ +#define SHF_GROUP (1 << 9) /* Section is member of a group. */ +#define SHF_TLS (1 << 10) /* Section hold thread-local data. */ +#define SHF_COMPRESSED (1 << 11) /* Section with compressed data. */ +#define SHF_MASKOS 0x0ff00000 /* OS-specific. */ +#define SHF_MASKPROC 0xf0000000 /* Processor-specific */ #endif /* _SYS_ELF_H_ */ diff --git a/sys/include/sys/endian.h b/sys/include/sys/endian.h new file mode 100644 index 0000000..5cbc94a --- /dev/null +++ b/sys/include/sys/endian.h @@ -0,0 +1,54 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_ENDIAN_H_ +#define _SYS_ENDIAN_H_ + +#include <sys/cdefs.h> +#include <sys/types.h> + +#define swap16(x) __swap16((x)) +#define swap32(x) __swap32((x)) + +__always_inline static inline uint16_t +__swap16(uint16_t x) +{ + return ((x << 8) & 0xFF00) | ((x >> 8) & 0x00FF); +} + +__always_inline static inline uint32_t +__swap32(uint32_t x) +{ + return ((x << 24) & 0xFF000000) | + ((x << 8) & 0x00FF0000) | + ((x >> 8) & 0x0000FF00) | + ((x >> 24) & 0x000000FF); +} + +#endif /* !_SYS_ENDIAN_H_ */ diff --git a/sys/include/sys/exec.h b/sys/include/sys/exec.h index 7e720fc..43df59f 100644 --- a/sys/include/sys/exec.h +++ b/sys/include/sys/exec.h @@ -32,8 +32,6 @@ #include <sys/types.h> -#if defined(_KERNEL) - /* Danger: Do not change these !! */ #define AT_NULL 0 #define AT_ENTRY 1 @@ -45,7 +43,9 @@ #define AT_RANDOM 7 #define AT_EXECFN 8 #define AT_PAGESIZE 9 +#define _AT_MAX 16 +#if defined(_KERNEL) #define MAX_PHDRS 32 #define STACK_PUSH(PTR, VAL) *(--(PTR)) = VAL #define AUXVAL(PTR, TAG, VAL) \ diff --git a/sys/include/sys/fbdev.h b/sys/include/sys/fbdev.h new file mode 100644 index 0000000..e206889 --- /dev/null +++ b/sys/include/sys/fbdev.h @@ -0,0 +1,40 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_FBDEV_H_ +#define _SYS_FBDEV_H_ + +struct fbattr { + uint32_t width; + uint32_t height; + uint32_t pitch; + uint32_t bpp; +}; + +#endif /* !_SYS_FBDEV_H_ */ diff --git a/sys/include/sys/fcntl.h b/sys/include/sys/fcntl.h index 122a378..83d38af 100644 --- a/sys/include/sys/fcntl.h +++ b/sys/include/sys/fcntl.h @@ -33,6 +33,7 @@ #define O_RDONLY 0x0000 #define O_WRONLY 0x0001 #define O_RDWR 0x0002 +#define O_CREAT 0x0004 /* Makes seal checking easier */ #if defined(_KERNEL) diff --git a/sys/include/sys/filedesc.h b/sys/include/sys/filedesc.h index a544811..adbcfa8 100644 --- a/sys/include/sys/filedesc.h +++ b/sys/include/sys/filedesc.h @@ -31,8 +31,15 @@ #define _SYS_FILEDESC_H_ #include <sys/types.h> +#if defined(_KERNEL) #include <sys/vnode.h> +#include <sys/syscall.h> #include <sys/spinlock.h> +#include <sys/syscall.h> + +#define SEEK_SET 0 +#define SEEK_CUR 1 +#define SEEK_END 2 struct filedesc { int fdno; @@ -48,10 +55,14 @@ int fd_close(unsigned int fd); int fd_read(unsigned int fd, void *buf, size_t count); int fd_write(unsigned int fd, void *buf, size_t count); -int fd_alloc(struct filedesc **fd_out); +int fd_alloc(struct proc *td, struct filedesc **fd_out); int fd_open(const char *pathname, int flags); +off_t fd_seek(int fildes, off_t offset, int whence); + +int fd_dup(struct proc *td, int fd); +struct filedesc *fd_get(struct proc *td, unsigned int fdno); -int fd_dup(int fd); -struct filedesc *fd_get(unsigned int fdno); +scret_t sys_lseek(struct syscall_args *scargs); +#endif /* _KERNEL */ #endif /* !_SYS_FILEDESC_H_ */ diff --git a/sys/include/sys/krq.h b/sys/include/sys/krq.h new file mode 100644 index 0000000..9cb6ec6 --- /dev/null +++ b/sys/include/sys/krq.h @@ -0,0 +1,40 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_KRQ_H_ +#define _SYS_KRQ_H_ + +#include <sys/syscall.h> + +#if defined(_KERNEL) +scret_t sys_inject(struct syscall_args *scargs); +#else +int inject(const char *path); +#endif /* _KERNEL */ +#endif /* !_SYS_KRQ_H_ */ diff --git a/sys/include/sys/limits.h b/sys/include/sys/limits.h index 6185719..c0ce5af 100644 --- a/sys/include/sys/limits.h +++ b/sys/include/sys/limits.h @@ -31,7 +31,12 @@ #define _SYS_LIMITS_H_ #define PATH_MAX 1024 +#define NAME_MAX 256 #define SSIZE_MAX 32767 +#define ARG_MAX 4096 #define CHAR_BIT 8 - +#define CPU_MAX 256 +#define VSR_MAX_DOMAIN 16 +#define VSR_MAX_CAPSULE 16 +#define IOVEC_MAX 512 #endif /* !_SYS_LIMITS_H_ */ diff --git a/sys/include/sys/mman.h b/sys/include/sys/mman.h index 4ead9ba..de360e4 100644 --- a/sys/include/sys/mman.h +++ b/sys/include/sys/mman.h @@ -35,6 +35,8 @@ #if defined(_KERNEL) #include <sys/tree.h> #include <vm/vm_obj.h> +#else +#include <stddef.h> #endif /* _KERNEL */ /* @@ -49,10 +51,10 @@ #endif /* !_KERNEL */ /* mmap() flags */ +#define MAP_ANON 0x0000 #define MAP_SHARED 0x0001 #define MAP_PRIVATE 0x0002 #define MAP_FIXED 0x0004 -#define MAP_ANON 0x0008 #if defined(_KERNEL) /* @@ -80,19 +82,19 @@ struct mmap_lgdr { size_t nbytes; }; -/* Kernel munmap() routine */ -int munmap_at(void *addr, size_t len); - -/* Kernel mmap() routine */ -void *mmap_at(void *addr, size_t len, int prot, int flags, - int fildes, off_t off); - int mmap_entrycmp(const struct mmap_entry *a, const struct mmap_entry *b); RBT_PROTOTYPE(lgdr_entries, mmap_entry, hd, mmap_entrycmp) -#endif /* _KERNEL */ /* Syscall layer */ -scret_t mmap(struct syscall_args *scargs); -scret_t munmap(struct syscall_args *scargs); +scret_t sys_mmap(struct syscall_args *scargs); +scret_t sys_munmap(struct syscall_args *scargs); +#endif /* _KERNEL */ + +/* Kernel munmap() routine */ +int munmap(void *addr, size_t len); + +/* Kernel mmap() routine */ +void *mmap(void *addr, size_t len, int prot, int flags, + int fildes, off_t off); #endif /* !_SYS_MMAN_H_ */ diff --git a/sys/include/sys/mmio.h b/sys/include/sys/mmio.h index 9f6e4e2..0fa9e36 100644 --- a/sys/include/sys/mmio.h +++ b/sys/include/sys/mmio.h @@ -42,7 +42,6 @@ #if defined(_KERNEL) - /* * mmio_write<n> - Writes to MMIO address with specific size * diff --git a/sys/include/sys/mount.h b/sys/include/sys/mount.h index 1fcdbfa..636c7bf 100644 --- a/sys/include/sys/mount.h +++ b/sys/include/sys/mount.h @@ -47,6 +47,7 @@ #define MOUNT_RAMFS "initramfs" #define MOUNT_DEVFS "devfs" #define MOUNT_CTLFS "ctlfs" +#define MOUNT_TMPFS "tmpfs" struct vfsops; struct mount; @@ -59,6 +60,7 @@ extern mountlist_t g_mountlist; extern const struct vfsops g_initramfs_vfsops; extern const struct vfsops g_devfs_vfsops; extern const struct vfsops g_ctlfs_vfsops; +extern const struct vfsops g_tmpfs_vfsops; struct mount { char *name; diff --git a/sys/include/sys/mutex.h b/sys/include/sys/mutex.h new file mode 100644 index 0000000..8a4d50a --- /dev/null +++ b/sys/include/sys/mutex.h @@ -0,0 +1,52 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_MUTEX_H_ +#define _SYS_MUTEX_H_ + +#include <sys/types.h> +#include <vm/dynalloc.h> + +#define MUTEX_NAME_LEN 32 + +#if defined(_KERNEL) + +struct mutex { + char name[MUTEX_NAME_LEN]; + volatile uint8_t lock; +}; + +struct mutex *mutex_new(const char *name); +void mutex_free(struct mutex *mtx); + +int mutex_acquire(struct mutex *mtx, int flags); +void mutex_release(struct mutex *mtx); + +#endif /* _KERNEL */ +#endif /* !_SYS_MUTEX_H_ */ diff --git a/sys/include/sys/namei.h b/sys/include/sys/namei.h index f81f905..ccd7f35 100644 --- a/sys/include/sys/namei.h +++ b/sys/include/sys/namei.h @@ -32,6 +32,9 @@ #include <sys/types.h> #include <sys/vnode.h> +#include <sys/param.h> + +#define NAMEI_WANTPARENT BIT(0) /* Request parent only */ struct nameidata { const char *path; /* Pathname */ diff --git a/sys/include/sys/param.h b/sys/include/sys/param.h index c0a5686..2bbbabd 100644 --- a/sys/include/sys/param.h +++ b/sys/include/sys/param.h @@ -30,11 +30,20 @@ #ifndef _SYS_PARAM_H_ #define _SYS_PARAM_H_ +#if defined(_KERNEL) +#include <machine/param.h> +#endif + /* Assumed cache line size */ #ifndef COHERENCY_UNIT #define COHERENCY_UNIT 64 #endif +/* Assumed machine word size */ +#ifndef M_WORD_SIZE +#define M_WORD_SIZE 4 +#endif + /* Bit related macros */ #define ISSET(v, f) ((v) & (f)) #define BIT(n) (1ULL << (n)) @@ -47,6 +56,7 @@ /* Align up/down a value */ #define ALIGN_DOWN(value, align) ((value) & ~((align)-1)) #define ALIGN_UP(value, align) (((value) + (align)-1) & ~((align)-1)) +#define MALIGN(value) ALIGN_UP((value), M_WORD_SIZE) /* Bitmap helper macros */ #define setbit(a, b) ((a)[(b) >> 3] |= BIT(b % 8)) @@ -67,8 +77,12 @@ /* Gives 1 if pointer is aligned */ #define PTR_ALIGNED(PTR, ALIGN) (!((uintptr_t)PTR & (ALIGN - 1))) -/* Adds a value to a pointer */ +/* + * PTR_OFFSET: Adds an offset to the pointer + * PTR_NOFFSET: Subtracts a negative offset from the pointer + */ #define PTR_OFFSET(PTR, OFF) ((void *)((uintptr_t)PTR + OFF)) +#define PTR_NOFFSET(PTR, NOFF) ((void *)((uintptr_t)PTR - NOFF)) #define NELEM(a) (sizeof(a) / sizeof(a[0])) diff --git a/sys/include/sys/proc.h b/sys/include/sys/proc.h index 1b59de9..809ee23 100644 --- a/sys/include/sys/proc.h +++ b/sys/include/sys/proc.h @@ -38,6 +38,9 @@ #include <sys/cdefs.h> #include <sys/syscall.h> #include <sys/exec.h> +#include <sys/ucred.h> +#include <sys/limits.h> +#include <sys/vsr.h> #include <sys/filedesc.h> #include <sys/signal.h> #include <sys/vnode.h> @@ -53,22 +56,53 @@ #define PROC_MAX_FILEDES 256 #define PROC_SIGMAX 64 +/* + * The coredump structure, contains information + * about crashes. + * + * @pid: PID of process that has crashed + * @fault_addr: Address of faulting memory access + * @tf: Copy of the programs trapframe + * @checksum: CRC32 checksum of entire coredump + * + * XXX: DO NOT REORDER (always add to the end before 'checksum') + */ +struct __packed coredump { + pid_t pid; + uintptr_t fault_addr; + struct trapframe tf; + + /* XXX: Add entries above the checksum */ + uint32_t checksum; +}; + +/* + * Sometimes we may need to pin a process + * to a specific CPU. This type represents + * the (machine independent) logical processor + * ID for a process to be pinned to. + */ +typedef int16_t affinity_t; + struct proc { pid_t pid; struct exec_prog exec; + struct ucred cred; struct ksiginfo *ksig_list[PROC_SIGMAX]; struct filedesc *fds[PROC_MAX_FILEDES]; + struct vsr_domain *vsr_tab[VSR_MAX_DOMAIN]; struct mmap_lgdr *mlgdr; struct vcache *vcache; struct spinlock vcache_lock; struct trapframe tf; struct pcb pcb; struct proc *parent; - void *spawn_data; + affinity_t affinity; + void *data; size_t priority; int exit_status; bool rested; - uint32_t flags; + volatile uint32_t flags; uint32_t nleaves; uintptr_t stack_base; struct spinlock ksigq_lock; @@ -83,19 +117,38 @@ struct proc { #define PROC_ZOMB BIT(2) /* Zombie (dead but not deallocated) */ #define PROC_LEAFQ BIT(3) /* Leaf queue is active */ #define PROC_WAITED BIT(4) /* Being waited on by parent */ +#define PROC_KTD BIT(5) /* Kernel thread */ +#define PROC_SLEEP BIT(6) /* Thread execution paused */ +#define PROC_PINNED BIT(7) /* Pinned to CPU */ struct proc *this_td(void); +struct proc *td_copy(struct proc *td); struct proc *get_child(struct proc *cur, pid_t pid); + +int proc_init(struct proc *td, struct proc *parent); +void proc_pin(struct proc *td, affinity_t cpu); +void proc_unpin(struct proc *td); + +void proc_reap(struct proc *td); +void proc_coredump(struct proc *td, uintptr_t fault_addr); + +pid_t getpid(void); +pid_t getppid(void); + +scret_t sys_getpid(struct syscall_args *scargs); +scret_t sys_getppid(struct syscall_args *scargs); +scret_t sys_waitpid(struct syscall_args *scargs); + int md_spawn(struct proc *p, struct proc *parent, uintptr_t ip); scret_t sys_spawn(struct syscall_args *scargs); pid_t spawn(struct proc *cur, void(*func)(void), void *p, int flags, struct proc **newprocp); -void md_td_stackinit(struct proc *td, void *stack_top, struct exec_prog *prog); +uintptr_t md_td_stackinit(struct proc *td, void *stack_top, struct exec_prog *prog); __dead void md_td_kick(struct proc *td); int fork1(struct proc *cur, int flags, void(*ip)(void), struct proc **newprocp); -int exit1(struct proc *td); +int exit1(struct proc *td, int flags); __dead scret_t sys_exit(struct syscall_args *scargs); #endif /* _KERNEL */ diff --git a/sys/include/sys/queue.h b/sys/include/sys/queue.h index e5d607d..2226ccc 100644 --- a/sys/include/sys/queue.h +++ b/sys/include/sys/queue.h @@ -27,7 +27,12 @@ * POSSIBILITY OF SUCH DAMAGE. */ +#if !defined(_KERNEL) +#include <stdint.h> +#include <stddef.h> +#else #include <sys/types.h> +#endif /* !_KERNEL */ #ifndef _QUEUE_H_ #define _QUEUE_H_ @@ -79,7 +84,6 @@ struct { \ ((tvar) = TAILQ_NEXT(var, field), 1); \ (var) = (tvar)) - #define TAILQ_FOREACH_REVERSE(var, head, headname, field) \ for((var) = TAILQ_LAST(head, headname); \ (var) != TAILQ_END(head); \ diff --git a/sys/include/sys/sched.h b/sys/include/sys/sched.h index 80f4d1c..7bba9df 100644 --- a/sys/include/sys/sched.h +++ b/sys/include/sys/sched.h @@ -32,11 +32,45 @@ #include <sys/proc.h> #include <sys/cdefs.h> +#include <sys/limits.h> +#include <sys/time.h> + +/* + * Scheduler CPU information + * + * @nswitch: Number of context switches + * @idle: Number of milliseconds idle + */ +struct sched_cpu { + uint64_t nswitch; +}; + +/* + * Scheduler statistics + * + * @nproc: Number processes running + * @ncpu: Number of CPU cores + * @nhlt: Number of halted CPU cores + * @quantum_usec: Scheduler quantum (microseconds) + */ +struct sched_stat { + size_t nproc; + uint16_t ncpu; + uint16_t nhlt; + uint32_t quantum_usec; + struct sched_cpu cpus[CPU_MAX]; +}; #if defined(_KERNEL) +void sched_stat(struct sched_stat *statp); void sched_init(void); + +void sched_preempt_set(bool enable); +bool sched_preemptable(void); + void sched_yield(void); +void sched_suspend(struct proc *td, const struct timeval *tv); void sched_detach(struct proc *td); __dead void sched_enter(void); diff --git a/sys/include/sys/schedvar.h b/sys/include/sys/schedvar.h index 5ed9f5f..017fcb7 100644 --- a/sys/include/sys/schedvar.h +++ b/sys/include/sys/schedvar.h @@ -60,5 +60,11 @@ struct sched_queue { size_t nthread; }; +struct proc *sched_dequeue_td(void); +void mi_sched_switch(struct proc *from); + +void md_sched_switch(struct trapframe *tf); +void sched_oneshot(bool now); + #endif /* _KERNEL */ #endif /* !_SYS_SCHEDVAR_H_ */ diff --git a/sys/include/sys/signal.h b/sys/include/sys/signal.h index 9fc767d..eaf2d41 100644 --- a/sys/include/sys/signal.h +++ b/sys/include/sys/signal.h @@ -37,6 +37,7 @@ #define SIGFPE 8 /* Floating point exception */ #define SIGKILL 9 /* Kill */ #define SIGSEGV 11 /* Segmentation violation */ +#define SIGTERM 15 /* Terminate gracefully */ typedef uint32_t sigset_t; @@ -80,5 +81,6 @@ int sigismember(const sigset_t *set, int signo); void sigfpe_default(int signo); void sigkill_default(int signo); void sigsegv_default(int signo); +void sigterm_default(int signo); #endif /* _KERNEL */ #endif /* !_SYS_SIGNAL_H_ */ diff --git a/sys/include/sys/socket.h b/sys/include/sys/socket.h new file mode 100644 index 0000000..1a33108 --- /dev/null +++ b/sys/include/sys/socket.h @@ -0,0 +1,202 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_SOCKET_H_ +#define _SYS_SOCKET_H_ + +#include <sys/socketvar.h> +#include <sys/queue.h> +#include <sys/param.h> +#include <sys/uio.h> +#if defined(_KERNEL) +#include <sys/types.h> +#include <sys/proc.h> +#include <sys/syscall.h> +#include <sys/mutex.h> +#else +#include <stdint.h> +#include <stddef.h> +#endif /* _KERNEL */ + +#ifndef _SA_FAMILY_T_DEFINED_ +#define _SA_FAMILY_T_DEFINED_ +typedef uint32_t sa_family_t; +#endif /* _SA_FAMILY_T_DEFINED_ */ + +#ifndef _SOCKLEN_T_DEFINED_ +#define _SOCKLEN_T_DEFINED_ +typedef uint32_t socklen_t; +#endif /* !_SOCKLEN_T_DEFINED_ */ + +/* + * Socket level number + */ +#define SOL_SOCKET 0xFFFF + +/* + * Address family defines + */ +#define AF_UNSPEC 0 +#define AF_UNIX 1 +#define AF_LOCAL AF_UNIX + +/* Socket types */ +#define SOCK_STREAM 1 + +/* Socket option names */ +#define SO_RCVTIMEO 0 /* Max time recv(2) waits */ +#define _SO_MAX 1 /* Max socket options */ + +struct sockaddr_un { + sa_family_t sun_family; + char sun_path[108]; +}; + +struct sockaddr { + sa_family_t sa_family; + char sa_data[14]; +}; + +/* + * POSIX message header for recvmsg() + * and sendmsg() calls. + */ +struct msghdr { + void *msg_name; /* Optional address */ + socklen_t msg_namelen; /* Size of address */ + struct iovec *msg_iov; /* Scatter/gather array */ + int msg_iovlen; /* Members in msg_iov */ + void *msg_control; /* Ancillary data, see below */ + socklen_t msg_controllen; /* Ancillary data buffer len */ + int msg_flags; /* Message flags */ +}; + +/* + * POSIX control message header for + * ancillary data objects. + */ +struct cmsghdr { + socklen_t cmsg_len; + int cmsg_level; + int cmsg_type; +}; + +#define CMSG_SPACE(len) (MALIGN(sizeof(struct cmsghdr)) + MALIGN(len)) + +/* Return pointer to cmsg data */ +#define CMSG_DATA(cmsg) PTR_OFFSET(cmsg, sizeof(struct cmsghdr)) + +/* Return length of control message */ +#define CMSG_LEN(len) (MALIGN(sizeof(struct cmsghdr)) + MALIGN(len)) + +/* Return pointer to next cmsghdr */ +#define CMSG_NXTHDR(mhdr, cmsg) \ + PTR_OFFSET(cmsg, MALIGN((cmsg)>cmsg_len)) + \ + MALIGN(sizeof(struct cmsghdr)) > \ + PTR_OFFSET((mhdr)->msg_control, (mhdr)->msg_controllen) ? \ + (struct cmsghdr *)NULL : \ + (struct cmsghdr *)PTR_OFFSET(cmsg, MALIGN((cmsg)->cmsg_len)) + +/* Return pointer to first header */ +#define CMSG_FIRSTHDR(mhdr) \ + ((mhdr)->msg_controllen >= sizeof(struct cmsghdr) ? \ + (struct cmsghdr *)(mhdr)->msg_control : \ + (struct cmsghdr *)NULL); + +/* Socket level control messages */ +#define SCM_RIGHTS 0x01 + +#if defined(_KERNEL) + +struct cmsg { + union { + struct cmsghdr hdr; + uint8_t buf[CMSG_SPACE(sizeof(int))]; + }; + + size_t control_len; + TAILQ_ENTRY(cmsg) link; +}; + +/* + * List of cmsg headers and data, queued up + * during sendmsg() + */ +struct cmsg_list { + TAILQ_HEAD(, cmsg) list; + uint8_t is_init : 1; +}; + +/* + * Socket option that may be applied to + * sockets on the system. + */ +struct sockopt { + socklen_t len; + char data[]; +}; + +struct ksocket { + int sockfd; + union { + struct sockaddr sockaddr; + struct sockaddr_un un; + }; + struct sockopt *opt[_SO_MAX]; + struct proc *owner; + struct cmsg_list cmsg_list; + struct sockbuf buf; + struct mutex *mtx; +}; + +scret_t sys_socket(struct syscall_args *scargs); +scret_t sys_bind(struct syscall_args *scargs); +scret_t sys_connect(struct syscall_args *scargs); + +scret_t sys_recv(struct syscall_args *scargs); +scret_t sys_send(struct syscall_args *scargs); + +scret_t sys_recvmsg(struct syscall_args *scargs); +scret_t sys_sendmsg(struct syscall_args *scargs); +scret_t sys_setsockopt(struct syscall_args *scargs); +#endif /* _KERNEL */ + +int socket(int domain, int type, int protocol); +int bind(int sockfd, const struct sockaddr *addr, socklen_t len); + +int setsockopt(int sockfd, int level, int name, const void *v, socklen_t len); +int connect(int sockfd, const struct sockaddr *addr, socklen_t len); + +ssize_t send(int sockfd, const void *buf, size_t size, int flags); +ssize_t recv(int sockfd, void *buf, size_t len, int flags); + +ssize_t sendmsg(int socket, const struct msghdr *msg, int flags); +ssize_t recvmsg(int socket, struct msghdr *msg, int flags); + +#endif /* !_SYS_SOCKET_H_ */ diff --git a/sys/include/sys/socketvar.h b/sys/include/sys/socketvar.h new file mode 100644 index 0000000..e090a70 --- /dev/null +++ b/sys/include/sys/socketvar.h @@ -0,0 +1,53 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_SOCKETVAR_H_ +#define _SYS_SOCKETVAR_H_ + +#include <sys/types.h> +#if defined(_KERNEL) +#include <net/netbuf.h> + +/* + * Socket buffer + * + * @buf: Actual data buffer + * @head: Buffer head + * @tail: Buffer tail + * @watermark: Max length + */ +struct sockbuf { + struct netbuf buf; + size_t head; + size_t tail; + size_t watermark; +}; + +#endif /* _KERNEL */ +#endif /* !_SYS_SOCKETVAR_H_ */ diff --git a/sys/include/sys/spawn.h b/sys/include/sys/spawn.h index 3828d5c..28dbe5b 100644 --- a/sys/include/sys/spawn.h +++ b/sys/include/sys/spawn.h @@ -31,8 +31,9 @@ #define _SYS_SPAWN_H_ #include <sys/types.h> +#include <sys/param.h> #if !defined(_KERNEL) -pid_t spawn(const char *pathname, int flags); +pid_t spawn(const char *pathname, char **argv, char **envp, int flags); #endif /* _KERNEL */ #endif /* !_SYS_SPAWN_H_ */ diff --git a/sys/include/sys/spinlock.h b/sys/include/sys/spinlock.h index 140addc..b416152 100644 --- a/sys/include/sys/spinlock.h +++ b/sys/include/sys/spinlock.h @@ -44,9 +44,6 @@ void spinlock_release(struct spinlock *lock); int spinlock_try_acquire(struct spinlock *lock); int spinlock_usleep(struct spinlock *lock, size_t usec_max); -/* System-wide locking (be careful!!) */ -int syslock(void); -void sysrel(void); #endif #endif /* !_SYS_SPINLOCK_H_ */ diff --git a/sys/include/sys/stat.h b/sys/include/sys/stat.h index 6303630..5409f2c 100644 --- a/sys/include/sys/stat.h +++ b/sys/include/sys/stat.h @@ -32,6 +32,8 @@ #include <sys/types.h> +#define S_IFBLK 0060000 + struct stat { dev_t st_dev; ino_t st_ino; @@ -46,4 +48,6 @@ struct stat { time_t st_ctime; }; +int stat(const char *path, struct stat *buf); + #endif /* _SYS_STAT_H_ */ diff --git a/sys/include/sys/syscall.h b/sys/include/sys/syscall.h index 2223a96..604f937 100644 --- a/sys/include/sys/syscall.h +++ b/sys/include/sys/syscall.h @@ -48,6 +48,26 @@ #define SYS_write 7 #define SYS_spawn 8 #define SYS_reboot 9 +#define SYS_mmap 10 +#define SYS_munmap 11 +#define SYS_access 12 +#define SYS_lseek 13 +#define SYS_sleep 14 +#define SYS_inject 15 +#define SYS_getpid 16 +#define SYS_getppid 17 +#define SYS_setuid 18 +#define SYS_getuid 19 +#define SYS_waitpid 20 +#define SYS_socket 21 +#define SYS_bind 22 +#define SYS_recv 23 +#define SYS_send 24 +#define SYS_sendmsg 25 +#define SYS_recvmsg 26 +#define SYS_connect 27 +#define SYS_setsockopt 28 +#define SYS_disk 29 #if defined(_KERNEL) /* Syscall return value and arg type */ diff --git a/sys/include/sys/sysctl.h b/sys/include/sys/sysctl.h index 078135b..ce7510d 100644 --- a/sys/include/sys/sysctl.h +++ b/sys/include/sys/sysctl.h @@ -30,16 +30,35 @@ #ifndef _SYS_SYSCTL_H_ #define _SYS_SYSCTL_H_ -#include <sys/types.h> #if defined(_KERNEL) +#include <sys/types.h> #include <sys/syscall.h> +#else +#include <stdint.h> +#include <stddef.h> #endif #include <sys/param.h> +/* + * List of 'kern.* ' identifiers + */ #define KERN_OSTYPE 0 #define KERN_OSRELEASE 1 #define KERN_VERSION 2 #define KERN_VCACHE_TYPE 3 +#define KERN_HOSTNAME 4 + +/* + * List of 'hw.* ' identifiers + */ +#define HW_PAGESIZE 5 +#define HW_NCPU 6 +#define HW_MACHINE 7 + +/* + * List of 'proc.*' identifiers + */ +#define PROC_COUNT 8 /* * Option types (i.e., int, string, etc) for @@ -61,6 +80,7 @@ struct sysctl_entry { }; scret_t sys_sysctl(struct syscall_args *scargs); +int sysctl_clearstr(int name); #endif /* _KERNEL */ /* diff --git a/sys/include/sys/syslog.h b/sys/include/sys/syslog.h index defb341..b9d34ab 100644 --- a/sys/include/sys/syslog.h +++ b/sys/include/sys/syslog.h @@ -31,11 +31,13 @@ #define _SYS_SYSLOG_H_ #include <stdarg.h> +#include <stdbool.h> #if defined(_KERNEL) #define OMIT_TIMESTAMP "\x01" +void syslog_silence(bool option); void kprintf(const char *fmt, ...); void serial_init(void); void serial_putc(char c); diff --git a/sys/include/sys/systm.h b/sys/include/sys/systm.h index 42e1723..2f69175 100644 --- a/sys/include/sys/systm.h +++ b/sys/include/sys/systm.h @@ -39,6 +39,7 @@ int copyin(const void *uaddr, void *kaddr, size_t len); int copyout(const void *kaddr, void *uaddr, size_t len); int copyinstr(const void *uaddr, char *kaddr, size_t len); +int cpu_report_count(uint32_t count); __always_inline static inline void __sigraise(int signo) diff --git a/sys/include/sys/termios.h b/sys/include/sys/termios.h index 27339f1..a3ba794 100644 --- a/sys/include/sys/termios.h +++ b/sys/include/sys/termios.h @@ -33,8 +33,33 @@ /* * c_iflag: Input flags */ -#define ISTRIP 0x00000000 -#define ICRNL 0x00000001 +#define ISTRIP 0x00000001 /* Strip char */ +#define ICRNL 0x00000002 /* Map CR to NL */ +#define BRKINT 0x00000004 /* Signal interrupt on break */ +#define IGNBRK 0x00000008 /* Ignore break condition */ +#define IGNCR 0x00000010 /* Ignore CR */ +#define IGNPAR 0x00000020 /* Ignore chars with parity errors */ +#define INCLR 0x00000040 /* Map NL to CR */ +#define INPCK 0x00000080 /* Enable input parity check */ +#define IXANY 0x00000100 /* Enable any char to restart output */ +#define IXOFF 0x00000200 /* Enable start/stop control */ +#define PARMRK 0x00000400 /* Mark parity errors */ + +/* + * c_oflag: Output flags + */ +#define OPOST 0x00000001 /* Post-process output */ +#define ONLCR 0x00000002 /* Map NL to CR-NL on output */ +#define OCRNL 0x00000004 /* Map CR to NL on output */ +#define ONOCR 0x00000008 /* Map CR to output at col 0 */ +#define ONLRET 0x00000010 /* NL performs CR function */ +#define OFILL 0x00000020 /* Use fill chars for delay */ +#define NLDLY 0x00000040 /* Select newline type */ +#define CRDLY 0x00000080 /* Select carriage-return delays */ +#define TABDLY 0x00000100 /* Select horizontal-tab delays */ +#define BSDLY 0x00000200 /* Select backspace delays */ +#define VTDLY 0x00000400 /* Select veritcal tab delays */ +#define FFDLY 0x00000800 /* Select form-feed delays */ #define NCCS 20 diff --git a/sys/include/sys/time.h b/sys/include/sys/time.h new file mode 100644 index 0000000..ce66885 --- /dev/null +++ b/sys/include/sys/time.h @@ -0,0 +1,60 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_TIME_H_ +#define _SYS_TIME_H_ + +#include <sys/types.h> +#if defined(_KERNEL) +#include <sys/syscall.h> +#endif /* _KERNEL */ + +struct timeval { + time_t tv_sec; + time_t tv_usec; +}; + +struct timespec { + time_t tv_sec; + long tv_nsec; +}; + +struct date { + uint16_t year; + uint8_t month; + uint8_t day; + uint8_t sec; + uint8_t min; + uint8_t hour; +}; + +#if defined(_KERNEL) +scret_t sys_sleep(struct syscall_args *scargs); +#endif +#endif /* !_SYS_TIME_H_ */ diff --git a/sys/include/sys/tree.h b/sys/include/sys/tree.h index 1054ade..6954185 100644 --- a/sys/include/sys/tree.h +++ b/sys/include/sys/tree.h @@ -746,7 +746,6 @@ name##_RB_MINMAX(struct name *head, int val) \ ((x) != NULL) && ((y) = name##_RB_PREV(x), 1); \ (x) = (y)) - /* * Copyright (c) 2016 David Gwynne <dlg@openbsd.org> * diff --git a/sys/include/sys/types.h b/sys/include/sys/types.h index 5cb2fc7..223f455 100644 --- a/sys/include/sys/types.h +++ b/sys/include/sys/types.h @@ -82,11 +82,11 @@ typedef __uint64_t uint64_t; #endif #if __SIZEOF_SIZE_T__ == 8 -typedef uint64_t __size_t; -typedef int64_t __ssize_t; /* Byte count or error */ +typedef __uint64_t __size_t; +typedef __int64_t __ssize_t; /* Byte count or error */ #elif __SIZEOF_SIZE_T__ == 4 -typedef uint32_t __size_t; -typedef int32_t __ssize_t; /* Byte count or error */ +typedef __uint32_t __size_t; +typedef __int32_t __ssize_t; /* Byte count or error */ #else #error "Unsupported size_t size" #endif @@ -100,14 +100,15 @@ typedef __size_t uintptr_t; typedef __size_t off_t; typedef int pid_t; typedef int dev_t; -typedef uint32_t mode_t; -typedef uint32_t ino_t; -typedef uint32_t nlink_t; -typedef uint32_t uid_t; -typedef uint32_t gid_t; -typedef uint32_t blksize_t; -typedef uint32_t blkcnt_t; -typedef uint64_t time_t; +typedef __uint32_t uid_t; +typedef __uint32_t mode_t; +typedef __uint32_t ino_t; +typedef __uint32_t nlink_t; +typedef __uint32_t uid_t; +typedef __uint32_t gid_t; +typedef __uint32_t blksize_t; +typedef __uint32_t blkcnt_t; +typedef __uint64_t time_t; #if defined(_HAVE_PTRDIFF_T) typedef __ptrdiff_t ptrdiff_t; #endif /* _HAVE_PTRDIFF_T */ diff --git a/sys/include/sys/ucred.h b/sys/include/sys/ucred.h new file mode 100644 index 0000000..f8cbbe0 --- /dev/null +++ b/sys/include/sys/ucred.h @@ -0,0 +1,57 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_UCRED_H_ +#define _SYS_UCRED_H_ + +#include <sys/types.h> +#if defined(_KERNEL) +#include <sys/spinlock.h> +#include <sys/syscall.h> +#endif + +/* + * Kernel structure for user credentials + */ +struct ucred { + uid_t euid; + uid_t ruid; +#if defined(_KERNEL) + struct spinlock lock; +#endif /* _KERNEL */ +}; + +int setuid(uid_t new); +uid_t getuid(void); + +#if defined(_KERNEL) +scret_t sys_setuid(struct syscall_args *scargs); +scret_t sys_getuid(struct syscall_args *scargs); +#endif +#endif /* !_SYS_UCRED_H_ */ diff --git a/sys/include/sys/uio.h b/sys/include/sys/uio.h new file mode 100644 index 0000000..4318a53 --- /dev/null +++ b/sys/include/sys/uio.h @@ -0,0 +1,58 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_UIO_H_ +#define _SYS_UIO_H_ + +#if defined(_KERNEL) +#include <sys/types.h> +#else +#include <stdint.h> +#include <stddef.h> +#endif /* _KERNEL */ + +/* + * POSIX I/O vector + */ +struct iovec { + void *iov_base; + size_t iov_len; +}; + +ssize_t readv(int filedes, const struct iovec *iov, int iovcnt); +ssize_t writev(int filedes, const struct iovec *iov, int iovcnt); + +#if defined(_KERNEL) + +int uio_copyin(const struct iovec *u_iov, struct iovec *k_iov, int iovcnt); +int uio_copyout(const struct iovec *k_iov, struct iovec *u_iov, int iovcnt); +void uio_copyin_clean(struct iovec *copy, int iovcnt); + +#endif /* _KERNEL */ +#endif /* !_SYS_UIO_H_ */ diff --git a/sys/include/sys/vfs.h b/sys/include/sys/vfs.h index 1ff722a..fcb7391 100644 --- a/sys/include/sys/vfs.h +++ b/sys/include/sys/vfs.h @@ -40,6 +40,7 @@ scret_t sys_close(struct syscall_args *args); scret_t sys_read(struct syscall_args *scargs); scret_t sys_write(struct syscall_args *sargs); scret_t sys_stat(struct syscall_args *scargs); +scret_t sys_access(struct syscall_args *scargs); #endif /* _KERNEL */ #endif /* !_SYS_VFS_H_ */ diff --git a/sys/include/sys/vmstat.h b/sys/include/sys/vmstat.h new file mode 100644 index 0000000..b7faeb2 --- /dev/null +++ b/sys/include/sys/vmstat.h @@ -0,0 +1,48 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_VMSTAT_H_ +#define _SYS_VMSTAT_H_ + +#include <sys/types.h> + +/* + * Virtual memory statistics + * + * @mem_avail: Available memory in MiB + * @mem_used: Allocated memory in MiB + * @mem_total: Total system memory in MiB + */ +struct vm_stat { + uint32_t mem_avail; + uint32_t mem_used; + size_t mem_total; +}; + +#endif /* !_VM_STAT_H_ */ diff --git a/sys/include/sys/vnode.h b/sys/include/sys/vnode.h index 33092f9..ff6f995 100644 --- a/sys/include/sys/vnode.h +++ b/sys/include/sys/vnode.h @@ -32,11 +32,11 @@ #include <sys/types.h> #include <sys/queue.h> +#include <sys/vnode.h> #include <sys/atomic.h> #include <sys/sio.h> -#include <vm/vm_obj.h> - #if defined(_KERNEL) +#include <vm/vm_obj.h> struct vops; @@ -47,6 +47,8 @@ struct vnode { const struct vops *vops; struct vm_object vobj; uint32_t refcount; + dev_t major; + dev_t dev; TAILQ_ENTRY(vnode) vcache_link; }; @@ -74,6 +76,7 @@ struct vcache { #define VDIR 0x02 /* Directory */ #define VCHR 0x03 /* Character device */ #define VBLK 0x04 /* Block device */ +#define VSOCK 0x05 /* Socket */ #define VNOVAL -1 @@ -83,6 +86,23 @@ struct vop_lookup_args { struct vnode **vpp; /* Result vnode */ }; +struct vop_create_args { + const char *path; /* Full path */ + const char *ppath; /* Parent path */ + struct vnode *dirvp; /* Directory vnode */ + struct vnode **vpp; /* Result vnode */ +}; + +struct vop_getattr_args { + struct vnode *vp; /* Target vnode */ + struct vattr *res; /* Result vattr */ +}; + +struct vop_readdir_args { + struct vnode *vp; /* Target vnode */ + struct sio_txn *sio; /* SIO data to read into */ +}; + /* * A field in this structure is unavailable * if it has a value of VNOVAL. @@ -92,34 +112,33 @@ struct vattr { size_t size; }; -struct vop_getattr_args { - struct vnode *vp; - struct vattr *res; -}; - struct vops { int(*lookup)(struct vop_lookup_args *args); int(*getattr)(struct vop_getattr_args *args); + int(*readdir)(struct vop_readdir_args *args); int(*read)(struct vnode *vp, struct sio_txn *sio); int(*write)(struct vnode *vp, struct sio_txn *sio); int(*reclaim)(struct vnode *vp); + int(*create)(struct vop_create_args *args); }; extern struct vnode *g_root_vnode; +/* Vnode cache operations */ int vfs_vcache_type(void); int vfs_vcache_migrate(int newtype); - int vfs_vcache_enter(struct vnode *vp); struct vnode *vfs_recycle_vnode(void); +/* Vnode operations */ int vfs_alloc_vnode(struct vnode **res, int type); int vfs_release_vnode(struct vnode *vp); -int vfs_vop_lookup(struct vnode *vp, struct vop_lookup_args *args); +/* Vnode operation wrappers */ +int vfs_vop_lookup(struct vop_lookup_args *args); +int vfs_vop_getattr(struct vop_getattr_args *args); int vfs_vop_read(struct vnode *vp, struct sio_txn *sio); int vfs_vop_write(struct vnode *vp, struct sio_txn *sio); -int vfs_vop_getattr(struct vnode *vp, struct vop_getattr_args *args); #endif /* _KERNEL */ #endif /* !_SYS_VNODE_H_ */ diff --git a/sys/include/sys/vsr.h b/sys/include/sys/vsr.h new file mode 100644 index 0000000..e63cce1 --- /dev/null +++ b/sys/include/sys/vsr.h @@ -0,0 +1,165 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_VSR_H_ +#define _SYS_VSR_H_ + +#include <sys/types.h> +#include <sys/queue.h> +#include <sys/param.h> +#include <sys/ucred.h> +#include <sys/limits.h> +#if defined(_KERNEL) +#include <sys/mutex.h> +#endif /* _KERNEL */ + +struct proc; + +#define VSR_FILE 0x00000000 /* Represented by file */ + +/* + * Defines the access semantics of whether + * r/w operations should be passed down to the + * global state or soley affecting a per-process + * shallow copy. + */ +typedef uint32_t vsr_mode_t; + +/* + * The Virtual System Resource namespace consists of + * domains containing named "capsules". The domain is + * simply a table indexed by a type value e.g. VSR_FILE + * and a capsule is simply a structure containing global data + * as well as a shallow copy which is controlled locally by the + * process. The capsule also contains various access semantics + * that help the VSR subsystem determine whether the access should + * be passed down globally or virtualized locally within the process. + */ +typedef uint8_t vsr_domain_t; + +/* + * VSR mode bits + */ +#define VSR_GLOB_WRITE BIT(0) /* Writes are global */ +#define VSR_GLOB_READ BIT(1) /* Reads are global */ +#define VSR_GLOB_CRED BIT(2) /* Global for specific creds */ + +#if defined(_KERNEL) + +struct vsr_capsule; + +/* + * VSR capsule operations + * + * @reclaim: Cleanup resources + */ +struct capsule_ops { + int(*reclaim)(struct vsr_capsule *cap, int flags); +}; + +/* + * Virtual system resource access + * semantics. + * + * @glob: Global data + * @shallow: Local per process copy + * @mode: VSR mode (see VSR_GLOB_*) + * @cred: Creds (used if VSR_GLOBAL_CRED set) + */ +struct vsr_access { + void *glob; + void *shallow; + vsr_mode_t mode; + struct ucred cred; +}; + +/* + * A virtual system resource capsule containing + * resource owner specific data and hashmap + * buckets. + * + * @name: Capsule name (e.g., "consfeat"), must be freed + * @data: Owner specific data + * @shadow: Local shadow copy (per-process) + * @buckets: Hashmap buckets + * @link: Bucket link + * @ops: Capsule operations + * @lock: Mutex lock protecting fields + */ +struct vsr_capsule { + char *name; + void *data; + void *shadow; + TAILQ_HEAD(, vsr_capsule) buckets; + TAILQ_ENTRY(vsr_capsule) link; + struct capsule_ops ops; + struct mutex lock; +}; + +/* + * Virtual system resource table containg + * VSRs for various types. + * + * Each VSR table belongs to a VSR domain + * (e.g., VSR_FILE). + * + * @ncaps: Number of capsules + * @is_init: Set if hashmap is set up + * @capsules: VSR capsule hashmap + */ +struct vsr_table { + struct vsr_capsule *capsules[VSR_MAX_CAPSULE]; +}; + +/* + * Virtual system resource domain (VSR). + * + * A VSR is represented by a specific VSR type + * (see VSR_*). Each VSR has a table of VSR capsules + * looked up by a VSR capsule name. + * + * One per process. + * + * @type: VSR type + * @table: VSR table + */ +struct vsr_domain { + int type; + struct vsr_table table; +}; + +void vsr_init_domains(struct proc *td); +void vsr_destroy_domains(struct proc *td); + +struct vsr_domain *vsr_new_domain(struct proc *td, vsr_domain_t type); +struct vsr_capsule *vsr_new_capsule(struct proc *td, vsr_domain_t type, const char *name); +struct vsr_capsule *vsr_lookup_capsule(struct proc *td, vsr_domain_t type, const char *name); + +#endif /* _KERNEL */ +#endif /* !_SYS_VSR_H_ */ diff --git a/sys/include/sys/wait.h b/sys/include/sys/wait.h new file mode 100644 index 0000000..07a2d4e --- /dev/null +++ b/sys/include/sys/wait.h @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_WAIT_H_ +#define _SYS_WAIT_H_ + +#include <sys/types.h> + +pid_t waitpid(pid_t pid, int *wstatus, int options); + +#endif /* !_SYS_WAIT_H_ */ diff --git a/sys/include/sys/workqueue.h b/sys/include/sys/workqueue.h new file mode 100644 index 0000000..9925f79 --- /dev/null +++ b/sys/include/sys/workqueue.h @@ -0,0 +1,101 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _SYS_WORKQUEUE_H_ +#define _SYS_WORKQUEUE_H_ + +#if defined(_KERNEL) + +#include <sys/types.h> +#include <sys/queue.h> +#include <sys/mutex.h> +#include <sys/proc.h> + +struct workqueue; +struct work; + +/* + * A work function can either refer to a work thread + * entry (or actual work to be done + */ +typedef void(*workfunc_t)(struct workqueue *wqp, struct work *wp); + +/* + * Represents work that may be added to a + * workqueue. + * + * @name: Name of this work/task [i] + * @data: Optional data to be passed with work [p] + * @func: Function with work to be done [p] + * @cookie: Used for validating the work structure [i] + * + * Field attributes: + * - [i]: Used internally + * - [p]: Used as parameter + */ +struct work { + char *name; + void *data; + workfunc_t func; + TAILQ_ENTRY(work) link; +}; + +/* + * A workqueue contains tasks that are + * queued up to be completed in their own + * thread context. + * + * @name: Name of workqueue. + * @work: Start of the workqueue + * @ipl: IPL that work here must run with + * @max_work: Max number of jobs that can be queued + * @nwork: Number of tasks to be done + * @cookie: For validating workqueues + * @worktd: Thread associated with the workqueue + * @lock: Protects the workqueue + */ +struct workqueue { + char *name; + TAILQ_HEAD(, work) work; + uint8_t ipl; + size_t max_work; + ssize_t nwork; + uint16_t cookie; + struct proc *worktd; + struct mutex *lock; +}; + +struct workqueue *workqueue_new(const char *name, size_t max_work, int ipl); + +int workqueue_enq(struct workqueue *wqp, const char *name, struct work *wp); +int workqueue_destroy(struct workqueue *wqp); +int work_destroy(struct work *wp); + +#endif /* !_KERNEL */ +#endif /* !_SYS_WORKQUEUE_H_ */ diff --git a/sys/include/vm/physmem.h b/sys/include/vm/physmem.h index ae11530..3f1da61 100644 --- a/sys/include/vm/physmem.h +++ b/sys/include/vm/physmem.h @@ -32,6 +32,10 @@ #include <sys/types.h> +uint32_t vm_mem_used(void); +uint32_t vm_mem_free(void); +size_t vm_mem_total(void); + void vm_physmem_init(void); uintptr_t vm_alloc_frame(size_t count); void vm_free_frame(uintptr_t base, size_t count); diff --git a/sys/include/vm/pmap.h b/sys/include/vm/pmap.h index 9eed184..e0549d4 100644 --- a/sys/include/vm/pmap.h +++ b/sys/include/vm/pmap.h @@ -76,9 +76,25 @@ int pmap_map(struct vas vas, vaddr_t va, paddr_t pa, vm_prot_t prot); int pmap_unmap(struct vas vas, vaddr_t va); /* + * Returns true if the page is clean (modified), otherwise + * returns false. + */ +bool pmap_is_clean(struct vas vas, vaddr_t va); + +/* + * Marks a page as clean (unmodified) + */ +void pmap_mark_clean(struct vas vas, vaddr_t va); + +/* * Mark a virtual address with a specific * caching type. */ int pmap_set_cache(struct vas vas, vaddr_t va, int type); +/* + * Machine dependent pmap init code. + */ +int pmap_init(void); + #endif /* !_VM_PMAP_H_ */ diff --git a/sys/include/vm/stat.h b/sys/include/vm/stat.h new file mode 100644 index 0000000..7e9a4a9 --- /dev/null +++ b/sys/include/vm/stat.h @@ -0,0 +1,39 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _VM_STAT_H_ +#define _VM_STAT_H_ + +#include <sys/types.h> +#include <sys/vmstat.h> + +int vm_stat_get(struct vm_stat *vmstat); +void vm_stat_init(void); + +#endif /* !_VM_STAT_H_ */ diff --git a/sys/include/vm/vm_device.h b/sys/include/vm/vm_device.h new file mode 100644 index 0000000..da476e2 --- /dev/null +++ b/sys/include/vm/vm_device.h @@ -0,0 +1,43 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _VM_DEVICE_H_ +#define _VM_DEVICE_H_ + +#include <sys/types.h> +#include <sys/vnode.h> +#include <sys/device.h> +#include <vm/vm_pager.h> +#include <vm/vm_obj.h> + +extern const struct vm_pagerops vm_vnops; + +struct vm_object *dv_attach(devmajor_t major, dev_t dev, vm_prot_t prot); + +#endif /* !_VM_DEVICE_H_ */ diff --git a/sys/include/vm/vm_pager.h b/sys/include/vm/vm_pager.h index e0503e0..4732234 100644 --- a/sys/include/vm/vm_pager.h +++ b/sys/include/vm/vm_pager.h @@ -40,7 +40,6 @@ struct vm_pagerops; extern const struct vm_pagerops vm_vnops; extern const struct vm_pagerops vm_anonops; - /* * Pager operations. * diff --git a/sys/kern/disk_engine.c b/sys/kern/disk_engine.c new file mode 100644 index 0000000..1061165 --- /dev/null +++ b/sys/kern/disk_engine.c @@ -0,0 +1,208 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/errno.h> +#include <sys/syscall.h> +#include <sys/syslog.h> +#include <sys/systm.h> +#include <sys/disk.h> +#include <vm/dynalloc.h> + +#define pr_trace(fmt, ...) kprintf("disk: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) + +/* + * Clones a disk parameter structure passed + * by a user. The structure returned is safe + * to be accessed freely by the kernel. + * + * @u_param: Contains user-side pointer + * @res: Resulting safe data + * + * Returns zero on success, otherwise a less than + * zero value is returned. + */ +static int +disk_param_clone(struct disk_param *u_param, struct disk_param *res) +{ + void *data; + int error; + + if (u_param == NULL) { + pr_error("disk_param_clone: got NULL u_param\n"); + return -EINVAL; + } + + error = copyin(u_param, res, sizeof(*res)); + if (error < 0) { + return error; + } + + /* + * If these parameters do not have a valid cookie, fuck + * that object, something is not right with it... + */ + if (res->cookie != DISK_PARAM_COOKIE) { + pr_error("disk_param_clone: erroneous params (bad cookie)\n"); + return -EACCES; + } + + data = dynalloc(res->size); + if (data == NULL) { + pr_error("disk_param_clone: out of memory\n"); + return -ENOMEM; + } + + error = copyin(res->buf, data, res->size); + if (error < 0) { + pr_error("failed to copy in param data\n"); + dynfree(data); + return error; + } + + res->u_buf = res->buf; + res->buf = data; + return 0; +} + +/* + * Deallocate a kernel managed disk parameter + * structure created by disk_param_clone() + * + * @param: Params to free + * + * Returns zero on success, otherwise a less than + * zero value is returned. + */ +static int +disk_param_free(struct disk_param *param) +{ + if (param == NULL) { + return -EINVAL; + } + + if (param->cookie != DISK_PARAM_COOKIE) { + return -EACCES; + } + + dynfree(param->buf); + return 0; +} + +/* + * Perform an operation on a disk. + * + * @id: ID of disk to operate on + * @opcode: Operation to perform (see DISK_IO_*) + * @u_param: User side disk parameters + * + * Returns a less than zero value on error + */ +static ssize_t +disk_mux_io(diskid_t id, diskop_t opcode, struct disk_param *u_param) +{ + struct disk_param param; + struct disk *dp; + ssize_t retval = -EIO; + int error; + + if (u_param == NULL) { + return -EINVAL; + } + + error = disk_param_clone(u_param, ¶m); + if (error < 0) { + return error; + } + + /* First, attempt to acquire the disk */ + error = disk_get_id(id, &dp); + if (error < 0) { + pr_error("disk_mux_io: no such device (id=%d)\n", id); + return error; + } + + switch (opcode) { + case DISK_IO_READ: + retval = disk_read( + id, + param.blk, + param.buf, + param.size + ); + + /* Write back the data to the user program */ + error = copyout(param.buf, param.u_buf, param.size); + if (error < 0) { + retval = error; + } + break; + case DISK_IO_WRITE: + retval = disk_write( + id, + param.blk, + param.buf, + param.size + ); + break; + case DISK_IO_QUERY: + retval = disk_query( + id, + param.buf + ); + + /* Write back info to user program */ + error = copyout(param.buf, param.u_buf, param.size); + if (error < 0) { + retval = error; + } + break; + } + + disk_param_free(¶m); + return retval; +} + +/* + * Disk I/O multiplexer syscall + * + * arg0: disk id + * arg1: opcode + * arg2: disk params + */ +scret_t +sys_disk(struct syscall_args *scargs) +{ + struct disk_param *u_param = (void *)scargs->arg2; + diskid_t id = scargs->arg0; + diskop_t opcode = scargs->arg1; + + return disk_mux_io(id, opcode, u_param); +} diff --git a/sys/kern/driver_blacklist.c b/sys/kern/driver_blacklist.c new file mode 100644 index 0000000..982d5c9 --- /dev/null +++ b/sys/kern/driver_blacklist.c @@ -0,0 +1,170 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/errno.h> +#include <sys/queue.h> +#include <sys/driver.h> +#include <vm/dynalloc.h> +#include <string.h> + +#define BLACKLIST_SIZE 64 + +/* + * A driver blacklist entry + * + * @name: Name of driver to be blacklisted + * @buckets: To handle collisions + */ +struct blacklist_entry { + char *name; + TAILQ_ENTRY(blacklist_entry) link; + TAILQ_HEAD(, blacklist_entry) buckets; +}; + +static struct blacklist_entry blacklist[BLACKLIST_SIZE]; + +static uint32_t +fnv1_hash(const char *s) +{ + uint32_t hash = 2166136261UL; + const uint8_t *p = (uint8_t *)s; + + while (*p != '\0') { + hash ^= *p; + hash = hash * 0x01000193; + ++p; + } + + return hash; +} + +/* + * Returns a bucket in case of collision + */ +static struct blacklist_entry * +blacklist_collide(struct blacklist_entry *entp, const char *name) +{ + struct blacklist_entry *tmp; + + if (entp->name == NULL) { + return NULL; + } + + TAILQ_FOREACH(tmp, &entp->buckets, link) { + if (strcmp(name, tmp->name) == 0) { + return tmp; + } + } + + return NULL; +} + +/* + * Mark a driver to be ignored during startup. + * Blacklisted drivers will not be ran. + * + * @name: Name of driver (e.g., 'ahci') + */ +int +driver_blacklist(const char *name) +{ + struct blacklist_entry *ent; + struct blacklist_entry *bucket; + size_t name_len; + uint32_t hash; + + if (name == NULL) { + return -EINVAL; + } + + hash = fnv1_hash(name); + ent = &blacklist[hash % BLACKLIST_SIZE]; + if (ent->name != NULL) { + bucket = dynalloc(sizeof(*bucket)); + if (bucket == NULL) { + return -EINVAL; + } + TAILQ_INSERT_TAIL(&ent->buckets, bucket, link); + return 0; + } + + name_len = strlen(name); + ent->name = dynalloc(name_len + 1); + if (ent->name == NULL) { + return -ENOMEM; + } + memcpy(ent->name, name, name_len + 1); + return 0; +} + +/* + * Checks if a driver name is in the blacklist. + * Returns 0 if not, otherwise 1. + */ +int +driver_blacklist_check(const char *name) +{ + struct blacklist_entry *ent; + uint32_t hash; + + if (name == NULL) { + return -EINVAL; + } + + hash = fnv1_hash(name); + ent = &blacklist[hash % BLACKLIST_SIZE]; + if (ent->name == NULL) { + return 0; + } + + if (strcmp(ent->name, name) == 0) { + return 1; + } + + ent = blacklist_collide(ent, name); + if (ent != NULL) { + return 1; + } + + return 0; +} + +/* + * Initialize each entry in the driver + * blacklist + */ +void +driver_blacklist_init(void) +{ + for (size_t i = 0; i < BLACKLIST_SIZE; ++i) { + blacklist[i].name = NULL; + TAILQ_INIT(&blacklist[i].buckets); + } +} diff --git a/sys/kern/driver_subr.c b/sys/kern/driver_subr.c new file mode 100644 index 0000000..a0f9f73 --- /dev/null +++ b/sys/kern/driver_subr.c @@ -0,0 +1,76 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/driver.h> +#include <sys/proc.h> +#include <sys/cdefs.h> +#include <sys/syslog.h> +#include <sys/panic.h> +#include <dev/timer.h> +#include <machine/sync.h> + +/* + * Initialize early drivers + * + * XXX: This should *NOT* be called directly, + * use DRIVERS_SCHED() instead. + */ +void +__driver_init_td(void) +{ + const struct driver *dp; + struct driver_var *var; + struct proc *td; + uintptr_t start, end; + + td = this_td(); + start = (uintptr_t)__driversd_init_start; + end = (uintptr_t)__driversd_init_end; + + for (dp = (void *)start; (uintptr_t)dp < end; ++dp) { + var = dp->data; + + /* + * Check the blacklist to see if this driver + * is marked to be ignored. If so, just continue + * to the next. + */ + if (driver_blacklist_check(dp->name)) { + continue; + } + + if (var->deferred) { + dp->init(); + var->deferred = 0; + } + } + + exit1(td, 0); + __builtin_unreachable(); +} diff --git a/sys/kern/exec_elf64.c b/sys/kern/exec_elf64.c index 3767b0b..8dc87dc 100644 --- a/sys/kern/exec_elf64.c +++ b/sys/kern/exec_elf64.c @@ -49,11 +49,43 @@ #define PHDR(HDRP, IDX) \ (void *)((uintptr_t)HDRP + (HDRP)->e_phoff + (HDRP->e_phentsize * IDX)) +#define SHDR(HDRP, IDX) \ + (void *)((uintptr_t)HDRP + (HDRP)->e_shoff + (HDRP->e_shentsize * IDX)) + struct elf_file { char *data; size_t size; }; +static int +elf_parse_shdrs(Elf64_Ehdr *eh) +{ + Elf64_Shdr *shp; + uint32_t nshdr; + + if (eh == NULL) { + return -EINVAL; + } + + nshdr = eh->e_shnum; + for (uint32_t i = 0; i < nshdr; ++i) { + shp = SHDR(eh, i); + + /* Drop null entries */ + if (shp->sh_type == SHT_NULL) { + continue; + } + + switch (shp->sh_type) { + case SHT_NOBITS: + memset((void *)shp->sh_addr, 0x0, shp->sh_size); + break; + } + } + + return 0; +} + /* * Load the file and give back an "elf_file" * structure. @@ -80,7 +112,7 @@ elf_get_file(const char *pathname, struct elf_file *res) getattr_args.res = &vattr; getattr_args.vp = vp; - status = vfs_vop_getattr(vp, &getattr_args); + status = vfs_vop_getattr(&getattr_args); if (status != 0) goto done; @@ -192,6 +224,7 @@ elf64_load(const char *pathname, struct proc *td, struct exec_prog *prog) if ((status = elf64_verify(hdr)) != 0) goto done; + memset(loadmap, 0, sizeof(loadmap)); pcbp = &td->pcb; start = -1; end = 0; @@ -242,6 +275,7 @@ elf64_load(const char *pathname, struct proc *td, struct exec_prog *prog) } } + elf_parse_shdrs(hdr); memcpy(prog->loadmap, loadmap, sizeof(loadmap)); prog->start = start; prog->end = end; diff --git a/sys/kern/init_main.c b/sys/kern/init_main.c index 146c4a9..4a0f7a8 100644 --- a/sys/kern/init_main.c +++ b/sys/kern/init_main.c @@ -35,15 +35,26 @@ #include <sys/exec.h> #include <sys/driver.h> #include <sys/panic.h> +#include <sys/sysctl.h> +#include <sys/systm.h> #include <dev/acpi/uacpi.h> #include <dev/cons/cons.h> #include <dev/acpi/acpi.h> #include <machine/cpu.h> #include <machine/cdefs.h> #include <vm/vm.h> +#include <vm/stat.h> #include <string.h> -static struct proc proc0; +#define _START_PATH "/usr/sbin/init" +#if defined(_INSTALL_MEDIA) +#define _START_ARG "/usr/sbin/install" +#else +#define _START_ARG NULL +#endif /* _INSTALL_MEDIA */ + +struct proc g_proc0; +struct proc *g_init; static void copyright(void) @@ -57,9 +68,10 @@ start_init(void) { struct proc *td = this_td(); struct execve_args execve_args; - char *argv[] = { "/usr/bin/osh", NULL }; + char *argv[] = { _START_PATH, _START_ARG, NULL }; char *envp[] = { NULL }; + kprintf("starting init...\n"); execve_args.pathname = argv[0]; execve_args.argv = argv; execve_args.envp = envp; @@ -93,23 +105,35 @@ main(void) /* Init the virtual file system */ vfs_init(); + /* Init vmstats */ + vm_stat_init(); + /* Expose the console to devfs */ cons_expose(); - uacpi_init(); - /* Start scheduler and bootstrap APs */ md_intoff(); sched_init(); + memset(&g_proc0, 0, sizeof(g_proc0)); + sysctl_clearstr(KERN_HOSTNAME); + /* Startup pid 1 */ - memset(&proc0, 0, sizeof(proc0.tf)); - spawn(&proc0, start_init, NULL, 0, NULL); + spawn(&g_proc0, start_init, NULL, 0, &g_init); + md_inton(); + + uacpi_init(); - /* Load all drivers */ + /* Load all early drivers */ DRIVERS_INIT(); - /* Bootstrap APs and here we go! */ + /* Only log to kmsg from here */ + syslog_silence(true); + + /* + * Bootstrap APs, schedule all other drivers + * and here we go! + */ mp_bootstrap_aps(&g_bsp_ci); sched_enter(); __builtin_unreachable(); diff --git a/sys/kern/kern_accnt.c b/sys/kern/kern_accnt.c new file mode 100644 index 0000000..51905e7 --- /dev/null +++ b/sys/kern/kern_accnt.c @@ -0,0 +1,128 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/* + * System Accounting + */ + +#include <sys/sched.h> +#include <sys/schedvar.h> +#include <sys/proc.h> +#include <fs/ctlfs.h> +#include <machine/cpu.h> +#include <string.h> + +/* Called within kern_sched.c */ +void sched_accnt_init(void); + +static struct ctlops sched_stat_ctl; +volatile size_t g_nthreads; + +static int +ctl_stat_read(struct ctlfs_dev *cdp, struct sio_txn *sio) +{ + struct sched_stat stat; + + if (sio->len > sizeof(stat)) { + sio->len = sizeof(stat); + } + + sched_stat(&stat); + memcpy(sio->buf, &stat, sio->len); + return sio->len; +} + +static uint16_t +cpu_nhlt(void) +{ + uint16_t nhlt = 0; + struct cpu_info *ci; + + for (size_t i = 0; i < CPU_MAX; ++i) { + ci = cpu_get(i); + if (ci == NULL) { + continue; + } + if (!ci->online) { + ++nhlt; + } + } + + return nhlt; +} + +/* + * Get scheduler accounting information + * + * @statp: Info gets copied here + */ +void +sched_stat(struct sched_stat *statp) +{ + struct sched_cpu *cpustat; + + statp->nproc = atomic_load_64(&g_nthreads); + statp->ncpu = cpu_count(); + statp->quantum_usec = DEFAULT_TIMESLICE_USEC; + statp->nhlt = cpu_nhlt(); + + /* + * Setup the per-cpu info/statistics + */ + for (int i = 0; i < CPU_MAX; ++i) { + cpustat = cpu_get_stat(i); + if (cpustat == NULL) { + break; + } + + statp->cpus[i] = *cpustat; + } +} + +void +sched_accnt_init(void) +{ + char devname[] = "sched"; + struct ctlfs_dev ctl; + + /* + * Register some accounting information in + * '/ctl/sched/stat' + */ + ctl.mode = 0444; + ctlfs_create_node(devname, &ctl); + ctl.devname = devname; + ctl.ops = &sched_stat_ctl; + ctlfs_create_entry("stat", &ctl); +} + +static struct ctlops sched_stat_ctl = { + .read = ctl_stat_read, + .write = NULL +}; diff --git a/sys/kern/kern_cpu.c b/sys/kern/kern_cpu.c new file mode 100644 index 0000000..69d44c4 --- /dev/null +++ b/sys/kern/kern_cpu.c @@ -0,0 +1,61 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/systm.h> +#include <sys/sysctl.h> +#include <sys/types.h> + +/* + * Report the number of processors that are online + * in the machine. + * + * @count: Number of processors active + * + * Returns zero on success, otherwise a less + * than zero value is returned. + */ +int +cpu_report_count(uint32_t count) +{ + struct sysctl_args args; + int error, name = HW_NCPU; + + args.name = &name; + args.nlen = 1; + args.oldlenp = 0; + args.oldp = NULL; + args.newp = &count; + args.newlen = sizeof(count); + + if ((error = sysctl(&args)) != 0) { + return error; + } + + return 0; +} diff --git a/sys/kern/kern_cred.c b/sys/kern/kern_cred.c new file mode 100644 index 0000000..017b22a --- /dev/null +++ b/sys/kern/kern_cred.c @@ -0,0 +1,87 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/errno.h> +#include <sys/ucred.h> +#include <sys/proc.h> + +int +setuid(uid_t new) +{ + struct proc *td; + struct ucred *cur_cred; + + td = this_td(); + cur_cred = &td->cred; + + /* + * Only root can become other users. If you are not + * root, fuck off. + */ + if (cur_cred->ruid != 0) { + return -EPERM; + } + + spinlock_acquire(&cur_cred->lock); + cur_cred->euid = new; + cur_cred->ruid = new; + spinlock_release(&cur_cred->lock); + return 0; +} + +uid_t +getuid(void) +{ + struct proc *td; + + td = this_td(); + if (td == NULL) { + return -1; + } + + return td->cred.ruid; +} + +/* + * setuid() syscall + * + * arg0: `new' + */ +scret_t +sys_setuid(struct syscall_args *scargs) +{ + return setuid(scargs->arg0); +} + +scret_t +sys_getuid(struct syscall_args *scargs) +{ + return getuid(); +} diff --git a/sys/kern/kern_descrip.c b/sys/kern/kern_descrip.c index d122e89..83845f6 100644 --- a/sys/kern/kern_descrip.c +++ b/sys/kern/kern_descrip.c @@ -41,6 +41,7 @@ /* * Allocate a file descriptor. * + * @td: Process to allocate from (null for CURRENT) * @fd_out: Pointer to allocated file descriptor output. * * This routine will create a new file descriptor @@ -49,10 +50,13 @@ * Returns 0 on success. */ int -fd_alloc(struct filedesc **fd_out) +fd_alloc(struct proc *td, struct filedesc **fd_out) { struct filedesc *fd; - struct proc *td = this_td(); + + if (td == NULL) { + td = this_td(); + } /* Find free fd table entry */ for (size_t i = 3; i < PROC_MAX_FILEDES; ++i) { @@ -85,12 +89,15 @@ fd_alloc(struct filedesc **fd_out) * Fetch a file descriptor from a file descriptor * number. * + * @td: Process to get fd from (NULL for current) * @fdno: File descriptor to fetch */ struct filedesc * -fd_get(unsigned int fdno) +fd_get(struct proc *td, unsigned int fdno) { - struct proc *td = this_td(); + if (td == NULL) { + td = this_td(); + } if (fdno > PROC_MAX_FILEDES) { return NULL; @@ -111,7 +118,7 @@ fd_close(unsigned int fd) struct filedesc *filedes; struct proc *td; - if ((filedes = fd_get(fd)) == NULL) { + if ((filedes = fd_get(NULL, fd)) == NULL) { return -EBADF; } @@ -149,18 +156,32 @@ fd_rw(unsigned int fd, void *buf, size_t count, uint8_t write) { char *kbuf = NULL; ssize_t n; + uint32_t seal; struct filedesc *filedes; struct sio_txn sio; scret_t retval = 0; + if (fd > PROC_MAX_FILEDES) { + return -EBADF; + } + if (count > SSIZE_MAX) { retval = -EINVAL; goto done; } - filedes = fd_get(fd); - kbuf = dynalloc(count); + filedes = fd_get(NULL, fd); + seal = filedes->flags; + /* Check the seal */ + if (write && !ISSET(seal, O_ALLOW_WR)) { + return -EPERM; + } + if (!write && ISSET(seal, O_WRONLY)) { + return -EPERM; + } + + kbuf = dynalloc(count); if (kbuf == NULL) { retval = -ENOMEM; goto done; @@ -187,6 +208,7 @@ fd_rw(unsigned int fd, void *buf, size_t count, uint8_t write) sio.buf = kbuf; sio.offset = filedes->offset; + spinlock_acquire(&filedes->lock); if (write) { /* Copy in user buffer */ if (copyin(buf, kbuf, count) < 0) { @@ -205,19 +227,52 @@ fd_rw(unsigned int fd, void *buf, size_t count, uint8_t write) goto done; } + /* End of file? */ + if (n == 0) { + retval = 0; + goto done; + } + if (copyout(kbuf, buf, count) < 0) { retval = -EFAULT; goto done; } } - retval = count; + + /* Increment the offset per read */ + filedes->offset += n; + retval = n; done: if (kbuf != NULL) { dynfree(kbuf); } + spinlock_release(&filedes->lock); return retval; } +static int +fd_do_create(const char *path, struct nameidata *ndp) +{ + struct vop_create_args cargs; + struct vnode *dirvp = ndp->vp; + const struct vops *vops = dirvp->vops; + int error; + + if (vops->create == NULL) { + return -EINVAL; + } + + cargs.path = path; + cargs.ppath = ndp->path; + cargs.dirvp = dirvp; + cargs.vpp = &ndp->vp; + if ((error = vops->create(&cargs)) < 0) { + return error; + } + + return 0; +} + int fd_read(unsigned int fd, void *buf, size_t count) { @@ -236,28 +291,35 @@ fd_write(unsigned int fd, void *buf, size_t count) * * @pathname: Path of file to open. * @flags: Flags to use. - * - * TODO: Use of flags. */ int fd_open(const char *pathname, int flags) { int error; + const struct vops *vops; struct filedesc *filedes; struct nameidata nd; nd.path = pathname; - nd.flags = 0; + nd.flags = ISSET(flags, O_CREAT) ? NAMEI_WANTPARENT : 0; if ((error = namei(&nd)) < 0) { return error; } - if ((error = fd_alloc(&filedes)) != 0) { + if ((error = fd_alloc(NULL, &filedes)) != 0) { vfs_release_vnode(nd.vp); return error; } + vops = nd.vp->vops; + if (ISSET(flags, O_CREAT) && vops->create != NULL) { + error = fd_do_create(pathname, &nd); + } + if (error < 0) { + return error; + } + filedes->vp = nd.vp; filedes->flags = flags; return filedes->fdno; @@ -266,18 +328,25 @@ fd_open(const char *pathname, int flags) /* * Duplicate a file descriptor. New file descriptor * points to the same vnode. + * + * @td: Process of fd to dup (NULL for current) + * @fd: File descriptor to dup */ int -fd_dup(int fd) +fd_dup(struct proc *td, int fd) { int error; struct filedesc *new_desc, *tmp; - tmp = fd_get(fd); + if (td == NULL) { + td = this_td(); + } + + tmp = fd_get(td, fd); if (tmp == NULL) return -EBADF; - if ((error = fd_alloc(&new_desc)) != 0) + if ((error = fd_alloc(td, &new_desc)) != 0) return error; /* Ref that vnode before we point to it */ @@ -285,3 +354,51 @@ fd_dup(int fd) new_desc->vp = tmp->vp; return new_desc->fdno; } + +off_t +fd_seek(int fildes, off_t offset, int whence) +{ + struct filedesc *tmp; + struct vattr attr; + struct vop_getattr_args getattr_args; + + tmp = fd_get(NULL, fildes); + if (tmp == NULL) { + return -EBADF; + } + + getattr_args.vp = tmp->vp; + getattr_args.res = &attr; + if ((vfs_vop_getattr(&getattr_args)) < 0) { + return -EPIPE; + } + + switch (whence) { + case SEEK_SET: + tmp->offset = offset; + break; + case SEEK_CUR: + tmp->offset += offset; + break; + case SEEK_END: + tmp->offset = attr.size + offset; + break; + default: + return -EINVAL; + } + + return tmp->offset; +} + +/* + * Update file offset + * + * arg0: `filedes' + * arg1: `offset' + * arg2: `whence' + */ +scret_t +sys_lseek(struct syscall_args *scargs) +{ + return fd_seek(scargs->arg0, scargs->arg1, scargs->arg2); +} diff --git a/sys/kern/kern_disk.c b/sys/kern/kern_disk.c new file mode 100644 index 0000000..a3fa05e --- /dev/null +++ b/sys/kern/kern_disk.c @@ -0,0 +1,475 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/queue.h> +#include <sys/errno.h> +#include <sys/syslog.h> +#include <sys/sio.h> +#include <sys/param.h> +#include <sys/panic.h> +#include <sys/spinlock.h> +#include <sys/device.h> +#include <sys/disk.h> +#include <vm/dynalloc.h> +#include <assert.h> +#include <string.h> + +#define pr_trace(fmt, ...) kprintf("disk: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) + +#define DEFAULT_BSIZE 512 /* Default block size in bytes */ +#define DISKQ_COOKIE 0xD9EA /* Verification cookie */ + +/* + * The maximum disks supported by the kernel + * is defined by the `DISK_MAX' kconf(9) option. + * + * We define a default of 16 if that option is not + * specified. + */ +#if defined(__DISK_MAX) +#define DISK_MAX __DISK_MAX +#else +#define DISK_MAX 16 /* Maximum disks */ +#endif + +/* + * We set a hard limit at 64 disks to prevent misconfiguration as + * it is unlikely that one would ever have that many on a single + * instance. Though of course, anything is possible, so one may + * patch the hard limit defined below to a higher value if needed. + */ +__static_assert(DISK_MAX < 64, "DISK_MAX exceeds hard limit"); + +/* + * The disk queue stores descriptors of disks that + * are registered with the system. This allows for + * easy and simplified access of the storage medium. + * + * XXX: An array would be more efficent, however disks + * could be detached or swapped during runtime thus + * making the usage of queues a more sane design. + * + * This also provides the added benefit of lazy-allocation + * so memory isn't wasted and only allocated when we actually + * have a disk descriptor that it would be used to store. + */ +static struct spinlock diskq_lock; +static TAILQ_HEAD(, disk) diskq; +static uint16_t disk_count = 0; +static uint16_t diskq_cookie = 0; + +/* + * Verify that a disk descriptor has been properly + * initialized by comparing against the cookie field. + * + * Returns a value of zero if valid, otherwise a less + * than zero value is returned. + */ +__always_inline static inline int +check_disk_cookie(struct disk *dp) +{ + __assert(dp != NULL); + return (dp->cookie == DISKQ_COOKIE) ? 0 : -1; +} + +/* + * Verify if the disk queue is initialized and + * ready for descriptors to be added. + * + * Returns a value of zero if it has already been + * initialized, otherwise a value less than zero + * is returned after check_diskq() initializes + * the disk queue. + */ +static inline int +check_diskq(void) +{ + if (diskq_cookie != DISKQ_COOKIE) { + TAILQ_INIT(&diskq); + diskq_cookie = DISKQ_COOKIE; + return -1; + } + + return 0; +} + +/* + * Acquire a disk descriptor through a zero-based + * disk index. Returns a pointer to the disk descriptor + * on success, otherwise a less than zero value is returned. + * + * @id: Disk index + * + * XXX: This is the lockless internal implementation, + * please use disk_get_id() instead. + */ +static struct disk * +__disk_get_id(diskid_t id) +{ + struct disk *dp; + + if (id >= disk_count) { + return NULL; + } + + dp = TAILQ_FIRST(&diskq); + if (dp == NULL) { + return NULL; + } + + /* + * Now, we start at the first disk entry and + * traverse the list. If the ID of a disk matches + * the ID we are looking for, return it. + */ + while (dp != NULL) { + if (dp->id == id) { + return dp; + } + + dp = TAILQ_NEXT(dp, link); + } + + /* Nothing found :( */ + return NULL; +} + +/* + * Attempt to perform a read/write operation on + * a disk. + * + * @id: ID of disk to operate on + * @blk: Block offset to read at + * @buf: Buffer to read data into + * @len: Number of bytes to read + * @write: If true, do a write + * + * XXX: The size in which blocks are read at is in + * virtual blocks which is defined by V_BSIZE + * in sys/disk.h + */ +static ssize_t +disk_rw(diskid_t id, blkoff_t blk, void *buf, size_t len, bool write) +{ + const struct bdevsw *bdev; + struct sio_txn sio; + struct disk *dp; + int error; + + len = ALIGN_UP(len, V_BSIZE); + + /* Attempt to grab the disk object */ + error = disk_get_id(id, &dp); + if (error < 0) { + return error; + } + + /* Sanity check, should not happen */ + bdev = dp->bdev; + if (__unlikely(bdev == NULL)) { + return -EIO; + } + + /* Prepare the buffer */ + sio.buf = buf; + sio.offset = blk * dp->bsize; + sio.len = len; + + /* Handle writes */ + if (write) { + if (bdev->write == NULL) { + return -ENOTSUP; + } + + return bdev->write(dp->dev, &sio, 0); + } + + /* Do we support this operation? */ + if (bdev->read == NULL) { + return -ENOTSUP; + } + + return bdev->read(dp->dev, &sio, 0); +} + +/* + * Register a disk with the system so that it may + * be accessible independently of its device major + * and minor numbers + * + * @name: Name of the disk + * @dev: Device minor + * @bdev: Block device operations associated with device + * + * Returns zero on success, otherwise a less than zero + * value is returned. + */ +int +disk_add(const char *name, dev_t dev, const struct bdevsw *bdev, int flags) +{ + struct disk *dp; + size_t name_len; + + if (name == NULL || bdev == NULL) { + return -EINVAL; + } + + /* Disk queue must be initialized */ + check_diskq(); + + /* There is a limit to how many can be added */ + if (disk_count >= DISK_MAX) { + pr_error("disk_add: disk limit %d/%d reached\n", + disk_count, DISK_MAX); + return -EAGAIN; + } + + /* Is the disk name of correct length? */ + name_len = strlen(name); + if (name_len >= sizeof(dp->name) - 1) { + pr_error("disk_add: name too big (len=%d)\n", name_len); + return -E2BIG; + } + + dp = dynalloc(sizeof(*dp)); + if (dp == NULL) { + pr_error("failed to allocate disk\n"); + return -ENOMEM; + } + + /* Initialize the descriptor */ + memset(dp, 0, sizeof(*dp)); + memcpy(dp->name, name, name_len); + dp->cookie = DISKQ_COOKIE; + dp->bdev = bdev; + dp->dev = dev; + dp->id = disk_count++; + dp->bsize = DEFAULT_BSIZE; + + /* + * We are to panic if the virtual blocksize + * defined is not a multiple of any hardware + * block size + */ + if ((V_BSIZE & (dp->bsize - 1)) != 0) { + panic("virtual block size not hw bsize aligned\n"); + } + + /* Now we can add it to the queue */ + spinlock_acquire(&diskq_lock); + TAILQ_INSERT_TAIL(&diskq, dp, link); + spinlock_release(&diskq_lock); + return 0; +} + +/* + * Acquire a disk descriptor by using a zero-based + * index. + * + * @id: Disk index (0: primary) + * @res: Resulting disk descriptor + * + * Returns zero on success, otherwise a less than + * zero value is returned. + */ +int +disk_get_id(diskid_t id, struct disk **res) +{ + int error; + struct disk *dp; + + if (res == NULL) { + return -EINVAL; + } + + if (id >= disk_count) { + return -ENODEV; + } + + /* Grab the disk */ + spinlock_acquire(&diskq_lock); + dp = __disk_get_id(id); + spinlock_release(&diskq_lock); + + /* Did it even exist? */ + if (dp == NULL) { + return -ENODEV; + } + + /* Should not fail but make sure */ + error = check_disk_cookie(dp); + if (__unlikely(error < 0)) { + panic("disk_get_id: got bad disk object\n"); + } + + *res = dp; + return 0; +} + +/* + * Allocate a memory buffer that may be used for + * disk I/O. + * + * @id: ID of disk buffer will be used for + * @len: Length to allocate + */ +void * +disk_buf_alloc(diskid_t id, size_t len) +{ + struct disk *dp; + void *buf; + + if (len == 0) { + return NULL; + } + + /* Attempt to acquire the disk */ + if (disk_get_id(id, &dp) < 0) { + return NULL; + } + + /* + * Here we will align the buffer size by the + * virtual block size to ensure it is big enough. + */ + len = ALIGN_UP(len, V_BSIZE); + buf = dynalloc(len); + return buf; +} + +/* + * Free a memory buffer that was allocated by + * disk_buf_alloc() + */ +void +disk_buf_free(void *p) +{ + if (p != NULL) { + dynfree(p); + } +} + +/* + * Attempt to perform a read operation on + * a disk. + * + * @id: ID of disk to operate on + * @blk: Block offset to read at + * @buf: Buffer to read data into + * @len: Number of bytes to read + */ +ssize_t +disk_read(diskid_t id, blkoff_t blk, void *buf, size_t len) +{ + ssize_t retval; + char *tmp; + + tmp = disk_buf_alloc(id, len); + if (tmp == NULL) { + return -ENOMEM; + } + + retval = disk_rw(id, blk, tmp, len, false); + if (retval < 0) { + disk_buf_free(tmp); + return retval; + } + + memcpy(buf, tmp, len); + disk_buf_free(tmp); + return retval; +} + +/* + * Attempt to perform a write operation on + * a disk. + * + * @id: ID of disk to operate on + * @blk: Block offset to read at + * @buf: Buffer containing data to write + * @len: Number of bytes to read + */ +ssize_t +disk_write(diskid_t id, blkoff_t blk, const void *buf, size_t len) +{ + ssize_t retval; + char *tmp; + + tmp = disk_buf_alloc(id, len); + if (tmp == NULL) { + return -ENOMEM; + } + + memcpy(tmp, buf, len); + retval = disk_rw(id, blk, tmp, len, true); + disk_buf_free(tmp); + return retval; +} + +/* + * Attempt to request attributes from a specific + * device. + * + * @id: ID of disk to query + * @res: Resulting information goes here + * + * This function returns zero on success, otherwise + * a less than zero value is returned. + */ +int +disk_query(diskid_t id, struct disk_info *res) +{ + const struct bdevsw *bdev; + struct disk *dp; + int error; + + if (res == NULL) { + return -EINVAL; + } + + /* Attempt to grab the disk */ + error = disk_get_id(id, &dp); + if (error < 0) { + pr_error("disk_query: bad disk ID %d\n", id); + return error; + } + + bdev = dp->bdev; + if (__unlikely(bdev == NULL)) { + pr_error("disk_query: no bdev for disk %d\n", id); + return -EIO; + } + + res->block_size = dp->bsize; + res->vblock_size = V_BSIZE; + res->n_block = bdev->bsize(dp->dev); + return 0; +} diff --git a/sys/kern/kern_exec.c b/sys/kern/kern_exec.c index bf6a26e..2a53b8a 100644 --- a/sys/kern/kern_exec.c +++ b/sys/kern/kern_exec.c @@ -37,6 +37,7 @@ #include <vm/map.h> #include <vm/physmem.h> #include <machine/pcb.h> +#include <machine/cdefs.h> #include <string.h> /* @@ -87,6 +88,7 @@ execve(struct proc *td, const struct execve_args *args) release_stack(td); /* Save program state */ + md_intoff(); memcpy(&td->exec, &prog, sizeof(td->exec)); /* Set new stack and map it to userspace */ @@ -99,7 +101,7 @@ execve(struct proc *td, const struct execve_args *args) stack_top = td->stack_base + (PROC_STACK_SIZE - 1); /* Setup registers, signals and stack */ - md_td_stackinit(td, (void *)(stack_top + VM_HIGHER_HALF), &prog); + stack_top = md_td_stackinit(td, (void *)(stack_top + VM_HIGHER_HALF), &prog); setregs(td, &prog, stack_top); signals_init(td); diff --git a/sys/kern/kern_exit.c b/sys/kern/kern_exit.c index d6c9168..af697d7 100644 --- a/sys/kern/kern_exit.c +++ b/sys/kern/kern_exit.c @@ -30,15 +30,24 @@ #include <sys/proc.h> #include <sys/sched.h> #include <sys/syslog.h> +#include <sys/atomic.h> +#include <sys/panic.h> +#include <sys/filedesc.h> +#include <sys/vnode.h> +#include <dev/cons/cons.h> #include <vm/physmem.h> #include <vm/dynalloc.h> #include <vm/vm.h> #include <vm/map.h> #include <machine/pcb.h> +#include <machine/cpu.h> #define pr_trace(fmt, ...) kprintf("exit: " fmt, ##__VA_ARGS__) #define pr_error(...) pr_trace(__VA_ARGS__) +extern volatile size_t g_nthreads; +extern struct proc g_init; + static void unload_td(struct proc *td) { @@ -49,6 +58,10 @@ unload_td(struct proc *td) size_t len; sched_detach(td); + if (ISSET(td->flags, PROC_KTD)) { + return; + } + execp = &td->exec; auxvalp = &execp->auxval; pcbp = &td->pcb; @@ -73,47 +86,92 @@ unload_td(struct proc *td) } } +void +proc_reap(struct proc *td) +{ + struct pcb *pcbp; + struct filedesc *fdp; + vaddr_t stack_va; + paddr_t stack_pa; + + cons_detach(); + + /* Clear out all fds */ + for (size_t i = 4; i < PROC_MAX_FILEDES; ++i) { + fdp = td->fds[i]; + if (fdp == NULL) { + continue; + } + if (fdp->refcnt == 1) { + vfs_release_vnode(fdp->vp); + dynfree(fdp); + fdp = NULL; + } + } + + pcbp = &td->pcb; + unload_td(td); + + /* + * User space stacks are identity mapped and + * kernel space stacks are not. + */ + if (ISSET(td->flags, PROC_KTD)) { + stack_va = td->stack_base; + stack_pa = td->stack_base - VM_HIGHER_HALF; + } else { + stack_va = td->stack_base; + stack_pa = td->stack_base; + vm_unmap(pcbp->addrsp, stack_va, PROC_STACK_SIZE); + } + + vm_free_frame(stack_pa, PROC_STACK_PAGES); + pmap_destroy_vas(pcbp->addrsp); +} + /* * Kill a thread and deallocate its resources. * * @td: Thread to exit */ int -exit1(struct proc *td) +exit1(struct proc *td, int flags) { - struct pcb *pcbp; struct proc *curtd, *procp; - uintptr_t stack; + struct proc *parent; + struct cpu_info *ci; pid_t target_pid, curpid; + if (td->pid == 1) { + panic("init died\n"); + } + + ci = this_cpu(); target_pid = td->pid; curtd = this_td(); - pcbp = &td->pcb; curpid = curtd->pid; - stack = td->stack_base; + td->flags |= PROC_EXITING; + parent = td->parent; + + /* We have one less process in the system! */ + atomic_dec_64(&g_nthreads); - /* If we have any children, kill them too */ + /* Reassign children to init */ if (td->nleaves > 0) { TAILQ_FOREACH(procp, &td->leafq, leaf_link) { - exit1(procp); + procp->parent = &g_init; } } - /* - * If this is on the higher half, it is kernel - * mapped and we need to convert it to a physical - * address. - */ - if (stack >= VM_HIGHER_HALF) { - stack -= VM_HIGHER_HALF; + if (target_pid != curpid) { + proc_reap(td); } - unload_td(td); - vm_unmap(pcbp->addrsp, td->stack_base, PROC_STACK_SIZE); - vm_free_frame(stack, PROC_STACK_PAGES); - pmap_destroy_vas(pcbp->addrsp); + if (td->data != NULL) { + dynfree(td->data); + } /* * Only free the process structure if we aren't @@ -124,14 +182,29 @@ exit1(struct proc *td) dynfree(td); } else { td->flags |= PROC_ZOMB; + td->flags &= ~PROC_WAITED; } /* * If we are the thread exiting, reenter the scheduler * and do not return. */ - if (target_pid == curpid) + if (target_pid == curpid) { + /* + * If the thread is exiting on a core that is not + * preemptable, something is not right. + */ + if (__unlikely(!sched_preemptable())) { + panic("exit1: cpu %d not preemptable\n", ci->id); + } + + ci->curtd = NULL; + if (parent->pid == 0) + sched_enter(); + + parent->flags &= ~PROC_SLEEP; sched_enter(); + } return 0; } @@ -145,6 +218,6 @@ sys_exit(struct syscall_args *scargs) struct proc *td = this_td(); td->exit_status = scargs->arg0; - exit1(td); + exit1(td, 0); __builtin_unreachable(); } diff --git a/sys/kern/kern_krq.c b/sys/kern/kern_krq.c new file mode 100644 index 0000000..c12a98c --- /dev/null +++ b/sys/kern/kern_krq.c @@ -0,0 +1,61 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/syscall.h> +#include <sys/krq.h> +#include <sys/errno.h> +#include <sys/spinlock.h> +#include <sys/driver.h> +#include <sys/syslog.h> + +static struct spinlock krq_lock = {0}; + +/* + * Load a kernel runtime quantum (KRQ) + * + * @arg0: path + * + * XXX: If the 'path' argument is NULL, all deferrable + * drivers are loaded. + * + * TODO: Handle non-null paths where a completly seperate + * module/krq can be loaded. + */ +scret_t +sys_inject(struct syscall_args *scargs) +{ + if (scargs->arg0 != 0) { + return -EINVAL; + } + + spinlock_acquire(&krq_lock); + DRIVERS_SCHED(); + spinlock_release(&krq_lock); + return 0; +} diff --git a/sys/kern/kern_panic.c b/sys/kern/kern_panic.c index 7660fff..13b4964 100644 --- a/sys/kern/kern_panic.c +++ b/sys/kern/kern_panic.c @@ -31,8 +31,25 @@ #include <sys/spinlock.h> #include <sys/syslog.h> #include <sys/reboot.h> +#include <dev/cons/cons.h> #include <machine/cdefs.h> #include <machine/cpu.h> +#include <string.h> + +#if defined(__PANIC_SCR) +#define PANIC_SCR __PANIC_SCR +#else +#define PANIC_SCR 0 +#endif + +static void +panic_puts(const char *str) +{ + size_t len; + + len = strlen(str); + cons_putstr(&g_root_scr, str, len); +} /* * Burn and sizzle - the core logic that really ends @@ -49,14 +66,40 @@ bas(bool do_trace, int reboot_type) spinlock_acquire(&lock); /* Never released */ if (do_trace) { - kprintf(OMIT_TIMESTAMP "** backtrace\n"); + panic_puts(" ** backtrace\n"); md_backtrace(); } + panic_puts("\n-- ALL CORES HAVE BEEN HALTED --\n"); cpu_reboot(reboot_type); __builtin_unreachable(); } +static void +panic_screen(void) +{ + struct cons_screen *scr = &g_root_scr; + + if (scr->fb_mem != NULL) { + scr->bg = 0x8B0000; + scr->fg = 0xAABBAA; + cons_reset_cursor(scr); + cons_clear_scr(scr, 0x393B39); + } +} + +static void +do_panic(const char *fmt, va_list *ap) +{ + syslog_silence(false); + spinlock_release(&g_root_scr.lock); + panic_puts("panic: "); + vkprintf(fmt, ap); + bas(true, REBOOT_HALT); + + __builtin_unreachable(); +} + /* * Tells the user something terribly wrong happened then * halting the system as soon as possible. @@ -75,11 +118,11 @@ panic(const char *fmt, ...) md_intoff(); cpu_halt_others(); + if (PANIC_SCR) { + panic_screen(); + } va_start(ap, fmt); - kprintf(OMIT_TIMESTAMP "\npanic: "); - vkprintf(fmt, &ap); - bas(true, REBOOT_HALT); - + do_panic(fmt, &ap); __builtin_unreachable(); } @@ -95,7 +138,6 @@ hcf(const char *fmt, ...) { va_list ap; - if (fmt != NULL) { va_start(ap, fmt); kprintf(OMIT_TIMESTAMP); diff --git a/sys/kern/kern_proc.c b/sys/kern/kern_proc.c new file mode 100644 index 0000000..8bc5680 --- /dev/null +++ b/sys/kern/kern_proc.c @@ -0,0 +1,143 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/proc.h> +#include <sys/errno.h> +#include <sys/cdefs.h> +#include <sys/vnode.h> +#include <sys/tree.h> +#include <sys/syscall.h> +#include <sys/filedesc.h> +#include <sys/fcntl.h> +#include <string.h> +#include <crc32.h> + +extern volatile size_t g_nthreads; + +pid_t +getpid(void) +{ + struct proc *td; + + td = this_td(); + if (td == NULL) { + return -1; + } + + return td->pid; +} + +pid_t +getppid(void) +{ + struct proc *td; + + td = this_td(); + if (td == NULL) { + return -1; + } + if (td->parent == NULL) { + return -1; + } + + return td->parent->pid; +} + +void +proc_coredump(struct proc *td, uintptr_t fault_addr) +{ + struct coredump core; + struct sio_txn sio; + struct vnode *vp; + char pathname[128]; + int fd; + + snprintf(pathname, sizeof(pathname), "/tmp/core.%d", td->pid); + fd = fd_open(pathname, O_RDWR | O_CREAT); + + /* ... Hopefully not */ + if (__unlikely(fd < 0)) { + return; + } + + core.pid = td->pid; + core.fault_addr = fault_addr; + memcpy(&core.tf, &td->tf, sizeof(td->tf)); + + core.checksum = crc32(&core, sizeof(core) - sizeof(core.checksum)); + vp = fd_get(NULL, fd)->vp; + + sio.buf = &core; + sio.len = sizeof(core); + sio.offset = 0; + + /* Write the core file */ + vfs_vop_write(vp, &sio); + fd_close(fd); +} + +int +proc_init(struct proc *td, struct proc *parent) +{ + struct mmap_lgdr *mlgdr; + + mlgdr = dynalloc(sizeof(*mlgdr)); + if (mlgdr == NULL) { + return -ENOMEM; + } + + /* Add to parent leafq */ + TAILQ_INSERT_TAIL(&parent->leafq, td, leaf_link); + atomic_inc_int(&parent->nleaves); + atomic_inc_64(&g_nthreads); + td->parent = parent; + td->exit_status = -1; + td->cred = parent->cred; + + /* Initialize the mmap ledger */ + mlgdr->nbytes = 0; + RBT_INIT(lgdr_entries, &mlgdr->hd); + td->mlgdr = mlgdr; + td->flags |= PROC_WAITED; + signals_init(td); + return 0; +} + +scret_t +sys_getpid(struct syscall_args *scargs) +{ + return getpid(); +} + +scret_t +sys_getppid(struct syscall_args *scargs) +{ + return getppid(); +} diff --git a/sys/kern/kern_sched.c b/sys/kern/kern_sched.c index c22ea25..9c5e215 100644 --- a/sys/kern/kern_sched.c +++ b/sys/kern/kern_sched.c @@ -34,6 +34,7 @@ #include <sys/param.h> #include <sys/syslog.h> #include <sys/atomic.h> +#include <dev/cons/cons.h> #include <machine/frame.h> #include <machine/cpu.h> #include <machine/cdefs.h> @@ -44,7 +45,8 @@ #define pr_trace(fmt, ...) kprintf("ksched: " fmt, ##__VA_ARGS__) -void sched_switch(struct trapframe *tf); +void md_sched_switch(struct trapframe *tf); +void sched_accnt_init(void); static sched_policy_t policy = SCHED_POLICY_MLFQ; @@ -63,7 +65,7 @@ __cacheline_aligned static struct spinlock tdq_lock = {0}; /* * Perform timer oneshot */ -static inline void +void sched_oneshot(bool now) { struct timer timer; @@ -77,39 +79,75 @@ sched_oneshot(bool now) } /* - * Save thread state and enqueue it back into one - * of the ready queues. + * Returns true if a processor is associated + * with a specific thread + * + * @ci: CPU that wants to take 'td' + * @td: Thread to check against */ -static void -sched_save_td(struct proc *td, struct trapframe *tf) +static bool +cpu_is_assoc(struct cpu_info *ci, struct proc *td) { /* - * Save trapframe to process structure only - * if PROC_EXEC is not set. + * If we are not pinned, any processor is + * associated. */ - if (!ISSET(td->flags, PROC_EXEC)) { - memcpy(&td->tf, tf, sizeof(td->tf)); + if (!ISSET(td->flags, PROC_PINNED)) { + return true; } - sched_enqueue_td(td); + return ci->id == td->affinity; } -static struct proc * +struct proc * sched_dequeue_td(void) { struct sched_queue *queue; struct proc *td = NULL; + struct cpu_info *ci; + uint32_t ncpu = 0; spinlock_acquire(&tdq_lock); + ci = this_cpu(); for (size_t i = 0; i < SCHED_NQUEUE; ++i) { queue = &qlist[i]; - if (!TAILQ_EMPTY(&queue->q)) { - td = TAILQ_FIRST(&queue->q); - TAILQ_REMOVE(&queue->q, td, link); - spinlock_release(&tdq_lock); - return td; + if (TAILQ_EMPTY(&queue->q)) { + continue; + } + + td = TAILQ_FIRST(&queue->q); + if (td == NULL) { + continue; + } + + while (ISSET(td->flags, PROC_SLEEP)) { + td = TAILQ_NEXT(td, link); + if (td == NULL) { + break; + } } + + /* + * If we are on a multicore system and this isn't + * our process, don't take it. Some threads might + * be pinned to a specific processor. + */ + ncpu = cpu_count(); + while (!cpu_is_assoc(ci, td) && ncpu > 1) { + td = TAILQ_NEXT(td, link); + if (td == NULL) { + break; + } + } + + if (td == NULL) { + continue; + } + + TAILQ_REMOVE(&queue->q, td, link); + spinlock_release(&tdq_lock); + return td; } /* We got nothing */ @@ -141,6 +179,9 @@ this_td(void) struct cpu_info *ci; ci = this_cpu(); + if (ci == NULL) { + return NULL; + } return ci->curtd; } @@ -177,35 +218,21 @@ td_pri_update(struct proc *td) } /* - * Perform a context switch. + * MI work to be done during a context + * switch. Called by md_sched_switch() */ void -sched_switch(struct trapframe *tf) +mi_sched_switch(struct proc *from) { - struct cpu_info *ci; - struct pcb *pcbp; - struct proc *next_td, *td; - - ci = this_cpu(); - td = ci->curtd; - - if (td != NULL) { - dispatch_signals(td); - td_pri_update(td); - sched_save_td(td, tf); - } + if (from != NULL) { + if (from->pid == 0) + return; - if ((next_td = sched_dequeue_td()) == NULL) { - sched_oneshot(false); - return; + dispatch_signals(from); + td_pri_update(from); } - memcpy(tf, &next_td->tf, sizeof(*tf)); - ci->curtd = next_td; - pcbp = &next_td->pcb; - - pmap_switch_vas(pcbp->addrsp); - sched_oneshot(false); + cons_detach(); } /* @@ -224,12 +251,27 @@ sched_enter(void) void sched_yield(void) { - struct proc *td = this_td(); + struct proc *td; + struct cpu_info *ci = this_cpu(); + + if ((td = ci->curtd) == NULL) { + return; + } + + td->rested = true; - if (td != NULL) { - td->rested = true; - sched_switch(&td->tf); + /* FIXME: Hang yielding when waited on */ + if (ISSET(td->flags, PROC_WAITED)) { + return; } + + ci->curtd = NULL; + md_inton(); + sched_oneshot(false); + + md_hlt(); + md_intoff(); + ci->curtd = td; } void @@ -244,6 +286,121 @@ sched_detach(struct proc *td) spinlock_release(&tdq_lock); } +/* + * Pin a process to a specific processor + * + * @td: Process to pin + * @cpu: Logical processor ID to pin `td' to. + * + * XXX: 'cpu' is a machine independent value, representing + * CPU<n> + */ +void +proc_pin(struct proc *td, affinity_t cpu) +{ + td->affinity = cpu; + td->flags |= PROC_PINNED; +} + +/* + * Unpin a pinned process, allowing it to be + * picked up by any processor + * + * @td: Process to unpin + */ +void +proc_unpin(struct proc *td) +{ + td->affinity = 0; + td->flags &= ~PROC_PINNED; +} + +/* + * Suspend a process for a specified amount + * of time. This calling process will yield for + * the amount of time specified in 'tv' + * + * @td: Process to suspend (NULL for current) + * @tv: Time value to use + * + * XXX: 'tv' being NULL is equivalent to calling + * sched_detach() + */ +void +sched_suspend(struct proc *td, const struct timeval *tv) +{ + struct timer tmr; + const time_t USEC_PER_SEC = 1000000; + ssize_t usec; + time_t usec_cur, usec_tmp; + bool have_timer = true; + tmrr_status_t tmr_status; + + if (td == NULL) + td = this_td(); + if (__unlikely(td == NULL)) + return; + + if (tv == NULL) { + sched_detach(td); + return; + } + + /* + * Now, we need a generic timer so that we can compute + * how much time has elapsed since this process has + * requested to be suspended. However, we cannot assume + * that it would be present. If the lookup fails, all we + * can do is try to estimate how much time went by which + * works fine too, just not as accurate. + */ + tmr_status = req_timer(TIMER_GP, &tmr); + if (tmr_status != TMRR_SUCCESS) { + have_timer = false; + } + + /* We need microsecond precision */ + if (tmr.get_time_sec == NULL) { + have_timer = false; + } + + /* + * Compute the max time in microseconds that + * we will wait. We are using both tv->tv_sec + * and tv->tv_usec + */ + usec = tv->tv_usec; + usec += tv->tv_sec * USEC_PER_SEC; + usec_cur = (have_timer) ? tmr.get_time_usec() : 0; + + for (;;) { + sched_yield(); + + /* + * If we have a timer in our paws, compute how much + * time went by. Otherwise we estimate by subtracting + * the scheduler quantum. + * + * XXX: The timing here works decently as intended. However, + * it would be nice to smoothen out any jitter. Such can + * probably be done by subtracting 'usec' by the exponential + * moving average of 'usec_tmp' rather than the raw original + * value. + */ + if (have_timer) { + usec_tmp = (tmr.get_time_usec() - usec_cur); + } else { + usec_tmp = DEFAULT_TIMESLICE_USEC; + } + + /* We are done here! */ + usec -= usec_tmp; + if (usec <= 0) { + break; + } + } +} + void sched_init(void) { @@ -254,4 +411,6 @@ sched_init(void) pr_trace("prepared %d queues (policy=0x%x)\n", SCHED_NQUEUE, policy); + + sched_accnt_init(); } diff --git a/sys/kern/kern_sig.c b/sys/kern/kern_sig.c index 58bd52d..044de7b 100644 --- a/sys/kern/kern_sig.c +++ b/sys/kern/kern_sig.c @@ -58,6 +58,12 @@ static struct sigaction sa_tab[] = { .sa_flags = 0, .sa_sigaction = NULL }, + [SIGTERM] = { + .sa_handler = sigterm_default, + .sa_mask = 0, + .sa_flags = 0, + .sa_sigaction = NULL + } }; /* diff --git a/sys/kern/kern_socket.c b/sys/kern/kern_socket.c new file mode 100644 index 0000000..d0fbe19 --- /dev/null +++ b/sys/kern/kern_socket.c @@ -0,0 +1,1009 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/socket.h> +#include <sys/sio.h> +#include <sys/systm.h> +#include <sys/proc.h> +#include <sys/time.h> +#include <sys/namei.h> +#include <sys/sched.h> +#include <sys/errno.h> +#include <sys/syslog.h> +#include <sys/filedesc.h> +#include <sys/fcntl.h> +#include <sys/vnode.h> +#include <vm/dynalloc.h> +#include <string.h> + +#define pr_trace(fmt, ...) kprintf("socket: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) + +static struct vops socket_vops; + +/* + * This table maps socket option names to + * lengths of their underlying structure. + * + * This is used for bounds/length checking within + * setsockopt() + */ +static size_t sockopt_lentab[_SO_MAX] = { + [ SO_RCVTIMEO ] = sizeof(struct timeval) +}; + +/* + * Get a kernel socket structure from a + * file descriptor. + * + * @sockfd: File descriptor to lookup + * @res: Result pointer + * + * Returns zero on success, otherwise a less + * than zero errno. + */ +static int +get_ksock(int sockfd, struct ksocket **res) +{ + struct ksocket *ksock; + struct filedesc *fdesc; + struct vnode *vp; + + if (res == NULL) { + return -EINVAL; + } + + /* Grab the file descriptor */ + fdesc = fd_get(NULL, sockfd); + if (fdesc == NULL) { + return -EBADF; + } + + /* Is this even a socket? */ + if ((vp = fdesc->vp) == NULL) { + return -ENOTSOCK; + } + if (vp->type != VSOCK) { + return -ENOTSOCK; + } + + ksock = vp->data; + if (__unlikely(ksock == NULL)) { + return -EIO; + } + + *res = ksock; + return 0; +} + +/* + * VFS reclaim callback for the socket + * layer + * + * Returns zero on success, otherwise a less + * than zero errno. + */ +static int +socket_reclaim(struct vnode *vp) +{ + struct ksocket *ksock; + struct sockopt *opt; + + /* Is this even a socket? */ + if (vp->type != VSOCK) { + return -ENOTSOCK; + } + + /* Is there any data attached? */ + if ((ksock = vp->data) == NULL) { + return -EIO; + } + + /* Free up any used options */ + for (int i = 0; i < _SO_MAX; ++i) { + opt = ksock->opt[i]; + if (opt != NULL) { + dynfree(opt); + ksock->opt[i] = NULL; + } + } + + fd_close(ksock->sockfd); + mutex_free(ksock->mtx); + dynfree(ksock); + return 0; +} + +/* + * Create a socket file from the sockaddr + * structure + * + * @ksock: Socket to create a file for + * @sockaddr_un: domain sockaddr + */ +static int +socket_mkfile(struct ksocket *ksock, struct sockaddr_un *un) +{ + struct filedesc *fdesc; + struct vnode *vp; + int fd; + + fd = fd_open(un->sun_path, O_CREAT | O_RDONLY); + if (fd < 0) { + return fd; + } + + /* Grab the actual handle now */ + fdesc = fd_get(NULL, fd); + if (fdesc == NULL) { + fd_close(fd); + return -EIO; + } + + /* Hijack the vnode */ + vp = fdesc->vp; + vp->type = VSOCK; + vp->vops = &socket_vops; + vp->data = ksock; + return fd; +} + +/* + * Connect to a domain socket - used by connect() + * + * @sockfd: Socket file descriptor + * @ksock: Current ksock + * @un: Current sockaddr_un + */ +static int +connect_domain(int sockfd, struct ksocket *ksock, struct sockaddr_un *un) +{ + int error; + struct nameidata ndp; + struct filedesc *filedesc; + struct vnode *vp; + + ndp.path = un->sun_path; + ndp.flags = 0; + if ((error = namei(&ndp)) < 0) { + return error; + } + + vp = ndp.vp; + filedesc = fd_get(NULL, sockfd); + if (filedesc == NULL) { + pr_error("connect: no filedesc for current\n"); + return -EIO; + } + + filedesc->vp = vp; + return 0; +} + +/* + * Wait until data is received for the + * recv() function. + * + * @sockfd: Socket we are waiting on + * + * Returns zero on success, otherwise a less + * than zero value is returned. + */ +static int +socket_rx_wait(int sockfd) +{ + struct ksocket *ksock; + struct sockopt *opt; + struct timeval tv; + int error; + + if (ksock == NULL) { + return -EINVAL; + } + + error = get_ksock(sockfd, &ksock); + if (error < 0) { + return error; + } + + /* + * If the socket does not have this option set, + * we will assume that there is no timeout value. + */ + opt = ksock->opt[SO_RCVTIMEO]; + if (opt == NULL) { + return 0; + } + + memcpy(&tv, opt->data, opt->len); + sched_suspend(NULL, &tv); + return 0; +} + +/* + * Send data to socket - POSIX send(2) core + * + * @sockfd: File descriptor that backs this socket + * @buf: Buffer containing data to transmit + * @size: Size of the buffer + * @flags: Optional flags + * + * Returns zero on success, otherwise a less + * than zero errno. + */ +ssize_t +send(int sockfd, const void *buf, size_t size, int flags) +{ + struct ksocket *ksock; + struct sockbuf *sbuf; + struct netbuf *netbuf; + size_t tail; + int error; + + /* Size cannot be zero */ + if (size == 0) { + return -EINVAL; + } + + if ((error = get_ksock(sockfd, &ksock)) < 0) { + return error; + } + + sbuf = &ksock->buf; + netbuf = &sbuf->buf; + mutex_acquire(ksock->mtx, 0); + + /* Make sure we dont overflow */ + if (netbuf->len > sbuf->watermark) { + mutex_release(ksock->mtx); + return -ENOBUFS; + } + + if (netbuf->len == 0) { + sbuf->head = 0; + sbuf->tail = 0; + } + + /* Clamp the size if needed */ + if ((netbuf->len + size) > sbuf->watermark) { + size = sbuf->watermark - netbuf->len; + } + if (size == 0) { + return -ENOBUFS; + } + + /* Copy the new data */ + tail = sbuf->tail; + memcpy(&netbuf->data[tail], buf, size); + + sbuf->tail += size; + netbuf->len += size; + mutex_release(ksock->mtx); + return size; +} + +/* + * Recv data from socket - POSIX recv(2) core + * + * @sockfd: File descriptor that backs this socket + * @buf: RX buffer + * @size: Size of the buffer + * @flags: Optional flags + * + * Returns length on success, otherwise a less + * than zero errno. + */ +ssize_t +recv(int sockfd, void *buf, size_t len, int flags) +{ + struct ksocket *ksock; + struct sockbuf *sbuf; + struct netbuf *netbuf; + size_t head; + ssize_t retval = len; + int error; + + /* Length cannot be zero */ + if (len == 0) { + return -EINVAL; + } + + if ((error = get_ksock(sockfd, &ksock)) < 0) { + return error; + } + + sbuf = &ksock->buf; + netbuf = &sbuf->buf; + mutex_acquire(ksock->mtx, 0); + + /* Is it empty? */ + if (netbuf->len == 0) { + sbuf->head = 0; + sbuf->tail = 0; + retval = -EAGAIN; + goto done; + } + + if (len > netbuf->len) { + len = netbuf->len; + } + + head = sbuf->head; + memcpy(buf, &netbuf->data[head], len); + sbuf->head = (sbuf->head + len) % NETBUF_LEN; +done: + mutex_release(ksock->mtx); + return retval; +} + +/* + * POSIX socket(7) core + * + * @domain: Address family (see AF_*) + * @type: Socket type + * @protocol: Socket protocol + * + * Returns zero on success, otherwise a less + * than zero errno. + */ +int +socket(int domain, int type, int protocol) +{ + struct ksocket *ksock = NULL; + struct sockbuf *sbuf = NULL; + struct proc *td = this_td(); + int fd, error = -1; + + ksock = dynalloc(sizeof(*ksock)); + if (ksock == NULL) { + error = -ENOMEM; + goto fail; + } + + memset(ksock, 0, sizeof(*ksock)); + sbuf = &ksock->buf; + sbuf->head = 0; + sbuf->tail = 0; + + switch (domain) { + case AF_UNIX: + { + struct sockaddr_un *un; + + un = &ksock->un; + sbuf->watermark = NETBUF_LEN; + + /* Set up a path and create a socket file */ + un->sun_family = domain; + snprintf(un->sun_path, sizeof(un->sun_path), "/tmp/%d-sock0", td->pid); + fd = socket_mkfile(ksock, un); + } + return fd; + default: + error = -EINVAL; + break; + } + +fail: + if (ksock != NULL) + dynfree(ksock); + + fd_close(fd); + return error; +} + +/* + * Bind address to socket - POSIX bind(2) core + * + * @sockfd: File descriptor + * @addr: Address to bind + * @len: Sockaddr len + * + * Returns zero on success, otherwise a less + * than zero errno. + */ +int +bind(int sockfd, const struct sockaddr *addr, socklen_t len) +{ + struct proc *td; + struct ksocket *ksock; + struct cmsg_list *clp; + int error; + + if ((error = get_ksock(sockfd, &ksock)) < 0) { + kprintf("error=%d\n", error); + return error; + } + + /* Create the new mutex lock */ + ksock->mtx = mutex_new("ksocket"); + if (ksock->mtx == NULL) { + return -ENOMEM; + } + + /* Mark ourselves as the owner */ + td = this_td(); + ksock->owner = td; + + /* Initialize the cmsg list queue */ + clp = &ksock->cmsg_list; + TAILQ_INIT(&clp->list); + clp->is_init = 1; + return 0; +} + +/* + * Set socket options - POSIX setsockopt(3) core + * + * @sockfd: File descriptor of socket + * @level: Protocol level + * @v: Options value + * @len: Length of data pointed to by 'v' + */ +int +setsockopt(int sockfd, int level, int name, const void *v, socklen_t len) +{ + struct ksocket *ksock; + struct sockopt *opt; + size_t exp_len; + int error; + + /* Must have a valid fd */ + if (sockfd < 0) { + return -EBADF; + } + + /* Ensure value and length are valid */ + if (v == NULL || len == 0) { + return -EINVAL; + } + + /* Verify the name */ + if (name >= _SO_MAX) { + return -EINVAL; + } + + /* Grab a new socket */ + if ((error = get_ksock(sockfd, &ksock)) < 0) { + return error; + } + + /* Clamp the input length as needed */ + exp_len = sockopt_lentab[name]; + if (len > exp_len) { + len = exp_len; + } + + /* + * Here we will grab the socket options. If it is + * NULL, we'll need to allocate one. + */ + if ((opt = ksock->opt[name]) == NULL) { + opt = dynalloc(sizeof(*opt) + len); + + if (opt == NULL) { + return -ENOMEM; + } + + opt->len = len; + ksock->opt[name] = opt; + } + + memcpy(opt->data, v, len); + opt->len = len; + return 0; +} + +/* + * Connect to a socket + * + * @sockfd: File descriptor to connect + * @addr: Address to connect to + * @len: Length of address + */ +int +connect(int sockfd, const struct sockaddr *addr, socklen_t len) +{ + struct ksocket *ksock; + int error = -1; + + if ((error = get_ksock(sockfd, &ksock)) < 0) { + return error; + } + + switch (addr->sa_family) { + case AF_UNIX: + { + struct sockaddr_un *un; + + un = (struct sockaddr_un *)addr; + if (un->sun_path[0] == '\0') { + pr_error("connect: bad socket path\n"); + return -1; + } + + /* Wait for the connection to be established */ + do { + error = connect_domain(sockfd, ksock, un); + if (error != 0) { + sched_yield(); + } + } while (error != 0); + + return 0; + } + } + + return -1; +} + +/* + * Send socket control message - POSIX.1-2008 + * + * @socket: Socket to transmit on + * @msg: Further arguments + * @flags: Optional flags + * + * Returns zero on success, otherwise a less + * than zero errno. + */ +ssize_t +sendmsg(int socket, const struct msghdr *msg, int flags) +{ + struct ksocket *ksock; + struct cmsg *cmsg; + struct sockaddr_un *un; + struct cmsg_list *clp; + size_t control_len = 0; + int error; + + if ((error = get_ksock(socket, &ksock)) < 0) { + return error; + } + + /* We cannot do sendmsg() non domain sockets */ + un = &ksock->un; + if (un->sun_family != AF_UNIX) { + return -EBADF; + } + + control_len = MALIGN(msg->msg_controllen); + + /* Allocate a new cmsg */ + cmsg = dynalloc(control_len + sizeof(struct cmsg)); + if (cmsg == NULL) { + return -EINVAL; + } + + memcpy(cmsg->buf, msg->msg_control, control_len); + clp = &ksock->cmsg_list; + cmsg->control_len = control_len; + TAILQ_INSERT_TAIL(&clp->list, cmsg, link); + return 0; +} + +/* + * Receive socket control message - POSIX.1‐2017 + * + * @socket: Socket to receive on + * @msg: Further arguments + * @flags: Optional flags + * + * Returns zero on success, otherwise a less + * than zero errno. + */ +ssize_t +recvmsg(int socket, struct msghdr *msg, int flags) +{ + struct ksocket *ksock; + struct sockaddr_un *un; + struct cmsg *cmsg, *tmp; + struct cmsghdr *cmsghdr; + struct cmsg_list *clp; + uint8_t *fds; + int error; + + if (socket < 0) { + return -EINVAL; + } + + /* Grab the socket descriptor */ + if ((error = get_ksock(socket, &ksock)) < 0) { + return error; + } + + /* Must be a unix domain socket */ + un = &ksock->un; + if (un->sun_family != AF_UNIX) { + return -EBADF; + } + + /* Grab the control message list */ + clp = &ksock->cmsg_list; + cmsg = TAILQ_FIRST(&clp->list); + + /* Empty? */ + while (cmsg == NULL) { + sched_yield(); + cmsg = TAILQ_FIRST(&clp->list); + } + + while (cmsg != NULL) { + cmsghdr = &cmsg->hdr; + + /* Check the control message type */ + switch (cmsghdr->cmsg_type) { + case SCM_RIGHTS: + { + fds = (uint8_t *)CMSG_DATA(cmsghdr); + pr_trace("SCM_RIGHTS -> fd %d (from pid %d)\n", fds[0], + ksock->owner->pid); + + break; + } + } + + tmp = cmsg; + cmsg = TAILQ_NEXT(cmsg, link); + + TAILQ_REMOVE(&clp->list, tmp, link); + dynfree(tmp); + } + + return 0; +} + +/* + * socket(7) syscall + * + * arg0: domain + * arg1: type + * arg2: protocol + */ +scret_t +sys_socket(struct syscall_args *scargs) +{ + int domain = scargs->arg0; + int type = scargs->arg1; + int protocol = scargs->arg2; + + return socket(domain, type, protocol); +} + +/* + * bind(2) syscall + * + * arg0: sockfd + * arg1: addr + * arg2: len + */ +scret_t +sys_bind(struct syscall_args *scargs) +{ + const struct sockaddr *u_addr = (void *)scargs->arg1; + struct sockaddr addr_copy; + int sockfd = scargs->arg0; + int len = scargs->arg2; + int error; + + error = copyin(u_addr, &addr_copy, sizeof(addr_copy)); + if (error < 0) { + return error; + } + + return bind(sockfd, &addr_copy, len); +} + +/* + * recv(2) syscall + * + * arg0: sockfd + * arg1: buf + * arg2: size + * arg3: flags + */ +scret_t +sys_recv(struct syscall_args *scargs) +{ + char buf[NETBUF_LEN]; + void *u_buf = (void *)scargs->arg1; + int sockfd = scargs->arg0; + size_t len = scargs->arg2; + int error, flags = scargs->arg3; + + if (len > sizeof(buf)) { + return -ENOBUFS; + } + + for (;;) { + error = recv(sockfd, buf, len, flags); + if (error <= 0 && error != -EAGAIN) { + break; + } + + /* + * Wait for data to be ready on the socket. + * If a less than zero value is returned, don't + * handle timeouts. + */ + error = socket_rx_wait(sockfd); + if (error < 0) { + continue; + } + + /* Try one more time, obey timeout */ + error = recv(sockfd, buf, len, flags); + if (error == -EAGAIN) { + return error; + } + break; + } + + if (error < 0) { + pr_error("sys_recv: recv() fail (fd=%d)\n", sockfd); + return error; + } + + error = copyout(buf, u_buf, len); + return (error == 0) ? len : error; +} + +/* + * send(2) syscall + * + * arg0: sockfd + * arg1: buf + * arg2: size + * arg3: flags + */ +scret_t +sys_send(struct syscall_args *scargs) +{ + char buf[NETBUF_LEN]; + const void *u_buf = (void *)scargs->arg1; + int sockfd = scargs->arg0; + size_t len = scargs->arg2; + int error, flags = scargs->arg3; + + if (len > sizeof(buf)) { + return -ENOBUFS; + } + + error = copyin(u_buf, buf, len); + if (error < 0) { + pr_error("sys_send: copyin() failure (fd=%d)\n", sockfd); + return error; + } + + return send(sockfd, buf, len, flags); +} + +/* + * recvmsg(3) syscall + * + * arg0: socket + * arg1: msg + * arg2: flags + */ +scret_t +sys_recvmsg(struct syscall_args *scargs) +{ + struct msghdr *u_msg = (void *)scargs->arg1; + void *u_control, *control = NULL; + size_t controllen; + struct iovec msg_iov; + struct msghdr msg; + ssize_t retval; + int socket = scargs->arg0; + int flags = scargs->arg2; + int error; + + /* Read the message header */ + error = copyin(u_msg, &msg, sizeof(msg)); + if (error < 0) { + pr_error("sys_recvmsg: bad msg\n"); + return error; + } + + /* Grab the message I/O vector */ + error = uio_copyin(msg.msg_iov, &msg_iov, msg.msg_iovlen); + if (error < 0) { + return error; + } + + /* Save control fields */ + u_control = msg.msg_control; + controllen = msg.msg_controllen; + + /* Allocate a new control field to copy in */ + control = dynalloc(controllen); + msg.msg_control = control; + if (msg.msg_control == NULL) { + uio_copyin_clean(&msg_iov, msg.msg_iovlen); + return -ENOMEM; + } + + memset(msg.msg_control, 0, controllen); + error = copyin(u_control, msg.msg_control, controllen); + if (error < 0) { + retval = error; + goto done; + } + + /* + * Now wait until we get a control + * message + */ + msg.msg_iov = &msg_iov; + for (;;) { + retval = recvmsg(socket, &msg, flags); + if (retval == 0) { + break; + } + + sched_yield(); + } +done: + uio_copyin_clean(&msg_iov, msg.msg_iovlen); + dynfree(control); + return retval; +} + +/* + * sendmsg(3) syscall + * + * arg0: socket + * arg1: msg + * arg2: flags + */ +scret_t +sys_sendmsg(struct syscall_args *scargs) +{ + struct iovec msg_iov; + struct msghdr *u_msg = (void *)scargs->arg1; + struct msghdr msg; + ssize_t retval; + int socket = scargs->arg0; + int flags = scargs->arg2; + int error; + + /* Read the message header */ + error = copyin(u_msg, &msg, sizeof(msg)); + if (error < 0) { + pr_error("sys_sendmsg: bad msg\n"); + return error; + } + + /* Grab the message I/O vector */ + error = uio_copyin(msg.msg_iov, &msg_iov, msg.msg_iovlen); + if (error < 0) { + return error; + } + + msg.msg_name = NULL; + msg.msg_namelen = 0; + msg.msg_iov = &msg_iov; + + for (;;) { + retval = sendmsg(socket, &msg, flags); + if (retval == 0) { + break; + } + sched_yield(); + } + uio_copyin_clean(&msg_iov, msg.msg_iovlen); + return retval; +} + +/* + * connect(3) syscall + * + * arg0: sockfd + * arg1: address + * arg2: len + */ +scret_t +sys_connect(struct syscall_args *scargs) +{ + char buf[256]; + struct sockaddr *u_addr = (void *)scargs->arg1; + struct sockaddr *sockaddr; + int error; + int sockfd = scargs->arg0; + socklen_t len = scargs->arg2; + + if (len >= sizeof(buf)) { + pr_error("sys_connect: address too big\n"); + return -E2BIG; + } + + error = copyin(u_addr, buf, len); + if (error < 0) { + pr_error("sys_connect: bad 'address'\n"); + return error; + } + + sockaddr = (struct sockaddr *)buf; + return connect(sockfd, sockaddr, len); +} + +/* + * POSIX setsockopt(3) syscall + * + * arg0: sockfd + * arg1: level + * arg2: name + * arg3: data + * arg4: len + */ +scret_t +sys_setsockopt(struct syscall_args *scargs) +{ + int sockfd = scargs->arg0; + int level = scargs->arg1; + int name = scargs->arg2; + void *u_data = (void *)scargs->arg3; + socklen_t len = scargs->arg4; + void *data; + size_t exp_len; + int retval; + + /* Verify that the name is correct */ + if (name >= _SO_MAX) { + return -EINVAL; + } + + /* Clamp length as needed */ + exp_len = sockopt_lentab[name]; + if (len > exp_len) { + len = exp_len; + } + + data = dynalloc(len); + if (data == NULL) { + return -ENOMEM; + } + + /* Grab data from userland */ + retval = copyin(u_data, data, len); + if (retval < 0) { + dynfree(data); + return retval; + } + + retval = setsockopt(sockfd, level, name, data, len); + dynfree(data); + return retval; +} + +static struct vops socket_vops = { + .read = NULL, + .write = NULL, + .reclaim = socket_reclaim, +}; diff --git a/sys/kern/kern_spawn.c b/sys/kern/kern_spawn.c index cb898dc..12f3d16 100644 --- a/sys/kern/kern_spawn.c +++ b/sys/kern/kern_spawn.c @@ -27,6 +27,8 @@ * POSSIBILITY OF SUCH DAMAGE. */ +#include <sys/spawn.h> +#include <sys/wait.h> #include <sys/proc.h> #include <sys/exec.h> #include <sys/mman.h> @@ -34,7 +36,6 @@ #include <sys/errno.h> #include <sys/syslog.h> #include <sys/syscall.h> -#include <sys/atomic.h> #include <sys/signal.h> #include <sys/limits.h> #include <sys/sched.h> @@ -44,10 +45,17 @@ #define pr_trace(fmt, ...) kprintf("spawn: " fmt, ##__VA_ARGS__) #define pr_error(...) pr_trace(__VA_ARGS__) -static volatile size_t nthreads = 0; +#define ARGVP_MAX (ARG_MAX / sizeof(void *)) +static size_t next_pid = 1; + +/* + * TODO: envp + */ struct spawn_args { char path[PATH_MAX]; + char argv_blk[ARG_MAX]; + char *argv[ARGVP_MAX]; }; static inline void @@ -66,29 +74,54 @@ spawn_thunk(void) struct proc *cur; struct execve_args execve_args; struct spawn_args *args; - char *argv[] = { NULL, NULL }; char *envp[] = { NULL }; cur = this_td(); - args = cur->spawn_data; + args = cur->data; path = args->path; + memset(pathbuf, 0, sizeof(pathbuf)); memcpy(pathbuf, path, strlen(path)); - argv[0] = (char *)pathbuf; - execve_args.pathname = argv[0]; - execve_args.argv = argv; + execve_args.pathname = pathbuf; + execve_args.argv = (char **)&args->argv[0]; execve_args.envp = envp; - path = NULL; - dynfree(args); if (execve(cur, &execve_args) != 0) { pr_error("execve failed, aborting\n"); - exit1(this_td()); + exit1(this_td(), 0); } __builtin_unreachable(); } +pid_t +waitpid(pid_t pid, int *wstatus, int options) +{ + struct proc *child, *td; + pid_t ret; + + td = this_td(); + child = get_child(td, pid); + + if (child == NULL) { + return -1; + } + + /* Wait for it to be done */ + while (!ISSET(child->flags, PROC_ZOMB)) { + sched_yield(); + } + + /* Give back the status */ + if (wstatus != NULL) { + copyout(&child->exit_status, wstatus, sizeof(*wstatus)); + } + + ret = child->pid; + proc_reap(child); + return ret; +} + /* * Spawn a new process * @@ -108,8 +141,8 @@ pid_t spawn(struct proc *cur, void(*func)(void), void *p, int flags, struct proc **newprocp) { struct proc *newproc; - struct mmap_lgdr *mlgdr; int error; + pid_t pid; newproc = dynalloc(sizeof(*newproc)); if (newproc == NULL) { @@ -118,19 +151,10 @@ spawn(struct proc *cur, void(*func)(void), void *p, int flags, struct proc **new return -ENOMEM; } - mlgdr = dynalloc(sizeof(*mlgdr)); - if (mlgdr == NULL) { - dynfree(newproc); - try_free_data(p); - pr_error("could not alloc proc mlgdr (-ENOMEM)\n"); - return -ENOMEM; - } - memset(newproc, 0, sizeof(*newproc)); error = md_spawn(newproc, cur, (uintptr_t)func); if (error < 0) { dynfree(newproc); - dynfree(mlgdr); try_free_data(p); pr_error("error initializing proc\n"); return error; @@ -146,21 +170,19 @@ spawn(struct proc *cur, void(*func)(void), void *p, int flags, struct proc **new cur->flags |= PROC_LEAFQ; } - /* Add to parent leafq */ - TAILQ_INSERT_TAIL(&cur->leafq, newproc, leaf_link); - atomic_inc_int(&cur->nleaves); - newproc->parent = cur; - newproc->spawn_data = p; - - /* Initialize the mmap ledger */ - mlgdr->nbytes = 0; - RBT_INIT(lgdr_entries, &mlgdr->hd); - newproc->mlgdr = mlgdr; + error = proc_init(newproc, cur); + if (error < 0) { + dynfree(newproc); + try_free_data(p); + pr_error("error initializing proc\n"); + return error; + } - newproc->pid = ++nthreads; - signals_init(newproc); + newproc->data = p; + newproc->pid = next_pid++; sched_enqueue_td(newproc); - return newproc->pid; + pid = newproc->pid; + return pid; } /* @@ -177,6 +199,9 @@ get_child(struct proc *cur, pid_t pid) struct proc *procp; TAILQ_FOREACH(procp, &cur->leafq, leaf_link) { + if (procp == NULL) { + continue; + } if (procp->pid == pid) { return procp; } @@ -186,20 +211,48 @@ get_child(struct proc *cur, pid_t pid) } /* + * arg0: PID + * arg1: wstatus + * arg2: options + * + * Returns PID of terminated child, returns + * -1 on failure. + */ +scret_t +sys_waitpid(struct syscall_args *scargs) +{ + pid_t pid; + int *u_wstatus; + int options; + + pid = scargs->arg0; + u_wstatus = (void *)scargs->arg1; + options = scargs->arg2; + return waitpid(pid, u_wstatus, options); +} + +/* * arg0: The file /path/to/executable - * arg1: Optional flags (`flags') + * arg1: Argv + * arg2: Envp (TODO) + * arg3: Optional flags (`flags') */ scret_t sys_spawn(struct syscall_args *scargs) { struct spawn_args *args; - const char *u_path; + char *path; + const char *u_path, **u_argv; + const char *u_p = NULL; struct proc *td; int flags, error; + size_t len, bytes_copied = 0; + size_t argv_i = 0; td = this_td(); - flags = scargs->arg1; u_path = (const char *)scargs->arg0; + u_argv = (const char **)scargs->arg1; + flags = scargs->arg3; args = dynalloc(sizeof(*args)); if (args == NULL) { @@ -212,5 +265,30 @@ sys_spawn(struct syscall_args *scargs) return error; } + memset(args->argv, 0, ARG_MAX); + for (size_t i = 0; i < ARG_MAX - 1; ++i) { + error = copyin(&u_argv[argv_i], &u_p, sizeof(u_p)); + if (error < 0) { + dynfree(args); + return error; + } + if (u_p == NULL) { + args->argv[argv_i++] = NULL; + break; + } + + path = &args->argv_blk[i]; + error = copyinstr(u_p, path, ARG_MAX - bytes_copied); + if (error < 0) { + dynfree(args); + return error; + } + + args->argv[argv_i++] = &args->argv_blk[i]; + len = strlen(path); + bytes_copied += (len + 1); + i += len; + } + return spawn(td, spawn_thunk, args, flags, NULL); } diff --git a/sys/kern/kern_stub.c b/sys/kern/kern_stub.c index 8603fd5..a9a56ac 100644 --- a/sys/kern/kern_stub.c +++ b/sys/kern/kern_stub.c @@ -40,8 +40,10 @@ sigfpe_default(int signo) static struct proc *td; td = this_td(); - kprintf("Floating point exception (pid=%d)\n", td->pid); - exit1(td); + syslog_silence(false); + kprintf(OMIT_TIMESTAMP "Floating point exception (pid=%d)\n", td->pid); + syslog_silence(true); + exit1(td, 0); } void @@ -50,8 +52,10 @@ sigkill_default(int signo) static struct proc *td; td = this_td(); - kprintf("Terminated (pid=%d)\n", td->pid); - exit1(td); + syslog_silence(false); + kprintf(OMIT_TIMESTAMP "Terminated (pid=%d)\n", td->pid); + syslog_silence(true); + exit1(td, 0); } void @@ -60,8 +64,22 @@ sigsegv_default(int signo) static struct proc *td; td = this_td(); - kprintf("Segmentation fault (pid=%d)\n", td->pid); - exit1(td); + syslog_silence(false); + kprintf(OMIT_TIMESTAMP "Segmentation fault (pid=%d)\n", td->pid); + syslog_silence(true); + exit1(td, 0); +} + +void +sigterm_default(int signo) +{ + static struct proc *td; + + td = this_td(); + syslog_silence(false); + kprintf(OMIT_TIMESTAMP "Terminated (pid=%d)\n", td->pid); + syslog_silence(true); + exit1(td, 0); } int @@ -75,3 +93,9 @@ dev_nowrite(void) { return -ENOTSUP; } + +int +dev_nobsize(void) +{ + return -ENOTSUP; +} diff --git a/sys/kern/kern_subr.c b/sys/kern/kern_subr.c index f437ec7..8a08f33 100644 --- a/sys/kern/kern_subr.c +++ b/sys/kern/kern_subr.c @@ -29,9 +29,12 @@ #include <sys/proc.h> #include <sys/types.h> +#include <sys/param.h> #include <sys/errno.h> +#include <sys/mman.h> #include <sys/exec.h> #include <sys/systm.h> +#include <vm/vm.h> #include <string.h> /* @@ -45,6 +48,8 @@ static bool check_uaddr(const void *uaddr) { vaddr_t stack_start, stack_end; + struct mmap_lgdr *lp; + struct mmap_entry find, *res; struct exec_prog exec; struct proc *td; uintptr_t addr; @@ -61,6 +66,22 @@ check_uaddr(const void *uaddr) if (addr >= stack_start && addr <= stack_end) return true; + /* Try to grab the mmap ledger */ + if ((lp = td->mlgdr) == NULL) { + return false; + } + + /* + * Now give an attempt at looking through the + * mmap ledger. Perhaps this memory was allocated + * in the user heap? + */ + find.va_start = ALIGN_DOWN(addr, DEFAULT_PAGESIZE); + res = RBT_FIND(lgdr_entries, &lp->hd, &find); + if (res != NULL) { + return true; + } + return false; } diff --git a/sys/kern/kern_synch.c b/sys/kern/kern_synch.c index 57b27d0..7660f1f 100644 --- a/sys/kern/kern_synch.c +++ b/sys/kern/kern_synch.c @@ -28,19 +28,20 @@ */ #include <sys/types.h> +#include <sys/mutex.h> #include <sys/systm.h> #include <sys/errno.h> +#include <sys/sched.h> #include <sys/atomic.h> #include <sys/syslog.h> #include <sys/spinlock.h> +#include <machine/cdefs.h> #include <dev/timer.h> +#include <string.h> #define pr_trace(fmt, ...) kprintf("synch: " fmt, ##__VA_ARGS__) #define pr_error(...) pr_trace(__VA_ARGS__) -/* XXX: Be very careful with this */ -static struct spinlock __syslock; - /* * Returns 0 on success, returns non-zero value * on timeout/failure. @@ -80,7 +81,10 @@ spinlock_usleep(struct spinlock *lock, size_t usec_max) void spinlock_acquire(struct spinlock *lock) { - while (__atomic_test_and_set(&lock->lock, __ATOMIC_ACQUIRE)); + sched_preempt_set(false); + while (__atomic_test_and_set(&lock->lock, __ATOMIC_ACQUIRE)) { + md_pause(); + } } /* @@ -104,35 +108,66 @@ spinlock_try_acquire(struct spinlock *lock) return 1; } - while (__atomic_test_and_set(&lock->lock, __ATOMIC_ACQUIRE)); - return 0; + return __atomic_test_and_set(&lock->lock, __ATOMIC_ACQUIRE); } void spinlock_release(struct spinlock *lock) { __atomic_clear(&lock->lock, __ATOMIC_RELEASE); + sched_preempt_set(true); } /* - * Attempt to hold the system-wide lock, returns 1 - * if already held. - * - * XXX: Only use for CRITICAL code sections. + * Create a new mutex lock object */ -int -syslock(void) +struct mutex * +mutex_new(const char *name) { - return spinlock_try_acquire(&__syslock); + struct mutex *mtx; + size_t namelen; + + mtx = dynalloc(sizeof(*mtx)); + if (mtx == NULL) { + return NULL; + } + + mtx->lock = 0; + namelen = strlen(name); + + /* Don't overflow the name buffer */ + if (namelen >= MUTEX_NAME_LEN) { + namelen = MUTEX_NAME_LEN - 1; + } + + memcpy(mtx->name, name, namelen); + return mtx; } /* - * Release the system-wide lock + * Acquire a mutex * - * XXX: Only use for CRITICAL code sections. + * @mtx: Mutex to acquire + * @flags: Optional flags */ +int +mutex_acquire(struct mutex *mtx, int flags) +{ + while (__atomic_test_and_set(&mtx->lock, __ATOMIC_ACQUIRE)) { + sched_yield(); + } + + return 0; +} + +void +mutex_release(struct mutex *mtx) +{ + __atomic_clear(&mtx->lock, __ATOMIC_RELEASE); +} + void -sysrel(void) +mutex_free(struct mutex *mtx) { - spinlock_release(&__syslock); + dynfree(mtx); } diff --git a/sys/kern/kern_syscall.c b/sys/kern/kern_syscall.c index 249a04a..c352b9c 100644 --- a/sys/kern/kern_syscall.c +++ b/sys/kern/kern_syscall.c @@ -29,10 +29,16 @@ #include <sys/syscall.h> #include <sys/sysctl.h> +#include <sys/socket.h> #include <sys/reboot.h> #include <sys/types.h> +#include <sys/ucred.h> +#include <sys/disk.h> +#include <sys/time.h> +#include <sys/mman.h> #include <sys/proc.h> #include <sys/vfs.h> +#include <sys/krq.h> scret_t(*g_sctab[])(struct syscall_args *) = { NULL, /* SYS_none */ @@ -45,6 +51,26 @@ scret_t(*g_sctab[])(struct syscall_args *) = { sys_write, /* SYS_write */ sys_spawn, /* SYS_spawn */ sys_reboot, /* SYS_reboot */ + sys_mmap, /* SYS_mmap */ + sys_munmap, /* SYS_munap */ + sys_access, /* SYS_access */ + sys_lseek, /* SYS_lseek */ + sys_sleep, /* SYS_sleep */ + sys_inject, /* SYS_inject */ + sys_getpid, /* SYS_getpid */ + sys_getppid, /* SYS_getppid */ + sys_setuid, /* SYS_setuid */ + sys_getuid, /* SYS_getuid */ + sys_waitpid, /* SYS_waitpid */ + sys_socket, /* SYS_socket */ + sys_bind, /* SYS_bind */ + sys_recv, /* SYS_recv */ + sys_send, /* SYS_send */ + sys_sendmsg, /* SYS_sendmsg */ + sys_recvmsg, /* SYS_recvmsg */ + sys_connect, /* SYS_connect */ + sys_setsockopt, /* SYS_setsockopt */ + sys_disk, /* SYS_disk */ }; const size_t MAX_SYSCALLS = NELEM(g_sctab); diff --git a/sys/kern/kern_sysctl.c b/sys/kern/kern_sysctl.c index 7679aa1..1f5e578 100644 --- a/sys/kern/kern_sysctl.c +++ b/sys/kern/kern_sysctl.c @@ -33,12 +33,16 @@ #include <sys/errno.h> #include <sys/systm.h> #include <vm/dynalloc.h> +#include <vm/vm.h> #include <string.h> #define HYRA_RELEASE "Hyra/" HYRA_ARCH " " \ HYRA_VERSION " " \ HYRA_BUILDDATE +extern size_t g_nthreads; +static uint32_t pagesize = DEFAULT_PAGESIZE; +static char machine[] = HYRA_ARCH; static char hyra[] = "Hyra"; static char hyra_version[] = HYRA_VERSION; static char osrelease[] = HYRA_RELEASE; @@ -49,10 +53,20 @@ static char osrelease[] = HYRA_RELEASE; * allocated through dynalloc(9). */ static struct sysctl_entry common_optab[] = { + /* 'kern.*' */ [KERN_OSTYPE] = { KERN_OSTYPE, SYSCTL_OPTYPE_STR_RO, hyra }, [KERN_OSRELEASE] = { KERN_OSRELEASE, SYSCTL_OPTYPE_STR_RO, &osrelease }, [KERN_VERSION] = { KERN_VERSION, SYSCTL_OPTYPE_STR_RO, &hyra_version }, - [KERN_VCACHE_TYPE] = { KERN_VCACHE_TYPE, SYSCTL_OPTYPE_STR, NULL } + [KERN_VCACHE_TYPE] = { KERN_VCACHE_TYPE, SYSCTL_OPTYPE_STR, NULL }, + [KERN_HOSTNAME] = { KERN_HOSTNAME, SYSCTL_OPTYPE_STR, NULL }, + + /* 'hw.*' */ + [HW_PAGESIZE] = { HW_PAGESIZE, SYSCTL_OPTYPE_INT_RO, &pagesize }, + [HW_NCPU] = { HW_NCPU, SYSCTL_OPTYPE_INT, NULL }, + [HW_MACHINE] = {HW_MACHINE, SYSCTL_OPTYPE_STR_RO, &machine }, + + /* 'proc.*' */ + [PROC_COUNT] = { PROC_COUNT, SYSCTL_OPTYPE_INT_RO, &g_nthreads } }; static int @@ -91,19 +105,18 @@ static int do_sysctl(struct sysctl_args *args) { struct sysctl_args new_args; - size_t name_len, oldlenp; + size_t name_len = 1, oldlenp = 0; int *name = NULL; void *oldp = NULL, *newp = NULL; - int retval = 0; - - if (args->oldlenp == NULL) { - return -EINVAL; - } - - name_len = args->nlen; - retval = copyin(args->oldlenp, &oldlenp, sizeof(oldlenp)); - if (retval != 0) { - goto done; + int retval = 0, have_oldlen = 0; + + if (args->oldlenp != NULL) { + have_oldlen = 1; + name_len = args->nlen; + retval = copyin(args->oldlenp, &oldlenp, sizeof(oldlenp)); + if (retval != 0) { + goto done; + } } /* Copy in newp if it is set */ @@ -124,25 +137,30 @@ do_sysctl(struct sysctl_args *args) return retval; } - oldp = dynalloc(oldlenp); - retval = copyin(args->oldp, oldp, oldlenp); - if (retval != 0) { - return retval; + if (oldlenp != 0) { + oldp = dynalloc(oldlenp); + retval = copyin(args->oldp, oldp, oldlenp); + if (retval != 0) { + return retval; + } } /* Prepare the arguments for the sysctl call */ new_args.name = name; new_args.nlen = name_len; new_args.oldp = oldp; - new_args.oldlenp = &oldlenp; + new_args.oldlenp = (have_oldlen) ? &oldlenp : NULL; new_args.newp = newp; + new_args.newlen = args->newlen; retval = sysctl(&new_args); if (retval != 0) { goto done; } - copyout(oldp, args->oldp, oldlenp); + if (oldlenp != 0) { + copyout(oldp, args->oldp, oldlenp); + } done: if (name != NULL) dynfree(name); @@ -154,6 +172,33 @@ done: return retval; } +/* + * Clear a writable sysctl string variable to the + * value of "(undef)" + * + * @name: Name to clear + */ +int +sysctl_clearstr(int name) +{ + struct sysctl_args args; + char val[] = "(undef)"; + int error; + + args.name = &name; + args.nlen = 1; + args.oldlenp = 0; + args.oldp = NULL; + args.newp = val; + args.newlen = sizeof(val); + + if ((error = sysctl(&args)) != 0) { + return error; + } + + return 0; +} + int sysctl(struct sysctl_args *args) { diff --git a/sys/kern/kern_syslog.c b/sys/kern/kern_syslog.c index 665734d..c7f51f7 100644 --- a/sys/kern/kern_syslog.c +++ b/sys/kern/kern_syslog.c @@ -28,9 +28,14 @@ */ #include <sys/syslog.h> +#include <sys/cdefs.h> +#include <sys/sio.h> #include <sys/spinlock.h> +#include <sys/device.h> +#include <sys/errno.h> #include <dev/cons/cons.h> #include <dev/timer.h> +#include <fs/devfs.h> #include <stdarg.h> #include <string.h> @@ -40,21 +45,105 @@ #define SERIAL_DEBUG 0 #endif +#if defined(__USER_KMSG) +#define USER_KMSG __USER_KMSG +#else +#define USER_KMSG 0 +#endif + +#define KBUF_SIZE (1 << 16) + +/* Sanity check */ +__static_assert(KBUF_SIZE <= (1 << 16), "KBUF_SIZE too high!"); + /* Global logger lock */ -static struct spinlock lock = {0}; +static struct spinlock kmsg_lock = {0}; +static bool no_cons_log = false; + +/* Kernel message buffer */ +static char kmsg[KBUF_SIZE]; +static size_t kmsg_i = 0; +static struct cdevsw kmsg_cdevw; + +static void +kmsg_append(const char *s, size_t len) +{ + spinlock_acquire(&kmsg_lock); + if ((kmsg_i + len) >= KBUF_SIZE) { + kmsg_i = 0; + } + + for (size_t i = 0; i < len; ++i) { + kmsg[kmsg_i + i] = s[i]; + } + kmsg_i += len; + spinlock_release(&kmsg_lock); +} + +/* + * Character device function. + */ +static int +kmsg_read(dev_t dev, struct sio_txn *sio, int flags) +{ + size_t len, offset, j; + size_t bytes_read = 0; + char *p = sio->buf; + + spinlock_acquire(&kmsg_lock); + len = sio->len; + offset = sio->offset; + + if (len == 0) { + spinlock_release(&kmsg_lock); + return -EINVAL; + } + if (offset >= kmsg_i) { + spinlock_release(&kmsg_lock); + return 0; + } + + for (size_t i = 0; i < len; ++i) { + j = offset + i; + if (j > kmsg_i) { + break; + } + + p[i] = kmsg[j]; + ++bytes_read; + } + + spinlock_release(&kmsg_lock); + return bytes_read; +} static void syslog_write(const char *s, size_t len) { - const char *p = s; + const char *p; + size_t l; - while (len--) { - cons_putch(&g_root_scr, *p); - if (SERIAL_DEBUG) { + if (SERIAL_DEBUG) { + p = s; + l = len; + while (l--) { serial_putc(*p); + ++p; } - ++p; } + + kmsg_append(s, len); + + /* + * If the USER_KMSG option is disabled in kconf, + * do not log to the console if everything else + * has already started. + */ + if (!USER_KMSG && no_cons_log) { + return; + } + + cons_putstr(&g_root_scr, s, len); } /* @@ -101,7 +190,6 @@ kprintf(const char *fmt, ...) } } - spinlock_acquire(&lock); if (use_timestamp) { syslog_write(timestamp, strlen(timestamp)); } @@ -110,5 +198,38 @@ kprintf(const char *fmt, ...) vkprintf(fmt_p, &ap); va_end(ap); - spinlock_release(&lock); } + +/* + * Silence kernel messages in if the system + * is already operating in a user context. + * + * XXX: This is ignored if the kconf USER_KMSG + * option is set to "no". A kmsg device file + * is also created on the first call. + */ +void +syslog_silence(bool option) +{ + static bool once = false; + static char devname[] = "kmsg"; + devmajor_t major; + dev_t dev; + + if (!once) { + once = true; + major = dev_alloc_major(); + dev = dev_alloc(major); + + dev_register(major, dev, &kmsg_cdevw); + devfs_create_entry(devname, major, dev, 0444); + + } + + no_cons_log = option; +} + +static struct cdevsw kmsg_cdevw = { + .read = kmsg_read, + .write = nowrite +}; diff --git a/sys/include/net/if_ether.h b/sys/kern/kern_time.c index a8fcfa5..e741157 100644 --- a/sys/include/net/if_ether.h +++ b/sys/kern/kern_time.c @@ -27,48 +27,47 @@ * POSSIBILITY OF SUCH DAMAGE. */ -#ifndef _IF_ETHER_H_ -#define _IF_ETHER_H_ - -#include <sys/cdefs.h> #include <sys/types.h> -#include <net/if.h> - -#define MACADDR_LEN 6 - -struct __packed ether_frame { - uint8_t sync[7]; /* Preamble (sync stuff) */ - uint8_t spd; /* Start frame delimiter */ - uint8_t macd[6]; /* MAC destination */ - uint8_t macs[6]; /* MAC source */ - uint16_t type; /* Protocol type */ - char payload[1]; /* sized @ 1+n */ -}; +#include <sys/time.h> +#include <sys/syscall.h> +#include <sys/systm.h> +#include <sys/errno.h> +#include <sys/cdefs.h> +#include <dev/timer.h> +#include <machine/cdefs.h> /* - * Used by the driver to buffer packets. + * arg0: Timespec + * arg1: Remaining timeval */ -struct etherbuf { - struct ether_frame *frp; - off_t head; - off_t tail; - size_t cap; /* In entries */ -}; +scret_t +sys_sleep(struct syscall_args *scargs) +{ + struct timespec ts; + struct timer tmr; + size_t timeout_msec; + tmrr_status_t status; + int error; -/* - * Ethernet device - * - * if_ether: E - * driver: D - * - * @if_name: Interface name. - * @tx: Transmit packets (D->E) - */ -struct etherdev { - char if_name[IFNAMESIZ]; - struct etherbuf *buf; - ssize_t(*tx)(struct etherdev *ep, const void *buf, size_t len); - char mac_addr[MACADDR_LEN]; -}; + error = copyin((void *)scargs->arg0, &ts, sizeof(ts)); + if (error < 0) { + return error; + } + + if (ts.tv_nsec >= 1000000000) { + return -EINVAL; + } + + status = req_timer(TIMER_GP, &tmr); + if (__unlikely(status != TMRR_SUCCESS)) { + return -ENOTSUP; + } + if (__unlikely(tmr.msleep == NULL)) { + return -ENOTSUP; + } -#endif /* !_IF_ETHER_H_ */ + timeout_msec = ts.tv_nsec / 1000000; + timeout_msec += ts.tv_sec * 1000; + tmr.msleep(timeout_msec); + return 0; +} diff --git a/sys/kern/kern_uio.c b/sys/kern/kern_uio.c new file mode 100644 index 0000000..5cdd8f6 --- /dev/null +++ b/sys/kern/kern_uio.c @@ -0,0 +1,271 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/limits.h> +#include <sys/systm.h> +#include <sys/errno.h> +#include <sys/types.h> +#include <sys/uio.h> +#include <sys/filedesc.h> + +/* + * Clean up after a UIO copyin() operation + * + * @iov: iovec copy to clean up + * @iovcnt: Number of iovec entries + */ +void +uio_copyin_clean(struct iovec *iov, int iovcnt) +{ + for (int i = 0; i < iovcnt; ++i) { + if (iov[i].iov_base == NULL) { + continue; + } + + dynfree(iov[i].iov_base); + iov[i].iov_base = NULL; + } +} + +/* + * Read data into POSIX.1‐2017 iovec + * + * @filedes: File descriptor number + * @iov: I/O vector to read file into + * @iovnt: Number of I/O vectors + */ +ssize_t +readv(int filedes, const struct iovec *iov, int iovcnt) +{ + void *base; + size_t len; + ssize_t tmp, bytes_read = 0; + + if (filedes < 0) { + return -EINVAL; + } + + /* + * Make sure that this conforms to our max + * iovec limit. + */ + if (iovcnt > IOVEC_MAX) { + return -EINVAL; + } + + /* + * Go through each I/O vector and read a chunk + * of data into one. + */ + for (int i = 0; i < iovcnt; ++i) { + base = iov[i].iov_base; + len = iov[i].iov_len; + + /* + * If we encounter a base that is NULL, + * or if the length to read is an invalid + * value of zero. We can just assume this + * is some sort of weird list termination? + */ + if (base == NULL || len == 0) { + break; + } + + /* Read the file into this base */ + tmp = fd_read(filedes, base, len); + + /* Did anything go wrong? */ + if (tmp < 0) { + return tmp; + } + + /* No more data */ + if (tmp == 0) { + break; + } + + /* Read more bytes */ + bytes_read += tmp; + } + + return bytes_read; +} + +/* + * Write data from POSIX.1‐2017 iovec + * + * @filedes: File descriptor number + * @iov: I/O vector to write to file + * @iovnt: Number of I/O vectors + */ +ssize_t +writev(int filedes, const struct iovec *iov, int iovcnt) +{ + void *base; + size_t len; + ssize_t bytes_written = 0; + ssize_t tmp; + + if (filedes < 0) { + return -EINVAL; + } + + /* + * Are we within the limits? Return an + * error if not. + */ + if (iovcnt > IOVEC_MAX) { + return -EINVAL; + } + + for (int i = 0; i < iovcnt; ++i) { + base = iov[i].iov_base; + len = iov[i].iov_len; + + /* + * These are invalid, whatever these are, + * terminate our walk through. + */ + if (base == NULL || len == 0) { + break; + } + + /* Write the data from the iovec */ + tmp = fd_write(filedes, base, len); + + /* Was there an error? */ + if (tmp < 0) { + return tmp; + } + + /* No more data to read? */ + if (tmp == 0) { + break; + } + + bytes_written += tmp; + } + + return bytes_written; +} + +/* + * Validate iovecs coming in from userland + * and copy it to a kernel buffer. + * + * XXX: A new buffer is allocated in k_iov[i]->iov_base + * and must be freed with dynfree() after use. + * + * @u_iov: Userspace source iovecs + * @k_iov: Kernel destination iovec + * @iovcnt: Number of iovecs to copy + */ +int +uio_copyin(const struct iovec *u_iov, struct iovec *k_iov, int iovcnt) +{ + struct iovec *iov_dest; + const struct iovec *iov_src; + size_t len; + void *old_base; + int error; + + if (u_iov == NULL || k_iov == NULL) { + return -EINVAL; + } + + for (int i = 0; i < iovcnt; ++i) { + iov_dest = &k_iov[i]; + iov_src = &u_iov[i]; + error = copyin(iov_src, iov_dest, sizeof(*iov_dest)); + + if (error < 0) { + uio_copyin_clean(iov_dest, i + 1); + return error; + } + + /* + * Save the old base so that we may copy the data to + * the new kernel buffer. First we'd need to allocate + * one of course. + */ + old_base = iov_dest->iov_base; + len = iov_dest->iov_len; + iov_dest->iov_base = dynalloc(len); + + /* Did it fail? */ + if (iov_dest->iov_base == NULL) { + uio_copyin_clean(iov_dest, i + 1); + return -ENOMEM; + } + + /* Copy actual data in */ + error = copyin(old_base, iov_dest->iov_base, len); + if (error < 0) { + uio_copyin_clean(iov_dest, i + 1); + return error; + } + } + + return 0; +} + +/* + * Validate iovecs going out from kernel space (us) + * before actually sending it out. + * + * @k_iov: Kernel iovec to copyout + * @u_iov: Userspace destination + * @iovcnt: Number of iovecs + */ +int +uio_copyout(const struct iovec *k_iov, struct iovec *u_iov, int iovcnt) +{ + struct iovec iov_shadow, *iov_dest; + const struct iovec *iov_src; + int error; + + for (int i = 0; i < iovcnt; ++i) { + iov_dest = &u_iov[i]; + iov_src = &k_iov[i]; + + /* Grab a shadow copy */ + error = copyin(iov_src, &iov_shadow, sizeof(iov_shadow)); + if (error < 0) { + return error; + } + + /* Copy out actual data */ + error = copyout(iov_src->iov_base, iov_dest->iov_base, iov_dest->iov_len); + if (error < 0) { + return error; + } + } + + return 0; +} diff --git a/sys/kern/kern_vsr.c b/sys/kern/kern_vsr.c new file mode 100644 index 0000000..c59be1e --- /dev/null +++ b/sys/kern/kern_vsr.c @@ -0,0 +1,344 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/vsr.h> +#include <sys/proc.h> +#include <sys/param.h> +#include <sys/limits.h> +#include <sys/syslog.h> +#include <vm/dynalloc.h> +#include <string.h> + +#define pr_trace(fmt, ...) kprintf("vsr: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) + +static uint32_t +fnv1_hash(const char *s) +{ + uint32_t hash = 2166136261UL; + const uint8_t *p = (uint8_t *)s; + + while (*p != '\0') { + hash ^= *p; + hash = hash * 0x01000193; + ++p; + } + + return hash; +} + +/* + * Add a VSR capsule to a domain. + */ +static void +vsr_domain_add(struct vsr_domain *vsp, struct vsr_capsule *cap) +{ + struct vsr_table *tab; + struct vsr_capsule **slot; + uint32_t hash; + + if (vsp == NULL || cap == NULL) { + return; + } + + if (cap->name == NULL) { + pr_error("vsr_domain_add: cap->name == NULL\n"); + return; + } + + tab = &vsp->table; + hash = fnv1_hash(cap->name); + slot = &tab->capsules[hash % VSR_MAX_CAPSULE]; + + /* If this slot is free, set it */ + if (*slot == NULL) { + *slot = cap; + return; + } + + /* Handle collision */ + TAILQ_INSERT_TAIL(&(*slot)->buckets, cap, link); +} + +/* + * Handle VSR domain hashmap collisions. + * + * @slot: Slot that we have collided with + * @name: Name to lookup + * + * Returns the pointer to the actual capsule if the + * collision has been resolved, otherwise, NULL if the + * entry to look up was not found. + */ +static struct vsr_capsule * +vsr_domain_clash(struct vsr_capsule *slot, const char *name) +{ + struct vsr_capsule *cap_ent; + + TAILQ_FOREACH(cap_ent, &slot->buckets, link) { + if (cap_ent == NULL) { + continue; + } + + if (strcmp(cap_ent->name, name) == 0) { + return cap_ent; + } + } + + return NULL; +} + +/* + * Lookup a capsule within a VSR domain + * by name. + * + * @vsp: Domain to lookup within + * @name: Name to use as lookup key + * + * Returns NULL if no entry was found. + */ +static struct vsr_capsule * +vfs_domain_lookup(struct vsr_domain *vsp, const char *name) +{ + uint32_t hash; + struct vsr_table *tab; + struct vsr_capsule **slot; + + if (vsp == NULL || name == NULL) { + return NULL; + } + + tab = &vsp->table; + hash = fnv1_hash(name); + slot = &tab->capsules[hash % VSR_MAX_CAPSULE]; + + if (*slot == NULL) { + return NULL; + } + + if (strcmp((*slot)->name, name) != 0) { + return vsr_domain_clash(*slot, name); + } + + return *slot; +} + +/* + * Destroy a VSR capsule + * + * @capule: Capsule to destroy + */ +static void +vsr_destroy_capsule(struct vsr_capsule *capsule) +{ + struct vsr_capsule *bucket; + struct capsule_ops *ops; + + if (capsule->name != NULL) { + dynfree(capsule->name); + capsule->name = NULL; + } + + ops = &capsule->ops; + if (ops->reclaim != NULL) { + ops->reclaim(capsule, 0); + } + + TAILQ_FOREACH(bucket, &capsule->buckets, link) { + if (bucket == NULL) { + continue; + } + vsr_destroy_capsule(bucket); + } + + /* Release any held locks */ + mutex_release(&capsule->lock); +} + +/* + * Destroy a VSR table + * + * @tab: Table to destroy. + */ +static void +vsr_destroy_table(struct vsr_table *tab) +{ + struct vsr_capsule *capsule; + + if (tab == NULL) { + pr_error("vsr_destroy_table: tab is NULL\n"); + return; + } + + for (int i = 0; i < VSR_MAX_CAPSULE; ++i) { + if ((capsule = tab->capsules[i]) == NULL) { + continue; + } + + vsr_destroy_capsule(capsule); + } +} + +/* + * Allocate a new VSR capsule and add it to + * VSR domain. + * + * @type: Domain type (e.g., VSR_FILE) + * @name: Capsule name (e.g., "mod0.data") + * @sz: Length of capsulized data + */ +struct vsr_capsule * +vsr_new_capsule(struct proc *td, vsr_domain_t type, const char *name) +{ + struct vsr_capsule *capsule; + struct vsr_domain *domain; + + /* Valid args? */ + if (type >= VSR_MAX_DOMAIN || td == NULL) { + return NULL; + } + + /* + * The VSR domain must be registered for + * us to add any capsules to it. + */ + if ((domain = td->vsr_tab[type]) == NULL) { + pr_error("VSR domain %d not registered\n", type); + return NULL; + } + + /* Allocate a new capsule */ + capsule = dynalloc(sizeof(*capsule)); + if (capsule == NULL) { + return NULL; + } + + memset(capsule, 0, sizeof(*capsule)); + capsule->name = strdup(name); + + TAILQ_INIT(&capsule->buckets); + vsr_domain_add(domain, capsule); + return capsule; +} + +/* + * Allocate a new VSR domain and add it to + * a specific process. + * + * @type: VSR type (e.g., VSR_FILE) + */ +struct vsr_domain * +vsr_new_domain(struct proc *td, vsr_domain_t type) +{ + struct vsr_domain *domain; + + /* Valid args? */ + if (type >= VSR_MAX_DOMAIN || td == NULL) { + return NULL; + } + + /* + * Do not overwrite the entry if it is + * already allocated and log this anomalous + * activity. + */ + if (td->vsr_tab[type] != NULL) { + pr_error("[security]: type %d already allocated\n", type); + return NULL; + } + + domain = dynalloc(sizeof(*domain)); + if (domain == NULL) { + return NULL; + } + + /* Initialize the domain */ + memset(domain, 0, sizeof(*domain)); + domain->type = type; + + td->vsr_tab[type] = domain; + return domain; +} + +/* + * Lookup a capsule by name for the current + * process. + */ +struct vsr_capsule * +vsr_lookup_capsule(struct proc *td, vsr_domain_t type, const char *name) +{ + struct vsr_domain *domain; + + if (td == NULL) { + return NULL; + } + + /* + * The VSR domain must be registered for + * us to lookup any capsules from it. + */ + if ((domain = td->vsr_tab[type]) == NULL) { + pr_error("VSR domain %d not registered\n", type); + return NULL; + } + + return vfs_domain_lookup(domain, name); +} + +/* + * Initialize per-process domains + */ +void +vsr_init_domains(struct proc *td) +{ + if (vsr_new_domain(td, VSR_FILE) == NULL) { + pr_error("failed to initialize VSR file domain\n"); + } +} + +/* + * Destroy per-process domains + */ +void +vsr_destroy_domains(struct proc *td) +{ + struct vsr_domain *domain; + + if (td == NULL) { + return; + } + + for (int i = 0; i < VSR_MAX_DOMAIN; ++i) { + if ((domain = td->vsr_tab[i]) == NULL) { + continue; + } + + vsr_destroy_table(&domain->table); + } +} diff --git a/sys/kern/kern_work.c b/sys/kern/kern_work.c new file mode 100644 index 0000000..918af89 --- /dev/null +++ b/sys/kern/kern_work.c @@ -0,0 +1,274 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/errno.h> +#include <sys/panic.h> +#include <sys/proc.h> +#include <sys/sched.h> +#include <sys/syslog.h> +#include <sys/workqueue.h> +#include <vm/dynalloc.h> +#include <string.h> + +#define pr_trace(fmt, ...) kprintf("workq: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) + +extern struct proc g_proc0; + +/* + * The workqueue cookie value that is used for + * verifying if a workqueue object is properly + * set up or not. + */ +#define WQ_COOKIE 0xFC0B + +/* + * A worker services work in the queue + * and there is one per workqueue. + */ +static void +workqueue_worker(void) +{ + struct proc *td; + struct workqueue *wqp; + struct work *wp; + + td = this_td(); + if ((wqp = td->data) == NULL) { + panic("no workqueue in thread\n"); + } + + /* + * Weird things can happen, just be careful + * here... + */ + if (wqp->cookie != WQ_COOKIE) { + panic("bad WQ_COOKIE in worker\n"); + } + + for (;;) { + mutex_acquire(wqp->lock, 0); + wp = TAILQ_FIRST(&wqp->work); + + /* Try again later if empty */ + if (wp == NULL) { + mutex_release(wqp->lock); + sched_yield(); + continue; + } + + wp->func(wqp, wp); + TAILQ_REMOVE(&wqp->work, wp, link); + + /* + * Decrement the amount of work that is + * left to get done. Check for underflows + * which should not happen unless something + * clobbers the fields. + */ + if ((--wqp->nwork) < 0) { + panic("wqp nwork underflow\n"); + } + + mutex_release(wqp->lock); + sched_yield(); + } +} + +/* + * Allocates a new work queue that may be used + * to hold queued up tasks. + * + * @name: Name to give the workqueue + * @max_work: Maximum number of jobs to be added + * @ipl: IPL that the work must operate in + * + * Returns a pointer to the new workqueue on success, + * otherwise a value of NULL is returned. + */ +struct workqueue * +workqueue_new(const char *name, size_t max_work, int ipl) +{ + struct workqueue *wqp; + struct proc *td; + + td = this_td(); + if (__unlikely(td == NULL)) { + pr_error("no thread in workqueue_new()\n"); + return NULL; + } + + wqp = dynalloc(sizeof(*wqp)); + if (wqp == NULL) { + return NULL; + } + + wqp->name = strdup(name); + TAILQ_INIT(&wqp->work); + wqp->ipl = ipl; + wqp->max_work = max_work; + wqp->nwork = 0; + wqp->cookie = WQ_COOKIE; + wqp->lock = mutex_new(wqp->name); + + /* + * We need to spawn the work thread which + * is behind the management of this specific + * workqueue. It typically does something like + * dequeuing at the head of the workqueue, performing + * the work, cleaning up as needed and dequeuing the + * next and waiting if there are none yet. + */ + spawn( + &g_proc0, workqueue_worker, + wqp, 0, + &wqp->worktd + ); + + return wqp; +} + +/* + * Enqueue a work item onto a specific + * workqueue. + * + * @wqp: Pointer to specific workqueue + * @name: Name to set for work unit + * @wp: Pointer to work that should be enqueued + * + * Returns zero on success, otherwise a less than + * zero value is returned. + */ +int +workqueue_enq(struct workqueue *wqp, const char *name, struct work *wp) +{ + if (wqp == NULL || wp == NULL) { + return -EINVAL; + } + + if (name == NULL) { + return -EINVAL; + } + + /* Verify that we have a valid workqueue */ + if (__unlikely(wqp->cookie != WQ_COOKIE)) { + panic("workq: bad cookie on work enqueue\n"); + } + + wp->name = strdup(name); + mutex_acquire(wqp->lock, 0); + + /* + * If we have reached the max amount of jobs + * that we can enqueue here, just log it and + * bail. + */ + if (wqp->nwork >= wqp->max_work) { + pr_error("max jobs reached for '%s'\n", wqp->name); + mutex_release(wqp->lock); + return -EAGAIN; + } + + TAILQ_INSERT_TAIL(&wqp->work, wp, link); + ++wqp->nwork; + mutex_release(wqp->lock); + return 0; +} + +/* + * Destroy a workqueue and free resources + * associated with it. + * + * @wqp: Pointer to workqueue to destroy + * + * Returns zero on success, otherwise a less + * than zero value is returned. + */ +int +workqueue_destroy(struct workqueue *wqp) +{ + if (wqp == NULL) { + return -EINVAL; + } + + /* Should not happen but just make sure */ + if (__unlikely(wqp->cookie != WQ_COOKIE)) { + panic("workq: bad cookie on destroy\n"); + } + + /* Free the name if we have it */ + if (wqp->name != NULL) { + dynfree(wqp->name); + } + + if (wqp->lock != NULL) { + mutex_free(wqp->lock); + } + + /* Brutally murder any workthreads */ + if (wqp->worktd != NULL) { + exit1(wqp->worktd, 0); + wqp->worktd = NULL; + } + + /* + * Zero before we free for security reasons, we + * don't really know what will be queued up but + * for certain things, it is best if we make it + * as if it never existed in the first place. + * + * XXX: There is no need to free the workqueue here as + * we had to pass it to spawn() to run the worker. + * + * During an exit, spawn() will free the thread data + * meaning this is already cleaned up. + */ + memset(wqp, 0, sizeof(*wqp)); + return 0; +} + +/* + * Cleanup after work + * + * @wp: Work to clean up + */ +int +work_destroy(struct work *wp) +{ + if (wp == NULL) { + return -EINVAL; + } + + if (wp->name != NULL) { + dynfree(wp->name); + } + + return 0; +} diff --git a/sys/kern/vfs_init.c b/sys/kern/vfs_init.c index 8c1bc74..bc7f8b0 100644 --- a/sys/kern/vfs_init.c +++ b/sys/kern/vfs_init.c @@ -37,7 +37,8 @@ struct vnode *g_root_vnode = NULL; static struct fs_info fs_list[] = { {MOUNT_RAMFS, &g_initramfs_vfsops, 0, 0}, {MOUNT_DEVFS, &g_devfs_vfsops, 0, 0}, - {MOUNT_CTLFS, &g_ctlfs_vfsops, 0, 0} + {MOUNT_CTLFS, &g_ctlfs_vfsops, 0, 0}, + {MOUNT_TMPFS, &g_tmpfs_vfsops, 0, 0} }; void diff --git a/sys/kern/vfs_lookup.c b/sys/kern/vfs_lookup.c index d04b812..7320102 100644 --- a/sys/kern/vfs_lookup.c +++ b/sys/kern/vfs_lookup.c @@ -29,6 +29,7 @@ #include <sys/namei.h> #include <sys/vnode.h> +#include <sys/param.h> #include <sys/mount.h> #include <sys/errno.h> #include <vm/dynalloc.h> @@ -118,20 +119,60 @@ vfs_get_fname_at(const char *path, size_t idx) } /* + * Count the number of components that exist within + * a path minus the delimiter as well as any redundant + * delimiters. + * + * @path: Path to count + */ +static uint8_t +namei_num_cnp(const char *path) +{ + const char *p = path; + uint8_t count = 0; + + while (*p != '\0') { + /* Skip redundant delimiters */ + if (p[0] == '/' && p[1] == '/') { + ++p; + continue; + } + + if (*p == '/') { + ++count; + } + ++p; + } + + /* Don't count leading slash */ + if (*(p - 1) == '/') { + --count; + } + + return count; +} + +/* * Search for a path within a mountpoint. * * @mp: Mountpoint to search in. * @path: Path to search for. + * @ndp: Namei data pointer */ static struct vnode * -namei_mp_search(struct mount *mp, const char *path) +namei_mp_search(struct mount *mp, const char *path, struct nameidata *ndp) { struct vop_lookup_args lookup_args; struct vnode *vp = mp->vp; + uint8_t n_cnp = 0; char *name; int status; - for (size_t i = 1;; ++i) { + n_cnp = namei_num_cnp(path); + if (ISSET(ndp->flags, NAMEI_WANTPARENT)) { + --n_cnp; + } + for (size_t i = 1; i < n_cnp; ++i) { name = vfs_get_fname_at(path, i); if (name == NULL) break; @@ -140,7 +181,7 @@ namei_mp_search(struct mount *mp, const char *path) lookup_args.dirvp = vp; lookup_args.vpp = &vp; - status = vfs_vop_lookup(vp, &lookup_args); + status = vfs_vop_lookup(&lookup_args); dynfree(name); if (status != 0) { @@ -193,7 +234,7 @@ namei(struct nameidata *ndp) lookup_args.name = path; lookup_args.dirvp = g_root_vnode; lookup_args.vpp = &vp; - status = vfs_vop_lookup(lookup_args.dirvp, &lookup_args); + status = vfs_vop_lookup(&lookup_args); /* Did we find it in the root */ if (status == 0) { @@ -212,7 +253,7 @@ namei(struct nameidata *ndp) /* If the name matches, search within */ if (strcmp(mp->name, name) == 0) - vp = namei_mp_search(mp, path); + vp = namei_mp_search(mp, path, ndp); /* Did we find it at this mountpoint? */ if (vp != NULL) { diff --git a/sys/kern/vfs_subr.c b/sys/kern/vfs_subr.c index da0a4f9..69417d0 100644 --- a/sys/kern/vfs_subr.c +++ b/sys/kern/vfs_subr.c @@ -141,8 +141,9 @@ vfs_release_vnode(struct vnode *vp) } int -vfs_vop_lookup(struct vnode *vp, struct vop_lookup_args *args) +vfs_vop_lookup(struct vop_lookup_args *args) { + const struct vnode *vp = args->dirvp; const struct vops *vops = vp->vops; if (vops == NULL) @@ -180,8 +181,9 @@ vfs_vop_write(struct vnode *vp, struct sio_txn *sio) } int -vfs_vop_getattr(struct vnode *vp, struct vop_getattr_args *args) +vfs_vop_getattr(struct vop_getattr_args *args) { + const struct vnode *vp = args->vp; const struct vops *vops = vp->vops; if (vops == NULL) diff --git a/sys/kern/vfs_syscalls.c b/sys/kern/vfs_syscalls.c index 990d722..d15ecf1 100644 --- a/sys/kern/vfs_syscalls.c +++ b/sys/kern/vfs_syscalls.c @@ -43,7 +43,7 @@ static int vfs_dostat(const char *path, struct stat *sbuf) { char pathbuf[PATH_MAX]; - struct vattr *attr; + struct vattr attr; struct stat st; struct vnode *vp; struct vop_getattr_args gattr; @@ -58,7 +58,7 @@ vfs_dostat(const char *path, struct stat *sbuf) return -EFAULT; } - nd.path = path; + nd.path = pathbuf; nd.flags = 0; if ((error = namei(&nd)) != 0) { @@ -67,19 +67,42 @@ vfs_dostat(const char *path, struct stat *sbuf) vp = nd.vp; gattr.vp = vp; - error = vfs_vop_getattr(vp, &gattr); + gattr.res = &attr; + error = vfs_vop_getattr(&gattr); if (error != 0) { return error; } - attr = gattr.res; memset(&st, VNOVAL, sizeof(st)); /* Copy stat data to userspace statbuf */ - st.st_mode = attr->mode; - st.st_size = attr->size; + st.st_mode = attr.mode; + st.st_size = attr.size; copyout(&st, sbuf, sizeof(*sbuf)); + vfs_release_vnode(vp); + return 0; +} + +static int +vfs_doaccess(const char *path) +{ + struct nameidata nd; + char pathbuf[PATH_MAX]; + int error; + + if ((copyinstr(path, pathbuf, sizeof(pathbuf))) < 0) { + return -EFAULT; + } + + nd.path = pathbuf; + nd.flags = 0; + + if ((error = namei(&nd)) != 0) { + return error; + } + + vfs_release_vnode(nd.vp); return 0; } @@ -149,3 +172,14 @@ sys_stat(struct syscall_args *scargs) { return vfs_dostat((const char *)scargs->arg0, (void *)scargs->arg1); } + +/* + * Check if a file can be accessed. + * + * @arg0: path + */ +scret_t +sys_access(struct syscall_args *scargs) +{ + return vfs_doaccess((const char *)scargs->arg0); +} diff --git a/sys/kern/vfs_vcache.c b/sys/kern/vfs_vcache.c index 25e244c..6c08caf 100644 --- a/sys/kern/vfs_vcache.c +++ b/sys/kern/vfs_vcache.c @@ -161,7 +161,7 @@ vfs_vcache_migrate(int newtype) args.oldp = NULL; args.oldlenp = NULL; args.newp = sysctl_val; - args.newlen = strlen(sysctl_val); + args.newlen = strlen(sysctl_val) + 1; if ((retval = sysctl(&args)) != 0) { return retval; diff --git a/sys/lib/crc32.c b/sys/lib/crc32.c new file mode 100644 index 0000000..dda4428 --- /dev/null +++ b/sys/lib/crc32.c @@ -0,0 +1,89 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <crc32.h> + +static const uint32_t crc32_tab[] = { + 0x00000000, 0x77073096, 0xEE0E612C, 0x990951BA, 0x076DC419, 0x706AF48F, + 0xE963A535, 0x9E6495A3, 0x0EDB8832, 0x79DCB8A4, 0xE0D5E91E, 0x97D2D988, + 0x09B64C2B, 0x7EB17CBD, 0xE7B82D07, 0x90BF1D91, 0x1DB71064, 0x6AB020F2, + 0xF3B97148, 0x84BE41DE, 0x1ADAD47D, 0x6DDDE4EB, 0xF4D4B551, 0x83D385C7, + 0x136C9856, 0x646BA8C0, 0xFD62F97A, 0x8A65C9EC, 0x14015C4F, 0x63066CD9, + 0xFA0F3D63, 0x8D080DF5, 0x3B6E20C8, 0x4C69105E, 0xD56041E4, 0xA2677172, + 0x3C03E4D1, 0x4B04D447, 0xD20D85FD, 0xA50AB56B, 0x35B5A8FA, 0x42B2986C, + 0xDBBBC9D6, 0xACBCF940, 0x32D86CE3, 0x45DF5C75, 0xDCD60DCF, 0xABD13D59, + 0x26D930AC, 0x51DE003A, 0xC8D75180, 0xBFD06116, 0x21B4F4B5, 0x56B3C423, + 0xCFBA9599, 0xB8BDA50F, 0x2802B89E, 0x5F058808, 0xC60CD9B2, 0xB10BE924, + 0x2F6F7C87, 0x58684C11, 0xC1611DAB, 0xB6662D3D, 0x76DC4190, 0x01DB7106, + 0x98D220BC, 0xEFD5102A, 0x71B18589, 0x06B6B51F, 0x9FBFE4A5, 0xE8B8D433, + 0x7807C9A2, 0x0F00F934, 0x9609A88E, 0xE10E9818, 0x7F6A0DBB, 0x086D3D2D, + 0x91646C97, 0xE6635C01, 0x6B6B51F4, 0x1C6C6162, 0x856530D8, 0xF262004E, + 0x6C0695ED, 0x1B01A57B, 0x8208F4C1, 0xF50FC457, 0x65B0D9C6, 0x12B7E950, + 0x8BBEB8EA, 0xFCB9887C, 0x62DD1DDF, 0x15DA2D49, 0x8CD37CF3, 0xFBD44C65, + 0x4DB26158, 0x3AB551CE, 0xA3BC0074, 0xD4BB30E2, 0x4ADFA541, 0x3DD895D7, + 0xA4D1C46D, 0xD3D6F4FB, 0x4369E96A, 0x346ED9FC, 0xAD678846, 0xDA60B8D0, + 0x44042D73, 0x33031DE5, 0xAA0A4C5F, 0xDD0D7CC9, 0x5005713C, 0x270241AA, + 0xBE0B1010, 0xC90C2086, 0x5768B525, 0x206F85B3, 0xB966D409, 0xCE61E49F, + 0x5EDEF90E, 0x29D9C998, 0xB0D09822, 0xC7D7A8B4, 0x59B33D17, 0x2EB40D81, + 0xB7BD5C3B, 0xC0BA6CAD, 0xEDB88320, 0x9ABFB3B6, 0x03B6E20C, 0x74B1D29A, + 0xEAD54739, 0x9DD277AF, 0x04DB2615, 0x73DC1683, 0xE3630B12, 0x94643B84, + 0x0D6D6A3E, 0x7A6A5AA8, 0xE40ECF0B, 0x9309FF9D, 0x0A00AE27, 0x7D079EB1, + 0xF00F9344, 0x8708A3D2, 0x1E01F268, 0x6906C2FE, 0xF762575D, 0x806567CB, + 0x196C3671, 0x6E6B06E7, 0xFED41B76, 0x89D32BE0, 0x10DA7A5A, 0x67DD4ACC, + 0xF9B9DF6F, 0x8EBEEFF9, 0x17B7BE43, 0x60B08ED5, 0xD6D6A3E8, 0xA1D1937E, + 0x38D8C2C4, 0x4FDFF252, 0xD1BB67F1, 0xA6BC5767, 0x3FB506DD, 0x48B2364B, + 0xD80D2BDA, 0xAF0A1B4C, 0x36034AF6, 0x41047A60, 0xDF60EFC3, 0xA867DF55, + 0x316E8EEF, 0x4669BE79, 0xCB61B38C, 0xBC66831A, 0x256FD2A0, 0x5268E236, + 0xCC0C7795, 0xBB0B4703, 0x220216B9, 0x5505262F, 0xC5BA3BBE, 0xB2BD0B28, + 0x2BB45A92, 0x5CB36A04, 0xC2D7FFA7, 0xB5D0CF31, 0x2CD99E8B, 0x5BDEAE1D, + 0x9B64C2B0, 0xEC63F226, 0x756AA39C, 0x026D930A, 0x9C0906A9, 0xEB0E363F, + 0x72076785, 0x05005713, 0x95BF4A82, 0xE2B87A14, 0x7BB12BAE, 0x0CB61B38, + 0x92D28E9B, 0xE5D5BE0D, 0x7CDCEFB7, 0x0BDBDF21, 0x86D3D2D4, 0xF1D4E242, + 0x68DDB3F8, 0x1FDA836E, 0x81BE16CD, 0xF6B9265B, 0x6FB077E1, 0x18B74777, + 0x88085AE6, 0xFF0F6A70, 0x66063BCA, 0x11010B5C, 0x8F659EFF, 0xF862AE69, + 0x616BFFD3, 0x166CCF45, 0xA00AE278, 0xD70DD2EE, 0x4E048354, 0x3903B3C2, + 0xA7672661, 0xD06016F7, 0x4969474D, 0x3E6E77DB, 0xAED16A4A, 0xD9D65ADC, + 0x40DF0B66, 0x37D83BF0, 0xA9BCAE53, 0xDEBB9EC5, 0x47B2CF7F, 0x30B5FFE9, + 0xBDBDF21C, 0xCABAC28A, 0x53B39330, 0x24B4A3A6, 0xBAD03605, 0xCDD70693, + 0x54DE5729, 0x23D967BF, 0xB3667A2E, 0xC4614AB8, 0x5D681B02, 0x2A6F2B94, + 0xB40BBE37, 0xC30C8EA1, 0x5A05DF1B, 0x2D02EF8D +}; + +uint32_t +crc32(const void *data, size_t len) +{ + const uint8_t *p = data; + uint32_t val = 0xFFFFFFFF; + + for (size_t i = 0; i < len; ++i) { + val = (val >> 8) ^ crc32_tab[(val ^ p[i]) & 0xFF]; + } + + return val ^ 0xFFFFFFFF; +} diff --git a/sys/lib/string/strdup.c b/sys/lib/string/strdup.c new file mode 100644 index 0000000..9c101bc --- /dev/null +++ b/sys/lib/string/strdup.c @@ -0,0 +1,52 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <string.h> +#include <vm/dynalloc.h> + +char * +strdup(const char *s) +{ + size_t s_len; + char *p; + + /* Make sure size is not zero */ + if ((s_len = strlen(s)) == 0) { + return NULL; + } + + /* Allocate new memory for this string */ + p = dynalloc(s_len + 1); + if (p == NULL) { + return NULL; + } + + memcpy(p, s, s_len); + return p; +} diff --git a/sys/lib/string/vsnprintf.c b/sys/lib/string/vsnprintf.c index e9e391f..489514f 100644 --- a/sys/lib/string/vsnprintf.c +++ b/sys/lib/string/vsnprintf.c @@ -96,6 +96,9 @@ vsnprintf(char *s, size_t size, const char *fmt, va_list ap) c1 = (char )va_arg(ap, int); printc(s, size, &off, c1); break; + case '%': + printc(s, size, &off, c); + break; case 'd': num = va_arg(ap, int); itoa(num, num_buf, 10); @@ -104,6 +107,7 @@ vsnprintf(char *s, size_t size, const char *fmt, va_list ap) num_len = strlen(num_buf); for (size_t i = num_len; i < pad_width; ++i) printc(s, size, &off, '0'); + pad_width = 0; } printstr(s, size, &off, num_buf); break; diff --git a/sys/net/if.c b/sys/net/if.c new file mode 100644 index 0000000..5c9bc01 --- /dev/null +++ b/sys/net/if.c @@ -0,0 +1,85 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/queue.h> +#include <sys/spinlock.h> +#include <sys/errno.h> +#include <net/if_var.h> +#include <string.h> + +static TAILQ_HEAD(, netif) netif_list; +static bool netif_init = false; + +/* + * Expose a network interface to the rest of the + * system. + */ +void +netif_add(struct netif *nifp) +{ + if (!netif_init) { + TAILQ_INIT(&netif_list); + netif_init = true; + } + + TAILQ_INSERT_TAIL(&netif_list, nifp, link); +} + +/* + * Lookup a network interface by name or type. + * + * @name: Name to lookup (use `type' if NULL) + * @type: Type to lookup (use if `name' is NULL) + */ +int +netif_lookup(const char *name, uint8_t type, struct netif **res) +{ + struct netif *netif; + + if (!netif_init) { + return -EAGAIN; + } + + TAILQ_FOREACH(netif, &netif_list, link) { + if (name != NULL) { + if (strcmp(netif->name, name) == 0) { + *res = netif; + return 0; + } + } + + if (name == NULL && netif->type == type) { + *res = netif; + return 0; + } + } + + return -ENODEV; +} diff --git a/sys/netinet/if_ether.c b/sys/netinet/if_ether.c new file mode 100644 index 0000000..db1d6d4 --- /dev/null +++ b/sys/netinet/if_ether.c @@ -0,0 +1,122 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/endian.h> +#include <sys/errno.h> +#include <vm/dynalloc.h> +#include <net/ethertypes.h> +#include <netinet/if_ether.h> +#include <string.h> + +struct arp_pkt { + struct ether_frame ehfr; + struct ether_arp payload; +}; + +static struct arp_pkt * +arp_create(struct netif *nifp, uint32_t *sproto, uint32_t *tproto, uint16_t op) +{ + struct arp_pkt *packet; + struct arp_hdr *hdrp; + struct ether_frame *frp; + struct ether_arp *payload; + + packet = dynalloc(sizeof(*packet)); + if (packet == NULL) { + return NULL; + } + + frp = &packet->ehfr; + payload = &packet->payload; + hdrp = &payload->hdr; + + /* Ethernet frame, from source to all */ + memcpy(frp->ether_saddr, &nifp->addr, ETHER_ADDR_LEN); + memset(frp->ether_daddr, 0xFF, ETHER_ADDR_LEN); + frp->ether_type = swap16(ETHERTYPE_ARP); + + /* Now for the ARP header */ + hdrp->hw_type = swap16(ARP_HWTYPE_ETHER); + hdrp->proto_type = swap16(ETHERTYPE_IPV4); + hdrp->hw_len = ETHER_ADDR_LEN; + hdrp->proto_len = 4; + hdrp->op_type = swap16(op); + + memcpy(payload->sha, frp->ether_saddr, ETHER_ADDR_LEN); + memset(payload->tha, 0xFF, ETHER_ADDR_LEN); + + /* Protocol source address */ + *((uint32_t *)payload->spa) = *sproto; + *((uint32_t *)payload->tpa) = *tproto; + return packet; +} + +static int +arp_send(struct netif *nifp, uint8_t *sproto, uint8_t *tproto, uint16_t op) +{ + struct arp_pkt *packet; + struct netbuf nb; + uint32_t *src_tmp, *targ_tmp; + + if (nifp->tx_enq == NULL) { + return -ENOTSUP; + } + if (nifp->tx_start == NULL) { + return -ENOTSUP; + } + + src_tmp = (uint32_t *)sproto; + targ_tmp = (uint32_t *)tproto; + + packet = arp_create(nifp, src_tmp, targ_tmp, op); + if (packet == NULL) { + return -ENOMEM; + } + + nb.len = sizeof(*packet); + memcpy(nb.data, packet, nb.len); + + nifp->tx_enq(nifp, &nb, NULL); + nifp->tx_start(nifp); + dynfree(packet); + return 0; +} + +int +arp_request(struct netif *nifp, uint8_t *sproto, uint8_t *tproto) +{ + return arp_send(nifp, sproto, tproto, ARP_REQUEST); +} + +int +arp_reply(struct netif *nifp, uint8_t *sproto, uint8_t *tproto) +{ + return arp_send(nifp, sproto, tproto, ARP_REPLY); +} diff --git a/sys/vm/vm_device.c b/sys/vm/vm_device.c new file mode 100644 index 0000000..e990b47 --- /dev/null +++ b/sys/vm/vm_device.c @@ -0,0 +1,78 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/device.h> +#include <sys/syslog.h> +#include <vm/vm_device.h> + +#define pr_trace(fmt, ...) kprintf("vm_device: " fmt, ##__VA_ARGS__) +#define pr_error(...) pr_trace(__VA_ARGS__) + +const struct vm_pagerops dv_vnops; + +/* + * Attach a cdev to a vm_object + * + * @major: Char device major + * @minor: Char device minor. + */ +struct vm_object * +dv_attach(devmajor_t major, dev_t dev, vm_prot_t prot) +{ + int error; + struct cdevsw *cdevp; + struct vm_object *vmobj; + + if ((cdevp = dev_get(major, dev)) == NULL) { + pr_error("bad attach (major=%d, dev=%d)\n", major, dev); + return NULL; + } + + if (cdevp->mmap == NULL) { + pr_error("cdev lacks mmap() (major=%d, dev=%d)\n", major, dev); + return NULL; + } + + error = vm_obj_init(&cdevp->vmobj, &dv_vnops, 1); + if (error != 0) { + return NULL; + } + + vmobj = &cdevp->vmobj; + vmobj->prot = prot; + vmobj->data = cdevp; + vmobj->pgops = &dv_vnops; + return vmobj; +} + +/* TODO */ +const struct vm_pagerops dv_vnops = { + .get = NULL, +}; diff --git a/sys/vm/vm_init.c b/sys/vm/vm_init.c index 2846a69..7518838 100644 --- a/sys/vm/vm_init.c +++ b/sys/vm/vm_init.c @@ -56,6 +56,7 @@ vm_init(void) void *pool; vm_physmem_init(); + pmap_init(); g_kvas = pmap_read_vas(); vm_ctx.dynalloc_pool_sz = DYNALLOC_POOL_SZ; diff --git a/sys/vm/vm_map.c b/sys/vm/vm_map.c index b56e896..bb9df83 100644 --- a/sys/vm/vm_map.c +++ b/sys/vm/vm_map.c @@ -35,8 +35,10 @@ #include <sys/syscall.h> #include <sys/syslog.h> #include <sys/mman.h> +#include <sys/filedesc.h> #include <vm/dynalloc.h> #include <vm/vm_pager.h> +#include <vm/vm_device.h> #include <vm/pmap.h> #include <vm/map.h> #include <vm/vm.h> @@ -157,51 +159,113 @@ vm_map_modify(struct vas vas, vaddr_t va, paddr_t pa, vm_prot_t prot, bool unmap * crashes. */ void * -mmap_at(void *addr, size_t len, int prot, int flags, int fildes, off_t off) +mmap(void *addr, size_t len, int prot, int flags, int fildes, off_t off) { - struct vm_object *map_obj; + struct vm_object *map_obj = NULL; + struct cdevsw *cdevp; struct vm_page *pg; struct mmap_entry *ep; + struct vnode *vp; + struct filedesc *fdp; struct proc *td; struct vas vas; int error, npgs; paddr_t pa; vaddr_t va; size_t misalign; + off_t page_off; misalign = len & (DEFAULT_PAGESIZE - 1); len = ALIGN_UP(len + misalign, DEFAULT_PAGESIZE); npgs = len / DEFAULT_PAGESIZE; - - if (addr == NULL) { - pr_error("mmap: NULL addr not supported\n"); - return NULL; - } + vas = pmap_read_vas(); /* Validate flags */ - if (ISSET(flags, MAP_FIXED | MAP_SHARED)) { - pr_error("mmap: fixed/shared mappings not yet supported\n"); + if (ISSET(flags, MAP_FIXED)) { + pr_error("mmap: fixed mappings not yet supported\n"); mmap_dbg(addr, len, prot, flags, fildes, off); return NULL; } - map_obj = dynalloc(sizeof(*map_obj)); - if (map_obj == NULL) { - kprintf("mmap: failed to allocate map object\n"); - return NULL; + + /* + * Attempt to open the file if mapping + * is shared. + */ + if (ISSET(flags, MAP_SHARED)) { + fdp = fd_get(NULL, fildes); + if (fdp == NULL) { + pr_error("mmap: no such fd (fd=%d)\n", fildes); + return NULL; + } + + vp = fdp->vp; + if (vp->type != VCHR) { + /* TODO */ + pr_error("mmap: only device files supported\n"); + return NULL; + } + + map_obj = dv_attach(vp->major, vp->dev, prot); + if (map_obj == NULL) { + kprintf("mmap: dv_attach() failure\n"); + return NULL; + } + + cdevp = map_obj->data; + if ((pa = cdevp->mmap(vp->dev, len, off, 0)) == 0) { + kprintf("mmap: dev mmap() gave 0\n"); + return NULL; + } + + /* + * If the address passed is NULL, just identity + * map everything. + * + * XXX: This is why the bounds check done in the + * cdev mmap() *must* be correct. + * + * TODO: Use copy-on-write for this instead. Since mapping + * certain devices may required a lot of memory to + * be referenced anyways, we could use a buffered + * copy-on-write technique where only a window of + * pages can be mapped on-demand and other pages + * freed when that window is exceeded. + */ + if (addr == NULL) { + addr = (void *)pa; + } + + va = ALIGN_DOWN((vaddr_t)addr, DEFAULT_PAGESIZE); + error = vm_map(vas, va, pa, prot, len); + if (error != 0) { + kprintf("mmap: map failed (error=%d)\n", error); + return NULL; + } + + goto done; } - error = vm_obj_init(map_obj, &vm_anonops, 1); - if (error < 0) { - kprintf("mmap: vm_obj_init() returned %d\n", error); - kprintf("mmap: failed to init object\n"); - return NULL; + + /* Only allocate new obj if needed */ + if (map_obj == NULL) { + map_obj = dynalloc(sizeof(*map_obj)); + if (map_obj == NULL) { + kprintf("mmap: failed to allocate map object\n"); + return NULL; + } + error = vm_obj_init(map_obj, &vm_anonops, 1); + if (error < 0) { + kprintf("mmap: vm_obj_init() returned %d\n", error); + kprintf("mmap: failed to init object\n"); + return NULL; + } } /* XXX: Assuming private */ - vas = pmap_read_vas(); va = ALIGN_DOWN((vaddr_t)addr, DEFAULT_PAGESIZE); for (int i = 0; i < npgs; ++i) { pg = vm_pagealloc(map_obj, PALLOC_ZERO); + page_off = i * DEFAULT_PAGESIZE; if (pg == NULL) { /* TODO */ @@ -209,15 +273,21 @@ mmap_at(void *addr, size_t len, int prot, int flags, int fildes, off_t off) return NULL; } + /* TODO: copy-on-write */ + if (addr == NULL) { + va = pg->phys_addr; + addr = (void *)va; + } + pa = pg->phys_addr; - error = vm_map(vas, va, pa, prot, len); - pr_trace("va=%p, len=%d\n", va, len); + error = vm_map(vas, va + page_off, pa, prot, len); if (error < 0) { pr_error("mmap: failed to map page (retval=%x)\n", error); return NULL; } } +done: /* Add entry to ledger */ td = this_td(); ep = dynalloc(sizeof(*ep)); @@ -243,7 +313,7 @@ mmap_at(void *addr, size_t len, int prot, int flags, int fildes, off_t off) * multiple of the machine page size. */ int -munmap_at(void *addr, size_t len) +munmap(void *addr, size_t len) { int pgno; vaddr_t va; @@ -299,7 +369,7 @@ munmap_at(void *addr, size_t len) * arg5 -> off */ scret_t -mmap(struct syscall_args *scargs) +sys_mmap(struct syscall_args *scargs) { void *addr; size_t len; @@ -308,11 +378,11 @@ mmap(struct syscall_args *scargs) addr = (void *)scargs->arg0; len = scargs->arg1; - prot = scargs->arg2; + prot = scargs->arg2 | PROT_USER; flags = scargs->arg3; fildes = scargs->arg4; off = scargs->arg5; - return (scret_t)mmap_at(addr, len, prot, flags, fildes, off); + return (scret_t)mmap(addr, len, prot, flags, fildes, off); } /* @@ -322,14 +392,14 @@ mmap(struct syscall_args *scargs) * arg1 -> len */ scret_t -munmap(struct syscall_args *scargs) +sys_munmap(struct syscall_args *scargs) { void *addr; size_t len; addr = (void *)scargs->arg0; len = scargs->arg1; - return (scret_t)munmap_at(addr, len); + return (scret_t)munmap(addr, len); } /* diff --git a/sys/vm/vm_physmem.c b/sys/vm/vm_physmem.c index c7fcedb..42b7a31 100644 --- a/sys/vm/vm_physmem.c +++ b/sys/vm/vm_physmem.c @@ -32,15 +32,22 @@ #include <sys/limine.h> #include <sys/syslog.h> #include <sys/spinlock.h> +#include <sys/panic.h> #include <vm/physmem.h> #include <vm/vm.h> #include <string.h> -size_t highest_frame_idx = 0; -size_t bitmap_size = 0; -size_t bitmap_free_start = 0; +#define BYTES_PER_MIB 8388608 -uint8_t *bitmap; +static size_t pages_free = 0; +static size_t pages_used = 0; +static size_t pages_total = 0; +static size_t highest_frame_idx = 0; +static size_t bitmap_size = 0; +static size_t bitmap_free_start = 0; +static ssize_t last_idx = 0; + +static uint8_t *bitmap; static struct limine_memmap_response *resp = NULL; static struct spinlock lock = {0}; @@ -59,9 +66,11 @@ physmem_populate_bitmap(void) for (size_t i = 0; i < resp->entry_count; ++i) { ent = resp->entries[i]; + pages_total += ent->length / DEFAULT_PAGESIZE; if (ent->type != LIMINE_MEMMAP_USABLE) { /* This memory is not usable */ + pages_used += ent->length / DEFAULT_PAGESIZE; continue; } @@ -72,6 +81,8 @@ physmem_populate_bitmap(void) for (size_t j = 0; j < ent->length; j += DEFAULT_PAGESIZE) { clrbit(bitmap, (ent->base + j) / DEFAULT_PAGESIZE); } + + pages_free += ent->length / DEFAULT_PAGESIZE; } } @@ -105,7 +116,6 @@ physmem_alloc_bitmap(void) } } - /* * Init the physical memory bitmap. */ @@ -137,29 +147,59 @@ physmem_init_bitmap(void) * * @count: Number of frames to allocate. */ -uintptr_t -vm_alloc_frame(size_t count) +static uintptr_t +__vm_alloc_frame(size_t count) { size_t frames = 0; + ssize_t idx = -1; uintptr_t ret = 0; - spinlock_acquire(&lock); - for (size_t i = 0; i < highest_frame_idx; ++i) { + for (size_t i = last_idx; i < highest_frame_idx; ++i) { if (!testbit(bitmap, i)) { - /* We have a free page */ - if (++frames != count) { - continue; - } - - for (size_t j = i; j < i + count; ++j) { - setbit(bitmap, j); - } + if (idx < 0) + idx = i; + if (++frames >= count) + break; - ret = i * DEFAULT_PAGESIZE; - break; + continue; } + + idx = -1; + frames = 0; + } + + if (idx < 0 || frames != count) { + ret = 0; + goto done; + } + + for (size_t i = idx; i < idx + count; ++i) { + setbit(bitmap, i); + } + ret = idx * DEFAULT_PAGESIZE; + last_idx = idx; + memset(PHYS_TO_VIRT(ret), 0, count * DEFAULT_PAGESIZE); +done: + return ret; +} + +uintptr_t +vm_alloc_frame(size_t count) +{ + uintptr_t ret; + + spinlock_acquire(&lock); + if ((ret = __vm_alloc_frame(count)) == 0) { + last_idx = 0; + ret = __vm_alloc_frame(count); } + if (ret == 0) { + panic("out of memory\n"); + } + + pages_used += count; + pages_free -= count; spinlock_release(&lock); return ret; } @@ -169,13 +209,47 @@ vm_free_frame(uintptr_t base, size_t count) { size_t stop_at = base + (count * DEFAULT_PAGESIZE); + base = ALIGN_UP(base, DEFAULT_PAGESIZE); + spinlock_acquire(&lock); for (uintptr_t p = base; p < stop_at; p += DEFAULT_PAGESIZE) { clrbit(bitmap, p / DEFAULT_PAGESIZE); } + pages_used -= count; + pages_free += count; spinlock_release(&lock); } +/* + * Return the amount of memory in MiB that is + * currently allocated. + */ +uint32_t +vm_mem_used(void) +{ + return (pages_used * DEFAULT_PAGESIZE) / BYTES_PER_MIB; +} + +/* + * Return the amount of memory in MiB that is + * currently free. + */ +uint32_t +vm_mem_free(void) +{ + return (pages_free * DEFAULT_PAGESIZE) / BYTES_PER_MIB; +} + +/* + * Return the total amount of memory supported + * by the machine. + */ +size_t +vm_mem_total(void) +{ + return (pages_total * DEFAULT_PAGESIZE) / BYTES_PER_MIB; +} + void vm_physmem_init(void) { diff --git a/sys/vm/vm_stat.c b/sys/vm/vm_stat.c new file mode 100644 index 0000000..3e39047 --- /dev/null +++ b/sys/vm/vm_stat.c @@ -0,0 +1,95 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/errno.h> +#include <fs/ctlfs.h> +#include <vm/physmem.h> +#include <vm/vm.h> +#include <vm/stat.h> +#include <string.h> + +#include <sys/syslog.h> + +static struct ctlops vm_stat_ctl; + +/* + * ctlfs hook to read the virtual memory + * statistics. + */ +static int +vm_stat_read(struct ctlfs_dev *cdp, struct sio_txn *sio) +{ + struct vm_stat stat; + int error; + + if (sio->len > sizeof(stat)) { + sio->len = sizeof(stat); + } + + error = vm_stat_get(&stat); + if (error < 0) { + return error; + } + + memcpy(sio->buf, &stat, sio->len); + return sio->len; +} + +int +vm_stat_get(struct vm_stat *vmstat) +{ + if (vmstat == NULL) { + return -EINVAL; + } + + vmstat->mem_avail = vm_mem_free(); + vmstat->mem_used = vm_mem_used(); + vmstat->mem_total = vm_mem_total(); + return 0; +} + +void +vm_stat_init(void) +{ + char devname[] = "vm"; + struct ctlfs_dev ctl; + + /* Register a stat control file */ + ctl.mode = 0444; + ctlfs_create_node(devname, &ctl); + ctl.devname = devname; + ctl.ops = &vm_stat_ctl; + ctlfs_create_entry("stat", &ctl); +} + +static struct ctlops vm_stat_ctl = { + .read = vm_stat_read, + .write = NULL +}; diff --git a/sys/vm/vm_vnode.c b/sys/vm/vm_vnode.c index 2457c97..777b382 100644 --- a/sys/vm/vm_vnode.c +++ b/sys/vm/vm_vnode.c @@ -73,7 +73,7 @@ vn_io(struct vnode *vp, struct vm_page **pgs, unsigned int npages, int rw) args.res = &vattr; c = MAX(vattr.size / DEFAULT_PAGESIZE, 1); - if ((err = vfs_vop_getattr(vp, &args)) != 0) { + if ((err = vfs_vop_getattr(&args)) != 0) { return err; } @@ -162,7 +162,6 @@ vn_attach(struct vnode *vp, vm_prot_t prot) if (vp->type != VREG) { pr_error("vn_attach: vp=%p, prot=%x\n", vp, prot); - pr_error("vn_attach: Special files not supported yet!\n"); return NULL; } diff --git a/tools/omar/omar.c b/tools/omar/omar.c index 129303e..a4c7ad6 100644 --- a/tools/omar/omar.c +++ b/tools/omar/omar.c @@ -53,6 +53,9 @@ #define OMAR_ARCHIVE 0 #define OMAR_EXTRACT 1 +/* Revision */ +#define OMAR_REV 2 + #define ALIGN_UP(value, align) (((value) + (align)-1) & ~((align)-1)) #define BLOCK_SIZE 512 @@ -68,12 +71,16 @@ static const char *outpath = NULL; * @magic: Header magic ("OMAR") * @len: Length of the file * @namelen: Length of the filename + * @rev: OMAR revision + * @mode: File permissions */ struct omar_hdr { char magic[4]; uint8_t type; uint8_t namelen; uint32_t len; + uint8_t rev; + uint32_t mode; } __attribute__((packed)); static inline void @@ -112,7 +119,7 @@ strip_root(const char *path) * Recursive mkdir */ static void -mkpath(const char *path) +mkpath(struct omar_hdr *hdr, const char *path) { size_t len; char buf[256]; @@ -126,12 +133,12 @@ mkpath(const char *path) for (p = (char *)buf + 1; *p != '\0'; ++p) { if (*p == '/') { *p = '\0'; - mkdir(buf, 0700); + mkdir(buf, hdr->mode); *p = '/'; } } - mkdir(buf, 0700); + mkdir(buf, hdr->mode); } /* @@ -166,9 +173,11 @@ file_push(const char *pathname, const char *name) if (S_ISDIR(sb.st_mode)) { hdr.type = OMAR_DIR; } + hdr.mode = sb.st_mode; } hdr.len = (pathname == NULL) ? 0 : sb.st_size; + hdr.rev = OMAR_REV; hdr.namelen = strlen(name); /* @@ -282,16 +291,17 @@ archive_create(const char *base, const char *dirname) /* * Extract a single file * + * @hp: File header * @data: Data to extract * @len: Length of data * @path: Path to output file */ static int -extract_single(char *data, size_t len, const char *path) +extract_single(struct omar_hdr *hp, char *data, size_t len, const char *path) { int fd; - if ((fd = open(path, O_WRONLY | O_CREAT, 0700)) < 0) { + if ((fd = open(path, O_WRONLY | O_CREAT, hp->mode)) < 0) { return fd; } @@ -312,8 +322,10 @@ archive_extract(void) struct stat sb; struct omar_hdr *hdr; int fd, error; + size_t len; off_t off; char namebuf[256]; + char pathbuf[256]; if ((fd = open(inpath, O_RDONLY)) < 0) { perror("open"); @@ -351,20 +363,31 @@ archive_extract(void) fprintf(stderr, "bad magic\n"); break; } + if (hdr->rev != OMAR_REV) { + fprintf(stderr, "cannot extract rev %d archive\n", hdr->rev); + fprintf(stderr, "current OMAR revision: %d\n", OMAR_REV); + } name = (char *)hdr + sizeof(struct omar_hdr); memcpy(namebuf, name, hdr->namelen); namebuf[hdr->namelen] = '\0'; - printf("unpacking %s\n", namebuf); + + /* Get the full path */ + len = snprintf(pathbuf, sizeof(pathbuf), "%s/%s", outpath, namebuf); + if (len < 0) { + free(buf); + return len; + } + printf("unpacking %s\n", pathbuf); if (hdr->type == OMAR_DIR) { off = 512; - mkpath(namebuf); + mkpath(hdr, pathbuf); } else { - off = ALIGN_UP(sizeof(hdr) + hdr->namelen + hdr->len, BLOCK_SIZE); + off = ALIGN_UP(sizeof(*hdr) + hdr->namelen + hdr->len, BLOCK_SIZE); p = (char *)hdr + sizeof(struct omar_hdr); p += hdr->namelen; - extract_single(p, hdr->len, namebuf); + extract_single(hdr, p, hdr->len, pathbuf); } hdr = (struct omar_hdr *)((char *)hdr + off); diff --git a/tools/ovmf.sh b/tools/ovmf.sh new file mode 100644 index 0000000..a0c9eb2 --- /dev/null +++ b/tools/ovmf.sh @@ -0,0 +1,8 @@ +set -e + +ARCH=aarch64 +OUTPUT=ovmf/ovmf-$ARCH.fd + +mkdir -p ovmf/ +curl -Lo $OUTPUT https://github.com/osdev0/edk2-ovmf-nightly/releases/latest/download/ovmf-code-$ARCH.fd +dd if=/dev/zero of=$OUTPUT bs=1 count=0 seek=67108864 diff --git a/usr.bin/Makefile b/usr.bin/Makefile index 1c973ff..d754404 100644 --- a/usr.bin/Makefile +++ b/usr.bin/Makefile @@ -6,3 +6,27 @@ ARGS = -I$(ROOT)/builddeps LDSCRIPT=$(LDSCRIPT) USRDIR=$(USRDIR) ROOT=$(ROOT) .PHONY: all all: make -C osh/ $(ARGS) + make -C kmsg/ $(ARGS) + make -C fetch/ $(ARGS) + make -C kfgwm/ $(ARGS) + make -C date/ $(ARGS) + make -C mex/ $(ARGS) + make -C beep/ $(ARGS) + make -C mrow/ $(ARGS) + make -C elfdump/ $(ARGS) + make -C cat/ $(ARGS) + make -C getconf/ $(ARGS) + make -C echo/ $(ARGS) + make -C readcore/ $(ARGS) + make -C login/ $(ARGS) + make -C sleep/ $(ARGS) + make -C kstat/ $(ARGS) + make -C nerve/ $(ARGS) + make -C whoami/ $(ARGS) + make -C oasm/ $(ARGS) + make -C oemu/ $(ARGS) + make -C dmidump/ $(ARGS) + make -C sysctl/ $(ARGS) + make -C reboot/ $(ARGS) + make -C screensave/ $(ARGS) + make -C notes/ $(ARGS) diff --git a/usr.bin/beep/Makefile b/usr.bin/beep/Makefile new file mode 100644 index 0000000..409f87c --- /dev/null +++ b/usr.bin/beep/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/beep: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/beep/main.c b/usr.bin/beep/main.c new file mode 100644 index 0000000..d64a9b5 --- /dev/null +++ b/usr.bin/beep/main.c @@ -0,0 +1,70 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> +#include <string.h> +#include <fcntl.h> +#include <unistd.h> + +int +main(int argc, char **argv) +{ + uint32_t payload; + uint16_t duration; + uint16_t freq; + int beep_fd; + + if (argc < 3) { + printf("usage: beep <freq> <duration>\n"); + return -1; + } + + duration = atoi(argv[2]); + freq = atoi(argv[1]); + + if (duration == 0) { + printf("bad duration\n"); + return -1; + } + if (freq == 0) { + printf("bad frequency\n"); + return -1; + } + + beep_fd = open("/dev/beep", O_WRONLY); + if (beep_fd < 0) { + printf("failed to open beep fd\n"); + return -1; + } + + payload = freq; + payload |= (duration << 16); + write(beep_fd, &payload, sizeof(payload)); + return 0; +} diff --git a/usr.bin/cat/Makefile b/usr.bin/cat/Makefile new file mode 100644 index 0000000..4ecfea7 --- /dev/null +++ b/usr.bin/cat/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/cat: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/cat/cat.c b/usr.bin/cat/cat.c new file mode 100644 index 0000000..4fb74d1 --- /dev/null +++ b/usr.bin/cat/cat.c @@ -0,0 +1,112 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <unistd.h> +#include <fcntl.h> +#include <string.h> +#include <stdio.h> +#include <stdlib.h> + +#define NUM_MODE_NONE 0 +#define NUM_MODE_ALL 1 +#define NUM_MODE_NONBLANK 2 + +static void +help(void) +{ + printf( + "usage: cat <flags> <file>\n" + "[-b] do not number blank lines\n" + "[-n] number all lines\n" + ); +} + +static void +cat(const char *pathname, int num_mode) +{ + FILE *file; + char buf[64]; + int fd; + size_t lineno = 1; + + file = fopen(pathname, "r"); + if (file == NULL) { + return; + } + + while (fgets(buf, sizeof(buf), file) != NULL) { + switch (num_mode) { + case NUM_MODE_NONE: + break; + case NUM_MODE_ALL: + printf("%d ", lineno); + break; + case NUM_MODE_NONBLANK: + if (buf[0] == '\n') { + break; + } + printf("%d ", lineno); + break; + } + printf("%s", buf); + ++lineno; + } + + fclose(file); +} + +int +main(int argc, char **argv) +{ + int num_mode = NUM_MODE_NONE; + int c; + + if (argc < 2) { + help(); + return -1; + } + + while ((c = getopt(argc, argv, "nb")) != -1) { + switch (c) { + case 'n': + num_mode = NUM_MODE_ALL; + break; + case 'b': + num_mode = NUM_MODE_NONBLANK; + break; + } + } + + for (size_t i = optind; i < argc; ++i) { + cat(argv[i], num_mode); + } + + return 0; +} diff --git a/usr.bin/date/Makefile b/usr.bin/date/Makefile new file mode 100644 index 0000000..09ff299 --- /dev/null +++ b/usr.bin/date/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/date: + gcc $(CFILES) -Iinclude/ -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/date/date.c b/usr.bin/date/date.c new file mode 100644 index 0000000..8c4a9d1 --- /dev/null +++ b/usr.bin/date/date.c @@ -0,0 +1,132 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/time.h> +#include <sys/cdefs.h> +#include <stdio.h> +#include <fcntl.h> +#include <unistd.h> +#include <string.h> + +#define MONTHS_PER_YEAR 12 +#define DAYS_PER_WEEK 7 + +/* Months of the year */ +static const char *montab[] = { + "Jan", "Feb", "Mar", + "Apr", "May", "Jun", + "Jul", "Aug", "Sep", + "Oct", "Nov", "Dec" +}; + +/* Days of the week */ +static const char *daytab[] = { + "Sat", "Sun", "Mon", + "Tue", "Wed", "Thu", + "Fri" +}; + +static int +set_time(int clock_fd, struct date *dp, char *timestr) +{ + uint32_t hour, min, sec; + char *p; + + /* Hour */ + p = strtok(timestr, ":"); + if (p == NULL) + return -1; + hour = atoi(p); + + /* Minute */ + p = strtok(NULL, ":"); + if (p == NULL) + return -1; + min = atoi(p); + + /* Second */ + p = strtok(NULL, ":"); + if (p == NULL) + return -1; + sec = atoi(p); + + /* Set the time */ + dp->hour = hour; + dp->min = min; + dp->sec = sec; + write(clock_fd, dp, sizeof(*dp)); + return 0; +} + +int +main(int argc, char **argv) +{ + const char *day, *month; + char date_str[32]; + struct date d; + int rtc_fd, error = 0; + + if ((rtc_fd = open("/dev/rtc", O_RDWR)) < 0) { + return rtc_fd; + } + + + read(rtc_fd, &d, sizeof(d)); + + /* + * If a time was specified to be set in the + * 'hh:mm:ss' format, attempt to write it. + */ + if (argc > 1) { + error = set_time(rtc_fd, &d, argv[1]); + if (error < 0) + printf("bad time specified, not set\n"); + read(rtc_fd, &d, sizeof(d)); + } + + close(rtc_fd); + + /* This should not happen */ + if (__unlikely(d.month > MONTHS_PER_YEAR)) { + printf("got bad month %d from RTC\n", d.month); + return -1; + } + if (__unlikely(d.month == 0 || d.day == 0)) { + printf("got zero month/day from RTC\n"); + return -1; + } + + day = daytab[d.day % DAYS_PER_WEEK]; + month = montab[d.month - 1]; + + snprintf(date_str, sizeof(date_str), "%s %s %d %02d:%02d:%02d\n", + day, month, d.day, d.hour, d.min, d.sec); + fputs(date_str, stdout); + return 0; +} diff --git a/usr.bin/dmidump/Makefile b/usr.bin/dmidump/Makefile new file mode 100644 index 0000000..e9cd625 --- /dev/null +++ b/usr.bin/dmidump/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/dmidump: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/dmidump/dmidump.c b/usr.bin/dmidump/dmidump.c new file mode 100644 index 0000000..96d97bc --- /dev/null +++ b/usr.bin/dmidump/dmidump.c @@ -0,0 +1,78 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/dmi.h> +#include <unistd.h> +#include <fcntl.h> +#include <stdio.h> + +/* + * The kernel fills DMI structures to zero, + * if any of the fields are unset then p[0] + * will have a null terminator which tells + * us we should ignore it. + */ +static void +dmi_printfield(const char *name, const char *p) +{ + if (p[0] == '\0') { + return; + } + + printf("%s: %s\n", name, p); +} + +static void +dmi_dump_board(void) +{ + struct dmi_board board; + int fd; + + fd = open("/ctl/dmi/board", O_RDONLY); + if (fd < 0) { + printf("failed to open board control\n"); + return; + } + + read(fd, &board, sizeof(board)); + printf("** BOARD INFO **\n"); + dmi_printfield("CPU version", board.cpu_version); + dmi_printfield("CPU OEM", board.cpu_manuf); + dmi_printfield("product", board.product); + dmi_printfield("vendor", board.vendor); + dmi_printfield("version", board.version); + close(fd); +} + +int +main(int argc, char **argv) +{ + dmi_dump_board(); + return 0; +} diff --git a/usr.bin/echo/Makefile b/usr.bin/echo/Makefile new file mode 100644 index 0000000..296461b --- /dev/null +++ b/usr.bin/echo/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/echo: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/echo/echo.c b/usr.bin/echo/echo.c new file mode 100644 index 0000000..760c788 --- /dev/null +++ b/usr.bin/echo/echo.c @@ -0,0 +1,44 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> + +int +main(int argc, char **argv) +{ + for (int i = 1; i < argc; ++i) { + printf("%s ", argv[i]); + } + + if (argc > 1) { + printf("\n"); + } + + return 0; +} diff --git a/usr.bin/elfdump/Makefile b/usr.bin/elfdump/Makefile new file mode 100644 index 0000000..b450635 --- /dev/null +++ b/usr.bin/elfdump/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/elfdump: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/elfdump/elfdump.c b/usr.bin/elfdump/elfdump.c new file mode 100644 index 0000000..335cdec --- /dev/null +++ b/usr.bin/elfdump/elfdump.c @@ -0,0 +1,171 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/elf.h> +#include <sys/errno.h> +#include <stdio.h> +#include <fcntl.h> +#include <unistd.h> +#include <string.h> + +/* Ehdr.e_type table */ +static const char *elftype[] = { + [ET_NONE] = "Untyped", + [ET_REL] = "Relocatable", + [ET_EXEC] = "Executable", + [ET_DYN] = "Shared object", + [ET_CORE] = "Core dump" +}; + +/* Phdr.p_type table */ +static const char *phdrtype[] = { + [PT_NULL] = "Null", + [PT_LOAD] = "Loadable", + [PT_DYNAMIC] = "Dynamic", + [PT_NOTE] = "Note (linker garbage)", +}; + +/* + * Verify the validity of the ELF header from its + * various fields such as magic bytes, ABI, endianness, + * etc. + * + * Returns 0 on success. + */ +static int +elf64_verify(const Elf64_Ehdr *hdr) +{ + const char *mag = &hdr->e_ident[EI_MAG0]; + + if (memcmp(mag, ELFMAG, SELFMAG) != 0) { + printf("Bad ELF magic\n"); + return -ENOEXEC; + } + if (hdr->e_ident[EI_OSABI] != ELFOSABI_SYSV) { + printf("Bad ELF ABI\n"); + return -ENOEXEC; + } + if (hdr->e_ident[EI_DATA] != ELFDATA2LSB) { + printf("Bad endianness\n"); + return -ENOEXEC; + } + if (hdr->e_ident[EI_CLASS] != ELFCLASS64) { + printf("ELF not 64 bits\n"); + return -ENOEXEC; + } + + return 0; +} + +static void +parse_phdrs(const Elf64_Ehdr *eh, int fd) +{ + Elf64_Phdr phdr; + const char *type = "Unknown"; + + lseek(fd, eh->e_phoff, SEEK_SET); + printf("-- PHDRS BEGIN --\n"); + for (size_t i = 0; i < eh->e_phnum; ++i) { + if (read(fd, &phdr, eh->e_phentsize) <= 0) { + printf("failed to read phdr %d\n", i); + break; + } + if (phdr.p_type < NELEM(phdrtype)) { + type = phdrtype[phdr.p_type]; + } + + printf("* [P.%d] Type: %s\n", i, type); + printf("* [P.%d] Offset: %d\n", i, phdr.p_offset); + printf("* [P.%d] Vaddr: %p\n", i, phdr.p_vaddr); + printf("* [P.%d] Paddr: %p\n", i, phdr.p_paddr); + printf("* [P.%d] Memory size: %d\n", i, phdr.p_memsz); + printf("* [P.%d] Flags: %p\n", i, phdr.p_flags); + printf("* [P.%d] Alignment: %p\n", i, phdr.p_align); + + /* Seperator */ + if (i < (eh->e_phnum - 1)) { + printf("-----------------------------\n"); + } + } + printf("-- PHDRS END --\n"); +} + +static int +parse_ehdr(const Elf64_Ehdr *eh, int fd) +{ + const char *elf_type = "Bad"; + + if (eh->e_type < NELEM(elftype)) { + elf_type = elftype[eh->e_type]; + } + + printf("* Entrypoint: %p\n", eh->e_entry); + printf("* Program headers start offset: %p\n", eh->e_phoff); + printf("* Section headers start offset: %p\n", eh->e_shoff); + printf("* Number of program headers: %d\n", eh->e_phnum); + printf("* Endianess: Little\n"); + parse_phdrs(eh, fd); + return 0; +} + +static int +elfdump_run(const char *filename) +{ + Elf64_Ehdr eh; + int fd, error; + + fd = open(filename, O_RDONLY); + if (fd < 0) { + return fd; + } + + printf("-- Dumping %s --\n", filename); + read(fd, &eh, sizeof(eh)); + + if ((error = elf64_verify(&eh)) < 0) { + return error; + } + if ((error = parse_ehdr(&eh, fd)) < 0) { + return error; + } + + close(fd); + return 0; +} + +int +main(int argc, char **argv) +{ + if (argc < 2) { + printf("elfdump: usage: elfdump <elf path>\n"); + return -1; + } + + return elfdump_run(argv[1]); +} diff --git a/usr.bin/fetch/Makefile b/usr.bin/fetch/Makefile new file mode 100644 index 0000000..4b08e84 --- /dev/null +++ b/usr.bin/fetch/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/fetch: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/fetch/fetch.c b/usr.bin/fetch/fetch.c new file mode 100644 index 0000000..1e8ef92 --- /dev/null +++ b/usr.bin/fetch/fetch.c @@ -0,0 +1,105 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <unistd.h> +#include <fcntl.h> +#include <string.h> +#include <stdlib.h> +#include <stdio.h> + +#define CPUID(level, a, b, c, d) \ + __ASMV("cpuid\n\t" \ + : "=a" (a), "=b" (b), "=c" (c), "=d" (d) \ + : "0" (level)) + +#define ASCII_ART \ + " ____ \n" \ + " | \\__\\ user: %s\n" \ + " | /\\ \\ OS: Hyra/amd64 v"_OSVER"\n" \ + " |/ \\ \\ arch: "_OSARCH"\n" \ + " \\ R. \\ \\ cpu: %s\n" \ + " \\ I. \\ \\\n" + + +/* + * Get the processor brand string + * + * @buffer: Buffer to copy branch string + * + * Returns a pointer to newly allocated memory + * containing the vendor string. One must ensure + * to call free() after use. + */ +static char * +get_brand(void) +{ + uint32_t eax, ebx, ecx, edx; + uint32_t regs[12]; + char buf[sizeof(regs) + 1]; + char *p = buf; + + /* Can we even get the brand? */ + CPUID(0x80000000, eax, ebx, ecx, edx); + if (eax < 0x80000004) { + return NULL; + } + + CPUID(0x80000002, regs[0], regs[1], regs[2], regs[3]); + CPUID(0x80000003, regs[4], regs[5], regs[6], regs[7]); + CPUID(0x80000004, regs[8], regs[9], regs[10], regs[11]); + + /* Log it */ + memcpy(p, regs, sizeof(regs)); + buf[sizeof(regs)] = '\0'; + + /* Strip away leading whitespaces */ + for (int i = 0; i < sizeof(buf); ++i) { + if (buf[i] == ' ') { + ++p; + } else { + break; + } + } + + return strdup(p); +} + +int +main(void) +{ + char *brand = get_brand(); + + if (brand == NULL) { + brand = strdup("unknown"); + } + + printf(ASCII_ART, getlogin(), brand); + free(brand); + return 0; +} diff --git a/usr.bin/getconf/Makefile b/usr.bin/getconf/Makefile new file mode 100644 index 0000000..48c05a8 --- /dev/null +++ b/usr.bin/getconf/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/getconf: + gcc $(CFILES) -Iinclude/ -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/getconf/getconf.c b/usr.bin/getconf/getconf.c new file mode 100644 index 0000000..f028e76 --- /dev/null +++ b/usr.bin/getconf/getconf.c @@ -0,0 +1,93 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/param.h> +#include <sys/limits.h> +#include <stdint.h> +#include <stdio.h> +#include <unistd.h> +#include <string.h> + +struct sysvar { + const char *var; + uint8_t auxv : 1; + uint32_t val; +}; + +static struct sysvar vartab[] = { + { "PAGESIZE", 1, AT_PAGESIZE }, + { "CHAR_BIT", 0, CHAR_BIT }, + { "NAME_MAX", 0, NAME_MAX }, + { "PATH_MAX", 0, PATH_MAX }, + { "SSIZE_MAX", 0, SSIZE_MAX }, + { NULL, 0, 0 } +}; + +static int +getvar_val(struct sysvar *vp) +{ + if (vp->auxv) { + return sysconf(vp->val); + } + + return vp->val; +} + +static int +getvar(const char *sysvar) +{ + for (int i = 0; vartab[i].var != NULL; ++i) { + if (strcmp(vartab[i].var, sysvar) == 0) { + return getvar_val(&vartab[i]); + } + } + + return -1; +} + +int +main(int argc, char **argv) +{ + char *var; + int retval; + + if (argc < 2) { + printf("usage: getconf <SYSTEM VAR>\n"); + return -1; + } + + var = argv[1]; + if ((retval = getvar(var)) < 0) { + printf("bad system var \"%s\"\n", var); + return retval; + } + + printf("%d\n", retval); + return 0; +} diff --git a/usr.bin/kfgwm/Makefile b/usr.bin/kfgwm/Makefile new file mode 100644 index 0000000..a0fb49a --- /dev/null +++ b/usr.bin/kfgwm/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/kfgwm: + gcc $(CFILES) -Iinclude/ -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/kfgwm/font.c b/usr.bin/kfgwm/font.c new file mode 100644 index 0000000..9873b02 --- /dev/null +++ b/usr.bin/kfgwm/font.c @@ -0,0 +1,379 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <kfg/font.h> +#include <fcntl.h> +#include <unistd.h> + +/* TODO: Open a .psf font and get rid of this */ +const uint8_t g_KFG_FONT[] = { + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c, 0x42, 0x81, 0x81, 0xa5, 0xa5, 0x81, + 0x81, 0xa5, 0x99, 0x81, 0x42, 0x3c, 0x00, 0x00, 0x00, 0x3c, 0x7e, 0xff, + 0xff, 0xdb, 0xdb, 0xff, 0xff, 0xdb, 0xe7, 0xff, 0x7e, 0x3c, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x6c, 0xfe, 0xfe, 0xfe, 0x7c, 0x7c, 0x38, 0x38, 0x10, + 0x10, 0x00, 0x00, 0x00, 0x00, 0x10, 0x10, 0x38, 0x38, 0x7c, 0x7c, 0xfe, + 0x7c, 0x7c, 0x38, 0x38, 0x10, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, + 0x3c, 0x3c, 0xdb, 0xff, 0xff, 0xdb, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x18, 0x3c, 0x7e, 0xff, 0xff, 0xff, 0x66, 0x18, 0x18, + 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x78, + 0x78, 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, + 0xff, 0xff, 0xe7, 0xc3, 0xc3, 0xe7, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x78, 0xcc, 0x84, 0x84, 0xcc, 0x78, 0x00, + 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xc3, 0x99, 0xbd, + 0xbd, 0x99, 0xc3, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0x00, 0x00, 0x1e, + 0x0e, 0x1e, 0x32, 0x78, 0xcc, 0xcc, 0xcc, 0x78, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x78, 0xcc, 0xcc, 0xcc, 0x78, 0x30, 0xfc, 0x30, 0x30, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x18, 0x1c, 0x1e, 0x16, 0x12, + 0x10, 0x10, 0x70, 0xf0, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x30, 0x38, 0x2c, + 0x26, 0x32, 0x3a, 0x2e, 0x26, 0x22, 0x62, 0xe2, 0xc6, 0x0e, 0x0c, 0x00, + 0x00, 0x00, 0x00, 0x18, 0x18, 0xdb, 0x3c, 0xe7, 0x3c, 0xdb, 0x18, 0x18, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0xc0, 0xe0, 0xf8, 0xfe, + 0xf8, 0xe0, 0xc0, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, + 0x06, 0x0e, 0x3e, 0xfe, 0x3e, 0x0e, 0x06, 0x02, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x30, 0x78, 0xfc, 0x30, 0x30, 0x30, 0x30, 0x30, 0xfc, 0x78, + 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, + 0xcc, 0xcc, 0x00, 0xcc, 0xcc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7f, 0xdb, + 0xdb, 0xdb, 0xdb, 0x7b, 0x1b, 0x1b, 0x1b, 0x1b, 0x1b, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x7c, 0xc6, 0x60, 0x38, 0x6c, 0xc6, 0xc6, 0x6c, 0x38, 0x0c, + 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0xfe, 0xfe, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x78, + 0xfc, 0x30, 0x30, 0x30, 0x30, 0x30, 0xfc, 0x78, 0x30, 0xfc, 0x00, 0x00, + 0x00, 0x00, 0x30, 0x78, 0xfc, 0x30, 0x30, 0x30, 0x30, 0x30, 0x30, 0x30, + 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x30, 0x30, 0x30, 0x30, 0x30, + 0x30, 0x30, 0xfc, 0x78, 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x18, 0x0c, 0xfe, 0xfe, 0x0c, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x60, 0xfe, 0xfe, 0x60, 0x30, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, + 0xc0, 0xc0, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x24, 0x66, 0xff, 0xff, 0x66, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x10, 0x10, 0x38, 0x38, 0x7c, 0x7c, 0xfe, 0xfe, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xfe, 0x7c, 0x7c, + 0x38, 0x38, 0x10, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x30, 0x78, 0x78, 0x78, 0x78, 0x30, 0x30, 0x30, 0x00, 0x30, + 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x6c, 0x6c, + 0x6c, 0xfe, 0x6c, 0x6c, 0x6c, 0xfe, 0x6c, 0x6c, 0x6c, 0x00, 0x00, 0x00, + 0x00, 0x18, 0x18, 0x7c, 0xc6, 0xc0, 0xc0, 0x7c, 0x06, 0x06, 0xc6, 0x7c, + 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, 0xc6, 0xc6, 0x0c, 0x0c, 0x18, 0x38, + 0x30, 0x60, 0x60, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, 0x00, 0x38, 0x6c, + 0x6c, 0x38, 0x30, 0x76, 0xde, 0xcc, 0xcc, 0xde, 0x76, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x18, 0x18, 0x18, 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x30, 0x60, 0x60, 0x60, 0x60, + 0x60, 0x60, 0x60, 0x30, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x60, 0x30, + 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x30, 0x60, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x6c, 0x38, 0xfe, 0x38, 0x6c, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x7e, + 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x30, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x06, 0x06, + 0x0c, 0x0c, 0x18, 0x38, 0x30, 0x60, 0x60, 0xc0, 0xc0, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xd6, 0xd6, 0xd6, 0xc6, 0xc6, 0xc6, + 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x38, 0x78, 0x18, 0x18, 0x18, + 0x18, 0x18, 0x18, 0x18, 0x7e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, + 0x06, 0x06, 0x0c, 0x18, 0x30, 0x60, 0xc0, 0xc0, 0xfe, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x7c, 0xc6, 0x06, 0x06, 0x3c, 0x06, 0x06, 0x06, 0x06, 0xc6, + 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x0c, 0x1c, 0x3c, 0x6c, 0xcc, + 0xfe, 0x0c, 0x0c, 0x0c, 0x0c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xc0, + 0xc0, 0xc0, 0xfc, 0x06, 0x06, 0x06, 0x06, 0xc6, 0x7c, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x3c, 0x60, 0xc0, 0xc0, 0xfc, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, + 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xc6, 0x06, 0x06, 0x0c, 0x18, + 0x30, 0x30, 0x30, 0x30, 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, + 0xc6, 0xc6, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0x7e, 0x06, 0x06, 0x06, 0x0c, + 0x78, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, + 0x18, 0x00, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x18, 0x18, 0x00, 0x00, 0x18, 0x18, 0x30, 0x00, 0x00, + 0x00, 0x00, 0x06, 0x0c, 0x18, 0x30, 0x60, 0xc0, 0x60, 0x30, 0x18, 0x0c, + 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0x00, + 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x60, + 0x30, 0x18, 0x0c, 0x06, 0x0c, 0x18, 0x30, 0x60, 0xc0, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0x06, 0x0c, 0x18, 0x30, 0x30, 0x00, 0x30, + 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xde, 0xde, + 0xde, 0xde, 0xc0, 0xc0, 0x7e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x38, 0x6c, + 0xc6, 0xc6, 0xc6, 0xc6, 0xfe, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, + 0x00, 0x00, 0xfc, 0xc6, 0xc6, 0xc6, 0xfc, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, + 0xfc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc0, 0xc0, 0xc0, 0xc0, + 0xc0, 0xc0, 0xc0, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf8, 0xcc, + 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xcc, 0xf8, 0x00, 0x00, 0x00, + 0x00, 0x00, 0xfe, 0xc0, 0xc0, 0xc0, 0xfc, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, + 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xc0, 0xc0, 0xc0, 0xfc, 0xc0, + 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, + 0xc0, 0xc0, 0xc0, 0xde, 0xc6, 0xc6, 0xc6, 0xc6, 0x7e, 0x00, 0x00, 0x00, + 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xfe, 0xc6, 0xc6, 0xc6, 0xc6, + 0xc6, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfc, 0x30, 0x30, 0x30, 0x30, 0x30, + 0x30, 0x30, 0x30, 0x30, 0xfc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x0c, + 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0xcc, 0xcc, 0x78, 0x00, 0x00, 0x00, + 0x00, 0x00, 0xc6, 0xc6, 0xcc, 0xd8, 0xf0, 0xe0, 0xf0, 0xd8, 0xcc, 0xc6, + 0xc6, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, + 0xc0, 0xc0, 0xc0, 0xc0, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc6, 0xc6, + 0xee, 0xfe, 0xd6, 0xd6, 0xd6, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, + 0x00, 0x00, 0xc6, 0xc6, 0xe6, 0xe6, 0xf6, 0xde, 0xce, 0xce, 0xc6, 0xc6, + 0xc6, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, + 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfc, 0xc6, + 0xc6, 0xc6, 0xc6, 0xfc, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xf6, 0xda, + 0x6c, 0x06, 0x00, 0x00, 0x00, 0x00, 0xfc, 0xc6, 0xc6, 0xc6, 0xc6, 0xfc, + 0xd8, 0xcc, 0xcc, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, + 0xc0, 0x60, 0x30, 0x18, 0x0c, 0x06, 0x06, 0xc6, 0x7c, 0x00, 0x00, 0x00, + 0x00, 0x00, 0xff, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, + 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, + 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc6, 0xc6, + 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x6c, 0x38, 0x10, 0x00, 0x00, 0x00, + 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xd6, 0xd6, 0xd6, 0xd6, 0xfe, 0x6c, + 0x6c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0x6c, 0x38, 0x38, + 0x38, 0x6c, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, 0x00, 0xcc, 0xcc, + 0xcc, 0xcc, 0xcc, 0x78, 0x30, 0x30, 0x30, 0x30, 0x30, 0x00, 0x00, 0x00, + 0x00, 0x00, 0xfe, 0x06, 0x06, 0x0c, 0x18, 0x30, 0x60, 0xc0, 0xc0, 0xc0, + 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x78, 0x60, 0x60, 0x60, 0x60, 0x60, + 0x60, 0x60, 0x60, 0x60, 0x78, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0xc0, + 0x60, 0x60, 0x30, 0x38, 0x18, 0x0c, 0x0c, 0x06, 0x06, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x78, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, + 0x78, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x38, 0x6c, 0xc6, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0x00, + 0x00, 0x00, 0x18, 0x18, 0x18, 0x0c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0x06, 0x06, + 0x7e, 0xc6, 0xc6, 0xc6, 0x7e, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0xc0, + 0xc0, 0xdc, 0xe6, 0xc6, 0xc6, 0xc6, 0xc6, 0xe6, 0xdc, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc0, 0xc0, 0xc0, 0xc0, 0xc6, + 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x06, 0x06, 0x06, 0x76, 0xce, 0xc6, + 0xc6, 0xc6, 0xc6, 0xce, 0x76, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x7c, 0xc6, 0xc6, 0xfe, 0xc0, 0xc0, 0xc0, 0x7e, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x1c, 0x36, 0x30, 0x30, 0xfc, 0x30, 0x30, 0x30, 0x30, 0x30, + 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x76, 0xce, 0xc6, + 0xc6, 0xc6, 0xce, 0x76, 0x06, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0xc0, 0xc0, + 0xc0, 0xdc, 0xe6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x18, 0x00, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, + 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x06, 0x00, 0x00, 0x1e, 0x06, 0x06, + 0x06, 0x06, 0x06, 0x06, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0xc0, 0xc0, + 0xc0, 0xc6, 0xcc, 0xd8, 0xf0, 0xf0, 0xd8, 0xcc, 0xc6, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, + 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xec, 0xfe, 0xd6, + 0xd6, 0xd6, 0xd6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0xdc, 0xe6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, + 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xdc, 0xe6, 0xc6, + 0xc6, 0xc6, 0xe6, 0xdc, 0xc0, 0xc0, 0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x76, 0xce, 0xc6, 0xc6, 0xc6, 0xce, 0x76, 0x06, 0x06, 0x06, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0xdc, 0xe6, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, + 0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc0, + 0x70, 0x1c, 0x06, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x30, + 0x30, 0xfe, 0x30, 0x30, 0x30, 0x30, 0x30, 0x36, 0x1c, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, + 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc6, 0xc6, 0xc6, + 0xc6, 0xc6, 0x6c, 0x38, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0xc6, 0xc6, 0xd6, 0xd6, 0xd6, 0xd6, 0xfe, 0x6c, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0xc6, 0xc6, 0x6c, 0x38, 0x38, 0x6c, 0xc6, + 0xc6, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc6, 0xc6, 0xc6, + 0xc6, 0xc6, 0xce, 0x76, 0x06, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0xfe, 0x06, 0x0c, 0x18, 0x30, 0x60, 0xc0, 0xfe, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x1c, 0x30, 0x30, 0x30, 0x30, 0xe0, 0x30, 0x30, 0x30, 0x30, + 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x30, 0x30, 0x30, 0x30, 0x00, + 0x30, 0x30, 0x30, 0x30, 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x30, + 0x30, 0x30, 0x30, 0x1c, 0x30, 0x30, 0x30, 0x30, 0xe0, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x76, 0xdc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, 0x10, 0x38, 0x38, 0x6c, + 0x6c, 0xc6, 0xc6, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c, 0x66, + 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0x66, 0x3c, 0x18, 0xcc, 0x78, 0x00, + 0x00, 0x00, 0x6c, 0x6c, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, + 0x7c, 0x00, 0x00, 0x00, 0x00, 0x0c, 0x18, 0x30, 0x00, 0x7c, 0xc6, 0xc6, + 0xfe, 0xc0, 0xc0, 0xc0, 0x7e, 0x00, 0x00, 0x00, 0x00, 0x10, 0x38, 0x6c, + 0x00, 0x7c, 0x06, 0x06, 0x7e, 0xc6, 0xc6, 0xc6, 0x7e, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x6c, 0x6c, 0x00, 0x7c, 0x06, 0x06, 0x7e, 0xc6, 0xc6, 0xc6, + 0x7e, 0x00, 0x00, 0x00, 0x00, 0x60, 0x30, 0x18, 0x00, 0x7c, 0x06, 0x06, + 0x7e, 0xc6, 0xc6, 0xc6, 0x7e, 0x00, 0x00, 0x00, 0x00, 0x38, 0x6c, 0x38, + 0x00, 0x7c, 0x06, 0x06, 0x7e, 0xc6, 0xc6, 0xc6, 0x7e, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc0, 0xc0, 0xc0, 0xc0, 0xc6, + 0x7c, 0x18, 0x0c, 0x38, 0x00, 0x10, 0x38, 0x6c, 0x00, 0x7c, 0xc6, 0xc6, + 0xfe, 0xc0, 0xc0, 0xc0, 0x7e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x6c, 0x6c, + 0x00, 0x7c, 0xc6, 0xc6, 0xfe, 0xc0, 0xc0, 0xc0, 0x7e, 0x00, 0x00, 0x00, + 0x00, 0x60, 0x30, 0x18, 0x00, 0x7c, 0xc6, 0xc6, 0xfe, 0xc0, 0xc0, 0xc0, + 0x7e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x6c, 0x6c, 0x00, 0x38, 0x18, 0x18, + 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x10, 0x38, 0x6c, + 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, + 0x00, 0x60, 0x30, 0x18, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, + 0x3c, 0x00, 0x00, 0x00, 0xc6, 0xc6, 0x10, 0x38, 0x6c, 0xc6, 0xc6, 0xc6, + 0xfe, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x38, 0x6c, 0x38, 0x00, + 0x38, 0x6c, 0xc6, 0xc6, 0xc6, 0xfe, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, + 0x18, 0x30, 0x60, 0x00, 0xfe, 0xc0, 0xc0, 0xfc, 0xc0, 0xc0, 0xc0, 0xc0, + 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xec, 0x36, 0x36, + 0x76, 0xde, 0xd8, 0xd8, 0x6e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x3c, + 0x6c, 0xcc, 0xcc, 0xfe, 0xcc, 0xcc, 0xcc, 0xcc, 0xce, 0x00, 0x00, 0x00, + 0x00, 0x10, 0x38, 0x6c, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, + 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x6c, 0x6c, 0x00, 0x7c, 0xc6, 0xc6, + 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x60, 0x30, 0x18, + 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, + 0x00, 0x10, 0x38, 0x6c, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, + 0x7c, 0x00, 0x00, 0x00, 0x00, 0x60, 0x30, 0x18, 0x00, 0xc6, 0xc6, 0xc6, + 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x6c, 0x6c, + 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xce, 0x76, 0x06, 0xc6, 0x7c, 0x00, + 0x6c, 0x6c, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, + 0x7c, 0x00, 0x00, 0x00, 0x6c, 0x6c, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, + 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, + 0x30, 0x78, 0xcc, 0xc0, 0xc0, 0xcc, 0x78, 0x30, 0x30, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x38, 0x6c, 0x60, 0x60, 0x60, 0xf8, 0x60, 0x60, 0x60, 0xe6, + 0xfc, 0x00, 0x00, 0x00, 0x00, 0x00, 0xcc, 0xcc, 0xcc, 0x78, 0x30, 0xfc, + 0x30, 0xfc, 0x30, 0x30, 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf8, 0xcc, + 0xcc, 0xf8, 0xc4, 0xcc, 0xde, 0xcc, 0xcc, 0xcc, 0xc6, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x0e, 0x1b, 0x18, 0x18, 0x18, 0x7e, 0x18, 0x18, 0x18, 0x18, + 0x18, 0xd8, 0x70, 0x00, 0x00, 0x0c, 0x18, 0x30, 0x00, 0x7c, 0x06, 0x06, + 0x7e, 0xc6, 0xc6, 0xc6, 0x7e, 0x00, 0x00, 0x00, 0x00, 0x0c, 0x18, 0x30, + 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, + 0x00, 0x0c, 0x18, 0x30, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, + 0x7c, 0x00, 0x00, 0x00, 0x00, 0x0c, 0x18, 0x30, 0x00, 0xc6, 0xc6, 0xc6, + 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x76, 0xdc, 0x00, + 0x00, 0xdc, 0xe6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, + 0x76, 0xdc, 0x00, 0xc6, 0xc6, 0xe6, 0xf6, 0xfe, 0xde, 0xce, 0xc6, 0xc6, + 0xc6, 0x00, 0x00, 0x00, 0x00, 0x78, 0xd8, 0xd8, 0x6c, 0x00, 0xfc, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x38, 0x6c, 0x6c, + 0x38, 0x00, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x18, 0x18, 0x00, 0x18, 0x18, 0x30, 0x60, 0xc0, 0xc6, 0xc6, + 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0xfe, 0xc0, 0xc0, 0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0xfe, 0x06, 0x06, 0x06, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0xc0, 0xc2, 0xc6, 0xcc, 0xd8, 0x30, 0x60, 0xdc, 0x86, 0x0c, + 0x18, 0x3e, 0x00, 0x00, 0x00, 0x00, 0xc0, 0xc2, 0xc6, 0xcc, 0xd8, 0x30, + 0x66, 0xce, 0x9e, 0x3e, 0x06, 0x06, 0x00, 0x00, 0x00, 0x00, 0x30, 0x30, + 0x00, 0x30, 0x30, 0x30, 0x78, 0x78, 0x78, 0x78, 0x30, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x36, 0x6c, 0xd8, 0x6c, 0x36, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xd8, 0x6c, 0x36, + 0x6c, 0xd8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x22, 0x88, 0x22, 0x88, + 0x22, 0x88, 0x22, 0x88, 0x22, 0x88, 0x22, 0x88, 0x22, 0x88, 0x22, 0x88, + 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, + 0x55, 0xaa, 0x55, 0xaa, 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, + 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, 0x18, 0x18, 0x18, 0x18, + 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, + 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0xf8, 0xf8, 0x18, 0x18, 0x18, + 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0xf8, 0xf8, 0x18, + 0x18, 0xf8, 0xf8, 0x18, 0x18, 0x18, 0x18, 0x18, 0x36, 0x36, 0x36, 0x36, + 0x36, 0x36, 0x36, 0xf6, 0xf6, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xfe, 0x36, 0x36, 0x36, + 0x36, 0x36, 0x36, 0x36, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf8, 0xf8, 0x18, + 0x18, 0xf8, 0xf8, 0x18, 0x18, 0x18, 0x18, 0x18, 0x36, 0x36, 0x36, 0x36, + 0x36, 0xf6, 0xf6, 0x06, 0x06, 0xf6, 0xf6, 0x36, 0x36, 0x36, 0x36, 0x36, + 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, + 0x36, 0x36, 0x36, 0x36, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xfe, 0x06, + 0x06, 0xf6, 0xf6, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, + 0x36, 0xf6, 0xf6, 0x06, 0x06, 0xfe, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0xfe, 0xfe, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x18, 0x18, 0x18, 0xf8, 0xf8, 0x18, + 0x18, 0xf8, 0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0xf8, 0xf8, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, + 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x1f, 0x1f, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0xff, + 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0xff, 0xff, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, + 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x1f, 0x1f, 0x18, 0x18, 0x18, + 0x18, 0x18, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, + 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x18, 0x18, + 0x18, 0x18, 0x18, 0xff, 0xff, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, + 0x18, 0x18, 0x18, 0x18, 0x18, 0x1f, 0x1f, 0x18, 0x18, 0x1f, 0x1f, 0x18, + 0x18, 0x18, 0x18, 0x18, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x37, + 0x37, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, + 0x36, 0x37, 0x37, 0x30, 0x30, 0x3f, 0x3f, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x3f, 0x3f, 0x30, 0x30, 0x37, 0x37, 0x36, + 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0xf7, 0xf7, 0x00, + 0x00, 0xff, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0xff, 0xff, 0x00, 0x00, 0xf7, 0xf7, 0x36, 0x36, 0x36, 0x36, 0x36, + 0x36, 0x36, 0x36, 0x36, 0x36, 0x37, 0x37, 0x30, 0x30, 0x37, 0x37, 0x36, + 0x36, 0x36, 0x36, 0x36, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0x00, + 0x00, 0xff, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x36, 0x36, 0x36, 0x36, + 0x36, 0xf7, 0xf7, 0x00, 0x00, 0xf7, 0xf7, 0x36, 0x36, 0x36, 0x36, 0x36, + 0x18, 0x18, 0x18, 0x18, 0x18, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0xff, + 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0x18, 0x18, 0x18, 0x18, 0x18, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0x36, 0x36, 0x36, + 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x3f, + 0x3f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x18, 0x18, + 0x18, 0x1f, 0x1f, 0x18, 0x18, 0x1f, 0x1f, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x1f, 0x1f, 0x18, 0x18, 0x1f, 0x1f, 0x18, + 0x18, 0x18, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3f, + 0x3f, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, + 0x36, 0x36, 0x36, 0xff, 0xff, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, + 0x18, 0x18, 0x18, 0x18, 0x18, 0xff, 0xff, 0x18, 0x18, 0xff, 0xff, 0x18, + 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0xf8, + 0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x1f, 0x1f, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, + 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0xff, 0xff, 0xff, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xf0, 0xf0, 0xf0, 0xf0, + 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, + 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, + 0x0f, 0x0f, 0x0f, 0x0f, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x76, 0xd6, 0xdc, 0xc8, 0xc8, 0xdc, 0xd6, 0x76, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x78, 0xcc, 0xcc, 0xcc, 0xd8, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, + 0xd8, 0xc0, 0xc0, 0x00, 0x00, 0x00, 0xfe, 0xc6, 0xc6, 0xc0, 0xc0, 0xc0, + 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x7e, 0xfe, 0x24, 0x24, 0x24, 0x24, 0x66, 0xc6, 0x00, 0x00, 0x00, + 0x00, 0x00, 0xfe, 0xfe, 0xc2, 0x60, 0x30, 0x18, 0x30, 0x60, 0xc2, 0xfe, + 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7e, 0xc8, 0xcc, + 0xcc, 0xcc, 0xcc, 0xcc, 0x78, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x66, 0x66, 0x66, 0x66, 0x66, 0x66, 0x76, 0x6c, 0x60, 0xc0, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x66, 0xfc, 0x98, 0x18, 0x18, 0x18, 0x18, + 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfc, 0x30, 0x30, 0x78, 0xcc, 0xcc, + 0xcc, 0x78, 0x30, 0x30, 0xfc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x38, 0x6c, + 0xc6, 0xc6, 0xc6, 0xfe, 0xc6, 0xc6, 0xc6, 0x6c, 0x38, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x38, 0x6c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x6c, 0x6c, 0x6c, + 0xee, 0x00, 0x00, 0x00, 0x00, 0x00, 0x78, 0xcc, 0x60, 0x30, 0x78, 0xcc, + 0xcc, 0xcc, 0xcc, 0xcc, 0x78, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x76, 0xbb, 0x99, 0x99, 0xdd, 0x6e, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x02, 0x06, 0x3c, 0x6c, 0xce, 0xd6, 0xd6, 0xe6, 0x6c, 0x78, + 0xc0, 0x80, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x30, 0x60, 0xc0, 0xc0, 0xfe, + 0xc0, 0xc0, 0x60, 0x30, 0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x38, 0x6c, + 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0xfe, 0x00, 0x00, 0xfe, 0x00, 0x00, 0xfe, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x30, 0xfc, + 0x30, 0x30, 0x00, 0x00, 0xfc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x60, 0x30, 0x18, 0x0c, 0x18, 0x30, 0x60, 0x00, 0xfc, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x18, 0x30, 0x60, 0xc0, 0x60, 0x30, 0x18, 0x00, + 0xfc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1c, 0x36, 0x36, 0x30, 0x30, 0x30, + 0x30, 0x30, 0x30, 0x30, 0x30, 0x30, 0x30, 0x30, 0x18, 0x18, 0x18, 0x18, + 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0xd8, 0xd8, 0x70, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x30, 0x30, 0x00, 0xfc, 0x00, 0x30, 0x30, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x76, 0xdc, 0x00, + 0x76, 0xdc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x78, 0xcc, 0xcc, + 0xcc, 0x78, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x30, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x0c, 0x0c, + 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0xcc, 0x6c, 0x3c, 0x1c, 0x0c, 0x00, 0x00, + 0x00, 0xd8, 0xec, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x38, 0x6c, 0x0c, 0x18, 0x30, 0x60, 0x7c, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x78, 0x78, 0x78, 0x78, 0x78, 0x78, 0x78, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, + 0x00, 0x00, 0x00, 0x00 +}; diff --git a/usr.bin/kfgwm/include/kfg/font.h b/usr.bin/kfgwm/include/kfg/font.h new file mode 100644 index 0000000..7752952 --- /dev/null +++ b/usr.bin/kfgwm/include/kfg/font.h @@ -0,0 +1,40 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _KFGWM_FONT_H_ +#define _KFGWM_FONT_H_ + +#include <sys/types.h> + +#define FONT_WIDTH 8 +#define FONT_HEIGHT 16 + +extern const uint8_t g_KFG_FONT[]; + +#endif /* !_KFGWM_FONT_H_ */ diff --git a/usr.bin/kfgwm/include/kfg/types.h b/usr.bin/kfgwm/include/kfg/types.h new file mode 100644 index 0000000..2d17ae1 --- /dev/null +++ b/usr.bin/kfgwm/include/kfg/types.h @@ -0,0 +1,40 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef KFG_TYPES_H_ +#define KFG_TYPES_H_ + +#include <sys/types.h> +#include <stddef.h> + +typedef uint32_t kfgpos_t; +typedef uint32_t kfgdim_t; +typedef uint32_t kfgpixel_t; + +#endif /* !KFG_TYPES_H_ */ diff --git a/usr.bin/kfgwm/include/kfg/window.h b/usr.bin/kfgwm/include/kfg/window.h new file mode 100644 index 0000000..a597969 --- /dev/null +++ b/usr.bin/kfgwm/include/kfg/window.h @@ -0,0 +1,68 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef KFG_WINDOW_H_ +#define KFG_WINDOW_H_ + +#include <kfg/types.h> + +#define KFG_RED 0x6E0C24 +#define KFG_YELLOW 0xF0A401 +#define KFG_WHITE 0xF2E5BC +#define KFG_DARK 0x1D2021 +#define KFG_BLUE 0x076678 +#define KFG_AQUA 0x427B58 + +/* Default dimensions */ +#define KFG_BORDER_WIDTH 1 +#define KFG_BORDER_HEIGHT 1 +#define KFG_TITLE_HEIGHT 10 + +struct kfg_window { + kfgpos_t x; + kfgpos_t y; + kfgdim_t width; + kfgdim_t height; + kfgdim_t fb_pitch; + kfgpixel_t bg; + kfgpixel_t border_bg; + kfgpixel_t *framebuf; +}; + +struct kfg_text { + const char *text; + kfgpos_t x; + kfgpos_t y; +}; + +struct kfg_window *kfg_win_new(struct kfg_window *parent, kfgpos_t x, kfgpos_t y); +int kfg_win_draw(struct kfg_window *parent, struct kfg_window *wp); +int kfg_win_putstr(struct kfg_window *wp, struct kfg_text *tp); + +#endif /* !KFG_WINDOW_H_ */ diff --git a/usr.bin/kfgwm/kfgwm.c b/usr.bin/kfgwm/kfgwm.c new file mode 100644 index 0000000..5a9e7b8 --- /dev/null +++ b/usr.bin/kfgwm/kfgwm.c @@ -0,0 +1,95 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/mman.h> +#include <sys/types.h> +#include <sys/fbdev.h> +#include <kfg/window.h> +#include <fcntl.h> +#include <stddef.h> +#include <stdlib.h> +#include <unistd.h> + +static struct fbattr fbattr; +static uint32_t *framep; + +static void +test_win(struct kfg_window *root, kfgpos_t x, kfgpos_t y, const char *str) +{ + struct kfg_text text; + struct kfg_window *test_win; + + test_win = kfg_win_new(root, x, y); + text.text = str; + text.x = 0; + text.y = 0; + + kfg_win_draw(root, test_win); + kfg_win_putstr(test_win, &text); +} + +int +main(void) +{ + int fb_fd, fbattr_fd, prot; + size_t fb_size; + struct kfg_window *root_win; + + fb_fd = open("/dev/fb0", O_RDWR); + if (fb_fd < 0) { + return fb_fd; + } + + fbattr_fd = open("/ctl/fb0/attr", O_RDONLY); + if (fbattr_fd < 0) { + close(fb_fd); + return fbattr_fd; + } + + read(fbattr_fd, &fbattr, sizeof(fbattr)); + close(fbattr_fd); + + fb_size = fbattr.height * fbattr.pitch; + prot = PROT_READ | PROT_WRITE; + framep = mmap(NULL, fb_size, prot, MAP_SHARED, fb_fd, 0); + + root_win = malloc(sizeof(*root_win)); + root_win->x = 0; + root_win->y = 0; + root_win->width = fbattr.width; + root_win->height = fbattr.height; + root_win->fb_pitch = fbattr.pitch; + root_win->framebuf = framep; + root_win->bg = KFG_RED; + root_win->border_bg = KFG_RED; + test_win(root_win, 40, 85, "Hello, World!"); + test_win(root_win, 150, 20, "Mrow!"); + + for (;;); +} diff --git a/usr.bin/kfgwm/window.c b/usr.bin/kfgwm/window.c new file mode 100644 index 0000000..3908302 --- /dev/null +++ b/usr.bin/kfgwm/window.c @@ -0,0 +1,221 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <sys/cdefs.h> +#include <sys/param.h> +#include <kfg/window.h> +#include <kfg/font.h> +#include <stdlib.h> +#include <stddef.h> +#include <string.h> + +__always_inline static inline size_t +pixel_index(struct kfg_window *wp, kfgpos_t x, kfgpos_t y) +{ + return x + y * (wp->fb_pitch / 4); +} + +static int +kfg_win_putc(struct kfg_window *wp, uint32_t x, uint32_t y, char ch) +{ + size_t idx; + const uint8_t *glyph; + uint32_t fg, bg; + + glyph = &g_KFG_FONT[(int)ch*16]; + fg = KFG_WHITE; + bg = wp->bg; + + for (uint32_t cy = 0; cy < FONT_HEIGHT; ++cy) { + idx = pixel_index(wp, x + (FONT_WIDTH - 1), y + cy); + for (uint32_t cx = 0; cx < FONT_WIDTH; ++cx) { + wp->framebuf[idx--] = ISSET(glyph[cy], BIT(cx)) ? fg : bg; + } + } +} + +static void +draw_win(struct kfg_window *parent, struct kfg_window *wp) +{ + kfgpixel_t *framep; + kfgpos_t x_i, y_i; /* Start */ + kfgpos_t x_end, y_end; /* End */ + kfgpixel_t brush = wp->bg; + kfgpos_t rx, ry; /* Starts at 0 */ + kfgpos_t rx_end, ry_end; /* Starts at 0 */ + size_t i; + + framep = parent->framebuf; + x_i = wp->x; + y_i = wp->y; + x_end = x_i + wp->width; + y_end = y_i + wp->height; + + if (x_end > parent->width) + x_end = parent->width; + if (y_end > parent->height) + y_end = parent->height; + + for (kfgpos_t x = x_i; x < x_end; ++x) { + for (kfgpos_t y = y_i; y < y_i+KFG_TITLE_HEIGHT; ++y) { + rx = (x - x_i); + ry = (y - y_i); + + if (rx <= KFG_BORDER_WIDTH && (rx % 2) == 0) + brush = KFG_WHITE; + else + brush = KFG_AQUA; + + i = pixel_index(parent, x, y); + framep[i] = brush; + } + } + + y_i = wp->y + KFG_TITLE_HEIGHT; + for (kfgpos_t x = x_i; x < x_end; ++x) { + for (kfgpos_t y = y_i; y < y_end; ++y) { + rx = (x - x_i); + ry = (y - y_i); + + if (rx <= KFG_BORDER_WIDTH) + brush = wp->border_bg; + else if (ry <= KFG_BORDER_HEIGHT) + brush = wp->border_bg; + else if (rx >= (wp->width - KFG_BORDER_WIDTH)) + brush = wp->border_bg; + else if (ry >= (wp->height - KFG_BORDER_HEIGHT)) + brush = wp->border_bg; + else + brush = wp->bg; + + i = pixel_index(parent, x, y); + framep[i] = brush; + } + } +} + +/* + * Draw a window on the screen + * + * @parent: Parent window + * @wp: New window to draw + * + * TODO: Double buffering and multiple windows. + */ +int +kfg_win_draw(struct kfg_window *parent, struct kfg_window *wp) +{ + kfgpos_t start_x, start_y; + kfgpos_t end_x, end_y; + kfgpos_t max_x, max_y; + kfgdim_t width, height; + + if (parent == NULL) { + return -EINVAL; + } + if (parent->framebuf == NULL) { + return -EINVAL; + } + + max_x = wp->x + parent->width; + max_y = wp->y + parent->height; + + /* Don't overflow the framebuffer! */ + if ((wp->x + wp->width) > max_x) { + wp->x = max_x; + } + if ((wp->y + wp->height) > max_y) { + wp->y = max_y; + } + + draw_win(parent, wp); + return 0; +} + +/* + * Create a new default window + * + * @x: X position for this window + * @y: Y position for this window + * @w: Window width + * @h: Window height + */ +struct kfg_window * +kfg_win_new(struct kfg_window *parent, kfgpos_t x, kfgpos_t y) +{ + struct kfg_window *wp; + + if ((wp = malloc(sizeof(*wp))) == NULL) { + return NULL; + } + + wp->x = x; + wp->y = y; + wp->width = 250; + wp->height = 150; + wp->fb_pitch = parent->fb_pitch; + wp->framebuf = parent->framebuf; + wp->bg = KFG_DARK; + wp->border_bg = KFG_RED; + return wp; +} + +int +kfg_win_putstr(struct kfg_window *wp, struct kfg_text *tp) +{ + size_t slen; + const char *p; + kfgpos_t x, y; + + if (tp == NULL) + return -EINVAL; + if (tp->text == NULL) + return -EINVAL; + + slen = strlen(tp->text); + x = (wp->x + tp->x) + (KFG_BORDER_WIDTH + 1); + y = (KFG_TITLE_HEIGHT + wp->y) + tp->y; + p = tp->text; + + while (slen--) { + if (y >= wp->height) { + break; + } + + kfg_win_putc(wp, x, y, *(p++)); + x += FONT_WIDTH; + if (x >= wp->width) { + y += FONT_HEIGHT; + x = wp->x + (KFG_BORDER_WIDTH + 1); + } + } + + return 0; +} diff --git a/usr.bin/kmsg/Makefile b/usr.bin/kmsg/Makefile new file mode 100644 index 0000000..9b76cc2 --- /dev/null +++ b/usr.bin/kmsg/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/kmsg: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/kmsg/kmsg.c b/usr.bin/kmsg/kmsg.c new file mode 100644 index 0000000..2deae39 --- /dev/null +++ b/usr.bin/kmsg/kmsg.c @@ -0,0 +1,58 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <unistd.h> +#include <fcntl.h> +#include <string.h> +#include <stdio.h> + +int +main(void) +{ + int mfd; + ssize_t retval; + char linebuf[256]; + + if ((mfd = open("/dev/kmsg", O_RDONLY)) < 0) { + return mfd; + } + + for (;;) { + retval = read(mfd, linebuf, sizeof(linebuf) - 1); + if (retval <= 0) { + break; + } + linebuf[retval] = '\0'; + fputs(linebuf, stdout); + } + + close(mfd); + return 0; +} diff --git a/usr.bin/kstat/Makefile b/usr.bin/kstat/Makefile new file mode 100644 index 0000000..ccceb3c --- /dev/null +++ b/usr.bin/kstat/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/kstat: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/kstat/kstat.c b/usr.bin/kstat/kstat.c new file mode 100644 index 0000000..cbbe602 --- /dev/null +++ b/usr.bin/kstat/kstat.c @@ -0,0 +1,122 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/sched.h> +#include <sys/vmstat.h> +#include <stdio.h> +#include <unistd.h> +#include <fcntl.h> + +#define MIB_PER_GIB 1024 + +static void +print_size_mib(const char *name, size_t mib) +{ + if (name == NULL) { + return; + } + + if (mib >= MIB_PER_GIB) { + printf("%s: %d GiB\n", name, mib / MIB_PER_GIB); + } else { + printf("%s: %d MiB\n", name, mib); + } +} + +static void +get_vm_stat(void) +{ + struct vm_stat vmstat; + int retval, fd; + + fd = open("/ctl/vm/stat", O_RDONLY); + if (fd < 0) { + printf("failed to open '/ctl/vm/stat'\n"); + return; + } + + retval = read(fd, &vmstat, sizeof(vmstat)); + if (retval <= 0) { + printf("failed to read vmstat\n"); + return; + } + + close(fd); + print_size_mib("memory available", vmstat.mem_avail); + print_size_mib("memory used", vmstat.mem_used); + print_size_mib("memory total", vmstat.mem_total); +} + +static void +get_sched_stat(void) +{ + struct sched_stat stat; + struct sched_cpu *cpu; + double nonline, noffline; + uint16_t online_percent; + int fd; + + fd = open("/ctl/sched/stat", O_RDONLY); + if (fd < 0) { + printf("failed to get sched stat\n"); + return; + } + if (read(fd, &stat, sizeof(stat)) < 0) { + printf("failed to read sched stat\n"); + return; + } + + close(fd); + noffline = stat.nhlt; + nonline = (stat.ncpu - noffline); + online_percent = (uint16_t)(((double)nonline / (nonline + noffline)) * 100); + + printf("number of tasks: %d\n", stat.nproc); + printf("number of cores online: %d\n", stat.ncpu); + printf("scheduler quantum: %d usec\n", stat.quantum_usec); + printf("CPU is %d%% online\n", online_percent); + + /* + * Log out some per-cpu information + */ + for (int i = 0; i < stat.ncpu; ++i) { + cpu = &stat.cpus[i]; + printf("[cpu %d]: %d switches\n", i, cpu->nswitch); + } +} + +int +main(void) +{ + printf("-- scheduler statistics --\n"); + get_sched_stat(); + printf("-- memory statistics --\n"); + get_vm_stat(); + return 0; +} diff --git a/usr.bin/link.ld b/usr.bin/link.ld index 9fad881..5e99291 100644 --- a/usr.bin/link.ld +++ b/usr.bin/link.ld @@ -23,4 +23,9 @@ SECTIONS *(.bss.*) __bss_end = .; } + + /DISCARD/ : { + *(.eh_frame) + *(.note .note.*) + } } diff --git a/usr.bin/login/Makefile b/usr.bin/login/Makefile new file mode 100644 index 0000000..8b37d4c --- /dev/null +++ b/usr.bin/login/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/login: + gcc -Iinclude/ $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/login/login.c b/usr.bin/login/login.c new file mode 100644 index 0000000..5b21303 --- /dev/null +++ b/usr.bin/login/login.c @@ -0,0 +1,295 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/spawn.h> +#include <sys/types.h> +#include <sys/errno.h> +#include <crypto/sha256.h> +#include <stdio.h> +#include <stdlib.h> +#include <string.h> + +/* Row indices for /etc/passwd */ +#define ROW_USERNAME 0 +#define ROW_HASH 1 +#define ROW_USERID 2 +#define ROW_GRPID 3 +#define ROW_GECOS 4 +#define ROW_HOME 5 +#define ROW_SHELL 6 + +#define is_ascii(C) ((C) >= 0 && (C) <= 128) +#define is_digit(C) ((C >= '0' && C <= '9')) + +#define DEFAULT_SHELL "/usr/bin/osh" + +static char buf[64]; +static uint8_t buf_i; +static short echo_chars = 1; + +/* + * Verify a UID is valid + * + * Returns 0 on success + */ +static int +check_uid(const char *uid) +{ + size_t len; + + len = strlen(uid); + + /* Must not be greater than 4 chars */ + if (len > 4) { + return -1; + } + + for (int i = 0; i < len; ++i) { + if (!is_digit(uid[i])) { + return -1; + } + } + + return 0; +} + +/* + * Check an /etc/passwd entry against an alias + * (username) + * + * @alias: Alias to lookup + * @hash: Password hash + * @entry: /etc/passwd entry + * + * Returns -1 on failure + * Returns 0 if the entry matches + */ +static int +check_user(char *alias, char *hash, char *entry) +{ + const char *p; + char shell_path[256]; + char *shell_argv[] = { DEFAULT_SHELL, NULL }; + char *envp[] = { NULL }; + size_t len, row = 0; + size_t line = 1; + short have_user = 0; + short have_pw = 0; + short have_uid = 0; + short have_shell = 0; + uid_t uid = -1; + pid_t shell_pid; + + if (alias == NULL || entry == NULL) { + return -EINVAL; + } + + /* Grab the username */ + p = strtok(entry, ":"); + if (p == NULL) { + printf("bad /etc/passwd entry @ line 1\n"); + return -1; + } + + /* Iterate through each field */ + while (p != NULL) { + switch (row) { + case ROW_USERNAME: + if (strcmp(p, alias) == 0) { + have_user = 1; + } + break; /* UNREACHABLE */ + case ROW_HASH: + if (strcmp(p, hash) == 0) { + have_pw = 1; + } + break; + case ROW_USERID: + if (check_uid(p) != 0) { + printf("bad uid @ line %d\n", line); + return -1; + } + + uid = atoi(p); + have_uid = 1; + break; + case ROW_SHELL: + len = strlen(p) - 1; + if (len >= sizeof(shell_path) - 1) { + printf("bad shell path @ line %d\n", line); + return -1; + } + + memcpy(shell_path, p, len); + shell_path[len] = '\0'; + have_shell = 1; + break; + } + + p = strtok(NULL, ":"); + ++row; + ++line; + } + + /* + * We need to have found the password hash, + * the username, AND the UID. If we have not, + * then this has failed. + */ + if (!have_pw || !have_user || !have_uid) { + return -1; + } + + /* Do we have the shell path? */ + if (!have_shell) { + return -1; + } + + setuid(uid); + shell_argv[0] = shell_path; + shell_pid = spawn(shell_argv[0], shell_argv, envp, 0); + return 0; +} + +static char * +getstr(void) +{ + char c, printc; + int input; + + buf_i = 0; + + for (;;) { + if ((input = getchar()) < 0) { + continue; + } + + c = (char)input; + if (c == '\t') { + continue; + } + + /* + * If we want to echo characters, 'printc' becomes + * exactly the character we got. Otherwise, just + * print little stars to redact it. + */ + printc = echo_chars ? c : '*'; + + /* return on newline */ + if (c == '\n') { + buf[buf_i] = '\0'; + putchar('\n'); + return buf; + } + + /* handle backspaces and DEL */ + if (c == '\b' || c == 127) { + if (buf_i > 0) { + fputs("\b \b", stdout); + buf[--buf_i] = '\0'; + } + } else if (is_ascii(c) && buf_i < sizeof(buf) - 1) { + /* write to fd and add to buffer */ + buf[buf_i++] = c; + putchar(printc); + } + } +} + +static int +getuser(FILE *fp) +{ + char *pwtmp, *alias, *p; + char entry[256]; + char pwhash[SHA256_HEX_SIZE]; + int retval; + + printf("username: "); + p = getstr(); + alias = strdup(p); + + /* Grab the password now */ + echo_chars = 0; + printf("password: "); + p = getstr(); + pwtmp = strdup(p); + sha256_hex(pwtmp, strlen(pwtmp), pwhash); + + /* Paranoia */ + memset(pwtmp, 0, strlen(pwtmp)); + buf_i = 0; + memset(buf, 0, sizeof(buf)); + + /* Clean up */ + free(pwtmp); + pwtmp = NULL; + + /* See if anything matches */ + while (fgets(entry, sizeof(entry), fp) != NULL) { + retval = check_user(alias, pwhash, entry); + if (retval == 0) { + free(alias); + return 0; + } + } + + /* If we reach this point, bad creds */ + free(alias); + alias = NULL; + + printf("bad username or password\n"); + fseek(fp, 0, SEEK_SET); + memset(buf, 0, sizeof(buf)); + buf_i = 0; + echo_chars = 1; + return -1; +} + +int +main(void) +{ + FILE *fp; + + fp = fopen("/etc/passwd", "r"); + if (fp == NULL) { + printf("failed to open /etc/passwd\n"); + return -1; + } + + printf("- Please authenticate yourself -\n"); + for (;;) { + if (getuser(fp) == 0) { + break; + } + } + + fclose(fp); + return 0; +} diff --git a/usr.bin/mex/Makefile b/usr.bin/mex/Makefile new file mode 100644 index 0000000..6c0db59 --- /dev/null +++ b/usr.bin/mex/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/mex: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/mex/mex.c b/usr.bin/mex/mex.c new file mode 100644 index 0000000..7e6f8aa --- /dev/null +++ b/usr.bin/mex/mex.c @@ -0,0 +1,105 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <unistd.h> +#include <stddef.h> +#include <fcntl.h> +#include <string.h> +#include <stdio.h> + +#define LINE_LEN 16 + +static void +dump_line(const char *line, size_t len) +{ + /* The amount of bytes we write */ + const uint8_t BYTE_COUNT = 2; + + for (size_t i = 0; i < LINE_LEN; ++i) { + if (i < len) { + printf("%02x", line[i] & 0xFF); + } else { + printf(" "); + } + + /* Put spacing between bytes */ + if (((i + 1) % BYTE_COUNT) == 0) { + printf(" "); + } + } + + printf(" "); + for (size_t i = 0; i < len; ++i) { + if (line[i] > 31 && line[i] < 127) { + printf("%c", line[i]); + } else { + printf("."); + } + } + + printf("\n"); +} + +static void +dump_file(int fd) +{ + char buf[LINE_LEN]; + ssize_t count; + size_t offset = 0; + + for (;;) { + count = read(fd, buf, sizeof(char) * LINE_LEN); + if (count <= 0) { + break; + } + + printf("%08x: ", offset); + offset += LINE_LEN; + dump_line(buf, count); + } +} + +int +main(int argc, char **argv) +{ + int fd; + + if (argc < 2) { + printf("mex: usage: mex <filename>\n"); + return -1; + } + + if ((fd = open(argv[1], O_RDONLY)) < 0) { + printf("mex: failed to open input\n"); + return fd; + } + + dump_file(fd); + return 0; +} diff --git a/usr.bin/mrow/Makefile b/usr.bin/mrow/Makefile new file mode 100644 index 0000000..d7c7ef4 --- /dev/null +++ b/usr.bin/mrow/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/mrow: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) -lgfx diff --git a/usr.bin/mrow/mrow.c b/usr.bin/mrow/mrow.c new file mode 100644 index 0000000..1179f7e --- /dev/null +++ b/usr.bin/mrow/mrow.c @@ -0,0 +1,287 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <fcntl.h> +#include <stddef.h> +#include <unistd.h> +#include <stdio.h> +#include <time.h> +#include <stdlib.h> +#include <stdbool.h> +#include <libgfx/gfx.h> +#include <libgfx/draw.h> + +#define IS_ASCII(C) ((C) > 0 && (C) < 127) + +#define PLAYER_BG 0x808080 +#define MOUSE_BG 0x404040 +#define GAME_BG 0x000000 + +#define SPRITE_WIDTH 20 +#define SPRITE_HEIGHT 20 +#define MAX_MOUSE_SPEED 2 +#define MIN_MOUSE_SPEED 1 +#define PLAYER_SPEED 30 + +#define SCR_WIDTH (gfx_ctx.fbdev.width) +#define SCR_HEIGHT (gfx_ctx.fbdev.height) +#define MAX_X (SCR_WIDTH - SPRITE_WIDTH) +#define MAX_Y (SCR_HEIGHT - SPRITE_HEIGHT) + +/* Hit beep stuff */ +#define HIT_BEEP_MSEC 50 +#define HIT_BEEP_FREQ 600 + +static struct gfx_ctx gfx_ctx; +static uint32_t *framep; +static int beep_fd; +static size_t hit_count = 0; + +struct player { + int32_t x; + int32_t y; +}; + +struct mouse { + int32_t x; + int32_t y; + uint8_t x_inc : 1; + uint8_t y_inc : 1; + uint8_t speed; +}; + +static void +draw_sprite(uint32_t x, uint32_t y, uint32_t color) +{ + struct gfx_shape sprite_shape = GFX_SHAPE_DEFAULT; + + sprite_shape.x = x; + sprite_shape.y = y; + sprite_shape.width = SPRITE_WIDTH; + sprite_shape.height = SPRITE_HEIGHT; + sprite_shape.color = color; + gfx_draw_shape(&gfx_ctx, &sprite_shape); +} + +static void +update_mouse(struct mouse *mouse) +{ + draw_sprite(mouse->x, mouse->y, GAME_BG); + + /* Move the mouse in the x direction */ + if (mouse->x_inc) { + mouse->x += mouse->speed; + } else { + mouse->x -= mouse->speed; + } + + /* Move the mouse in the y direction */ + if (mouse->y_inc) { + mouse->y += mouse->speed; + } else { + mouse->y -= mouse->speed; + } + + if (mouse->x >= MAX_X) { + mouse->x = MAX_X; + mouse->x_inc = 0; + } else if (mouse->x <= 0) { + mouse->x = 0; + mouse->x_inc = 1; + } + + if (mouse->y >= MAX_Y) { + mouse->y = MAX_Y; + mouse->y_inc = 0; + } else if (mouse->y <= 0) { + mouse->y = 0; + mouse->y_inc = 1; + } + + draw_sprite(mouse->x, mouse->y, MOUSE_BG); +} + +static void +beep(uint16_t msec, uint16_t freq) +{ + uint32_t payload; + + /* Can't beep :( */ + if (beep_fd < 0) { + return; + } + + payload = freq; + payload |= (msec << 16); + write(beep_fd, &payload, sizeof(payload)); +} + +static void +score_increment(struct player *p, struct mouse *m) +{ + printf("\033[31;40mSCORE: %d\033[0m\n", ++hit_count); + + if (m->speed < MAX_MOUSE_SPEED) { + m->speed += 1; + } else { + m->speed = MIN_MOUSE_SPEED; + } +} + +static bool +mouse_collide(struct player *p, struct mouse *m) +{ + bool detected = false; + bool x_overlap, y_overlap; + + x_overlap = p->x < (m->x + SPRITE_WIDTH) && + (p->x + SPRITE_WIDTH) > m->x; + y_overlap = p->y < (m->y + SPRITE_HEIGHT) && + (p->y + SPRITE_HEIGHT) > m->y; + detected = x_overlap && y_overlap; + + /* + * Play a little ACK sound and reset the game + * if we collide + */ + if (detected) { + beep(HIT_BEEP_MSEC, HIT_BEEP_FREQ); + + /* Clear the sprites */ + draw_sprite(m->x, m->y, GAME_BG); + draw_sprite(p->x, p->y, GAME_BG); + + m->x = 0; + m->y = rand() % MAX_Y; + m->x_inc ^= 1; + m->y_inc ^= 1; + score_increment(p, m); + } + + return detected; + +} + +static void +game_loop(void) +{ + struct timespec ts; + struct mouse mouse; + struct player p; + char c; + bool running = true; + + ts.tv_sec = 0; + ts.tv_nsec = 7000000; + + /* Setup the player */ + p.x = 0; + p.y = 0; + + /* Setup the mouse */ + mouse.x = MAX_X; + mouse.y = MAX_Y; + mouse.x_inc = 0; + mouse.y_inc = 0; + mouse.speed = MIN_MOUSE_SPEED; + + /* Draw player and mouse */ + draw_sprite(p.x, p.y, PLAYER_BG); + draw_sprite(mouse.x, mouse.y, MOUSE_BG); + + while (running) { + if (mouse_collide(&p, &mouse)) { + continue; + } + + c = getchar(); + sleep(&ts, &ts); + update_mouse(&mouse); + + if (IS_ASCII(c)) { + draw_sprite(p.x, p.y, GAME_BG); + } + + switch (c) { + case 'w': + p.y -= PLAYER_SPEED; + if (p.y <= 0) { + p.y = 0; + } + break; + case 'a': + p.x -= PLAYER_SPEED; + if (p.x <= 0) { + p.x = 0; + } + break; + case 's': + p.y += PLAYER_SPEED; + if (p.y > MAX_Y){ + p.y = MAX_Y; + } + break; + case 'd': + p.x += PLAYER_SPEED; + if (p.x > MAX_X) { + p.x = MAX_X; + } + break; + case 'q': + running = false; + default: + continue; + } + + draw_sprite(p.x, p.y, PLAYER_BG); + } +} + +int +main(void) +{ + int error; + char c; + + error = gfx_init(&gfx_ctx); + if (error < 0) { + printf("failed to init libgfx\n"); + return error; + } + + beep_fd = open("/dev/beep", O_WRONLY); + game_loop(); + printf("\033[35;40mYOUR FINAL SCORE: %d\033[0m\n", hit_count); + + /* Cleanup */ + close(beep_fd); + gfx_cleanup(&gfx_ctx); + return 0; +} diff --git a/usr.bin/nerve/Makefile b/usr.bin/nerve/Makefile new file mode 100644 index 0000000..cc0fd91 --- /dev/null +++ b/usr.bin/nerve/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/nerve: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/nerve/nerve.c b/usr.bin/nerve/nerve.c new file mode 100644 index 0000000..75a19be --- /dev/null +++ b/usr.bin/nerve/nerve.c @@ -0,0 +1,377 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <sys/console.h> +#include <stdio.h> +#include <string.h> +#include <unistd.h> +#include <fcntl.h> +#include <stdint.h> + +/* Verb numeric defs (see string defs) */ +#define VERB_UNKNOWN -1 +#define VERB_POKE 0x0000 +#define VERB_PEEK 0x0001 + +/* Verb string defs (see numeric defs) */ +#define SVERB_POKE "poke" +#define SVERB_PEEK "peek" + +/* Nerve numeric defs (see string defs) */ +#define NERVE_UNKNOWN -1 +#define NERVE_CONSATTR 0x0000 +#define NERVE_CONSFEAT 0x0001 + +/* Nerve string defs (see numeric defs) */ +#define SNERVE_CONSATTR "consattr" +#define SNERVE_CONSFEAT "consfeat" + +/* Misc defines */ +#define NERVE_PACKET_LEN 16 + +struct verb_handler; + +static int poke_nerve(const char *nerve, struct verb_handler *h); +static int peek_nerve(const char *nerve, struct verb_handler *h); +static int nerve_to_def(const char *nerve); + +/* + * Contains verb handlers called when a verb + * (e.g., 'poke') is matched. + */ +struct verb_handler { + int(*run)(const char *nerve, struct verb_handler *h); + char **argv; + size_t argc; +}; + +/* + * Holds information that may be sent down + * my nerves. + * + * Example: nerve poke <x> 1 0 1 + * * * * + * +--------+ / / / + * | meow | <------+ / / + * |--------| / / + * | foo | <------+ / + * |--------| / + * | foobar | <------+ + * +--------+ + * packet + */ +struct nerve_payload { + uint32_t packet[NERVE_PACKET_LEN]; + uint16_t len; +}; + +/* + * Verb handler table, when a verb is matched, + * its respective handler is called. + */ +static struct verb_handler verbtab[] = { + { poke_nerve }, + { peek_nerve } +}; + +/* + * Print list of available options as well as + * information about the program. + */ +static void +help(void) +{ + printf( + "nerve: usage: nerve <verb> [ .. data ..]\n" + "verb 'poke': Poke a control (/ctl) nerve\n" + "???????????????? NERVES ????????????????\n" + "consattr: Console attributes\n" + "consfeat: Console features\n" + ); +} + +/* + * The user gets to send data down my nerves through + * a nerve payload. This function acquires the nerve + * payload. Please don't hurt me. + * + * @argc: Number of arguments within argv + * @argv: Argument vector + * @res: Where the payload goes + */ +static int +get_nerve_payload(int argc, char *argv[], struct nerve_payload *res) +{ + char *payload_str; + uint32_t datum; + + /* Do we have a nerve payload? */ + if (argc < 4) { + printf("[!] missing nerve payload\n"); + return -1; + } + + /* Reset fields */ + res->len = 0; + memset(res->packet, 0, sizeof(res->packet)); + + /* Start grabbing bytes */ + for (int i = 3; i < argc; ++i) { + if (res->len >= NERVE_PACKET_LEN) { + printf("[*] truncated packet\n"); + break; + } + payload_str = argv[i]; + datum = atoi(payload_str); + res->packet[res->len++] = datum; + } + + return 0; +} + +/* + * Peek at a control nerve located in /ctl/ + * + * @nerve: Name of nerve to peek at + * @h: Verb handler, instance of self + * + * Returns less than zero if the nerve does + * not match. + */ +static int +peek_nerve(const char *nerve, struct verb_handler *h) +{ + int error, nerve_idx = -1; + + if (nerve == NULL || h == NULL) { + return -EINVAL; + } + + /* Grab the nerve table index */ + nerve_idx = nerve_to_def(nerve); + if (nerve_idx == NERVE_UNKNOWN) { + printf("[&^]: This is not my nerve.\n"); + return -1; + } + + switch (nerve_idx) { + case NERVE_CONSATTR: + { + struct console_attr c; + int fd; + + fd = open("/ctl/console/attr", O_RDONLY); + read(fd, &c, sizeof(c)); + printf("(cursx=%d, cursy=%d)\n", c.cursor_x, c.cursor_y); + close(fd); + break; + } + case NERVE_CONSFEAT: + { + struct console_feat f; + int fd; + + fd = open("/ctl/console/feat", O_RDONLY); + read(fd, &f, sizeof(f)); + printf("ansi_esc=%d\n", f.ansi_esc); + printf("show_curs=%d\n", f.show_curs); + close(fd); + break; + } + default: + break; + } + + return 0; +} + +/* + * Poke a control nerve located in /ctl/ + * + * @nerve: Name of the nerve (e.g., consattr) + * @h: Verb handler, instance of self + * + * Returns less than zero if the nerve does not + * match. + */ +static int +poke_nerve(const char *nerve, struct verb_handler *h) +{ + struct nerve_payload payload; + int error, nerve_idx = -1; + + if (nerve == NULL || h == NULL) { + return -EINVAL; + } + + /* Grab the nerve table index */ + nerve_idx = nerve_to_def(nerve); + if (nerve_idx == NERVE_UNKNOWN) { + printf("[&^]: This is not my nerve.\n"); + return -1; + } + + /* Grab the payload passed by the user */ + error = get_nerve_payload(h->argc, h->argv, &payload); + if (error < 0) { + printf("[!] nerve error\n"); + return -1; + } + + switch (nerve_idx) { + case NERVE_CONSATTR: + { + struct console_attr c; + int fd; + + c.cursor_x = payload.packet[0]; + c.cursor_y = payload.packet[1]; + + fd = open("/ctl/console/attr", O_WRONLY); + write(fd, &c, sizeof(c)); + close(fd); + break; + } + case NERVE_CONSFEAT: + { + struct console_feat f; + int fd; + + f.ansi_esc = payload.packet[0] & 0xFF; + f.show_curs = payload.packet[1] & 0xFF; + + fd = open("/ctl/console/feat", O_WRONLY); + write(fd, &f, sizeof(f)); + close(fd); + break; + } + default: + break; + } + + return -1; +} + +/* + * Convert a nerve name into a numeric nerve + * definition + * + * @nerve: Nerve name to convert + */ +static int +nerve_to_def(const char *nerve) +{ + /* + * Now we need to parse the nerve string + * and see if it matches with anything + * that we know. + */ + switch (*nerve) { + case 'c': + if (strcmp(nerve, SNERVE_CONSATTR) == 0) { + return NERVE_CONSATTR; + } else if (strcmp(nerve, SNERVE_CONSFEAT) == 0) { + return NERVE_CONSFEAT; + } + } + + return NERVE_UNKNOWN; +} + +/* + * Convert a string verb, passed in through the command + * line, into a numeric definition + * + * @verb: String verb + */ +static int +verb_to_def(const char *verb) +{ + if (verb == NULL) { + return -EINVAL; + } + + /* + * Parse the verb and try to match it against + * a constant. + * + * XXX: Here we are first matching the first character + * before we match the entire verb as that is more + * efficient than scanning each entire string until + * one matches. + */ + switch (*verb) { + case 'p': + if (strcmp(verb, SVERB_POKE) == 0) { + return VERB_POKE; + } + if (strcmp(verb, SVERB_PEEK) == 0) { + return VERB_PEEK; + } + default: + printf("[!] bad verb \"%s\"\n", verb); + return VERB_UNKNOWN; + } + + return VERB_UNKNOWN; +} + +int +main(int argc, char **argv) +{ + struct verb_handler *verbd; + int verb; + + if (argc < 2) { + help(); + return -1; + } + + verb = verb_to_def(argv[1]); + if (verb < 0) { + return -1; + } + + /* Make sure the arguments match */ + switch (verb) { + case VERB_POKE: + if (argc < 3) { + printf("[!] missing nerve name\n"); + help(); + return -1; + } + break; + } + + verbd = &verbtab[verb]; + verbd->argv = argv; + verbd->argc = argc; + return verbd->run(argv[2], verbd); +} diff --git a/usr.bin/notes/Makefile b/usr.bin/notes/Makefile new file mode 100644 index 0000000..c8717a9 --- /dev/null +++ b/usr.bin/notes/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/notes: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/notes/notes.c b/usr.bin/notes/notes.c new file mode 100644 index 0000000..9db8b60 --- /dev/null +++ b/usr.bin/notes/notes.c @@ -0,0 +1,132 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> +#include <stdbool.h> +#include <unistd.h> +#include <fcntl.h> +#include <ctype.h> + +#define BEEP_MSEC 100 +#define key_step(KEY) ('9' - ((KEY))) + +static uint8_t freq_addend = 0; + +static uint16_t freqtab[] = { + [ key_step('0') ] = 950, + [ key_step('9') ] = 900, + [ key_step('8') ] = 850, + [ key_step('7') ] = 800, + [ key_step('6') ] = 750, + [ key_step('5') ] = 700, + [ key_step('4') ] = 650, + [ key_step('3') ] = 600, + [ key_step('2') ] = 550, + [ key_step('1') ] = 500 +}; + +static int beep_fd = 0; +static bool running = false; + +static void +beep(uint16_t freq) +{ + uint32_t payload; + + if (beep_fd < 0) { + return; + } + + payload = freq; + payload |= (BEEP_MSEC << 16); + write(beep_fd, &payload, sizeof(payload)); +} + +static inline void +play_notekey(char key) +{ + uint8_t step = key_step(key); + uint16_t freq; + + /* Should not happen */ + if (step >= NELEM(freqtab)) { + step = key_step('0'); + } + + freq = freqtab[step] + freq_addend; + beep(freq); +} + +static void +play_loop(void) +{ + uint16_t freq = 0; + char c; + + running = true; + while (running) { + c = getchar(); + switch (c) { + case 'q': + running = false; + break; + case 'i': + /* NOTE: Overflow purposefully allowed here */ + ++freq_addend; + printf("%d ", freq_addend); + break; + case 'd': + /* NOTE: Underflow purposefully allowed here */ + --freq_addend; + printf("%d ", freq_addend); + break; + default: + if (!isdigit(c)) { + break; + } + + play_notekey(c); + } + } + + printf("\ncya!\n"); +} + +int +main(int argc, char **argv) +{ + beep_fd = open("/dev/beep", O_WRONLY); + if (beep_fd < 0) { + return -1; + } + + printf("bleep bloop time! - [i]nc/[d]ec\n"); + play_loop(); + close(beep_fd); +} diff --git a/usr.bin/oasm/Makefile b/usr.bin/oasm/Makefile new file mode 100644 index 0000000..a83aaab --- /dev/null +++ b/usr.bin/oasm/Makefile @@ -0,0 +1,7 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") +CFLAGS = -Iinclude/ + +$(ROOT)/base/usr/bin/oasm: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) $(CFLAGS) diff --git a/usr.bin/oasm/emit.c b/usr.bin/oasm/emit.c new file mode 100644 index 0000000..099f0b2 --- /dev/null +++ b/usr.bin/oasm/emit.c @@ -0,0 +1,564 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <oasm/emit.h> +#include <oasm/log.h> +#include <stdlib.h> +#include <string.h> + +static inline void +emit_bytes(struct emit_state *state, void *p, size_t len) +{ + write(state->out_fd, p, len); +} + +/* + * Convert an IR register to an OSMX64 + * valid register value that can be encoded + * into the instruction. + */ +static inline reg_t +ir_to_reg(tt_t ir) +{ + switch (ir) { + case TT_X0: return OSMX64_R_X0; + case TT_X1: return OSMX64_R_X1; + case TT_X2: return OSMX64_R_X2; + case TT_X3: return OSMX64_R_X3; + case TT_X4: return OSMX64_R_X4; + case TT_X5: return OSMX64_R_X5; + case TT_X6: return OSMX64_R_X6; + case TT_X7: return OSMX64_R_X7; + case TT_X8: return OSMX64_R_X8; + case TT_X9: return OSMX64_R_X9; + case TT_X10: return OSMX64_R_X10; + case TT_X11: return OSMX64_R_X11; + case TT_X12: return OSMX64_R_X12; + case TT_X13: return OSMX64_R_X13; + case TT_X14: return OSMX64_R_X14; + case TT_X15: return OSMX64_R_X15; + } + + return OSMX64_R_BAD; +} + +/* + * Encode a MOV instruction + * + * mov [r], [r/imm] + * + * Returns the next token on success, + * otherwise NULL. + */ +static struct oasm_token * +emit_encode_mov(struct emit_state *state, struct oasm_token *tok) +{ + inst_t curinst; + reg_t rd; + + if (state == NULL || tok == NULL) { + return NULL; + } + + /* Next token should be a register */ + tok = TAILQ_NEXT(tok, link); + if (tok == NULL) { + return NULL; + } + if (!tok_is_xreg(tok->type)) { + oasm_err("[emit error]: bad 'mov' order\n"); + return NULL; + } + + rd = ir_to_reg(tok->type); + if (rd == OSMX64_R_BAD) { + oasm_err("[emit error]: got bad reg in 'mov'\n"); + return NULL; + } + + /* Next token should be an IMM */ + tok = TAILQ_NEXT(tok, link); + if (tok == NULL) { + oasm_err("[emit error]: bad 'mov' order\n"); + return NULL; + } + if (tok->type != TT_IMM) { + oasm_err("[emit error]: expected <imm>\n"); + return NULL; + } + + curinst.opcode = OSMX64_MOV_IMM; + curinst.rd = rd; + curinst.imm = tok->imm; + emit_bytes(state, &curinst, sizeof(curinst)); + return TAILQ_NEXT(tok, link); +} + +/* + * Encode a INC/DEC instruction + * + * inc/dec [r] + * + * Returns the next token on success, + * otherwise NULL. + */ +static struct oasm_token * +emit_encode_incdec(struct emit_state *state, struct oasm_token *tok) +{ + inst_t curinst; + reg_t rd; + uint8_t opcode = OSMX64_INC; + char *inst_str = "inc"; + + if (state == NULL || tok == NULL) { + return NULL; + } + + if (tok->type == TT_DEC) { + inst_str = "dec"; + opcode = OSMX64_DEC; + } + + /* Next token should be a register */ + tok = TAILQ_NEXT(tok, link); + if (tok == NULL) { + return NULL; + } + if (!tok_is_xreg(tok->type)) { + oasm_err("[emit error]: bad '%s' order\n", inst_str); + return NULL; + } + + rd = ir_to_reg(tok->type); + if (rd == OSMX64_R_BAD) { + oasm_err("[emit error]: got bad reg in '%s'\n", inst_str); + return NULL; + } + + curinst.opcode = opcode; + curinst.rd = rd; + curinst.unused = 0; + emit_bytes(state, &curinst, sizeof(curinst)); + return TAILQ_NEXT(tok, link); +} + +/* + * Encode an arithmetic instruction + * + * add [r], <imm> + * + * Returns the next token on success, + * otherwise NULL. + */ +static struct oasm_token * +emit_encode_arith(struct emit_state *state, struct oasm_token *tok) +{ + inst_t curinst; + reg_t rd; + uint8_t opcode = OSMX64_ADD; + char *inst_str = "add"; + + switch (tok->type) { + case TT_SUB: + inst_str = "sub"; + opcode = OSMX64_SUB; + break; + case TT_MUL: + inst_str = "mul"; + opcode = OSMX64_MUL; + break; + case TT_DIV: + inst_str = "div"; + opcode = OSMX64_DIV; + break; + } + + /* + * The next operand must be an X<n> + * register. + */ + tok = TAILQ_NEXT(tok, link); + if (tok == NULL) { + return NULL; + } + if (!tok_is_xreg(tok->type)) { + oasm_err("[emit error]: bad '%s' order\n", inst_str); + return NULL; + } + + /* Get the register and validate it */ + rd = ir_to_reg(tok->type); + if (rd == OSMX64_R_BAD) { + oasm_err("[emit error]: got bad reg in '%s'\n", inst_str); + return NULL; + } + + /* The next token should be an <imm> */ + tok = TAILQ_NEXT(tok, link); + if (tok == NULL) { + return NULL; + } + if (tok->type != TT_IMM) { + oasm_err("[emit error]: expected <imm> in '%s'\n", inst_str); + return NULL; + } + + curinst.opcode = opcode; + curinst.rd = rd; + curinst.imm = tok->imm; + emit_bytes(state, &curinst, sizeof(curinst)); + return TAILQ_NEXT(tok, link); +} + +/* + * Encode a HLT instruction + * + * 'hlt' - no operands + * + * Returns the next token on success, + * otherwise NULL. + */ +static struct oasm_token * +emit_encode_hlt(struct emit_state *state, struct oasm_token *tok) +{ + inst_t curinst; + + curinst.opcode = OSMX64_HLT; + curinst.rd = 0; + curinst.unused = 0; + emit_bytes(state, &curinst, sizeof(curinst)); + return TAILQ_NEXT(tok, link); +} + +/* + * Encode a BR instruction + * + * br [r] + * + * Returns the next token on success, + * otherwise NULL. + */ +static struct oasm_token * +emit_encode_br(struct emit_state *state, struct oasm_token *tok) +{ + inst_t curinst; + reg_t rd; + uint8_t opcode = OSMX64_BR; + char *inst_str = "br"; + + /* Grab the register */ + tok = TAILQ_NEXT(tok, link); + if (tok == NULL) { + return NULL; + } + if (!tok_is_xreg(tok->type)) { + oasm_err("[emit error]: expected register in '%s'\n", inst_str); + return NULL; + } + + rd = ir_to_reg(tok->type); + if (rd == OSMX64_R_BAD) { + oasm_err("[emit error]: got bad in register in '%s'\n", inst_str); + return NULL; + } + + curinst.opcode = opcode; + curinst.rd = rd; + curinst.unused = 0; + emit_bytes(state, &curinst, sizeof(curinst)); + return TAILQ_NEXT(tok, link); +} + +/* + * Encode the MRO type instructions + * + * mrob x1[7:0] + * mrow x1[15:0] ! Mrowwww :3333 + * mrod x1[31:0] + * mroq x[63:0] + * + * Returns the next token on success, + * otherwise NULL. + */ +static struct oasm_token * +emit_encode_mro(struct emit_state *state, struct oasm_token *tok) +{ + inst_t curinst; + reg_t rd; + uint8_t opcode = OSMX64_MROB; + char *inst_str = "mrob"; + + switch (tok->type) { + case TT_MROW: + opcode = OSMX64_MROW; + inst_str = "mrow"; + break; + case TT_MROD: + opcode = OSMX64_MROD; + inst_str = "mrod"; + break; + case TT_MROQ: + opcode = OSMX64_MROQ; + inst_str = "mroq"; + break; + } + + /* Next token should be a register */ + tok = TAILQ_NEXT(tok, link); + if (!tok_is_xreg(tok->type)) { + oasm_err("[emit error]: expected register in '%s'\n", inst_str); + return NULL; + } + + rd = ir_to_reg(tok->type); + if (rd == OSMX64_R_BAD) { + oasm_err("[emit error]: got bad register in '%s'\n", inst_str); + return NULL; + } + + /* Next token should be an IMM */ + tok = TAILQ_NEXT(tok, link); + if (tok->type != TT_IMM) { + oasm_err("[emit error]: expected <imm> after reg in '%s'\n", inst_str); + return NULL; + } + + curinst.opcode = opcode; + curinst.rd = rd; + curinst.imm = tok->imm; + emit_bytes(state, &curinst, sizeof(curinst)); + return TAILQ_NEXT(tok, link); +} + +/* + * Encode a NOP instruction + * + * 'nop' - no operands + * + * Returns the next token on success, + * otherwise NULL. + */ +static struct oasm_token * +emit_encode_nop(struct emit_state *state, struct oasm_token *tok) +{ + inst_t curinst; + + curinst.opcode = OSMX64_NOP; + curinst.rd = 0; + curinst.unused = 0; + emit_bytes(state, &curinst, sizeof(curinst)); + return TAILQ_NEXT(tok, link); +} + +/* + * Encode a bitwise instruction: + * + * and r, r/imm + * or r, r/imm + * xor r, r/imm + */ +static struct oasm_token * +emit_encode_bitw(struct emit_state *state, struct oasm_token *tok) +{ + inst_t curinst; + imm_t imm; + reg_t rd; + uint8_t opcode = OSMX64_AND; + char *inst_str = "and"; + + switch (tok->type) { + case TT_OR: + opcode = OSMX64_OR; + inst_str = "or"; + break; + case TT_XOR: + opcode = OSMX64_XOR; + inst_str = "xor"; + break; + case TT_LSR: + opcode = OSMX64_LSR; + inst_str = "lsr"; + break; + case TT_LSL: + opcode = OSMX64_LSL; + inst_str = "lsl"; + break; + } + + /* Next token should be a register */ + tok = TAILQ_NEXT(tok, link); + if (tok == NULL) { + oasm_err("[emit error]: expected register for '%s'\n", inst_str); + return NULL; + } + if (!tok_is_xreg(tok->type)) { + oasm_err("[emit error]: bad register for '%s'\n", inst_str); + return NULL; + } + + rd = ir_to_reg(tok->type); + tok = TAILQ_NEXT(tok, link); + if (tok == NULL) { + oasm_err("[emit error]: missing operand in '%s'\n", inst_str); + return NULL; + } + + /* + * Check that the next token is an immediate + * value. + * + * TODO: Allow a register operand to be passed + * to these instructions. + */ + if (tok->type != TT_IMM) { + oasm_err("[emit error]: expected <imm> for '%s'\n", inst_str); + return NULL; + } + + imm = tok->imm; + curinst.opcode = opcode; + curinst.rd = rd; + curinst.imm = imm; + emit_bytes(state, &curinst, sizeof(curinst)); + return TAILQ_NEXT(tok, link); +} + +int +emit_osmx64(struct emit_state *state, struct oasm_token *tp) +{ + struct oasm_token *toknew; + + if (state == NULL || tp == NULL) { + return -EINVAL; + } + + /* + * We need to create a copy of the object as the + * caller will likely end up destroying it. + */ + toknew = malloc(sizeof(*toknew)); + if (toknew == NULL) { + return -ENOMEM; + } + + memcpy(toknew, tp, sizeof(*toknew)); + TAILQ_INSERT_TAIL(&state->ir, toknew, link); + return 0; +} + +int +emit_init(struct emit_state *state) +{ + state->last_token = TT_UNKNOWN; + state->is_init = 1; + TAILQ_INIT(&state->ir); + return 0; +} + +int +emit_destroy(struct emit_state *state) +{ + struct oasm_token *curtok, *last = NULL; + + TAILQ_FOREACH(curtok, &state->ir, link) { + if (last != NULL) { + free(last); + last = NULL; + } + if (curtok->raw != NULL) { + free(curtok->raw); + } + + last = curtok; + } + + /* Clean up any last objects */ + if (last != NULL) { + free(last); + } + + return 0; +} + +int +emit_process(struct oasm_state *oasm, struct emit_state *emit) +{ + struct oasm_token *curtok; + tt_t last_tok; + + if (!emit->is_init) { + return -1; + } + + emit->out_fd = oasm->out_fd; + curtok = TAILQ_FIRST(&emit->ir); + while (curtok != NULL) { + switch (curtok->type) { + case TT_NOP: + curtok = emit_encode_nop(emit, curtok); + break; + case TT_MOV: + curtok = emit_encode_mov(emit, curtok); + break; + case TT_INC: + case TT_DEC: + curtok = emit_encode_incdec(emit, curtok); + break; + case TT_ADD: + case TT_SUB: + case TT_MUL: + case TT_DIV: + curtok = emit_encode_arith(emit, curtok); + break; + case TT_AND: + case TT_OR: + case TT_XOR: + case TT_LSR: + case TT_LSL: + curtok = emit_encode_bitw(emit, curtok); + break; + case TT_BR: + curtok = emit_encode_br(emit, curtok); + break; + case TT_HLT: + curtok = emit_encode_hlt(emit, curtok); + break; + default: + if (tok_is_mro(curtok->type)) { + curtok = emit_encode_mro(emit, curtok); + break; + } + curtok = TAILQ_NEXT(curtok, link); + break; + } + } + + return 0; +} diff --git a/usr.bin/oasm/include/oasm/emit.h b/usr.bin/oasm/include/oasm/emit.h new file mode 100644 index 0000000..57683a8 --- /dev/null +++ b/usr.bin/oasm/include/oasm/emit.h @@ -0,0 +1,120 @@ +/* Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _EMIT_H_ +#define _EMIT_H_ + +#include <sys/queue.h> +#include <stdint.h> +#include <stddef.h> +#include <oasm/lex.h> +#include <oasm/state.h> + +/* + * The OSMX64 architecture has 32-bit instructions + * that are encoded in the following manner: + * + * - [0:7]: Opcode + * - [11:8]: Register + * - [31:12]: Reserved + * + * The values below define various operation + * codes. + */ +#define OSMX64_NOP 0x00 /* No-operation */ +#define OSMX64_ADD 0x01 /* Add operation */ +#define OSMX64_SUB 0x02 /* Sub operation */ +#define OSMX64_MUL 0x03 /* Multiply operation */ +#define OSMX64_DIV 0x04 /* Divide operation */ +#define OSMX64_INC 0x05 /* Increment operation */ +#define OSMX64_DEC 0x06 /* Decrement operation */ +#define OSMX64_OR 0x07 /* Bitwise OR operation */ +#define OSMX64_XOR 0x08 /* Bitwise XOR operation */ +#define OSMX64_AND 0x09 /* Bitwise AND operation */ +#define OSMX64_NOT 0x0A /* Bitwise NOT operation */ +#define OSMX64_SLL 0x0B /* Shift left logical operation */ +#define OSMX64_SRL 0x0C /* Shift right logical operation */ +#define OSMX64_MOV_IMM 0x0D /* Data move operation from IMM */ +#define OSMX64_HLT 0x0E /* Halt the processor */ +#define OSMX64_BR 0x0F /* Branch */ +#define OSMX64_MROB 0x10 /* Mask register over byte */ +#define OSMX64_MROW 0x11 /* Mask register over word */ +#define OSMX64_MROD 0x12 /* Mask register over dword */ +#define OSMX64_MROQ 0x13 /* Mask register over qword */ +#define OSMX64_LSR 0x14 /* Logical shift right */ +#define OSMX64_LSL 0x15 /* Logical shift left */ + +/* + * OSMX64 register definitions + */ +#define OSMX64_R_X0 0x00 +#define OSMX64_R_X1 0x01 +#define OSMX64_R_X2 0x02 +#define OSMX64_R_X3 0x03 +#define OSMX64_R_X4 0x04 +#define OSMX64_R_X5 0x05 +#define OSMX64_R_X6 0x06 +#define OSMX64_R_X7 0x07 +#define OSMX64_R_X8 0x08 +#define OSMX64_R_X9 0x09 +#define OSMX64_R_X10 0x0A +#define OSMX64_R_X11 0x0B +#define OSMX64_R_X12 0x0C +#define OSMX64_R_X13 0x0D +#define OSMX64_R_X14 0x0E +#define OSMX64_R_X15 0x0F +#define OSMX64_R_BAD 0xFF + +typedef uint8_t reg_t; +typedef uint16_t imm_t; + +/* + * OSMX64 instruction + */ +typedef struct { + uint8_t opcode; + uint8_t rd; + union { + uint16_t imm; + uint16_t unused; + }; +} inst_t; + +struct emit_state { + tt_t last_token; + uint8_t is_init : 1; + int out_fd; + TAILQ_HEAD(, oasm_token) ir; +}; + +int emit_init(struct emit_state *state); +int emit_destroy(struct emit_state *state); +int emit_process(struct oasm_state *oasm, struct emit_state *emit); +int emit_osmx64(struct emit_state *state, struct oasm_token *tp); + +#endif /* !_EMIT_H_ */ diff --git a/usr.bin/oasm/include/oasm/label.h b/usr.bin/oasm/include/oasm/label.h new file mode 100644 index 0000000..8acb369 --- /dev/null +++ b/usr.bin/oasm/include/oasm/label.h @@ -0,0 +1,55 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _OASM_LABEL_H_ +#define _OASM_LABEL_H_ + +#include <sys/types.h> +#include <sys/queue.h> + +#define MAX_LABELS 128 + +/* + * Represents a label + * + * @name: Label name (e.g., _start) + * @ip: Address at which label code starts + */ +struct oasm_label { + char *name; + uintptr_t ip; + TAILQ_ENTRY(oasm_label) link; + TAILQ_HEAD(, oasm_label) buckets; +}; + +void labels_destroy(void); +int label_enter(const char *name, uintptr_t ip); +struct oasm_label *label_lookup(const char *name); + +#endif /* !_OASM_LABEL_H_ */ diff --git a/usr.bin/oasm/include/oasm/lex.h b/usr.bin/oasm/include/oasm/lex.h new file mode 100644 index 0000000..93422a6 --- /dev/null +++ b/usr.bin/oasm/include/oasm/lex.h @@ -0,0 +1,188 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _OASM_LEX_H_ +#define _OASM_LEX_H_ + +#include <sys/queue.h> +#include <sys/cdefs.h> +#include <stdint.h> +#include <stdbool.h> + +struct oasm_state; + +#define __XN_REGS \ + TT_X0, \ + TT_X1, \ + TT_X2, \ + TT_X3, \ + TT_X4, \ + TT_X5, \ + TT_X6, \ + TT_X7, \ + TT_X8, \ + TT_X9, \ + TT_X10, \ + TT_X11, \ + TT_X12, \ + TT_X13, \ + TT_X14, \ + TT_X15 + +#define __FN_REGS \ + TT_F0, \ + TT_F1, \ + TT_F2, \ + TT_F3, \ + TT_F4, \ + TT_F5, \ + TT_F6, \ + TT_F7 + +#define __DN_REGS \ + TT_D0, \ + TT_D1, \ + TT_D2, \ + TT_D3, \ + TT_D4, \ + TT_D5, \ + TT_D6, \ + TT_D7 + +#define __VN_REGS \ + TT_V0, \ + TT_V1, \ + TT_V2, \ + TT_V3, \ + TT_V4, \ + TT_V5, \ + TT_V6, \ + TT_V7 + +/* + * Token type definitions + */ +typedef enum { + TT_UNKNOWN, /* Unknown token */ + TT_NOP, /* No operation */ + + /* Arithmetic instructions */ + TT_ADD, /* 'add' */ + TT_SUB, /* 'sub' */ + TT_MUL, /* 'mul' */ + TT_DIV, /* 'div' */ + TT_HLT, /* 'hlt' */ + TT_BR, /* 'br' */ + TT_MROB, /* 'mrob' */ + TT_MROW, /* 'mrow' */ + TT_MROD, /* 'mrod' */ + TT_MROQ, /* 'mroq' */ + TT_AND, /* 'and' */ + TT_OR, /* 'or' */ + TT_XOR, /* 'xor' */ + TT_LSR, /* 'lsr' */ + TT_LSL, /* 'lsl' */ + + /* Register ops */ + TT_MOV, /* 'mov' */ + TT_INC, /* 'inc' */ + TT_DEC, /* 'dec' */ + TT_IMM, /* #<n> */ + TT_LABEL, /* 'label: ...' */ + + /* Register sets */ + __XN_REGS, /* x0-x15 */ + __FN_REGS, /* f0-f7 */ + __DN_REGS, /* d0-d7 */ + __VN_REGS, /* v0-v7 */ + + /* Symbols */ + TT_COMMA, /* ',' */ +} tt_t; + +struct oasm_token { + tt_t type; + uint8_t is_reg : 1; + uint16_t imm; + char *raw; + TAILQ_ENTRY(oasm_token) link; +}; + +int lex_tok(struct oasm_state *state, struct oasm_token *ttp); + + +/* + * Check if a token is an X<n> register. + * Returns true on match. + */ +__always_inline static inline bool +tok_is_xreg(tt_t tok) +{ + switch (tok) { + case TT_X0: + case TT_X1: + case TT_X2: + case TT_X3: + case TT_X4: + case TT_X5: + case TT_X6: + case TT_X7: + case TT_X8: + case TT_X9: + case TT_X10: + case TT_X11: + case TT_X12: + case TT_X13: + case TT_X14: + case TT_X15: + return true; + } + + return false; +} + +/* + * Check if a token is of an MRO type + * instruction. Returns true on match. + */ +__always_inline static inline bool +tok_is_mro(tt_t tok) +{ + switch (tok) { + case TT_MROB: + case TT_MROW: + case TT_MROD: + case TT_MROQ: + return true; + } + + return false; +} + +#endif /* !_OASM_LEX_H_ */ diff --git a/usr.bin/oasm/include/oasm/log.h b/usr.bin/oasm/include/oasm/log.h new file mode 100644 index 0000000..330c273 --- /dev/null +++ b/usr.bin/oasm/include/oasm/log.h @@ -0,0 +1,48 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _OASM_LOG_H_ +#define _OASM_LOG_H_ + +#include <sys/types.h> +#include <sys/cdefs.h> +#include <stdio.h> + +#define ERROR_COLOR "\033[31;40m" +#define WARN_COLOR "\033[35;40m" + +void __oasm_debug(const char *fmt, ...); +void __oasm_err(const char *fmt, ...); +void __oasm_warn(const char *fmt, ...); + +#define oasm_debug(...) __oasm_debug(__VA_ARGS__) +#define oasm_err(...) __oasm_err(__VA_ARGS__) +#define oasm_warn(...) __oasm_warn(__VA_ARGS__) + +#endif /* !_OASM_LOG_H_ */ diff --git a/usr.bin/oasm/include/oasm/parse.h b/usr.bin/oasm/include/oasm/parse.h new file mode 100644 index 0000000..04962e7 --- /dev/null +++ b/usr.bin/oasm/include/oasm/parse.h @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _OASM_PARSE_H_ +#define _OASM_PARSE_H_ + +#include <oasm/state.h> + +void parse_enter(struct oasm_state *state); + +#endif /* !_OASM_PARSE_H_ */ diff --git a/usr.bin/oasm/include/oasm/state.h b/usr.bin/oasm/include/oasm/state.h new file mode 100644 index 0000000..6dd2435 --- /dev/null +++ b/usr.bin/oasm/include/oasm/state.h @@ -0,0 +1,59 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _OASM_STATE_H_ +#define _OASM_STATE_H_ + +#include <sys/types.h> +#include <fcntl.h> +#include <unistd.h> +#include <oasm/lex.h> + +/* + * OASM state: + * + * @filename: Filname of unit we are parsing + * @pip: Pseudo instruction pointer + * @label_ip: IP at current label start + * @in_fd: Input file descriptor + * @out_fd: Resulting binary output file descriptor + * @line: Current line number + * @last: Last token + */ +struct oasm_state { + char *filename; + off_t pip; + off_t label_ip; + int in_fd; + int out_fd; + off_t line; + tt_t last; +}; + +#endif /* !_OASM_STATE_H_ */ diff --git a/usr.bin/oasm/label.c b/usr.bin/oasm/label.c new file mode 100644 index 0000000..2647bb9 --- /dev/null +++ b/usr.bin/oasm/label.c @@ -0,0 +1,166 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/errno.h> +#include <sys/queue.h> +#include <oasm/label.h> +#include <oasm/log.h> +#include <stdlib.h> +#include <string.h> +#include <stddef.h> +#include <stdbool.h> + +static struct oasm_label *labels[MAX_LABELS]; +static size_t label_count = 0; + +static uint32_t +fnv1_hash(const char *s) +{ + uint32_t hash = 2166136261UL; + const uint8_t *p = (uint8_t *)s; + + while (*p != '\0') { + hash ^= *p; + hash = hash * 0x01000193; + ++p; + } + + return hash; +} + +/* + * The label table is a big hashmap containing + * label entries. This function creates and add + * a new label into the table. + * + * @name: Name of the label (e.g., _start) + * @ip: Instruction pointer + */ +int +label_enter(const char *name, uintptr_t ip) +{ + uint32_t hash = fnv1_hash(name); + uint32_t idx = hash % MAX_LABELS; + struct oasm_label *lp, *lp_new; + + if (label_count >= MAX_LABELS) { + oasm_err("[internal error]: too many labels\n"); + return -EIO; + } + + lp_new = malloc(sizeof(*lp_new)); + if (lp_new == NULL) { + oasm_err("[internal error]: out of memory\n"); + return -ENOMEM; + } + + /* Initialize the label */ + lp_new->name = strdup(name); + lp_new->ip = ip; + TAILQ_INIT(&lp_new->buckets); + + /* + * If there is no existing entry here, we + * can take this slot. + */ + lp = labels[idx]; + if (lp == NULL) { + labels[idx] = lp_new; + ++label_count; + return 0; + } + + /* + * To prevent collisions in our table here, + * we must check if the name matches at all. + * If it does not, there is a collision and + * we'll have to add this to a bucket. + */ + if (strcmp(name, lp->name) != 0) { + TAILQ_INSERT_TAIL(&lp->buckets, lp_new, link); + ++label_count; + return 0; + } + + /* Can't put the same entry in twice */ + oasm_err("[internal error]: duplicate labels\n"); + return -EEXIST; +} + +/* + * Find a label entry in the label table. + * + * @name: Name of the label to lookup (e.g., _start) + */ +struct oasm_label * +label_lookup(const char *name) +{ + uint32_t hash = fnv1_hash(name); + uint32_t idx = hash % MAX_LABELS; + struct oasm_label *lp, *lp_tmp; + + lp = labels[idx]; + if (lp == NULL) { + return NULL; + } + + /* Is this the label we are looking up? */ + if (strcmp(name, lp->name) == 0) { + return lp; + } + + /* Maybe there was a collision? */ + TAILQ_FOREACH(lp_tmp, &lp->buckets, link) { + if (strcmp(name, lp_tmp->name) == 0) { + return lp_tmp; + } + } + + return NULL; +} + +/* + * Clean up all allocated labels by + * calling free() on each entry of + * the queue. + */ +void +labels_destroy(void) +{ + struct oasm_label *lp; + + for (size_t i = 0; i < MAX_LABELS; ++i) { + lp = labels[i]; + if (lp != NULL) { + free(lp->name); + free(lp); + } + } +} diff --git a/usr.bin/oasm/lex.c b/usr.bin/oasm/lex.c new file mode 100644 index 0000000..1f58d07 --- /dev/null +++ b/usr.bin/oasm/lex.c @@ -0,0 +1,445 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <string.h> +#include <stdlib.h> +#include <oasm/state.h> +#include <oasm/lex.h> +#include <oasm/log.h> + +#define COMMENT '!' +#define is_num(c) ((c) >= '0' && (c) <= '9') + +static char putback = '\0'; + +/* Instruction mnemonic strings */ +#define S_IMN_NOP "nop" +#define S_IMN_MOV "mov" +#define S_IMN_ADD "add" +#define S_IMN_SUB "sub" +#define S_IMN_MUL "mul" +#define S_IMN_DIV "div" +#define S_IMN_INC "inc" +#define S_IMN_DEC "dec" +#define S_IMN_HLT "hlt" +#define S_IMN_BR "br" +#define S_IMN_MROB "mrob" +#define S_IMN_MROW "mrow" +#define S_IMN_MROD "mrod" +#define S_IMN_MROQ "mroq" +#define S_IMN_AND "and" +#define S_IMN_OR "or" +#define S_IMN_XOR "xor" +#define S_IMN_LSL "lsl" +#define S_IMN_LSR "lsr" + +/* Instruction length */ +#define OSMX64_INST_LEN 4 + +/* + * Update the state when the caller encounters + * a newline. + */ +static inline void +lex_newline(struct oasm_state *state) +{ + ++state->line; + state->pip += OSMX64_INST_LEN; +} + +/* + * Returns 0 if a char is counted as a + * skippable token. Otherwise, -1 + */ +static inline int +lex_skippable(struct oasm_state *state, char c) +{ + switch (c) { + case ' ': return 0; + case '\f': return 0; + case '\t': return 0; + case '\r': return 0; + case '\n': + lex_newline(state); + return 0; + } + + return -1; +} + +/* + * For cleaning up allocated sources + * during error conditions + * + * @p: Memory to free + */ +static inline void +lex_try_free(void *p) +{ + if (p != NULL) { + free(p); + } +} + +/* + * Put back a token to grab later + * + * @c: Character to put back + */ +static inline char +lex_putback(char c) +{ + putback = c; + return c; +} + +/* + * Grab a character from the input file + * descriptor. + */ +static char +lex_cin(struct oasm_state *state) +{ + char retval; + + if (putback != '\0') { + retval = putback; + putback = '\0'; + return retval; + } + + if (read(state->in_fd, &retval, 1) <= 0) { + return '\0'; + } + return retval; +} + +/* + * Nom an operation, directive or any kind + * of raw string (unquoted/builtin) and return + * memory allocated by strdup() pointing to the + * string. + * + * @state: OASM state pointer + * @res: Resulting string + * + * Returns 0 on success. Greater than zero + * value of the last character if a comma or + * space was not buffered. + */ +static int +lex_nomstr(struct oasm_state *state, char **res) +{ + char buf[256]; + int retval = 0, n = 0; + int tmp; + + memset(buf, 0, sizeof(buf)); + + /* + * We are filling the buffer containing + * the operation or directive. + * + * Keep going until we hit a space or comman (^) + * Examples of such strings (everything in '[]'): + * + * [mov] [x0], [#1] + * ^ ^ + */ + while ((tmp = lex_cin(state)) != 0) { + if (tmp == ' ' || tmp == ',') { + retval = tmp; + break; + } + if (tmp == ':') { + retval = tmp; + break; + } + if (tmp == '\n') { + ++state->line; + retval = tmp; + break; + + } + + buf[n++] = tmp; + } + + *res = strdup(buf); + return retval; +} + +static tt_t +token_arith(char *p) +{ + if (strcmp(p, S_IMN_MOV) == 0) { + return TT_MOV; + } else if (strcmp(p, S_IMN_INC) == 0) { + return TT_INC; + } else if (strcmp(p, S_IMN_DEC) == 0) { + return TT_DEC; + } else if (strcmp(p, S_IMN_ADD) == 0) { + return TT_ADD; + } else if (strcmp(p, S_IMN_SUB) == 0) { + return TT_SUB; + } else if (strcmp(p, S_IMN_DIV) == 0) { + return TT_DIV; + } else if (strcmp(p, S_IMN_HLT) == 0) { + return TT_HLT; + } else if (strcmp(p, S_IMN_MUL) == 0) { + return TT_MUL; + } else if (strcmp(p, S_IMN_XOR) == 0) { + return TT_XOR; + } + + return TT_UNKNOWN; +} + +/* + * Control flow instructions + */ +static tt_t +token_cfi(char *p) +{ + if (strcmp(p, S_IMN_BR) == 0) { + return TT_BR; + } + + return TT_UNKNOWN; +} + +/* + * Bitwise MRO instructions + */ +static tt_t +token_bitw_mro(char *p) +{ + if (strcmp(p, S_IMN_MROB) == 0) { + return TT_MROB; + } else if (strcmp(p, S_IMN_MROW) == 0) { + return TT_MROW; + } else if (strcmp(p, S_IMN_MROD) == 0) { + return TT_MROD; + } else if (strcmp(p, S_IMN_MROQ) == 0) { + return TT_MROQ; + } else if (strcmp(p, S_IMN_AND) == 0) { + return TT_AND; + } else if (strcmp(p, S_IMN_OR) == 0) { + return TT_OR; + } + + return TT_UNKNOWN; +} + +/* + * Bitwise instructions + */ +static tt_t +token_bitw(char *p) +{ + tt_t token; + + token = token_bitw_mro(p); + if (token != TT_UNKNOWN) { + return token; + } + + if (strcmp(p, S_IMN_LSL) == 0) { + return TT_LSL; + } else if (strcmp(p, S_IMN_LSR) == 0) { + return TT_LSR; + } + + return TT_UNKNOWN; +} + +static tt_t +token_xreg(char *p) +{ + int num; + + if (p[0] != 'x') { + return TT_UNKNOWN; + } + + if (!is_num(p[1])) { + return TT_UNKNOWN; + } + + num = atoi(&p[1]); + switch (num) { + case 0: return TT_X0; + case 1: return TT_X1; + case 2: return TT_X2; + case 3: return TT_X3; + case 4: return TT_X4; + case 5: return TT_X5; + case 6: return TT_X6; + case 7: return TT_X7; + case 8: return TT_X8; + case 9: return TT_X9; + case 10: return TT_X10; + case 11: return TT_X11; + case 12: return TT_X12; + case 13: return TT_X13; + case 14: return TT_X14; + case 15: return TT_X15; + } + + return TT_UNKNOWN; +} + +static tt_t +token_operand(char *p) +{ + /* Is this a numeric constant? */ + if (p[0] == '#') { + return TT_IMM; + } + + return TT_UNKNOWN; +} + +static tt_t +token_reg(char *p) +{ + tt_t tok; + + if ((tok = token_xreg(p)) != TT_UNKNOWN) { + return tok; + } + + return TT_UNKNOWN; +} + +int +lex_tok(struct oasm_state *state, struct oasm_token *ttp) +{ + char *p = NULL; + char c = ' '; + short in_comment = 0; + int tmp; + tt_t tok; + + if (state == NULL || ttp == NULL) { + return -EINVAL; + } + + /* + * Grab characters. If they are skippable or + * comments, don't use them. + */ + while (lex_skippable(state, c) == 0 || in_comment) { + if ((c = lex_cin(state)) == 0) { + return -1; + } + + if (c == COMMENT) { + in_comment = 1; + } else if (c == '\n') { + in_comment = 0; + } + } + + switch (c) { + case '\n': + lex_newline(state); + return 0; + case '\0': + return -1; + case ',': + return TT_COMMA; + default: + ttp->type = TT_UNKNOWN; + ttp->raw = NULL; + + lex_putback(c); + c = lex_nomstr(state, &p); + + while (c == ':') { + ttp->type = TT_LABEL; + ttp->raw = p; + state->label_ip = state->pip; + return 0; + } + + /* No operation? */ + if (strcmp(p, S_IMN_NOP) == 0) { + ttp->type = TT_NOP; + ttp->raw = p; + return 0; + } + + /* Arithmetic operation? */ + if ((tok = token_arith(p)) != TT_UNKNOWN) { + ttp->type = tok; + ttp->raw = p; + return 0; + } + + /* Control flow instruction? */ + if ((tok = token_cfi(p)) != TT_UNKNOWN) { + ttp->type = tok; + ttp->raw = p; + return 0; + } + + /* Register? */ + if ((tok = token_reg(p)) != TT_UNKNOWN) { + ttp->is_reg = 1; + ttp->type = tok; + ttp->raw = p; + return 0; + } + + if ((tok = token_bitw(p)) != TT_UNKNOWN) { + ttp->type = tok; + ttp->raw = p; + return 0; + } + + /* Immediate operand? */ + if ((tok = token_operand(p)) != TT_UNKNOWN) { + if (tok == TT_IMM) { + ttp->imm = atoi(&p[1]); + } + + ttp->type = tok; + ttp->raw = p; + return 0; + } + + oasm_err("bad token \"%s\"\n", p); + lex_try_free(p); + return -1; + } + + return 0; +} diff --git a/usr.bin/oasm/log.c b/usr.bin/oasm/log.c new file mode 100644 index 0000000..c408865 --- /dev/null +++ b/usr.bin/oasm/log.c @@ -0,0 +1,81 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <oasm/log.h> +#include <oasm/state.h> +#include <stdarg.h> +#include <stdio.h> + +/* TODO FIXME: Use stdarg.h */ +#define __va_start(ap, fmt) __builtin_va_start(ap, fmt) +#define __va_end(ap) __builtin_va_end(ap) + +extern struct oasm_state g_state; + +void +oasm_debug(const char *fmt, ...) +{ + char buf[512]; + va_list ap; + int ret; + + __va_start(ap, fmt); + ret = vsnprintf(buf, sizeof(buf), fmt, ap); + printf("[debug]: %s\033[0m", buf); + printf("\033[0m"); + __va_end(ap); +} + +void +oasm_err(const char *fmt, ...) +{ + char buf[512]; + va_list ap; + int ret; + + __va_start(ap, fmt); + ret = vsnprintf(buf, sizeof(buf), fmt, ap); + printf(ERROR_COLOR "error: %s\033[0m", buf); + printf("%s: line %d\n", g_state.filename, g_state.line); + __va_end(ap); +} + +void +oasm_warn(const char *fmt, ...) +{ + char buf[512]; + va_list ap; + int ret; + + __va_start(ap, fmt); + ret = vsnprintf(buf, sizeof(buf), fmt, ap); + printf(WARN_COLOR "warning: %s\033[0m", buf); + printf("line %d\n", g_state.filename, g_state.line); + __va_end(ap); +} diff --git a/usr.bin/oasm/oasm.c b/usr.bin/oasm/oasm.c new file mode 100644 index 0000000..6c37778 --- /dev/null +++ b/usr.bin/oasm/oasm.c @@ -0,0 +1,73 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> +#include <fcntl.h> +#include <unistd.h> +#include <oasm/state.h> +#include <oasm/parse.h> +#define OASM_DBG +#include <oasm/log.h> + +struct oasm_state g_state; + +static void +oasm_start(struct oasm_state *state) +{ + state->line = 1; + parse_enter(state); +} + +int +main(int argc, char **argv) +{ + if (argc < 3) { + printf("oasm: usage: oasm <file> <output>\n"); + return -1; + } + + g_state.in_fd = open(argv[1], O_RDONLY); + if (g_state.in_fd < 0) { + printf("could not open \"%s\"\n", argv[1]); + return -1; + } + + g_state.out_fd = open(argv[2], O_CREAT | O_WRONLY); + if (g_state.out_fd < 0) { + printf("could not open output \"%s\"\n", argv[2]); + close(g_state.in_fd); + return -1; + } + + g_state.filename = argv[1]; + oasm_start(&g_state); + close(g_state.in_fd); + close(g_state.out_fd); + return 0; +} diff --git a/usr.bin/oasm/parse.c b/usr.bin/oasm/parse.c new file mode 100644 index 0000000..042cce8 --- /dev/null +++ b/usr.bin/oasm/parse.c @@ -0,0 +1,285 @@ +/* Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdint.h> +#include <stddef.h> +#include <stdlib.h> +#include <oasm/emit.h> +#include <oasm/state.h> +#include <oasm/lex.h> +#include <oasm/parse.h> +#include <oasm/log.h> +#include <oasm/label.h> + +static struct emit_state emit_state; +static const char *tokstr[] = { + [ TT_UNKNOWN] = "bad", + [ TT_NOP ] = "nop", + [ TT_ADD ] = "add", + [ TT_SUB ] = "sub", + [ TT_MUL ] = "mul", + [ TT_DIV ] = "div", + [ TT_HLT ] = "hlt", + [ TT_BR ] = "br", + [ TT_COMMA ] = ",", + [ TT_INC ] = "inc", + [ TT_DEC ] = "dec", + [ TT_MOV ] = "mov", + [ TT_IMM ] = "<imm>", + [ TT_LABEL ] = "<label>", + [ TT_LSR ] = "lsr", + [ TT_LSL ] = "lsl", + + /* Bitwise */ + [ TT_MROB ] = "mrob", + [ TT_MROW ] = "mrow", + [ TT_MROD ] = "mrod", + [ TT_MROQ ] = "mroq", + [ TT_AND ] = "and", + [ TT_OR ] = "or", + [ TT_XOR ] = "xor", + + /* X<n> registers */ + [ TT_X0 ] = "x0", + [ TT_X1 ] = "x1", + [ TT_X2 ] = "x2", + [ TT_X3 ] = "x3", + [ TT_X4 ] = "x4", + [ TT_X5 ] = "x5", + [ TT_X6 ] = "x6", + [ TT_X7 ] = "x7", + [ TT_X8 ] = "x8", + [ TT_X9 ] = "x9", + [ TT_X10 ] = "x10", + [ TT_X11 ] = "x11", + [ TT_X12 ] = "x12", + [ TT_X13 ] = "x13", + [ TT_X14 ] = "x14", + [ TT_X15 ] = "x15", + + /* V<n> registers */ + [ TT_F0 ] = "v0", + [ TT_F1 ] = "v1", + [ TT_F2 ] = "v2", + [ TT_F3 ] = "v3", + [ TT_F4 ] = "v4", + [ TT_F5 ] = "v5", + [ TT_F6 ] = "v6", + [ TT_F7 ] = "v7", + + /* D<n> registers */ + [ TT_D0 ] = "d0", + [ TT_D1 ] = "d1", + [ TT_D2 ] = "d2", + [ TT_D3 ] = "d3", + [ TT_D4 ] = "d4", + [ TT_D5 ] = "d5", + [ TT_D6 ] = "d6", + [ TT_D7 ] = "d7", + + /* V<n> registers */ + [ TT_V0 ] = "v0", + [ TT_V1 ] = "v1", + [ TT_V2 ] = "v2", + [ TT_V3 ] = "v3", + [ TT_V4 ] = "v4", + [ TT_V5 ] = "v5", + [ TT_V6 ] = "v6", + [ TT_V7 ] = "v7", +}; + +static int +parse_reg(struct oasm_state *state, struct oasm_token *tok) +{ + const char *p; + + /* Valid instructions that go with regs */ + switch (state->last) { + case TT_MOV: + case TT_DEC: + case TT_INC: + case TT_ADD: + case TT_SUB: + case TT_MUL: + case TT_DIV: + case TT_BR: + case TT_AND: + case TT_OR: + case TT_XOR: + case TT_LSR: + case TT_LSL: + state->last = tok->type; + break; + default: + if (tok_is_mro(state->last)) { + break; + } + + p = tokstr[state->last]; + oasm_err("bad token '%s' for regop\n", p); + return -1; + } + + if (!tok_is_xreg(tok->type)) { + p = tokstr[tok->type]; + oasm_err("bad register \"%s\"\n", p); + return -1; + } + + state->last = tok->type; + emit_osmx64(&emit_state, tok); + return 0; +} + +static int +parse_tok(struct oasm_state *state, struct oasm_token *tok) +{ + const char *p; + int error; + + switch (tok->type) { + case TT_NOP: + state->last = tok->type; + emit_osmx64(&emit_state, tok); + break; + case TT_BR: + state->last = tok->type; + emit_osmx64(&emit_state, tok); + break; + case TT_LABEL: + state->last = tok->type; + label_enter(tok->raw, state->pip); + break; + case TT_AND: + state->last = tok->type; + emit_osmx64(&emit_state, tok); + break; + case TT_OR: + state->last = tok->type; + emit_osmx64(&emit_state, tok); + break; + case TT_XOR: + state->last = tok->type; + emit_osmx64(&emit_state, tok); + break; + case TT_HLT: + state->last = tok->type; + emit_osmx64(&emit_state, tok); + break; + case TT_MUL: + state->last = tok->type; + emit_osmx64(&emit_state, tok); + break; + case TT_DIV: + state->last = tok->type; + emit_osmx64(&emit_state, tok); + break; + case TT_LSR: + state->last = tok->type; + emit_osmx64(&emit_state, tok); + break; + case TT_LSL: + state->last = tok->type; + emit_osmx64(&emit_state, tok); + break; + case TT_MOV: + state->last = tok->type; + emit_osmx64(&emit_state, tok); + break; + case TT_ADD: + state->last = tok->type; + emit_osmx64(&emit_state, tok); + break; + case TT_SUB: + state->last = tok->type; + emit_osmx64(&emit_state, tok); + break; + case TT_DEC: + case TT_INC: + state->last = tok->type; + emit_osmx64(&emit_state, tok); + break; + case TT_IMM: + p = tokstr[state->last]; + if (!tok_is_xreg(state->last)) { + oasm_err("expected X<n> but got %s\n", p); + return -1; + } + emit_osmx64(&emit_state, tok); + break; + default: + if (tok_is_mro(tok->type)) { + state->last = tok->type; + emit_osmx64(&emit_state, tok); + return 0; + } + + if (!tok->is_reg) { + oasm_err("syntax error\n"); + return -1; + } + + error = parse_reg(state, tok); + if (error < 0) { + return error; + } + break; + } + + return 0; +} + +void +parse_enter(struct oasm_state *state) +{ + struct oasm_token tok; + const char *type, *raw; + int error = 0; + + emit_init(&emit_state); + + for (;;) { + error = lex_tok(state, &tok); + if (error < 0) { + break; + } + + if (parse_tok(state, &tok) < 0) { + break; + } + + type = tokstr[tok.type]; + raw = tok.raw; + oasm_debug("got token type %s (%s)\n", type, raw); + } + + /* Process then destroy the emit state */ + emit_process(state, &emit_state); + emit_destroy(&emit_state); + labels_destroy(); +} diff --git a/usr.bin/oemu/Makefile b/usr.bin/oemu/Makefile new file mode 100644 index 0000000..366208c --- /dev/null +++ b/usr.bin/oemu/Makefile @@ -0,0 +1,7 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") +CFLAGS = -Iinclude/ + +$(ROOT)/base/usr/bin/oemu: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) $(CFLAGS) diff --git a/usr.bin/oemu/cpu.c b/usr.bin/oemu/cpu.c new file mode 100644 index 0000000..de8b465 --- /dev/null +++ b/usr.bin/oemu/cpu.c @@ -0,0 +1,523 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <sys/param.h> +#include <stdlib.h> +#include <string.h> +#include <stdio.h> +#include <stdbool.h> +#include <oemu/cpu.h> +#include <oemu/types.h> +#include <oemu/osmx64.h> + +/* + * Return true if the instruction is an + * MRO type instruction. + */ +static bool +cpu_is_mro(inst_t *inst) +{ + switch (inst->opcode) { + case INST_MROB: + case INST_MROW: + case INST_MROD: + case INST_MROQ: + return true; + } + + return false; +} + +/* + * Decode the INST_MOV_IMM instruction + * + * @cpu: CPU that is executing + * @inst: Instruction dword + */ +static void +cpu_mov_imm(struct oemu_cpu *cpu, inst_t *inst) +{ + struct cpu_regs *regs = &cpu->regs; + + if (inst->rd > NELEM(regs->xreg)) { + printf("bad register operand for 'mov'\n"); + return; + } + + regs->xreg[inst->rd] = inst->imm; + printf("#%d -> x%d\n", inst->imm, inst->rd); +} + +/* + * Decode the INST_INC instruction + * + * @cpu: CPU that is executing + * @inst: Instruction dword + */ +static void +cpu_inc(struct oemu_cpu *cpu, inst_t *inst) +{ + struct cpu_regs *regs = &cpu->regs; + imm_t imm; + + if (inst->rd > NELEM(regs->xreg)) { + printf("bad register operand for 'mov'\n"); + return; + } + + imm = regs->xreg[inst->rd]++; + printf("INC X%d [%x], new=%x\n", inst->rd, + imm, regs->xreg[inst->rd]); +} + +/* + * Decode the INST_DEC instruction + * + * @cpu: CPU that is executing + * @inst: Instruction dword + */ +static void +cpu_dec(struct oemu_cpu *cpu, inst_t *inst) +{ + struct cpu_regs *regs = &cpu->regs; + imm_t imm; + + if (inst->rd > NELEM(regs->xreg)) { + printf("bad register operand for 'mov'\n"); + return; + } + + imm = regs->xreg[inst->rd]--; + printf("DEC X%d [%x], new=%x\n", inst->rd, + imm, regs->xreg[inst->rd]); +} + +/* + * Decode the INST_ADD instruction + * + * @cpu: CPU that is executing + * @inst: Instruction dword + */ +static void +cpu_add(struct oemu_cpu *cpu, inst_t *inst) +{ + struct cpu_regs *regs = &cpu->regs; + imm_t imm; + + if (inst->rd > NELEM(regs->xreg)) { + printf("bad register operand for 'add'\n"); + return; + } + + imm = regs->xreg[inst->rd]; + regs->xreg[inst->rd] += inst->imm; + printf("%d + %d -> X%d, new=%d\n", + imm, inst->imm, inst->rd, regs->xreg[inst->rd]); +} + +/* + * Decode the INST_SUB instruction + * + * @cpu: CPU that is executing + * @inst: Instruction dword + */ +static void +cpu_sub(struct oemu_cpu *cpu, inst_t *inst) +{ + struct cpu_regs *regs = &cpu->regs; + imm_t imm; + + if (inst->rd > NELEM(regs->xreg)) { + printf("bad register operand for 'sub'\n"); + return; + } + + imm = regs->xreg[inst->rd]; + regs->xreg[inst->rd] -= inst->imm; + printf("%d - %d -> X%d, new=%d\n", + imm, inst->imm, inst->rd, regs->xreg[inst->rd]); +} + +/* + * Decode the INST_MUL instruction + * + * @cpu: CPU that is executing + * @inst: Instruction dword + */ +static void +cpu_mul(struct oemu_cpu *cpu, inst_t *inst) +{ + struct cpu_regs *regs = &cpu->regs; + imm_t imm; + + if (inst->rd > NELEM(regs->xreg)) { + printf("bad register operand for 'mul'\n"); + return; + } + + imm = regs->xreg[inst->rd]; + regs->xreg[inst->rd] *= inst->imm; + printf("%d * %d -> X%d, new=%d\n", + imm, inst->imm, inst->rd, regs->xreg[inst->rd]); +} +static void +cpu_and(struct oemu_cpu *cpu, inst_t *inst) +{ + struct cpu_regs *regs = &cpu->regs; + imm_t imm; + + if (inst->rd > NELEM(regs->xreg)) { + printf("bad register operand for 'and'\n"); + return; + } + + imm = inst->imm; + regs->xreg[inst->rd] &= inst->imm; + printf("X%d & %x -> X%d, new=%d\n", + inst->rd, inst->imm, inst->rd, regs->xreg[inst->rd]); +} + +static void +cpu_or(struct oemu_cpu *cpu, inst_t *inst) +{ + struct cpu_regs *regs = &cpu->regs; + imm_t imm; + + if (inst->rd > NELEM(regs->xreg)) { + printf("bad register operand for 'or'\n"); + return; + } + + imm = inst->imm; + regs->xreg[inst->rd] |= imm; + printf("X%d | %x -> X%d, new=%d\n", + inst->rd, inst->imm, inst->rd, regs->xreg[inst->rd]); +} + +static void +cpu_xor(struct oemu_cpu *cpu, inst_t *inst) +{ + struct cpu_regs *regs = &cpu->regs; + imm_t imm; + + if (inst->rd > NELEM(regs->xreg)) { + printf("bad register operand for 'xor'\n"); + return; + } + + imm = inst->imm; + regs->xreg[inst->rd] ^= imm; + printf("X%d ^ %x -> X%d, new=%d\n", + inst->rd, inst->imm, inst->rd, regs->xreg[inst->rd]); +} + +/* + * Decode the INST_DIV instruction + * + * @cpu: CPU that is executing + * @inst: Instruction dword + */ +static void +cpu_div(struct oemu_cpu *cpu, inst_t *inst) +{ + struct cpu_regs *regs = &cpu->regs; + imm_t imm; + + if (inst->rd > NELEM(regs->xreg)) { + printf("bad register operand for 'div'\n"); + return; + } + + imm = regs->xreg[inst->rd]; + if (imm == 0) { + /* TODO: Some sort of interrupt */ + printf("** DIVIDE BY ZERO **\n"); + return; + } + + regs->xreg[inst->rd] /= inst->imm; + printf("%d / %d -> X%d, new=%d\n", + imm, inst->imm, inst->rd, regs->xreg[inst->rd]); +} + +/* + * Decode the INST_DIV instruction + */ +static void +cpu_br(struct oemu_cpu *cpu, inst_t *inst) +{ + struct cpu_regs *regs = &cpu->regs; + imm_t imm; + addr_t br_to; + + if (inst->rd > NELEM(regs->xreg)) { + printf("bad register operand for 'br'\n"); + return; + } + + /* + * If we are branching to the reset vector, might + * as well reset all state. + */ + br_to = regs->xreg[inst->rd]; + if (br_to == 0) { + cpu_reset(cpu); + } + + regs->ip = br_to; +} + +/* + * Decode a logical shift instruction: + * + * LSR r, r/imm + * LSL r, r/imm + */ +static void +cpu_lshift(struct oemu_cpu *cpu, inst_t *inst) +{ + struct cpu_regs *regs = &cpu->regs; + reg_t reg = inst->rd; + imm_t shift = inst->imm; + + switch (inst->opcode) { + case INST_LSR: + regs->xreg[reg] >>= shift; + printf("X%d >> %d -> %d\n", reg, shift, regs->xreg[reg]); + break; + case INST_LSL: + regs->xreg[reg] <<= shift; + printf("X%d << %d -> %d\n", reg, shift, regs->xreg[reg]); + break; + } +} + +/* + * Decode MRO type instructions + */ +static void +cpu_mro(struct oemu_cpu *cpu, inst_t *inst) +{ + inst_t *next_inst; + struct cpu_regs *regs = &cpu->regs; + char *inst_str = "bad"; + uint64_t mask = 0; + bool set_mask = false; + imm_t imm; + + switch (inst->imm) { + case 0: break; + case 1: + set_mask = true; + break; + default: + imm = inst->imm & 1; + if (inst->imm == 1) { + set_mask = true; + } + break; + } + + switch (inst->opcode) { + case INST_MROB: + inst_str = "mrob"; + if (!set_mask) { + break; + } + mask |= MASK(8); + break; + case INST_MROW: + inst_str = "mrow"; + if (!set_mask) { + break; + } + mask |= MASK(16); + break; + case INST_MROD: + inst_str = "mrod"; + if (!set_mask) { + break; + } + mask |= MASK(32); + break; + case INST_MROQ: + inst_str = "mroq"; + if (!set_mask) { + break; + } + mask |= __UINT64_MAX; + break; + } + + if (inst->rd > NELEM(regs->xreg)) { + printf("bad register operand for '%s'\n", inst_str); + return; + } + + if (set_mask) { + imm = regs->xreg[inst->rd] |= mask; + printf("set %x->x%d, new=%x\n", mask, inst->rd, imm); + } else { + imm = regs->xreg[inst->rd] &= ~mask; + printf("cleared %x->x%d, new=%x\n", mask, inst->rd, imm); + } +} + +/* + * Reset a CPU to a default state + */ +void +cpu_reset(struct oemu_cpu *cpu) +{ + struct cpu_regs *regs; + + /* + * When an OSMX64 processor first starts up, it will + * initially be executing in supervisor mode with all + * of its registeres initialized to zeros. + */ + regs = &cpu->regs; + regs->ip = 0; + regs->sr_state = CPU_SRS_SV; + regs->blr = 0x0; + regs->ilr = 0x0; + memset(regs->xreg, 0x0, sizeof(regs->xreg)); +} +void +cpu_regdump(struct oemu_cpu *cpu) +{ + struct cpu_regs *regs; + + regs = &cpu->regs; + printf( + "X0=%p, X1=%p, X2=%p\n" + "X3=%p, X4=%p, X5=%p\n" + "X6=%p, X7=%p, X8=%p\n" + "X9=%p, X10=%p, X11=%p\n" + "X12=%p, X13=%p, X14=%p\n" + "X15=%p, IP=%p, SRS=%p\n" + "BLR=%p, ILR=%p\n", + regs->xreg[0], regs->xreg[1], + regs->xreg[2], regs->xreg[3], + regs->xreg[4], regs->xreg[5], + regs->xreg[6], regs->xreg[7], + regs->xreg[8], regs->xreg[9], + regs->xreg[10], regs->xreg[11], + regs->xreg[12], regs->xreg[13], + regs->xreg[14], regs->xreg[15], + regs->ip, regs->sr_state, + regs->blr, regs->ilr + ); +} + +/* + * Main instruction execution loop. + */ +void +cpu_kick(struct oemu_cpu *cpu, struct sysmem *mem) +{ + struct cpu_regs *regs = &cpu->regs; + inst_t *inst; + uint8_t *memp = mem->mem; + + for (;;) { + inst = (inst_t *)&memp[regs->ip]; + + switch (inst->opcode) { + case INST_NOP: + /* NOP */ + regs->ip += sizeof(*inst); + continue; + case INST_MOV_IMM: + cpu_mov_imm(cpu, inst); + break; + case INST_INC: + cpu_inc(cpu, inst); + break; + case INST_DEC: + cpu_dec(cpu, inst); + break; + case INST_ADD: + cpu_add(cpu, inst); + break; + case INST_SUB: + cpu_sub(cpu, inst); + break; + case INST_MUL: + cpu_mul(cpu, inst); + break; + case INST_DIV: + cpu_div(cpu, inst); + break; + case INST_AND: + cpu_and(cpu, inst); + break; + case INST_OR: + cpu_or(cpu, inst); + break; + case INST_XOR: + cpu_xor(cpu, inst); + break; + case INST_BR: + cpu_br(cpu, inst); + break; + case INST_LSL: + case INST_LSR: + cpu_lshift(cpu, inst); + break; + default: + if (cpu_is_mro(inst)) { + cpu_mro(cpu, inst); + } + break; + } + + /* + * X0 is readonly and should always be zero, undo + * any writes or side effects from any operations + * upon this register. + */ + regs->xreg[0] = 0; + + /* Is this a halt instruction? */ + if (inst->opcode == INST_HLT) { + printf("HALTED\n"); + break; + } + + if (regs->ip >= MEMORY_SIZE) { + break; + } + + regs->ip += sizeof(*inst); + } + + cpu_regdump(cpu); +} diff --git a/usr.bin/oemu/emu.c b/usr.bin/oemu/emu.c new file mode 100644 index 0000000..1b4280b --- /dev/null +++ b/usr.bin/oemu/emu.c @@ -0,0 +1,127 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/errno.h> +#include <stdio.h> +#include <fcntl.h> +#include <unistd.h> +#include <stdlib.h> +#include <stdio.h> +#include <oemu/cpu.h> + +static struct oemu_cpu core_0; +struct sysmem g_mem; + +static void +help(void) +{ + printf( + "OSMORA OSMX64 Emulator\n" + "usage: oemu <binary file>\n" + ); +} + +/* + * Allocate and initialize platform + * memory. + */ +static int +mem_init(void) +{ + printf("allocating 0x%x bytes of memory\n", MEMORY_SIZE); + g_mem.mem_size = MEMORY_SIZE; + g_mem.mem = malloc(MEMORY_SIZE); + if (g_mem.mem == NULL) { + printf("failed to allocate memory\n"); + return -1; + } +} + +/* + * Load a program specified by a path into + * memory for execution. + */ +static int +program_load(const char *path, paddr_t loadoff) +{ + void *mem = g_mem.mem; + size_t size; + int fd; + + fd = open(path, O_RDONLY); + if (fd < 0) { + printf("failed to open \"%s\"\n", path); + return -ENOENT; + } + + /* Grab the size of the file */ + size = lseek(fd, 0, SEEK_END); + lseek(fd, loadoff, SEEK_SET); + printf("loading size %d\n", size); + + /* Is it too big? */ + if (size >= g_mem.mem_size) { + printf("program too big !! (memsize=%x)\n", g_mem.mem_size); + close(fd); + return -1; + } + + printf("read data into %p\n", mem); + printf("read %d bytes\n", read(fd, mem, size)); + close(fd); + return 0; +} + +int +main(int argc, char **argv) +{ + if (argc < 2) { + help(); + return -1; + } + + /* Initialize memory */ + if (mem_init() < 0) { + return -1; + } + + /* Put the CPU in a known state */ + cpu_reset(&core_0); + + /* + * Load the program and send the little guy off + * to start nomming those 32-bit instructions + */ + if (program_load(argv[1], 0x00000000) < 0) { + return -1; + } + cpu_kick(&core_0, &g_mem); + free(g_mem.mem); + return 0; +} diff --git a/usr.bin/oemu/include/oemu/cpu.h b/usr.bin/oemu/include/oemu/cpu.h new file mode 100644 index 0000000..882fe93 --- /dev/null +++ b/usr.bin/oemu/include/oemu/cpu.h @@ -0,0 +1,83 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _OEMU_CPU_H_ +#define _OEMU_CPU_H_ + +#include <sys/types.h> +#include <sys/param.h> +#include <stdint.h> +#include <stddef.h> +#include <oemu/types.h> + +#define MEMORY_SIZE 512 + +/* + * Processor state register + */ +#define CPU_SRS_SV BIT(1) /* Supervisor flag */ +#define CPU_SRS_CARRY BIT(2) /* Carry flag */ + +/* + * System memory + * + * @mem: Data + * @mem_size: Memory size max + */ +struct sysmem { + void *mem; + size_t mem_size; +}; + +/* + * CPU register state + * + * @xreg: X<n> + * @ip: Instruction pointer + * @sr_state: Processor state register + * @blr: Branch link register + * @ilr: Interrupt link register + */ +struct cpu_regs { + reg_t xreg[16]; + reg_t ip; + reg_t sr_state; + reg_t blr; + reg_t ilr; +}; + +struct oemu_cpu { + struct cpu_regs regs; +}; + +void cpu_regdump(struct oemu_cpu *cpu); +void cpu_reset(struct oemu_cpu *cpu); +void cpu_kick(struct oemu_cpu *cpu, struct sysmem *mem); + +#endif /* !_OEMU_CPU_H_ */ diff --git a/usr.bin/oemu/include/oemu/osmx64.h b/usr.bin/oemu/include/oemu/osmx64.h new file mode 100644 index 0000000..1e094d0 --- /dev/null +++ b/usr.bin/oemu/include/oemu/osmx64.h @@ -0,0 +1,90 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _OEMU_OSMX64_H_ +#define _OEMU_OSMX64_H_ + +#include <stdint.h> + +/* Opcodes */ +#define INST_NOP 0x00 /* No-operation */ +#define INST_ADD 0x01 /* Add operation */ +#define INST_SUB 0x02 /* Sub operation */ +#define INST_MUL 0x03 /* Multiply operation */ +#define INST_DIV 0x04 /* Divide operation */ +#define INST_INC 0x05 /* Increment operation */ +#define INST_DEC 0x06 /* Decrement operation */ +#define INST_OR 0x07 /* Bitwise OR operation */ +#define INST_XOR 0x08 /* Bitwise XOR operation */ +#define INST_AND 0x09 /* Bitwise AND operation */ +#define INST_NOT 0x0A /* Bitwise NOT operation */ +#define INST_SLL 0x0B /* Shift left logical operation */ +#define INST_SRL 0x0C /* Shift right logical operation */ +#define INST_MOV_IMM 0x0D /* Data move operation from IMM */ +#define INST_HLT 0x0E /* Halt */ +#define INST_BR 0x0F /* Branch */ +#define INST_MROB 0x10 /* Mask register over byte */ +#define INST_MROW 0x11 /* Mask register over word */ +#define INST_MROD 0x12 /* Mask register over dword */ +#define INST_MROQ 0x13 /* Mask register over qword */ +#define INST_LSR 0x14 /* Logical shift right */ +#define INST_LSL 0x15 /* Logical shift left */ + +/* Registers */ +#define REG_X0 0x00 +#define REG_X1 0x01 +#define REG_X2 0x02 +#define REG_X3 0x03 +#define REG_X4 0x04 +#define REG_X5 0x05 +#define REG_X6 0x06 +#define REG_X7 0x07 +#define REG_X8 0x08 +#define REG_X9 0x09 +#define REG_X10 0x0A +#define REG_X11 0x0B +#define REG_X12 0x0C +#define REG_X13 0x0D +#define REG_X14 0x0E +#define REG_X15 0x0F +#define REG_BAD 0xFF + +/* + * OSMX64 instruction format + */ +typedef struct { + uint8_t opcode; + uint8_t rd; + union { + uint16_t imm; + uint16_t unused; + }; +} inst_t; + +#endif /* !_OEMU_OSMX64_H_ */ diff --git a/usr.bin/oemu/include/oemu/types.h b/usr.bin/oemu/include/oemu/types.h new file mode 100644 index 0000000..caf6e9b --- /dev/null +++ b/usr.bin/oemu/include/oemu/types.h @@ -0,0 +1,40 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef _OEMU_TYPES_H_ +#define _OEMU_TYPES_H_ + +#include <sys/types.h> + +typedef uint64_t reg_t; +typedef uintptr_t addr_t; +typedef uint16_t imm_t; +typedef addr_t paddr_t; + +#endif /* !_OEMU_TYPES_H_ */ diff --git a/usr.bin/osh/osh.c b/usr.bin/osh/osh.c index c45d9c8..71ca6de 100644 --- a/usr.bin/osh/osh.c +++ b/usr.bin/osh/osh.c @@ -29,78 +29,131 @@ #include <sys/types.h> #include <sys/cdefs.h> -#include <sys/reboot.h> +#include <sys/errno.h> +#include <sys/spawn.h> +#include <sys/wait.h> #include <fcntl.h> #include <stddef.h> +#include <stdbool.h> #include <unistd.h> #include <string.h> +#include <stdio.h> -#define prcons(FD, STR) write((FD), (STR), strlen((STR))) +#define is_printable(C) ((C) >= 32 && (C) <= 126) #define is_ascii(C) ((C) >= 0 && (C) <= 128) + +#define INPUT_SIZE 64 + +#define REPEAT "!!" +#define COMMENT '@' #define WELCOME \ ":::::::::::::::::::::::::::::::::::::::\n" \ ":: OSMORA GATEWAY ~ Every key echos ::\n" \ ":: ..... Proceed with purpose ..... ::\n" \ - ":::::::::::::::::::::::::::::::::::::::\n" + ":::::::::::::::::::::::::::::::::::::::" #define HELP \ "Default commands:\n" \ "help - Display this help message\n" \ "echo - Print the arguments to the console\n" \ "reboot - Reboot the machine\n" \ - "shutdown - Power off the machine\n" \ - "exit - Exit the shell\n" - -#define PROMPT "[root::osmora]~ " - -static char buf[64]; -static uint8_t i; + "kmsg - Print kernel message buffer\n" \ + "fetch - System information\n" \ + "kfg - Start up kfgwm\n" \ + "bell - Toggle backspace bell\n" \ + "date - Get the current date\n" \ + "clear - Clear the screen\n" \ + "exit - Exit the shell" + +#define PROMPT "[%s::%s]~ " + +static char last_command[INPUT_SIZE]; +static char buf[INPUT_SIZE]; static int running; +static int bell_fd; +static bool bs_bell = true; /* Beep on backspace */ -struct command { +static void cmd_help(int argc, char *argv[]); +static void cmd_echo(int argc, char *argv[]); +static void cmd_exit(int argc, char *argv[]); +static void cmd_bell(int argc, char *argv[]); +static void cmd_clear(int argc, char *argv[]); + +struct builtin_cmd { const char *name; - void (*func)(int fd, int argc, char *argv[]); + void (*func)(int argc, char *argv[]); }; -void -cmd_help(int fd, int argc, char *argv[]) +/* + * Results after parsing a command + * + * @bg: Run command in background + */ +struct parse_state { + uint8_t bg : 1; +}; + +static struct builtin_cmd cmds[] = { + {"help",cmd_help}, + {"exit",cmd_exit}, + {"bell", cmd_bell}, + {"clear", cmd_clear}, + {NULL, NULL} +}; + +static void +cmd_help(int argc, char *argv[]) { - prcons(fd, HELP); + puts(HELP); } -void -cmd_exit(int fd, int argc, char *argv[]) +static void +cmd_exit(int argc, char *argv[]) { running = 0; } -void -cmd_reboot(int fd, int argc, char *argv[]) +static void +cmd_clear(int argc, char *argv[]) { - cpu_reboot(REBOOT_RESET); + fputs("\033[2J", stdout); } -void -cmd_shutdown(int fd, int argc, char *argv[]) +static void +cmd_bell(int argc, char *argv[]) { - cpu_reboot(REBOOT_POWEROFF | REBOOT_HALT); -} + const char *usage_str = "usage: bell [on/off]"; + const char *arg; -void -cmd_echo(int fd, int argc, char *argv[]) -{ - for (i = 1; i < argc; i++) { - prcons(fd, argv[i]); - prcons(fd, " "); + if (argc < 2) { + puts(usage_str); + return; + } + + arg = argv[1]; + if (strcmp(arg, "on") == 0) { + bs_bell = true; + } else if (strcmp(arg, "off") == 0) { + bs_bell = false; + } else { + puts(usage_str); } - prcons(fd, "\n"); } -int -parse_args(char *input, char *argv[], int max_args) +static int +parse_args(char *input, char *argv[], int max_args, struct parse_state *p) { int argc = 0; + /* ignore comments */ + if (*input == '@') { + return 0; + } + + /* setup default state */ + p->bg = 0; + + /* parse loop */ while (*input != '\0') { /* skip leading spaces */ while (*input == ' ') { @@ -112,11 +165,26 @@ parse_args(char *input, char *argv[], int max_args) break; } + /* comment? */ + if (*input == COMMENT) { + break; + } + + /* run in background? */ + if (*input == '&') { + p->bg = 1; + } + if (argc < max_args) { argv[argc++] = input; /* mark start of the argument */ } /* move forward until next space or end */ while (*input != '\0' && *input != ' ') { + /* ignore comments */ + if (*input == COMMENT) { + return 0; + } + input++; } @@ -130,92 +198,285 @@ parse_args(char *input, char *argv[], int max_args) return argc; } -static char * -getstr(int fd) +/* + * Grab a string from stdin and return + * the resulting offset within the input + * buffer we are at. + */ +static uint8_t +getstr(void) { char c; - uint8_t input; - i = 0; + int input; + uint32_t beep_payload; + uint8_t buf_i = 0; + + /* + * Prepare the beep payload @ 500 Hz + * for 20ms + */ + beep_payload = 500; + beep_payload |= (30 << 16); for (;;) { - if (read(fd, &input, 2) <= 0) { + if ((input = getchar()) < 0) { continue; } - c = input & 0xFF; + c = (char)input; + if (c == '\t') { + continue; + } /* return on newline */ if (c == '\n') { - buf[i] = '\0'; - write(fd, "\n", 1); - return buf; + buf[buf_i] = '\0'; + putchar('\n'); + return buf_i; } /* handle backspaces and DEL */ if (c == '\b' || c == 127) { - if (i > 0) { - i--; - write(fd, "\b \b", 3); + if (buf_i > 0) { + buf_i--; + fputs("\b \b", stdout); + } else if (bell_fd > 0 && bs_bell) { + write(bell_fd, &beep_payload, sizeof(beep_payload)); } - } else if (is_ascii(c) && i < sizeof(buf) - 1) { + } else if (is_printable(c) && buf_i < sizeof(buf) - 1) { /* write to fd and add to buffer */ - buf[i++] = c; - write(fd, &c, 1); + buf[buf_i++] = c; + putchar(c); } } } -struct command cmds[] = { - {"help", cmd_help}, - {"echo", cmd_echo}, - {"exit", cmd_exit}, - {"reboot", cmd_reboot}, - {"shutdown", cmd_shutdown}, - {NULL, NULL} -}; +static void +builtin_run(struct builtin_cmd *cmd, int argc, char *argv[]) +{ + if (cmd->func != NULL) { + cmd->func(argc, argv); + return; + } +} -int -main(void) +static int +cmd_run(const char *input, int argc, char *argv[]) +{ + char bin_path[512]; + char *envp[1] = { NULL }; + pid_t child; + + /* + * If we can access the raw input as a file, try to + * spawn it as a program. This case would run if for + * example, the user entered /usr/sbin/foo, or some + * path directly into the console. + */ + if (access(input, F_OK) == 0) { + child = spawn(input, argv, envp, 0); + if (child < 0) { + return child; + } + return child; + } + + snprintf(bin_path, sizeof(bin_path), "/usr/bin/%s", input); + + /* See if we can access it */ + if (access(bin_path, F_OK) != 0) { + return -1; + } + + if ((child = spawn(bin_path, argv, envp, 0)) < 0) { + return child; + } + + return child; +} + +/* + * Match a command with a builtin or binary + * + * @input: Command input + * @argc: Argument count + * @argv: Argument vector + */ +static int +command_match(const char *input, int argc, char *argv[]) +{ + int found = 0; + int i; + pid_t child = -1; + + for (i = 0; cmds[i].name != NULL; i++) { + if (strcmp(input, cmds[i].name) == 0) { + builtin_run(&cmds[i], argc, argv); + found = 1; + } + } + + if (found == 0) { + if ((child = cmd_run(input, argc, argv)) < 0) { + puts("Unrecognized command"); + return -1; + } + } + + return child; +} + +static void +script_skip_comment(int fd) { - int fd, found, argc; - char *input, *argv[16]; char c; - if ((fd = open("/dev/console", O_RDWR)) < 0) { - return fd; + while (c != '\n') { + if (read(fd, &c, 1) <= 0) + break; } +} - i = 0; - running = 1; - found = 0; +/* + * Parse a single line typed in from the + * user. + * + * @input: Input line + */ +static int +parse_line(char *input) +{ + int argc; + char *argv[16]; + struct parse_state state = {0}; + pid_t child; + + /* + * If we are using the REPEAT shorthand, + * repeat the last command. We return -EAGAIN + * to indicate we did not parse a normal command + * so the repeat command isn't pushed into the last + * command buffer and we enter a recursive hell. + */ + if (strcmp(input, REPEAT) == 0) { + parse_line(last_command); + return -EAGAIN; + } - prcons(fd, WELCOME); - while (running) { - prcons(fd, PROMPT); + /* Ensure the aux vector is zeored */ + memset(argv, 0, sizeof(argv)); - input = getstr(fd); - if (input[0] == '\0') { + /* + * Grab args from the user, there should be + * at least one. + */ + argc = parse_args(input, argv, sizeof(argv), &state); + if (argc == 0) { + return -EAGAIN; + } + + child = command_match(input, argc, argv); + if (child > 0 && !state.bg) { + waitpid(child, NULL, 0); + } + + return 0; +} + +static int +open_script(const char *pathname) +{ + int fd, argc, buf_i = 0; + char c, *input; + char buf[256]; + + fd = open(pathname, O_RDONLY); + if (fd < 0) { + printf("osh: failed to open %s\n", pathname); + return fd; + } + + while (read(fd, &c, 1) > 0) { + /* Skip comments */ + if (c == COMMENT) { + script_skip_comment(fd); continue; } - argc = parse_args(input, argv, sizeof(argv)); - if (argc == 0) { + /* Skip blank newlines */ + if (c == '\n' && buf_i == 0) { continue; } - for (i = 0; cmds[i].name != NULL; i++) { - if (strcmp(input, cmds[i].name) == 0) { - cmds[i].func(fd, argc, argv); - found = 1; - break; - } + if (buf_i >= sizeof(buf) - 1) { + buf_i = 0; } - if (found == 0) { - prcons(fd, "Unrecognized command\n"); + if (c == '\n') { + buf[buf_i] = '\0'; + parse_line(buf); + buf_i = 0; + continue; + } + buf[buf_i++] = c; + } + + return 0; +} + +static void +dump_file(const char *pathname) +{ + FILE *file; + char buf[64]; + int fd; + + file = fopen(pathname, "r"); + if (file == NULL) { + return; + } + + while (fgets(buf, sizeof(buf), file) != NULL) { + printf("%s", buf); + } + + fclose(file); +} + +int +main(int argc, char **argv) +{ + int found, prog_argc; + int stdout_fd; + char hostname[128] = "osmora"; + uint8_t buf_i; + char *p; + char c; + pid_t child; + + if (argc > 1) { + return open_script(argv[1]); + } + + running = 1; + bell_fd = open("/dev/beep", O_WRONLY); + dump_file("/etc/motd"); + gethostname(hostname, sizeof(hostname)); + + while (running) { + printf(PROMPT, getlogin(), hostname); + + buf_i = getstr(); + if (buf[0] == '\0') { + continue; + } + + buf[buf_i] = '\0'; + if (parse_line(buf) < 0) { + continue; } - found = 0; + memcpy(last_command, buf, buf_i + 1); buf[0] = '\0'; } return 0; diff --git a/usr.bin/readcore/Makefile b/usr.bin/readcore/Makefile new file mode 100644 index 0000000..0c18475 --- /dev/null +++ b/usr.bin/readcore/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/readcore: + gcc -Iinclude/ $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/readcore/core.c b/usr.bin/readcore/core.c new file mode 100644 index 0000000..6871d06 --- /dev/null +++ b/usr.bin/readcore/core.c @@ -0,0 +1,50 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdint.h> +#include <stdio.h> +#include "frame.h" +#include "core.h" + +void +core_dumpframe(const struct core *core) +{ +#if defined(__x86_64__) + printf( + "RDI=%p, RSI=%p\n" + "RCX=%p, RDX=%p\n" + "RAX=%p, RIP=%p\n", + core->frame.rdi, core->frame.rsi, + core->frame.rcx, core->frame.rdx, + core->frame.rax, core->frame.rip + ); +#else + printf("core_dumpframe: unsupported arch\n"); +#endif +} diff --git a/usr.bin/readcore/crc32.c b/usr.bin/readcore/crc32.c new file mode 100644 index 0000000..2df49ac --- /dev/null +++ b/usr.bin/readcore/crc32.c @@ -0,0 +1,91 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdint.h> +#include <stdlib.h> +#include "crc32.h" + +static const uint32_t crc32_tab[] = { + 0x00000000, 0x77073096, 0xEE0E612C, 0x990951BA, 0x076DC419, 0x706AF48F, + 0xE963A535, 0x9E6495A3, 0x0EDB8832, 0x79DCB8A4, 0xE0D5E91E, 0x97D2D988, + 0x09B64C2B, 0x7EB17CBD, 0xE7B82D07, 0x90BF1D91, 0x1DB71064, 0x6AB020F2, + 0xF3B97148, 0x84BE41DE, 0x1ADAD47D, 0x6DDDE4EB, 0xF4D4B551, 0x83D385C7, + 0x136C9856, 0x646BA8C0, 0xFD62F97A, 0x8A65C9EC, 0x14015C4F, 0x63066CD9, + 0xFA0F3D63, 0x8D080DF5, 0x3B6E20C8, 0x4C69105E, 0xD56041E4, 0xA2677172, + 0x3C03E4D1, 0x4B04D447, 0xD20D85FD, 0xA50AB56B, 0x35B5A8FA, 0x42B2986C, + 0xDBBBC9D6, 0xACBCF940, 0x32D86CE3, 0x45DF5C75, 0xDCD60DCF, 0xABD13D59, + 0x26D930AC, 0x51DE003A, 0xC8D75180, 0xBFD06116, 0x21B4F4B5, 0x56B3C423, + 0xCFBA9599, 0xB8BDA50F, 0x2802B89E, 0x5F058808, 0xC60CD9B2, 0xB10BE924, + 0x2F6F7C87, 0x58684C11, 0xC1611DAB, 0xB6662D3D, 0x76DC4190, 0x01DB7106, + 0x98D220BC, 0xEFD5102A, 0x71B18589, 0x06B6B51F, 0x9FBFE4A5, 0xE8B8D433, + 0x7807C9A2, 0x0F00F934, 0x9609A88E, 0xE10E9818, 0x7F6A0DBB, 0x086D3D2D, + 0x91646C97, 0xE6635C01, 0x6B6B51F4, 0x1C6C6162, 0x856530D8, 0xF262004E, + 0x6C0695ED, 0x1B01A57B, 0x8208F4C1, 0xF50FC457, 0x65B0D9C6, 0x12B7E950, + 0x8BBEB8EA, 0xFCB9887C, 0x62DD1DDF, 0x15DA2D49, 0x8CD37CF3, 0xFBD44C65, + 0x4DB26158, 0x3AB551CE, 0xA3BC0074, 0xD4BB30E2, 0x4ADFA541, 0x3DD895D7, + 0xA4D1C46D, 0xD3D6F4FB, 0x4369E96A, 0x346ED9FC, 0xAD678846, 0xDA60B8D0, + 0x44042D73, 0x33031DE5, 0xAA0A4C5F, 0xDD0D7CC9, 0x5005713C, 0x270241AA, + 0xBE0B1010, 0xC90C2086, 0x5768B525, 0x206F85B3, 0xB966D409, 0xCE61E49F, + 0x5EDEF90E, 0x29D9C998, 0xB0D09822, 0xC7D7A8B4, 0x59B33D17, 0x2EB40D81, + 0xB7BD5C3B, 0xC0BA6CAD, 0xEDB88320, 0x9ABFB3B6, 0x03B6E20C, 0x74B1D29A, + 0xEAD54739, 0x9DD277AF, 0x04DB2615, 0x73DC1683, 0xE3630B12, 0x94643B84, + 0x0D6D6A3E, 0x7A6A5AA8, 0xE40ECF0B, 0x9309FF9D, 0x0A00AE27, 0x7D079EB1, + 0xF00F9344, 0x8708A3D2, 0x1E01F268, 0x6906C2FE, 0xF762575D, 0x806567CB, + 0x196C3671, 0x6E6B06E7, 0xFED41B76, 0x89D32BE0, 0x10DA7A5A, 0x67DD4ACC, + 0xF9B9DF6F, 0x8EBEEFF9, 0x17B7BE43, 0x60B08ED5, 0xD6D6A3E8, 0xA1D1937E, + 0x38D8C2C4, 0x4FDFF252, 0xD1BB67F1, 0xA6BC5767, 0x3FB506DD, 0x48B2364B, + 0xD80D2BDA, 0xAF0A1B4C, 0x36034AF6, 0x41047A60, 0xDF60EFC3, 0xA867DF55, + 0x316E8EEF, 0x4669BE79, 0xCB61B38C, 0xBC66831A, 0x256FD2A0, 0x5268E236, + 0xCC0C7795, 0xBB0B4703, 0x220216B9, 0x5505262F, 0xC5BA3BBE, 0xB2BD0B28, + 0x2BB45A92, 0x5CB36A04, 0xC2D7FFA7, 0xB5D0CF31, 0x2CD99E8B, 0x5BDEAE1D, + 0x9B64C2B0, 0xEC63F226, 0x756AA39C, 0x026D930A, 0x9C0906A9, 0xEB0E363F, + 0x72076785, 0x05005713, 0x95BF4A82, 0xE2B87A14, 0x7BB12BAE, 0x0CB61B38, + 0x92D28E9B, 0xE5D5BE0D, 0x7CDCEFB7, 0x0BDBDF21, 0x86D3D2D4, 0xF1D4E242, + 0x68DDB3F8, 0x1FDA836E, 0x81BE16CD, 0xF6B9265B, 0x6FB077E1, 0x18B74777, + 0x88085AE6, 0xFF0F6A70, 0x66063BCA, 0x11010B5C, 0x8F659EFF, 0xF862AE69, + 0x616BFFD3, 0x166CCF45, 0xA00AE278, 0xD70DD2EE, 0x4E048354, 0x3903B3C2, + 0xA7672661, 0xD06016F7, 0x4969474D, 0x3E6E77DB, 0xAED16A4A, 0xD9D65ADC, + 0x40DF0B66, 0x37D83BF0, 0xA9BCAE53, 0xDEBB9EC5, 0x47B2CF7F, 0x30B5FFE9, + 0xBDBDF21C, 0xCABAC28A, 0x53B39330, 0x24B4A3A6, 0xBAD03605, 0xCDD70693, + 0x54DE5729, 0x23D967BF, 0xB3667A2E, 0xC4614AB8, 0x5D681B02, 0x2A6F2B94, + 0xB40BBE37, 0xC30C8EA1, 0x5A05DF1B, 0x2D02EF8D +}; + +uint32_t +crc32(const void *data, size_t len) +{ + const uint8_t *p = data; + uint32_t val = 0xFFFFFFFF; + + for (size_t i = 0; i < len; ++i) { + val = (val >> 8) ^ crc32_tab[(val ^ p[i]) & 0xFF]; + } + + return val ^ 0xFFFFFFFF; +} diff --git a/usr.bin/readcore/include/core.h b/usr.bin/readcore/include/core.h new file mode 100644 index 0000000..51105f4 --- /dev/null +++ b/usr.bin/readcore/include/core.h @@ -0,0 +1,44 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef CORE_H_ +#define CORE_H_ + +#include <sys/cdefs.h> +#include <sys/types.h> +#include "frame.h" + +struct __packed core { + pid_t pid; + uintptr_t fault_addr; + struct core_frame frame; + uint32_t checksum; +}; + +#endif /* !CORE_H_ */ diff --git a/usr.bin/readcore/include/crc32.h b/usr.bin/readcore/include/crc32.h new file mode 100644 index 0000000..a175a30 --- /dev/null +++ b/usr.bin/readcore/include/crc32.h @@ -0,0 +1,37 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef CRC32_H_ +#define CRC32_H_ + +#include <stdint.h> + +uint32_t crc32(const void *data, size_t len); + +#endif diff --git a/usr.bin/readcore/include/frame.h b/usr.bin/readcore/include/frame.h new file mode 100644 index 0000000..50740fb --- /dev/null +++ b/usr.bin/readcore/include/frame.h @@ -0,0 +1,107 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#ifndef FRAME_H_ +#define FRAME_H_ + +#include <sys/types.h> + +struct core; + +#if defined(__x86_64__) +struct core_frame { + uint64_t trapno; + uint64_t rax; + uint64_t rcx; + uint64_t rdx; + uint64_t rbx; + uint64_t rsi; + uint64_t rdi; + uint64_t rbp; + uint64_t r8; + uint64_t r9; + uint64_t r10; + uint64_t r11; + uint64_t r12; + uint64_t r13; + uint64_t r14; + uint64_t r15; + uint64_t error_code; + uint64_t rip; + uint64_t cs; + uint64_t rflags; + uint64_t rsp; + uint64_t ss; +}; +#elif defined(__aarch64__) +struct core_frame { + lreg_t x30; + lreg_t x29; + lreg_t x28; + lreg_t x27; + lreg_t x26; + lreg_t x25; + lreg_t x24; + lreg_t x23; + lreg_t x22; + lreg_t x21; + lreg_t x20; + lreg_t x19; + lreg_t x18; + lreg_t x17; + lreg_t x16; + lreg_t x15; + lreg_t x14; + lreg_t x13; + lreg_t x12; + lreg_t x11; + lreg_t x10; + lreg_t x9; + lreg_t x8; + lreg_t x7; + lreg_t x6; + lreg_t x5; + lreg_t x4; + lreg_t x3; + lreg_t x2; + lreg_t x1; + lreg_t x0; + lreg_t elr; + lreg_t esr; + frament_t trapno; +}; +#else +struct core_frame { + uint64_t data[30]; +}; +#endif + +void core_dumpframe(const struct core *core); + +#endif /* !FRAME_H_ */ diff --git a/usr.bin/readcore/readcore.c b/usr.bin/readcore/readcore.c new file mode 100644 index 0000000..9d8b17b --- /dev/null +++ b/usr.bin/readcore/readcore.c @@ -0,0 +1,78 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> +#include <fcntl.h> +#include <unistd.h> +#include <stdint.h> +#include "crc32.h" +#include "frame.h" +#include "core.h" + +static void +parse_core(const struct core *dump) +{ + uint32_t checksum; + + printf("-- CORE DUMP OF PID %d CRASH -- \n", dump->pid); + printf("Faulting address: %p\n", dump->fault_addr); + core_dumpframe(dump); + + checksum = crc32(dump, sizeof(*dump) - sizeof(checksum)); + if (checksum != dump->checksum) { + printf("!! WARNING: coredump might be corrupt !!\n"); + } +} + +int +main(int argc, char **argv) +{ + int fd; + struct core core; + + if (argc < 2) { + printf("usage: readcore <coredump>\n"); + return -1; + } + + fd = open(argv[1], O_RDONLY); + if (fd < 2) { + printf("readcore: Could not open \"%s\"\n", argv[1]); + return fd; + } + + if (read(fd, &core, sizeof(core)) < sizeof(core)) { + printf("readcore: bad read()\n"); + return -1; + } + + parse_core(&core); + close(fd); + return 0; +} diff --git a/usr.bin/reboot/Makefile b/usr.bin/reboot/Makefile new file mode 100644 index 0000000..3700676 --- /dev/null +++ b/usr.bin/reboot/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/reboot: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/reboot/reboot.c b/usr.bin/reboot/reboot.c new file mode 100644 index 0000000..ac9785a --- /dev/null +++ b/usr.bin/reboot/reboot.c @@ -0,0 +1,87 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/reboot.h> +#include <stdio.h> +#include <unistd.h> + +#define REBOOT_FLAGS "rhp" +#define REBOOT_FLAG_RB 'r' /* Reboot */ +#define REBOOT_FLAG_HLT 'h' /* Halt */ +#define REBOOT_FLAG_PWR 'p' /* Power off */ + +static void +help(void) +{ + printf( + "reboot: usage: reboot [flags]\n" + "flags:\n" + " [-r] Reboot\n" + " [-h] Halt\n" + " [-p] Power off\n" + ); +} + +int +main(int argc, char **argv) +{ + int c; + + if (argc < 2) { + help(); + return -1; + } + + /* + * Now we parse the args. Every case is a fall through + * as if one fails (indicated by us returning), another + * method is attempted. + */ + while ((c = getopt(argc, argv, REBOOT_FLAGS)) != -1) { + switch (c) { + case REBOOT_FLAG_RB: + cpu_reboot(REBOOT_RESET); + printf("REBOOT failed\n"); + /* Fall through */ + case REBOOT_FLAG_HLT: + cpu_reboot(REBOOT_HALT); + printf("HALT failed\n"); + /* Fall through */ + case REBOOT_FLAG_PWR: + cpu_reboot(REBOOT_POWEROFF); + printf("POWEROFF failed\n"); + /* Fall through */ + default: + printf("got bad flag '%c'\n", c); + break; + } + } + + return 0; +} diff --git a/usr.bin/screensave/Makefile b/usr.bin/screensave/Makefile new file mode 100644 index 0000000..a005346 --- /dev/null +++ b/usr.bin/screensave/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/screensave: + gcc $(CFILES) -lgfx -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/screensave/screensave.c b/usr.bin/screensave/screensave.c new file mode 100644 index 0000000..bb67cde --- /dev/null +++ b/usr.bin/screensave/screensave.c @@ -0,0 +1,116 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/types.h> +#include <stdio.h> +#include <time.h> +#include <unistd.h> +#include <fcntl.h> +#include <libgfx/draw.h> +#include <libgfx/gfx.h> + +static struct gfx_ctx ctx; + +static ssize_t +rand_bytes(char *buf, size_t len) +{ + ssize_t retval; + int fd; + + fd = open("/dev/random", O_RDONLY); + if (fd < 0) { + return fd; + } + + if ((retval = read(fd, buf, len)) < 0) { + close(fd); + return retval; + } + + close(fd); + return retval; +} + +static void +screensave(void) +{ + size_t n_iter = 0; /* Monotonic */ + struct timespec ts; + char randbuf[2]; + color_t curpix, nextpix; + uint8_t step = 0; + + ts.tv_sec = 0; + ts.tv_nsec = 3000000; + + /* Begin the radiation ::) */ + for (;;) { + rand_bytes(randbuf, sizeof(randbuf)); + for (size_t i = 0; i < (ctx.fb_size / 4) - 1; i += step + 1) { + curpix = ctx.io[i]; + nextpix = ctx.io[i + 1]; + + /* If a multiple of 16, AND, otherwise XOR */ + if ((n_iter & 15) != 0) { + curpix ^= randbuf[0] & 3; + nextpix ^= (curpix | (nextpix << 1)); + nextpix ^= step; + } else { + curpix &= randbuf[0] & 3; + nextpix &= (curpix | (nextpix << 1)); + nextpix &= step; + } + + ctx.io[i] = curpix; + ctx.io[i + 1] = nextpix; + } + + sleep(&ts, &ts); + if ((++step) > 50) { + step = 0; + } + ++n_iter; + } +} + +int +main(void) +{ + int error; + + error = gfx_init(&ctx); + if (error < 0) { + printf("could not init libgfx\n"); + return error; + } + + screensave(); + gfx_cleanup(&ctx); + return 0; +} diff --git a/usr.bin/sleep/Makefile b/usr.bin/sleep/Makefile new file mode 100644 index 0000000..5bfd04f --- /dev/null +++ b/usr.bin/sleep/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/sleep: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/sleep/sleep.c b/usr.bin/sleep/sleep.c new file mode 100644 index 0000000..f7d07f8 --- /dev/null +++ b/usr.bin/sleep/sleep.c @@ -0,0 +1,55 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <time.h> +#include <string.h> +#include <stdio.h> + +int +main(int argc, char **argv) +{ + struct timespec ts; + uint16_t nsec = 0; + + if (argc < 2) { + printf("sleep: usage: sleep <seconds>\n"); + return -1; + } + + nsec = atoi(argv[1]); + if (nsec == 0) { + printf("sleep: bad argument\n"); + return -1; + } + + ts.tv_nsec = 0; + ts.tv_sec = nsec; + sleep(&ts, &ts); + return 0; +} diff --git a/usr.bin/sysctl/Makefile b/usr.bin/sysctl/Makefile new file mode 100644 index 0000000..e32dbc4 --- /dev/null +++ b/usr.bin/sysctl/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/sysctl: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/sysctl/sysctl.c b/usr.bin/sysctl/sysctl.c new file mode 100644 index 0000000..4a84484 --- /dev/null +++ b/usr.bin/sysctl/sysctl.c @@ -0,0 +1,314 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/sysctl.h> +#include <stdint.h> +#include <stdio.h> +#include <string.h> +#include <stdbool.h> + +#define BUF_SIZE 128 + +/* Kern var string constants */ +#define NAME_OSTYPE "ostype" +#define NAME_OSRELEASE "osrelease" +#define NAME_VERSION "version" +#define NAME_VCACHE_TYPE "vcache_type" + +/* Hw var string constants */ +#define NAME_PAGESIZE "pagesize" +#define NAME_NCPU "ncpu" +#define NAME_MACHINE "machine" + +/* Proc var string constants */ +#define NAME_COUNT "count" + +/* Name start string constants */ +#define NAME_KERN "kern" +#define NAME_HW "hw" +#define NAME_PROC "proc" + +/* Name start int constants */ +#define NAME_DEF_KERN 0 +#define NAME_DEF_HW 1 +#define NAME_DEF_PROC 2 + +/* + * Print the contents read from a sysctl + * variable depending on its type. + * + * @data: Data to print + * @is_str: True if a string + */ +static inline void +varbuf_print(char data[BUF_SIZE], bool is_str) +{ + uint32_t *val; + + if (is_str) { + printf("%s\n", data); + } else { + val = (uint32_t *)data; + printf("%d\n", *val); + } +} + +/* + * Convert string name to a internal name + * definition. + * + * @name: Name to convert + * + * Convert to int def + * / + * kern.ostype + * ^^ + * + * -- + * Returns a less than zero value on failure + * (e.g., entry not found). + */ +static int +name_to_def(const char *name) +{ + switch (*name) { + case 'k': + if (strcmp(name, NAME_KERN) == 0) { + return NAME_DEF_KERN; + } + + return -1; + case 'h': + if (strcmp(name, NAME_HW) == 0) { + return NAME_DEF_HW; + } + + return -1; + case 'p': + if (strcmp(name, NAME_PROC) == 0) { + return NAME_DEF_PROC; + } + + return -1; + } + + return -1; +} + +/* + * Handle parsing of 'kern.*' node names + * + * @node: Node name to parse + * @is_str: Set to true if string + */ +static int +kern_node(const char *node, bool *is_str) +{ + switch (*node) { + case 'v': + if (strcmp(node, NAME_VERSION) == 0) { + return KERN_VERSION; + } + + if (strcmp(node, NAME_VCACHE_TYPE) == 0) { + return KERN_VCACHE_TYPE; + } + return -1; + case 'o': + if (strcmp(node, NAME_OSTYPE) == 0) { + return KERN_OSTYPE; + } + + if (strcmp(node, NAME_OSRELEASE) == 0) { + return KERN_OSRELEASE; + } + return -1; + } + + return -1; +} + +/* + * Handle parsing of 'hw.*' node names + * + * @node: Node name to parse + * @is_str: Set to true if string + */ +static int +hw_node(const char *node, bool *is_str) +{ + switch (*node) { + case 'p': + if (strcmp(node, NAME_PAGESIZE) == 0) { + *is_str = false; + return HW_PAGESIZE; + } + + return -1; + case 'n': + if (strcmp(node, NAME_NCPU) == 0) { + *is_str = false; + return HW_NCPU; + } + + return -1; + case 'm': + if (strcmp(node, NAME_MACHINE) == 0) { + return HW_MACHINE; + } + return -1; + } + + return -1; +} + +/* + * Handle parsing of 'proc.*' node names + * + * @node: Node name to parse + * @is_str: Set to true if string + */ +static int +proc_node(const char *node, bool *is_str) +{ + switch (*node) { + case 'c': + if (strcmp(node, NAME_COUNT) == 0) { + *is_str = false; + return PROC_COUNT; + } + + return -1; + } + + return -1; +} + +/* + * Convert string node to a sysctl name + * definition. + * + * @name: Name to convert + * @is_str: Set to true if string + * + * Convert to int def + * / + * kern.ostype + * ^^ name + * + * -- + * Returns a less than zero value on failure + * (e.g., entry not found). + */ +static int +node_to_def(int name, const char *node, bool *is_str) +{ + int retval; + bool dmmy; + + /* + * If the caller did not set `is_str' just + * set it to a dummy value. Otherwise, we will + * make it *default* to a 'true' value. + */ + if (is_str == NULL) { + is_str = &dmmy; + } else { + *is_str = true; + } + + switch (name) { + case NAME_DEF_KERN: + return kern_node(node, is_str); + case NAME_DEF_HW: + return hw_node(node, is_str); + case NAME_DEF_PROC: + return proc_node(node, is_str); + } + + return -1; +} + +int +main(int argc, char **argv) +{ + struct sysctl_args args; + char *var, *p; + int type, error; + int root, name; + size_t oldlen; + bool is_str; + char buf[BUF_SIZE]; + + if (argc < 2) { + printf("sysctl: usage: sysctl <var>\n"); + return -1; + } + + var = argv[1]; + p = strtok(var, "."); + + if (p == NULL) { + printf("sysctl: bad var \"%s\"\n", p); + return -1; + } + + if ((root = name_to_def(p)) < 0) { + printf("sysctl: bad var \"%s\"\n", p); + return root; + } + + p = strtok(NULL, "."); + if (p == NULL) { + printf("sysctl: bad var \"%s\"\n", p); + return -1; + } + + if ((name = node_to_def(root, p, &is_str)) < 0) { + printf("sysctl: bad var \"%s\"\n", p); + return name; + } + + memset(buf, 0, sizeof(buf)); + oldlen = sizeof(buf); + args.name = &name; + args.nlen = 1; + args.oldp = buf; + args.oldlenp = &oldlen; + args.newp = NULL; + args.newlen = 0; + + if ((error = sysctl(&args)) != 0) { + printf("sysctl returned %d\n", error); + return error; + } + + varbuf_print(buf, is_str); + return 0; +} diff --git a/usr.bin/whoami/Makefile b/usr.bin/whoami/Makefile new file mode 100644 index 0000000..ced9ae2 --- /dev/null +++ b/usr.bin/whoami/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/bin/whoami: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.bin/whoami/whoami.c b/usr.bin/whoami/whoami.c new file mode 100644 index 0000000..c3adcf0 --- /dev/null +++ b/usr.bin/whoami/whoami.c @@ -0,0 +1,38 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <stdio.h> +#include <unistd.h> + +int +main(void) +{ + printf("%s\f\n", getlogin()); + return 0; +} diff --git a/usr.sbin/Makefile b/usr.sbin/Makefile index b517c2f..870848c 100644 --- a/usr.sbin/Makefile +++ b/usr.sbin/Makefile @@ -6,3 +6,5 @@ ARGS = -I$(ROOT)/builddeps LDSCRIPT=$(LDSCRIPT) USRDIR=$(USRDIR) ROOT=$(ROOT) .PHONY: all all: make -C init/ $(ARGS) + make -C install/ $(ARGS) + make -C inject/ $(ARGS) diff --git a/usr.sbin/init/main.c b/usr.sbin/init/main.c index a136740..12bb98c 100644 --- a/usr.sbin/init/main.c +++ b/usr.sbin/init/main.c @@ -27,8 +27,68 @@ * POSSIBILITY OF SUCH DAMAGE. */ +#include <sys/spawn.h> +#include <stddef.h> +#include <unistd.h> +#include <stdio.h> +#include <string.h> + +#define log_trace(fmt, ...) printf("[init]: " fmt, ##__VA_ARGS__) +#define log_error(fmt, ...) printf("[error]: " fmt, ##__VA_ARGS__) + +#define SHELL_PATH "/usr/bin/osh" +#define LOGIN_PATH "/usr/bin/login" +#define INIT_RC_PATH "/usr/rc/init.rc" + +static void +init_hostname(void) +{ + char hostname[128]; + size_t len; + FILE *fp; + + fp = fopen("/etc/hostname", "r"); + if (fp == NULL) { + log_error("[init]: error opening /etc/hostname\n"); + return; + } + + len = fread(hostname, sizeof(char), sizeof(hostname), fp); + if (len == 0) { + log_error("[init]: error reading /etc/hostname\n"); + fclose(fp); + return; + } + + hostname[len - 1] = '\0'; + if (sethostname(hostname, len) < 0) { + log_error("[init]: error setting hostname\n"); + log_error("[init]: tried to set %s (len=%d)\n", hostname, len); + fclose(fp); + return; + } + + log_trace("hostname -> %s\n", hostname); + fclose(fp); +} + int -main(void) +main(int argc, char **argv) { + char *login_argv[] = { LOGIN_PATH, NULL }; + char *start_argv[] = { SHELL_PATH, INIT_RC_PATH, NULL }; + char *envp[] = { NULL }; + + /* Initialize the system hostname */ + init_hostname(); + + /* Start the init.rc */ + log_trace("init.rc up\n"); + spawn(SHELL_PATH, start_argv, envp, 0); + start_argv[1] = NULL; + + /* Start the login manager */ + spawn(login_argv[0], login_argv, envp, 0); + for (;;); return 0; } diff --git a/usr.sbin/inject/Makefile b/usr.sbin/inject/Makefile new file mode 100644 index 0000000..7175ae9 --- /dev/null +++ b/usr.sbin/inject/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/sbin/inject: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.sbin/inject/inject.c b/usr.sbin/inject/inject.c new file mode 100644 index 0000000..514ca82 --- /dev/null +++ b/usr.sbin/inject/inject.c @@ -0,0 +1,43 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/krq.h> +#include <stdio.h> + +int +main(int argc, char **argv) +{ + char *path = NULL; + + if (argc > 1) { + path = argv[1]; + } + + return inject(path); +} diff --git a/usr.sbin/install/Makefile b/usr.sbin/install/Makefile new file mode 100644 index 0000000..36c5969 --- /dev/null +++ b/usr.sbin/install/Makefile @@ -0,0 +1,6 @@ +include user.mk + +CFILES = $(shell find . -name "*.c") + +$(ROOT)/base/usr/sbin/install: + gcc $(CFILES) -o $@ $(INTERNAL_CFLAGS) diff --git a/usr.sbin/install/install.c b/usr.sbin/install/install.c new file mode 100644 index 0000000..803c864 --- /dev/null +++ b/usr.sbin/install/install.c @@ -0,0 +1,315 @@ +/* + * Copyright (c) 2023-2025 Ian Marco Moffett and the Osmora Team. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of Hyra nor the names of its + * contributors may be used to endorse or promote products derived from + * this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +#include <sys/mman.h> +#include <sys/disklabel.h> +#include <sys/fbdev.h> +#include <sys/reboot.h> +#include <sys/spawn.h> +#include <sys/wait.h> +#include <sys/stat.h> +#include <sys/param.h> +#include <stdio.h> +#include <fcntl.h> +#include <unistd.h> +#include <stddef.h> +#include <string.h> +#include <stdbool.h> + +#define TEXT_STYLE "\033[37;44m" +#define INSTALLER_BG 0x00007F +#define BLOCK_SIZE 512 +#define WAIT_KEY(VAR, C) while (((VAR = getchar())) != (C)) + +static struct fbattr fb_attr; +static void *fbmem; + +struct progress_bar { + bool dec; + uint8_t progress; +}; + +/* + * Clear the screen to a given background color + * + * @color: RGB value of chosen color + * @setattr: Sets default text style if true + */ +static void +installer_clearscr(uint32_t color, bool setattr) +{ + size_t fb_size; + uint32_t *p; + + if (setattr) { + puts(TEXT_STYLE); + } + + puts("\033[H"); + fb_size = fb_attr.height * fb_attr.pitch; + p = fbmem; + + for (size_t i = 0; i < fb_size / sizeof(*p); ++i) { + p[i] = color; + } +} + +static void +pre_installer(void) +{ + char *argv[] = { "/usr/bin/osh", NULL }; + char *envp[] = { NULL }; + char c; + pid_t child = -1; + + puts("[S]hell/[I]nstall"); + for (;;) { + c = getchar(); + if (c == 's') { + puts("\033[0m"); + installer_clearscr(0x000000, false); + child = spawn(argv[0], argv, envp, 0); + installer_clearscr(INSTALLER_BG, true); + break; + } else if (c == 'i') { + break; + } + } + + if (child > 0) { + waitpid(child, NULL, 0); + } +} + +static void +reboot_prompt(void) +{ + char c; + + puts("Press 'r' to reboot"); + WAIT_KEY(c, 'r'); + cpu_reboot(REBOOT_RESET); +} + +/* + * Create a progress bar animation for long + * operations. + * + * @bp: Pointer to a progress bar structure. + * @n: Number of blocks operated on. + * @max: Max blocks per bar update. + */ +static void +progress_update(struct progress_bar *bp, size_t n, size_t max) +{ + /* + * We only want to update the progress bar + * per `max' blocks written. + */ + if ((n > 0) && (n % max) != 0) { + return; + } + + /* Add more '.' chars */ + if (bp->progress < 8 && !bp->dec) { + fwrite(".", sizeof(char), 1, stdout); + } else if (bp->progress >= 8) { + bp->dec = true; + } + + /* Remove '.' chars */ + if (bp->dec && bp->progress > 0) { + fwrite("\b\f", sizeof(char), 2, stdout); + } else if (bp->progress == 0) { + bp->dec = false; + } + + if (!bp->dec) { + ++bp->progress; + } else { + --bp->progress; + } +} + +/* + * Wipe a number of blocks beginning at the current + * fd offset. + * + * @hdd_fd: Target drive fd + * @count: Number of bytes to wipe + */ +static void +installer_wipe(int hdd_fd, uint32_t count) +{ + struct progress_bar bar = {0, 0}; + size_t write_blocks, nblocks; + char buf[BLOCK_SIZE * 2]; + + if (__unlikely(count == 0)) { + puts("bad count for /dev/sd1"); + reboot_prompt(); + } + + count = ALIGN_UP(count, sizeof(buf)); + memset(buf, 0, sizeof(buf)); + write_blocks = sizeof(buf) / BLOCK_SIZE; + nblocks = count / BLOCK_SIZE; + + /* Zero that shit */ + puts("zeroing..."); + for (int i = 0; i < nblocks; i += write_blocks) { + write(hdd_fd, buf, sizeof(buf)); + progress_update(&bar, i, 256); + } + + lseek(hdd_fd, 0, SEEK_SET); + puts("OK"); +} + +/* + * Write data to the drive. + * + * @hdd: HDD file descriptor + * @p: Data pointer + * @len: Length of data. + */ +static void +installer_write(int hdd_fd, int file_fd, void *p, size_t len) +{ + size_t nblocks; + struct progress_bar bar = {0, 0}; + char buf[BLOCK_SIZE]; + char *bufp; + + len = ALIGN_UP(len, BLOCK_SIZE); + nblocks = len / BLOCK_SIZE; + bufp = (p == NULL || len < BLOCK_SIZE) ? buf : p; + + if (len < BLOCK_SIZE) { + memcpy(buf, p, len); + } + + for (size_t i = 0; i < nblocks; ++i) { + if (file_fd > 0) { + read(file_fd, bufp, BLOCK_SIZE); + } + + write(hdd_fd, bufp, BLOCK_SIZE); + progress_update(&bar, i, 128); + } + + puts("OK"); +} + +static void +installer_run(void) +{ + struct stat hdd_sb, iso_sb; + struct disklabel label; + const char *hdd_path = "/dev/sd1"; + const char *iso_path = "/boot/Hyra.iso"; + char buf[256]; + int hdd_fd, iso_fd, error; + int n; + char c; + + pre_installer(); + + if ((hdd_fd = open(hdd_path, O_RDWR)) < 0) { + puts("No available devices to target!"); + reboot_prompt(); + } + if (stat(hdd_path, &hdd_sb) < 0) { + puts("hdd stat() failure\n"); + reboot_prompt(); + } + + snprintf(buf, sizeof(buf), "/dev/sd1 (%d sectors) [a]", hdd_sb.st_size); + puts("Please choose which device to target"); + puts(buf); + WAIT_KEY(c, 'a'); + + /* Wait for y/n option */ + puts("\033[37;41m!! DRIVE WILL BE WIPED !!" TEXT_STYLE); + puts("Are you sure? [y/n]"); + WAIT_KEY(c, 'y') { + if (c == 'n') { + reboot_prompt(); + } + } + + if ((iso_fd = open(iso_path, O_RDONLY)) < 0) { + puts("failed to read install data\n"); + reboot_prompt(); + } + if (stat(iso_path, &iso_sb) < 0) { + puts("hdd stat() failure\n"); + reboot_prompt(); + } + + /* Prepare the parition table */ + label.magic = DISK_MAG; + label.sect_size = BLOCK_SIZE; + + installer_wipe(hdd_fd, iso_sb.st_size + sizeof(label)); + puts("writing install data"); + installer_write(hdd_fd, iso_fd, NULL, iso_sb.st_size); + puts("writing parition table"); + installer_write(hdd_fd, -1, &label, sizeof(label)); + + puts("\nInstallation complete!"); + reboot_prompt(); +} + +int +main(void) +{ + int fb_fd, fbattr_fd, prot; + size_t fb_size; + + if ((fb_fd = open("/dev/fb0", O_RDWR)) < 0) { + puts("FATAL: failed to open /dev/fb0"); + return fb_fd; + } + if ((fbattr_fd = open("/ctl/fb0/attr", O_RDONLY)) < 0) { + puts("FATAL: failed to open /ctl/fb0/attr"); + return fbattr_fd; + } + + read(fbattr_fd, &fb_attr, sizeof(fb_attr)); + fb_size = fb_attr.height * fb_attr.pitch; + + prot = PROT_READ | PROT_WRITE; + fbmem = mmap(NULL, fb_size, prot, MAP_SHARED, fb_fd, 0); + + installer_clearscr(INSTALLER_BG, true); + puts("Welcome to Hyra/" _OSARCH " v" _OSVER "!"); + installer_run(); + return 0; +} diff --git a/usr.sbin/link.ld b/usr.sbin/link.ld index 9fad881..5e99291 100644 --- a/usr.sbin/link.ld +++ b/usr.sbin/link.ld @@ -23,4 +23,9 @@ SECTIONS *(.bss.*) __bss_end = .; } + + /DISCARD/ : { + *(.eh_frame) + *(.note .note.*) + } } |