diff options
author | Ian Moffett <ian@osmora.org> | 2024-03-07 17:28:00 -0500 |
---|---|---|
committer | Ian Moffett <ian@osmora.org> | 2024-03-07 17:28:32 -0500 |
commit | bd5969fc876a10b18613302db7087ef3c40f18e1 (patch) | |
tree | 7c2b8619afe902abf99570df2873fbdf40a4d1a1 /lib/mlibc/options | |
parent | a95b38b1b92b172e6cc4e8e56a88a30cc65907b0 (diff) |
lib: Add mlibc
Signed-off-by: Ian Moffett <ian@osmora.org>
Diffstat (limited to 'lib/mlibc/options')
716 files changed, 65840 insertions, 0 deletions
diff --git a/lib/mlibc/options/ansi/generic/assert-stubs.cpp b/lib/mlibc/options/ansi/generic/assert-stubs.cpp new file mode 100644 index 0000000..6ebb6ed --- /dev/null +++ b/lib/mlibc/options/ansi/generic/assert-stubs.cpp @@ -0,0 +1,13 @@ + +#include <assert.h> +#include <stdio.h> +#include <stdlib.h> + +#include <bits/ensure.h> + +[[gnu::noreturn]] void __assert_fail(const char *assertion, const char *file, unsigned int line, + const char *function) { + fprintf(stderr, "In function %s, file %s:%d: Assertion '%s' failed!\n", + function, file, line, assertion); + abort(); +} diff --git a/lib/mlibc/options/ansi/generic/complex-stubs.c b/lib/mlibc/options/ansi/generic/complex-stubs.c new file mode 100644 index 0000000..069626b --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex-stubs.c @@ -0,0 +1,9 @@ +#include <complex.h> + +long double cimagl(long double complex z) { + return __imag__(z); +} + +long double creall(long double complex z) { + return __real__(z); +} diff --git a/lib/mlibc/options/ansi/generic/complex/cabs.c b/lib/mlibc/options/ansi/generic/complex/cabs.c new file mode 100644 index 0000000..2750fab --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cabs.c @@ -0,0 +1,53 @@ +/* $NetBSD: cabs.c,v 1.1 2007/08/20 16:01:30 drochner Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<cabs>>, <<cabsf>>---complex absolute-value + +INDEX + cabs +INDEX + cabsf + +ANSI_SYNOPSIS + #include <complex.h> + double cabs(double complex <[z]>); + float cabsf(float complex <[z]>); + + +DESCRIPTION + These functions compute compute the complex absolute value + (also called norm, modulus, or magnitude) of <[z]>. + + <<cabsf>> is identical to <<cabs>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The cabs functions return the complex absolute value. + +PORTABILITY + <<cabs>> and <<cabsf>> are ISO C99 + +QUICKREF + <<cabs>> and <<cabsf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> + +double +cabs(double complex z) +{ + + return hypot( creal(z), cimag(z) ); +} diff --git a/lib/mlibc/options/ansi/generic/complex/cabsf.c b/lib/mlibc/options/ansi/generic/complex/cabsf.c new file mode 100644 index 0000000..635e23e --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cabsf.c @@ -0,0 +1,19 @@ +/* $NetBSD: cabsf.c,v 1.1 2007/08/20 16:01:30 drochner Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float +cabsf(float complex z) +{ + + return hypotf( crealf(z), cimagf(z) ); +} diff --git a/lib/mlibc/options/ansi/generic/complex/cacos.c b/lib/mlibc/options/ansi/generic/complex/cacos.c new file mode 100644 index 0000000..86e1198 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cacos.c @@ -0,0 +1,99 @@ +/* $NetBSD: cacos.c,v 1.1 2007/08/20 16:01:30 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<cacos>>, <<cacosf>>---complex arc cosine + +INDEX + cacos +INDEX + cacosf + +ANSI_SYNOPSIS + #include <complex.h> + double complex cacos(double complex <[z]>); + float complex cacosf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex arc cosine of <[z]>, + with branch cuts outside the interval [-1, +1] along the real axis. + + <<cacosf>> is identical to <<cacos>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + These functions return the complex arc cosine value, in the range + of a strip mathematically unbounded along the imaginary axis + and in the interval [0, pi] along the real axis. + @end ifnottex + @tex + These functions return the complex arc cosine value, in the range + of a strip mathematically unbounded along the imaginary axis + and in the interval [<<0>>, $\pi$] along the real axis. + @end tex + +PORTABILITY + <<cacos>> and <<cacosf>> are ISO C99 + +QUICKREF + <<cacos>> and <<cacosf>> are ISO C99 + +*/ + +#include <complex.h> +#include <math.h> + +double complex +cacos(double complex z) +{ + double complex w; + + /* FIXME: The original NetBSD code results in an ICE when trying to + build this function on ARM/Thumb using gcc 4.5.1. For now we use + a hopefully temporary workaround. */ +#if 0 + w = casin(z); + w = (M_PI_2 - creal(w)) - cimag(w) * I; +#else + double complex tmp0, tmp1; + + tmp0 = casin(z); + tmp1 = M_PI_2 - creal(tmp0); + w = tmp1 - (cimag(tmp0) * I); +#endif + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cacosf.c b/lib/mlibc/options/ansi/generic/complex/cacosf.c new file mode 100644 index 0000000..3874dd5 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cacosf.c @@ -0,0 +1,46 @@ +/* $NetBSD: cacosf.c,v 1.1 2007/08/20 16:01:30 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +cacosf(float complex z) +{ + float complex w; + + w = casinf(z); + w = ((float)M_PI_2 - crealf(w)) - cimagf(w) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cacosh.c b/lib/mlibc/options/ansi/generic/complex/cacosh.c new file mode 100644 index 0000000..3d42c40 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cacosh.c @@ -0,0 +1,93 @@ +/* $NetBSD: cacosh.c,v 1.2 2009/08/03 19:41:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<cacosh>>, <<cacoshf>>---complex arc hyperbolic cosine + +INDEX + cacosh +INDEX + cacoshf + +ANSI_SYNOPSIS + #include <complex.h> + double complex cacosh(double complex <[z]>); + float complex cacoshf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex arc hyperbolic cosine of <[z]>, + with a branch cut at values less than 1 along the real axis. + + <<cacoshf>> is identical to <<cacosh>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + These functions return the complex arc hyperbolic cosine value, + in the range of a half-strip of non-negative values along the + real axis and in the interval [-i * pi, +i * pi] along the + imaginary axis. + @end ifnottex + @tex + These functions return the complex arc hyperbolic cosine value, + in the range of a half-strip of non-negative values along the + real axis and in the interval [$-i\pi$, $+i\pi$] along the + imaginary axis. + @end tex + +PORTABILITY + <<cacosh>> and <<cacoshf>> are ISO C99 + +QUICKREF + <<cacosh>> and <<cacoshf>> are ISO C99 + +*/ + + +#include <complex.h> + +double complex +cacosh(double complex z) +{ + double complex w; + +#if 0 /* does not give the principal value */ + w = I * cacos(z); +#else + w = clog(z + csqrt(z + 1) * csqrt(z - 1)); +#endif + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cacoshf.c b/lib/mlibc/options/ansi/generic/complex/cacoshf.c new file mode 100644 index 0000000..41a557a --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cacoshf.c @@ -0,0 +1,48 @@ +/* $NetBSD: cacoshf.c,v 1.2 2009/08/03 19:41:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> + +float complex +cacoshf(float complex z) +{ + float complex w; + +#if 0 /* does not give the principal value */ + w = I * cacosf(z); +#else + w = clogf(z + csqrtf(z + 1) * csqrtf(z - 1)); +#endif + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/carg.c b/lib/mlibc/options/ansi/generic/complex/carg.c new file mode 100644 index 0000000..0447420 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/carg.c @@ -0,0 +1,59 @@ +/* $NetBSD: carg.c,v 1.1 2007/08/20 16:01:31 drochner Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<carg>>, <<cargf>>---argument (phase angle) + +INDEX + carg +INDEX + cargf + +ANSI_SYNOPSIS + #include <complex.h> + double carg(double complex <[z]>); + float cargf(float complex <[z]>); + + +DESCRIPTION + These functions compute the argument (also called phase angle) + of <[z]>, with a branch cut along the negative real axis. + + <<cargf>> is identical to <<carg>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + The carg functions return the value of the argument in the + interval [-pi, +pi] + @end ifnottex + @tex + The carg functions return the value of the argument in the + interval [$-\pi$, $+\pi$] + @end tex + +PORTABILITY + <<carg>> and <<cargf>> are ISO C99 + +QUICKREF + <<carg>> and <<cargf>> are ISO C99 + +*/ + +#include <complex.h> +#include <math.h> + +double +carg(double complex z) +{ + + return atan2( cimag(z) , creal(z) ); +} diff --git a/lib/mlibc/options/ansi/generic/complex/cargf.c b/lib/mlibc/options/ansi/generic/complex/cargf.c new file mode 100644 index 0000000..1683d21 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cargf.c @@ -0,0 +1,19 @@ +/* $NetBSD: cargf.c,v 1.1 2007/08/20 16:01:31 drochner Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float +cargf(float complex z) +{ + + return atan2f( cimagf(z), crealf(z) ); +} diff --git a/lib/mlibc/options/ansi/generic/complex/casin.c b/lib/mlibc/options/ansi/generic/complex/casin.c new file mode 100644 index 0000000..5019fd8 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/casin.c @@ -0,0 +1,165 @@ +/* $NetBSD: casin.c,v 1.1 2007/08/20 16:01:31 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<casin>>, <<casinf>>---complex arc sine + +INDEX + casin +INDEX + casinf + +ANSI_SYNOPSIS + #include <complex.h> + double complex casin(double complex <[z]>); + float complex casinf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex arc sine of <[z]>, + with branch cuts outside the interval [-1, +1] along the real axis. + + <<casinf>> is identical to <<casin>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + These functions return the complex arc sine value, in the range + of a strip mathematically unbounded along the imaginary axis + and in the interval [-pi/2, +pi/2] along the real axis. + @end ifnottex + @tex + These functions return the complex arc sine value, in the range + of a strip mathematically unbounded along the imaginary axis + and in the interval [$-\pi/2$, $+\pi/2$] along the real axis. + @end tex + +PORTABILITY + <<casin>> and <<casinf>> are ISO C99 + +QUICKREF + <<casin>> and <<casinf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> + +#ifdef __weak_alias +__weak_alias(casin, _casin) +#endif + +double complex +casin(double complex z) +{ + double complex w; + double complex ca, ct, zz, z2; + double x, y; + + x = creal(z); + y = cimag(z); + +#if 0 /* MD: test is incorrect, casin(>1) is defined */ + if (y == 0.0) { + if (fabs(x) > 1.0) { + w = M_PI_2 + 0.0 * I; +#if 0 + mtherr ("casin", DOMAIN); +#endif + } else { + w = asin(x) + 0.0 * I; + } + return w; + } +#endif + +/* Power series expansion */ +/* +b = cabs(z); +if( b < 0.125 ) +{ +z2.r = (x - y) * (x + y); +z2.i = 2.0 * x * y; + +cn = 1.0; +n = 1.0; +ca.r = x; +ca.i = y; +sum.r = x; +sum.i = y; +do + { + ct.r = z2.r * ca.r - z2.i * ca.i; + ct.i = z2.r * ca.i + z2.i * ca.r; + ca.r = ct.r; + ca.i = ct.i; + + cn *= n; + n += 1.0; + cn /= n; + n += 1.0; + b = cn/n; + + ct.r *= b; + ct.i *= b; + sum.r += ct.r; + sum.i += ct.i; + b = fabs(ct.r) + fabs(ct.i); + } +while( b > MACHEP ); +w->r = sum.r; +w->i = sum.i; +return; +} +*/ + + + ca = x + y * I; + ct = ca * I; + /* sqrt( 1 - z*z) */ + /* cmul( &ca, &ca, &zz ) */ + /*x * x - y * y */ + zz = (x - y) * (x + y) + (2.0 * x * y) * I; + + zz = 1.0 - creal(zz) - cimag(zz) * I; + z2 = csqrt(zz); + + zz = ct + z2; + zz = clog(zz); + /* multiply by 1/i = -i */ + w = zz * (-1.0 * I); + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/casinf.c b/lib/mlibc/options/ansi/generic/complex/casinf.c new file mode 100644 index 0000000..9a9f759 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/casinf.c @@ -0,0 +1,122 @@ +/* $NetBSD: casinf.c,v 1.1 2007/08/20 16:01:31 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +#ifdef __weak_alias +__weak_alias(casinf, _casinf) +#endif + +float complex +casinf(float complex z) +{ + float complex w; + float complex ca, ct, zz, z2; + float x, y; + + x = crealf(z); + y = cimagf(z); + +#if 0 /* MD: test is incorrect, casin(>1) is defined */ + if (y == 0.0f) { + if (fabsf(x) > 1.0) { + w = M_PI_2 + 0.0f * I; +#if 0 + mtherr ("casin", DOMAIN); +#endif + } else { + w = asinf(x) + 0.0f * I; + } + return w; + } +#endif + +/* Power series expansion */ +/* +b = cabsf(z); +if( b < 0.125 ) +{ +z2.r = (x - y) * (x + y); +z2.i = 2.0 * x * y; + +cn = 1.0; +n = 1.0; +ca.r = x; +ca.i = y; +sum.r = x; +sum.i = y; +do + { + ct.r = z2.r * ca.r - z2.i * ca.i; + ct.i = z2.r * ca.i + z2.i * ca.r; + ca.r = ct.r; + ca.i = ct.i; + + cn *= n; + n += 1.0; + cn /= n; + n += 1.0; + b = cn/n; + + ct.r *= b; + ct.i *= b; + sum.r += ct.r; + sum.i += ct.i; + b = fabsf(ct.r) + fabsf(ct.i); + } +while( b > MACHEP ); +w->r = sum.r; +w->i = sum.i; +return; +} +*/ + + + ca = x + y * I; + ct = ca * I; + /* sqrt( 1 - z*z) */ + /* cmul( &ca, &ca, &zz ) */ + /*x * x - y * y */ + zz = (x - y) * (x + y) + (2.0f * x * y) * I; + + zz = 1.0f - crealf(zz) - cimagf(zz) * I; + z2 = csqrtf(zz); + + zz = ct + z2; + zz = clogf(zz); + /* multiply by 1/i = -i */ + w = zz * (-1.0f * I); + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/casinh.c b/lib/mlibc/options/ansi/generic/complex/casinh.c new file mode 100644 index 0000000..16238a6 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/casinh.c @@ -0,0 +1,97 @@ +/* $NetBSD: casinh.c,v 1.1 2007/08/20 16:01:31 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<casinh>>, <<casinhf>>---complex arc hyperbolic sine + +INDEX + casinh +INDEX + casinhf + +ANSI_SYNOPSIS + #include <complex.h> + double complex casinh(double complex <[z]>); + float complex casinhf(float complex <[z]>); + + +DESCRIPTION + @ifnottex + These functions compute the complex arc hyperbolic sine of <[z]>, + with branch cuts outside the interval [-i, +i] along the + imaginary axis. + @end ifnottex + @tex + These functions compute the complex arc hyperbolic sine of <[z]>, + with branch cuts outside the interval [$-i$, $+i$] along the + imaginary axis. + @end tex + + <<casinhf>> is identical to <<casinh>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + These functions return the complex arc hyperbolic sine value, + in the range of a strip mathematically unbounded along the + real axis and in the interval [-i*p/2, +i*p/2] along the + imaginary axis. + @end ifnottex + @tex + These functions return the complex arc hyperbolic sine value, + in the range of a strip mathematically unbounded along the + real axis and in the interval [$-i\pi/2$, $+i\pi/2$] along the + imaginary axis. + @end tex + +PORTABILITY + <<casinh>> and <<casinhf>> are ISO C99 + +QUICKREF + <<casinh>> and <<casinhf>> are ISO C99 + +*/ + + +#include <complex.h> + +double complex +casinh(double complex z) +{ + double complex w; + + w = -1.0 * I * casin(z * I); + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/casinhf.c b/lib/mlibc/options/ansi/generic/complex/casinhf.c new file mode 100644 index 0000000..0db55a0 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/casinhf.c @@ -0,0 +1,44 @@ +/* $NetBSD: casinhf.c,v 1.1 2007/08/20 16:01:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> + +float complex +casinhf(float complex z) +{ + float complex w; + + w = -1.0f * I * casinf(z * I); + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/catan.c b/lib/mlibc/options/ansi/generic/complex/catan.c new file mode 100644 index 0000000..0cf4739 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/catan.c @@ -0,0 +1,130 @@ +/* $NetBSD: catan.c,v 1.1 2007/08/20 16:01:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<catan>>, <<catanf>>---complex arc tangent + +INDEX + catan +INDEX + catanf + +ANSI_SYNOPSIS + #include <complex.h> + double complex catan(double complex <[z]>); + float complex catanf(float complex <[z]>); + + +DESCRIPTION + @ifnottex + These functions compute the complex arc tangent of <[z]>, + with branch cuts outside the interval [-i, +i] along the + imaginary axis. + @end ifnottex + @tex + These functions compute the complex arc tangent of <[z]>, + with branch cuts outside the interval [$-i$, $+i$] along the + imaginary axis. + @end tex + + <<catanf>> is identical to <<catan>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + These functions return the complex arc tangent value, in the range + of a strip mathematically unbounded along the imaginary axis + and in the interval [-pi/2, +pi/2] along the real axis. + @end ifnottex + @tex + These functions return the complex arc tangent, in the range + of a strip mathematically unbounded along the imaginary axis + and in the interval [$-\pi/2$, $+\pi/2$] along the real axis. + @end tex + +PORTABILITY + <<catan>> and <<catanf>> are ISO C99 + +QUICKREF + <<catan>> and <<catanf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> +#include "cephes_subr.h" + +#ifdef __weak_alias +__weak_alias(catan, _catan) +#endif + +double complex +catan(double complex z) +{ + double complex w; + double a, t, x, x2, y; + + x = creal(z); + y = cimag(z); + + if ((x == 0.0) && (y > 1.0)) + goto ovrf; + + x2 = x * x; + a = 1.0 - x2 - (y * y); + if (a == 0.0) + goto ovrf; + + t = 0.5 * atan2(2.0 * x, a); + w = __mlibc_redupi(t); + + t = y - 1.0; + a = x2 + (t * t); + if (a == 0.0) + goto ovrf; + + t = y + 1.0; + a = (x2 + (t * t))/a; + w = w + (0.25 * log(a)) * I; + return w; + +ovrf: +#if 0 + mtherr ("catan", OVERFLOW); +#endif + w = HUGE_VAL + HUGE_VAL * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/catanf.c b/lib/mlibc/options/ansi/generic/complex/catanf.c new file mode 100644 index 0000000..33c47df --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/catanf.c @@ -0,0 +1,79 @@ +/* $NetBSD: catanf.c,v 1.1 2007/08/20 16:01:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> +#include "cephes_subrf.h" + +#ifdef __weak_alias +__weak_alias(catanf, _catanf) +#endif + +float complex +catanf(float complex z) +{ + float complex w; + float a, t, x, x2, y; + + x = crealf(z); + y = cimagf(z); + + if ((x == 0.0f) && (y > 1.0f)) + goto ovrf; + + x2 = x * x; + a = 1.0f - x2 - (y * y); + if (a == 0.0f) + goto ovrf; + + t = 0.5f * atan2f(2.0f * x, a); + w = __mlibc_redupif(t); + + t = y - 1.0f; + a = x2 + (t * t); + if (a == 0.0f) + goto ovrf; + + t = y + 1.0f; + a = (x2 + (t * t))/a; + w = w + (0.25f * logf(a)) * I; + return w; + +ovrf: +#if 0 + mtherr ("catan", OVERFLOW); +#endif + w = HUGE_VALF + HUGE_VALF * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/catanh.c b/lib/mlibc/options/ansi/generic/complex/catanh.c new file mode 100644 index 0000000..2b9ef9e --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/catanh.c @@ -0,0 +1,90 @@ +/* $NetBSD: catanh.c,v 1.1 2007/08/20 16:01:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<catanh>>, <<catanhf>>---complex arc hyperbolic tangent + +INDEX + catanh +INDEX + catanhf + +ANSI_SYNOPSIS + #include <complex.h> + double complex catanh(double complex <[z]>); + float complex catanhf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex arc hyperbolic tan of <[z]>, + with branch cuts outside the interval [-1, +1] along the + real axis. + + <<catanhf>> is identical to <<catanh>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + These functions return the complex arc hyperbolic tangent value, + in the range of a strip mathematically unbounded along the + real axis and in the interval [-i*p/2, +i*p/2] along the + imaginary axis. + @end ifnottex + @tex + These functions return the complex arc hyperbolic tangent value, + in the range of a strip mathematically unbounded along the + real axis and in the interval [$-i\pi/2$, $+i\pi/2$] along the + imaginary axis. + @end tex + +PORTABILITY + <<catanh>> and <<catanhf>> are ISO C99 + +QUICKREF + <<catanh>> and <<catanhf>> are ISO C99 + +*/ + + +#include <complex.h> + +double complex +catanh(double complex z) +{ + double complex w; + + w = -1.0 * I * catan(z * I); + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/catanhf.c b/lib/mlibc/options/ansi/generic/complex/catanhf.c new file mode 100644 index 0000000..fe6127a --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/catanhf.c @@ -0,0 +1,44 @@ +/* $NetBSD: catanhf.c,v 1.1 2007/08/20 16:01:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> + +float complex +catanhf(float complex z) +{ + float complex w; + + w = -1.0f * I * catanf(z * I); + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ccos.c b/lib/mlibc/options/ansi/generic/complex/ccos.c new file mode 100644 index 0000000..ebb52bf --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ccos.c @@ -0,0 +1,81 @@ +/* $NetBSD: ccos.c,v 1.1 2007/08/20 16:01:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<ccos>>, <<ccosf>>---complex cosine + +INDEX + ccos +INDEX + ccosf + +ANSI_SYNOPSIS + #include <complex.h> + double complex ccos(double complex <[z]>); + float complex ccosf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex cosine of <[z]>. + + <<ccosf>> is identical to <<ccos>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + These functions return the complex cosine value. + +PORTABILITY + <<ccos>> and <<ccosf>> are ISO C99 + +QUICKREF + <<ccos>> and <<ccosf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> +#include "cephes_subr.h" + +double complex +ccos(double complex z) +{ + double complex w; + double ch, sh; + + __mlibc_cchsh(cimag(z), &ch, &sh); + w = cos(creal(z)) * ch - (sin(creal(z)) * sh) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ccosf.c b/lib/mlibc/options/ansi/generic/complex/ccosf.c new file mode 100644 index 0000000..db7fab3 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ccosf.c @@ -0,0 +1,48 @@ +/* $NetBSD: ccosf.c,v 1.1 2007/08/20 16:01:33 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> +#include "cephes_subrf.h" + +float complex +ccosf(float complex z) +{ + float complex w; + float ch, sh; + + __mlibc_cchshf(cimagf(z), &ch, &sh); + w = cosf(crealf(z)) * ch - (sinf(crealf(z)) * sh) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ccosh.c b/lib/mlibc/options/ansi/generic/complex/ccosh.c new file mode 100644 index 0000000..223a5ed --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ccosh.c @@ -0,0 +1,81 @@ +/* $NetBSD: ccosh.c,v 1.1 2007/08/20 16:01:33 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<ccosh>>, <<ccoshf>>---complex hyperbolic cosine + +INDEX + ccosh +INDEX + ccoshf + +ANSI_SYNOPSIS + #include <complex.h> + double complex ccosh(double complex <[z]>); + float complex ccoshf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex hyperbolic cosine of <[z]>. + + <<ccoshf>> is identical to <<ccosh>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + These functions return the complex hyperbolic cosine value. + +PORTABILITY + <<ccosh>> and <<ccoshf>> are ISO C99 + +QUICKREF + <<ccosh>> and <<ccoshf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> + +double complex +ccosh(double complex z) +{ + double complex w; + double x, y; + + x = creal(z); + y = cimag(z); + w = cosh(x) * cos(y) + (sinh(x) * sin(y)) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ccoshf.c b/lib/mlibc/options/ansi/generic/complex/ccoshf.c new file mode 100644 index 0000000..af11353 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ccoshf.c @@ -0,0 +1,48 @@ +/* $NetBSD: ccoshf.c,v 1.1 2007/08/20 16:01:33 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +ccoshf(float complex z) +{ + float complex w; + float x, y; + + x = crealf(z); + y = cimagf(z); + w = coshf(x) * cosf(y) + (sinhf(x) * sinf(y)) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cephes_subr.c b/lib/mlibc/options/ansi/generic/complex/cephes_subr.c new file mode 100644 index 0000000..fe08b42 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cephes_subr.c @@ -0,0 +1,126 @@ +/* $NetBSD: cephes_subr.c,v 1.1 2007/08/20 16:01:33 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> +#include "cephes_subr.h" + +/* calculate cosh and sinh */ + +void +__mlibc_cchsh(double x, double *c, double *s) +{ + double e, ei; + + if (fabs(x) <= 0.5) { + *c = cosh(x); + *s = sinh(x); + } else { + e = exp(x); + ei = 0.5 / e; + e = 0.5 * e; + *s = e - ei; + *c = e + ei; + } +} + +/* Program to subtract nearest integer multiple of PI */ + +/* extended precision value of PI: */ +static const double DP1 = 3.14159265160560607910E0; +static const double DP2 = 1.98418714791870343106E-9; +static const double DP3 = 1.14423774522196636802E-17; +#define MACHEP 1.1e-16 + +double +__mlibc_redupi(double x) +{ + double t; + long i; + + t = x / M_PI; + if (t >= 0.0) + t += 0.5; + else + t -= 0.5; + + i = t; /* the multiple */ + t = i; + t = ((x - t * DP1) - t * DP2) - t * DP3; + return t; +} + +/* Taylor series expansion for cosh(2y) - cos(2x) */ + +double +__mlibc_ctans(double complex z) +{ + double f, x, x2, y, y2, rn, t; + double d; + + x = fabs(2.0 * creal(z)); + y = fabs(2.0 * cimag(z)); + + x = __mlibc_redupi(x); + + x = x * x; + y = y * y; + x2 = 1.0; + y2 = 1.0; + f = 1.0; + rn = 0.0; + d = 0.0; + do { + rn += 1.0; + f *= rn; + rn += 1.0; + f *= rn; + x2 *= x; + y2 *= y; + t = y2 + x2; + t /= f; + d += t; + + rn += 1.0; + f *= rn; + rn += 1.0; + f *= rn; + x2 *= x; + y2 *= y; + t = y2 - x2; + t /= f; + d += t; + } while (fabs(t/d) > MACHEP); + return d; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cephes_subr.h b/lib/mlibc/options/ansi/generic/complex/cephes_subr.h new file mode 100644 index 0000000..719075e --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cephes_subr.h @@ -0,0 +1,9 @@ +/* $NetBSD: cephes_subr.h,v 1.1 2007/08/20 16:01:33 drochner Exp $ */ + +#ifndef __MLIBC_ABI_ONLY + +void __mlibc_cchsh(double, double *, double *); +double __mlibc_redupi(double); +double __mlibc_ctans(double complex); + +#endif /* !__MLIBC_ABI_ONLY */ diff --git a/lib/mlibc/options/ansi/generic/complex/cephes_subrf.c b/lib/mlibc/options/ansi/generic/complex/cephes_subrf.c new file mode 100644 index 0000000..1ce18e5 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cephes_subrf.c @@ -0,0 +1,125 @@ +/* $NetBSD: cephes_subrf.c,v 1.1 2007/08/20 16:01:34 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> +#include "cephes_subrf.h" + +/* calculate cosh and sinh */ + +void +__mlibc_cchshf(float x, float *c, float *s) +{ + float e, ei; + + if (fabsf(x) <= 0.5f) { + *c = coshf(x); + *s = sinhf(x); + } else { + e = expf(x); + ei = 0.5f / e; + e = 0.5f * e; + *s = e - ei; + *c = e + ei; + } +} + +/* Program to subtract nearest integer multiple of PI */ + +/* extended precision value of PI: */ +static const double DP1 = 3.140625; +static const double DP2 = 9.67502593994140625E-4; +static const double DP3 = 1.509957990978376432E-7; +#define MACHEPF 3.0e-8 + +float +__mlibc_redupif(float x) +{ + float t; + long i; + + t = x / (float)M_PI; + if (t >= 0.0f) + t += 0.5f; + else + t -= 0.5f; + + i = t; /* the multiple */ + t = i; + t = ((x - t * DP1) - t * DP2) - t * DP3; + return t; +} + +/* Taylor series expansion for cosh(2y) - cos(2x) */ + +float +__mlibc_ctansf(float complex z) +{ + float f, x, x2, y, y2, rn, t, d; + + x = fabsf(2.0f * crealf(z)); + y = fabsf(2.0f * cimagf(z)); + + x = __mlibc_redupif(x); + + x = x * x; + y = y * y; + x2 = 1.0f; + y2 = 1.0f; + f = 1.0f; + rn = 0.0f; + d = 0.0f; + do { + rn += 1.0f; + f *= rn; + rn += 1.0f; + f *= rn; + x2 *= x; + y2 *= y; + t = y2 + x2; + t /= f; + d += t; + + rn += 1.0f; + f *= rn; + rn += 1.0f; + f *= rn; + x2 *= x; + y2 *= y; + t = y2 - x2; + t /= f; + d += t; + } while (fabsf(t/d) > MACHEPF); + return d; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cephes_subrf.h b/lib/mlibc/options/ansi/generic/complex/cephes_subrf.h new file mode 100644 index 0000000..84cdd82 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cephes_subrf.h @@ -0,0 +1,9 @@ +/* $NetBSD: cephes_subrf.h,v 1.1 2007/08/20 16:01:34 drochner Exp $ */ + +#ifndef __MLIBC_ABI_ONLY + +void __mlibc_cchshf(float, float *, float *); +float __mlibc_redupif(float); +float __mlibc_ctansf(float complex); + +#endif /* !__MLIBC_ABI_ONLY */ diff --git a/lib/mlibc/options/ansi/generic/complex/cexp.c b/lib/mlibc/options/ansi/generic/complex/cexp.c new file mode 100644 index 0000000..b9a3fd0 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cexp.c @@ -0,0 +1,82 @@ +/* $NetBSD: cexp.c,v 1.1 2007/08/20 16:01:34 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<cexp>>, <<cexpf>>---complex base-e exponential + +INDEX + cexp +INDEX + cexpf + +ANSI_SYNOPSIS + #include <complex.h> + double complex cexp(double complex <[z]>); + float complex cexpf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex base-<[e]> exponential of <[z]>. + + <<cexpf>> is identical to <<cexp>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The cexp functions return the complex base-<[e]> exponential value. + +PORTABILITY + <<cexp>> and <<cexpf>> are ISO C99 + +QUICKREF + <<cexp>> and <<cexpf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> + +double complex +cexp(double complex z) +{ + double complex w; + double r, x, y; + + x = creal(z); + y = cimag(z); + r = exp(x); + w = r * cos(y) + r * sin(y) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cexpf.c b/lib/mlibc/options/ansi/generic/complex/cexpf.c new file mode 100644 index 0000000..07fab1f --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cexpf.c @@ -0,0 +1,49 @@ +/* $NetBSD: cexpf.c,v 1.1 2007/08/20 16:01:34 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +cexpf(float complex z) +{ + float complex w; + float r, x, y; + + x = crealf(z); + y = cimagf(z); + r = expf(x); + w = r * cosf(y) + r * sinf(y) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cimag.c b/lib/mlibc/options/ansi/generic/complex/cimag.c new file mode 100644 index 0000000..24619f0 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cimag.c @@ -0,0 +1,54 @@ +/* $NetBSD: cimag.c,v 1.2 2010/09/15 16:11:29 christos Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<cimag>>, <<cimagf>>---imaginary part + +INDEX + cimag +INDEX + cimagf + +ANSI_SYNOPSIS + #include <complex.h> + double cimag(double complex <[z]>); + float cimagf(float complex <[z]>); + + +DESCRIPTION + These functions compute the imaginary part of <[z]>. + + <<cimagf>> is identical to <<cimag>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The cimag functions return the imaginary part value (as a real). + +PORTABILITY + <<cimag>> and <<cimagf>> are ISO C99 + +QUICKREF + <<cimag>> and <<cimagf>> are ISO C99 + +*/ + + +#include <complex.h> + +#include "fdlibm.h" + +double +cimag(double complex z) +{ + double_complex w = { .z = z }; + + return (IMAG_PART(w)); +} diff --git a/lib/mlibc/options/ansi/generic/complex/cimagf.c b/lib/mlibc/options/ansi/generic/complex/cimagf.c new file mode 100644 index 0000000..28ed81c --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cimagf.c @@ -0,0 +1,21 @@ +/* $NetBSD: cimagf.c,v 1.2 2010/09/15 16:11:29 christos Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> + +#include "fdlibm.h" + +float +cimagf(float complex z) +{ + float_complex w = { .z = z }; + + return (IMAG_PART(w)); +} diff --git a/lib/mlibc/options/ansi/generic/complex/clog.c b/lib/mlibc/options/ansi/generic/complex/clog.c new file mode 100644 index 0000000..f7ad3d2 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/clog.c @@ -0,0 +1,91 @@ +/* $NetBSD: clog.c,v 1.1 2007/08/20 16:01:35 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<clog>>, <<clogf>>---complex base-e logarithm + +INDEX + clog +INDEX + clogf + +ANSI_SYNOPSIS + #include <complex.h> + double complex clog(double complex <[z]>); + float complex clogf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex natural (base-<[e]>) logarithm + of <[z]>, with a branch cut along the negative real axis. + + <<clogf>> is identical to <<clog>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + The clog functions return the complex natural logarithm value, in + the range of a strip mathematically unbounded along the real axis + and in the interval [-i*pi , +i*pi] along the imaginary axis. + @end ifnottex + @tex + The clog functions return the complex natural logarithm value, in + the range of a strip mathematically unbounded along the real axis + and in the interval [$-i\pi$, $+i\pi$] along the imaginary axis. + @end tex + +PORTABILITY + <<clog>> and <<clogf>> are ISO C99 + +QUICKREF + <<clog>> and <<clogf>> are ISO C99 + +*/ + +#include <complex.h> +#include <math.h> + +double complex +clog(double complex z) +{ + double complex w; + double p, rr; + + rr = cabs(z); + p = log(rr); + rr = atan2(cimag(z), creal(z)); + w = p + rr * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/clogf.c b/lib/mlibc/options/ansi/generic/complex/clogf.c new file mode 100644 index 0000000..078cea5 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/clogf.c @@ -0,0 +1,49 @@ +/* $NetBSD: clogf.c,v 1.1 2007/08/20 16:01:35 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +clogf(float complex z) +{ + float complex w; + float p, rr; + + rr = cabsf(z); + p = logf(rr); + rr = atan2f(cimagf(z), crealf(z)); + w = p + rr * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/conj.c b/lib/mlibc/options/ansi/generic/complex/conj.c new file mode 100644 index 0000000..a761b5a --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/conj.c @@ -0,0 +1,56 @@ +/* $NetBSD: conj.c,v 1.2 2010/09/15 16:11:29 christos Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<conj>>, <<conjf>>---complex conjugate + +INDEX + conj +INDEX + conjf + +ANSI_SYNOPSIS + #include <complex.h> + double complex conj(double complex <[z]>); + float complex conjf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex conjugate of <[z]>, + by reversing the sign of its imaginary part. + + <<conjf>> is identical to <<conj>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The conj functions return the complex conjugate value. + +PORTABILITY + <<conj>> and <<conjf>> are ISO C99 + +QUICKREF + <<conj>> and <<conjf>> are ISO C99 + +*/ + +#include <complex.h> + +#include "fdlibm.h" + +double complex +conj(double complex z) +{ + double_complex w = { .z = z }; + + IMAG_PART(w) = -IMAG_PART(w); + + return (w.z); +} diff --git a/lib/mlibc/options/ansi/generic/complex/conjf.c b/lib/mlibc/options/ansi/generic/complex/conjf.c new file mode 100644 index 0000000..0ca71ef --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/conjf.c @@ -0,0 +1,23 @@ +/* $NetBSD: conjf.c,v 1.2 2010/09/15 16:11:29 christos Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> + +#include "fdlibm.h" + +float complex +conjf(float complex z) +{ + float_complex w = { .z = z }; + + IMAG_PART(w) = -IMAG_PART(w); + + return (w.z); +} diff --git a/lib/mlibc/options/ansi/generic/complex/cpow.c b/lib/mlibc/options/ansi/generic/complex/cpow.c new file mode 100644 index 0000000..b60f7be --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cpow.c @@ -0,0 +1,101 @@ +/* $NetBSD: cpow.c,v 1.1 2007/08/20 16:01:35 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<cpow>>, <<cpowf>>---complex power + +INDEX + cpow +INDEX + cpowf + +ANSI_SYNOPSIS + #include <complex.h> + double complex cpow(double complex <[x]>, double complex <[y]>); + float complex cpowf(float complex <[x]>, float complex <[y]>); + + +DESCRIPTION + @ifnottex + The cpow functions compute the complex power function x^y + power, with a branch cut for the first parameter along the + negative real axis. + @end ifnottex + @tex + The cpow functions compute the complex power function $x^y$ + power, with a branch cut for the first parameter along the + negative real axis. + @end tex + + <<cpowf>> is identical to <<cpow>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The cpow functions return the complex power function value. + +PORTABILITY + <<cpow>> and <<cpowf>> are ISO C99 + +QUICKREF + <<cpow>> and <<cpowf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> + +double complex +cpow(double complex a, double complex z) +{ + double complex w; + double x, y, r, theta, absa, arga; + + x = creal(z); + y = cimag(z); + absa = cabs(a); + if (absa == 0.0) { + return (0.0 + 0.0 * I); + } + arga = carg(a); + r = pow(absa, x); + theta = x * arga; + if (y != 0.0) { + r = r * exp(-y * arga); + theta = theta + y * log(absa); + } + w = r * cos(theta) + (r * sin(theta)) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cpowf.c b/lib/mlibc/options/ansi/generic/complex/cpowf.c new file mode 100644 index 0000000..1e736af --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cpowf.c @@ -0,0 +1,59 @@ +/* $NetBSD: cpowf.c,v 1.1 2007/08/20 16:01:36 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +cpowf(float complex a, float complex z) +{ + float complex w; + float x, y, r, theta, absa, arga; + + x = crealf(z); + y = cimagf(z); + absa = cabsf(a); + if (absa == 0.0f) { + return (0.0f + 0.0f * I); + } + arga = cargf(a); + r = powf(absa, x); + theta = x * arga; + if (y != 0.0f) { + r = r * expf(-y * arga); + theta = theta + y * logf(absa); + } + w = r * cosf(theta) + (r * sinf(theta)) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cproj.c b/lib/mlibc/options/ansi/generic/complex/cproj.c new file mode 100644 index 0000000..0ed50f2 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cproj.c @@ -0,0 +1,105 @@ +/* $NetBSD: cproj.c,v 1.3 2010/09/20 17:51:38 christos Exp $ */ + +/*- + * Copyright (c) 2010 The NetBSD Foundation, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<cproj>>, <<cprojf>>--- Riemann sphere projection + +INDEX + cproj +INDEX + cprojf + +ANSI_SYNOPSIS + #include <complex.h> + double complex cproj(double complex <[z]>); + float complex cprojf(float complex <[z]>); + + +DESCRIPTION + These functions compute a projection of <[z]> onto the Riemann + sphere: <[z]> projects to <[z]> except that all complex infinities + (even those with one infinite part and one NaN part) project + to positive infinity on the real axis. If <[z]> has an infinite part, + then <<cproj>>(<[z]>) is equivalent to + + INFINITY + I * copysign(0.0, cimag(z)) + + <<cprojf>> is identical to <<cproj>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The cproj functions return the value of the projection onto + the Riemann sphere. + +PORTABILITY + <<cproj>> and <<cprojf>> are ISO C99 + +QUICKREF + <<cproj>> and <<cprojf>> are ISO C99 + +*/ + +/*__RCSID("$NetBSD: cproj.c,v 1.3 2010/09/20 17:51:38 christos Exp $"); */ + +#include <complex.h> +#include <math.h> + +#include "fdlibm.h" + +/* + * cproj(double complex z) + * + * These functions return the value of the projection (not stereographic!) + * onto the Riemann sphere. + * + * z projects to z, except that all complex infinities (even those with one + * infinite part and one NaN part) project to positive infinity on the real axis. + * If z has an infinite part, then cproj(z) shall be equivalent to: + * + * INFINITY + I * copysign(0.0, cimag(z)) + */ +double complex +cproj(double complex z) +{ + double_complex w = { .z = z }; + + if (isinf(creal(z)) || isinf(cimag(z))) { +#ifdef __INFINITY + REAL_PART(w) = __INFINITY; +#else + REAL_PART(w) = INFINITY; +#endif + IMAG_PART(w) = copysign(0.0, cimag(z)); + } + + return (w.z); +} diff --git a/lib/mlibc/options/ansi/generic/complex/cprojf.c b/lib/mlibc/options/ansi/generic/complex/cprojf.c new file mode 100644 index 0000000..76c3d8a --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cprojf.c @@ -0,0 +1,67 @@ +/* $NetBSD: cprojf.c,v 1.3 2010/09/20 17:51:38 christos Exp $ */ + +/*- + * Copyright (c) 2010 The NetBSD Foundation, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/*__RCSID("$NetBSD: cprojf.c,v 1.3 2010/09/20 17:51:38 christos Exp $"); */ + +#include <complex.h> +#include <math.h> + +#include "fdlibm.h" + +/* + * cprojf(float complex z) + * + * These functions return the value of the projection (not stereographic!) + * onto the Riemann sphere. + * + * z projects to z, except that all complex infinities (even those with one + * infinite part and one NaN part) project to positive infinity on the real axis. + * If z has an infinite part, then cproj(z) shall be equivalent to: + * + * INFINITY + I * copysign(0.0, cimag(z)) + */ + +float complex +cprojf(float complex z) +{ + float_complex w = { .z = z }; + + if (isinf(crealf(z)) || isinf(cimagf(z))) { +#ifdef __INFINITY + REAL_PART(w) = __INFINITY; +#else + REAL_PART(w) = INFINITY; +#endif + IMAG_PART(w) = copysignf(0.0, cimagf(z)); + } + + return (w.z); +} diff --git a/lib/mlibc/options/ansi/generic/complex/creal.c b/lib/mlibc/options/ansi/generic/complex/creal.c new file mode 100644 index 0000000..07bf96f --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/creal.c @@ -0,0 +1,54 @@ +/* $NetBSD: creal.c,v 1.2 2010/09/15 16:11:29 christos Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<creal>>, <<crealf>>---real part + +INDEX + creal +INDEX + crealf + +ANSI_SYNOPSIS + #include <complex.h> + double creal(double complex <[z]>); + float crealf(float complex <[z]>); + + +DESCRIPTION + These functions compute the real part of <[z]>. + + <<crealf>> is identical to <<creal>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The creal functions return the real part value. + +PORTABILITY + <<creal>> and <<crealf>> are ISO C99 + +QUICKREF + <<creal>> and <<crealf>> are ISO C99 + +*/ + + +#include <complex.h> + +#include "fdlibm.h" + +double +creal(double complex z) +{ + double_complex w = { .z = z }; + + return (REAL_PART(w)); +} diff --git a/lib/mlibc/options/ansi/generic/complex/crealf.c b/lib/mlibc/options/ansi/generic/complex/crealf.c new file mode 100644 index 0000000..245986d --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/crealf.c @@ -0,0 +1,21 @@ +/* $NetBSD: crealf.c,v 1.2 2010/09/15 16:11:29 christos Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> + +#include "fdlibm.h" + +float +crealf(float complex z) +{ + float_complex w = { .z = z }; + + return (REAL_PART(w)); +} diff --git a/lib/mlibc/options/ansi/generic/complex/csin.c b/lib/mlibc/options/ansi/generic/complex/csin.c new file mode 100644 index 0000000..b32d057 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/csin.c @@ -0,0 +1,81 @@ +/* $NetBSD: csin.c,v 1.1 2007/08/20 16:01:36 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<csin>>, <<csinf>>---complex sine + +INDEX + csin +INDEX + csinf + +ANSI_SYNOPSIS + #include <complex.h> + double complex csin(double complex <[z]>); + float complex csinf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex sine of <[z]>. + + <<csinf>> is identical to <<csin>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + These functions return the complex sine value. + +PORTABILITY + <<csin>> and <<csinf>> are ISO C99 + +QUICKREF + <<csin>> and <<csinf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> +#include "cephes_subr.h" + +double complex +csin(double complex z) +{ + double complex w; + double ch, sh; + + __mlibc_cchsh(cimag(z), &ch, &sh); + w = sin(creal(z)) * ch + (cos(creal(z)) * sh) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/csinf.c b/lib/mlibc/options/ansi/generic/complex/csinf.c new file mode 100644 index 0000000..0d81d41 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/csinf.c @@ -0,0 +1,48 @@ +/* $NetBSD: csinf.c,v 1.1 2007/08/20 16:01:36 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> +#include "cephes_subrf.h" + +float complex +csinf(float complex z) +{ + float complex w; + float ch, sh; + + __mlibc_cchshf(cimagf(z), &ch, &sh); + w = sinf(crealf(z)) * ch + (cosf(crealf(z)) * sh) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/csinh.c b/lib/mlibc/options/ansi/generic/complex/csinh.c new file mode 100644 index 0000000..f117162 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/csinh.c @@ -0,0 +1,80 @@ +/* $NetBSD: csinh.c,v 1.1 2007/08/20 16:01:36 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<csinh>>, <<csinhf>>---complex hyperbolic sine + +INDEX + csinh +INDEX + csinhf + +ANSI_SYNOPSIS + #include <complex.h> + double complex csinh(double complex <[z]>); + float complex csinhf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex hyperbolic sine of <[z]>. + + <<ccoshf>> is identical to <<ccosh>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + These functions return the complex hyperbolic sine value. + +PORTABILITY + <<csinh>> and <<csinhf>> are ISO C99 + +QUICKREF + <<csinh>> and <<csinhf>> are ISO C99 + +*/ + +#include <complex.h> +#include <math.h> + +double complex +csinh(double complex z) +{ + double complex w; + double x, y; + + x = creal(z); + y = cimag(z); + w = sinh(x) * cos(y) + (cosh(x) * sin(y)) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/csinhf.c b/lib/mlibc/options/ansi/generic/complex/csinhf.c new file mode 100644 index 0000000..3cd6ba7 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/csinhf.c @@ -0,0 +1,48 @@ +/* $NetBSD: csinhf.c,v 1.1 2007/08/20 16:01:37 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +csinhf(float complex z) +{ + float complex w; + float x, y; + + x = crealf(z); + y = cimagf(z); + w = sinhf(x) * cosf(y) + (coshf(x) * sinf(y)) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/csqrt.c b/lib/mlibc/options/ansi/generic/complex/csqrt.c new file mode 100644 index 0000000..b144b7c --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/csqrt.c @@ -0,0 +1,137 @@ +/* $NetBSD: csqrt.c,v 1.1 2007/08/20 16:01:37 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<csqrt>>, <<csqrtf>>---complex square root + +INDEX + csqrt +INDEX + csqrtf + +ANSI_SYNOPSIS + #include <complex.h> + double complex csqrt(double complex <[z]>); + float complex csqrtf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex square root of <[z]>, with + a branch cut along the negative real axis. + + <<csqrtf>> is identical to <<csqrt>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The csqrt functions return the complex square root value, in + the range of the right halfplane (including the imaginary axis). + +PORTABILITY + <<csqrt>> and <<csqrtf>> are ISO C99 + +QUICKREF + <<csqrt>> and <<csqrtf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> + +double complex +csqrt(double complex z) +{ + double complex w; + double x, y, r, t, scale; + + x = creal (z); + y = cimag (z); + + if (y == 0.0) { + if (x == 0.0) { + w = 0.0 + y * I; + } else { + r = fabs(x); + r = sqrt(r); + if (x < 0.0) { + w = 0.0 + r * I; + } else { + w = r + y * I; + } + } + return w; + } + if (x == 0.0) { + r = fabs(y); + r = sqrt(0.5 * r); + if (y > 0) + w = r + r * I; + else + w = r - r * I; + return w; + } + /* Rescale to avoid internal overflow or underflow. */ + if ((fabs(x) > 4.0) || (fabs(y) > 4.0)) { + x *= 0.25; + y *= 0.25; + scale = 2.0; + } else { +#if 1 + x *= 1.8014398509481984e16; /* 2^54 */ + y *= 1.8014398509481984e16; + scale = 7.450580596923828125e-9; /* 2^-27 */ +#else + x *= 4.0; + y *= 4.0; + scale = 0.5; +#endif + } + w = x + y * I; + r = cabs(w); + if (x > 0) { + t = sqrt(0.5 * r + 0.5 * x); + r = scale * fabs((0.5 * y) / t ); + t *= scale; + } else { + r = sqrt(0.5 * r - 0.5 * x); + t = scale * fabs((0.5 * y) / r); + r *= scale; + } + if (y < 0) + w = t - r * I; + else + w = t + r * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/csqrtf.c b/lib/mlibc/options/ansi/generic/complex/csqrtf.c new file mode 100644 index 0000000..13451fa --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/csqrtf.c @@ -0,0 +1,102 @@ +/* $NetBSD: csqrtf.c,v 1.1 2007/08/20 16:01:37 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +csqrtf(float complex z) +{ + float complex w; + float x, y, r, t, scale; + + x = crealf (z); + y = cimagf (z); + + if (y == 0.0f) { + if (x < 0.0f) { + w = 0.0f + sqrtf(-x) * I; + return w; + } else if (x == 0.0f) { + return (0.0f + y * I); + } else { + w = sqrtf(x) + y * I; + return w; + } + } + + if (x == 0.0f) { + r = fabsf(y); + r = sqrtf(0.5f * r); + if (y > 0) + w = r + r * I; + else + w = r - r * I; + return w; + } + + /* Rescale to avoid internal overflow or underflow. */ + if ((fabsf(x) > 4.0f) || (fabsf(y) > 4.0f)) { + x *= 0.25f; + y *= 0.25f; + scale = 2.0f; + } else { +#if 1 + x *= 6.7108864e7f; /* 2^26 */ + y *= 6.7108864e7f; + scale = 1.220703125e-4f; /* 2^-13 */ +#else + x *= 4.0f; + y *= 4.0f; + scale = 0.5f; +#endif + } + w = x + y * I; + r = cabsf(w); + if( x > 0 ) { + t = sqrtf(0.5f * r + 0.5f * x); + r = scale * fabsf((0.5f * y) / t); + t *= scale; + } else { + r = sqrtf(0.5f * r - 0.5f * x); + t = scale * fabsf((0.5f * y) / r); + r *= scale; + } + + if (y < 0) + w = t - r * I; + else + w = t + r * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ctan.c b/lib/mlibc/options/ansi/generic/complex/ctan.c new file mode 100644 index 0000000..600989d --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ctan.c @@ -0,0 +1,91 @@ +/* $NetBSD: ctan.c,v 1.1 2007/08/20 16:01:37 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<ctan>>, <<ctanf>>---complex tangent + +INDEX + ctan +INDEX + ctanf + +ANSI_SYNOPSIS + #include <complex.h> + double complex ctan(double complex <[z]>); + float complex ctanf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex tangent of <[z]>. + + <<ctanf>> is identical to <<ctan>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + These functions return the complex tangent value. + +PORTABILITY + <<ctan>> and <<ctanf>> are ISO C99 + +QUICKREF + <<ctan>> and <<ctanf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> +#include "cephes_subr.h" + +double complex +ctan(double complex z) +{ + double complex w; + double d; + + d = cos(2.0 * creal(z)) + cosh(2.0 * cimag(z)); + + if (fabs(d) < 0.25) + d = __mlibc_ctans(z); + + if (d == 0.0) { + /* mtherr ("ctan", OVERFLOW); */ + w = HUGE_VAL + HUGE_VAL * I; + return w; + } + + w = sin(2.0 * creal(z)) / d + (sinh(2.0 * cimag(z)) / d) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ctanf.c b/lib/mlibc/options/ansi/generic/complex/ctanf.c new file mode 100644 index 0000000..52360e0 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ctanf.c @@ -0,0 +1,58 @@ +/* $NetBSD: ctanf.c,v 1.1 2007/08/20 16:01:38 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> +#include "cephes_subrf.h" + +float complex +ctanf(float complex z) +{ + float complex w; + float d; + + d = cosf(2.0f * crealf(z)) + coshf(2.0f * cimagf(z)); + + if (fabsf(d) < 0.25f) + d = __mlibc_ctansf(z); + + if (d == 0.0f) { + /* mtherr ("ctan", OVERFLOW); */ + w = HUGE_VALF + HUGE_VALF * I; + return w; + } + + w = sinf(2.0f * crealf(z)) / d + (sinhf(2.0f * cimagf(z)) / d) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ctanh.c b/lib/mlibc/options/ansi/generic/complex/ctanh.c new file mode 100644 index 0000000..db27e5b --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ctanh.c @@ -0,0 +1,83 @@ +/* $NetBSD: ctanh.c,v 1.1 2007/08/20 16:01:38 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<ctanh>>, <<ctanf>>---complex hyperbolic tangent + +INDEX + ctanh +INDEX + ctanhf + +ANSI_SYNOPSIS + #include <complex.h> + double complex ctanh(double complex <[z]>); + float complex ctanhf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex hyperbolic tangent of <[z]>. + + <<ctanhf>> is identical to <<ctanh>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + These functions return the complex hyperbolic tangent value. + +PORTABILITY + <<ctanh>> and <<ctanhf>> are ISO C99 + +QUICKREF + <<ctanh>> and <<ctanhf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> + +double complex +ctanh(double complex z) +{ + double complex w; + double x, y, d; + + x = creal(z); + y = cimag(z); + d = cosh(2.0 * x) + cos(2.0 * y); + w = sinh(2.0 * x) / d + (sin(2.0 * y) / d) * I; + + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ctanhf.c b/lib/mlibc/options/ansi/generic/complex/ctanhf.c new file mode 100644 index 0000000..6aaf20f --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ctanhf.c @@ -0,0 +1,50 @@ +/* $NetBSD: ctanhf.c,v 1.1 2007/08/20 16:01:38 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +ctanhf(float complex z) +{ + float complex w; + float x, y, d; + + x = crealf(z); + y = cimagf(z); + d = coshf(2.0f * x) + cosf(2.0f * y); + w = sinhf(2.0f * x) / d + (sinf(2.0f * y) / d) * I; + + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/fdlibm.h b/lib/mlibc/options/ansi/generic/complex/fdlibm.h new file mode 100644 index 0000000..75cdd2a --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/fdlibm.h @@ -0,0 +1,17 @@ +#ifndef __MLIBC_FDLIBM_H +#define __MLIBC_FDLIBM_H + +#define REAL_PART(z) ((z).parts[0]) +#define IMAG_PART(z) ((z).parts[1]) + +typedef union { + float complex z; + float parts[2]; +} float_complex; + +typedef union { + double complex z; + double parts[2]; +} double_complex; + +#endif diff --git a/lib/mlibc/options/ansi/generic/ctype-stubs.cpp b/lib/mlibc/options/ansi/generic/ctype-stubs.cpp new file mode 100644 index 0000000..3ce76e9 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/ctype-stubs.cpp @@ -0,0 +1,326 @@ + +#include <ctype.h> +#include <wctype.h> + +#include <bits/ensure.h> +#include <mlibc/charset.hpp> + +// -------------------------------------------------------------------------------------- +// char ctype functions. +// -------------------------------------------------------------------------------------- + +int isalpha(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_alpha(cp); +} + +int isdigit(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_digit(cp); +} + +int isxdigit(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_xdigit(cp); +} + +int isalnum(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_alnum(cp); +} + +int ispunct(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_punct(cp); +} + +int isgraph(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_graph(cp); +} + +int isblank(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_blank(cp); +} + +int isspace(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_space(cp); +} + +int isprint(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_print(cp); +} + +int islower(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_lower(cp); +} + +int isupper(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_upper(cp); +} + +int iscntrl(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::generic_is_control(cp); +} + +int isascii(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return cp <= 0x7F; +} + +// -------------------------------------------------------------------------------------- +// wchar_t ctype functions. +// -------------------------------------------------------------------------------------- + +int iswalpha(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_alpha(cp); +} + +int iswdigit(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_digit(cp); +} + +int iswxdigit(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_xdigit(cp); +} + +int iswalnum(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_alnum(cp); +} + +int iswpunct(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_punct(cp); +} + +int iswgraph(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_graph(cp); +} + +int iswblank(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_blank(cp); +} + +int iswspace(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_space(cp); +} + +int iswprint(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_print(cp); +} + +int iswlower(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_lower(cp); +} + +int iswupper(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_upper(cp); +} + +int iswcntrl(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::generic_is_control(cp); +} + +// -------------------------------------------------------------------------------------- +// iswctype functions. +// -------------------------------------------------------------------------------------- + +namespace { + enum { + ct_null, + ct_alnum, + ct_alpha, + ct_blank, + ct_cntrl, + ct_digit, + ct_graph, + ct_lower, + ct_print, + ct_punct, + ct_space, + ct_upper, + ct_xdigit, + ct_count + }; +} + +wctype_t wctype(const char *cs) { + frg::string_view s{cs}; + if(s == "alnum") return ct_alnum; + if(s == "alpha") return ct_alpha; + if(s == "blank") return ct_blank; + if(s == "cntrl") return ct_cntrl; + if(s == "digit") return ct_digit; + if(s == "graph") return ct_graph; + if(s == "lower") return ct_lower; + if(s == "print") return ct_print; + if(s == "punct") return ct_punct; + if(s == "space") return ct_space; + if(s == "upper") return ct_upper; + if(s == "xdigit") return ct_xdigit; + mlibc::infoLogger() << "mlibc: wctype(\"" << cs << "\") is not supported" << frg::endlog; + return ct_null; +} + +int iswctype(wint_t wc, wctype_t type) { + switch (type) { + case ct_alnum: + return iswalnum(wc); + case ct_alpha: + return iswalpha(wc); + case ct_blank: + return iswblank(wc); + case ct_cntrl: + return iswcntrl(wc); + case ct_digit: + return iswdigit(wc); + case ct_graph: + return iswgraph(wc); + case ct_lower: + return iswlower(wc); + case ct_print: + return iswprint(wc); + case ct_punct: + return iswpunct(wc); + case ct_space: + return iswspace(wc); + case ct_upper: + return iswupper(wc); + case ct_xdigit: + return iswxdigit(wc); + } + return 0; +} + +// -------------------------------------------------------------------------------------- +// char conversion functions. +// -------------------------------------------------------------------------------------- + +int tolower(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return nc; + return mlibc::current_charset()->to_lower(cp); +} + +int toupper(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return nc; + return mlibc::current_charset()->to_upper(cp); +} + +// -------------------------------------------------------------------------------------- +// wchar_t conversion functions. +// -------------------------------------------------------------------------------------- + +wint_t towlower(wint_t wc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(wc, cp); e != mlibc::charcode_error::null) + return wc; + return mlibc::current_charset()->to_lower(cp); +} + +wint_t towupper(wint_t wc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(wc, cp); e != mlibc::charcode_error::null) + return wc; + return mlibc::current_charset()->to_upper(cp); +} + diff --git a/lib/mlibc/options/ansi/generic/environment.cpp b/lib/mlibc/options/ansi/generic/environment.cpp new file mode 100644 index 0000000..5625592 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/environment.cpp @@ -0,0 +1,164 @@ +#include <errno.h> +#include <stdlib.h> +#include <stdio.h> + +#include <bits/ensure.h> +#include <mlibc/allocator.hpp> +#include <mlibc/debug.hpp> + +#include <frg/string.hpp> +#include <frg/vector.hpp> + +namespace { + char *empty_environment[] = { nullptr }; +} + +char **environ = empty_environment; + +namespace { + +size_t find_environ_index(frg::string_view name) { + for(size_t i = 0; environ[i]; i++) { + frg::string_view view{environ[i]}; + size_t s = view.find_first('='); + if(s == size_t(-1)) { + mlibc::infoLogger() << "mlibc: environment string \"" + << frg::escape_fmt{view.data(), view.size()} + << "\" does not contain an equals sign (=)" << frg::endlog; + continue; + } + if(view.sub_string(0, s) == name) + return i; + } + + return -1; +} + +// Environment vector that is mutated by putenv() and setenv(). +// Cannot be global as it is accessed during library initialization. +frg::vector<char *, MemoryAllocator> &get_vector() { + static frg::vector<char *, MemoryAllocator> vector{getAllocator()}; + return vector; +} + +void update_vector() { + auto &vector = get_vector(); + if(environ == vector.data()) + return; + + // If the environ variable was changed, we copy the environment. + // Note that we must only copy the pointers but not the strings themselves! + vector.clear(); + for(size_t i = 0; environ[i]; i++) + vector.push(environ[i]); + vector.push(nullptr); + + environ = vector.data(); +} + +void assign_variable(frg::string_view name, const char *string, bool overwrite) { + auto &vector = get_vector(); + __ensure(environ == vector.data()); + + auto k = find_environ_index(name); + if(k != size_t(-1)) { + if(overwrite) + vector[k] = const_cast<char *>(string); + }else{ + // Last pointer of environ must always be a null delimiter. + __ensure(!vector.back()); + vector.back() = const_cast<char *>(string); + vector.push(nullptr); + } + + // push() might have re-allocated the vector. + environ = vector.data(); +} + +void unassign_variable(frg::string_view name) { + auto &vector = get_vector(); + __ensure(environ == vector.data()); + + auto k = find_environ_index(name); + if(k == size_t(-1)) + return; + + // Last pointer of environ must always be a null delimiter. + __ensure(vector.size() >= 2 && !vector.back()); + std::swap(vector[k], vector[vector.size() - 2]); + vector.pop(); + vector.back() = nullptr; + + // pop() might have re-allocated the vector. + environ = vector.data(); +} + +} // anonymous namespace + +char *getenv(const char *name) { + auto k = find_environ_index(name); + if(k == size_t(-1)) + return nullptr; + + frg::string_view view{environ[k]}; + size_t s = view.find_first('='); + __ensure(s != size_t(-1)); + return const_cast<char *>(view.data() + s + 1); +} + +namespace mlibc { + +int putenv(char *string) { + frg::string_view view{string}; + size_t s = view.find_first('='); + if(s == size_t(-1)) + __ensure(!"Environment strings need to contain an equals sign"); + + update_vector(); + assign_variable(view.sub_string(0, s), string, true); + return 0; +} + +} // namespace mlibc + +#if __MLIBC_POSIX_OPTION + +int putenv(char *string) { + return mlibc::putenv(string); +} + +int setenv(const char *name, const char *value, int overwrite) { + frg::string_view view{name}; + size_t s = view.find_first('='); + if(s != size_t(-1)) { + mlibc::infoLogger() << "mlibc: environment variable \"" + << frg::escape_fmt{view.data(), view.size()} << "\" contains an equals sign" + << frg::endlog; + errno = EINVAL; + return -1; + } + + // We never free strings here. TODO: Reuse them? + char *string; + __ensure(asprintf(&string, "%s=%s", name, value) > 0); + __ensure(string); + + update_vector(); + assign_variable(name, string, overwrite); + return 0; +} + +int unsetenv(const char *name) { + update_vector(); + unassign_variable(name); + return 0; +} + +int clearenv(void) { + auto vector = get_vector(); + vector.clear(); + update_vector(); + return 0; +} + +#endif /* __MLIBC_POSIX_OPTION */ diff --git a/lib/mlibc/options/ansi/generic/errno-stubs.cpp b/lib/mlibc/options/ansi/generic/errno-stubs.cpp new file mode 100644 index 0000000..8229a9a --- /dev/null +++ b/lib/mlibc/options/ansi/generic/errno-stubs.cpp @@ -0,0 +1,12 @@ +#include <errno.h> + +int __thread __mlibc_errno; + +char *program_invocation_name = nullptr; +char *program_invocation_short_name = nullptr; +extern char *__progname __attribute__((__weak__, __alias__("program_invocation_short_name"))); +extern char *__progname_full __attribute__((__weak__, __alias__("program_invocation_name"))); + +int *__errno_location() { + return &__mlibc_errno; +} diff --git a/lib/mlibc/options/ansi/generic/fenv-stubs.cpp b/lib/mlibc/options/ansi/generic/fenv-stubs.cpp new file mode 100644 index 0000000..7153844 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/fenv-stubs.cpp @@ -0,0 +1,43 @@ + +#include <bits/ensure.h> +#include <fenv.h> + +// The functions that are not in this file but are defined in the header +// are implemented like musl does in assembly. +extern "C" __attribute__((__visibility__("hidden"))) int __fesetround(int); + +int fegetexceptflag(fexcept_t *, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int feholdexcept(fenv_t *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int fesetexceptflag(const fexcept_t *, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int fesetround(int r) { + if (r != FE_TONEAREST +#ifdef FE_DOWNWARD + && r != FE_DOWNWARD +#endif +#ifdef FE_UPWARD + && r != FE_UPWARD +#endif +#ifdef FE_TOWARDZERO + && r != FE_TOWARDZERO +#endif + ) + return -1; + return __fesetround(r); +} + +int feupdateenv(const fenv_t *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/ansi/generic/file-io.cpp b/lib/mlibc/options/ansi/generic/file-io.cpp new file mode 100644 index 0000000..e59b109 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/file-io.cpp @@ -0,0 +1,745 @@ + +#include <errno.h> +#include <stdlib.h> +#include <stdint.h> +#include <string.h> +#include <stdio.h> +#if __MLIBC_GLIBC_OPTION +#include <stdio_ext.h> +#endif + +#include <bits/ensure.h> + +#include <mlibc/debug.hpp> + +#include <abi-bits/fcntl.h> +#include <frg/allocation.hpp> +#include <frg/mutex.hpp> +#include <mlibc/allocator.hpp> +#include <mlibc/file-io.hpp> +#include <mlibc/ansi-sysdeps.hpp> +#include <mlibc/lock.hpp> + +namespace mlibc { + +// -------------------------------------------------------------------------------------- +// abstract_file implementation. +// -------------------------------------------------------------------------------------- + +namespace { + using file_list = frg::intrusive_list< + abstract_file, + frg::locate_member< + abstract_file, + frg::default_list_hook<abstract_file>, + &abstract_file::_list_hook + > + >; + + // Useful when debugging the FILE implementation. + constexpr bool globallyDisableBuffering = false; + + // The maximum number of characters we permit the user to ungetc. + constexpr size_t ungetBufferSize = 8; + + // List of files that will be flushed before exit(). + file_list &global_file_list() { + static frg::eternal<file_list> list; + return list.get(); + }; +} + +// For pipe-like streams (seek returns ESPIPE), we need to make sure +// that the buffer only ever contains all-dirty or all-clean data. +// Regarding _type and _bufmode: +// As we might construct FILE objects for FDs that are not actually +// open (e.g. for std{in,out,err}), we defer the type determination and cache the result. + +abstract_file::abstract_file(void (*do_dispose)(abstract_file *)) +: _type{stream_type::unknown}, _bufmode{buffer_mode::unknown}, _do_dispose{do_dispose} { + // TODO: For __fwriting to work correctly, set the __io_mode to 1 if the write is write-only. + __buffer_ptr = nullptr; + __unget_ptr = nullptr; + __buffer_size = 4096; + __offset = 0; + __io_offset = 0; + __valid_limit = 0; + __dirty_begin = 0; + __dirty_end = 0; + __io_mode = 0; + __status_bits = 0; + + global_file_list().push_back(this); +} + +abstract_file::~abstract_file() { + if(__dirty_begin != __dirty_end) + mlibc::infoLogger() << "mlibc warning: File is not flushed before destruction" + << frg::endlog; + + if(__buffer_ptr) + getAllocator().free(__buffer_ptr - ungetBufferSize); + + auto it = global_file_list().iterator_to(this); + global_file_list().erase(it); +} + +void abstract_file::dispose() { + if(!_do_dispose) + return; + _do_dispose(this); +} + +// Note that read() and write() are asymmetric: +// While read() can trigger a write-back, write() can never trigger a read-ahead(). +// This peculiarity is reflected in their code. + +int abstract_file::read(char *buffer, size_t max_size, size_t *actual_size) { + __ensure(max_size); + + if(_init_bufmode()) + return -1; + + size_t unget_length = 0; + if (__unget_ptr != __buffer_ptr) { + unget_length = frg::min(max_size, (size_t)(__buffer_ptr - __unget_ptr)); + memcpy(buffer, __unget_ptr, unget_length); + + __unget_ptr += unget_length; + buffer += unget_length; + max_size -= unget_length; + + if (max_size == 0) { + *actual_size = unget_length; + return 0; + } + } + + if(globallyDisableBuffering || _bufmode == buffer_mode::no_buffer) { + size_t io_size; + if(int e = io_read(buffer, max_size, &io_size); e) { + __status_bits |= __MLIBC_ERROR_BIT; + return e; + } + if(!io_size) + __status_bits |= __MLIBC_EOF_BIT; + *actual_size = io_size + unget_length; + return 0; + } + + // Ensure correct buffer type for pipe-like streams. + // TODO: In order to support pipe-like streams we need to write-back the buffer. + if(__io_mode && __valid_limit) + mlibc::panicLogger() << "mlibc: Cannot read-write to same pipe-like stream" + << frg::endlog; + __io_mode = 0; + + // Clear the buffer, then buffer new data. + if(__offset == __valid_limit) { + // TODO: We only have to write-back/reset if __valid_limit reaches the buffer end. + if(int e = _write_back(); e) + return e; + if(int e = _reset(); e) + return e; + + // Perform a read-ahead. + _ensure_allocation(); + size_t io_size; + if(int e = io_read(__buffer_ptr, __buffer_size, &io_size); e) { + __status_bits |= __MLIBC_ERROR_BIT; + return e; + } + if(!io_size) { + __status_bits |= __MLIBC_EOF_BIT; + *actual_size = 0; + return 0; + } + + __io_offset = io_size; + __valid_limit = io_size; + } + + // Return data from the buffer. + __ensure(__offset < __valid_limit); + + auto chunk = frg::min(size_t(__valid_limit - __offset), max_size); + memcpy(buffer, __buffer_ptr + __offset, chunk); + __offset += chunk; + + *actual_size = chunk + unget_length; + return 0; +} + +int abstract_file::write(const char *buffer, size_t max_size, size_t *actual_size) { + __ensure(max_size); + + if(_init_bufmode()) + return -1; + if(globallyDisableBuffering || _bufmode == buffer_mode::no_buffer) { + // As we do not buffer, nothing can be dirty. + __ensure(__dirty_begin == __dirty_end); + size_t io_size; + if(int e = io_write(buffer, max_size, &io_size); e) { + __status_bits |= __MLIBC_ERROR_BIT; + return e; + } + *actual_size = io_size; + return 0; + } + + // Flush the buffer if necessary. + if(__offset == __buffer_size) { + if(int e = _write_back(); e) + return e; + if(int e = _reset(); e) + return e; + } + + // Ensure correct buffer type for pipe-like streams. + // TODO: We could full support pipe-like files + // by ungetc()ing all data before a write happens, + // however, for now we just report an error. + if(!__io_mode && __valid_limit) // TODO: Only check this for pipe-like streams. + mlibc::panicLogger() << "mlibc: Cannot read-write to same pipe-like stream" + << frg::endlog; + __io_mode = 1; + + __ensure(__offset < __buffer_size); + auto chunk = frg::min(__buffer_size - __offset, max_size); + + // Line-buffered streams perform I/O on full lines. + bool flush_line = false; + if(_bufmode == buffer_mode::line_buffer) { + auto nl = reinterpret_cast<char *>(memchr(buffer, '\n', chunk)); + if(nl) { + chunk = nl + 1 - buffer; + flush_line = true; + } + } + __ensure(chunk); + + // Buffer data (without necessarily performing I/O). + _ensure_allocation(); + memcpy(__buffer_ptr + __offset, buffer, chunk); + + if(__dirty_begin != __dirty_end) { + __dirty_begin = frg::min(__dirty_begin, __offset); + __dirty_end = frg::max(__dirty_end, __offset + chunk); + }else{ + __dirty_begin = __offset; + __dirty_end = __offset + chunk; + } + __valid_limit = frg::max(__offset + chunk, __valid_limit); + __offset += chunk; + + // Flush line-buffered streams. + if(flush_line) { + if(_write_back()) + return -1; + } + + *actual_size = chunk; + return 0; +} + +int abstract_file::unget(char c) { + if (!__unget_ptr) { + // This can happen if the file is unbuffered, but we still need + // a space to store ungetc'd data. + __ensure(!__buffer_ptr); + _ensure_allocation(); + __ensure(__unget_ptr); + } + + if ((size_t)(__buffer_ptr - __unget_ptr) + 1 > ungetBufferSize) + return EOF; + else { + *(--__unget_ptr) = c; + return c; + } +} + +int abstract_file::update_bufmode(buffer_mode mode) { + // setvbuf() has undefined behavior if I/O has been performed. + __ensure(__dirty_begin == __dirty_end + && "update_bufmode() must only be called before performing I/O"); + _bufmode = mode; + return 0; +} + +void abstract_file::purge() { + __offset = 0; + __io_offset = 0; + __valid_limit = 0; + __dirty_end = __dirty_begin; + __unget_ptr = __buffer_ptr; +} + +int abstract_file::flush() { + if (__dirty_end != __dirty_begin) { + if (int e = _write_back(); e) + return e; + } + + if (int e = _save_pos(); e) + return e; + purge(); + return 0; +} + +int abstract_file::tell(off_t *current_offset) { + off_t seek_offset; + if(int e = io_seek(0, SEEK_CUR, &seek_offset); e) + return e; + + *current_offset = seek_offset + (off_t(__offset) - off_t(__io_offset)); + return 0; +} + +int abstract_file::seek(off_t offset, int whence) { + if(int e = _write_back(); e) + return e; + + off_t new_offset; + if(whence == SEEK_CUR) { + auto seek_offset = offset + (off_t(__offset) - off_t(__io_offset)); + if(int e = io_seek(seek_offset, whence, &new_offset); e) { + __status_bits |= __MLIBC_ERROR_BIT; + return e; + } + }else{ + __ensure(whence == SEEK_SET || whence == SEEK_END); + if(int e = io_seek(offset, whence, &new_offset); e) { + __status_bits |= __MLIBC_ERROR_BIT; + return e; + } + } + + // We just forget the current buffer. + // TODO: If the seek is "small", we can just modify our internal offset. + purge(); + + return 0; +} + +int abstract_file::_init_type() { + if(_type != stream_type::unknown) + return 0; + + if(int e = determine_type(&_type); e) + return e; + __ensure(_type != stream_type::unknown); + return 0; +} + +int abstract_file::_init_bufmode() { + if(_bufmode != buffer_mode::unknown) + return 0; + + if(determine_bufmode(&_bufmode)) + return -1; + __ensure(_bufmode != buffer_mode::unknown); + return 0; +} + +int abstract_file::_write_back() { + if(int e = _init_type(); e) + return e; + + if(__dirty_begin == __dirty_end) + return 0; + + // For non-pipe streams, first do a seek to reset the + // I/O position to zero, then do a write(). + if(_type == stream_type::file_like) { + if(__io_offset != __dirty_begin) { + __ensure(__dirty_begin - __io_offset > 0); + off_t new_offset; + if(int e = io_seek(off_t(__dirty_begin) - off_t(__io_offset), SEEK_CUR, &new_offset); e) + return e; + __io_offset = __dirty_begin; + } + }else{ + __ensure(_type == stream_type::pipe_like); + __ensure(__io_offset == __dirty_begin); + } + + // Now, we are in the correct position to write-back everything. + while(__io_offset < __dirty_end) { + size_t io_size; + if(int e = io_write(__buffer_ptr + __io_offset, __dirty_end - __io_offset, &io_size); e) { + __status_bits |= __MLIBC_ERROR_BIT; + return e; + } + __ensure(io_size > 0 && "io_write() is expected to always write at least one byte"); + __io_offset += io_size; + __dirty_begin += io_size; + } + + return 0; +} + +int abstract_file::_save_pos() { + if (int e = _init_type(); e) + return e; + if (int e = _init_bufmode(); e) + return e; + + if (_type == stream_type::file_like && _bufmode != buffer_mode::no_buffer) { + off_t new_offset; + auto seek_offset = (off_t(__offset) - off_t(__io_offset)); + if (int e = io_seek(seek_offset, SEEK_CUR, &new_offset); e) { + __status_bits |= __MLIBC_ERROR_BIT; + mlibc::infoLogger() << "hit io_seek() error " << e << frg::endlog; + return e; + } + return 0; + } + return 0; // nothing to do for the rest +} + +int abstract_file::_reset() { + if(int e = _init_type(); e) + return e; + + // For pipe-like files, we must not forget already read data. + // TODO: Report this error to the user. + if(_type == stream_type::pipe_like) + __ensure(__offset == __valid_limit); + + __ensure(__dirty_begin == __dirty_end); + __offset = 0; + __io_offset = 0; + __valid_limit = 0; + + return 0; +} + +// This may still be called when buffering is disabled, for ungetc. +void abstract_file::_ensure_allocation() { + if(__buffer_ptr) + return; + + auto ptr = getAllocator().allocate(__buffer_size + ungetBufferSize); + __buffer_ptr = reinterpret_cast<char *>(ptr) + ungetBufferSize; + __unget_ptr = __buffer_ptr; +} + +// -------------------------------------------------------------------------------------- +// fd_file implementation. +// -------------------------------------------------------------------------------------- + +fd_file::fd_file(int fd, void (*do_dispose)(abstract_file *), bool force_unbuffered) +: abstract_file{do_dispose}, _fd{fd}, _force_unbuffered{force_unbuffered} { } + +int fd_file::fd() { + return _fd; +} + +int fd_file::close() { + if(__dirty_begin != __dirty_end) + mlibc::infoLogger() << "mlibc warning: File is not flushed before closing" + << frg::endlog; + if(int e = mlibc::sys_close(_fd); e) + return e; + return 0; +} + +int fd_file::reopen(const char *path, const char *mode) { + int mode_flags = parse_modestring(mode); + + int fd; + if(int e = sys_open(path, mode_flags, S_IRUSR|S_IWUSR|S_IRGRP|S_IWGRP|S_IROTH|S_IWOTH, &fd); e) { + return e; + } + + flush(); + close(); + getAllocator().deallocate(__buffer_ptr, __buffer_size + ungetBufferSize); + + __buffer_ptr = nullptr; + __unget_ptr = nullptr; + __buffer_size = 4096; + _reset(); + _fd = fd; + + if(mode_flags & O_APPEND) { + seek(0, SEEK_END); + } + + return 0; +} + +int fd_file::determine_type(stream_type *type) { + off_t offset; + int e = mlibc::sys_seek(_fd, 0, SEEK_CUR, &offset); + if(!e) { + *type = stream_type::file_like; + return 0; + }else if(e == ESPIPE) { + *type = stream_type::pipe_like; + return 0; + }else{ + return e; + } +} + +int fd_file::determine_bufmode(buffer_mode *mode) { + // When isatty() is not implemented, we fall back to the safest default (no buffering). + if(!mlibc::sys_isatty) { + MLIBC_MISSING_SYSDEP(); + *mode = buffer_mode::no_buffer; + return 0; + } + if(_force_unbuffered) { + *mode = buffer_mode::no_buffer; + return 0; + } + + if(int e = mlibc::sys_isatty(_fd); !e) { + *mode = buffer_mode::line_buffer; + return 0; + }else if(e == ENOTTY) { + *mode = buffer_mode::full_buffer; + return 0; + }else{ + mlibc::infoLogger() << "mlibc: sys_isatty() failed while determining whether" + " stream is interactive" << frg::endlog; + return -1; + } +} + +int fd_file::io_read(char *buffer, size_t max_size, size_t *actual_size) { + ssize_t s; + if(int e = mlibc::sys_read(_fd, buffer, max_size, &s); e) + return e; + *actual_size = s; + return 0; +} + +int fd_file::io_write(const char *buffer, size_t max_size, size_t *actual_size) { + ssize_t s; + if(int e = mlibc::sys_write(_fd, buffer, max_size, &s); e) + return e; + *actual_size = s; + return 0; +} + +int fd_file::io_seek(off_t offset, int whence, off_t *new_offset) { + if(int e = mlibc::sys_seek(_fd, offset, whence, new_offset); e) + return e; + return 0; +} + +int fd_file::parse_modestring(const char *mode) { + // Consume the first char; this must be 'r', 'w' or 'a'. + int flags = 0; + bool has_plus = strchr(mode, '+'); + if(*mode == 'r') { + if(has_plus) { + flags = O_RDWR; + }else{ + flags = O_RDONLY; + } + }else if(*mode == 'w') { + if(has_plus) { + flags = O_RDWR; + }else{ + flags = O_WRONLY; + } + flags |= O_CREAT | O_TRUNC; + }else if(*mode == 'a') { + if(has_plus) { + flags = O_APPEND | O_RDWR; + }else{ + flags = O_APPEND | O_WRONLY; + } + flags |= O_CREAT; + }else{ + mlibc::infoLogger() << "Illegal fopen() mode '" << *mode << "'" << frg::endlog; + } + mode += 1; + + // Consume additional flags. + while(*mode) { + if(*mode == '+') { + mode++; // This is already handled above. + }else if(*mode == 'b') { + mode++; // mlibc assumes that there is no distinction between text and binary. + }else if(*mode == 'e') { + flags |= O_CLOEXEC; + mode++; + }else{ + mlibc::infoLogger() << "Illegal fopen() flag '" << mode << "'" << frg::endlog; + mode++; + } + } + + return flags; +} + +} // namespace mlibc + +namespace { + mlibc::fd_file stdin_file{0}; + mlibc::fd_file stdout_file{1}; + mlibc::fd_file stderr_file{2, nullptr, true}; + + struct stdio_guard { + stdio_guard() { } + + ~stdio_guard() { + // Only flush the files but do not close them. + for(auto it : mlibc::global_file_list()) { + if(int e = it->flush(); e) + mlibc::infoLogger() << "mlibc warning: Failed to flush file before exit()" + << frg::endlog; + } + } + } global_stdio_guard; +} + +FILE *stderr = &stderr_file; +FILE *stdin = &stdin_file; +FILE *stdout = &stdout_file; + +int fileno_unlocked(FILE *file_base) { + auto file = static_cast<mlibc::fd_file *>(file_base); + return file->fd(); +} + +int fileno(FILE *file_base) { + auto file = static_cast<mlibc::fd_file *>(file_base); + frg::unique_lock lock(file->_lock); + return fileno_unlocked(file_base); +} + +FILE *fopen(const char *path, const char *mode) { + int flags = mlibc::fd_file::parse_modestring(mode); + + int fd; + if(int e = mlibc::sys_open(path, flags, 0666, &fd); e) { + errno = e; + return nullptr; + } + + return frg::construct<mlibc::fd_file>(getAllocator(), fd, + mlibc::file_dispose_cb<mlibc::fd_file>); +} + +int fclose(FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + int e = 0; + if(file->flush()) + e = EOF; + if(file->close()) + e = EOF; + file->dispose(); + return e; +} + +int fseek(FILE *file_base, long offset, int whence) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + if(int e = file->seek(offset, whence); e) { + errno = e; + return -1; + } + return 0; +} + +long ftell(FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + off_t current_offset; + if(int e = file->tell(¤t_offset); e) { + errno = e; + return -1; + } + return current_offset; +} + +int fflush_unlocked(FILE *file_base) { + if(file_base == NULL) { + // Only flush the files but do not close them. + for(auto it : mlibc::global_file_list()) { + if(int e = it->flush(); e) + mlibc::infoLogger() << "mlibc warning: Failed to flush file" + << frg::endlog; + } + return 0; + } + auto file = static_cast<mlibc::abstract_file *>(file_base); + if(file->flush()) + return EOF; + return 0; +} +int fflush(FILE *file_base) { + if(file_base == NULL) { + // Only flush the files but do not close them. + for(auto it : mlibc::global_file_list()) { + frg::unique_lock lock(it->_lock); + if(int e = it->flush(); e) + mlibc::infoLogger() << "mlibc warning: Failed to flush file" + << frg::endlog; + } + return 0; + } + + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + if (file->flush()) + return EOF; + return 0; +} + +int setvbuf(FILE *file_base, char *, int mode, size_t) { + // TODO: We could also honor the buffer, but for now use just set the mode. + auto file = static_cast<mlibc::abstract_file *>(file_base); + if(mode == _IONBF) { + if(int e = file->update_bufmode(mlibc::buffer_mode::no_buffer); e) { + errno = e; + return -1; + } + }else if(mode == _IOLBF) { + if(int e = file->update_bufmode(mlibc::buffer_mode::line_buffer); e) { + errno = e; + return -1; + } + }else if(mode == _IOFBF) { + if(int e = file->update_bufmode(mlibc::buffer_mode::full_buffer); e) { + errno = e; + return -1; + } + }else{ + errno = EINVAL; + return -1; + } + + return 0; +} + +void rewind(FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + file->seek(0, SEEK_SET); + file_base->__status_bits &= ~(__MLIBC_EOF_BIT | __MLIBC_ERROR_BIT); +} + +int ungetc(int c, FILE *file_base) { + if (c == EOF) + return EOF; + + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + return file->unget(c); +} + +#if __MLIBC_GLIBC_OPTION +void __fpurge(FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + file->purge(); +} +#endif + diff --git a/lib/mlibc/options/ansi/generic/inttypes-stubs.cpp b/lib/mlibc/options/ansi/generic/inttypes-stubs.cpp new file mode 100644 index 0000000..ae0f9e7 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/inttypes-stubs.cpp @@ -0,0 +1,100 @@ + +#include <ctype.h> +#include <inttypes.h> +#include <string.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> + +static const char *__mlibc_digits = "0123456789abcdefghijklmnopqrstuvwxyz"; + +intmax_t imaxabs(intmax_t num) { + return num < 0 ? -num : num; +} +imaxdiv_t imaxdiv(intmax_t number, intmax_t denom) { + imaxdiv_t r; + r.quot = number / denom; + r.rem = number % denom; + return r; +} + +template <class T> T strtoxmax(const char *it, char **out, int base) { + T v = 0; + bool negate = false; + const unsigned char *s = (const unsigned char *)it; + int c; + + if(std::is_signed<T>::value) { + if(*s == '+') { + s++; + }else if(*s == '-') { + negate = true; + s++; + } + } + + do { + c = *s++; + } while (isspace(c)); + if ((base == 0 || base == 16) && c == '0' && (*s == 'x' || *s == 'X')) { + c = s[1]; + s += 2; + base = 16; + } + if (base == 0) + base = c == '0' ? 8 : 10; + + if(base == 8) { + if(*it != 0) + goto parse_digits; + it++; + }else if(base == 16) { + if(*it != 0) + goto parse_digits; + it++; + if(*it != 'x' && *it != 'X') + goto parse_digits; + it++; + } + +parse_digits: + while(*it) { + if(isspace(*it)) { + it++; + continue; + } + + __ensure(base <= 10); // TODO: For base > 10 we need to implement tolower(). + //auto c = strchr(__mlibc_digits, tolower(*it)); + auto c = strchr(__mlibc_digits, *it); + if(!c || (c - __mlibc_digits) >= base) + break; + v = v * base + (c - __mlibc_digits); + it++; + } + + if(std::is_signed<T>::value) { + if(negate) + v = -v; + } + + if(out) + *out = const_cast<char *>(it); + return v; +} + +intmax_t strtoimax(const char *it, char **out, int base) { + // TODO: This function has to check for overflow! + return strtoxmax<intmax_t>(it, out, base); +} +uintmax_t strtoumax(const char *it, char **out, int base) { + return strtoxmax<uintmax_t>(it, out, base); +} +intmax_t wcstoimax(const wchar_t *__restrict, wchar_t **__restrict, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +uintmax_t wcstoumax(const wchar_t *__restrict, wchar_t **__restrict, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/ansi/generic/locale-stubs.cpp b/lib/mlibc/options/ansi/generic/locale-stubs.cpp new file mode 100644 index 0000000..38f5859 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/locale-stubs.cpp @@ -0,0 +1,195 @@ + +#include <limits.h> +#include <locale.h> +#include <string.h> + +#include <bits/ensure.h> + +#include <mlibc/debug.hpp> +#include <frg/optional.hpp> + +namespace { + // Values of the C locale are defined by the C standard. + constexpr lconv c_lconv = { + const_cast<char *>("."), // decimal_point + const_cast<char *>(""), // thousands_sep + const_cast<char *>(""), // grouping + const_cast<char *>(""), // mon_decimal_point + const_cast<char *>(""), // mon_thousands_sep + const_cast<char *>(""), // mon_grouping + const_cast<char *>(""), // positive_sign + const_cast<char *>(""), // negative_sign + const_cast<char *>(""), // currency_symbol + CHAR_MAX, // frac_digits + CHAR_MAX, // p_cs_precedes + CHAR_MAX, // n_cs_precedes + CHAR_MAX, // p_sep_by_space + CHAR_MAX, // n_sep_by_space + CHAR_MAX, // p_sign_posn + CHAR_MAX, // n_sign_posn + const_cast<char *>(""), // int_curr_symbol + CHAR_MAX, // int_frac_digits + CHAR_MAX, // int_p_cs_precedes + CHAR_MAX, // int_n_cs_precedes + CHAR_MAX, // int_p_sep_by_space + CHAR_MAX, // int_n_sep_by_space + CHAR_MAX, // int_p_sign_posn + CHAR_MAX // int_n_sign_posn + }; +} + +namespace mlibc { + struct locale_description { + // Identifier of this locale. used in setlocale(). + const char *name; + lconv lc; + }; + + constinit const locale_description c_locale{ + .name = "C", + .lc = c_lconv + }; + + constinit const locale_description posix_locale{ + .name = "POSIX", + .lc = c_lconv + }; + + const locale_description *query_locale_description(const char *name) { + if(!strcmp(name, "C")) + return &c_locale; + if(!strcmp(name, "POSIX")) + return &posix_locale; + return nullptr; + } + + const locale_description *collate_facet; + const locale_description *ctype_facet; + const locale_description *monetary_facet; + const locale_description *numeric_facet; + const locale_description *time_facet; + const locale_description *messages_facet; +} + +void __mlibc_initLocale() { + mlibc::collate_facet = &mlibc::c_locale; + mlibc::ctype_facet = &mlibc::c_locale; + mlibc::monetary_facet = &mlibc::c_locale; + mlibc::numeric_facet = &mlibc::c_locale; + mlibc::time_facet = &mlibc::c_locale; + mlibc::messages_facet = &mlibc::c_locale; +} + +char *setlocale(int category, const char *name) { + if(category == LC_ALL) { + // ´TODO: Implement correct return value when categories differ. + auto current_desc = mlibc::collate_facet; + __ensure(current_desc == mlibc::ctype_facet); + __ensure(current_desc == mlibc::monetary_facet); + __ensure(current_desc == mlibc::numeric_facet); + __ensure(current_desc == mlibc::time_facet); + __ensure(current_desc == mlibc::messages_facet); + + if(name) { + // Our default C locale is the C locale. + if(!strlen(name)) + name = "C"; + + auto new_desc = mlibc::query_locale_description(name); + if(!new_desc) { + mlibc::infoLogger() << "mlibc: Locale " << name + << " is not supported" << frg::endlog; + return nullptr; + } + + mlibc::collate_facet = new_desc; + mlibc::ctype_facet = new_desc; + mlibc::monetary_facet = new_desc; + mlibc::numeric_facet = new_desc; + mlibc::time_facet = new_desc; + mlibc::messages_facet = new_desc; + } + return const_cast<char *>(current_desc->name); + }else{ + const mlibc::locale_description **facet_ptr; + switch(category) { + case LC_COLLATE: + facet_ptr = &mlibc::collate_facet; + break; + case LC_CTYPE: + facet_ptr = &mlibc::ctype_facet; + break; + case LC_MONETARY: + facet_ptr = &mlibc::monetary_facet; + break; + case LC_NUMERIC: + facet_ptr = &mlibc::numeric_facet; + break; + case LC_TIME: + facet_ptr = &mlibc::time_facet; + break; + case LC_MESSAGES: + facet_ptr = &mlibc::messages_facet; + break; + default: + mlibc::infoLogger() << "mlibc: Unexpected value " << category + << " for category in setlocale()" << frg::endlog; + return nullptr; + } + + auto current_desc = *facet_ptr; + if(name) { + // Our default C locale is the C locale. + if(!strlen(name)) + name = "C"; + + auto new_desc = mlibc::query_locale_description(name); + if(!new_desc) { + mlibc::infoLogger() << "mlibc: Locale " << name + << " is not supported" << frg::endlog; + return nullptr; + } + + *facet_ptr = new_desc; + } + return const_cast<char *>(current_desc->name); + } +} + +namespace { + lconv effective_lc; +} + +struct lconv *localeconv(void) { + // Numeric locale. + const auto &numeric_lc = mlibc::numeric_facet->lc; + effective_lc.decimal_point = numeric_lc.decimal_point; + effective_lc.thousands_sep = numeric_lc.thousands_sep; + effective_lc.grouping = numeric_lc.grouping; + + // Monetary locale. + const auto &monetary_lc = mlibc::monetary_facet->lc; + effective_lc.mon_decimal_point = monetary_lc.mon_decimal_point; + effective_lc.mon_thousands_sep = monetary_lc.mon_thousands_sep; + effective_lc.mon_grouping = monetary_lc.mon_grouping; + effective_lc.positive_sign = monetary_lc.positive_sign; + effective_lc.negative_sign = monetary_lc.negative_sign; + effective_lc.currency_symbol = monetary_lc.currency_symbol; + effective_lc.frac_digits = monetary_lc.frac_digits; + effective_lc.p_cs_precedes = monetary_lc.p_cs_precedes; + effective_lc.n_cs_precedes = monetary_lc.n_cs_precedes; + effective_lc.p_sep_by_space = monetary_lc.p_sep_by_space; + effective_lc.n_sep_by_space = monetary_lc.n_sep_by_space; + effective_lc.p_sign_posn = monetary_lc.p_sign_posn; + effective_lc.n_sign_posn = monetary_lc.n_sign_posn; + effective_lc.int_curr_symbol = monetary_lc.int_curr_symbol; + effective_lc.int_frac_digits = monetary_lc.int_frac_digits; + effective_lc.int_p_cs_precedes = monetary_lc.int_p_cs_precedes; + effective_lc.int_n_cs_precedes = monetary_lc.int_n_cs_precedes; + effective_lc.int_p_sep_by_space = monetary_lc.int_p_sep_by_space; + effective_lc.int_n_sep_by_space = monetary_lc.int_n_sep_by_space; + effective_lc.int_p_sign_posn = monetary_lc.int_p_sign_posn; + effective_lc.int_n_sign_posn = monetary_lc.int_n_sign_posn; + + return &effective_lc; +} diff --git a/lib/mlibc/options/ansi/generic/math-stubs.ignored-cpp b/lib/mlibc/options/ansi/generic/math-stubs.ignored-cpp new file mode 100644 index 0000000..9be985f --- /dev/null +++ b/lib/mlibc/options/ansi/generic/math-stubs.ignored-cpp @@ -0,0 +1,1831 @@ + +#include <math.h> +#include <immintrin.h> + +#include <bits/ensure.h> + +#include <stdint.h> + +#include <mlibc/debug.hpp> + +// Taken from musl. See musl for the license/copyright! +#define FORCE_EVAL(x) do { \ + if (sizeof(x) == sizeof(float)) { \ + volatile float __x; \ + __x = (x); \ + } else if (sizeof(x) == sizeof(double)) { \ + volatile double __x; \ + __x = (x); \ + } else { \ + volatile long double __x; \ + __x = (x); \ + } \ +} while(0) + +namespace ieee754 { + +struct SoftDouble { + typedef uint64_t Bits; + typedef uint64_t Mantissa; + typedef int16_t Exp; + + static constexpr int kMantissaBits = 52; + static constexpr int kExpBits = 11; + static constexpr int kBias = 1023; + + // this exponent represents zeros (when mantissa = 0) and subnormals (when mantissa != 0) + static constexpr Exp kSubExp = -kBias; + // this exponent represents infinities (when mantissa = 0) and NaNs (when mantissa != 0) + static constexpr Exp kInfExp = ((Exp(1) << kExpBits) - 1) - kBias; + + static constexpr Bits kMantissaMask = (Bits(1) << kMantissaBits) - 1; + static constexpr Bits kExpMask = ((Bits(1) << kExpBits) - 1) << kMantissaBits; + static constexpr Bits kSignMask = Bits(1) << (kMantissaBits + kExpBits); + + SoftDouble(bool negative, Mantissa mantissa, Exp exp) + : negative(negative), mantissa(mantissa), exp(exp) { +// mlibc::infoLogger.log() << "(" << (int)negative << ", " << (void *)mantissa +// << ", " << exp << ")" << frg::end_log; + __ensure(mantissa < (Mantissa(1) << kMantissaBits)); + __ensure((exp + kBias) >= 0); + __ensure((exp + kBias) < (Exp(1) << kExpBits)); + } + + const bool negative; + const Mantissa mantissa; + const Exp exp; +}; + +template<typename F> +using Bits = typename F::Bits; + +template<typename F> +using Mantissa = typename F::Mantissa; + +template<typename F> +using Exp = typename F::Exp; + +template<typename F> +bool isZero(F x) { + return x.exp == F::kSubExp && x.mantissa == 0; +} + +template<typename F> +bool isFinite(F x) { + return x.exp != F::kInfExp; +} + +// -------------------------------------------------------- +// Soft float operations +// -------------------------------------------------------- + +template<typename F> +F constZero(bool negative) { + return F(negative, 0, F::kSubExp); +} + +template<typename F> +F constOne(bool negative) { + return F(negative, 0, 0); +} + +template<typename F> +F floor(F x) { + if(!isFinite(x) || isZero(x)) // TODO: need exception for the not-finite case? + return x; + + if(x.exp > F::kMantissaBits) + return x; // x is already integral + + if(x.exp < 0) { + // TODO: raise inexact + // return -1 or +0 + return x.negative ? constOne<F>(true) : constZero<F>(false); + } + + Mantissa<F> mask = F::kMantissaMask >> x.exp; + if(!(x.mantissa & mask)) + return x; // x is already integral + + // TODO: raise inexact + Mantissa<F> integral_position = (Mantissa<F>(1) << F::kMantissaBits) >> x.exp; + if(x.negative) + return F(true, (x.mantissa + integral_position) & (~mask), x.exp); + return F(false, x.mantissa & (~mask), x.exp); +} + +template<typename F> +F ceil(F x) { + if(!isFinite(x) || isZero(x)) // TODO: need exception for the not-finite case? + return x; + + if(x.exp > F::kMantissaBits) + return x; // x is already integral + + if(x.exp < 0) { + // TODO: raise inexact + // return -0 or +1 + return x.negative ? constZero<F>(true) : constOne<F>(false); + } + + Mantissa<F> mask = F::kMantissaMask >> x.exp; + if(!(x.mantissa & mask)) + return x; // x is already integral + + // TODO: raise inexact + Mantissa<F> integral_position = (Mantissa<F>(1) << F::kMantissaBits) >> x.exp; + if(x.negative) + return F(true, x.mantissa & (~mask), x.exp); + return F(false, (x.mantissa + integral_position) & (~mask), x.exp); +} + +// -------------------------------------------------------- +// Soft float <-> bit string conversion functions +// -------------------------------------------------------- + +template<typename F> +uint64_t compileBits(F soft) { + auto bits = Bits<F>(soft.mantissa) | ((Bits<F>(soft.exp) + F::kBias) << soft.kMantissaBits); + return soft.negative ? (F::kSignMask | bits) : bits; +} + +SoftDouble extractBits(uint64_t bits) { + return SoftDouble(bits & SoftDouble::kSignMask, bits & SoftDouble::kMantissaMask, + ((bits & SoftDouble::kExpMask) >> SoftDouble::kMantissaBits) - SoftDouble::kBias); +} + +// -------------------------------------------------------- +// Soft float -> native float conversion functions +// -------------------------------------------------------- + +union DoubleBits { + double fp; + uint64_t bits; +}; + +double compileNative(SoftDouble soft) { + DoubleBits word; + word.bits = compileBits(soft); + return word.fp; +} + +SoftDouble extractNative(double native) { + DoubleBits word; + word.fp = native; + return extractBits(word.bits); +} + +} // namespace ieee754 + +int __mlibc_fpclassify(double x) { + return __builtin_fpclassify(FP_NAN, FP_INFINITE, FP_NORMAL, FP_SUBNORMAL, FP_ZERO, x); +} +int __mlibc_fpclassifyf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +int __mlibc_fpclassifyl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double acos(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float acosf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double acosl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double asin(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float asinf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double asinl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double atan(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float atanf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double atanl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double atan2(double x, double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float atan2f(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double atan2l(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +// Taken from musl. See musl for the license/copyright! +float __sindf(double x) { + /* |sin(x)/x - s(x)| < 2**-37.5 (~[-4.89e-12, 4.824e-12]). */ + static const double S1 = -0x15555554cbac77.0p-55, /* -0.166666666416265235595 */ + S2 = 0x111110896efbb2.0p-59, /* 0.0083333293858894631756 */ + S3 = -0x1a00f9e2cae774.0p-65, /* -0.000198393348360966317347 */ + S4 = 0x16cd878c3b46a7.0p-71; /* 0.0000027183114939898219064 */ + + double r, s, w, z; + + /* Try to optimize for parallel evaluation as in __tandf.c. */ + z = x*x; + w = z*z; + r = S3 + z*S4; + s = z*x; + return (x + s*(S1 + z*S2)) + s*w*r; +} + +// Taken from musl. See musl for the license/copyright! +float __cosdf(double x) { + /* |cos(x) - c(x)| < 2**-34.1 (~[-5.37e-11, 5.295e-11]). */ + static const double C0 = -0x1ffffffd0c5e81.0p-54, /* -0.499999997251031003120 */ + C1 = 0x155553e1053a42.0p-57, /* 0.0416666233237390631894 */ + C2 = -0x16c087e80f1e27.0p-62, /* -0.00138867637746099294692 */ + C3 = 0x199342e0ee5069.0p-68; /* 0.0000243904487962774090654 */ + + double r, w, z; + + /* Try to optimize for parallel evaluation as in __tandf.c. */ + z = x*x; + w = z*z; + r = C2+z*C3; + return ((1.0+z*C0) + w*C1) + (w*z)*r; +} + +float __tandf(double x, int odd) { + /* |tan(x)/x - t(x)| < 2**-25.5 (~[-2e-08, 2e-08]). */ + static const double T[] = { + 0x15554d3418c99f.0p-54, /* 0.333331395030791399758 */ + 0x1112fd38999f72.0p-55, /* 0.133392002712976742718 */ + 0x1b54c91d865afe.0p-57, /* 0.0533812378445670393523 */ + 0x191df3908c33ce.0p-58, /* 0.0245283181166547278873 */ + 0x185dadfcecf44e.0p-61, /* 0.00297435743359967304927 */ + 0x1362b9bf971bcd.0p-59, /* 0.00946564784943673166728 */ + }; + + double z,r,w,s,t,u; + + z = x*x; + /* + * Split up the polynomial into small independent terms to give + * opportunities for parallel evaluation. The chosen splitting is + * micro-optimized for Athlons (XP, X64). It costs 2 multiplications + * relative to Horner's method on sequential machines. + * + * We add the small terms from lowest degree up for efficiency on + * non-sequential machines (the lowest degree terms tend to be ready + * earlier). Apart from this, we don't care about order of + * operations, and don't need to to care since we have precision to + * spare. However, the chosen splitting is good for accuracy too, + * and would give results as accurate as Horner's method if the + * small terms were added from highest degree down. + */ + r = T[4] + z*T[5]; + t = T[2] + z*T[3]; + w = z*z; + s = z*x; + u = T[0] + z*T[1]; + r = (x + s*u) + (s*w)*(t + w*r); + return odd ? -1.0/r : r; +} + +#define DBL_EPSILON 2.22044604925031308085e-16 +#define EPS DBL_EPSILON + +/* Get a 32 bit int from a float. */ +#define GET_FLOAT_WORD(w,d) \ +do { \ + union {float f; uint32_t i;} __u; \ + __u.f = (d); \ + (w) = __u.i; \ +} while (0) + +/* Get the more significant 32 bit int from a double. */ +#define GET_HIGH_WORD(hi,d) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + (hi) = __u.i >> 32; \ +} while (0) + +/* Get the less significant 32 bit int from a double. */ +#define GET_LOW_WORD(lo,d) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + (lo) = (uint32_t)__u.i; \ +} while (0) + +// Taken from musl. See musl for the license/copyright! +int __rem_pio2_large(double *x, double *y, int e0, int nx, int prec) +{ + static const int init_jk[] = {3,4,4,6}; /* initial value for jk */ + + /* + * Table of constants for 2/pi, 396 Hex digits (476 decimal) of 2/pi + * + * integer array, contains the (24*i)-th to (24*i+23)-th + * bit of 2/pi after binary point. The corresponding + * floating value is + * + * ipio2[i] * 2^(-24(i+1)). + * + * NB: This table must have at least (e0-3)/24 + jk terms. + * For quad precision (e0 <= 16360, jk = 6), this is 686. + */ + static const int32_t ipio2[] = { + 0xA2F983, 0x6E4E44, 0x1529FC, 0x2757D1, 0xF534DD, 0xC0DB62, + 0x95993C, 0x439041, 0xFE5163, 0xABDEBB, 0xC561B7, 0x246E3A, + 0x424DD2, 0xE00649, 0x2EEA09, 0xD1921C, 0xFE1DEB, 0x1CB129, + 0xA73EE8, 0x8235F5, 0x2EBB44, 0x84E99C, 0x7026B4, 0x5F7E41, + 0x3991D6, 0x398353, 0x39F49C, 0x845F8B, 0xBDF928, 0x3B1FF8, + 0x97FFDE, 0x05980F, 0xEF2F11, 0x8B5A0A, 0x6D1F6D, 0x367ECF, + 0x27CB09, 0xB74F46, 0x3F669E, 0x5FEA2D, 0x7527BA, 0xC7EBE5, + 0xF17B3D, 0x0739F7, 0x8A5292, 0xEA6BFB, 0x5FB11F, 0x8D5D08, + 0x560330, 0x46FC7B, 0x6BABF0, 0xCFBC20, 0x9AF436, 0x1DA9E3, + 0x91615E, 0xE61B08, 0x659985, 0x5F14A0, 0x68408D, 0xFFD880, + 0x4D7327, 0x310606, 0x1556CA, 0x73A8C9, 0x60E27B, 0xC08C6B, + + #if LDBL_MAX_EXP > 1024 + 0x47C419, 0xC367CD, 0xDCE809, 0x2A8359, 0xC4768B, 0x961CA6, + 0xDDAF44, 0xD15719, 0x053EA5, 0xFF0705, 0x3F7E33, 0xE832C2, + 0xDE4F98, 0x327DBB, 0xC33D26, 0xEF6B1E, 0x5EF89F, 0x3A1F35, + 0xCAF27F, 0x1D87F1, 0x21907C, 0x7C246A, 0xFA6ED5, 0x772D30, + 0x433B15, 0xC614B5, 0x9D19C3, 0xC2C4AD, 0x414D2C, 0x5D000C, + 0x467D86, 0x2D71E3, 0x9AC69B, 0x006233, 0x7CD2B4, 0x97A7B4, + 0xD55537, 0xF63ED7, 0x1810A3, 0xFC764D, 0x2A9D64, 0xABD770, + 0xF87C63, 0x57B07A, 0xE71517, 0x5649C0, 0xD9D63B, 0x3884A7, + 0xCB2324, 0x778AD6, 0x23545A, 0xB91F00, 0x1B0AF1, 0xDFCE19, + 0xFF319F, 0x6A1E66, 0x615799, 0x47FBAC, 0xD87F7E, 0xB76522, + 0x89E832, 0x60BFE6, 0xCDC4EF, 0x09366C, 0xD43F5D, 0xD7DE16, + 0xDE3B58, 0x929BDE, 0x2822D2, 0xE88628, 0x4D58E2, 0x32CAC6, + 0x16E308, 0xCB7DE0, 0x50C017, 0xA71DF3, 0x5BE018, 0x34132E, + 0x621283, 0x014883, 0x5B8EF5, 0x7FB0AD, 0xF2E91E, 0x434A48, + 0xD36710, 0xD8DDAA, 0x425FAE, 0xCE616A, 0xA4280A, 0xB499D3, + 0xF2A606, 0x7F775C, 0x83C2A3, 0x883C61, 0x78738A, 0x5A8CAF, + 0xBDD76F, 0x63A62D, 0xCBBFF4, 0xEF818D, 0x67C126, 0x45CA55, + 0x36D9CA, 0xD2A828, 0x8D61C2, 0x77C912, 0x142604, 0x9B4612, + 0xC459C4, 0x44C5C8, 0x91B24D, 0xF31700, 0xAD43D4, 0xE54929, + 0x10D5FD, 0xFCBE00, 0xCC941E, 0xEECE70, 0xF53E13, 0x80F1EC, + 0xC3E7B3, 0x28F8C7, 0x940593, 0x3E71C1, 0xB3092E, 0xF3450B, + 0x9C1288, 0x7B20AB, 0x9FB52E, 0xC29247, 0x2F327B, 0x6D550C, + 0x90A772, 0x1FE76B, 0x96CB31, 0x4A1679, 0xE27941, 0x89DFF4, + 0x9794E8, 0x84E6E2, 0x973199, 0x6BED88, 0x365F5F, 0x0EFDBB, + 0xB49A48, 0x6CA467, 0x427271, 0x325D8D, 0xB8159F, 0x09E5BC, + 0x25318D, 0x3974F7, 0x1C0530, 0x010C0D, 0x68084B, 0x58EE2C, + 0x90AA47, 0x02E774, 0x24D6BD, 0xA67DF7, 0x72486E, 0xEF169F, + 0xA6948E, 0xF691B4, 0x5153D1, 0xF20ACF, 0x339820, 0x7E4BF5, + 0x6863B2, 0x5F3EDD, 0x035D40, 0x7F8985, 0x295255, 0xC06437, + 0x10D86D, 0x324832, 0x754C5B, 0xD4714E, 0x6E5445, 0xC1090B, + 0x69F52A, 0xD56614, 0x9D0727, 0x50045D, 0xDB3BB4, 0xC576EA, + 0x17F987, 0x7D6B49, 0xBA271D, 0x296996, 0xACCCC6, 0x5414AD, + 0x6AE290, 0x89D988, 0x50722C, 0xBEA404, 0x940777, 0x7030F3, + 0x27FC00, 0xA871EA, 0x49C266, 0x3DE064, 0x83DD97, 0x973FA3, + 0xFD9443, 0x8C860D, 0xDE4131, 0x9D3992, 0x8C70DD, 0xE7B717, + 0x3BDF08, 0x2B3715, 0xA0805C, 0x93805A, 0x921110, 0xD8E80F, + 0xAF806C, 0x4BFFDB, 0x0F9038, 0x761859, 0x15A562, 0xBBCB61, + 0xB989C7, 0xBD4010, 0x04F2D2, 0x277549, 0xF6B6EB, 0xBB22DB, + 0xAA140A, 0x2F2689, 0x768364, 0x333B09, 0x1A940E, 0xAA3A51, + 0xC2A31D, 0xAEEDAF, 0x12265C, 0x4DC26D, 0x9C7A2D, 0x9756C0, + 0x833F03, 0xF6F009, 0x8C402B, 0x99316D, 0x07B439, 0x15200C, + 0x5BC3D8, 0xC492F5, 0x4BADC6, 0xA5CA4E, 0xCD37A7, 0x36A9E6, + 0x9492AB, 0x6842DD, 0xDE6319, 0xEF8C76, 0x528B68, 0x37DBFC, + 0xABA1AE, 0x3115DF, 0xA1AE00, 0xDAFB0C, 0x664D64, 0xB705ED, + 0x306529, 0xBF5657, 0x3AFF47, 0xB9F96A, 0xF3BE75, 0xDF9328, + 0x3080AB, 0xF68C66, 0x15CB04, 0x0622FA, 0x1DE4D9, 0xA4B33D, + 0x8F1B57, 0x09CD36, 0xE9424E, 0xA4BE13, 0xB52333, 0x1AAAF0, + 0xA8654F, 0xA5C1D2, 0x0F3F0B, 0xCD785B, 0x76F923, 0x048B7B, + 0x721789, 0x53A6C6, 0xE26E6F, 0x00EBEF, 0x584A9B, 0xB7DAC4, + 0xBA66AA, 0xCFCF76, 0x1D02D1, 0x2DF1B1, 0xC1998C, 0x77ADC3, + 0xDA4886, 0xA05DF7, 0xF480C6, 0x2FF0AC, 0x9AECDD, 0xBC5C3F, + 0x6DDED0, 0x1FC790, 0xB6DB2A, 0x3A25A3, 0x9AAF00, 0x9353AD, + 0x0457B6, 0xB42D29, 0x7E804B, 0xA707DA, 0x0EAA76, 0xA1597B, + 0x2A1216, 0x2DB7DC, 0xFDE5FA, 0xFEDB89, 0xFDBE89, 0x6C76E4, + 0xFCA906, 0x70803E, 0x156E85, 0xFF87FD, 0x073E28, 0x336761, + 0x86182A, 0xEABD4D, 0xAFE7B3, 0x6E6D8F, 0x396795, 0x5BBF31, + 0x48D784, 0x16DF30, 0x432DC7, 0x356125, 0xCE70C9, 0xB8CB30, + 0xFD6CBF, 0xA200A4, 0xE46C05, 0xA0DD5A, 0x476F21, 0xD21262, + 0x845CB9, 0x496170, 0xE0566B, 0x015299, 0x375550, 0xB7D51E, + 0xC4F133, 0x5F6E13, 0xE4305D, 0xA92E85, 0xC3B21D, 0x3632A1, + 0xA4B708, 0xD4B1EA, 0x21F716, 0xE4698F, 0x77FF27, 0x80030C, + 0x2D408D, 0xA0CD4F, 0x99A520, 0xD3A2B3, 0x0A5D2F, 0x42F9B4, + 0xCBDA11, 0xD0BE7D, 0xC1DB9B, 0xBD17AB, 0x81A2CA, 0x5C6A08, + 0x17552E, 0x550027, 0xF0147F, 0x8607E1, 0x640B14, 0x8D4196, + 0xDEBE87, 0x2AFDDA, 0xB6256B, 0x34897B, 0xFEF305, 0x9EBFB9, + 0x4F6A68, 0xA82A4A, 0x5AC44F, 0xBCF82D, 0x985AD7, 0x95C7F4, + 0x8D4D0D, 0xA63A20, 0x5F57A4, 0xB13F14, 0x953880, 0x0120CC, + 0x86DD71, 0xB6DEC9, 0xF560BF, 0x11654D, 0x6B0701, 0xACB08C, + 0xD0C0B2, 0x485551, 0x0EFB1E, 0xC37295, 0x3B06A3, 0x3540C0, + 0x7BDC06, 0xCC45E0, 0xFA294E, 0xC8CAD6, 0x41F3E8, 0xDE647C, + 0xD8649B, 0x31BED9, 0xC397A4, 0xD45877, 0xC5E369, 0x13DAF0, + 0x3C3ABA, 0x461846, 0x5F7555, 0xF5BDD2, 0xC6926E, 0x5D2EAC, + 0xED440E, 0x423E1C, 0x87C461, 0xE9FD29, 0xF3D6E7, 0xCA7C22, + 0x35916F, 0xC5E008, 0x8DD7FF, 0xE26A6E, 0xC6FDB0, 0xC10893, + 0x745D7C, 0xB2AD6B, 0x9D6ECD, 0x7B723E, 0x6A11C6, 0xA9CFF7, + 0xDF7329, 0xBAC9B5, 0x5100B7, 0x0DB2E2, 0x24BA74, 0x607DE5, + 0x8AD874, 0x2C150D, 0x0C1881, 0x94667E, 0x162901, 0x767A9F, + 0xBEFDFD, 0xEF4556, 0x367ED9, 0x13D9EC, 0xB9BA8B, 0xFC97C4, + 0x27A831, 0xC36EF1, 0x36C594, 0x56A8D8, 0xB5A8B4, 0x0ECCCF, + 0x2D8912, 0x34576F, 0x89562C, 0xE3CE99, 0xB920D6, 0xAA5E6B, + 0x9C2A3E, 0xCC5F11, 0x4A0BFD, 0xFBF4E1, 0x6D3B8E, 0x2C86E2, + 0x84D4E9, 0xA9B4FC, 0xD1EEEF, 0xC9352E, 0x61392F, 0x442138, + 0xC8D91B, 0x0AFC81, 0x6A4AFB, 0xD81C2F, 0x84B453, 0x8C994E, + 0xCC2254, 0xDC552A, 0xD6C6C0, 0x96190B, 0xB8701A, 0x649569, + 0x605A26, 0xEE523F, 0x0F117F, 0x11B5F4, 0xF5CBFC, 0x2DBC34, + 0xEEBC34, 0xCC5DE8, 0x605EDD, 0x9B8E67, 0xEF3392, 0xB817C9, + 0x9B5861, 0xBC57E1, 0xC68351, 0x103ED8, 0x4871DD, 0xDD1C2D, + 0xA118AF, 0x462C21, 0xD7F359, 0x987AD9, 0xC0549E, 0xFA864F, + 0xFC0656, 0xAE79E5, 0x362289, 0x22AD38, 0xDC9367, 0xAAE855, + 0x382682, 0x9BE7CA, 0xA40D51, 0xB13399, 0x0ED7A9, 0x480569, + 0xF0B265, 0xA7887F, 0x974C88, 0x36D1F9, 0xB39221, 0x4A827B, + 0x21CF98, 0xDC9F40, 0x5547DC, 0x3A74E1, 0x42EB67, 0xDF9DFE, + 0x5FD45E, 0xA4677B, 0x7AACBA, 0xA2F655, 0x23882B, 0x55BA41, + 0x086E59, 0x862A21, 0x834739, 0xE6E389, 0xD49EE5, 0x40FB49, + 0xE956FF, 0xCA0F1C, 0x8A59C5, 0x2BFA94, 0xC5C1D3, 0xCFC50F, + 0xAE5ADB, 0x86C547, 0x624385, 0x3B8621, 0x94792C, 0x876110, + 0x7B4C2A, 0x1A2C80, 0x12BF43, 0x902688, 0x893C78, 0xE4C4A8, + 0x7BDBE5, 0xC23AC4, 0xEAF426, 0x8A67F7, 0xBF920D, 0x2BA365, + 0xB1933D, 0x0B7CBD, 0xDC51A4, 0x63DD27, 0xDDE169, 0x19949A, + 0x9529A8, 0x28CE68, 0xB4ED09, 0x209F44, 0xCA984E, 0x638270, + 0x237C7E, 0x32B90F, 0x8EF5A7, 0xE75614, 0x08F121, 0x2A9DB5, + 0x4D7E6F, 0x5119A5, 0xABF9B5, 0xD6DF82, 0x61DD96, 0x023616, + 0x9F3AC4, 0xA1A283, 0x6DED72, 0x7A8D39, 0xA9B882, 0x5C326B, + 0x5B2746, 0xED3400, 0x7700D2, 0x55F4FC, 0x4D5901, 0x8071E0, + #endif + }; + + static const double PIo2[] = { + 1.57079625129699707031e+00, /* 0x3FF921FB, 0x40000000 */ + 7.54978941586159635335e-08, /* 0x3E74442D, 0x00000000 */ + 5.39030252995776476554e-15, /* 0x3CF84698, 0x80000000 */ + 3.28200341580791294123e-22, /* 0x3B78CC51, 0x60000000 */ + 1.27065575308067607349e-29, /* 0x39F01B83, 0x80000000 */ + 1.22933308981111328932e-36, /* 0x387A2520, 0x40000000 */ + 2.73370053816464559624e-44, /* 0x36E38222, 0x80000000 */ + 2.16741683877804819444e-51, /* 0x3569F31D, 0x00000000 */ + }; + + int32_t jz,jx,jv,jp,jk,carry,n,iq[20],i,j,k,m,q0,ih; + double z,fw,f[20],fq[20],q[20]; + + /* initialize jk*/ + jk = init_jk[prec]; + jp = jk; + + /* determine jx,jv,q0, note that 3>q0 */ + jx = nx-1; + jv = (e0-3)/24; if(jv<0) jv=0; + q0 = e0-24*(jv+1); + + /* set up f[0] to f[jx+jk] where f[jx+jk] = ipio2[jv+jk] */ + j = jv-jx; m = jx+jk; + for (i=0; i<=m; i++,j++) + f[i] = j<0 ? 0.0 : (double)ipio2[j]; + + /* compute q[0],q[1],...q[jk] */ + for (i=0; i<=jk; i++) { + for (j=0,fw=0.0; j<=jx; j++) + fw += x[j]*f[jx+i-j]; + q[i] = fw; + } + + jz = jk; +recompute: + /* distill q[] into iq[] reversingly */ + for (i=0,j=jz,z=q[jz]; j>0; i++,j--) { + fw = (double)(int32_t)(0x1p-24*z); + iq[i] = (int32_t)(z - 0x1p24*fw); + z = q[j-1]+fw; + } + + /* compute n */ + z = scalbn(z,q0); /* actual value of z */ + z -= 8.0*floor(z*0.125); /* trim off integer >= 8 */ + n = (int32_t)z; + z -= (double)n; + ih = 0; + if (q0 > 0) { /* need iq[jz-1] to determine n */ + i = iq[jz-1]>>(24-q0); n += i; + iq[jz-1] -= i<<(24-q0); + ih = iq[jz-1]>>(23-q0); + } + else if (q0 == 0) ih = iq[jz-1]>>23; + else if (z >= 0.5) ih = 2; + + if (ih > 0) { /* q > 0.5 */ + n += 1; carry = 0; + for (i=0; i<jz; i++) { /* compute 1-q */ + j = iq[i]; + if (carry == 0) { + if (j != 0) { + carry = 1; + iq[i] = 0x1000000 - j; + } + } else + iq[i] = 0xffffff - j; + } + if (q0 > 0) { /* rare case: chance is 1 in 12 */ + switch(q0) { + case 1: + iq[jz-1] &= 0x7fffff; break; + case 2: + iq[jz-1] &= 0x3fffff; break; + } + } + if (ih == 2) { + z = 1.0 - z; + if (carry != 0) + z -= scalbn(1.0,q0); + } + } + + /* check if recomputation is needed */ + if (z == 0.0) { + j = 0; + for (i=jz-1; i>=jk; i--) j |= iq[i]; + if (j == 0) { /* need recomputation */ + for (k=1; iq[jk-k]==0; k++); /* k = no. of terms needed */ + + for (i=jz+1; i<=jz+k; i++) { /* add q[jz+1] to q[jz+k] */ + f[jx+i] = (double)ipio2[jv+i]; + for (j=0,fw=0.0; j<=jx; j++) + fw += x[j]*f[jx+i-j]; + q[i] = fw; + } + jz += k; + goto recompute; + } + } + + /* chop off zero terms */ + if (z == 0.0) { + jz -= 1; + q0 -= 24; + while (iq[jz] == 0) { + jz--; + q0 -= 24; + } + } else { /* break z into 24-bit if necessary */ + z = scalbn(z,-q0); + if (z >= 0x1p24) { + fw = (double)(int32_t)(0x1p-24*z); + iq[jz] = (int32_t)(z - 0x1p24*fw); + jz += 1; + q0 += 24; + iq[jz] = (int32_t)fw; + } else + iq[jz] = (int32_t)z; + } + + /* convert integer "bit" chunk to floating-point value */ + fw = scalbn(1.0,q0); + for (i=jz; i>=0; i--) { + q[i] = fw*(double)iq[i]; + fw *= 0x1p-24; + } + + /* compute PIo2[0,...,jp]*q[jz,...,0] */ + for(i=jz; i>=0; i--) { + for (fw=0.0,k=0; k<=jp && k<=jz-i; k++) + fw += PIo2[k]*q[i+k]; + fq[jz-i] = fw; + } + + /* compress fq[] into y[] */ + switch(prec) { + case 0: + fw = 0.0; + for (i=jz; i>=0; i--) + fw += fq[i]; + y[0] = ih==0 ? fw : -fw; + break; + case 1: + case 2: + fw = 0.0; + for (i=jz; i>=0; i--) + fw += fq[i]; + // TODO: drop excess precision here once double_t is used + fw = (double)fw; + y[0] = ih==0 ? fw : -fw; + fw = fq[0]-fw; + for (i=1; i<=jz; i++) + fw += fq[i]; + y[1] = ih==0 ? fw : -fw; + break; + case 3: /* painful */ + for (i=jz; i>0; i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (i=jz; i>1; i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (fw=0.0,i=jz; i>=2; i--) + fw += fq[i]; + if (ih==0) { + y[0] = fq[0]; y[1] = fq[1]; y[2] = fw; + } else { + y[0] = -fq[0]; y[1] = -fq[1]; y[2] = -fw; + } + } + return n&7; +} + +int __rem_pio2f(float x, double *y) { + /* + * invpio2: 53 bits of 2/pi + * pio2_1: first 25 bits of pi/2 + * pio2_1t: pi/2 - pio2_1 + */ + static const double toint = 1.5/EPS, + invpio2 = 6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */ + pio2_1 = 1.57079631090164184570e+00, /* 0x3FF921FB, 0x50000000 */ + pio2_1t = 1.58932547735281966916e-08; /* 0x3E5110b4, 0x611A6263 */ + + union {float f; uint32_t i;} u = {x}; + double tx[1],ty[1]; + double fn; + uint32_t ix; + int n, sign, e0; + + ix = u.i & 0x7fffffff; + /* 25+53 bit pi is good enough for medium size */ + if (ix < 0x4dc90fdb) { /* |x| ~< 2^28*(pi/2), medium size */ + /* Use a specialized rint() to get fn. Assume round-to-nearest. */ + fn = (double)x*invpio2 + toint - toint; + n = (int32_t)fn; + *y = x - fn*pio2_1 - fn*pio2_1t; + return n; + } + if(ix>=0x7f800000) { /* x is inf or NaN */ + *y = x-x; + return 0; + } + /* scale x into [2^23, 2^24-1] */ + sign = u.i>>31; + e0 = (ix>>23) - (0x7f+23); /* e0 = ilogb(|x|)-23, positive */ + u.i = ix - (e0<<23); + tx[0] = u.f; + n = __rem_pio2_large(tx,ty,e0,1,0); + if (sign) { + *y = -ty[0]; + return -n; + } + *y = ty[0]; + return n; +} + +double cos(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +// Taken from musl. See musl for the license/copyright! +float cosf(float x) { + /* Small multiples of pi/2 rounded to double precision. */ + static const double c1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ + c2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ + c3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ + c4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + + double y; + uint32_t ix; + unsigned n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x != 0 */ + FORCE_EVAL(x + 0x1p120f); + return 1.0f; + } + return __cosdf(x); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix > 0x4016cbe3) /* |x| ~> 3*pi/4 */ + return -__cosdf(sign ? x+c2pio2 : x-c2pio2); + else { + if (sign) + return __sindf(x + c1pio2); + else + return __sindf(c1pio2 - x); + } + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix > 0x40afeddf) /* |x| ~> 7*pi/4 */ + return __cosdf(sign ? x+c4pio2 : x-c4pio2); + else { + if (sign) + return __sindf(-x - c3pio2); + else + return __sindf(x - c3pio2); + } + } + + /* cos(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x-x; + + /* general argument reduction needed */ + n = __rem_pio2f(x,&y); + switch (n&3) { + case 0: return __cosdf(y); + case 1: return __sindf(-y); + case 2: return -__cosdf(y); + default: + return __sindf(y); + } +} +long double cosl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double sin(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +// Taken from musl. See musl for the license/copyright! +float sinf(float x) { + /* Small multiples of pi/2 rounded to double precision. */ + static const double s1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ + s2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ + s3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ + s4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + + double y; + uint32_t ix; + int n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00800000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __sindf(x); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix <= 0x4016cbe3) { /* |x| ~<= 3pi/4 */ + if (sign) + return -__cosdf(x + s1pio2); + else + return __cosdf(x - s1pio2); + } + return __sindf(sign ? -(x + s2pio2) : -(x - s2pio2)); + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix <= 0x40afeddf) { /* |x| ~<= 7*pi/4 */ + if (sign) + return __cosdf(x + s3pio2); + else + return -__cosdf(x - s3pio2); + } + return __sindf(sign ? x + s4pio2 : x - s4pio2); + } + + /* sin(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x - x; + + /* general argument reduction needed */ + n = __rem_pio2f(x, &y); + switch (n&3) { + case 0: return __sindf(y); + case 1: return __cosdf(y); + case 2: return __sindf(-y); + default: + return -__cosdf(y); + } +} +long double sinl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double tan(double x) { + mlibc::infoLogger() << "mlibc: tan() is not precise" << frg::endlog; + return tanf(x); +} +// Taken from musl. See musl for the license/copyright! +float tanf(float x) { + /* Small multiples of pi/2 rounded to double precision. */ + static const double t1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ + t2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ + t3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ + t4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + + double y; + uint32_t ix; + unsigned n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00800000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __tandf(x, 0); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix <= 0x4016cbe3) /* |x| ~<= 3pi/4 */ + return __tandf((sign ? x+t1pio2 : x-t1pio2), 1); + else + return __tandf((sign ? x+t2pio2 : x-t2pio2), 0); + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix <= 0x40afeddf) /* |x| ~<= 7*pi/4 */ + return __tandf((sign ? x+t3pio2 : x-t3pio2), 1); + else + return __tandf((sign ? x+t4pio2 : x-t4pio2), 0); + } + + /* tan(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x - x; + + /* argument reduction */ + n = __rem_pio2f(x, &y); + return __tandf(y, n&1); +} +long double tanl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double acosh(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float acoshf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double acoshl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double asinh(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float asinhf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double asinhl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double atanh(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float atanhf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double atanhl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double cosh(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float coshf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double coshl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double sinh(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float sinhf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double sinhl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double tanh(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float tanhf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double tanhl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double exp(double x) { + static const double half[2] = {0.5,-0.5}, + ln2hi = 6.93147180369123816490e-01, /* 0x3fe62e42, 0xfee00000 */ + ln2lo = 1.90821492927058770002e-10, /* 0x3dea39ef, 0x35793c76 */ + invln2 = 1.44269504088896338700e+00, /* 0x3ff71547, 0x652b82fe */ + P1 = 1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */ + P2 = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */ + P3 = 6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */ + P4 = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */ + P5 = 4.13813679705723846039e-08; /* 0x3E663769, 0x72BEA4D0 */ + + double hi, lo, c, xx, y; + int k, sign; + uint32_t hx; + + GET_HIGH_WORD(hx, x); + sign = hx>>31; + hx &= 0x7fffffff; /* high word of |x| */ + + /* special cases */ + if (hx >= 0x4086232b) { /* if |x| >= 708.39... */ + if (isnan(x)) + return x; + if (x > 709.782712893383973096) { + /* overflow if x!=inf */ + x *= 0x1p1023; + return x; + } + if (x < -708.39641853226410622) { + /* underflow if x!=-inf */ + FORCE_EVAL((float)(-0x1p-149/x)); + if (x < -745.13321910194110842) + return 0; + } + } + + /* argument reduction */ + if (hx > 0x3fd62e42) { /* if |x| > 0.5 ln2 */ + if (hx >= 0x3ff0a2b2) /* if |x| >= 1.5 ln2 */ + k = (int)(invln2*x + half[sign]); + else + k = 1 - sign - sign; + hi = x - k*ln2hi; /* k*ln2hi is exact here */ + lo = k*ln2lo; + x = hi - lo; + } else if (hx > 0x3e300000) { /* if |x| > 2**-28 */ + k = 0; + hi = x; + lo = 0; + } else { + /* inexact if x!=0 */ + FORCE_EVAL(0x1p1023 + x); + return 1 + x; + } + + /* x is now in primary range */ + xx = x*x; + c = x - xx*(P1+xx*(P2+xx*(P3+xx*(P4+xx*P5)))); + y = 1 + (x*c/(2-c) - lo + hi); + if (k == 0) + return y; + return scalbn(y, k); +} +float expf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double expl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double exp2(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +// Taken from musl. See musl for the license/copyright! +float exp2f(float x) { + constexpr int TBLSIZE = 16; + + constexpr float redux = 0x1.8p23f / TBLSIZE; + constexpr float P1 = 0x1.62e430p-1f; + constexpr float P2 = 0x1.ebfbe0p-3f; + constexpr float P3 = 0x1.c6b348p-5f; + constexpr float P4 = 0x1.3b2c9cp-7f; + + constexpr double exp2ft[TBLSIZE] = { + 0x1.6a09e667f3bcdp-1, + 0x1.7a11473eb0187p-1, + 0x1.8ace5422aa0dbp-1, + 0x1.9c49182a3f090p-1, + 0x1.ae89f995ad3adp-1, + 0x1.c199bdd85529cp-1, + 0x1.d5818dcfba487p-1, + 0x1.ea4afa2a490dap-1, + 0x1.0000000000000p+0, + 0x1.0b5586cf9890fp+0, + 0x1.172b83c7d517bp+0, + 0x1.2387a6e756238p+0, + 0x1.306fe0a31b715p+0, + 0x1.3dea64c123422p+0, + 0x1.4bfdad5362a27p+0, + 0x1.5ab07dd485429p+0, + }; + + double t, r, z; + union {float f; uint32_t i;} u = {x}; + union {double f; uint64_t i;} uk; + uint32_t ix, i0, k; + + /* Filter out exceptional cases. */ + ix = u.i & 0x7fffffff; + if (ix > 0x42fc0000) { /* |x| > 126 */ + if (ix > 0x7f800000) /* NaN */ + return x; + if (u.i >= 0x43000000 && u.i < 0x80000000) { /* x >= 128 */ + x *= 0x1p127f; + return x; + } + if (u.i >= 0x80000000) { /* x < -126 */ + if (u.i >= 0xc3160000 || (u.i & 0x0000ffff)) + FORCE_EVAL(-0x1p-149f/x); + if (u.i >= 0xc3160000) /* x <= -150 */ + return 0; + } + } else if (ix <= 0x33000000) { /* |x| <= 0x1p-25 */ + return 1.0f + x; + } + + /* Reduce x, computing z, i0, and k. */ + u.f = x + redux; + i0 = u.i; + i0 += TBLSIZE / 2; + k = i0 / TBLSIZE; + uk.i = (uint64_t)(0x3ff + k)<<52; + i0 &= TBLSIZE - 1; + u.f -= redux; + z = x - u.f; + /* Compute r = exp2(y) = exp2ft[i0] * p(z). */ + r = exp2ft[i0]; + t = r * z; + r = r + t * (P1 + z * P2) + t * (z * z) * (P3 + z * P4); + + /* Scale by 2**k */ + return r * uk.f; +} +long double exp2l(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double expm1(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float expm1f(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double expm1l(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double frexp(double x, int *power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float frexpf(float x, int *power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double frexpl(long double x, int *power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double ilogb(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float ilogbf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double ilogbl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double ldexp(double x, int power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float ldexpf(float x, int power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double ldexpl(long double x, int power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double log(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float logf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double logl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double log10(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float log10f(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double log10l(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double log1p(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float log1pf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double log1pl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +// Taken from musl. See musl for the license/copyright! +double log2(double x) { + static const double + ivln2hi = 1.44269504072144627571e+00, /* 0x3ff71547, 0x65200000 */ + ivln2lo = 1.67517131648865118353e-10, /* 0x3de705fc, 0x2eefa200 */ + Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ + Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ + Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ + Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ + Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ + Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ + Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + + union {double f; uint64_t i;} u = {x}; + double hfsq,f,s,z,R,w,t1,t2,y,hi,lo,val_hi,val_lo; + uint32_t hx; + int k; + + hx = u.i>>32; + k = 0; + if (hx < 0x00100000 || hx>>31) { + if (u.i<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (hx>>31) + return (x-x)/0.0; /* log(-#) = NaN */ + /* subnormal number, scale x up */ + k -= 54; + x *= 0x1p54; + u.f = x; + hx = u.i>>32; + } else if (hx >= 0x7ff00000) { + return x; + } else if (hx == 0x3ff00000 && u.i<<32 == 0) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + hx += 0x3ff00000 - 0x3fe6a09e; + k += (int)(hx>>20) - 0x3ff; + hx = (hx&0x000fffff) + 0x3fe6a09e; + u.i = (uint64_t)hx<<32 | (u.i&0xffffffff); + x = u.f; + + f = x - 1.0; + hfsq = 0.5*f*f; + s = f/(2.0+f); + z = s*s; + w = z*z; + t1 = w*(Lg2+w*(Lg4+w*Lg6)); + t2 = z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + R = t2 + t1; + + /* + * f-hfsq must (for args near 1) be evaluated in extra precision + * to avoid a large cancellation when x is near sqrt(2) or 1/sqrt(2). + * This is fairly efficient since f-hfsq only depends on f, so can + * be evaluated in parallel with R. Not combining hfsq with R also + * keeps R small (though not as small as a true `lo' term would be), + * so that extra precision is not needed for terms involving R. + * + * Compiler bugs involving extra precision used to break Dekker's + * theorem for spitting f-hfsq as hi+lo, unless double_t was used + * or the multi-precision calculations were avoided when double_t + * has extra precision. These problems are now automatically + * avoided as a side effect of the optimization of combining the + * Dekker splitting step with the clear-low-bits step. + * + * y must (for args near sqrt(2) and 1/sqrt(2)) be added in extra + * precision to avoid a very large cancellation when x is very near + * these values. Unlike the above cancellations, this problem is + * specific to base 2. It is strange that adding +-1 is so much + * harder than adding +-ln2 or +-log10_2. + * + * This uses Dekker's theorem to normalize y+val_hi, so the + * compiler bugs are back in some configurations, sigh. And I + * don't want to used double_t to avoid them, since that gives a + * pessimization and the support for avoiding the pessimization + * is not yet available. + * + * The multi-precision calculations for the multiplications are + * routine. + */ + + /* hi+lo = f - hfsq + s*(hfsq+R) ~ log(1+f) */ + hi = f - hfsq; + u.f = hi; + u.i &= (uint64_t)-1<<32; + hi = u.f; + lo = f - hi - hfsq + s*(hfsq+R); + + val_hi = hi*ivln2hi; + val_lo = (lo+hi)*ivln2lo + lo*ivln2hi; + + /* spadd(val_hi, val_lo, y), except for not using double_t: */ + y = k; + w = y + val_hi; + val_lo += (y - w) + val_hi; + val_hi = w; + + return val_lo + val_hi; +} +float log2f(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double log2l(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double logb(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float logbf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double logbl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double modf(double x, double *integral) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float modff(float x, float *integral) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double modfl(long double x, long double *integral) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double scalbn(double x, int n) { + union {double f; uint64_t i;} u; + double y = x; + + if (n > 1023) { + y *= 0x1p1023; + n -= 1023; + if (n > 1023) { + y *= 0x1p1023; + n -= 1023; + if (n > 1023) + n = 1023; + } + } else if (n < -1022) { + /* make sure final n < -53 to avoid double + rounding in the subnormal range */ + y *= 0x1p-1022 * 0x1p53; + n += 1022 - 53; + if (n < -1022) { + y *= 0x1p-1022 * 0x1p53; + n += 1022 - 53; + if (n < -1022) + n = -1022; + } + } + u.i = (uint64_t)(0x3ff+n)<<52; + x = y * u.f; + return x; +} +float scalbnf(float x, int power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double scalbnl(long double x, int power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double scalbln(double x, long power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float scalblnf(float x, long power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double scalblnl(long double x, long power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double cbrt(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float cbrtf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double cbrtl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double fabs(double x) { + return signbit(x) ? -x : x; +} +float fabsf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double fabsl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double hypot(double x, double y) { + __ensure(isfinite(x)); + __ensure(isfinite(y)); + // TODO: fix exception handling + double u = fabs(x); + double v = fabs(y); + if(u > v) + return u * sqrt(1 + (v / u) * (v / u)); + return v * sqrt(1 + (u / v) * (u / v)); +} +float hypotf(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double hypotl(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double pow(double x, double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float powf(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double powl(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double sqrt(double x) { + auto sse_x = _mm_set_sd(x); + return _mm_cvtsd_f64(_mm_sqrt_sd(sse_x, sse_x)); +} +float sqrtf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double sqrtl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double erf(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float erff(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double erfl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double erfc(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float erfcf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double erfcl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double lgamma(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float lgammaf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double lgammal(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double tgamma(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float tgammaf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double tgammal(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double ceil(double x) { + auto soft_x = ieee754::extractNative(x); + auto result = ieee754::ceil(soft_x); + return ieee754::compileNative(result); +} +float ceilf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double ceill(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double floor(double x) { + auto soft_x = ieee754::extractNative(x); + auto result = ieee754::floor(soft_x); + return ieee754::compileNative(result); +} +float floorf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double floorl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double nearbyint(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float nearbyintf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double nearbyintl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double rint(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float rintf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double rintl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +long lrint(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long lrintf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long lrintl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +long long llrint(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long long llrintf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long long llrintl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double round(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float roundf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double roundl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +long lround(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long lroundf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long lroundl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +long long llround(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long long llroundf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long long llroundl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double trunc(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float truncf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double truncl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double fmod(double x, double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float fmodf(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double fmodl(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double remainder(double x, double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float remainderf(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double remainderl(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double remquo(double x, double y, int *quotient) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float remquof(float x, float y, int *quotient) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double remquol(long double x, long double y, int *quotient) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double copysign(double x, double sign) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float copysignf(float x, float sign) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double copysignl(long double x, long double sign) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double nan(const char *tag) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float nanf(const char *tag) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double nanl(const char *tag) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double nextafter(double x, double dir) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float nextafterf(float x, float dir) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double nextafterl(long double x, long double dir) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double nexttoward(double x, long double dir) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float nexttowardf(float x, long double dir) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double nexttowardl(long double x, long double dir) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double fdim(double x, double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float fdimf(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double fdiml(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double fmax(double x, double y) { + __ensure(isfinite(x) && isfinite(y)); + return x < y ? y : x; +} +float fmaxf(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double fmaxl(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double fmin(double x, double y) { + __ensure(isfinite(x) && isfinite(y)); + return x < y ? x : y; +} +float fminf(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double fminl(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +//gnu extension + +void sincos(double x, double *sx, double *cx) { + mlibc::infoLogger() << "mlibc: sincos() is not precise" << frg::endlog; + float sxf; + float cxf; + sincosf(x, &sxf, &cxf); + *sx = sxf; + *cx = cxf; +} + +void sincosf(float x, float *sx, float *cx) { + // This is a lazy implementation. + __ensure(sx); + __ensure(cx); + *sx = sinf(x); + *cx = cosf(x); +} +void sincosl(long double, long double *, long double *) { + __ensure(!"sincosl() not implemented"); + __builtin_unreachable(); +} + +double exp10(double) { + __ensure(!"exp10() not implemented"); + __builtin_unreachable(); +} +float exp10f(float) { + __ensure(!"exp10f() not implemented"); + __builtin_unreachable(); +} +long double exp10l(long double) { + __ensure(!"exp10l() not implemented"); + __builtin_unreachable(); +} + +double pow10(double) { + __ensure(!"pow10() not implemented"); + __builtin_unreachable(); +} +float pow10f(float) { + __ensure(!"pow10f() not implemented"); + __builtin_unreachable(); +} +long double pow10l(long double) { + __ensure(!"pow10l() not implemented"); + __builtin_unreachable(); +} + diff --git a/lib/mlibc/options/ansi/generic/signal-stubs.cpp b/lib/mlibc/options/ansi/generic/signal-stubs.cpp new file mode 100644 index 0000000..6da9dc1 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/signal-stubs.cpp @@ -0,0 +1,44 @@ + +#include <bits/ensure.h> +#include <errno.h> +#include <signal.h> + +#include <mlibc/debug.hpp> +#include <mlibc/ansi-sysdeps.hpp> + +__sighandler signal(int sn, __sighandler handler) { + struct sigaction sa; + sa.sa_handler = handler; + sa.sa_flags = 0; + sa.sa_mask = 0; + struct sigaction old; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_sigaction, SIG_ERR); + if(int e = mlibc::sys_sigaction(sn, &sa, &old)){ + errno = e; + return SIG_ERR; + } + return old.sa_handler; +} + +int raise(int sig) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getpid && mlibc::sys_kill, -1); + pid_t pid = mlibc::sys_getpid(); + + if (int e = mlibc::sys_kill(pid, sig)) { + errno = e; + return -1; + } + + return 0; +} + +// This is a POSIX extension, but we have it in here for sigsetjmp +int sigprocmask(int how, const sigset_t *__restrict set, sigset_t *__restrict retrieve) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_sigprocmask, -1); + if(int e = mlibc::sys_sigprocmask(how, set, retrieve); e) { + errno = e; + return -1; + } + return 0; +} + diff --git a/lib/mlibc/options/ansi/generic/stdio-stubs.cpp b/lib/mlibc/options/ansi/generic/stdio-stubs.cpp new file mode 100644 index 0000000..479a655 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/stdio-stubs.cpp @@ -0,0 +1,1270 @@ +#include <ctype.h> +#include <errno.h> +#include <stdarg.h> +#include <stdio.h> +#include <string.h> +#include <stdint.h> +#include <stdlib.h> +#include <wchar.h> +#include <ctype.h> +#include <limits.h> + +#include <abi-bits/fcntl.h> + +#include <bits/ensure.h> + +#include <mlibc/lock.hpp> +#include <mlibc/allocator.hpp> +#include <mlibc/debug.hpp> +#include <mlibc/file-io.hpp> +#include <mlibc/ansi-sysdeps.hpp> +#include <frg/mutex.hpp> +#include <frg/expected.hpp> +#include <frg/printf.hpp> + +template<typename F> +struct PrintfAgent { + PrintfAgent(F *formatter, frg::va_struct *vsp) + : _formatter{formatter}, _vsp{vsp} { } + + frg::expected<frg::format_error> operator() (char c) { + _formatter->append(c); + return {}; + } + frg::expected<frg::format_error> operator() (const char *c, size_t n) { + _formatter->append(c, n); + return {}; + } + + frg::expected<frg::format_error> operator() (char t, frg::format_options opts, + frg::printf_size_mod szmod) { + switch(t) { + case 'c': + if (szmod == frg::printf_size_mod::long_size) { + char c_buf[sizeof(wchar_t)]; + auto c = static_cast<wchar_t>(va_arg(_vsp->args, wint_t)); + mbstate_t shift_state = {}; + if (wcrtomb(c_buf, c, &shift_state) == size_t(-1)) + return frg::format_error::agent_error; + _formatter->append(c_buf); + break; + } + frg::do_printf_chars(*_formatter, t, opts, szmod, _vsp); + break; + case 'p': case 's': + frg::do_printf_chars(*_formatter, t, opts, szmod, _vsp); + break; + case 'd': case 'i': case 'o': case 'x': case 'X': case 'u': + frg::do_printf_ints(*_formatter, t, opts, szmod, _vsp); + break; + case 'f': case 'F': case 'g': case 'G': case 'e': case 'E': + frg::do_printf_floats(*_formatter, t, opts, szmod, _vsp); + break; + case 'm': + __ensure(!opts.fill_zeros); + __ensure(!opts.left_justify); + __ensure(!opts.alt_conversion); + __ensure(opts.minimum_width == 0); + __ensure(szmod == frg::printf_size_mod::default_size); + __ensure(!opts.precision); + _formatter->append(strerror(errno)); + break; + case 'n': { + __ensure(szmod == frg::printf_size_mod::default_size); + auto p = va_arg(_vsp->args, int *); + *p = _formatter->count; + break; + } + default: + mlibc::infoLogger() << "\e[31mmlibc: Unknown printf terminator '" + << t << "'\e[39m" << frg::endlog; + __ensure(!"Illegal printf terminator"); + } + + return {}; + } + +private: + F *_formatter; + frg::va_struct *_vsp; +}; + +struct StreamPrinter { + StreamPrinter(FILE *stream) + : stream(stream), count(0) { } + + void append(char c) { + fwrite_unlocked(&c, 1, 1, stream); + count++; + } + + void append(const char *str) { + fwrite_unlocked(str, strlen(str), 1, stream); + count += strlen(str); + } + + void append(const char *str, size_t n) { + fwrite_unlocked(str, n, 1, stream); + count += n; + } + + FILE *stream; + size_t count; +}; + +struct BufferPrinter { + BufferPrinter(char *buffer) + : buffer(buffer), count(0) { } + + void append(char c) { + buffer[count] = c; + count++; + } + + void append(const char *str) { + // TODO: use strcat + for(size_t i = 0; str[i]; i++) { + buffer[count] = str[i]; + count++; + } + } + + void append(const char *str, size_t n) { + // TODO: use strcat + for(size_t i = 0; i < n; i++) { + buffer[count] = str[i]; + count++; + } + } + + char *buffer; + size_t count; +}; + +struct LimitedPrinter { + LimitedPrinter(char *buffer, size_t limit) + : buffer(buffer), limit(limit), count(0) { } + + void append(char c) { + if(count < limit) + buffer[count] = c; + count++; + } + + void append(const char *str) { + // TODO: use strcat + for(size_t i = 0; str[i]; i++) + append(str[i]); + } + + void append(const char *str, size_t n) { + // TODO: use strcat + for(size_t i = 0; i < n; i++) + append(str[i]); + } + + char *buffer; + size_t limit; + size_t count; +}; + +struct ResizePrinter { + ResizePrinter() + : buffer(nullptr), limit(0), count(0) { } + + void expand() { + if(count == limit) { + auto new_limit = frg::max(2 * limit, size_t(16)); + auto new_buffer = reinterpret_cast<char *>(malloc(new_limit)); + __ensure(new_buffer); + memcpy(new_buffer, buffer, count); + free(buffer); + buffer = new_buffer; + limit = new_limit; + } + __ensure(count < limit); + } + + void append(char c) { + expand(); + buffer[count] = c; + count++; + } + + void append(const char *str) { + for(size_t i = 0; str[i]; i++) + append(str[i]); + } + + void append(const char *str, size_t n) { + for(size_t i = 0; i < n; i++) + append(str[i]); + } + + char *buffer; + size_t limit; + size_t count; +}; + +int remove(const char *filename) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_rmdir, -1); + if(int e = mlibc::sys_rmdir(filename); e) { + if (e == ENOTDIR) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_unlinkat, -1); + if(e = mlibc::sys_unlinkat(AT_FDCWD, filename, 0); e) { + errno = e; + return -1; + } + + return 0; + } + return -1; + } + + return 0; +} + +int rename(const char *path, const char *new_path) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_rename, -1); + if(int e = mlibc::sys_rename(path, new_path); e) { + errno = e; + return -1; + } + return 0; +} + +int renameat(int olddirfd, const char *old_path, int newdirfd, const char *new_path) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_renameat, -1); + if(int e = mlibc::sys_renameat(olddirfd, old_path, newdirfd, new_path); e) { + errno = e; + return -1; + } + return 0; +} + +FILE *tmpfile(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +char *tmpnam(char *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +// fflush() is provided by the POSIX sublibrary +// fopen() is provided by the POSIX sublibrary +FILE *freopen(const char *__restrict path, const char *__restrict mode, FILE *__restrict f) { + auto file = static_cast<mlibc::abstract_file *>(f); + frg::unique_lock lock(file->_lock); + + if(file->reopen(path, mode) == -1) { + errno = EINVAL; + return nullptr; + } + + return f; +} + +void setbuf(FILE *__restrict stream, char *__restrict buffer) { + setvbuf(stream, buffer, buffer ? _IOFBF : _IONBF, BUFSIZ); +} +// setvbuf() is provided by the POSIX sublibrary + +void setlinebuf(FILE *stream) { + setvbuf(stream, NULL, _IOLBF, 0); +} + +void setbuffer(FILE *f, char *buf, size_t size) { + setvbuf(f, buf, buf ? _IOFBF : _IONBF, size); +} + +int fprintf(FILE *__restrict stream, const char *__restrict format, ...) { + va_list args; + va_start(args, format); + int result = vfprintf(stream, format, args); + va_end(args); + return result; +} + +int fscanf(FILE *__restrict stream, const char *__restrict format, ...) { + va_list args; + va_start(args, format); + int result = vfscanf(stream, format, args); + va_end(args); + return result; +} + +int printf(const char *__restrict format, ...) { + va_list args; + va_start(args, format); + int result = vfprintf(stdout, format, args); + va_end(args); + return result; +} + +namespace { + enum { + SCANF_TYPE_CHAR, + SCANF_TYPE_SHORT, + SCANF_TYPE_INTMAX, + SCANF_TYPE_L, + SCANF_TYPE_LL, + SCANF_TYPE_PTRDIFF, + SCANF_TYPE_SIZE_T, + SCANF_TYPE_INT + }; +} + +static void store_int(void *dest, unsigned int size, unsigned long long i) { + switch (size) { + case SCANF_TYPE_CHAR: + *(char *)dest = i; + break; + case SCANF_TYPE_SHORT: + *(short *)dest = i; + break; + case SCANF_TYPE_INTMAX: + *(intmax_t *)dest = i; + break; + case SCANF_TYPE_L: + *(long *)dest = i; + break; + case SCANF_TYPE_LL: + *(long long *)dest = i; + break; + case SCANF_TYPE_PTRDIFF: + *(ptrdiff_t *)dest = i; + break; + case SCANF_TYPE_SIZE_T: + *(size_t *)dest = i; + break; + /* fallthrough */ + case SCANF_TYPE_INT: + default: + *(int *)dest = i; + break; + } +} + +template<typename H> +static int do_scanf(H &handler, const char *fmt, __builtin_va_list args) { + int match_count = 0; + for (; *fmt; fmt++) { + + if (isspace(*fmt)) { + while (isspace(fmt[1])) fmt++; + while (isspace(handler.look_ahead())) + handler.consume(); + continue; + } + + if (*fmt != '%' || fmt[1] == '%') { + if (*fmt == '%') + fmt++; + char c = handler.consume(); + if (c != *fmt) + break; + continue; + } + + void *dest = NULL; + /* %n$ format */ + if (isdigit(*fmt) && fmt[1] == '$') { + /* TODO: dest = get_arg_at_pos(args, *fmt -'0'); */ + fmt += 3; + } else { + if (fmt[1] != '*') { + dest = va_arg(args, void*); + } + fmt++; + } + + int width = 0; + if (*fmt == '*') { + fmt++; + } else if (*fmt == '\'') { + /* TODO: numeric seperators locale stuff */ + mlibc::infoLogger() << "do_scanf: \' not implemented!" << frg::endlog; + fmt++; + continue; + } else if (*fmt == 'm') { + /* TODO: allocate buffer for them */ + mlibc::infoLogger() << "do_scanf: m not implemented!" << frg::endlog; + fmt++; + continue; + } else if (*fmt >= '0' && *fmt <= '9') { + /* read in width specifier */ + width = 0; + while (*fmt >= '0' && *fmt <= '9') { + width = width * 10 + (*fmt - '0'); + fmt++; + continue; + } + } + + /* type modifiers */ + unsigned int type = SCANF_TYPE_INT; + unsigned int base = 10; + switch (*fmt) { + case 'h': { + if (fmt[1] == 'h') { + type = SCANF_TYPE_CHAR; + fmt += 2; + break; + } + type = SCANF_TYPE_SHORT; + fmt++; + break; + } + case 'j': { + type = SCANF_TYPE_INTMAX; + fmt++; + break; + } + case 'l': { + if (fmt[1] == 'l') { + type = SCANF_TYPE_LL; + fmt += 2; + break; + } + type = SCANF_TYPE_L; + fmt++; + break; + } + case 'L': { + type = SCANF_TYPE_LL; + fmt++; + break; + } + case 'q': { + type = SCANF_TYPE_LL; + fmt++; + break; + } + case 't': { + type = SCANF_TYPE_PTRDIFF; + fmt++; + break; + } + case 'z': { + type = SCANF_TYPE_SIZE_T; + fmt++; + break; + } + } + + // Leading whitespace is skipped for most conversions except these. + if (*fmt != 'c' && *fmt != '[' && *fmt != 'n') { + while (isspace(handler.look_ahead())) + handler.consume(); + } + + switch (*fmt) { + case 'd': + case 'u': + base = 10; + [[fallthrough]]; + case 'i': { + bool is_negative = false; + unsigned long long res = 0; + + if((*fmt == 'i' || *fmt == 'd') && handler.look_ahead() == '-') { + handler.consume(); + is_negative = true; + } + + if(*fmt == 'i' && handler.look_ahead() == '0') { + handler.consume(); + if(handler.look_ahead() == 'x') { + handler.consume(); + base = 16; + } else { + base = 8; + } + } + + char c = handler.look_ahead(); + switch (base) { + case 10: + if(!isdigit(c)) + return match_count; + while (c >= '0' && c <= '9') { + handler.consume(); + res = res * 10 + (c - '0'); + c = handler.look_ahead(); + } + break; + case 16: + if (c == '0') { + handler.consume(); + c = handler.look_ahead(); + if (c == 'x') { + handler.consume(); + c = handler.look_ahead(); + } + } + while (true) { + if (c >= '0' && c <= '9') { + handler.consume(); + res = res * 16 + (c - '0'); + } else if (c >= 'a' && c <= 'f') { + handler.consume(); + res = res * 16 + (c - 'a' + 10); + } else if (c >= 'A' && c <= 'F') { + handler.consume(); + res = res * 16 + (c - 'A' + 10); + } else { + break; + } + c = handler.look_ahead(); + } + break; + case 8: + while (c >= '0' && c <= '7') { + handler.consume(); + res = res * 8 + (c - '0'); + c = handler.look_ahead(); + } + break; + } + if (dest) { + if(is_negative) + store_int(dest, type, -res); + else + store_int(dest, type, res); + } + break; + } + case 'o': { + unsigned long long res = 0; + char c = handler.look_ahead(); + while (c >= '0' && c <= '7') { + handler.consume(); + res = res * 8 + (c - '0'); + c = handler.look_ahead(); + } + if (dest) + store_int(dest, type, res); + break; + } + case 'x': + case 'X': { + unsigned long long res = 0; + char c = handler.look_ahead(); + if (c == '0') { + handler.consume(); + c = handler.look_ahead(); + if (c == 'x') { + handler.consume(); + c = handler.look_ahead(); + } + } + while (true) { + if (c >= '0' && c <= '9') { + handler.consume(); + res = res * 16 + (c - '0'); + } else if (c >= 'a' && c <= 'f') { + handler.consume(); + res = res * 16 + (c - 'a' + 10); + } else if (c >= 'A' && c <= 'F') { + handler.consume(); + res = res * 16 + (c - 'A' + 10); + } else { + break; + } + c = handler.look_ahead(); + } + if (dest) + store_int(dest, type, res); + break; + } + case 's': { + char *typed_dest = (char *)dest; + char c = handler.look_ahead(); + int count = 0; + while (c && !isspace(c)) { + handler.consume(); + if (typed_dest) + typed_dest[count] = c; + c = handler.look_ahead(); + count++; + if (width && count >= width) + break; + } + if (typed_dest) + typed_dest[count] = '\0'; + break; + } + case 'c': { + char *typed_dest = (char *)dest; + char c = handler.look_ahead(); + int count = 0; + if (!width) + width = 1; + while (c && count < width) { + handler.consume(); + if (typed_dest) + typed_dest[count] = c; + c = handler.look_ahead(); + count++; + } + break; + } + case '[': { + fmt++; + int invert = 0; + if (*fmt == '^') { + invert = 1; + fmt++; + } + + char scanset[257]; + memset(&scanset[0], invert, sizeof(char) * 257); + scanset[0] = '\0'; + + if (*fmt == '-') { + fmt++; + scanset[1+'-'] = 1 - invert; + } else if (*fmt == ']') { + fmt++; + scanset[1+']'] = 1 - invert; + } + + for (; *fmt != ']'; fmt++) { + if (!*fmt) return EOF; + if (*fmt == '-' && *fmt != ']') { + fmt++; + for (char c = *(fmt - 2); c < *fmt; c++) + scanset[1 + c] = 1 - invert; + } + scanset[1 + *fmt] = 1 - invert; + } + + char *typed_dest = (char *)dest; + int count = 0; + char c = handler.look_ahead(); + while (c && (!width || count < width)) { + handler.consume(); + if (!scanset[1 + c]) + break; + if (typed_dest) + typed_dest[count] = c; + c = handler.look_ahead(); + count++; + } + if (typed_dest) + typed_dest[count] = '\0'; + break; + } + case 'p': { + unsigned long long res = 0; + char c = handler.look_ahead(); + if (c == '0') { + handler.consume(); + c = handler.look_ahead(); + if (c == 'x') { + handler.consume(); + c = handler.look_ahead(); + } + } + while (true) { + if (c >= '0' && c <= '9') { + handler.consume(); + res = res * 16 + (c - '0'); + } else if (c >= 'a' && c <= 'f') { + handler.consume(); + res = res * 16 + (c - 'a'); + } else if (c >= 'A' && c <= 'F') { + handler.consume(); + res = res * 16 + (c - 'A'); + } else { + break; + } + c = handler.look_ahead(); + } + void **typed_dest = (void **)dest; + *typed_dest = (void *)(uintptr_t)res; + break; + } + case 'n': { + int *typed_dest = (int *)dest; + if (typed_dest) + *typed_dest = handler.num_consumed; + continue; + } + } + if (dest) match_count++; + } + return match_count; +} + +int scanf(const char *__restrict format, ...) { + va_list args; + va_start(args, format); + int result = vfscanf(stdin, format, args); + va_end(args); + return result; +} + +int snprintf(char *__restrict buffer, size_t max_size, const char *__restrict format, ...) { + va_list args; + va_start(args, format); + int result = vsnprintf(buffer, max_size, format, args); + va_end(args); + return result; +} + +int sprintf(char *__restrict buffer, const char *__restrict format, ...) { + va_list args; + va_start(args, format); + int result = vsprintf(buffer, format, args); + va_end(args); + return result; +} + +int sscanf(const char *__restrict buffer, const char *__restrict format, ...) { + va_list args; + va_start(args, format); + + int result = vsscanf(buffer, format, args); + + va_end(args); + return result; +} + +int vfprintf(FILE *__restrict stream, const char *__restrict format, __builtin_va_list args) { + frg::va_struct vs; + frg::arg arg_list[NL_ARGMAX + 1]; + vs.arg_list = arg_list; + va_copy(vs.args, args); + auto file = static_cast<mlibc::abstract_file *>(stream); + frg::unique_lock lock(file->_lock); + StreamPrinter p{stream}; +// mlibc::infoLogger() << "printf(" << format << ")" << frg::endlog; + auto res = frg::printf_format(PrintfAgent{&p, &vs}, format, &vs); + if (!res) + return -static_cast<int>(res.error()); + + return p.count; +} + +int vfscanf(FILE *__restrict stream, const char *__restrict format, __builtin_va_list args) { + auto file = static_cast<mlibc::abstract_file *>(stream); + frg::unique_lock lock(file->_lock); + + struct { + char look_ahead() { + char c; + size_t actual_size; + file->read(&c, 1, &actual_size); + if (actual_size) + file->unget(c); + return actual_size ? c : 0; + } + + char consume() { + char c; + size_t actual_size; + file->read(&c, 1, &actual_size); + if (actual_size) + num_consumed++; + return actual_size ? c : 0; + } + + mlibc::abstract_file *file; + int num_consumed; + } handler = {file, 0}; + + return do_scanf(handler, format, args); +} + +int vprintf(const char *__restrict format, __builtin_va_list args){ + return vfprintf(stdout, format, args); +} + +int vscanf(const char *__restrict, __builtin_va_list) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int vsnprintf(char *__restrict buffer, size_t max_size, + const char *__restrict format, __builtin_va_list args) { + frg::va_struct vs; + frg::arg arg_list[NL_ARGMAX + 1]; + vs.arg_list = arg_list; + va_copy(vs.args, args); + LimitedPrinter p{buffer, max_size ? max_size - 1 : 0}; +// mlibc::infoLogger() << "printf(" << format << ")" << frg::endlog; + auto res = frg::printf_format(PrintfAgent{&p, &vs}, format, &vs); + if (!res) + return -static_cast<int>(res.error()); + if (max_size) + p.buffer[frg::min(max_size - 1, p.count)] = 0; + return p.count; +} + +int vsprintf(char *__restrict buffer, const char *__restrict format, __builtin_va_list args) { + frg::va_struct vs; + frg::arg arg_list[NL_ARGMAX + 1]; + vs.arg_list = arg_list; + va_copy(vs.args, args); + BufferPrinter p(buffer); +// mlibc::infoLogger() << "printf(" << format << ")" << frg::endlog; + auto res = frg::printf_format(PrintfAgent{&p, &vs}, format, &vs); + if (!res) + return -static_cast<int>(res.error()); + p.buffer[p.count] = 0; + return p.count; +} + +int vsscanf(const char *__restrict buffer, const char *__restrict format, __builtin_va_list args) { + struct { + char look_ahead() { + return *buffer; + } + + char consume() { + num_consumed++; + return *buffer++; + } + + const char *buffer; + int num_consumed; + } handler = {buffer, 0}; + + int result = do_scanf(handler, format, args); + + return result; +} + +int fwprintf(FILE *__restrict, const wchar_t *__restrict, ...) MLIBC_STUB_BODY +int fwscanf(FILE *__restrict, const wchar_t *__restrict, ...) MLIBC_STUB_BODY +int vfwprintf(FILE *__restrict, const wchar_t *__restrict, __builtin_va_list) MLIBC_STUB_BODY +int vfwscanf(FILE *__restrict, const wchar_t *__restrict, __builtin_va_list) MLIBC_STUB_BODY + +int swprintf(wchar_t *__restrict, size_t, const wchar_t *__restrict, ...) MLIBC_STUB_BODY +int swscanf(wchar_t *__restrict, size_t, const wchar_t *__restrict, ...) MLIBC_STUB_BODY +int vswprintf(wchar_t *__restrict, size_t, const wchar_t *__restrict, __builtin_va_list) MLIBC_STUB_BODY +int vswscanf(wchar_t *__restrict, size_t, const wchar_t *__restrict, __builtin_va_list) MLIBC_STUB_BODY + +int wprintf(const wchar_t *__restrict, ...) MLIBC_STUB_BODY +int wscanf(const wchar_t *__restrict, ...) MLIBC_STUB_BODY +int vwprintf(const wchar_t *__restrict, __builtin_va_list) MLIBC_STUB_BODY +int vwscanf(const wchar_t *__restrict, __builtin_va_list) MLIBC_STUB_BODY + +int fgetc(FILE *stream) { + char c; + auto bytes_read = fread(&c, 1, 1, stream); + if(bytes_read != 1) + return EOF; + return c; +} + +char *fgets(char *__restrict buffer, size_t max_size, FILE *__restrict stream) { + auto file = static_cast<mlibc::abstract_file *>(stream); + frg::unique_lock lock(file->_lock); + return fgets_unlocked(buffer, max_size, stream); +} + +int fputc_unlocked(int c, FILE *stream) { + char d = c; + if(fwrite_unlocked(&d, 1, 1, stream) != 1) + return EOF; + return 1; +} + +int fputc(int c, FILE *stream) { + auto file = static_cast<mlibc::abstract_file *>(stream); + frg::unique_lock lock(file->_lock); + return fputc_unlocked(c, stream); +} + +int fputs_unlocked(const char *__restrict string, FILE *__restrict stream) { + if(fwrite_unlocked(string, strlen(string), 1, stream) != 1) + return EOF; + return 1; +} + +int fputs(const char *__restrict string, FILE *__restrict stream) { + auto file = static_cast<mlibc::abstract_file *>(stream); + frg::unique_lock lock(file->_lock); + return fputs_unlocked(string, stream); +} + +int getc_unlocked(FILE *stream) { + return fgetc_unlocked(stream); +} + +int getc(FILE *stream) { + return fgetc(stream); +} + +int getchar_unlocked(void) { + return fgetc_unlocked(stdin); +} + +int getchar(void) { + return fgetc(stdin); +} + +char *gets(char *s){ + return fgets(s, SIZE_MAX, stdin); +} + +int putc_unlocked(int c, FILE *stream) { + char d = c; + if(fwrite_unlocked(&d, 1, 1, stream) != 1) + return EOF; + return c; +} + +int putc(int c, FILE *stream) { + auto file = static_cast<mlibc::abstract_file *>(stream); + frg::unique_lock lock(file->_lock); + return putc_unlocked(c, stream); +} + +int putchar_unlocked(int c) { + return putc_unlocked(c, stdout); +} + +int putchar(int c) { + auto file = static_cast<mlibc::abstract_file *>(stdout); + frg::unique_lock lock(file->_lock); + return putchar_unlocked(c); +} + +int puts(const char *string) { + auto file = static_cast<mlibc::abstract_file *>(stdout); + frg::unique_lock lock(file->_lock); + + size_t progress = 0; + size_t len = strlen(string); + while(progress < len) { + size_t chunk; + if(file->write(string + progress, + len - progress, &chunk)) { + return EOF; + }else if(!chunk) { + return EOF; + } + + progress += chunk; + } + + size_t unused; + if (!file->write("\n", 1, &unused)) { + return EOF; + } + + return 1; +} + +wint_t fgetwc(FILE *) MLIBC_STUB_BODY +wchar_t *fgetws(wchar_t *__restrict, int, FILE *__restrict) MLIBC_STUB_BODY +wint_t fputwc(wchar_t, FILE *) MLIBC_STUB_BODY +int fputws(const wchar_t *__restrict, FILE *__restrict) MLIBC_STUB_BODY +int fwide(FILE *, int) MLIBC_STUB_BODY +wint_t getwc(FILE *) MLIBC_STUB_BODY +wint_t getwchar(void) MLIBC_STUB_BODY +wint_t putwc(wchar_t, FILE *) MLIBC_STUB_BODY +wint_t putwchar(wchar_t) MLIBC_STUB_BODY +wint_t ungetwc(wint_t, FILE *) MLIBC_STUB_BODY + +size_t fread(void *buffer, size_t size, size_t count, FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + return fread_unlocked(buffer, size, count, file_base); +} + +size_t fwrite(const void *buffer, size_t size , size_t count, FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + return fwrite_unlocked(buffer, size, count, file_base); +} + +int fgetpos(FILE *__restrict, fpos_t *__restrict) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +// fseek() is provided by the POSIX sublibrary +int fsetpos(FILE *, const fpos_t *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +// ftell() is provided by the POSIX sublibrary + +void clearerr(FILE *file_base) { + file_base->__status_bits = 0; +} + +int feof(FILE *file_base) { + return file_base->__status_bits & __MLIBC_EOF_BIT; +} + +int ferror(FILE *file_base) { + return file_base->__status_bits & __MLIBC_ERROR_BIT; +} + +void perror(const char *string) { + int error = errno; + if (string && *string) { + fprintf(stderr, "%s: ", string); + } + fprintf(stderr, "%s\n", strerror(error)); +} + +// POSIX extensions. + +ssize_t getline(char **line, size_t *n, FILE *stream) { + return getdelim(line, n, '\n', stream); +} + +ssize_t getdelim(char **line, size_t *n, int delim, FILE *stream) { + // Otherwise, we cannot store the buffer / size. + if(!line || !n) { + errno = EINVAL; + return -1; + } + + char *buffer = *line; + /* set the starting capacity to 512 if buffer = NULL */ + size_t capacity = (!buffer) ? 512 : *n; + size_t nwritten = 0; + + auto file = static_cast<mlibc::abstract_file *>(stream); + frg::unique_lock lock(file->_lock); + + // Avoid allocating if we've already hit the end + auto c = fgetc_unlocked(stream); + if (c == EOF || ferror(stream)) { + return -1; + } else { + file->unget(c); + } + + while (true) { + // Fill the buffer + while (buffer && capacity > 0 && nwritten < capacity - 1) { + auto c = fgetc_unlocked(stream); + if (ferror(stream)) { + return -1; + } else if (c == EOF) { + buffer[nwritten] = 0; + return nwritten; + } + + buffer[nwritten++] = c; + + if (c == delim) { + buffer[nwritten] = 0; + return nwritten; + } + } + + // Double the size of the buffer (but make sure it's at least 1024) + capacity = (capacity >= 1024) ? capacity * 2 : 1024; + buffer = reinterpret_cast<char *>(getAllocator().reallocate(*line, capacity)); + if (!buffer) { + errno = ENOMEM; + return -1; + } + + *line = buffer; + *n = capacity; + } +} + +// GLIBC extensions. + +int asprintf(char **out, const char *format, ...) { + va_list args; + va_start(args, format); + int result = vasprintf(out, format, args); + va_end(args); + return result; +} + +int vasprintf(char **out, const char *format, __builtin_va_list args) { + frg::va_struct vs; + frg::arg arg_list[NL_ARGMAX + 1]; + vs.arg_list = arg_list; + va_copy(vs.args, args); + ResizePrinter p; +// mlibc::infoLogger() << "printf(" << format << ")" << frg::endlog; + auto res = frg::printf_format(PrintfAgent{&p, &vs}, format, &vs); + if (!res) + return -static_cast<int>(res.error()); + p.expand(); + p.buffer[p.count] = 0; + *out = p.buffer; + return p.count; +} + +// Linux unlocked I/O extensions. + +void flockfile(FILE *file_base) { + static_cast<mlibc::abstract_file *>(file_base)->_lock.lock(); +} + +void funlockfile(FILE *file_base) { + static_cast<mlibc::abstract_file *>(file_base)->_lock.unlock(); +} + +int ftrylockfile(FILE *file_base) { + static_cast<mlibc::abstract_file *>(file_base)->_lock.try_lock(); + return 0; +} + +void clearerr_unlocked(FILE *file_base) { + file_base->__status_bits = 0; +} + +int feof_unlocked(FILE *file_base) { + return file_base->__status_bits & __MLIBC_EOF_BIT; +} + +int ferror_unlocked(FILE *file_base) { + return file_base->__status_bits & __MLIBC_ERROR_BIT; +} + +int fgetc_unlocked(FILE *stream) { + unsigned char d; + if(fread_unlocked(&d, 1, 1, stream) != 1) + return EOF; + return (int)d; +} + +size_t fread_unlocked(void *buffer, size_t size, size_t count, FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + if(!size || !count) + return 0; + + // Distinguish two cases here: If the object size is one, we perform byte-wise reads. + // Otherwise, we try to read each object individually. + if(size == 1) { + size_t progress = 0; + while(progress < count) { + size_t chunk; + if(int e = file->read((char *)buffer + progress, + count - progress, &chunk)) { + errno = e; + return 0; + }else if(!chunk) { + // TODO: Handle eof. + break; + } + + progress += chunk; + } + + return progress; + }else{ + for(size_t i = 0; i < count; i++) { + size_t progress = 0; + while(progress < size) { + size_t chunk; + if(int e = file->read((char *)buffer + i * size + progress, + size - progress, &chunk)) { + errno = e; + return 0; + }else if(!chunk) { + // TODO: Handle eof. + break; + } + + progress += chunk; + } + + if(progress < size) + return i; + } + + return count; + } +} + +size_t fwrite_unlocked(const void *buffer, size_t size, size_t count, FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + if(!size || !count) + return 0; + + // Distinguish two cases here: If the object size is one, we perform byte-wise writes. + // Otherwise, we try to write each object individually. + if(size == 1) { + size_t progress = 0; + while(progress < count) { + size_t chunk; + if(file->write((const char *)buffer + progress, + count - progress, &chunk)) { + // TODO: Handle I/O errors. + mlibc::infoLogger() << "mlibc: fwrite() I/O errors are not handled" + << frg::endlog; + break; + }else if(!chunk) { + // TODO: Handle eof. + break; + } + + progress += chunk; + } + + return progress; + }else{ + for(size_t i = 0; i < count; i++) { + size_t progress = 0; + while(progress < size) { + size_t chunk; + if(file->write((const char *)buffer + i * size + progress, + size - progress, &chunk)) { + // TODO: Handle I/O errors. + mlibc::infoLogger() << "mlibc: fwrite() I/O errors are not handled" + << frg::endlog; + break; + }else if(!chunk) { + // TODO: Handle eof. + break; + } + + progress += chunk; + } + + if(progress < size) + return i; + } + + return count; + } +} + +char *fgets_unlocked(char *__restrict buffer, int max_size, FILE *stream) { + __ensure(max_size > 0); + for(int i = 0; ; i++) { + if(i == max_size - 1) { + buffer[i] = 0; + return buffer; + } + + auto c = fgetc_unlocked(stream); + + // If fgetc() fails, there is either an EOF or an I/O error. + if(c == EOF) { + if(i) { + buffer[i] = 0; + return buffer; + } else { + // In this case, the buffer is not changed. + return nullptr; + } + } else { + buffer[i] = c; + } + + if(c == '\n') { + buffer[i + 1] = 0; + return buffer; + } + } +} diff --git a/lib/mlibc/options/ansi/generic/stdlib-stubs.cpp b/lib/mlibc/options/ansi/generic/stdlib-stubs.cpp new file mode 100644 index 0000000..86b8a9a --- /dev/null +++ b/lib/mlibc/options/ansi/generic/stdlib-stubs.cpp @@ -0,0 +1,511 @@ + +#include <errno.h> +#include <stdint.h> +#include <stdlib.h> +#include <string.h> +#include <signal.h> +#include <ctype.h> +#include <stdio.h> +#include <wchar.h> +#include <setjmp.h> +#include <limits.h> + +#include <frg/random.hpp> +#include <mlibc/debug.hpp> +#include <bits/ensure.h> +#include <bits/sigset_t.h> + +#include <mlibc/allocator.hpp> +#include <mlibc/charcode.hpp> +#include <mlibc/ansi-sysdeps.hpp> +#include <mlibc/strtofp.hpp> +#include <mlibc/strtol.hpp> +#include <mlibc/global-config.hpp> + +#if __MLIBC_POSIX_OPTION +#include <pthread.h> +#endif // __MLIBC_POSIX_OPTION + +extern "C" int __cxa_atexit(void (*function)(void *), void *argument, void *dso_tag); +void __mlibc_do_finalize(); + +namespace { + // According to the first paragraph of [C11 7.22.7], + // mblen(), mbtowc() and wctomb() have an internal state. + // The string functions mbstowcs() and wcstombs() do *not* have this state. + thread_local __mlibc_mbstate mblen_state = __MLIBC_MBSTATE_INITIALIZER; + thread_local __mlibc_mbstate mbtowc_state = __MLIBC_MBSTATE_INITIALIZER; +} + +double atof(const char *string) { + return strtod(string, NULL); +} +int atoi(const char *string) { + return strtol(string, nullptr, 10); +} +long atol(const char *string) { + return strtol(string, nullptr, 10); +} +long long atoll(const char *string) { + return strtoll(string, nullptr, 10); +} + +// POSIX extensions but are here for simplicities sake. Forward declaration is here +// to avoid exporting sigprocmask when posix is disabled. +int sigprocmask(int, const sigset_t *__restrict, sigset_t *__restrict); +extern "C" { + __attribute__((__returns_twice__)) int __sigsetjmp(sigjmp_buf buffer, int savesigs) { + buffer[0].savesigs = savesigs; + if (savesigs) + sigprocmask(0, NULL, &buffer[0].sigset); + return 0; + } +} + +__attribute__((__noreturn__)) void siglongjmp(sigjmp_buf buffer, int value) { + if (buffer[0].savesigs) + sigprocmask(SIG_SETMASK, &buffer[0].sigset, NULL); + jmp_buf b; + b[0].reg_state = buffer[0].reg_state; + longjmp(b, value); +} + +double strtod(const char *__restrict string, char **__restrict end) { + return mlibc::strtofp<double>(string, end); +} +float strtof(const char *__restrict string, char **__restrict end) { + return mlibc::strtofp<float>(string, end); +} +long double strtold(const char *__restrict string, char **__restrict end) { + return mlibc::strtofp<long double>(string, end); +} + +long strtol(const char *__restrict string, char **__restrict end, int base) { + return mlibc::stringToInteger<long, char>(string, end, base); +} +long long strtoll(const char *__restrict string, char **__restrict end, int base) { + return mlibc::stringToInteger<long long, char>(string, end, base); +} +unsigned long strtoul(const char *__restrict string, char **__restrict end, int base) { + return mlibc::stringToInteger<unsigned long, char>(string, end, base); +} +unsigned long long strtoull(const char *__restrict string, char **__restrict end, int base) { + return mlibc::stringToInteger<unsigned long long, char>(string, end, base); +} + +frg::mt19937 __mlibc_rand_engine; + +int rand() { + // rand() is specified to return a positive number so we discard the MSB. + return static_cast<int>(__mlibc_rand_engine() & 0x7FFFFFFF); +} + +static unsigned temper(unsigned x) { + x ^= x >> 11; + x ^= x << 7 & 0x9D2C5680; + x ^= x << 15 & 0xEFC60000; + x ^= x >> 18; + return x; +} + +int rand_r(unsigned *seed) { + return temper(*seed = *seed * 1103515245 + 12345) / 2; +} + +void srand(unsigned int s) { + __mlibc_rand_engine.seed(s); +} + +void *aligned_alloc(size_t alignment, size_t size) { + void *ptr; + + // alignment must be a power of two, and size % alignment must be 0 + if (alignment & (alignment - 1) || size & (alignment - 1)) { + errno = EINVAL; + return nullptr; + } + + // posix_memalign requires that the alignment is a multiple of sizeof(void *) + if (alignment < sizeof(void *)) + alignment = sizeof(void *); + + int ret = posix_memalign(&ptr, alignment, size); + if (ret) { + errno = ret; + return nullptr; + } + return ptr; + +} +void *calloc(size_t count, size_t size) { + // we want to ensure that count*size > SIZE_MAX doesn't happen + // to prevent overflowing, we divide both sides of the inequality by size and check with that + if(size && count > (SIZE_MAX / size)) { + errno = EINVAL; + return NULL; + } + + // TODO: this could be done more efficient if the OS gives us already zero'd pages + void *ptr = malloc(count * size); + if(!ptr) + return nullptr; + memset(ptr, 0, count * size); + return ptr; +} +// free() is provided by the platform +// malloc() is provided by the platform +// realloc() is provided by the platform + +void abort(void) { + sigset_t set; + sigemptyset(&set); + sigaddset(&set, SIGABRT); + if (mlibc::sys_sigprocmask) { + mlibc::sys_sigprocmask(SIG_UNBLOCK, &set, nullptr); + } + + raise(SIGABRT); + + sigfillset(&set); + sigdelset(&set, SIGABRT); + if (mlibc::sys_sigprocmask) { + mlibc::sys_sigprocmask(SIG_SETMASK, &set, nullptr); + } + + struct sigaction sa; + sa.sa_handler = SIG_DFL; + sa.sa_flags = 0; + sigemptyset(&sa.sa_mask); + + if (mlibc::sys_sigaction(SIGABRT, &sa, nullptr)) + mlibc::panicLogger() << "mlibc: sigaction failed in abort" << frg::endlog; + + if (raise(SIGABRT)) + mlibc::panicLogger() << "mlibc: raise failed in abort" << frg::endlog; + + __builtin_trap(); +} + +int atexit(void (*func)(void)) { + // TODO: the function pointer types are not compatible; + // the conversion here is undefined behavior. its fine to do + // this on the x86_64 abi though. + __cxa_atexit((void (*) (void *))func, nullptr, nullptr); + return 0; +} +int at_quick_exit(void (*func)(void)) { + (void)func; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void exit(int status) { + __mlibc_do_finalize(); + mlibc::sys_exit(status); +} + +void _Exit(int status) { + mlibc::sys_exit(status); +} + +// getenv() is provided by POSIX +void quick_exit(int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +extern char **environ; + +int system(const char *command) { + int status = -1; + pid_t child; + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fork && mlibc::sys_waitpid && + mlibc::sys_execve && mlibc::sys_sigprocmask && mlibc::sys_sigaction, -1); + +#if __MLIBC_POSIX_OPTION + pthread_testcancel(); +#endif // __MLIBC_POSIX_OPTION + + if (!command) { + return 1; + } + + struct sigaction new_sa, old_int, old_quit; + sigset_t new_mask, old_mask; + + new_sa.sa_handler = SIG_IGN; + new_sa.sa_flags = 0; + sigemptyset(&new_sa.sa_mask); + mlibc::sys_sigaction(SIGINT, &new_sa, &old_int); + mlibc::sys_sigaction(SIGQUIT, &new_sa, &old_quit); + + sigemptyset(&new_mask); + sigaddset(&new_mask, SIGCHLD); + mlibc::sys_sigprocmask(SIG_BLOCK, &new_mask, &old_mask); + + if (int e = mlibc::sys_fork(&child)) { + errno = e; + } else if (!child) { + mlibc::sys_sigaction(SIGINT, &old_int, nullptr); + mlibc::sys_sigaction(SIGQUIT, &old_quit, nullptr); + mlibc::sys_sigprocmask(SIG_SETMASK, &old_mask, nullptr); + + const char *args[] = { + "sh", "-c", command, nullptr + }; + + mlibc::sys_execve("/bin/sh", const_cast<char **>(args), environ); + _Exit(127); + } else { + int err; + pid_t unused; + + while ((err = mlibc::sys_waitpid(child, &status, 0, NULL, &unused)) < 0) { + if (err == EINTR) + continue; + + errno = err; + status = -1; + } + } + + mlibc::sys_sigaction(SIGINT, &old_int, nullptr); + mlibc::sys_sigaction(SIGQUIT, &old_quit, nullptr); + mlibc::sys_sigprocmask(SIG_SETMASK, &old_mask, nullptr); + + return status; +} + +char *mktemp(char *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void *bsearch(const void *key, const void *base, size_t count, size_t size, + int (*compare)(const void *, const void *)) { + // Invariant: Element is in the interval [i, j). + size_t i = 0; + size_t j = count; + + while(i < j) { + size_t k = (j - i) / 2; + auto element = reinterpret_cast<const char *>(base) + (i + k) * size; + auto res = compare(key, element); + if(res < 0) { + j = i + k; + }else if(res > 0) { + i = i + k + 1; + }else{ + return const_cast<char *>(element); + } + } + __ensure(i == j); + + return nullptr; +} + +static int qsort_callback(const void *a, const void *b, void *arg) { + auto compare = reinterpret_cast<int (*)(const void *, const void *)>(arg); + + return compare(a, b); +} + +void qsort(void *base, size_t count, size_t size, + int (*compare)(const void *, const void *)) { + return qsort_r(base, count, size, qsort_callback, (void *) compare); +} + +void qsort_r(void *base, size_t count, size_t size, + int (*compare)(const void *, const void *, void *), + void *arg) { + // TODO: implement a faster sort + for(size_t i = 0; i < count; i++) { + void *u = (void *)((uintptr_t)base + i * size); + for(size_t j = i + 1; j < count; j++) { + void *v = (void *)((uintptr_t)base + j * size); + if(compare(u, v, arg) <= 0) + continue; + + // swap u and v + char *u_bytes = (char *)u; + char *v_bytes = (char *)v; + for(size_t k = 0; k < size; k++) { + char temp = u_bytes[k]; + u_bytes[k] = v_bytes[k]; + v_bytes[k] = temp; + } + } + } +} + +int abs(int num) { + return num < 0 ? -num : num; +} + +long labs(long num) { + return num < 0 ? -num : num; +} + +long long llabs(long long num) { + return num < 0 ? -num : num; +} + +div_t div(int number, int denom) { + div_t r; + r.quot = number / denom; + r.rem = number % denom; + return r; +} + +ldiv_t ldiv(long number, long denom) { + ldiv_t r; + r.quot = number / denom; + r.rem = number % denom; + return r; +} + +lldiv_t lldiv(long long number, long long denom) { + lldiv_t r; + r.quot = number / denom; + r.rem = number % denom; + return r; +} + +int mblen(const char *mbs, size_t mb_limit) { + auto cc = mlibc::current_charcode(); + wchar_t wc; + mlibc::code_seq<const char> nseq{mbs, mbs + mb_limit}; + mlibc::code_seq<wchar_t> wseq{&wc, &wc + 1}; + + if(!mbs) { + mblen_state = __MLIBC_MBSTATE_INITIALIZER; + return cc->has_shift_states; + } + + if(auto e = cc->decode_wtranscode(nseq, wseq, mblen_state); e != mlibc::charcode_error::null) + __ensure(!"decode_wtranscode() errors are not handled"); + return nseq.it - mbs; +} + +int mbtowc(wchar_t *__restrict wc, const char *__restrict mb, size_t max_size) { + auto cc = mlibc::current_charcode(); + __ensure(max_size); + + // If wc is NULL, decode into a single local character which we discard + // to obtain the length. + wchar_t tmp_wc; + if (!wc) + wc = &tmp_wc; + + if (mb) { + if (*mb) { + mlibc::code_seq<wchar_t> wseq{wc, wc + 1}; + mlibc::code_seq<const char> nseq{mb, mb + max_size}; + auto e = cc->decode_wtranscode(nseq, wseq, mbtowc_state); + switch(e) { + // We keep the state, so we can simply return here. + case mlibc::charcode_error::input_underflow: + case mlibc::charcode_error::null: { + return nseq.it - mb; + } + case mlibc::charcode_error::illegal_input: { + errno = -EILSEQ; + return -1; + } + case mlibc::charcode_error::dirty: { + mlibc::panicLogger() << "decode_wtranscode() charcode_error::dirty errors are not handled" << frg::endlog; + break; + } + case mlibc::charcode_error::output_overflow: { + mlibc::panicLogger() << "decode_wtranscode() charcode_error::output_overflow errors are not handled" << frg::endlog; + break; + } + } + __builtin_unreachable(); + } else { + *wc = L'\0'; + return 0; // When mbs is a null byte, return 0 + } + } else { + mblen_state = __MLIBC_MBSTATE_INITIALIZER; + return cc->has_shift_states; + } +} + +int wctomb(char *, wchar_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +size_t mbstowcs(wchar_t *wcs, const char *mbs, size_t wc_limit) { + auto cc = mlibc::current_charcode(); + __mlibc_mbstate st = __MLIBC_MBSTATE_INITIALIZER; + mlibc::code_seq<const char> nseq{mbs, nullptr}; + mlibc::code_seq<wchar_t> wseq{wcs, wcs + wc_limit}; + + if(!wcs) { + size_t size; + if(auto e = cc->decode_wtranscode_length(nseq, &size, st); e != mlibc::charcode_error::null) + __ensure(!"decode_wtranscode() errors are not handled"); + return size; + } + + if(auto e = cc->decode_wtranscode(nseq, wseq, st); e != mlibc::charcode_error::null) { + __ensure(!"decode_wtranscode() errors are not handled"); + __builtin_unreachable(); + }else{ + size_t n = wseq.it - wcs; + if(n < wc_limit) // Null-terminate resulting wide string. + wcs[n] = 0; + return n; + } +} + +size_t wcstombs(char *mb_string, const wchar_t *wc_string, size_t max_size) { + return wcsrtombs(mb_string, &wc_string, max_size, 0); +} + +void free(void *ptr) { + // TODO: Print PID only if POSIX option is enabled. + if (mlibc::globalConfig().debugMalloc) { + mlibc::infoLogger() << "mlibc (PID ?): free() on " + << ptr << frg::endlog; + if((uintptr_t)ptr & 1) + mlibc::infoLogger() << __builtin_return_address(0) << frg::endlog; + } + getAllocator().free(ptr); +} + +void *malloc(size_t size) { + auto nptr = getAllocator().allocate(size); + // TODO: Print PID only if POSIX option is enabled. + if (mlibc::globalConfig().debugMalloc) + mlibc::infoLogger() << "mlibc (PID ?): malloc() returns " + << nptr << frg::endlog; + return nptr; +} + +void *realloc(void *ptr, size_t size) { + auto nptr = getAllocator().reallocate(ptr, size); + // TODO: Print PID only if POSIX option is enabled. + if (mlibc::globalConfig().debugMalloc) + mlibc::infoLogger() << "mlibc (PID ?): realloc() on " + << ptr << " returns " << nptr << frg::endlog; + return nptr; +} + +int posix_memalign(void **out, size_t align, size_t size) { + if(align < sizeof(void *)) + return EINVAL; + if(align & (align - 1)) // Make sure that align is a power of two. + return EINVAL; + auto p = getAllocator().allocate(frg::max(align, size)); + if(!p) + return ENOMEM; + // Hope that the alignment was respected. This works on the current allocator. + // TODO: Make the allocator alignment-aware. + __ensure(!(reinterpret_cast<uintptr_t>(p) & (align - 1))); + *out = p; + return 0; +} diff --git a/lib/mlibc/options/ansi/generic/string-stubs.cpp b/lib/mlibc/options/ansi/generic/string-stubs.cpp new file mode 100644 index 0000000..8defd0e --- /dev/null +++ b/lib/mlibc/options/ansi/generic/string-stubs.cpp @@ -0,0 +1,542 @@ +#include <string.h> +#include <errno.h> +#include <wchar.h> +#include <ctype.h> + +#include <bits/ensure.h> +#include <mlibc/strtol.hpp> + +// memset() is defined in options/internals. +// memcpy() is defined in options/internals. +// memmove() is defined in options/internals. +// strlen() is defined in options/internals. + +char *strcpy(char *__restrict dest, const char *src) { + char *dest_bytes = (char *)dest; + char *src_bytes = (char *)src; + while(*src_bytes) + *(dest_bytes++) = *(src_bytes++); + *dest_bytes = 0; + return dest; +} +char *strncpy(char *__restrict dest, const char *src, size_t max_size) { + auto dest_bytes = static_cast<char *>(dest); + auto src_bytes = static_cast<const char *>(src); + size_t i = 0; + while(*src_bytes && i < max_size) { + *(dest_bytes++) = *(src_bytes++); + i++; + } + while(i < max_size) { + *(dest_bytes++) = 0; + i++; + } + return dest; +} + +char *strcat(char *__restrict dest, const char *__restrict src) { + strcpy(dest + strlen(dest), src); + return dest; +} +char *strncat(char *__restrict dest, const char *__restrict src, size_t max_size) { + auto dest_bytes = static_cast<char *>(dest); + auto src_bytes = static_cast<const char *>(src); + dest_bytes += strlen(dest); + size_t i = 0; + while(*src_bytes && i < max_size) { + *(dest_bytes++) = *(src_bytes++); + i++; + } + *dest_bytes = 0; + return dest; +} + +int memcmp(const void *a, const void *b, size_t size) { + for(size_t i = 0; i < size; i++) { + auto a_byte = static_cast<const unsigned char *>(a)[i]; + auto b_byte = static_cast<const unsigned char *>(b)[i]; + if(a_byte < b_byte) + return -1; + if(a_byte > b_byte) + return 1; + } + return 0; +} +int strcmp(const char *a, const char *b) { + size_t i = 0; + while(true) { + unsigned char a_byte = a[i]; + unsigned char b_byte = b[i]; + if(!a_byte && !b_byte) + return 0; + // If only one char is null, one of the following cases applies. + if(a_byte < b_byte) + return -1; + if(a_byte > b_byte) + return 1; + i++; + } +} + +int strcoll(const char *a, const char *b) { + // TODO: strcoll should take "LC_COLLATE" into account. + return strcmp(a, b); +} + +int strncmp(const char *a, const char *b, size_t max_size) { + size_t i = 0; + while(true) { + if(!(i < max_size)) + return 0; + unsigned char a_byte = a[i]; + unsigned char b_byte = b[i]; + if(!a_byte && !b_byte) + return 0; + // If only one char is null, one of the following cases applies. + if(a_byte < b_byte) + return -1; + if(a_byte > b_byte) + return 1; + i++; + } +} + +size_t strxfrm(char *__restrict dest, const char *__restrict src, size_t n) { + // NOTE: This might not work for non ANSI charsets. + size_t l = strlen(src); + + // man page: If the value returned is n or more, the contents of dest are indeterminate. + if(n > l) + strncpy(dest, src, n); + + return l; +} + +void *memchr(const void *s, int c, size_t size) { + auto s_bytes = static_cast<const unsigned char *>(s); + for(size_t i = 0; i < size; i++) + if(s_bytes[i] == static_cast<unsigned char>(c)) + return const_cast<unsigned char *>(s_bytes + i); + return nullptr; +} +char *strchr(const char *s, int c) { + size_t i = 0; + while(s[i]) { + if(s[i] == c) + return const_cast<char *>(&s[i]); + i++; + } + if(c == 0) + return const_cast<char *>(&s[i]); + return nullptr; +} +size_t strcspn(const char *s, const char *chrs) { + size_t n = 0; + while(true) { + if(!s[n] || strchr(chrs, s[n])) + return n; + n++; + } +} +char *strpbrk(const char *s, const char *chrs) { + size_t n = 0; + while(s[n]) { + if(strchr(chrs, s[n])) + return const_cast<char *>(s + n); + n++; + } + return nullptr; +} +char *strrchr(const char *s, int c) { + // The null-terminator is considered to be part of the string. + size_t length = strlen(s); + for(size_t i = 0; i <= length; i++) { + if(s[length - i] == c) + return const_cast<char *>(s + (length - i)); + } + return nullptr; +} +size_t strspn(const char *s, const char *chrs) { + size_t n = 0; + while(true) { + if(!s[n] || !strchr(chrs, s[n])) + return n; + n++; + } +} +char *strstr(const char *s, const char *pattern) { + for(size_t i = 0; s[i]; i++) { + bool found = true; + for(size_t j = 0; pattern[j]; j++) { + if(!pattern[j] || s[i + j] == pattern[j]) + continue; + + found = false; + break; + } + + if(found) + return const_cast<char *>(&s[i]); + } + + return nullptr; +} +char *strtok_r(char *__restrict s, const char *__restrict del, char **__restrict m) { + __ensure(m); + + // We use *m = null to memorize that the entire string was consumed. + char *tok; + if(s) { + tok = s; + }else if(*m) { + tok = *m; + }else { + return nullptr; + } + + // Skip initial delimiters. + // After this loop: *tok is non-null iff we return a token. + while(*tok && strchr(del, *tok)) + tok++; + + // Replace the following delimiter by a null-terminator. + // After this loop: *p is null iff we reached the end of the string. + auto p = tok; + while(*p && !strchr(del, *p)) + p++; + + if(*p) { + *p = 0; + *m = p + 1; + }else{ + *m = nullptr; + } + if(p == tok) + return nullptr; + return tok; +} +char *strtok(char *__restrict s, const char *__restrict delimiter) { + static char *saved; + return strtok_r(s, delimiter, &saved); +} + +// This is a GNU extension. +char *strchrnul(const char *s, int c) { + size_t i = 0; + while(s[i]) { + if(s[i] == c) + return const_cast<char *>(s + i); + i++; + } + return const_cast<char *>(s + i); +} + +double wcstod(const wchar_t *__restrict, wchar_t **__restrict) MLIBC_STUB_BODY +float wcstof(const wchar_t *__restrict, wchar_t **__restrict) MLIBC_STUB_BODY +long double wcstold(const wchar_t *__restrict, wchar_t **__restrict) MLIBC_STUB_BODY + +long wcstol(const wchar_t *__restrict nptr, wchar_t **__restrict endptr, int base) { + return mlibc::stringToInteger<long, wchar_t>(nptr, endptr, base); +} +unsigned long wcstoul(const wchar_t *__restrict nptr, wchar_t **__restrict endptr, int base) { + return mlibc::stringToInteger<unsigned long, wchar_t>(nptr, endptr, base); +} +long long wcstoll(const wchar_t *__restrict nptr, wchar_t **__restrict endptr, int base) { + return mlibc::stringToInteger<long long, wchar_t>(nptr, endptr, base); +} +unsigned long long wcstoull(const wchar_t *__restrict nptr, wchar_t **__restrict endptr, int base) { + return mlibc::stringToInteger<unsigned long long, wchar_t>(nptr, endptr, base); +} + +wchar_t *wcscpy(wchar_t *__restrict dest, const wchar_t *__restrict src) { + wchar_t *a = dest; + while((*dest++ = *src++)); + return a; +} + +wchar_t *wcsncpy(wchar_t *__restrict dest, const wchar_t *__restrict src, size_t n) { + wchar_t *a = dest; + while(n && *src) + n--, *dest++ = *src++; + wmemset(dest, 0, n); + return a; +} + +wchar_t *wmemcpy(wchar_t *__restrict dest, const wchar_t *__restrict src, size_t n) { + memcpy(dest, src, n * sizeof(wchar_t)); + return dest; +} + +wchar_t *wmemmove(wchar_t *dest, const wchar_t *src, size_t n) { + memmove(dest, src, n * sizeof(wchar_t)); + return dest; +} + +wchar_t *wcscat(wchar_t *__restrict dest, const wchar_t *__restrict src) { + wcscpy(dest + wcslen(dest), src); + return dest; +} + +wchar_t *wcsncat(wchar_t *__restrict, const wchar_t *__restrict, size_t) MLIBC_STUB_BODY + +int wcscmp(const wchar_t *l, const wchar_t *r) { + for(; *l == *r && *l && *r; l++, r++); + return *l - *r; +} + +int wcscoll(const wchar_t *, const wchar_t *) MLIBC_STUB_BODY +int wcsncmp(const wchar_t *, const wchar_t *, size_t) MLIBC_STUB_BODY +int wcsxfrm(wchar_t *__restrict, const wchar_t *__restrict, size_t) MLIBC_STUB_BODY + +int wmemcmp(const wchar_t *a, const wchar_t *b, size_t size) { + for(size_t i = 0; i < size; i++) { + auto a_byte = a[i]; + auto b_byte = b[i]; + if(a_byte < b_byte) + return -1; + if(a_byte > b_byte) + return 1; + } + return 0; +} + +wchar_t *wcschr(const wchar_t *s, wchar_t c) { + if(!c) + return (wchar_t *)s + wcslen(s); + for(; *s && *s != c; s++); + return *s ? (wchar_t *)s : 0; +} + +size_t wcscspn(const wchar_t *, const wchar_t *) MLIBC_STUB_BODY +wchar_t *wcspbrk(const wchar_t *, const wchar_t *) MLIBC_STUB_BODY + +wchar_t *wcsrchr(const wchar_t *s, wchar_t c) { + const wchar_t *p; + for(p = s + wcslen(s); p >= s && *p != c; p--); + return p >= s ? (wchar_t *)p : 0; +} + +size_t wcsspn(const wchar_t *, const wchar_t *) MLIBC_STUB_BODY +wchar_t *wcsstr(const wchar_t *, const wchar_t *) MLIBC_STUB_BODY +wchar_t *wcstok(wchar_t *__restrict, const wchar_t *__restrict, wchar_t **__restrict) MLIBC_STUB_BODY + +wchar_t *wmemchr(const wchar_t *s, wchar_t c, size_t size) { + auto s_bytes = s; + for(size_t i = 0; i < size; i++) + if(s_bytes[i] == c) + return const_cast<wchar_t *>(s_bytes + i); + return nullptr; +} + +size_t wcslen(const wchar_t *s) { + const wchar_t *a; + for(a = s; *s; s++); + return s-a; +} + +wchar_t *wmemset(wchar_t *d, wchar_t c, size_t n) { + wchar_t *ret = d; + while(n--) + *d++ = c; + return ret; +} + +char *strerror(int e) { + const char *s; + switch(e) { + case EAGAIN: s = "Operation would block (EAGAIN)"; break; + case EACCES: s = "Access denied (EACCESS)"; break; + case EBADF: s = "Bad file descriptor (EBADF)"; break; + case EEXIST: s = "File exists already (EEXIST)"; break; + case EFAULT: s = "Access violation (EFAULT)"; break; + case EINTR: s = "Operation interrupted (EINTR)"; break; + case EINVAL: s = "Invalid argument (EINVAL)"; break; + case EIO: s = "I/O error (EIO)"; break; + case EISDIR: s = "Resource is directory (EISDIR)"; break; + case ENOENT: s = "No such file or directory (ENOENT)"; break; + case ENOMEM: s = "Out of memory (ENOMEM)"; break; + case ENOTDIR: s = "Expected directory instead of file (ENOTDIR)"; break; + case ENOSYS: s = "Operation not implemented (ENOSYS)"; break; + case EPERM: s = "Operation not permitted (EPERM)"; break; + case EPIPE: s = "Broken pipe (EPIPE)"; break; + case ESPIPE: s = "Seek not possible (ESPIPE)"; break; + case ENXIO: s = "No such device or address (ENXIO)"; break; + case ENOEXEC: s = "Exec format error (ENOEXEC)"; break; + case ENOSPC: s = "No space left on device (ENOSPC)"; break; + case ENOTSOCK: s = "Socket operation on non-socket (ENOTSOCK)"; break; + case ENOTCONN: s = "Transport endpoint is not connected (ENOTCONN)"; break; + case EDOM: s = "Numerical argument out of domain (EDOM)"; break; + case EILSEQ: s = "Invalid or incomplete multibyte or wide character (EILSEQ)"; break; + case ERANGE: s = "Numerical result out of range (ERANGE)"; break; + case E2BIG: s = "Argument list too long (E2BIG)"; break; + case EADDRINUSE: s = "Address already in use (EADDRINUSE)"; break; + case EADDRNOTAVAIL: s = "Cannot assign requested address (EADDRNOTAVAIL)"; break; + case EAFNOSUPPORT: s = "Address family not supported by protocol (EAFNOSUPPORT)"; break; + case EALREADY: s = "Operation already in progress (EALREADY)"; break; + case EBADMSG: s = "Bad message (EBADMSG)"; break; + case EBUSY: s = "Device or resource busy (EBUSY)"; break; + case ECANCELED: s = "Operation canceled (ECANCELED)"; break; + case ECHILD: s = "No child processes (ECHILD)"; break; + case ECONNABORTED: s = "Software caused connection abort (ECONNABORTED)"; break; + case ECONNREFUSED: s = "Connection refused (ECONNREFUSED)"; break; + case ECONNRESET: s = "Connection reset by peer (ECONNRESET)"; break; + case EDEADLK: s = "Resource deadlock avoided (EDEADLK)"; break; + case EDESTADDRREQ: s = "Destination address required (EDESTADDRREQ)"; break; + case EDQUOT: s = "Disk quota exceeded (EDQUOT)"; break; + case EFBIG: s = "File too large (EFBIG)"; break; + case EHOSTUNREACH: s = "No route to host (EHOSTUNREACH)"; break; + case EIDRM: s = "Identifier removed (EIDRM)"; break; + case EINPROGRESS: s = "Operation now in progress (EINPROGRESS)"; break; + case EISCONN: s = "Transport endpoint is already connected (EISCONN)"; break; + case ELOOP: s = "Too many levels of symbolic links (ELOOP)"; break; + case EMFILE: s = "Too many open files (EMFILE)"; break; + case EMLINK: s = "Too many links (EMLINK)"; break; + case EMSGSIZE: s = "Message too long (EMSGSIZE)"; break; + case EMULTIHOP: s = "Multihop attempted (EMULTIHOP)"; break; + case ENAMETOOLONG: s = "File name too long (ENAMETOOLONG)"; break; + case ENETDOWN: s = "Network is down (ENETDOWN)"; break; + case ENETRESET: s = "Network dropped connection on reset (ENETRESET)"; break; + case ENETUNREACH: s = "Network is unreachable (ENETUNREACH)"; break; + case ENFILE: s = "Too many open files in system (ENFILE)"; break; + case ENOBUFS: s = "No buffer space available (ENOBUFS)"; break; + case ENODEV: s = "No such device (ENODEV)"; break; + case ENOLCK: s = "No locks available (ENOLCK)"; break; + case ENOLINK: s = "Link has been severed (ENOLINK)"; break; + case ENOMSG: s = "No message of desired type (ENOMSG)"; break; + case ENOPROTOOPT: s = "Protocol not available (ENOPROTOOPT)"; break; + case ENOTEMPTY: s = "Directory not empty (ENOTEMPTY)"; break; + case ENOTRECOVERABLE: s = "Sate not recoverable (ENOTRECOVERABLE)"; break; + case ENOTSUP: s = "Operation not supported (ENOTSUP)"; break; + case ENOTTY: s = "Inappropriate ioctl for device (ENOTTY)"; break; + case EOVERFLOW: s = "Value too large for defined datatype (EOVERFLOW)"; break; +#if EOPNOTSUPP != ENOTSUP + /* these are aliases on the mlibc abi */ + case EOPNOTSUPP: s = "Operation not supported (EOPNOTSUP)"; break; +#endif + case EOWNERDEAD: s = "Owner died (EOWNERDEAD)"; break; + case EPROTO: s = "Protocol error (EPROTO)"; break; + case EPROTONOSUPPORT: s = "Protocol not supported (EPROTONOSUPPORT)"; break; + case EPROTOTYPE: s = "Protocol wrong type for socket (EPROTOTYPE)"; break; + case EROFS: s = "Read-only file system (EROFS)"; break; + case ESRCH: s = "No such process (ESRCH)"; break; + case ESTALE: s = "Stale file handle (ESTALE)"; break; + case ETIMEDOUT: s = "Connection timed out (ETIMEDOUT)"; break; + case ETXTBSY: s = "Text file busy (ETXTBSY)"; break; + case EXDEV: s = "Invalid cross-device link (EXDEV)"; break; + case ENODATA: s = "No data available (ENODATA)"; break; + case ETIME: s = "Timer expired (ETIME)"; break; + case ENOKEY: s = "Required key not available (ENOKEY)"; break; + case ESHUTDOWN: s = "Cannot send after transport endpoint shutdown (ESHUTDOWN)"; break; + case EHOSTDOWN: s = "Host is down (EHOSTDOWN)"; break; + case EBADFD: s = "File descriptor in bad state (EBADFD)"; break; + case ENOMEDIUM: s = "No medium found (ENOMEDIUM)"; break; + case ENOTBLK: s = "Block device required (ENOTBLK)"; break; + case ENONET: s = "Machine is not on the network (ENONET)"; break; + case EPFNOSUPPORT: s = "Protocol family not supported (EPFNOSUPPORT)"; break; + case ESOCKTNOSUPPORT: s = "Socket type not supported (ESOCKTNOSUPPORT)"; break; + case ESTRPIPE: s = "Streams pipe error (ESTRPIPE)"; break; + case EREMOTEIO: s = "Remote I/O error (EREMOTEIO)"; break; + case ERFKILL: s = "Operation not possible due to RF-kill (ERFKILL)"; break; + case EBADR: s = "Invalid request descriptor (EBADR)"; break; + case EUNATCH: s = "Protocol driver not attached (EUNATCH)"; break; + case EMEDIUMTYPE: s = "Wrong medium type (EMEDIUMTYPE)"; break; + case EREMOTE: s = "Object is remote (EREMOTE)"; break; + case EKEYREJECTED: s = "Key was rejected by service (EKEYREJECTED)"; break; + case EUCLEAN: s = "Structure needs cleaning (EUCLEAN)"; break; + case EBADSLT: s = "Invalid slot (EBADSLT)"; break; + case ENOANO: s = "No anode (ENOANO)"; break; + case ENOCSI: s = "No CSI structure available (ENOCSI)"; break; + case ENOSTR: s = "Device not a stream (ENOSTR)"; break; + case ETOOMANYREFS: s = "Too many references: cannot splice (ETOOMANYREFS)"; break; + case ENOPKG: s = "Package not installed (ENOPKG)"; break; + case EKEYREVOKED: s = "Key has been revoked (EKEYREVOKED)"; break; + case EXFULL: s = "Exchange full (EXFULL)"; break; + case ELNRNG: s = "Link number out of range (ELNRNG)"; break; + case ENOTUNIQ: s = "Name not unique on network (ENOTUNIQ)"; break; + case ERESTART: s = "Interrupted system call should be restarted (ERESTART)"; break; + case EUSERS: s = "Too many users (EUSERS)"; break; + +#ifdef EIEIO + case EIEIO: s = "Computer bought the farm; OS internal error (EIEIO)"; break; +#endif + + default: + s = "Unknown error code (?)"; + } + return const_cast<char *>(s); +} +// strlen() is defined in options/internals. + +// POSIX extensions. + +int strerror_r(int e, char *buffer, size_t bufsz) { + auto s = strerror(e); + strncpy(buffer, s, bufsz); + // Note that strerror_r does not set errno on error! + if(strlen(s) >= bufsz) + return ERANGE; + return 0; +} + +void *mempcpy(void *dest, const void *src, size_t len) { + return (char *)memcpy(dest, src, len) + len; +} + +// GNU extensions. +// Taken from musl. +int strverscmp(const char *l0, const char *r0) { + const unsigned char *l = (const unsigned char *)l0; + const unsigned char *r = (const unsigned char *)r0; + size_t i, dp, j; + int z = 1; + + /* Find maximal matching prefix and track its maximal digit + * suffix and whether those digits are all zeros. */ + for(dp = i = 0; l[i] == r[i]; i++) { + int c = l[i]; + if(!c) + return 0; + if(!isdigit(c)) + dp = i + 1, z = 1; + else if(c != '0') + z = 0; + } + + if(l[dp] != '0' && r[dp] != '0') { + /* If we're not looking at a digit sequence that began + * with a zero, longest digit string is greater. */ + for(j = i; isdigit(l[j]); j++) { + if(!isdigit(r[j])) + return 1; + } + if(isdigit(r[j])) + return -1; + } else if(z && dp < i && (isdigit(l[i]) || isdigit(r[i]))) { + /* Otherwise, if common prefix of digit sequence is + * all zeros, digits order less than non-digits. */ + return (unsigned char)(l[i] - '0') - (unsigned char)(r[i] - '0'); + } + + return l[i] - r[i]; +} + +void *memmem(const void *hs, size_t haystackLen, const void *nd, size_t needleLen) { + const char *haystack = static_cast<const char *>(hs); + const char *needle = static_cast<const char *>(nd); + + for (size_t i = 0; i < haystackLen; i++) { + bool found = true; + + for (size_t j = 0; j < needleLen; j++) { + if (i + j >= haystackLen || haystack[i + j] != needle[j]) { + found = false; + break; + } + } + + if(found) + return const_cast<char *>(&haystack[i]); + } + + return nullptr; +} diff --git a/lib/mlibc/options/ansi/generic/threads.cpp b/lib/mlibc/options/ansi/generic/threads.cpp new file mode 100644 index 0000000..70fa055 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/threads.cpp @@ -0,0 +1,97 @@ +#include <abi-bits/errno.h> +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/thread.hpp> +#include <mlibc/threads.hpp> +#include <threads.h> + +int thrd_create(thrd_t *thr, thrd_start_t func, void *arg) { + int res = mlibc::thread_create(thr, 0, reinterpret_cast<void *>(func), arg, true); + + if(!res) { + return thrd_success; + } + + return (res == ENOMEM) ? thrd_nomem : thrd_error; +} + +int thrd_equal(thrd_t t1, thrd_t t2) { + if(t1 == t2) { + return 1; + } + return 0; +} + +thrd_t thrd_current(void) { + return reinterpret_cast<thrd_t>(mlibc::get_current_tcb()); +} + +int thrd_sleep(const struct timespec *, struct timespec *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void thrd_yield(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int thrd_detach(thrd_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int thrd_join(thrd_t thr, int *res) { + if(mlibc::thread_join(thr, res) != 0) { + return thrd_error; + } + + return thrd_success; +} + +__attribute__((__noreturn__)) void thrd_exit(int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int mtx_init(mtx_t *mtx, int type) { + struct __mlibc_mutexattr attr; + mlibc::thread_mutexattr_init(&attr); + + if(type & mtx_recursive) { + mlibc::thread_mutexattr_settype(&attr, __MLIBC_THREAD_MUTEX_RECURSIVE); + } + + int res = mlibc::thread_mutex_init(mtx, &attr) == 0 ? thrd_success : thrd_error; + mlibc::thread_mutexattr_destroy(&attr); + + return res; +} + +void mtx_destroy(mtx_t *mtx) { + mlibc::thread_mutex_destroy(mtx); +} + +int mtx_lock(mtx_t *mtx) { + return mlibc::thread_mutex_lock(mtx) == 0 ? thrd_success : thrd_error; +} + +int mtx_unlock(mtx_t *mtx) { + return mlibc::thread_mutex_unlock(mtx) == 0 ? thrd_success : thrd_error; +} + +int cnd_init(cnd_t *cond) { + return mlibc::thread_cond_init(cond, 0) == 0 ? thrd_success : thrd_error; +} + +void cnd_destroy(cnd_t *cond) { + mlibc::thread_cond_destroy(cond); +} + +int cnd_broadcast(cnd_t *cond) { + return mlibc::thread_cond_broadcast(cond) == 0 ? thrd_success : thrd_error; +} + +int cnd_wait(cnd_t *cond, mtx_t *mtx) { + return mlibc::thread_cond_timedwait(cond, mtx, nullptr) == 0 ? thrd_success : thrd_error; +} diff --git a/lib/mlibc/options/ansi/generic/time-stubs.cpp b/lib/mlibc/options/ansi/generic/time-stubs.cpp new file mode 100644 index 0000000..b8c7cf5 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/time-stubs.cpp @@ -0,0 +1,729 @@ + +#include <errno.h> +#include <stdio.h> +#include <string.h> +#include <time.h> +#include <limits.h> +#include <wchar.h> +#include <stdlib.h> +#include <ctype.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/file-window.hpp> +#include <mlibc/ansi-sysdeps.hpp> +#include <mlibc/allocator.hpp> +#include <mlibc/lock.hpp> +#include <mlibc/locale.hpp> +#include <mlibc/bitutil.hpp> +#include <mlibc/strings.hpp> + +#include <frg/mutex.hpp> + +const char __utc[] = "UTC"; + +// Variables defined by POSIX. +int daylight; +long timezone; +char *tzname[2]; + +static FutexLock __time_lock; +static file_window *get_localtime_window() { + static file_window window{"/etc/localtime"}; + return &window; +} + +// Function taken from musl +clock_t clock(void) { + struct timespec ts; + + if(clock_gettime(CLOCK_PROCESS_CPUTIME_ID, &ts)) + return -1; + + if(ts.tv_sec > LONG_MAX / 1000000 || ts.tv_nsec / 1000 > LONG_MAX - 1000000 * ts.tv_sec) + return -1; + + return ts.tv_sec * 1000000 + ts.tv_nsec / 1000; +} + +double difftime(time_t a, time_t b) { + return a - b; +} + +time_t mktime(struct tm *tm) { + return timegm(tm); +} + +/* There is no other implemented value than TIME_UTC; all other values + * are considered erroneous. */ +// Function taken from musl +int timespec_get(struct timespec *ts, int base) { + if(base != TIME_UTC) + return 0; + int ret = clock_gettime(CLOCK_REALTIME, ts); + return ret < 0 ? 0 : base; +} + +char *asctime(const struct tm *ptr) { + static char buf[26]; + return asctime_r(ptr, buf); +} + +char *ctime(const time_t *timer) { + struct tm *tm = localtime(timer); + if(!tm) { + return 0; + } + return asctime(tm); +} + +struct tm *gmtime(const time_t *unix_gmt) { + static thread_local struct tm per_thread_tm; + return gmtime_r(unix_gmt, &per_thread_tm); +} + +struct tm *localtime(const time_t *unix_gmt) { + tzset(); + static thread_local struct tm per_thread_tm; + return localtime_r(unix_gmt, &per_thread_tm); +} + +size_t strftime(char *__restrict dest, size_t max_size, + const char *__restrict format, const struct tm *__restrict tm) { + auto c = format; + auto p = dest; + + while(*c) { + int chunk; + auto space = (dest + max_size) - p; + __ensure(space >= 0); + + if(*c != '%') { + if(!space) + return 0; + *p = *c; + c++; + p++; + continue; + } + + switch(*++c) { + case 'Y': { + chunk = snprintf(p, space, "%d", 1900 + tm->tm_year); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'm': { + chunk = snprintf(p, space, "%.2d", tm->tm_mon + 1); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'd': { + chunk = snprintf(p, space, "%.2d", tm->tm_mday); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'Z': { + chunk = snprintf(p, space, "%s", "GMT"); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'H': { + chunk = snprintf(p, space, "%.2i", tm->tm_hour); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'M': { + chunk = snprintf(p, space, "%.2i", tm->tm_min); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'S': { + chunk = snprintf(p, space, "%.2d", tm->tm_sec); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'R': { + chunk = snprintf(p, space, "%.2i:%.2i", tm->tm_hour, tm->tm_min); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'T': { + chunk = snprintf(p, space, "%.2i:%.2i:%.2i", tm->tm_hour, tm->tm_min, tm->tm_sec); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'F': { + chunk = snprintf(p, space, "%d-%.2d-%.2d", 1900 + tm->tm_year, tm->tm_mon + 1, + tm->tm_mday); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'D': { + chunk = snprintf(p, space, "%.2d/%.2d/%.2d", tm->tm_mon + 1, tm->tm_mday, tm->tm_year % 100); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'a': { + int day = tm->tm_wday; + if(day < 0 || day > 6) + __ensure(!"Day not in bounds."); + + chunk = snprintf(p, space, "%s", mlibc::nl_langinfo(ABDAY_1 + day)); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'b': + case 'B': + case 'h': { + int mon = tm->tm_mon; + if(mon < 0 || mon > 11) + __ensure(!"Month not in bounds."); + + nl_item item = (*c == 'B') ? MON_1 : ABMON_1; + + chunk = snprintf(p, space, "%s", mlibc::nl_langinfo(item + mon)); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'c': { + chunk = snprintf(p, space, "%d/%.2d/%.2d %.2d:%.2d:%.2d", 1900 + tm->tm_year, + tm->tm_mon + 1, tm->tm_mday, tm->tm_hour, tm->tm_min, tm->tm_sec); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'e': { + chunk = snprintf(p, space, "%2d", tm->tm_mday); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'l': { + int hour = tm->tm_hour; + if(!hour) + hour = 12; + if(hour > 12) + hour -= 12; + chunk = snprintf(p, space, "%2d", hour); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'I': { + int hour = tm->tm_hour; + if(!hour) + hour = 12; + if(hour > 12) + hour -= 12; + chunk = snprintf(p, space, "%.2d", hour); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'p': { + chunk = snprintf(p, space, "%s", mlibc::nl_langinfo((tm->tm_hour < 12) ? AM_STR : PM_STR)); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'C': { + chunk = snprintf(p, space, "%.2d", (1900 + tm->tm_year) / 100); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'y': { + chunk = snprintf(p, space, "%.2d", (1900 + tm->tm_year) % 100); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'j': { + chunk = snprintf(p, space, "%.3d", tm->tm_yday + 1); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'A': { + chunk = snprintf(p, space, "%s", mlibc::nl_langinfo(DAY_1 + tm->tm_wday)); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'r': { + int hour = tm->tm_hour; + if(!hour) + hour = 12; + if(hour > 12) + hour -= 12; + chunk = snprintf(p, space, "%.2i:%.2i:%.2i %s", hour, tm->tm_min, tm->tm_sec, + mlibc::nl_langinfo((tm->tm_hour < 12) ? AM_STR : PM_STR)); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case '%': { + chunk = snprintf(p, space, "%%"); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 't': { + chunk = snprintf(p, space, "\t"); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'x': { + return strftime(dest, max_size, mlibc::nl_langinfo(D_FMT), tm); + } + case 'X': { + return strftime(dest, max_size, mlibc::nl_langinfo(T_FMT), tm); + } + case '\0': { + chunk = snprintf(p, space, "%%"); + if(chunk >= space) + return 0; + p += chunk; + break; + } + default: + mlibc::panicLogger() << "mlibc: strftime unknown format type: " << c << frg::endlog; + } + } + + auto space = (dest + max_size) - p; + if(!space) + return 0; + + *p = '\0'; + return (p - dest); +} + +size_t wcsftime(wchar_t *__restrict, size_t, const wchar_t *__restrict, + const struct tm *__restrict) { + mlibc::infoLogger() << "mlibc: wcsftime is a stub" << frg::endlog; + return 0; +} + +namespace { + +struct tzfile { + uint8_t magic[4]; + uint8_t version; + uint8_t reserved[15]; + uint32_t tzh_ttisgmtcnt; + uint32_t tzh_ttisstdcnt; + uint32_t tzh_leapcnt; + uint32_t tzh_timecnt; + uint32_t tzh_typecnt; + uint32_t tzh_charcnt; +}; + +struct[[gnu::packed]] ttinfo { + int32_t tt_gmtoff; + unsigned char tt_isdst; + unsigned char tt_abbrind; +}; + +} + +// TODO(geert): this function doesn't parse the TZ environment variable +// or properly handle the case where information might be missing from /etc/localtime +// also we should probably unify the code for this and unix_local_from_gmt() +void tzset(void) { + frg::unique_lock<FutexLock> lock(__time_lock); + // TODO(geert): we can probably cache this somehow + tzfile tzfile_time; + memcpy(&tzfile_time, reinterpret_cast<char *>(get_localtime_window()->get()), sizeof(tzfile)); + tzfile_time.tzh_ttisgmtcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_ttisgmtcnt); + tzfile_time.tzh_ttisstdcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_ttisstdcnt); + tzfile_time.tzh_leapcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_leapcnt); + tzfile_time.tzh_timecnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_timecnt); + tzfile_time.tzh_typecnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_typecnt); + tzfile_time.tzh_charcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_charcnt); + + if(tzfile_time.magic[0] != 'T' || tzfile_time.magic[1] != 'Z' || tzfile_time.magic[2] != 'i' + || tzfile_time.magic[3] != 'f') { + mlibc::infoLogger() << "mlibc: /etc/localtime is not a valid TZinfo file" << frg::endlog; + return; + } + + if(tzfile_time.version != '\0' && tzfile_time.version != '2' && tzfile_time.version != '3') { + mlibc::infoLogger() << "mlibc: /etc/localtime has an invalid TZinfo version" + << frg::endlog; + return; + } + + // There should be at least one entry in the ttinfo table. + // TODO: If there is not, we might want to fall back to UTC, no DST (?). + __ensure(tzfile_time.tzh_typecnt); + + char *abbrevs = reinterpret_cast<char *>(get_localtime_window()->get()) + sizeof(tzfile) + + tzfile_time.tzh_timecnt * sizeof(int32_t) + + tzfile_time.tzh_timecnt * sizeof(uint8_t) + + tzfile_time.tzh_typecnt * sizeof(struct ttinfo); + // start from the last ttinfo entry, this matches the behaviour of glibc and musl + for (int i = tzfile_time.tzh_typecnt; i > 0; i--) { + ttinfo time_info; + memcpy(&time_info, reinterpret_cast<char *>(get_localtime_window()->get()) + sizeof(tzfile) + + tzfile_time.tzh_timecnt * sizeof(int32_t) + + tzfile_time.tzh_timecnt * sizeof(uint8_t) + + i * sizeof(ttinfo), sizeof(ttinfo)); + time_info.tt_gmtoff = mlibc::bit_util<uint32_t>::byteswap(time_info.tt_gmtoff); + if (!time_info.tt_isdst && !tzname[0]) { + tzname[0] = abbrevs + time_info.tt_abbrind; + timezone = -time_info.tt_gmtoff; + } + if (time_info.tt_isdst && !tzname[1]) { + tzname[1] = abbrevs + time_info.tt_abbrind; + timezone = -time_info.tt_gmtoff; + daylight = 1; + } + } +} + +// POSIX extensions. + +int nanosleep(const struct timespec *req, struct timespec *) { + if (req->tv_sec < 0 || req->tv_nsec > 999999999 || req->tv_nsec < 0) { + errno = EINVAL; + return -1; + } + + if(!mlibc::sys_sleep) { + MLIBC_MISSING_SYSDEP(); + __ensure(!"Cannot continue without sys_sleep()"); + } + + struct timespec tmp = *req; + + int e = mlibc::sys_sleep(&tmp.tv_sec, &tmp.tv_nsec); + if (!e) { + return 0; + } else { + errno = e; + return -1; + } +} + +int clock_getres(clockid_t clockid, struct timespec *res) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_clock_getres, -1); + if(int e = mlibc::sys_clock_getres(clockid, &res->tv_sec, &res->tv_nsec); e) { + errno = e; + return -1; + } + return 0; +} + +int clock_gettime(clockid_t clock, struct timespec *time) { + if(int e = mlibc::sys_clock_get(clock, &time->tv_sec, &time->tv_nsec); e) { + errno = e; + return -1; + } + return 0; +} + +int clock_nanosleep(clockid_t clockid, int, const struct timespec *req, struct timespec *) { + mlibc::infoLogger() << "clock_nanosleep is implemented as nanosleep!" << frg::endlog; + __ensure(clockid == CLOCK_REALTIME || clockid == CLOCK_MONOTONIC); + return nanosleep(req, nullptr); +} + +int clock_settime(clockid_t, const struct timespec *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +time_t time(time_t *out) { + time_t secs; + long nanos; + if(int e = mlibc::sys_clock_get(CLOCK_REALTIME, &secs, &nanos); e) { + errno = e; + return (time_t)-1; + } + if(out) + *out = secs; + return secs; +} + +namespace { + +void civil_from_days(time_t days_since_epoch, int *year, unsigned int *month, unsigned int *day) { + time_t time = days_since_epoch + 719468; + int era = (time >= 0 ? time : time - 146096) / 146097; + unsigned int doe = static_cast<unsigned int>(time - era * 146097); + unsigned int yoe = (doe - doe/1460 + doe/36524 - doe/146096) / 365; + int y = static_cast<int>(yoe) + era * 400; + unsigned int doy = doe - (365*yoe + yoe/4 - yoe/100); + unsigned int mp = (5*doy + 2)/153; + unsigned int d = doy - (153*mp+2)/5 + 1; + unsigned int m = mp + (mp < 10 ? 3 : -9); + + *year = y + (m <= 2); + *month = m; + *day = d; +} + +void weekday_from_days(time_t days_since_epoch, unsigned int *weekday) { + *weekday = static_cast<unsigned int>(days_since_epoch >= -4 ? + (days_since_epoch+4) % 7 : (days_since_epoch+5) % 7 + 6); +} + +void yearday_from_date(unsigned int year, unsigned int month, unsigned int day, unsigned int *yday) { + unsigned int n1 = 275 * month / 9; + unsigned int n2 = (month + 9) / 12; + unsigned int n3 = (1 + (year - 4 * year / 4 + 2) / 3); + *yday = n1 - (n2 * n3) + day - 30; +} + +// Looks up the local time rules for a given +// UNIX GMT timestamp (seconds since 1970 GMT, ignoring leap seconds). +// This function assumes the __time_lock has been taken +// TODO(geert): if /etc/localtime isn't available this will fail... In that case +// we should call tzset() and use the variables to compute the variables from +// the tzset() global variables. Look at the musl code for how to do that +int unix_local_from_gmt(time_t unix_gmt, time_t *offset, bool *dst, char **tm_zone) { + tzfile tzfile_time; + memcpy(&tzfile_time, reinterpret_cast<char *>(get_localtime_window()->get()), sizeof(tzfile)); + tzfile_time.tzh_ttisgmtcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_ttisgmtcnt); + tzfile_time.tzh_ttisstdcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_ttisstdcnt); + tzfile_time.tzh_leapcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_leapcnt); + tzfile_time.tzh_timecnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_timecnt); + tzfile_time.tzh_typecnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_typecnt); + tzfile_time.tzh_charcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_charcnt); + + if(tzfile_time.magic[0] != 'T' || tzfile_time.magic[1] != 'Z' || tzfile_time.magic[2] != 'i' + || tzfile_time.magic[3] != 'f') { + mlibc::infoLogger() << "mlibc: /etc/localtime is not a valid TZinfo file" << frg::endlog; + return -1; + } + + if(tzfile_time.version != '\0' && tzfile_time.version != '2' && tzfile_time.version != '3') { + mlibc::infoLogger() << "mlibc: /etc/localtime has an invalid TZinfo version" + << frg::endlog; + return -1; + } + + int index = -1; + for(size_t i = 0; i < tzfile_time.tzh_timecnt; i++) { + int32_t ttime; + memcpy(&ttime, reinterpret_cast<char *>(get_localtime_window()->get()) + sizeof(tzfile) + + i * sizeof(int32_t), sizeof(int32_t)); + ttime = mlibc::bit_util<uint32_t>::byteswap(ttime); + // If we are before the first transition, the format dicates that + // the first ttinfo entry should be used (and not the ttinfo entry pointed + // to by the first transition time). + if(i && ttime > unix_gmt) { + index = i - 1; + break; + } + } + + // The format dictates that if no transition is applicable, + // the first entry in the file is chosen. + uint8_t ttinfo_index = 0; + if(index >= 0) { + memcpy(&ttinfo_index, reinterpret_cast<char *>(get_localtime_window()->get()) + sizeof(tzfile) + + tzfile_time.tzh_timecnt * sizeof(int32_t) + + index * sizeof(uint8_t), sizeof(uint8_t)); + } + + // There should be at least one entry in the ttinfo table. + // TODO: If there is not, we might want to fall back to UTC, no DST (?). + __ensure(tzfile_time.tzh_typecnt); + + ttinfo time_info; + memcpy(&time_info, reinterpret_cast<char *>(get_localtime_window()->get()) + sizeof(tzfile) + + tzfile_time.tzh_timecnt * sizeof(int32_t) + + tzfile_time.tzh_timecnt * sizeof(uint8_t) + + ttinfo_index * sizeof(ttinfo), sizeof(ttinfo)); + time_info.tt_gmtoff = mlibc::bit_util<uint32_t>::byteswap(time_info.tt_gmtoff); + + char *abbrevs = reinterpret_cast<char *>(get_localtime_window()->get()) + sizeof(tzfile) + + tzfile_time.tzh_timecnt * sizeof(int32_t) + + tzfile_time.tzh_timecnt * sizeof(uint8_t) + + tzfile_time.tzh_typecnt * sizeof(struct ttinfo); + + *offset = time_info.tt_gmtoff; + *dst = time_info.tt_isdst; + *tm_zone = abbrevs + time_info.tt_abbrind; + return 0; +} + +} //anonymous namespace + +struct tm *gmtime_r(const time_t *unix_gmt, struct tm *res) { + int year; + unsigned int month; + unsigned int day; + unsigned int weekday; + unsigned int yday; + + time_t unix_local = *unix_gmt; + + int days_since_epoch = unix_local / (60*60*24); + civil_from_days(days_since_epoch, &year, &month, &day); + weekday_from_days(days_since_epoch, &weekday); + yearday_from_date(year, month, day, &yday); + + res->tm_sec = unix_local % 60; + res->tm_min = (unix_local / 60) % 60; + res->tm_hour = (unix_local / (60*60)) % 24; + res->tm_mday = day; + res->tm_mon = month - 1; + res->tm_year = year - 1900; + res->tm_wday = weekday; + res->tm_yday = yday - 1; + res->tm_isdst = -1; + res->tm_zone = __utc; + res->tm_gmtoff = 0; + + return res; +} + +struct tm *localtime_r(const time_t *unix_gmt, struct tm *res) { + int year; + unsigned int month; + unsigned int day; + unsigned int weekday; + unsigned int yday; + + time_t offset = 0; + bool dst; + char *tm_zone; + frg::unique_lock<FutexLock> lock(__time_lock); + // TODO: Set errno if the conversion fails. + if(unix_local_from_gmt(*unix_gmt, &offset, &dst, &tm_zone)) { + __ensure(!"Error parsing /etc/localtime"); + __builtin_unreachable(); + } + time_t unix_local = *unix_gmt + offset; + + int days_since_epoch = unix_local / (60*60*24); + civil_from_days(days_since_epoch, &year, &month, &day); + weekday_from_days(days_since_epoch, &weekday); + yearday_from_date(year, month, day, &yday); + + res->tm_sec = unix_local % 60; + res->tm_min = (unix_local / 60) % 60; + res->tm_hour = (unix_local / (60*60)) % 24; + res->tm_mday = day; + res->tm_mon = month - 1; + res->tm_year = year - 1900; + res->tm_wday = weekday; + res->tm_yday = yday - 1; + res->tm_isdst = dst; + res->tm_zone = tm_zone; + res->tm_gmtoff = offset; + + return res; +} + +// This implementation of asctime_r is taken from sortix +char *asctime_r(const struct tm *tm, char *buf) { + static char weekday_names[7][4] = + { "Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat" }; + static char month_names[12][4] = + { "Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", + "Nov", "Dec" }; + sprintf(buf, "%.3s %.3s%3d %.2d:%.2d%.2d %d\n", + weekday_names[tm->tm_wday], + month_names[tm->tm_mon], + tm->tm_mday, + tm->tm_hour, + tm->tm_min, + tm->tm_sec, + tm->tm_year + 1900); + return buf; +} + +char *ctime_r(const time_t *clock, char *buf) { + return asctime_r(localtime(clock), buf); +} + +time_t timelocal(struct tm *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +constexpr static int days_from_civil(int y, unsigned m, unsigned d) noexcept { + y -= m <= 2; + const int era = (y >= 0 ? y : y - 399) / 400; + const unsigned yoe = static_cast<unsigned>(y - era * 400); // [0, 399] + const unsigned doy = (153 * (m > 2 ? m - 3 : m + 9) + 2) / 5 + d - 1; // [0, 365] + const unsigned doe = yoe * 365 + yoe / 4 - yoe / 100 + doy; // [0, 146096] + return era * 146097 + static_cast<int>(doe) - 719468; +} + +time_t timegm(struct tm *tm) { + time_t year = tm->tm_year + 1900; + time_t month = tm->tm_mon + 1; + time_t days = days_from_civil(year, month, tm->tm_mday); + time_t secs = (days * 86400) + (tm->tm_hour * 60 * 60) + (tm->tm_min * 60) + tm->tm_sec; + return secs; +} diff --git a/lib/mlibc/options/ansi/generic/uchar.cpp b/lib/mlibc/options/ansi/generic/uchar.cpp new file mode 100644 index 0000000..cb13c12 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/uchar.cpp @@ -0,0 +1,23 @@ +#include <bits/ensure.h> +#include <uchar.h> +#include <wchar.h> + +size_t c32rtomb(char *, char32_t, mbstate_t *) MLIBC_STUB_BODY + +size_t mbrtoc32(char32_t *__restrict pc32, const char *__restrict pmb, size_t max, mbstate_t *__restrict ps) { + static mbstate_t internal_state; + + if(!ps) + ps = &internal_state; + + if(!pmb) + return mbrtoc32(0, "", 1, ps); + + wchar_t wc; + size_t ret = mbrtowc(&wc, pmb, max, ps); + + if (ret <= 4 && pc32) + *pc32 = wc; + + return ret; +} diff --git a/lib/mlibc/options/ansi/generic/wchar-stubs.cpp b/lib/mlibc/options/ansi/generic/wchar-stubs.cpp new file mode 100644 index 0000000..d9f6598 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/wchar-stubs.cpp @@ -0,0 +1,783 @@ + +#include <errno.h> +#include <stdlib.h> +#include <stdio.h> +#include <wchar.h> +#include <wctype.h> +#include <bits/ensure.h> + +#include <mlibc/charcode.hpp> +#include <mlibc/debug.hpp> + +namespace { + // All conversion functions mbrlen(), mbrtowc(), wcrtomb(), + // mbsrtowcs() and wcsrtombs() have an internal state. + __mlibc_mbstate mbrlen_state = __MLIBC_MBSTATE_INITIALIZER; + __mlibc_mbstate mbrtowc_state = __MLIBC_MBSTATE_INITIALIZER; + __mlibc_mbstate mbsrtowcs_state = __MLIBC_MBSTATE_INITIALIZER; + __mlibc_mbstate wcsrtombs_state = __MLIBC_MBSTATE_INITIALIZER; +} + +wint_t btowc(int c) { + if(c == EOF) + return WEOF; + + char nc = c; + auto cc = mlibc::current_charcode(); + wchar_t wc; + if(auto e = cc->promote_wtranscode(nc, wc); e != mlibc::charcode_error::null) + return WEOF; + return wc; +} + +int wctob(wint_t wc) { + // TODO: Revisit this once we have character encoding functions. + return wc; +} + +int mbsinit(const mbstate_t *stp) { + if(!stp) + return -1; + return !stp->__progress && !stp->__shift; +} + +size_t mbrlen(const char *mbs, size_t mb_limit, mbstate_t *stp) { + auto cc = mlibc::current_charcode(); + wchar_t wc; + + if(!stp) + stp = &mbrlen_state; + if(!mbs) { + *stp = __MLIBC_MBSTATE_INITIALIZER; + return 0; + } + + mlibc::code_seq<const char> nseq{mbs, mbs + mb_limit}; + mlibc::code_seq<wchar_t> wseq{&wc, &wc + 1}; + if(auto e = cc->decode_wtranscode(nseq, wseq, *stp); e != mlibc::charcode_error::null) + __ensure(!"decode_wtranscode() errors are not handled"); + return nseq.it - mbs; +} + +size_t mbrtowc(wchar_t *wcp, const char *mbs, size_t mb_limit, mbstate_t *stp) { + auto cc = mlibc::current_charcode(); + + if(!stp) + stp = &mbrtowc_state; + if(!mbs) { + *stp = __MLIBC_MBSTATE_INITIALIZER; + return 0; + } + + wchar_t temp = 0; + if(!wcp) + wcp = &temp; + + mlibc::code_seq<const char> nseq{mbs, mbs + mb_limit}; + mlibc::code_seq<wchar_t> wseq{wcp, wcp + 1}; + if(auto e = cc->decode_wtranscode(nseq, wseq, *stp); e != mlibc::charcode_error::null) { + if(e == mlibc::charcode_error::input_underflow) + return static_cast<size_t>(-2); + __ensure(e == mlibc::charcode_error::illegal_input); + errno = EILSEQ; + return static_cast<size_t>(-1); + }else{ + if (*mbs) { + return nseq.it - mbs; + } else { + *stp = __MLIBC_MBSTATE_INITIALIZER; + *wcp = 0; + return 0; + } + } +} + +size_t wcrtomb(char *mbs, wchar_t wc, mbstate_t *stp) { + auto cc = mlibc::current_charcode(); + + // wcrtomb() always takes a mbstate_t. + __ensure(stp); + + // TODO: Implement the following case: + __ensure(mbs); + + mlibc::code_seq<const wchar_t> wseq{&wc, &wc + 1}; + mlibc::code_seq<char> nseq{mbs, mbs + 4}; // TODO: Replace 4 by some named constant. + if(auto e = cc->encode_wtranscode(nseq, wseq, *stp); e != mlibc::charcode_error::null) { + __ensure(!"encode_wtranscode() errors are not handled"); + __builtin_unreachable(); + }else{ + size_t n = nseq.it - mbs; + if(!n) // Null-terminate resulting wide string. + *mbs = 0; + return n; + } +} + +size_t mbsrtowcs(wchar_t *wcs, const char **mbsp, size_t wc_limit, mbstate_t *stp) { + __ensure(mbsp); + + auto cc = mlibc::current_charcode(); + __mlibc_mbstate st = __MLIBC_MBSTATE_INITIALIZER; + mlibc::code_seq<const char> nseq{*mbsp, nullptr}; + mlibc::code_seq<wchar_t> wseq{wcs, wcs + wc_limit}; + + if(!stp) + stp = &mbsrtowcs_state; + + if(!wcs) { + size_t size; + if(auto e = cc->decode_wtranscode_length(nseq, &size, st); e != mlibc::charcode_error::null) + __ensure(!"decode_wtranscode() errors are not handled"); + return size; + } + + if(auto e = cc->decode_wtranscode(nseq, wseq, st); e != mlibc::charcode_error::null) { + __ensure(!"decode_wtranscode() errors are not handled"); + __builtin_unreachable(); + }else{ + size_t n = wseq.it - wcs; + if(n < wc_limit) // Null-terminate resulting wide string. + wcs[n] = 0; + *mbsp = nullptr; + return n; + } +} + +size_t mbsnrtowcs(wchar_t *wcs, const char **mbsp, size_t mb_limit, size_t wc_limit, mbstate_t *stp) { + __ensure(mbsp); + + auto cc = mlibc::current_charcode(); + __mlibc_mbstate st = __MLIBC_MBSTATE_INITIALIZER; + mlibc::code_seq<const char> nseq{*mbsp, (*mbsp) + mb_limit}; + mlibc::code_seq<wchar_t> wseq{wcs, wcs + wc_limit}; + + if(!stp) + stp = &mbsrtowcs_state; + + if(!wcs) { + size_t size; + if(auto e = cc->decode_wtranscode_length(nseq, &size, st); e != mlibc::charcode_error::null) + __ensure(!"decode_wtranscode() errors are not handled"); + return size; + } + + if(auto e = cc->decode_wtranscode(nseq, wseq, st); e != mlibc::charcode_error::null) { + __ensure(!"decode_wtranscode() errors are not handled"); + __builtin_unreachable(); + }else{ + size_t n = wseq.it - wcs; + if(n < wc_limit) // Null-terminate resulting wide string. + wcs[n] = 0; + *mbsp = nullptr; + return n; + } +} + +size_t wcsrtombs(char *mbs, const wchar_t **wcsp, size_t mb_limit, mbstate_t *stp) { + __ensure(wcsp && "wcsrtombs() with null input"); + auto cc = mlibc::current_charcode(); + mlibc::code_seq<char> nseq{mbs, mbs + mb_limit}; + mlibc::code_seq<const wchar_t> wseq{*wcsp, nullptr}; + + if(!stp) + stp = &wcsrtombs_state; + + if(!mbs) { + size_t size; + if(auto e = cc->encode_wtranscode_length(wseq, &size, *stp); e != mlibc::charcode_error::null) + __ensure(!"decode_wtranscode() errors are not handled"); + return size; + } + + if(auto e = cc->encode_wtranscode(nseq, wseq, *stp); e != mlibc::charcode_error::null) { + __ensure(!"encode_wtranscode() errors are not handled"); + __builtin_unreachable(); + }else{ + *wcsp = wseq.it; + size_t n = nseq.it - mbs; + if(n < mb_limit) // Null-terminate resulting narrow string. + mbs[n] = 0; + return n; + } +} + +size_t wcsnrtombs(char *mbs, const wchar_t **wcsp, size_t wc_limit, size_t mb_limit, mbstate_t *stp) { + __ensure(wcsp && "wcsrtombs() with null input"); + auto cc = mlibc::current_charcode(); + mlibc::code_seq<char> nseq{mbs, mbs + mb_limit}; + mlibc::code_seq<const wchar_t> wseq{*wcsp, (*wcsp) + wc_limit}; + + if(!stp) + stp = &wcsrtombs_state; + + if(!mbs) { + size_t size; + if(auto e = cc->encode_wtranscode_length(wseq, &size, *stp); e != mlibc::charcode_error::null) + __ensure(!"decode_wtranscode() errors are not handled"); + return size; + } + + if(auto e = cc->encode_wtranscode(nseq, wseq, *stp); e != mlibc::charcode_error::null) { + __ensure(!"encode_wtranscode() errors are not handled"); + __builtin_unreachable(); + }else{ + *wcsp = wseq.it; + size_t n = nseq.it - mbs; + if(n < mb_limit) // Null-terminate resulting narrow string. + mbs[n] = 0; + return n; + } +} + +/* + * The code in this anonymous namespace and the wcwidth function below + * are taken from https://github.com/termux/wcwidth/, under the following license: + * + * Copyright (C) Fredrik Fornwall 2016. + * Distributed under the MIT License. + * + * Implementation of wcwidth(3) as a C port of: + * https://github.com/jquast/wcwidth + * + * Report issues at: + * https://github.com/termux/wcwidth + */ + +namespace { + +struct width_interval { + int start; + int end; +}; + +// From https://github.com/jquast/wcwidth/blob/master/wcwidth/table_zero.py +// at commit b29897e5a1b403a0e36f7fc991614981cbc42475 (2020-07-14): +struct width_interval ZERO_WIDTH[] = { + {0x00300, 0x0036f}, // Combining Grave Accent ..Combining Latin Small Le + {0x00483, 0x00489}, // Combining Cyrillic Titlo..Combining Cyrillic Milli + {0x00591, 0x005bd}, // Hebrew Accent Etnahta ..Hebrew Point Meteg + {0x005bf, 0x005bf}, // Hebrew Point Rafe ..Hebrew Point Rafe + {0x005c1, 0x005c2}, // Hebrew Point Shin Dot ..Hebrew Point Sin Dot + {0x005c4, 0x005c5}, // Hebrew Mark Upper Dot ..Hebrew Mark Lower Dot + {0x005c7, 0x005c7}, // Hebrew Point Qamats Qata..Hebrew Point Qamats Qata + {0x00610, 0x0061a}, // Arabic Sign Sallallahou ..Arabic Small Kasra + {0x0064b, 0x0065f}, // Arabic Fathatan ..Arabic Wavy Hamza Below + {0x00670, 0x00670}, // Arabic Letter Superscrip..Arabic Letter Superscrip + {0x006d6, 0x006dc}, // Arabic Small High Ligatu..Arabic Small High Seen + {0x006df, 0x006e4}, // Arabic Small High Rounde..Arabic Small High Madda + {0x006e7, 0x006e8}, // Arabic Small High Yeh ..Arabic Small High Noon + {0x006ea, 0x006ed}, // Arabic Empty Centre Low ..Arabic Small Low Meem + {0x00711, 0x00711}, // Syriac Letter Superscrip..Syriac Letter Superscrip + {0x00730, 0x0074a}, // Syriac Pthaha Above ..Syriac Barrekh + {0x007a6, 0x007b0}, // Thaana Abafili ..Thaana Sukun + {0x007eb, 0x007f3}, // Nko Combining Short High..Nko Combining Double Dot + {0x007fd, 0x007fd}, // Nko Dantayalan ..Nko Dantayalan + {0x00816, 0x00819}, // Samaritan Mark In ..Samaritan Mark Dagesh + {0x0081b, 0x00823}, // Samaritan Mark Epentheti..Samaritan Vowel Sign A + {0x00825, 0x00827}, // Samaritan Vowel Sign Sho..Samaritan Vowel Sign U + {0x00829, 0x0082d}, // Samaritan Vowel Sign Lon..Samaritan Mark Nequdaa + {0x00859, 0x0085b}, // Mandaic Affrication Mark..Mandaic Gemination Mark + {0x008d3, 0x008e1}, // Arabic Small Low Waw ..Arabic Small High Sign S + {0x008e3, 0x00902}, // Arabic Turned Damma Belo..Devanagari Sign Anusvara + {0x0093a, 0x0093a}, // Devanagari Vowel Sign Oe..Devanagari Vowel Sign Oe + {0x0093c, 0x0093c}, // Devanagari Sign Nukta ..Devanagari Sign Nukta + {0x00941, 0x00948}, // Devanagari Vowel Sign U ..Devanagari Vowel Sign Ai + {0x0094d, 0x0094d}, // Devanagari Sign Virama ..Devanagari Sign Virama + {0x00951, 0x00957}, // Devanagari Stress Sign U..Devanagari Vowel Sign Uu + {0x00962, 0x00963}, // Devanagari Vowel Sign Vo..Devanagari Vowel Sign Vo + {0x00981, 0x00981}, // Bengali Sign Candrabindu..Bengali Sign Candrabindu + {0x009bc, 0x009bc}, // Bengali Sign Nukta ..Bengali Sign Nukta + {0x009c1, 0x009c4}, // Bengali Vowel Sign U ..Bengali Vowel Sign Vocal + {0x009cd, 0x009cd}, // Bengali Sign Virama ..Bengali Sign Virama + {0x009e2, 0x009e3}, // Bengali Vowel Sign Vocal..Bengali Vowel Sign Vocal + {0x009fe, 0x009fe}, // Bengali Sandhi Mark ..Bengali Sandhi Mark + {0x00a01, 0x00a02}, // Gurmukhi Sign Adak Bindi..Gurmukhi Sign Bindi + {0x00a3c, 0x00a3c}, // Gurmukhi Sign Nukta ..Gurmukhi Sign Nukta + {0x00a41, 0x00a42}, // Gurmukhi Vowel Sign U ..Gurmukhi Vowel Sign Uu + {0x00a47, 0x00a48}, // Gurmukhi Vowel Sign Ee ..Gurmukhi Vowel Sign Ai + {0x00a4b, 0x00a4d}, // Gurmukhi Vowel Sign Oo ..Gurmukhi Sign Virama + {0x00a51, 0x00a51}, // Gurmukhi Sign Udaat ..Gurmukhi Sign Udaat + {0x00a70, 0x00a71}, // Gurmukhi Tippi ..Gurmukhi Addak + {0x00a75, 0x00a75}, // Gurmukhi Sign Yakash ..Gurmukhi Sign Yakash + {0x00a81, 0x00a82}, // Gujarati Sign Candrabind..Gujarati Sign Anusvara + {0x00abc, 0x00abc}, // Gujarati Sign Nukta ..Gujarati Sign Nukta + {0x00ac1, 0x00ac5}, // Gujarati Vowel Sign U ..Gujarati Vowel Sign Cand + {0x00ac7, 0x00ac8}, // Gujarati Vowel Sign E ..Gujarati Vowel Sign Ai + {0x00acd, 0x00acd}, // Gujarati Sign Virama ..Gujarati Sign Virama + {0x00ae2, 0x00ae3}, // Gujarati Vowel Sign Voca..Gujarati Vowel Sign Voca + {0x00afa, 0x00aff}, // Gujarati Sign Sukun ..Gujarati Sign Two-circle + {0x00b01, 0x00b01}, // Oriya Sign Candrabindu ..Oriya Sign Candrabindu + {0x00b3c, 0x00b3c}, // Oriya Sign Nukta ..Oriya Sign Nukta + {0x00b3f, 0x00b3f}, // Oriya Vowel Sign I ..Oriya Vowel Sign I + {0x00b41, 0x00b44}, // Oriya Vowel Sign U ..Oriya Vowel Sign Vocalic + {0x00b4d, 0x00b4d}, // Oriya Sign Virama ..Oriya Sign Virama + {0x00b55, 0x00b56}, // (nil) ..Oriya Ai Length Mark + {0x00b62, 0x00b63}, // Oriya Vowel Sign Vocalic..Oriya Vowel Sign Vocalic + {0x00b82, 0x00b82}, // Tamil Sign Anusvara ..Tamil Sign Anusvara + {0x00bc0, 0x00bc0}, // Tamil Vowel Sign Ii ..Tamil Vowel Sign Ii + {0x00bcd, 0x00bcd}, // Tamil Sign Virama ..Tamil Sign Virama + {0x00c00, 0x00c00}, // Telugu Sign Combining Ca..Telugu Sign Combining Ca + {0x00c04, 0x00c04}, // Telugu Sign Combining An..Telugu Sign Combining An + {0x00c3e, 0x00c40}, // Telugu Vowel Sign Aa ..Telugu Vowel Sign Ii + {0x00c46, 0x00c48}, // Telugu Vowel Sign E ..Telugu Vowel Sign Ai + {0x00c4a, 0x00c4d}, // Telugu Vowel Sign O ..Telugu Sign Virama + {0x00c55, 0x00c56}, // Telugu Length Mark ..Telugu Ai Length Mark + {0x00c62, 0x00c63}, // Telugu Vowel Sign Vocali..Telugu Vowel Sign Vocali + {0x00c81, 0x00c81}, // Kannada Sign Candrabindu..Kannada Sign Candrabindu + {0x00cbc, 0x00cbc}, // Kannada Sign Nukta ..Kannada Sign Nukta + {0x00cbf, 0x00cbf}, // Kannada Vowel Sign I ..Kannada Vowel Sign I + {0x00cc6, 0x00cc6}, // Kannada Vowel Sign E ..Kannada Vowel Sign E + {0x00ccc, 0x00ccd}, // Kannada Vowel Sign Au ..Kannada Sign Virama + {0x00ce2, 0x00ce3}, // Kannada Vowel Sign Vocal..Kannada Vowel Sign Vocal + {0x00d00, 0x00d01}, // Malayalam Sign Combining..Malayalam Sign Candrabin + {0x00d3b, 0x00d3c}, // Malayalam Sign Vertical ..Malayalam Sign Circular + {0x00d41, 0x00d44}, // Malayalam Vowel Sign U ..Malayalam Vowel Sign Voc + {0x00d4d, 0x00d4d}, // Malayalam Sign Virama ..Malayalam Sign Virama + {0x00d62, 0x00d63}, // Malayalam Vowel Sign Voc..Malayalam Vowel Sign Voc + {0x00d81, 0x00d81}, // (nil) ..(nil) + {0x00dca, 0x00dca}, // Sinhala Sign Al-lakuna ..Sinhala Sign Al-lakuna + {0x00dd2, 0x00dd4}, // Sinhala Vowel Sign Ketti..Sinhala Vowel Sign Ketti + {0x00dd6, 0x00dd6}, // Sinhala Vowel Sign Diga ..Sinhala Vowel Sign Diga + {0x00e31, 0x00e31}, // Thai Character Mai Han-a..Thai Character Mai Han-a + {0x00e34, 0x00e3a}, // Thai Character Sara I ..Thai Character Phinthu + {0x00e47, 0x00e4e}, // Thai Character Maitaikhu..Thai Character Yamakkan + {0x00eb1, 0x00eb1}, // Lao Vowel Sign Mai Kan ..Lao Vowel Sign Mai Kan + {0x00eb4, 0x00ebc}, // Lao Vowel Sign I ..Lao Semivowel Sign Lo + {0x00ec8, 0x00ecd}, // Lao Tone Mai Ek ..Lao Niggahita + {0x00f18, 0x00f19}, // Tibetan Astrological Sig..Tibetan Astrological Sig + {0x00f35, 0x00f35}, // Tibetan Mark Ngas Bzung ..Tibetan Mark Ngas Bzung + {0x00f37, 0x00f37}, // Tibetan Mark Ngas Bzung ..Tibetan Mark Ngas Bzung + {0x00f39, 0x00f39}, // Tibetan Mark Tsa -phru ..Tibetan Mark Tsa -phru + {0x00f71, 0x00f7e}, // Tibetan Vowel Sign Aa ..Tibetan Sign Rjes Su Nga + {0x00f80, 0x00f84}, // Tibetan Vowel Sign Rever..Tibetan Mark Halanta + {0x00f86, 0x00f87}, // Tibetan Sign Lci Rtags ..Tibetan Sign Yang Rtags + {0x00f8d, 0x00f97}, // Tibetan Subjoined Sign L..Tibetan Subjoined Letter + {0x00f99, 0x00fbc}, // Tibetan Subjoined Letter..Tibetan Subjoined Letter + {0x00fc6, 0x00fc6}, // Tibetan Symbol Padma Gda..Tibetan Symbol Padma Gda + {0x0102d, 0x01030}, // Myanmar Vowel Sign I ..Myanmar Vowel Sign Uu + {0x01032, 0x01037}, // Myanmar Vowel Sign Ai ..Myanmar Sign Dot Below + {0x01039, 0x0103a}, // Myanmar Sign Virama ..Myanmar Sign Asat + {0x0103d, 0x0103e}, // Myanmar Consonant Sign M..Myanmar Consonant Sign M + {0x01058, 0x01059}, // Myanmar Vowel Sign Vocal..Myanmar Vowel Sign Vocal + {0x0105e, 0x01060}, // Myanmar Consonant Sign M..Myanmar Consonant Sign M + {0x01071, 0x01074}, // Myanmar Vowel Sign Geba ..Myanmar Vowel Sign Kayah + {0x01082, 0x01082}, // Myanmar Consonant Sign S..Myanmar Consonant Sign S + {0x01085, 0x01086}, // Myanmar Vowel Sign Shan ..Myanmar Vowel Sign Shan + {0x0108d, 0x0108d}, // Myanmar Sign Shan Counci..Myanmar Sign Shan Counci + {0x0109d, 0x0109d}, // Myanmar Vowel Sign Aiton..Myanmar Vowel Sign Aiton + {0x0135d, 0x0135f}, // Ethiopic Combining Gemin..Ethiopic Combining Gemin + {0x01712, 0x01714}, // Tagalog Vowel Sign I ..Tagalog Sign Virama + {0x01732, 0x01734}, // Hanunoo Vowel Sign I ..Hanunoo Sign Pamudpod + {0x01752, 0x01753}, // Buhid Vowel Sign I ..Buhid Vowel Sign U + {0x01772, 0x01773}, // Tagbanwa Vowel Sign I ..Tagbanwa Vowel Sign U + {0x017b4, 0x017b5}, // Khmer Vowel Inherent Aq ..Khmer Vowel Inherent Aa + {0x017b7, 0x017bd}, // Khmer Vowel Sign I ..Khmer Vowel Sign Ua + {0x017c6, 0x017c6}, // Khmer Sign Nikahit ..Khmer Sign Nikahit + {0x017c9, 0x017d3}, // Khmer Sign Muusikatoan ..Khmer Sign Bathamasat + {0x017dd, 0x017dd}, // Khmer Sign Atthacan ..Khmer Sign Atthacan + {0x0180b, 0x0180d}, // Mongolian Free Variation..Mongolian Free Variation + {0x01885, 0x01886}, // Mongolian Letter Ali Gal..Mongolian Letter Ali Gal + {0x018a9, 0x018a9}, // Mongolian Letter Ali Gal..Mongolian Letter Ali Gal + {0x01920, 0x01922}, // Limbu Vowel Sign A ..Limbu Vowel Sign U + {0x01927, 0x01928}, // Limbu Vowel Sign E ..Limbu Vowel Sign O + {0x01932, 0x01932}, // Limbu Small Letter Anusv..Limbu Small Letter Anusv + {0x01939, 0x0193b}, // Limbu Sign Mukphreng ..Limbu Sign Sa-i + {0x01a17, 0x01a18}, // Buginese Vowel Sign I ..Buginese Vowel Sign U + {0x01a1b, 0x01a1b}, // Buginese Vowel Sign Ae ..Buginese Vowel Sign Ae + {0x01a56, 0x01a56}, // Tai Tham Consonant Sign ..Tai Tham Consonant Sign + {0x01a58, 0x01a5e}, // Tai Tham Sign Mai Kang L..Tai Tham Consonant Sign + {0x01a60, 0x01a60}, // Tai Tham Sign Sakot ..Tai Tham Sign Sakot + {0x01a62, 0x01a62}, // Tai Tham Vowel Sign Mai ..Tai Tham Vowel Sign Mai + {0x01a65, 0x01a6c}, // Tai Tham Vowel Sign I ..Tai Tham Vowel Sign Oa B + {0x01a73, 0x01a7c}, // Tai Tham Vowel Sign Oa A..Tai Tham Sign Khuen-lue + {0x01a7f, 0x01a7f}, // Tai Tham Combining Crypt..Tai Tham Combining Crypt + {0x01ab0, 0x01ac0}, // Combining Doubled Circum..(nil) + {0x01b00, 0x01b03}, // Balinese Sign Ulu Ricem ..Balinese Sign Surang + {0x01b34, 0x01b34}, // Balinese Sign Rerekan ..Balinese Sign Rerekan + {0x01b36, 0x01b3a}, // Balinese Vowel Sign Ulu ..Balinese Vowel Sign Ra R + {0x01b3c, 0x01b3c}, // Balinese Vowel Sign La L..Balinese Vowel Sign La L + {0x01b42, 0x01b42}, // Balinese Vowel Sign Pepe..Balinese Vowel Sign Pepe + {0x01b6b, 0x01b73}, // Balinese Musical Symbol ..Balinese Musical Symbol + {0x01b80, 0x01b81}, // Sundanese Sign Panyecek ..Sundanese Sign Panglayar + {0x01ba2, 0x01ba5}, // Sundanese Consonant Sign..Sundanese Vowel Sign Pan + {0x01ba8, 0x01ba9}, // Sundanese Vowel Sign Pam..Sundanese Vowel Sign Pan + {0x01bab, 0x01bad}, // Sundanese Sign Virama ..Sundanese Consonant Sign + {0x01be6, 0x01be6}, // Batak Sign Tompi ..Batak Sign Tompi + {0x01be8, 0x01be9}, // Batak Vowel Sign Pakpak ..Batak Vowel Sign Ee + {0x01bed, 0x01bed}, // Batak Vowel Sign Karo O ..Batak Vowel Sign Karo O + {0x01bef, 0x01bf1}, // Batak Vowel Sign U For S..Batak Consonant Sign H + {0x01c2c, 0x01c33}, // Lepcha Vowel Sign E ..Lepcha Consonant Sign T + {0x01c36, 0x01c37}, // Lepcha Sign Ran ..Lepcha Sign Nukta + {0x01cd0, 0x01cd2}, // Vedic Tone Karshana ..Vedic Tone Prenkha + {0x01cd4, 0x01ce0}, // Vedic Sign Yajurvedic Mi..Vedic Tone Rigvedic Kash + {0x01ce2, 0x01ce8}, // Vedic Sign Visarga Svari..Vedic Sign Visarga Anuda + {0x01ced, 0x01ced}, // Vedic Sign Tiryak ..Vedic Sign Tiryak + {0x01cf4, 0x01cf4}, // Vedic Tone Candra Above ..Vedic Tone Candra Above + {0x01cf8, 0x01cf9}, // Vedic Tone Ring Above ..Vedic Tone Double Ring A + {0x01dc0, 0x01df9}, // Combining Dotted Grave A..Combining Wide Inverted + {0x01dfb, 0x01dff}, // Combining Deletion Mark ..Combining Right Arrowhea + {0x020d0, 0x020f0}, // Combining Left Harpoon A..Combining Asterisk Above + {0x02cef, 0x02cf1}, // Coptic Combining Ni Abov..Coptic Combining Spiritu + {0x02d7f, 0x02d7f}, // Tifinagh Consonant Joine..Tifinagh Consonant Joine + {0x02de0, 0x02dff}, // Combining Cyrillic Lette..Combining Cyrillic Lette + {0x0302a, 0x0302d}, // Ideographic Level Tone M..Ideographic Entering Ton + {0x03099, 0x0309a}, // Combining Katakana-hirag..Combining Katakana-hirag + {0x0a66f, 0x0a672}, // Combining Cyrillic Vzmet..Combining Cyrillic Thous + {0x0a674, 0x0a67d}, // Combining Cyrillic Lette..Combining Cyrillic Payer + {0x0a69e, 0x0a69f}, // Combining Cyrillic Lette..Combining Cyrillic Lette + {0x0a6f0, 0x0a6f1}, // Bamum Combining Mark Koq..Bamum Combining Mark Tuk + {0x0a802, 0x0a802}, // Syloti Nagri Sign Dvisva..Syloti Nagri Sign Dvisva + {0x0a806, 0x0a806}, // Syloti Nagri Sign Hasant..Syloti Nagri Sign Hasant + {0x0a80b, 0x0a80b}, // Syloti Nagri Sign Anusva..Syloti Nagri Sign Anusva + {0x0a825, 0x0a826}, // Syloti Nagri Vowel Sign ..Syloti Nagri Vowel Sign + {0x0a82c, 0x0a82c}, // (nil) ..(nil) + {0x0a8c4, 0x0a8c5}, // Saurashtra Sign Virama ..Saurashtra Sign Candrabi + {0x0a8e0, 0x0a8f1}, // Combining Devanagari Dig..Combining Devanagari Sig + {0x0a8ff, 0x0a8ff}, // Devanagari Vowel Sign Ay..Devanagari Vowel Sign Ay + {0x0a926, 0x0a92d}, // Kayah Li Vowel Ue ..Kayah Li Tone Calya Plop + {0x0a947, 0x0a951}, // Rejang Vowel Sign I ..Rejang Consonant Sign R + {0x0a980, 0x0a982}, // Javanese Sign Panyangga ..Javanese Sign Layar + {0x0a9b3, 0x0a9b3}, // Javanese Sign Cecak Telu..Javanese Sign Cecak Telu + {0x0a9b6, 0x0a9b9}, // Javanese Vowel Sign Wulu..Javanese Vowel Sign Suku + {0x0a9bc, 0x0a9bd}, // Javanese Vowel Sign Pepe..Javanese Consonant Sign + {0x0a9e5, 0x0a9e5}, // Myanmar Sign Shan Saw ..Myanmar Sign Shan Saw + {0x0aa29, 0x0aa2e}, // Cham Vowel Sign Aa ..Cham Vowel Sign Oe + {0x0aa31, 0x0aa32}, // Cham Vowel Sign Au ..Cham Vowel Sign Ue + {0x0aa35, 0x0aa36}, // Cham Consonant Sign La ..Cham Consonant Sign Wa + {0x0aa43, 0x0aa43}, // Cham Consonant Sign Fina..Cham Consonant Sign Fina + {0x0aa4c, 0x0aa4c}, // Cham Consonant Sign Fina..Cham Consonant Sign Fina + {0x0aa7c, 0x0aa7c}, // Myanmar Sign Tai Laing T..Myanmar Sign Tai Laing T + {0x0aab0, 0x0aab0}, // Tai Viet Mai Kang ..Tai Viet Mai Kang + {0x0aab2, 0x0aab4}, // Tai Viet Vowel I ..Tai Viet Vowel U + {0x0aab7, 0x0aab8}, // Tai Viet Mai Khit ..Tai Viet Vowel Ia + {0x0aabe, 0x0aabf}, // Tai Viet Vowel Am ..Tai Viet Tone Mai Ek + {0x0aac1, 0x0aac1}, // Tai Viet Tone Mai Tho ..Tai Viet Tone Mai Tho + {0x0aaec, 0x0aaed}, // Meetei Mayek Vowel Sign ..Meetei Mayek Vowel Sign + {0x0aaf6, 0x0aaf6}, // Meetei Mayek Virama ..Meetei Mayek Virama + {0x0abe5, 0x0abe5}, // Meetei Mayek Vowel Sign ..Meetei Mayek Vowel Sign + {0x0abe8, 0x0abe8}, // Meetei Mayek Vowel Sign ..Meetei Mayek Vowel Sign + {0x0abed, 0x0abed}, // Meetei Mayek Apun Iyek ..Meetei Mayek Apun Iyek + {0x0fb1e, 0x0fb1e}, // Hebrew Point Judeo-spani..Hebrew Point Judeo-spani + {0x0fe00, 0x0fe0f}, // Variation Selector-1 ..Variation Selector-16 + {0x0fe20, 0x0fe2f}, // Combining Ligature Left ..Combining Cyrillic Titlo + {0x101fd, 0x101fd}, // Phaistos Disc Sign Combi..Phaistos Disc Sign Combi + {0x102e0, 0x102e0}, // Coptic Epact Thousands M..Coptic Epact Thousands M + {0x10376, 0x1037a}, // Combining Old Permic Let..Combining Old Permic Let + {0x10a01, 0x10a03}, // Kharoshthi Vowel Sign I ..Kharoshthi Vowel Sign Vo + {0x10a05, 0x10a06}, // Kharoshthi Vowel Sign E ..Kharoshthi Vowel Sign O + {0x10a0c, 0x10a0f}, // Kharoshthi Vowel Length ..Kharoshthi Sign Visarga + {0x10a38, 0x10a3a}, // Kharoshthi Sign Bar Abov..Kharoshthi Sign Dot Belo + {0x10a3f, 0x10a3f}, // Kharoshthi Virama ..Kharoshthi Virama + {0x10ae5, 0x10ae6}, // Manichaean Abbreviation ..Manichaean Abbreviation + {0x10d24, 0x10d27}, // Hanifi Rohingya Sign Har..Hanifi Rohingya Sign Tas + {0x10eab, 0x10eac}, // (nil) ..(nil) + {0x10f46, 0x10f50}, // Sogdian Combining Dot Be..Sogdian Combining Stroke + {0x11001, 0x11001}, // Brahmi Sign Anusvara ..Brahmi Sign Anusvara + {0x11038, 0x11046}, // Brahmi Vowel Sign Aa ..Brahmi Virama + {0x1107f, 0x11081}, // Brahmi Number Joiner ..Kaithi Sign Anusvara + {0x110b3, 0x110b6}, // Kaithi Vowel Sign U ..Kaithi Vowel Sign Ai + {0x110b9, 0x110ba}, // Kaithi Sign Virama ..Kaithi Sign Nukta + {0x11100, 0x11102}, // Chakma Sign Candrabindu ..Chakma Sign Visarga + {0x11127, 0x1112b}, // Chakma Vowel Sign A ..Chakma Vowel Sign Uu + {0x1112d, 0x11134}, // Chakma Vowel Sign Ai ..Chakma Maayyaa + {0x11173, 0x11173}, // Mahajani Sign Nukta ..Mahajani Sign Nukta + {0x11180, 0x11181}, // Sharada Sign Candrabindu..Sharada Sign Anusvara + {0x111b6, 0x111be}, // Sharada Vowel Sign U ..Sharada Vowel Sign O + {0x111c9, 0x111cc}, // Sharada Sandhi Mark ..Sharada Extra Short Vowe + {0x111cf, 0x111cf}, // (nil) ..(nil) + {0x1122f, 0x11231}, // Khojki Vowel Sign U ..Khojki Vowel Sign Ai + {0x11234, 0x11234}, // Khojki Sign Anusvara ..Khojki Sign Anusvara + {0x11236, 0x11237}, // Khojki Sign Nukta ..Khojki Sign Shadda + {0x1123e, 0x1123e}, // Khojki Sign Sukun ..Khojki Sign Sukun + {0x112df, 0x112df}, // Khudawadi Sign Anusvara ..Khudawadi Sign Anusvara + {0x112e3, 0x112ea}, // Khudawadi Vowel Sign U ..Khudawadi Sign Virama + {0x11300, 0x11301}, // Grantha Sign Combining A..Grantha Sign Candrabindu + {0x1133b, 0x1133c}, // Combining Bindu Below ..Grantha Sign Nukta + {0x11340, 0x11340}, // Grantha Vowel Sign Ii ..Grantha Vowel Sign Ii + {0x11366, 0x1136c}, // Combining Grantha Digit ..Combining Grantha Digit + {0x11370, 0x11374}, // Combining Grantha Letter..Combining Grantha Letter + {0x11438, 0x1143f}, // Newa Vowel Sign U ..Newa Vowel Sign Ai + {0x11442, 0x11444}, // Newa Sign Virama ..Newa Sign Anusvara + {0x11446, 0x11446}, // Newa Sign Nukta ..Newa Sign Nukta + {0x1145e, 0x1145e}, // Newa Sandhi Mark ..Newa Sandhi Mark + {0x114b3, 0x114b8}, // Tirhuta Vowel Sign U ..Tirhuta Vowel Sign Vocal + {0x114ba, 0x114ba}, // Tirhuta Vowel Sign Short..Tirhuta Vowel Sign Short + {0x114bf, 0x114c0}, // Tirhuta Sign Candrabindu..Tirhuta Sign Anusvara + {0x114c2, 0x114c3}, // Tirhuta Sign Virama ..Tirhuta Sign Nukta + {0x115b2, 0x115b5}, // Siddham Vowel Sign U ..Siddham Vowel Sign Vocal + {0x115bc, 0x115bd}, // Siddham Sign Candrabindu..Siddham Sign Anusvara + {0x115bf, 0x115c0}, // Siddham Sign Virama ..Siddham Sign Nukta + {0x115dc, 0x115dd}, // Siddham Vowel Sign Alter..Siddham Vowel Sign Alter + {0x11633, 0x1163a}, // Modi Vowel Sign U ..Modi Vowel Sign Ai + {0x1163d, 0x1163d}, // Modi Sign Anusvara ..Modi Sign Anusvara + {0x1163f, 0x11640}, // Modi Sign Virama ..Modi Sign Ardhacandra + {0x116ab, 0x116ab}, // Takri Sign Anusvara ..Takri Sign Anusvara + {0x116ad, 0x116ad}, // Takri Vowel Sign Aa ..Takri Vowel Sign Aa + {0x116b0, 0x116b5}, // Takri Vowel Sign U ..Takri Vowel Sign Au + {0x116b7, 0x116b7}, // Takri Sign Nukta ..Takri Sign Nukta + {0x1171d, 0x1171f}, // Ahom Consonant Sign Medi..Ahom Consonant Sign Medi + {0x11722, 0x11725}, // Ahom Vowel Sign I ..Ahom Vowel Sign Uu + {0x11727, 0x1172b}, // Ahom Vowel Sign Aw ..Ahom Sign Killer + {0x1182f, 0x11837}, // Dogra Vowel Sign U ..Dogra Sign Anusvara + {0x11839, 0x1183a}, // Dogra Sign Virama ..Dogra Sign Nukta + {0x1193b, 0x1193c}, // (nil) ..(nil) + {0x1193e, 0x1193e}, // (nil) ..(nil) + {0x11943, 0x11943}, // (nil) ..(nil) + {0x119d4, 0x119d7}, // Nandinagari Vowel Sign U..Nandinagari Vowel Sign V + {0x119da, 0x119db}, // Nandinagari Vowel Sign E..Nandinagari Vowel Sign A + {0x119e0, 0x119e0}, // Nandinagari Sign Virama ..Nandinagari Sign Virama + {0x11a01, 0x11a0a}, // Zanabazar Square Vowel S..Zanabazar Square Vowel L + {0x11a33, 0x11a38}, // Zanabazar Square Final C..Zanabazar Square Sign An + {0x11a3b, 0x11a3e}, // Zanabazar Square Cluster..Zanabazar Square Cluster + {0x11a47, 0x11a47}, // Zanabazar Square Subjoin..Zanabazar Square Subjoin + {0x11a51, 0x11a56}, // Soyombo Vowel Sign I ..Soyombo Vowel Sign Oe + {0x11a59, 0x11a5b}, // Soyombo Vowel Sign Vocal..Soyombo Vowel Length Mar + {0x11a8a, 0x11a96}, // Soyombo Final Consonant ..Soyombo Sign Anusvara + {0x11a98, 0x11a99}, // Soyombo Gemination Mark ..Soyombo Subjoiner + {0x11c30, 0x11c36}, // Bhaiksuki Vowel Sign I ..Bhaiksuki Vowel Sign Voc + {0x11c38, 0x11c3d}, // Bhaiksuki Vowel Sign E ..Bhaiksuki Sign Anusvara + {0x11c3f, 0x11c3f}, // Bhaiksuki Sign Virama ..Bhaiksuki Sign Virama + {0x11c92, 0x11ca7}, // Marchen Subjoined Letter..Marchen Subjoined Letter + {0x11caa, 0x11cb0}, // Marchen Subjoined Letter..Marchen Vowel Sign Aa + {0x11cb2, 0x11cb3}, // Marchen Vowel Sign U ..Marchen Vowel Sign E + {0x11cb5, 0x11cb6}, // Marchen Sign Anusvara ..Marchen Sign Candrabindu + {0x11d31, 0x11d36}, // Masaram Gondi Vowel Sign..Masaram Gondi Vowel Sign + {0x11d3a, 0x11d3a}, // Masaram Gondi Vowel Sign..Masaram Gondi Vowel Sign + {0x11d3c, 0x11d3d}, // Masaram Gondi Vowel Sign..Masaram Gondi Vowel Sign + {0x11d3f, 0x11d45}, // Masaram Gondi Vowel Sign..Masaram Gondi Virama + {0x11d47, 0x11d47}, // Masaram Gondi Ra-kara ..Masaram Gondi Ra-kara + {0x11d90, 0x11d91}, // Gunjala Gondi Vowel Sign..Gunjala Gondi Vowel Sign + {0x11d95, 0x11d95}, // Gunjala Gondi Sign Anusv..Gunjala Gondi Sign Anusv + {0x11d97, 0x11d97}, // Gunjala Gondi Virama ..Gunjala Gondi Virama + {0x11ef3, 0x11ef4}, // Makasar Vowel Sign I ..Makasar Vowel Sign U + {0x16af0, 0x16af4}, // Bassa Vah Combining High..Bassa Vah Combining High + {0x16b30, 0x16b36}, // Pahawh Hmong Mark Cim Tu..Pahawh Hmong Mark Cim Ta + {0x16f4f, 0x16f4f}, // Miao Sign Consonant Modi..Miao Sign Consonant Modi + {0x16f8f, 0x16f92}, // Miao Tone Right ..Miao Tone Below + {0x16fe4, 0x16fe4}, // (nil) ..(nil) + {0x1bc9d, 0x1bc9e}, // Duployan Thick Letter Se..Duployan Double Mark + {0x1d167, 0x1d169}, // Musical Symbol Combining..Musical Symbol Combining + {0x1d17b, 0x1d182}, // Musical Symbol Combining..Musical Symbol Combining + {0x1d185, 0x1d18b}, // Musical Symbol Combining..Musical Symbol Combining + {0x1d1aa, 0x1d1ad}, // Musical Symbol Combining..Musical Symbol Combining + {0x1d242, 0x1d244}, // Combining Greek Musical ..Combining Greek Musical + {0x1da00, 0x1da36}, // Signwriting Head Rim ..Signwriting Air Sucking + {0x1da3b, 0x1da6c}, // Signwriting Mouth Closed..Signwriting Excitement + {0x1da75, 0x1da75}, // Signwriting Upper Body T..Signwriting Upper Body T + {0x1da84, 0x1da84}, // Signwriting Location Hea..Signwriting Location Hea + {0x1da9b, 0x1da9f}, // Signwriting Fill Modifie..Signwriting Fill Modifie + {0x1daa1, 0x1daaf}, // Signwriting Rotation Mod..Signwriting Rotation Mod + {0x1e000, 0x1e006}, // Combining Glagolitic Let..Combining Glagolitic Let + {0x1e008, 0x1e018}, // Combining Glagolitic Let..Combining Glagolitic Let + {0x1e01b, 0x1e021}, // Combining Glagolitic Let..Combining Glagolitic Let + {0x1e023, 0x1e024}, // Combining Glagolitic Let..Combining Glagolitic Let + {0x1e026, 0x1e02a}, // Combining Glagolitic Let..Combining Glagolitic Let + {0x1e130, 0x1e136}, // Nyiakeng Puachue Hmong T..Nyiakeng Puachue Hmong T + {0x1e2ec, 0x1e2ef}, // Wancho Tone Tup ..Wancho Tone Koini + {0x1e8d0, 0x1e8d6}, // Mende Kikakui Combining ..Mende Kikakui Combining + {0x1e944, 0x1e94a}, // Adlam Alif Lengthener ..Adlam Nukta + {0xe0100, 0xe01ef}, // Variation Selector-17 ..Variation Selector-256 +}; + +// https://github.com/jquast/wcwidth/blob/master/wcwidth/table_wide.py +// at commit b29897e5a1b403a0e36f7fc991614981cbc42475 (2020-07-14): +struct width_interval WIDE_EASTASIAN[] = { + {0x01100, 0x0115f}, // Hangul Choseong Kiyeok ..Hangul Choseong Filler + {0x0231a, 0x0231b}, // Watch ..Hourglass + {0x02329, 0x0232a}, // Left-pointing Angle Brac..Right-pointing Angle Bra + {0x023e9, 0x023ec}, // Black Right-pointing Dou..Black Down-pointing Doub + {0x023f0, 0x023f0}, // Alarm Clock ..Alarm Clock + {0x023f3, 0x023f3}, // Hourglass With Flowing S..Hourglass With Flowing S + {0x025fd, 0x025fe}, // White Medium Small Squar..Black Medium Small Squar + {0x02614, 0x02615}, // Umbrella With Rain Drops..Hot Beverage + {0x02648, 0x02653}, // Aries ..Pisces + {0x0267f, 0x0267f}, // Wheelchair Symbol ..Wheelchair Symbol + {0x02693, 0x02693}, // Anchor ..Anchor + {0x026a1, 0x026a1}, // High Voltage Sign ..High Voltage Sign + {0x026aa, 0x026ab}, // Medium White Circle ..Medium Black Circle + {0x026bd, 0x026be}, // Soccer Ball ..Baseball + {0x026c4, 0x026c5}, // Snowman Without Snow ..Sun Behind Cloud + {0x026ce, 0x026ce}, // Ophiuchus ..Ophiuchus + {0x026d4, 0x026d4}, // No Entry ..No Entry + {0x026ea, 0x026ea}, // Church ..Church + {0x026f2, 0x026f3}, // Fountain ..Flag In Hole + {0x026f5, 0x026f5}, // Sailboat ..Sailboat + {0x026fa, 0x026fa}, // Tent ..Tent + {0x026fd, 0x026fd}, // Fuel Pump ..Fuel Pump + {0x02705, 0x02705}, // White Heavy Check Mark ..White Heavy Check Mark + {0x0270a, 0x0270b}, // Raised Fist ..Raised Hand + {0x02728, 0x02728}, // Sparkles ..Sparkles + {0x0274c, 0x0274c}, // Cross Mark ..Cross Mark + {0x0274e, 0x0274e}, // Negative Squared Cross M..Negative Squared Cross M + {0x02753, 0x02755}, // Black Question Mark Orna..White Exclamation Mark O + {0x02757, 0x02757}, // Heavy Exclamation Mark S..Heavy Exclamation Mark S + {0x02795, 0x02797}, // Heavy Plus Sign ..Heavy Division Sign + {0x027b0, 0x027b0}, // Curly Loop ..Curly Loop + {0x027bf, 0x027bf}, // Double Curly Loop ..Double Curly Loop + {0x02b1b, 0x02b1c}, // Black Large Square ..White Large Square + {0x02b50, 0x02b50}, // White Medium Star ..White Medium Star + {0x02b55, 0x02b55}, // Heavy Large Circle ..Heavy Large Circle + {0x02e80, 0x02e99}, // Cjk Radical Repeat ..Cjk Radical Rap + {0x02e9b, 0x02ef3}, // Cjk Radical Choke ..Cjk Radical C-simplified + {0x02f00, 0x02fd5}, // Kangxi Radical One ..Kangxi Radical Flute + {0x02ff0, 0x02ffb}, // Ideographic Description ..Ideographic Description + {0x03000, 0x0303e}, // Ideographic Space ..Ideographic Variation In + {0x03041, 0x03096}, // Hiragana Letter Small A ..Hiragana Letter Small Ke + {0x03099, 0x030ff}, // Combining Katakana-hirag..Katakana Digraph Koto + {0x03105, 0x0312f}, // Bopomofo Letter B ..Bopomofo Letter Nn + {0x03131, 0x0318e}, // Hangul Letter Kiyeok ..Hangul Letter Araeae + {0x03190, 0x031e3}, // Ideographic Annotation L..Cjk Stroke Q + {0x031f0, 0x0321e}, // Katakana Letter Small Ku..Parenthesized Korean Cha + {0x03220, 0x03247}, // Parenthesized Ideograph ..Circled Ideograph Koto + {0x03250, 0x04dbf}, // Partnership Sign ..(nil) + {0x04e00, 0x0a48c}, // Cjk Unified Ideograph-4e..Yi Syllable Yyr + {0x0a490, 0x0a4c6}, // Yi Radical Qot ..Yi Radical Ke + {0x0a960, 0x0a97c}, // Hangul Choseong Tikeut-m..Hangul Choseong Ssangyeo + {0x0ac00, 0x0d7a3}, // Hangul Syllable Ga ..Hangul Syllable Hih + {0x0f900, 0x0faff}, // Cjk Compatibility Ideogr..(nil) + {0x0fe10, 0x0fe19}, // Presentation Form For Ve..Presentation Form For Ve + {0x0fe30, 0x0fe52}, // Presentation Form For Ve..Small Full Stop + {0x0fe54, 0x0fe66}, // Small Semicolon ..Small Equals Sign + {0x0fe68, 0x0fe6b}, // Small Reverse Solidus ..Small Commercial At + {0x0ff01, 0x0ff60}, // Fullwidth Exclamation Ma..Fullwidth Right White Pa + {0x0ffe0, 0x0ffe6}, // Fullwidth Cent Sign ..Fullwidth Won Sign + {0x16fe0, 0x16fe4}, // Tangut Iteration Mark ..(nil) + {0x16ff0, 0x16ff1}, // (nil) ..(nil) + {0x17000, 0x187f7}, // (nil) ..(nil) + {0x18800, 0x18cd5}, // Tangut Component-001 ..(nil) + {0x18d00, 0x18d08}, // (nil) ..(nil) + {0x1b000, 0x1b11e}, // Katakana Letter Archaic ..Hentaigana Letter N-mu-m + {0x1b150, 0x1b152}, // Hiragana Letter Small Wi..Hiragana Letter Small Wo + {0x1b164, 0x1b167}, // Katakana Letter Small Wi..Katakana Letter Small N + {0x1b170, 0x1b2fb}, // Nushu Character-1b170 ..Nushu Character-1b2fb + {0x1f004, 0x1f004}, // Mahjong Tile Red Dragon ..Mahjong Tile Red Dragon + {0x1f0cf, 0x1f0cf}, // Playing Card Black Joker..Playing Card Black Joker + {0x1f18e, 0x1f18e}, // Negative Squared Ab ..Negative Squared Ab + {0x1f191, 0x1f19a}, // Squared Cl ..Squared Vs + {0x1f200, 0x1f202}, // Square Hiragana Hoka ..Squared Katakana Sa + {0x1f210, 0x1f23b}, // Squared Cjk Unified Ideo..Squared Cjk Unified Ideo + {0x1f240, 0x1f248}, // Tortoise Shell Bracketed..Tortoise Shell Bracketed + {0x1f250, 0x1f251}, // Circled Ideograph Advant..Circled Ideograph Accept + {0x1f260, 0x1f265}, // Rounded Symbol For Fu ..Rounded Symbol For Cai + {0x1f300, 0x1f320}, // Cyclone ..Shooting Star + {0x1f32d, 0x1f335}, // Hot Dog ..Cactus + {0x1f337, 0x1f37c}, // Tulip ..Baby Bottle + {0x1f37e, 0x1f393}, // Bottle With Popping Cork..Graduation Cap + {0x1f3a0, 0x1f3ca}, // Carousel Horse ..Swimmer + {0x1f3cf, 0x1f3d3}, // Cricket Bat And Ball ..Table Tennis Paddle And + {0x1f3e0, 0x1f3f0}, // House Building ..European Castle + {0x1f3f4, 0x1f3f4}, // Waving Black Flag ..Waving Black Flag + {0x1f3f8, 0x1f43e}, // Badminton Racquet And Sh..Paw Prints + {0x1f440, 0x1f440}, // Eyes ..Eyes + {0x1f442, 0x1f4fc}, // Ear ..Videocassette + {0x1f4ff, 0x1f53d}, // Prayer Beads ..Down-pointing Small Red + {0x1f54b, 0x1f54e}, // Kaaba ..Menorah With Nine Branch + {0x1f550, 0x1f567}, // Clock Face One Oclock ..Clock Face Twelve-thirty + {0x1f57a, 0x1f57a}, // Man Dancing ..Man Dancing + {0x1f595, 0x1f596}, // Reversed Hand With Middl..Raised Hand With Part Be + {0x1f5a4, 0x1f5a4}, // Black Heart ..Black Heart + {0x1f5fb, 0x1f64f}, // Mount Fuji ..Person With Folded Hands + {0x1f680, 0x1f6c5}, // Rocket ..Left Luggage + {0x1f6cc, 0x1f6cc}, // Sleeping Accommodation ..Sleeping Accommodation + {0x1f6d0, 0x1f6d2}, // Place Of Worship ..Shopping Trolley + {0x1f6d5, 0x1f6d7}, // Hindu Temple ..(nil) + {0x1f6eb, 0x1f6ec}, // Airplane Departure ..Airplane Arriving + {0x1f6f4, 0x1f6fc}, // Scooter ..(nil) + {0x1f7e0, 0x1f7eb}, // Large Orange Circle ..Large Brown Square + {0x1f90c, 0x1f93a}, // (nil) ..Fencer + {0x1f93c, 0x1f945}, // Wrestlers ..Goal Net + {0x1f947, 0x1f978}, // First Place Medal ..(nil) + {0x1f97a, 0x1f9cb}, // Face With Pleading Eyes ..(nil) + {0x1f9cd, 0x1f9ff}, // Standing Person ..Nazar Amulet + {0x1fa70, 0x1fa74}, // Ballet Shoes ..(nil) + {0x1fa78, 0x1fa7a}, // Drop Of Blood ..Stethoscope + {0x1fa80, 0x1fa86}, // Yo-yo ..(nil) + {0x1fa90, 0x1faa8}, // Ringed Planet ..(nil) + {0x1fab0, 0x1fab6}, // (nil) ..(nil) + {0x1fac0, 0x1fac2}, // (nil) ..(nil) + {0x1fad0, 0x1fad6}, // (nil) ..(nil) + {0x20000, 0x2fffd}, // Cjk Unified Ideograph-20..(nil) + {0x30000, 0x3fffd}, // (nil) ..(nil) +}; + +bool intable(struct width_interval* table, int table_length, int c) { + // First quick check for Latin1 etc. characters. + if (c < table[0].start) return false; + + // Binary search in table. + int bot = 0; + int top = table_length - 1; + while (top >= bot) { + int mid = (bot + top) / 2; + if (table[mid].end < c) { + bot = mid + 1; + } else if (table[mid].start > c) { + top = mid - 1; + } else { + return true; + } + } + return false; +} + +} + +int wcwidth(wchar_t ucs) { + // NOTE: created by hand, there isn't anything identifiable other than + // general Cf category code to identify these, and some characters in Cf + // category code are of non-zero width. + if (ucs == 0 || ucs == 0x034F || (0x200B <= ucs && ucs <= 0x200F) || + ucs == 0x2028 || ucs == 0x2029 || (0x202A <= ucs && ucs <= 0x202E) || + (0x2060 <= ucs && ucs <= 0x2063)) { + return 0; + } + + // C0/C1 control characters. + if (ucs < 32 || (0x07F <= ucs && ucs < 0x0A0)) return -1; + + // Combining characters with zero width. + if (intable(ZERO_WIDTH, sizeof(ZERO_WIDTH) / sizeof(struct width_interval), ucs)) return 0; + + return intable(WIDE_EASTASIAN, sizeof(WIDE_EASTASIAN) / sizeof(struct width_interval), ucs) ? 2 : 1; +} + +int wcswidth(const wchar_t *wcs, size_t n) { + int ret = 0; + for(size_t i = 0; i < n && wcs[i]; i++) { + int cols = wcwidth(wcs[i]); + if (cols < 0) + return -1; + ret += cols; + } + + return ret; +} + +wchar_t *wcsdup(const wchar_t *s) { + size_t len = wcslen(s); + wchar_t *ret = (wchar_t *) malloc(sizeof(wchar_t) * (len + 1)); + if(!ret) + return NULL; + wmemcpy(ret, s, len + 1); + return ret; +} + +int wcsncasecmp(const wchar_t* s1, const wchar_t* s2, size_t n) { + for(size_t i = 0; i < n; i++) { + wint_t c1 = towlower(s1[i]); + wint_t c2 = towlower(s2[i]); + if(c1 == L'\0' && c2 == L'\0') + return 0; + if(c1 < c2) + return -1; + if(c1 > c2) + return 1; + } + return 0; +} + +int wcscasecmp(const wchar_t *, const wchar_t *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/ansi/generic/wctype.cpp b/lib/mlibc/options/ansi/generic/wctype.cpp new file mode 100644 index 0000000..57dcbc9 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/wctype.cpp @@ -0,0 +1,9 @@ + +#include <wctype.h> +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <frg/string.hpp> + +wctrans_t wctrans(const char *) MLIBC_STUB_BODY +wint_t towctrans(wint_t, wctrans_t) MLIBC_STUB_BODY + diff --git a/lib/mlibc/options/ansi/include/alloca.h b/lib/mlibc/options/ansi/include/alloca.h new file mode 100644 index 0000000..0cc6bcb --- /dev/null +++ b/lib/mlibc/options/ansi/include/alloca.h @@ -0,0 +1,8 @@ + +#ifndef _ALLOCA_H +#define _ALLOCA_H + +#define alloca __builtin_alloca + +#endif // _ALLOCA_H + diff --git a/lib/mlibc/options/ansi/include/assert.h b/lib/mlibc/options/ansi/include/assert.h new file mode 100644 index 0000000..7eccae0 --- /dev/null +++ b/lib/mlibc/options/ansi/include/assert.h @@ -0,0 +1,46 @@ + +#ifndef _ASSERT_H +#define _ASSERT_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +// NOTE: This is not ISO C. Declared in LSB +__attribute__ ((__noreturn__)) void __assert_fail(const char *assertion, const char *file, unsigned int line, + const char *function); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _ASSERT_H + +#include <mlibc-config.h> + +#if __MLIBC_GLIBC_OPTION +# include <bits/glibc/glibc_assert.h> +#endif + +// NOTE: [7.2] requires this be outside the include guard +#ifdef NDEBUG + +#undef assert +#define assert(ignore) ((void)0) + +#else // NDEBUG + +#undef assert +#define assert(assertion) ((void)((assertion) \ + || (__assert_fail(#assertion, __FILE__, __LINE__, __func__), 0))) + +#endif // NDEBUG + +#ifndef __cplusplus +#undef static_assert +#define static_assert _Static_assert +#endif diff --git a/lib/mlibc/options/ansi/include/bits/ansi/fenv.h b/lib/mlibc/options/ansi/include/bits/ansi/fenv.h new file mode 100644 index 0000000..677ddaa --- /dev/null +++ b/lib/mlibc/options/ansi/include/bits/ansi/fenv.h @@ -0,0 +1,54 @@ +#ifndef MLIBC_FENV_H +#define MLIBC_FENV_H + +#if defined(__x86_64__) || defined(__i386__) + +#define FE_DENORMAL 2 +#define FE_DIVBYZERO 4 +#define FE_INEXACT 32 +#define FE_INVALID 1 +#define FE_OVERFLOW 8 +#define FE_UNDERFLOW 16 + +#define FE_ALL_EXCEPT (FE_DENORMAL | FE_DIVBYZERO | FE_INEXACT | FE_INVALID | FE_OVERFLOW | FE_UNDERFLOW) + +#define FE_TONEAREST 0 +#define FE_DOWNWARD 0x400 +#define FE_UPWARD 0x800 +#define FE_TOWARDZERO 0xC00 + +#elif defined(__aarch64__) + +#define FE_INVALID 1 +#define FE_DIVBYZERO 2 +#define FE_OVERFLOW 4 +#define FE_UNDERFLOW 8 +#define FE_INEXACT 16 + +#define FE_ALL_EXCEPT 31 + +#define FE_TONEAREST 0 +#define FE_UPWARD 0x400000 +#define FE_DOWNWARD 0x800000 +#define FE_TOWARDZERO 0xC00000 + +#elif defined(__riscv) && __riscv_xlen == 64 + +#define FE_INEXACT 1 +#define FE_UNDERFLOW 2 +#define FE_OVERFLOW 4 +#define FE_DIVBYZERO 8 +#define FE_INVALID 16 + +#define FE_ALL_EXCEPT 31 + +#define FE_TONEAREST 0 +#define FE_TOWARDZERO 1 +#define FE_DOWNWARD 2 +#define FE_UPWARD 3 + +#else +#error Unknown architecture +#endif + +#endif // MLIBC_FENV_H diff --git a/lib/mlibc/options/ansi/include/bits/ansi/time_t.h b/lib/mlibc/options/ansi/include/bits/ansi/time_t.h new file mode 100644 index 0000000..1c29fa0 --- /dev/null +++ b/lib/mlibc/options/ansi/include/bits/ansi/time_t.h @@ -0,0 +1,8 @@ + +#ifndef MLIBC_TIME_T +#define MLIBC_TIME_T + +typedef long time_t; + +#endif + diff --git a/lib/mlibc/options/ansi/include/bits/ansi/timespec.h b/lib/mlibc/options/ansi/include/bits/ansi/timespec.h new file mode 100644 index 0000000..d34aa64 --- /dev/null +++ b/lib/mlibc/options/ansi/include/bits/ansi/timespec.h @@ -0,0 +1,13 @@ + +#ifndef MLIBC_TIMESPEC_H +#define MLIBC_TIMESPEC_H + +#include <bits/ansi/time_t.h> + +struct timespec { + time_t tv_sec; + long tv_nsec; +}; + +#endif // MLIBC_TIMESPEC_H + diff --git a/lib/mlibc/options/ansi/include/complex.h b/lib/mlibc/options/ansi/include/complex.h new file mode 100644 index 0000000..6191f28 --- /dev/null +++ b/lib/mlibc/options/ansi/include/complex.h @@ -0,0 +1,134 @@ +/* $NetBSD: complex.h,v 1.3 2010/09/15 16:11:30 christos Exp $ */ + +/* + * Written by Matthias Drochner. + * Public domain. + */ + +#ifndef _COMPLEX_H +#define _COMPLEX_H + +#define complex _Complex +#define _Complex_I 1.0fi +#define I _Complex_I + +#define CMPLX(x, y) ((double complex)__builtin_complex((double)(x), (double)(y))) +#define CMPLXF(x, y) ((float complex)__builtin_complex((float)(x), (float)(y))) +#define CMPLXL(x, y) ((long double complex)__builtin_complex((long double)(x), (long double)(y))) + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +/* 7.3.5 Trigonometric functions */ +/* 7.3.5.1 The cacos functions */ +double complex cacos(double complex); +float complex cacosf(float complex); + +/* 7.3.5.2 The casin functions */ +double complex casin(double complex); +float complex casinf(float complex); + +/* 7.3.5.1 The catan functions */ +double complex catan(double complex); +float complex catanf(float complex); + +/* 7.3.5.1 The ccos functions */ +double complex ccos(double complex); +float complex ccosf(float complex); + +/* 7.3.5.1 The csin functions */ +double complex csin(double complex); +float complex csinf(float complex); + +/* 7.3.5.1 The ctan functions */ +double complex ctan(double complex); +float complex ctanf(float complex); + +/* 7.3.6 Hyperbolic functions */ +/* 7.3.6.1 The cacosh functions */ +double complex cacosh(double complex); +float complex cacoshf(float complex); + +/* 7.3.6.2 The casinh functions */ +double complex casinh(double complex); +float complex casinhf(float complex); + +/* 7.3.6.3 The catanh functions */ +double complex catanh(double complex); +float complex catanhf(float complex); + +/* 7.3.6.4 The ccosh functions */ +double complex ccosh(double complex); +float complex ccoshf(float complex); + +/* 7.3.6.5 The csinh functions */ +double complex csinh(double complex); +float complex csinhf(float complex); + +/* 7.3.6.6 The ctanh functions */ +double complex ctanh(double complex); +float complex ctanhf(float complex); + +/* 7.3.7 Exponential and logarithmic functions */ +/* 7.3.7.1 The cexp functions */ +double complex cexp(double complex); +float complex cexpf(float complex); + +/* 7.3.7.2 The clog functions */ +double complex clog(double complex); +float complex clogf(float complex); + +/* 7.3.8 Power and absolute-value functions */ +/* 7.3.8.1 The cabs functions */ +/*#ifndef __LIBM0_SOURCE__ */ +/* avoid conflict with historical cabs(struct complex) */ +/* double cabs(double complex) __RENAME(__c99_cabs); + float cabsf(float complex) __RENAME(__c99_cabsf); + #endif +*/ +double cabs(double complex) ; +float cabsf(float complex) ; + +/* 7.3.8.2 The cpow functions */ +double complex cpow(double complex, double complex); +float complex cpowf(float complex, float complex); + +/* 7.3.8.3 The csqrt functions */ +double complex csqrt(double complex); +float complex csqrtf(float complex); + +/* 7.3.9 Manipulation functions */ +/* 7.3.9.1 The carg functions */ +double carg(double complex); +float cargf(float complex); + +/* 7.3.9.2 The cimag functions */ +double cimag(double complex); +float cimagf(float complex); +long double cimagl(long double complex); + +/* 7.3.9.3 The conj functions */ +double complex conj(double complex); +float complex conjf(float complex); +/*long double complex conjl(long double complex); */ + +/* 7.3.9.4 The cproj functions */ +double complex cproj(double complex); +float complex cprojf(float complex); +/*long double complex cprojl(long double complex); */ + +/* 7.3.9.5 The creal functions */ +double creal(double complex); +float crealf(float complex); +long double creall(long double complex); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* ! _COMPLEX_H */ diff --git a/lib/mlibc/options/ansi/include/ctype.h b/lib/mlibc/options/ansi/include/ctype.h new file mode 100644 index 0000000..7cd1ec8 --- /dev/null +++ b/lib/mlibc/options/ansi/include/ctype.h @@ -0,0 +1,46 @@ +#ifndef _CTYPE_H +#define _CTYPE_H + +#include <mlibc-config.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +// Character classification function [7.4.1] +int isalnum(int c); +int isalpha(int c); +int isblank(int c); +int iscntrl(int c); +int isdigit(int c); +int isgraph(int c); +int islower(int c); +int isprint(int c); +int ispunct(int c); +int isspace(int c); +int isupper(int c); +int isxdigit(int c); + +// glibc extensions. +int isascii(int c); + +// Character case mapping functions [7.4.2] +int tolower(int c); +int toupper(int c); + +#endif /* !__MLIBC_ABI_ONLY */ + +// Borrowed from glibc +#define toascii(c) ((c) & 0x7f) + +#ifdef __cplusplus +} +#endif + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_ctype.h> +#endif + +#endif // _CTYPE_H diff --git a/lib/mlibc/options/ansi/include/errno.h b/lib/mlibc/options/ansi/include/errno.h new file mode 100644 index 0000000..7730b16 --- /dev/null +++ b/lib/mlibc/options/ansi/include/errno.h @@ -0,0 +1,31 @@ +#ifndef _ERRNO_H +#define _ERRNO_H + +#include <abi-bits/errno.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +// Some programs define their own errno as an "extern int" if it is not a macro. +#define errno __mlibc_errno +extern __thread int __mlibc_errno; + +int *__errno_location(void); + +// Linux extensions. + +extern char *program_invocation_name; +extern char *program_invocation_short_name; +extern char *__progname; +extern char *__progname_full; + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _ERRNO_H diff --git a/lib/mlibc/options/ansi/include/fenv.h b/lib/mlibc/options/ansi/include/fenv.h new file mode 100644 index 0000000..11e38f3 --- /dev/null +++ b/lib/mlibc/options/ansi/include/fenv.h @@ -0,0 +1,44 @@ + +#ifndef _FENV_H +#define _FENV_H + +#include <bits/types.h> +#include <bits/ansi/fenv.h> + +#ifdef __cplusplus +extern "C" { +#endif + +typedef struct { + __mlibc_uint32 __control_word; + __mlibc_uint32 __status_word; + __mlibc_uint32 __unused[5]; + __mlibc_uint32 __mxcsr; +} fenv_t; + +typedef __mlibc_uint16 fexcept_t; + +#ifndef __MLIBC_ABI_ONLY + +int feclearexcept(int); +int fegetenv(fenv_t *); +int fegetexceptflag(fexcept_t *, int); +int fegetround(void); +int feholdexcept(fenv_t *); +int feraiseexcept(int); +int fesetenv(const fenv_t *); +int fesetexceptflag(const fexcept_t *, int); +int fesetround(int); +int fetestexcept(int); +int feupdateenv(const fenv_t *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#define FE_DFL_ENV ((const fenv_t *) -1) + +#endif // _FENV_H + diff --git a/lib/mlibc/options/ansi/include/inttypes.h b/lib/mlibc/options/ansi/include/inttypes.h new file mode 100644 index 0000000..5495440 --- /dev/null +++ b/lib/mlibc/options/ansi/include/inttypes.h @@ -0,0 +1,146 @@ +#ifndef _STDINT_H +#define _STDINT_H + +#include <stdint.h> + +/* Even though this is not strictly not-ABI, it is mlibc-printf specific therefore */ +/* gate behind !__MLIBC_ABI_ONLY */ +#ifndef __MLIBC_ABI_ONLY + +#if UINTPTR_MAX == UINT64_MAX +# define __PRI64 "l" +# define __PRIPTR "l" +#else +# define __PRI64 "ll" +# define __PRIPTR "" +#endif + +// TODO: This is extremly unelegant and fragile. +#define PRId8 "d" +#define PRIi8 "i" +#define PRIdLEAST8 "d" +#define PRIiLEAST8 "i" +#define PRIdFAST8 "d" +#define PRIiFAST8 "i" +#define PRId16 "d" +#define PRIi16 "i" +#define PRIdLEAST16 "d" +#define PRIiLEAST16 "i" +#define PRIdFAST16 "ld" +#define PRIiFAST16 "li" +#define PRId32 "d" +#define PRIi32 "i" +#define PRIdLEAST32 "d" +#define PRIiLEAST32 "i" +#define PRIdFAST32 "ld" +#define PRIiFAST32 "li" +#define PRId64 __PRI64 "d" +#define PRIi64 __PRI64 "i" +#define PRIdLEAST64 __PRI64 "d" +#define PRIiLEAST64 __PRI64 "i" +#define PRIdFAST64 __PRI64 "d" +#define PRIiFAST64 __PRI64 "i" +#define PRIdMAX __PRI64 "d" +#define PRIiMAX __PRI64 "i" +#define PRIdPTR __PRIPTR "d" +#define PRIiPTR __PRIPTR "i" +#define PRIo8 "o" +#define PRIu8 "u" +#define PRIx8 "x" +#define PRIX8 "X" +#define PRIoLEAST8 "o" +#define PRIuLEAST8 "u" +#define PRIxLEAST8 "x" +#define PRIXLEAST8 "X" +#define PRIoFAST8 "o" +#define PRIuFAST8 "u" +#define PRIxFAST8 "x" +#define PRIXFAST8 "X" +#define PRIo16 "o" +#define PRIu16 "u" +#define PRIx16 "x" +#define PRIX16 "X" +#define PRIoLEAST16 "o" +#define PRIuLEAST16 "u" +#define PRIxLEAST16 "x" +#define PRIXLEAST16 "X" +#define PRIoFAST16 "lo" +#define PRIuFAST16 "lu" +#define PRIxFAST16 "lx" +#define PRIXFAST16 "lX" +#define PRIo32 "o" +#define PRIu32 "u" +#define PRIx32 "x" +#define PRIX32 "X" +#define PRIoLEAST32 "o" +#define PRIuLEAST32 "u" +#define PRIxLEAST32 "x" +#define PRIXLEAST32 "X" +#define PRIoFAST32 "lo" +#define PRIuFAST32 "lu" +#define PRIxFAST32 "lx" +#define PRIXFAST32 "lX" +#define PRIo64 __PRI64 "o" +#define PRIu64 __PRI64 "u" +#define PRIx64 __PRI64 "x" +#define PRIX64 __PRI64 "X" +#define PRIoLEAST64 __PRI64 "o" +#define PRIuLEAST64 __PRI64 "u" +#define PRIxLEAST64 __PRI64 "x" +#define PRIXLEAST64 __PRI64 "X" +#define PRIoFAST64 __PRI64 "o" +#define PRIuFAST64 __PRI64 "u" +#define PRIxFAST64 __PRI64 "x" +#define PRIXFAST64 __PRI64 "X" +#define PRIoMAX __PRI64 "o" +#define PRIuMAX __PRI64 "u" +#define PRIxMAX __PRI64 "x" +#define PRIXMAX __PRI64 "X" +#define PRIoPTR __PRIPTR "o" +#define PRIuPTR __PRIPTR "u" +#define PRIxPTR __PRIPTR "x" +#define PRIXPTR __PRIPTR "X" + +#define SCNu32 "u" +#define SCNu64 __PRI64 "u" +#define SCNuMAX __PRI64 "u" +#define SCNx16 "hx" +#define SCNx32 "x" +#define SCNx64 __PRI64 "x" +#define SCNxMAX __PRI64 "x" +#define SCNi8 "hhi" +#define SCNxPTR __PRIPTR "x" + +#define SCNi8 "hhi" +#define SCNi64 __PRI64 "i" + +#define SCNd32 "d" +#define SCNd64 __PRI64 "d" + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +extern "C" { +#endif + +typedef struct { + intmax_t quot; + intmax_t rem; +} imaxdiv_t; + +#ifndef __MLIBC_ABI_ONLY + +intmax_t imaxabs(intmax_t); +imaxdiv_t imaxdiv(intmax_t, intmax_t); +intmax_t strtoimax(const char *__restrict, char **__restrict, int); +uintmax_t strtoumax(const char *__restrict, char **__restrict, int); +intmax_t wcstoimax(const __WCHAR_TYPE__ *__restrict, __WCHAR_TYPE__ **__restrict, int); +uintmax_t wcstoumax(const __WCHAR_TYPE__ *__restrict, __WCHAR_TYPE__ **__restrict, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _STDINT_H diff --git a/lib/mlibc/options/ansi/include/limits.h b/lib/mlibc/options/ansi/include/limits.h new file mode 100644 index 0000000..86b786e --- /dev/null +++ b/lib/mlibc/options/ansi/include/limits.h @@ -0,0 +1,117 @@ +#ifndef _LIMITS_H +#define _LIMITS_H + +#define CHAR_BIT 8 + +#ifndef MB_LEN_MAX +# define MB_LEN_MAX 4 +#endif + +#ifdef LONG_MAX +# ifdef LONG_MAX == INT32_MAX +# define LONG_BIT 32 +# else +// Safe assumption +# define LONG_BIT 64 +# endif +#elif defined __LONG_MAX__ +# if __LONG_MAX__ == INT32_MAX +# define LONG_BIT 32 +# else +// Safe assumption +# define LONG_BIT 64 +# endif +#else +# error "Unsupported configuration, please define either LONG_MAX or __LONG_MAX__" +#endif + +#undef SCHAR_MIN +#undef SCHAR_MAX +#undef CHAR_MIN +#undef CHAR_MAX +#undef UCHAR_MAX +#undef SHRT_MIN +#undef SHRT_MAX +#undef USHRT_MAX +#undef INT_MIN +#undef INT_MAX +#undef UINT_MAX +#undef LONG_MIN +#undef LONG_MAX +#undef ULONG_MAX +#undef LLONG_MIN +#undef LLONG_MAX +#undef ULLONG_MAX + +#define SCHAR_MIN (-__SCHAR_MAX__ - 1) +#define SCHAR_MAX __SCHAR_MAX__ +#if __SCHAR_MAX__ == __INT_MAX__ +# define UCHAR_MAX (__SCHAR_MAX__ * 2U + 1U) +#else +# define UCHAR_MAX (__SCHAR_MAX__ * 2 + 1) +#endif + +#ifdef __CHAR_UNSIGNED__ +# define CHAR_MAX UCHAR_MAX +# if __SCHAR_MAX__ == __INT_MAX__ +# define CHAR_MIN 0U +# else +# define CHAR_MIN 0 +# endif +#else +# define CHAR_MAX SCHAR_MAX +# define CHAR_MIN SCHAR_MIN +#endif + +#define SHRT_MIN (-__SHRT_MAX__ - 1) +#define SHRT_MAX __SHRT_MAX__ +#if __SHRT_MAX_ == __INT_MAX__ +# define USHRT_MAX (__SHRT_MAX__ * 2U + 1U) +#else +# define USHRT_MAX (__SHRT_MAX__ * 2 + 1) +#endif + +#define INT_MIN (-__INT_MAX__ - 1) +#define INT_MAX __INT_MAX__ +#define UINT_MAX (__INT_MAX__ * 2 + 1) + +#define LONG_MIN (-__LONG_MAX__ - 1L) +#define LONG_MAX __LONG_MAX__ +#define ULONG_MAX (__LONG_MAX__ * 2UL + 1UL) + +#define LLONG_MIN (-__LONG_LONG_MAX__ - 1LL) +#define LLONG_MAX __LONG_LONG_MAX__ +#define ULLONG_MAX (__LONG_LONG_MAX__ * 2ULL + 1ULL) + +#define NAME_MAX 255 +#define PATH_MAX 4096 +#define LINE_MAX 4096 +#define PIPE_BUF 4096 + +#define CHARCLASS_NAME_MAX 14 +#define RE_DUP_MAX 255 + +// This value is a guaranteed minimum, get the current maximum from sysconf +#define NGROUPS_MAX 8 +// POSIX states 9 is the minimum for NL_ARGMAX +#define NL_ARGMAX 9 + +#if INTPTR_MAX == INT64_MAX +# define SSIZE_MAX LONG_MAX +#elif INTPTR_MAX == INT32_MAX +# define SSIZE_MAX INT_MAX +#endif + +#define _POSIX_ARG_MAX 4096 +#define _POSIX_OPEN_MAX 16 +#define _POSIX_HOST_NAME_MAX 255 +#define _POSIX_NAME_MAX 14 +#define _POSIX_TZNAME_MAX 6 +#define _XOPEN_NAME_MAX 255 + +#define PTHREAD_STACK_MIN 16384 +#define PTHREAD_KEYS_MAX 1024 + +#include <abi-bits/limits.h> + +#endif // _LIMITS_H diff --git a/lib/mlibc/options/ansi/include/locale.h b/lib/mlibc/options/ansi/include/locale.h new file mode 100644 index 0000000..3b4773d --- /dev/null +++ b/lib/mlibc/options/ansi/include/locale.h @@ -0,0 +1,81 @@ + +#ifndef _LOCALE_H +#define _LOCALE_H + +#include <mlibc-config.h> + +#include <bits/null.h> + +#define LC_ALL 1 +#define LC_COLLATE 2 +#define LC_CTYPE 3 +#define LC_MONETARY 4 +#define LC_NUMERIC 5 +#define LC_TIME 6 +#define LC_MESSAGES 7 + +#define LC_GLOBAL_LOCALE ((locale_t) -1L) + +#define LC_CTYPE_MASK (1<<LC_CTYPE) +#define LC_NUMERIC_MASK (1<<LC_NUMERIC) +#define LC_TIME_MASK (1<<LC_TIME) +#define LC_COLLATE_MASK (1<<LC_COLLATE) +#define LC_MONETARY_MASK (1<<LC_MONETARY) +#define LC_MESSAGES_MASK (1<<LC_MESSAGES) +#define LC_ALL_MASK 0x7FFFFFFF + +#ifdef __cplusplus +extern "C" { +#endif + +struct lconv { + char *decimal_point; + char *thousands_sep; + char *grouping; + char *mon_decimal_point; + char *mon_thousands_sep; + char *mon_grouping; + char *positive_sign; + char *negative_sign; + char *currency_symbol; + char frac_digits; + char p_cs_precedes; + char n_cs_precedes; + char p_sep_by_space; + char n_sep_by_space; + char p_sign_posn; + char n_sign_posn; + char *int_curr_symbol; + char int_frac_digits; + char int_p_cs_precedes; + char int_n_cs_precedes; + char int_p_sep_by_space; + char int_n_sep_by_space; + char int_p_sign_posn; + char int_n_sign_posn; +}; + +#ifndef __MLIBC_ABI_ONLY + +// [C11/7.11.1] setlocale() function + +char *setlocale(int category, const char *locale); + +// [C11/7.11.2] Locale inquiry function + +struct lconv *localeconv(void); + +#endif /* !__MLIBC_ABI_ONLY */ + +// posix extension + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_locale.h> +#endif // __MLIBC_POSIX_OPTION + +#ifdef __cplusplus +} +#endif + +#endif // _LOCALE_H + diff --git a/lib/mlibc/options/ansi/include/math.h b/lib/mlibc/options/ansi/include/math.h new file mode 100644 index 0000000..7d7ab3c --- /dev/null +++ b/lib/mlibc/options/ansi/include/math.h @@ -0,0 +1,383 @@ + +#ifndef _MATH_H +#define _MATH_H + +#include <bits/inline-definition.h> + +// this is a posix extension +#define M_E 2.7182818284590452354 +#define M_LOG2E 1.4426950408889634074 +#define M_LOG10E 0.43429448190325182765 +#define M_LN2 0.69314718055994530942 +#define M_LN10 2.30258509299404568402 +#define M_PI 3.14159265358979323846 +#define M_PI_2 1.57079632679489661923 +#define M_PI_4 0.78539816339744830962 +#define M_1_PI 0.31830988618379067154 +#define M_2_PI 0.63661977236758134308 +#define M_2_SQRTPI 1.12837916709551257390 +#define M_SQRT2 1.41421356237309504880 +#define M_SQRT1_2 0.70710678118654752440 +#define M_PIl 3.141592653589793238462643383279502884L + +// The following two definitions are from musl. +#define FP_ILOGBNAN (-1 - (int)(((unsigned)-1) >> 1)) +#define FP_ILOGB0 FP_ILOGBNAN + +#ifdef __cplusplus +extern "C" { +#endif + +typedef double double_t; +typedef float float_t; + +#define HUGE_VAL (__builtin_huge_val()) +#define HUGE_VALF (__builtin_huge_valf()) +#define HUGE_VALL (__builtin_huge_vall()) +#define INFINITY (__builtin_inff()) +#define NAN (__builtin_nanf("")) + +// [C11/7.12.1 Treatment of error conditions] + +#define MATH_ERRNO 1 +#define MATH_ERREXCEPT 2 +#define math_errhandling 3 + +// [C11/7.12.3 Classification macros] + +// NOTE: fpclassify always returns exactly one of those constants +// However making them bitwise disjoint simplifies isfinite() etc. +#define FP_INFINITE 1 +#define FP_NAN 2 +#define FP_NORMAL 4 +#define FP_SUBNORMAL 8 +#define FP_ZERO 16 + +#ifndef __MLIBC_ABI_ONLY + +int __fpclassify(double x); +int __fpclassifyf(float x); +int __fpclassifyl(long double x); + +#define fpclassify(x) \ + (sizeof(x) == sizeof(double) ? __fpclassify(x) : \ + (sizeof(x) == sizeof(float) ? __fpclassifyf(x) : \ + (sizeof(x) == sizeof(long double) ? __fpclassifyl(x) : \ + 0))) + +#define isfinite(x) (fpclassify(x) & (FP_NORMAL | FP_SUBNORMAL | FP_ZERO)) +#define isnan(x) (fpclassify(x) == FP_NAN) +#define isinf(x) (fpclassify(x) == FP_INFINITE) +#define isnormal(x) (fpclassify(x) == FP_NORMAL) + +// FIXME: this is gcc specific +#define signbit(x) (__builtin_signbit(x)) + +// [C11/7.12.14 Comparison macros] +#define isunordered(x,y) (isnan((x)) ? ((void)(y),1) : isnan((y))) + +__MLIBC_INLINE_DEFINITION int __mlibc_isless(double_t x, double_t y) { return !isunordered(x, y) && x < y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessf(float_t x, float_t y) { return !isunordered(x, y) && x < y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessl(long double x, long double y) { return !isunordered(x, y) && x < y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessequal(double_t x, double_t y) { return !isunordered(x, y) && x <= y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessequalf(float_t x, float_t y) { return !isunordered(x, y) && x <= y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessequall(long double x, long double y) { return !isunordered(x, y) && x <= y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessgreater(double_t x, double_t y) { return !isunordered(x, y) && x != y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessgreaterf(float_t x, float_t y) { return !isunordered(x, y) && x != y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessgreaterl(long double x, long double y) { return !isunordered(x, y) && x != y; } +__MLIBC_INLINE_DEFINITION int __mlibc_isgreater(double_t x, double_t y) { return !isunordered(x, y) && x > y; } +__MLIBC_INLINE_DEFINITION int __mlibc_isgreaterf(float_t x, float_t y) { return !isunordered(x, y) && x > y; } +__MLIBC_INLINE_DEFINITION int __mlibc_isgreaterl(long double x, long double y) { return !isunordered(x, y) && x > y; } +__MLIBC_INLINE_DEFINITION int __mlibc_isgreaterequal(double_t x, double_t y) { return !isunordered(x, y) && x >= y; } +__MLIBC_INLINE_DEFINITION int __mlibc_isgreaterequalf(float_t x, float_t y) { return !isunordered(x, y) && x >= y; } +__MLIBC_INLINE_DEFINITION int __mlibc_isgreaterequall(long double x, long double y) { return !isunordered(x, y) && x >= y; } + +// TODO: We chould use _Generic here but that does not work in C++ code. +#define __MLIBC_CHOOSE_COMPARISON(x, y, p) ( \ + sizeof((x)+(y)) == sizeof(float) ? p##f(x, y) : \ + sizeof((x)+(y)) == sizeof(double) ? p(x, y) : \ + p##l(x, y) ) + +#define isless(x, y) __MLIBC_CHOOSE_COMPARISON(x, y, __mlibc_isless) +#define islessequal(x, y) __MLIBC_CHOOSE_COMPARISON(x, y, __mlibc_islessequal) +#define islessgreater(x, y) __MLIBC_CHOOSE_COMPARISON(x, y, __mlibc_islessgreater) +#define isgreater(x, y) __MLIBC_CHOOSE_COMPARISON(x, y, __mlibc_isgreater) +#define isgreaterequal(x, y) __MLIBC_CHOOSE_COMPARISON(x, y, __mlibc_isgreaterequal) + +// this is a gnu extension +void sincos(double, double *, double *); +void sincosf(float, float *, float *); +void sincosl(long double, long double *, long double *); + +double exp10(double); +float exp10f(float); +long double exp10l(long double); + +double pow10(double); +float pow10f(float); +long double pow10l(long double); + +// [C11/7.12.4 Trigonometric functions] + +double acos(double x); +float acosf(float x); +long double acosl(long double x); + +double asin(double x); +float asinf(float x); +long double asinl(long double x); + +double atan(double x); +float atanf(float x); +long double atanl(long double x); + +double atan2(double x, double y); +float atan2f(float x, float y); +long double atan2l(long double x, long double y); + +double cos(double x); +float cosf(float x); +long double cosl(long double x); + +double sin(double x); +float sinf(float x); +long double sinl(long double x); + +double tan(double x); +float tanf(float x); +long double tanl(long double x); + +// [C11/7.12.5 Hyperbolic functions] + +double acosh(double x); +float acoshf(float x); +long double acoshl(long double x); + +double asinh(double x); +float asinhf(float x); +long double asinhl(long double x); + +double atanh(double x); +float atanhf(float x); +long double atanhl(long double x); + +double cosh(double x); +float coshf(float x); +long double coshl(long double x); + +double sinh(double x); +float sinhf(float x); +long double sinhl(long double x); + +double tanh(double x); +float tanhf(float x); +long double tanhl(long double x); + +// [C11/7.12.6 Exponential and logarithmic functions] + +double exp(double x); +float expf(float x); +long double expl(long double x); + +double exp2(double x); +float exp2f(float x); +long double exp2l(long double x); + +double expm1(double x); +float expm1f(float x); +long double expm1l(long double x); + +double frexp(double x, int *power); +float frexpf(float x, int *power); +long double frexpl(long double x, int *power); + +int ilogb(double x); +int ilogbf(float x); +int ilogbl(long double x); + +double ldexp(double x, int power); +float ldexpf(float x, int power); +long double ldexpl(long double x, int power); + +double log(double x); +float logf(float x); +long double logl(long double x); + +double log10(double x); +float log10f(float x); +long double log10l(long double x); + +double log1p(double x); +float log1pf(float x); +long double log1pl(long double x); + +double log2(double x); +float log2f(float x); +long double log2l(long double x); + +double logb(double x); +float logbf(float x); +long double logbl(long double x); + +double modf(double x, double *integral); +float modff(float x, float *integral); +long double modfl(long double x, long double *integral); + +double scalbn(double x, int power); +float scalbnf(float x, int power); +long double scalbnl(long double x, int power); + +double scalbln(double x, long power); +float scalblnf(float x, long power); +long double scalblnl(long double x, long power); + +// [C11/7.12.7 Power and absolute-value functions] + +double cbrt(double x); +float cbrtf(float x); +long double cbrtl(long double x); + +double fabs(double x); +float fabsf(float x); +long double fabsl(long double x); + +double hypot(double x, double y); +float hypotf(float x, float y); +long double hypotl(long double x, long double y); + +double pow(double x, double y); +float powf(float x, float y); +long double powl(long double x, long double y); + +double sqrt(double x); +float sqrtf(float x); +long double sqrtl(long double x); + +// [C11/7.12.8 Error and gamma functions] + +double erf(double x); +float erff(float x); +long double erfl(long double x); + +double erfc(double x); +float erfcf(float x); +long double erfcl(long double x); + +double lgamma(double x); +float lgammaf(float x); +long double lgammal(long double x); + +double tgamma(double x); +float tgammaf(float x); +long double tgammal(long double x); + +// [C11/7.12.9 Nearest integer functions] + +double ceil(double x); +float ceilf(float x); +long double ceill(long double x); + +double floor(double x); +float floorf(float x); +long double floorl(long double x); + +double nearbyint(double x); +float nearbyintf(float x); +long double nearbyintl(long double x); + +double rint(double x); +float rintf(float x); +long double rintl(long double x); + +long lrint(double x); +long lrintf(float x); +long lrintl(long double x); + +long long llrint(double x); +long long llrintf(float x); +long long llrintl(long double x); + +double round(double x); +float roundf(float x); +long double roundl(long double x); + +long lround(double x); +long lroundf(float x); +long lroundl(long double x); + +long long llround(double x); +long long llroundf(float x); +long long llroundl(long double x); + +double trunc(double x); +float truncf(float x); +long double truncl(long double x); + +// [C11/7.12.10 Remainder functions] + +double fmod(double x, double y); +float fmodf(float x, float y); +long double fmodl(long double x, long double y); + +double remainder(double x, double y); +float remainderf(float x, float y); +long double remainderl(long double x, long double y); + +double remquo(double x, double y, int *quotient); +float remquof(float x, float y, int *quotient); +long double remquol(long double x, long double y, int *quotient); + +// [C11/7.12.11 Manipulation functions] + +double copysign(double x, double sign); +float copysignf(float x, float sign); +long double copysignl(long double x, long double sign); + +double nan(const char *tag); +float nanf(const char *tag); +long double nanl(const char *tag); + +double nextafter(double x, double dir); +float nextafterf(float x, float dir); +long double nextafterl(long double x, long double dir); + +double nexttoward(double x, long double dir); +float nexttowardf(float x, long double dir); +long double nexttowardl(long double x, long double dir); + +// [C11/7.12.12 Maximum, minimum and positive difference functions] + +double fdim(double x, double y); +float fdimf(float x, float y); +long double fdiml(long double x, long double y); + +double fmax(double x, double y); +float fmaxf(float x, float y); +long double fmaxl(long double x, long double y); + +double fmin(double x, double y); +float fminf(float x, float y); +long double fminl(long double x, long double y); + +// [C11/7.12.13 Floating multiply-add] + +double fma(double, double, double); +float fmaf(float, float, float); +long double fmal(long double, long double, long double); + +extern int signgam; +#define __signgam signgam + +// BSD floating-point classification functions - obsolete + +int finite(double x); +int finitef(float x); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _MATH_H + diff --git a/lib/mlibc/options/ansi/include/mlibc/ansi-sysdeps.hpp b/lib/mlibc/options/ansi/include/mlibc/ansi-sysdeps.hpp new file mode 100644 index 0000000..203084e --- /dev/null +++ b/lib/mlibc/options/ansi/include/mlibc/ansi-sysdeps.hpp @@ -0,0 +1,71 @@ +#ifndef MLIBC_ANSI_SYSDEPS +#define MLIBC_ANSI_SYSDEPS + +#include <stddef.h> + +#include <abi-bits/seek-whence.h> +#include <abi-bits/vm-flags.h> +#include <abi-bits/pid_t.h> +#include <abi-bits/mode_t.h> +#include <bits/off_t.h> +#include <bits/ssize_t.h> +#include <bits/ansi/time_t.h> +#include <signal.h> +#include <stdarg.h> + +struct rusage; + +namespace [[gnu::visibility("hidden")]] mlibc { + +[[noreturn]] void sys_exit(int status); +[[noreturn, gnu::weak]] void sys_thread_exit(); + +// If *stack is not null, it should point to the lowest addressable byte of the stack. +// Returns the new stack pointer in *stack and the stack base in *stack_base. +[[gnu::weak]] int sys_prepare_stack(void **stack, void *entry, void *user_arg, void* tcb, size_t *stack_size, size_t *guard_size, void **stack_base); +[[gnu::weak]] int sys_clone(void *tcb, pid_t *pid_out, void *stack); + +int sys_futex_wait(int *pointer, int expected, const struct timespec *time); +int sys_futex_wake(int *pointer); + +int sys_open(const char *pathname, int flags, mode_t mode, int *fd); +[[gnu::weak]] int sys_flock(int fd, int options); + +[[gnu::weak]] int sys_open_dir(const char *path, int *handle); +[[gnu::weak]] int sys_read_entries(int handle, void *buffer, size_t max_size, + size_t *bytes_read); + +int sys_read(int fd, void *buf, size_t count, ssize_t *bytes_read); + +int sys_write(int fd, const void *buf, size_t count, ssize_t *bytes_written); +[[gnu::weak]] int sys_pread(int fd, void *buf, size_t n, off_t off, ssize_t *bytes_read); + +int sys_seek(int fd, off_t offset, int whence, off_t *new_offset); +int sys_close(int fd); + +int sys_clock_get(int clock, time_t *secs, long *nanos); +[[gnu::weak]] int sys_clock_getres(int clock, time_t *secs, long *nanos); +[[gnu::weak]] int sys_sleep(time_t *secs, long *nanos); +// In contrast to the isatty() library function, the sysdep function uses return value +// zero (and not one) to indicate that the file is a terminal. +[[gnu::weak]] int sys_isatty(int fd); +[[gnu::weak]] int sys_rmdir(const char *path); +[[gnu::weak]] int sys_unlinkat(int dirfd, const char *path, int flags); +[[gnu::weak]] int sys_rename(const char *path, const char *new_path); +[[gnu::weak]] int sys_renameat(int olddirfd, const char *old_path, int newdirfd, const char *new_path); + +[[gnu::weak]] int sys_sigprocmask(int how, const sigset_t *__restrict set, + sigset_t *__restrict retrieve); +[[gnu::weak]] int sys_sigaction(int, const struct sigaction *__restrict, + struct sigaction *__restrict); + +[[gnu::weak]] int sys_fork(pid_t *child); +[[gnu::weak]] int sys_waitpid(pid_t pid, int *status, int flags, struct rusage *ru, pid_t *ret_pid); +[[gnu::weak]] int sys_execve(const char *path, char *const argv[], char *const envp[]); + +[[gnu::weak]] pid_t sys_getpid(); +[[gnu::weak]] int sys_kill(int, int); + +} //namespace mlibc + +#endif // MLIBC_ANSI_SYSDEPS diff --git a/lib/mlibc/options/ansi/include/mlibc/environment.hpp b/lib/mlibc/options/ansi/include/mlibc/environment.hpp new file mode 100644 index 0000000..7fd5cf9 --- /dev/null +++ b/lib/mlibc/options/ansi/include/mlibc/environment.hpp @@ -0,0 +1,10 @@ +#ifndef MLIBC_ENVIRONMENT_HPP +#define MLIBC_ENVIRONMENT_HPP + +namespace mlibc { + +int putenv(char *string); + +} // namespace mlibc + +#endif // MLIBC_ENVIRONMENT_HPP diff --git a/lib/mlibc/options/ansi/include/mlibc/file-io.hpp b/lib/mlibc/options/ansi/include/mlibc/file-io.hpp new file mode 100644 index 0000000..1155a2b --- /dev/null +++ b/lib/mlibc/options/ansi/include/mlibc/file-io.hpp @@ -0,0 +1,111 @@ +#ifndef MLIBC_FILE_IO_HPP +#define MLIBC_FILE_IO_HPP + +#include <stdio.h> + +#include <mlibc/lock.hpp> +#include <mlibc/allocator.hpp> +#include <frg/list.hpp> + +namespace mlibc { + +enum class stream_type { + unknown, + file_like, + pipe_like +}; + +enum class buffer_mode { + unknown, + no_buffer, + line_buffer, + full_buffer +}; + +struct abstract_file : __mlibc_file_base { +public: + abstract_file(void (*do_dispose)(abstract_file *) = nullptr); + + abstract_file(const abstract_file &) = delete; + + abstract_file &operator= (const abstract_file &) = delete; + + virtual ~abstract_file(); + + void dispose(); + + virtual int close() = 0; + virtual int reopen(const char *path, const char *mode) = 0; + + int read(char *buffer, size_t max_size, size_t *actual_size); + int write(const char *buffer, size_t max_size, size_t *actual_size); + int unget(char c); + + int update_bufmode(buffer_mode mode); + + void purge(); + int flush(); + + int tell(off_t *current_offset); + int seek(off_t offset, int whence); + +protected: + virtual int determine_type(stream_type *type) = 0; + virtual int determine_bufmode(buffer_mode *mode) = 0; + virtual int io_read(char *buffer, size_t max_size, size_t *actual_size) = 0; + virtual int io_write(const char *buffer, size_t max_size, size_t *actual_size) = 0; + virtual int io_seek(off_t offset, int whence, off_t *new_offset) = 0; + + int _reset(); +private: + int _init_type(); + int _init_bufmode(); + + int _write_back(); + int _save_pos(); + + void _ensure_allocation(); + + stream_type _type; + buffer_mode _bufmode; + void (*_do_dispose)(abstract_file *); + +public: + // lock for file operations + RecursiveFutexLock _lock; + // All files are stored in a global linked list, so that they can be flushed at exit(). + frg::default_list_hook<abstract_file> _list_hook; +}; + +struct fd_file : abstract_file { + fd_file(int fd, void (*do_dispose)(abstract_file *) = nullptr, bool force_unbuffered = false); + + int fd(); + + int close() override; + int reopen(const char *path, const char *mode) override; + + static int parse_modestring(const char *mode); + +protected: + int determine_type(stream_type *type) override; + int determine_bufmode(buffer_mode *mode) override; + + int io_read(char *buffer, size_t max_size, size_t *actual_size) override; + int io_write(const char *buffer, size_t max_size, size_t *actual_size) override; + int io_seek(off_t offset, int whence, off_t *new_offset) override; + +private: + // Underlying file descriptor. + int _fd; + bool _force_unbuffered; +}; + +template <typename T> +void file_dispose_cb(abstract_file *base) { + frg::destruct(getAllocator(), static_cast<T *>(base)); +} + +} // namespace mlibc + +#endif // MLIBC_FILE_IO_HPP diff --git a/lib/mlibc/options/ansi/include/setjmp.h b/lib/mlibc/options/ansi/include/setjmp.h new file mode 100644 index 0000000..30346f0 --- /dev/null +++ b/lib/mlibc/options/ansi/include/setjmp.h @@ -0,0 +1,48 @@ + +#ifndef _SETJMP_H +#define _SETJMP_H + +#include <mlibc-config.h> +#include <bits/machine.h> +#include <abi-bits/signal.h> + +#ifdef __cplusplus +extern "C" { +#endif + +// [C11/7.13] Non-local jumps + +typedef struct __jmp_buf { + struct __mlibc_jmpbuf_register_state reg_state; +} jmp_buf[1]; + +#ifndef __MLIBC_ABI_ONLY + +__attribute__((__returns_twice__)) int setjmp(jmp_buf buffer); +__attribute__((__noreturn__)) void longjmp(jmp_buf buffer, int value); + +#endif /* !__MLIBC_ABI_ONLY */ + +// POSIX Non-local jumps signal extensions + +typedef struct __sigjmp_buf { + struct __mlibc_jmpbuf_register_state reg_state; + int savesigs; + sigset_t sigset; +} sigjmp_buf[1]; + +#ifndef __MLIBC_ABI_ONLY + +#if __MLIBC_POSIX_OPTION +__attribute__((__returns_twice__)) int sigsetjmp(sigjmp_buf buffer, int savesigs); +__attribute__((__noreturn__)) void siglongjmp(sigjmp_buf buffer, int value); +#endif // __MLIBC_POSIX_OPTION + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SETJMP_H + diff --git a/lib/mlibc/options/ansi/include/signal.h b/lib/mlibc/options/ansi/include/signal.h new file mode 100644 index 0000000..e27592b --- /dev/null +++ b/lib/mlibc/options/ansi/include/signal.h @@ -0,0 +1,48 @@ +#ifndef _SIGNAL_H +#define _SIGNAL_H + +#include <abi-bits/signal.h> +#include <mlibc-config.h> + +#ifdef __cplusplus +extern "C" { +#endif + +// [7.14] Signal handling basics + +typedef int sig_atomic_t; + +#define CLD_EXITED 1 +#define CLD_KILLED 2 +#define CLD_DUMPED 3 +#define CLD_TRAPPED 4 +#define CLD_STOPPED 5 +#define CLD_CONTINUED 6 + +#ifndef __MLIBC_ABI_ONLY + +// [7.14.1] signal() function + +__sighandler signal(int sig, __sighandler handler); + +// [7.14.2] raise() function + +int raise(int sig); + +#endif /* !__MLIBC_ABI_ONLY */ + +#define _NSIG NSIG + +#ifdef __cplusplus +} +#endif + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_signal.h> +#endif + +#if __MLIBC_GLIBC_OPTION +# include <bits/glibc/glibc_signal.h> +#endif + +#endif // _SIGNAL_H diff --git a/lib/mlibc/options/ansi/include/stdc-predef.h b/lib/mlibc/options/ansi/include/stdc-predef.h new file mode 100644 index 0000000..a0e3e92 --- /dev/null +++ b/lib/mlibc/options/ansi/include/stdc-predef.h @@ -0,0 +1,6 @@ +#ifndef _STDC_PREDEF_H +#define _STDC_PREDEF_H + +#define __STDC_ISO_10646__ 201206L + +#endif /* _STDC_PREDEF_H */ diff --git a/lib/mlibc/options/ansi/include/stdio.h b/lib/mlibc/options/ansi/include/stdio.h new file mode 100644 index 0000000..168a3c7 --- /dev/null +++ b/lib/mlibc/options/ansi/include/stdio.h @@ -0,0 +1,229 @@ + +#ifndef _STDIO_H +#define _STDIO_H + +#include <abi-bits/seek-whence.h> +#include <bits/null.h> +#include <bits/size_t.h> +#include <mlibc-config.h> + +// Glibc extensions require ssize_t. +#include <bits/ssize_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +// [C11-7.21.1] I/O related types + +#define __MLIBC_EOF_BIT 1 +#define __MLIBC_ERROR_BIT 2 + +struct __mlibc_file_base { + // Buffer for I/O operations. + // We reserve a few extra bytes for ungetc operations. This means + // that __buffer_ptr will point a few bytes *into* the allocation. + char *__buffer_ptr; + + // Number of bytes the buffer can hold. + size_t __buffer_size; + + // Current offset inside the buffer. + size_t __offset; + + // Position inside the buffer that matches the current file pointer. + size_t __io_offset; + + // Valid region of the buffer. + size_t __valid_limit; + + // Begin and end of the dirty region inside the buffer. + size_t __dirty_begin; + size_t __dirty_end; + + // This points to the same place as __buffer_ptr, or a few bytes earlier + // if there are bytes pushed by ungetc. If buffering is disabled, calls + // to ungetc will trigger an allocation. + char *__unget_ptr; + + // 0 if we are currently reading from the buffer. + // 1 if we are currently writing to the buffer. + // This is only really important for pipe-like streams. + int __io_mode; + + // EOF and error bits. + int __status_bits; +}; + +typedef struct __mlibc_file_base FILE; +typedef size_t fpos_t; + +// [C11-7.21.1] I/O related macros + +#define _IOFBF 1 +#define _IOLBF 2 +#define _IONBF 3 + +#define BUFSIZ 512 + +#define EOF (-1) + +#define FOPEN_MAX 1024 +#define FILENAME_MAX 256 +#define L_tmpnam 256 + +#define TMP_MAX 1024 + +#ifndef __MLIBC_ABI_ONLY + +extern FILE *stderr; +extern FILE *stdin; +extern FILE *stdout; + +// [C11-7.21.4] Operations on files + +int remove(const char *filename); +int rename(const char *old_path, const char *new_path); +int renameat(int olddirfd, const char *old_path, int newdirfd, const char *new_path); +FILE *tmpfile(void); +char *tmpnam(char *buffer); + +// [C11-7.21.5] File access functions + +int fclose(FILE *stream); +int fflush(FILE *stream); +FILE *fopen(const char *__restrict filename, const char *__restrict mode); +FILE *freopen(const char *__restrict filename, const char *__restrict mode, FILE *__restrict stream); +void setbuf(FILE *__restrict stream, char *__restrict buffer); +int setvbuf(FILE *__restrict stream, char *__restrict buffer, int mode, size_t size); +void setlinebuf(FILE *stream); +void setbuffer(FILE *, char *, size_t); + +// [C11-7.21.6] Formatted input/output functions + +__attribute__((__format__(printf, 2, 3))) +int fprintf(FILE *__restrict stream, const char *__restrict format, ...); + +__attribute__((__format__(scanf, 2, 3))) +int fscanf(FILE *__restrict stream, const char *__restrict format, ...); + +__attribute__((__format__(printf, 1, 2))) +int printf(const char *__restrict format, ...); + +__attribute__((__format__(scanf, 1, 2))) +int scanf(const char *__restrict format, ...); + +__attribute__((__format__(printf, 3, 4))) +int snprintf(char *__restrict buffer, size_t max_size, const char *__restrict format, ...); + +__attribute__((__format__(printf, 2, 3))) +int sprintf(char *__restrict buffer, const char *__restrict format, ...); + +__attribute__((__format__(scanf, 2, 3))) +int sscanf(const char *__restrict buffer, const char *__restrict format, ...); + +__attribute__((__format__(printf, 2, 0))) +int vfprintf(FILE *__restrict stream, const char *__restrict format, __builtin_va_list args); + +__attribute__((__format__(scanf, 2, 0))) +int vfscanf(FILE *__restrict stream, const char *__restrict format, __builtin_va_list args); + +__attribute__((__format__(printf, 1, 0))) +int vprintf(const char *__restrict format, __builtin_va_list args); + +__attribute__((__format__(scanf, 1, 0))) +int vscanf(const char *__restrict format, __builtin_va_list args); + +__attribute__((__format__(printf, 3, 0))) +int vsnprintf(char *__restrict buffer, size_t max_size, + const char *__restrict format, __builtin_va_list args); + +__attribute__((__format__(printf, 2, 0))) +int vsprintf(char *__restrict buffer, const char *__restrict format, __builtin_va_list args); + +__attribute__((__format__(scanf, 2, 0))) +int vsscanf(const char *__restrict buffer, const char *__restrict format, __builtin_va_list args); + +// this is a gnu extension +__attribute__((__format__(printf, 2, 0))) +int vasprintf(char **, const char *, __builtin_va_list); + +// [C11-7.21.7] Character input/output functions + +int fgetc(FILE *stream); +char *fgets(char *__restrict buffer, size_t max_size, FILE *__restrict stream); +int fputc(int c, FILE *stream); +int fputs(const char *__restrict string, FILE *__restrict stream); +char *gets(char *s); +int getc(FILE *stream); +int getchar(void); +int putc(int c, FILE *stream); +int putchar(int c); +int puts(const char *string); +int ungetc(int c, FILE *stream); + +// [C11-7.21.8] Direct input/output functions + +size_t fread(void *__restrict buffer, size_t size, size_t count, FILE *__restrict stream); +size_t fwrite(const void *__restrict buffer, size_t size, size_t count, FILE *__restrict stream); + +// [C11-7.21.9] File positioning functions + +int fgetpos(FILE *__restrict stream, fpos_t *__restrict position); +int fseek(FILE *stream, long offset, int whence); +int fsetpos(FILE *stream, const fpos_t *position); +long ftell(FILE *stream); +void rewind(FILE *stream); + +// [C11-7.21.10] Error handling functions + +void clearerr(FILE *stream); +int feof(FILE *stream); +int ferror(FILE *stream); +void perror(const char *string); + +// POSIX unlocked I/O extensions. + +int getc_unlocked(FILE *); +int getchar_unlocked(void); +int putc_unlocked(int, FILE *); +int putchar_unlocked(int); + +// GLIBC extensions. + +ssize_t getline(char **, size_t *, FILE *); +ssize_t getdelim(char **, size_t *, int, FILE *); + +int asprintf(char **, const char *, ...); + +// Linux unlocked I/O extensions. + +void flockfile(FILE *); +void funlockfile(FILE *); +int ftrylockfile(FILE *); + +void clearerr_unlocked(FILE *); +int feof_unlocked(FILE *); +int ferror_unlocked(FILE *); +int fileno_unlocked(FILE *); +int fflush_unlocked(FILE *); +int fgetc_unlocked(FILE *); +int fputc_unlocked(int, FILE *); +size_t fread_unlocked(void *__restrict, size_t, size_t, FILE *__restrict); +size_t fwrite_unlocked(const void *__restrict, size_t, size_t, FILE *__restrict); + +char *fgets_unlocked(char *, int, FILE *); +int fputs_unlocked(const char *, FILE *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_stdio.h> +#endif + +#endif // _STDIO_H + diff --git a/lib/mlibc/options/ansi/include/stdlib.h b/lib/mlibc/options/ansi/include/stdlib.h new file mode 100644 index 0000000..d0e916a --- /dev/null +++ b/lib/mlibc/options/ansi/include/stdlib.h @@ -0,0 +1,128 @@ +#ifndef _STDLIB_H +#define _STDLIB_H + +#include <alloca.h> +#include <mlibc-config.h> +#include <bits/null.h> +#include <bits/size_t.h> +#include <bits/wchar_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +// [7.22] General utilities + +typedef struct { + int quot, rem; +} div_t; + +typedef struct { + long quot, rem; +} ldiv_t; + +typedef struct { + long long quot, rem; +} lldiv_t; + +#define EXIT_FAILURE 1 +#define EXIT_SUCCESS 0 + +#define RAND_MAX 0x7FFFFFFF + +// TODO: this should not be a compile-time constant +#define MB_CUR_MAX 4 + +#ifndef __MLIBC_ABI_ONLY + +// [7.22.1] Numeric conversion functions + +double atof(const char *string); +int atoi(const char *string); +long atol(const char *string); +long long atoll(const char *string); +double strtod(const char *__restrict string, char **__restrict end); +float strtof(const char *__restrict string, char **__restrict end); +long double strtold(const char *__restrict string, char **__restrict end); +long strtol(const char *__restrict string, char **__restrict end, int base); +long long strtoll(const char *__restrict string, char **__restrict end, int base); +unsigned long strtoul(const char *__restrict string, char **__restrict end, int base); +unsigned long long strtoull(const char *__restrict string, char **__restrict end, int base); + +// [7.22.2] Pseudo-random sequence generation functions + +int rand(void); +int rand_r(unsigned *); +void srand(unsigned int); + +// [7.22.3] Memory management functions + +void *aligned_alloc(size_t alignment, size_t size); +void *calloc(size_t count, size_t size); +void free(void *pointer); +void *malloc(size_t size); +void *realloc(void *pointer, size_t size); + +int posix_memalign(void **, size_t, size_t); + +// [7.22.4] Communication with the environment + +__attribute__((__noreturn__)) void abort(void); +int atexit(void (*func)(void)); +int at_quick_exit(void (*func)(void)); +__attribute__((__noreturn__)) void exit(int status); +__attribute__((__noreturn__)) void _Exit(int status); +char *getenv(const char *name); +__attribute__((__noreturn__)) void quick_exit(int status); +int system(const char *string); + +// GLIBC extension. +char *mktemp(char *); + +// [7.22.5] Searching and sorting utilities + +void *bsearch(const void *key, const void *base, size_t count, size_t size, + int (*compare)(const void *, const void *)); +void qsort(void *base, size_t count, size_t size, + int (*compare)(const void *, const void *)); +void qsort_r(void *base, size_t nmemb, size_t size, + int (*compar)(const void *, const void *, void *), + void *arg); + +// [7.22.6] Integer arithmetic functions + +int abs(int number); +long labs(long number); +long long llabs(long long number); + +div_t div(int number, int denom); +ldiv_t ldiv(long number, long denom); +lldiv_t lldiv(long long number, long long denom); + +// [7.22.7] Multibyte character conversion functions + +int mblen(const char *, size_t); +int mbtowc(wchar_t *__restrict wc, const char *__restrict mb_chr, size_t max_size); +int wctomb(char *mb_chr, wchar_t wc); + +// [7.22.8] Multibyte string conversion functions + +size_t mbstowcs(wchar_t *__restrict wc_string, const char *__restrict mb_string, size_t max_size); +size_t wcstombs(char *mb_string, const wchar_t *__restrict wc_string, size_t max_size); + +#endif /* !__MLIBC_ABI_ONLY */ + +#if __MLIBC_GLIBC_OPTION +typedef int (*comparison_fn_t) (const void *, const void *); +#endif + +#ifdef __cplusplus +} +#endif + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_stdlib.h> +#endif + +#endif // _STDLIB_H + diff --git a/lib/mlibc/options/ansi/include/string.h b/lib/mlibc/options/ansi/include/string.h new file mode 100644 index 0000000..5297e36 --- /dev/null +++ b/lib/mlibc/options/ansi/include/string.h @@ -0,0 +1,107 @@ +#ifndef _STRING_H +#define _STRING_H + +#include <mlibc-config.h> +#include <bits/null.h> +#include <bits/size_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +// [7.24.2] Copying functions + +void *memcpy(void *__restrict dest, const void *__restrict src, size_t size); +void *memmove(void *dest, const void *src, size_t size); +char *strcpy(char *__restrict dest, const char *src); +char *strncpy(char *__restrict dest, const char *src, size_t max_size); + +// [7.24.3] Concatenation functions + +char *strcat(char *__restrict dest, const char *__restrict src); +char *strncat(char *__restrict dest, const char *__restrict src, size_t max_size); + +// [7.24.4] Comparison functions + +int memcmp(const void *a, const void *b, size_t size); +int strcmp(const char *a, const char *b); +int strcoll(const char *a, const char *b); +int strncmp(const char *a, const char *b, size_t max_size); +size_t strxfrm(char *__restrict dest, const char *__restrict src, size_t max_size); + +// [7.24.5] Search functions + +void *memchr(const void *s, int c, size_t size); +char *strchr(const char *s, int c); +size_t strcspn(const char *s, const char *chrs); +char *strpbrk(const char *s, const char *chrs); +char *strrchr(const char *s, int c); +size_t strspn(const char *s, const char *chrs); +char *strstr(const char *pattern, const char *s); +char *strtok(char *__restrict s, const char *__restrict delimiter); + +// This is a GNU extension. +char *strchrnul(const char *, int); + +// [7.24.6] Miscellaneous functions + +void *memset(void *dest, int c, size_t size); +char *strerror(int errnum); +size_t strlen(const char *s); + +#endif /* !__MLIBC_ABI_ONLY */ + +#if __MLIBC_POSIX_OPTION && (defined(_BSD_SOURCE) || defined(_GNU_SOURCE)) +#include <strings.h> +#endif + +#ifndef __MLIBC_ABI_ONLY + +// POSIX extensions. +int strerror_r(int, char *, size_t); +void *mempcpy(void *, const void *, size_t); + +// GNU extensions. +int strverscmp(const char *l0, const char *r0); +int ffsl(long i); +int ffsll(long long i); +void *memmem(const void *, size_t, const void *, size_t); + +/* Handling the basename mess: + * If <libgen.h> is included *at all*, we use the XPG-defined basename + * implementation, otherwise, we use the GNU one. Since our ABI previously + * provided the XPG one under basename, we'll have to diverge from GNU here and + * provide __mlibc_gnu_basename instead. + */ +#if __MLIBC_GLIBC_OPTION && defined(_GNU_SOURCE) && !defined(basename) +char *__mlibc_gnu_basename_c(const char *path); + +# ifdef __cplusplus +extern "C++" { +static inline const char *__mlibc_gnu_basename(const char *path) { + return __mlibc_gnu_basename_c(path); +} +static inline char *__mlibc_gnu_basename(char *path) { + return __mlibc_gnu_basename_c(path); +} +} +# else +# define __mlibc_gnu_basename __mlibc_gnu_basename_c +# endif + +#define basename __mlibc_gnu_basename +#endif + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_string.h> +#endif + +#endif // _STRING_H diff --git a/lib/mlibc/options/ansi/include/threads.h b/lib/mlibc/options/ansi/include/threads.h new file mode 100644 index 0000000..f96abcd --- /dev/null +++ b/lib/mlibc/options/ansi/include/threads.h @@ -0,0 +1,61 @@ +#ifndef _THREADS_H +#define _THREADS_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/threads.h> + +enum { + mtx_plain, + mtx_recursive, + mtx_timed, +}; + +enum { + thrd_success, + thrd_timedout, + thrd_busy, + thrd_error, + thrd_nomem, +}; + +typedef struct __mlibc_thread_data *thrd_t; +typedef struct __mlibc_mutex mtx_t; +typedef struct __mlibc_cond cnd_t; +#ifndef __cplusplus +#define thread_local _Thread_local +#endif + +typedef int (*thrd_start_t)(void*); + +#ifndef __MLIBC_ABI_ONLY + +int thrd_create(thrd_t *thr, thrd_start_t func, void *arg); +int thrd_equal(thrd_t lhs, thrd_t rhs); +thrd_t thrd_current(void); +int thrd_sleep(const struct timespec *duration, struct timespec *remaining); +void thrd_yield(void); +int thrd_detach(thrd_t thr); +int thrd_join(thrd_t thr, int *res); +__attribute__((__noreturn__)) void thrd_exit(int res); + +int mtx_init(mtx_t *mtx, int type); +void mtx_destroy(mtx_t *mtx); +int mtx_lock(mtx_t *mtx); +int mtx_unlock(mtx_t *mtx); + +int cnd_init(cnd_t *cond); +void cnd_destroy(cnd_t *cond); +int cnd_broadcast(cnd_t *cond); +int cnd_wait(cnd_t *cond, mtx_t *mtx); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* _THREADS_H */ + diff --git a/lib/mlibc/options/ansi/include/time.h b/lib/mlibc/options/ansi/include/time.h new file mode 100644 index 0000000..a3239e9 --- /dev/null +++ b/lib/mlibc/options/ansi/include/time.h @@ -0,0 +1,154 @@ +#ifndef _TIME_H +#define _TIME_H + +#include <bits/null.h> +#include <bits/size_t.h> +#include <bits/ansi/time_t.h> +#include <bits/ansi/timespec.h> +#include <mlibc-config.h> + +// [7.27.1] Components of time + +#define CLOCKS_PER_SEC ((clock_t)1000000) + +#define TIME_UTC 1 + +// POSIX extensions. + +#define CLOCK_REALTIME 0 +#define CLOCK_MONOTONIC 1 +#define CLOCK_PROCESS_CPUTIME_ID 2 +#define CLOCK_THREAD_CPUTIME_ID 3 +#define CLOCK_MONOTONIC_RAW 4 +#define CLOCK_REALTIME_COARSE 5 +#define CLOCK_MONOTONIC_COARSE 6 +#define CLOCK_BOOTTIME 7 +#define CLOCK_REALTIME_ALARM 8 +#define CLOCK_BOOTTIME_ALARM 9 + +#ifdef __cplusplus +extern "C" { +#endif + +// [7.27.1] Components of time + +typedef long clock_t; // Matches Linux' ABI. + +struct tm { + int tm_sec; + int tm_min; + int tm_hour; + int tm_mday; + int tm_mon; + int tm_year; + int tm_wday; + int tm_yday; + int tm_isdst; + long int tm_gmtoff; + const char *tm_zone; +}; + +#ifndef __MLIBC_ABI_ONLY + +// [7.27.2] Time manipulation functions + +clock_t clock(void); +double difftime(time_t a, time_t b); +time_t mktime(struct tm *ptr); +time_t time(time_t *timer); +int timespec_get(struct timespec *ptr, int base); + +// [7.27.3] Time conversion functions + +char *asctime(const struct tm *ptr); +char *ctime(const time_t *timer); +struct tm *gmtime(const time_t *timer); +struct tm *gmtime_r(const time_t *__restrict timer, struct tm *__restrict result); +struct tm *localtime(const time_t *timer); +size_t strftime(char *__restrict dest, size_t max_size, + const char *__restrict format, const struct tm *__restrict ptr); + +void tzset(void); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +// POSIX extensions. + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_time.h> +# include <bits/posix/timer_t.h> +#endif // __MLIBC_POSIX_OPTION + +#include <abi-bits/clockid_t.h> + +#define TIMER_ABSTIME 1 + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +extern int daylight; +extern long timezone; +extern char *tzname[2]; + +int nanosleep(const struct timespec *, struct timespec *); + +int clock_getres(clockid_t, struct timespec *); +int clock_gettime(clockid_t, struct timespec *); +int clock_nanosleep(clockid_t, int, const struct timespec *, struct timespec *); +int clock_settime(clockid_t, const struct timespec *); + +struct tm *localtime_r(const time_t *, struct tm *); +char *asctime_r(const struct tm *tm, char *buf); +char *ctime_r(const time_t *, char *); + +#if __MLIBC_POSIX_OPTION +char *strptime(const char *__restrict, const char *__restrict, + struct tm *__restrict); +#endif /* __MLIBC_POSIX_OPTION */ + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +// GNU extensions. + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +time_t timelocal(struct tm *); +time_t timegm(struct tm *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +// Linux extensions. + +#ifdef __cplusplus +extern "C" { +#endif + +struct itimerspec { + struct timespec it_interval; + struct timespec it_value; +}; + +#ifdef __cplusplus +} +#endif + +#endif // _TIME_H diff --git a/lib/mlibc/options/ansi/include/uchar.h b/lib/mlibc/options/ansi/include/uchar.h new file mode 100644 index 0000000..3651a60 --- /dev/null +++ b/lib/mlibc/options/ansi/include/uchar.h @@ -0,0 +1,29 @@ +#ifndef _UCHAR_H +#define _UCHAR_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/mbstate.h> +#include <bits/size_t.h> + +#ifndef __cplusplus +typedef __CHAR16_TYPE__ char16_t; +typedef __CHAR32_TYPE__ char32_t; +#endif /* __cplusplus */ + +typedef struct __mlibc_mbstate mbstate_t; + +#ifndef __MLIBC_ABI_ONLY + +size_t c32rtomb(char *pmb, char32_t c32, mbstate_t *ps); +size_t mbrtoc32(char32_t *pc32, const char *pmb, size_t max, mbstate_t *ps); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* _UCHAR_H */ diff --git a/lib/mlibc/options/ansi/include/wchar.h b/lib/mlibc/options/ansi/include/wchar.h new file mode 100644 index 0000000..27198c5 --- /dev/null +++ b/lib/mlibc/options/ansi/include/wchar.h @@ -0,0 +1,128 @@ +#ifndef _WCHAR_H +#define _WCHAR_H + +#include <bits/null.h> +#include <bits/size_t.h> +#include <bits/wchar_t.h> +#include <bits/wchar.h> +#include <bits/wint_t.h> +#include <bits/mbstate.h> + +#define WEOF 0xffffffffU + +#ifdef __cplusplus +extern "C" { +#endif + +typedef struct __mlibc_file_base FILE; + +typedef struct __mlibc_mbstate mbstate_t; + +// MISSING: struct tm + +#ifndef __MLIBC_ABI_ONLY + +// [7.28.2] Wide formatted I/O functions + +int fwprintf(FILE *__restrict, const wchar_t *__restrict, ...); +int fwscanf(FILE *__restrict, const wchar_t *__restrict, ...); +int vfwprintf(FILE *__restrict, const wchar_t *__restrict, __builtin_va_list); +int vfwscanf(FILE *__restrict, const wchar_t *__restrict, __builtin_va_list); + +int swprintf(wchar_t *__restrict, size_t, const wchar_t *__restrict, ...); +int swscanf(wchar_t *__restrict, size_t, const wchar_t *__restrict, ...); +int vswprintf(wchar_t *__restrict, size_t, const wchar_t *__restrict, __builtin_va_list); +int vswscanf(wchar_t *__restrict, size_t, const wchar_t *__restrict, __builtin_va_list); + +int wprintf(const wchar_t *__restrict, ...); +int wscanf(const wchar_t *__restrict, ...); +int vwprintf(const wchar_t *__restrict, __builtin_va_list); +int vwscanf(const wchar_t *__restrict, __builtin_va_list); + +// [7.28.3] Wide character I/O functions + +wint_t fgetwc(FILE *); +wchar_t *fgetws(wchar_t *__restrict, int, FILE *__restrict); +wint_t fputwc(wchar_t, FILE *); +int fputws(const wchar_t *__restrict, FILE *__restrict); +int fwide(FILE *, int); +wint_t getwc(FILE *); +wint_t getwchar(void); +wint_t putwc(wchar_t, FILE *); +wint_t putwchar(wchar_t); +wint_t ungetwc(wint_t, FILE *); + +// [7.28.4] Wide string functions + +double wcstod(const wchar_t *__restrict, wchar_t **__restrict); +float wcstof(const wchar_t *__restrict, wchar_t **__restrict); +long double wcstold(const wchar_t *__restrict, wchar_t **__restrict); + +long wcstol(const wchar_t *__restrict, wchar_t **__restrict, int); +long long wcstoll(const wchar_t *__restrict, wchar_t **__restrict, int); +unsigned long wcstoul(const wchar_t *__restrict, wchar_t **__restrict, int); +unsigned long long wcstoull(const wchar_t *__restrict, wchar_t **__restrict, int); + +wchar_t *wcscpy(wchar_t *__restrict, const wchar_t *__restrict); +wchar_t *wcsncpy(wchar_t *__restrict, const wchar_t *__restrict, size_t); +wchar_t *wmemcpy(wchar_t *__restrict, const wchar_t *__restrict, size_t); +wchar_t *wmemmove(wchar_t *, const wchar_t *, size_t); + +wchar_t *wcscat(wchar_t *__restrict, const wchar_t *__restrict); +wchar_t *wcsncat(wchar_t *__restrict, const wchar_t *__restrict, size_t); + +int wcscmp(const wchar_t *, const wchar_t *); +int wcscoll(const wchar_t *, const wchar_t *); +int wcsncmp(const wchar_t *, const wchar_t *, size_t); +int wcsxfrm(wchar_t *__restrict, const wchar_t *__restrict, size_t); +int wmemcmp(const wchar_t *, const wchar_t *, size_t); + +wchar_t *wcschr(const wchar_t *, wchar_t); +size_t wcscspn(const wchar_t *, const wchar_t *); +wchar_t *wcspbrk(const wchar_t *, const wchar_t *); +wchar_t *wcsrchr(const wchar_t *, wchar_t); +size_t wcsspn(const wchar_t *, const wchar_t *); +wchar_t *wcsstr(const wchar_t *, const wchar_t *); +wchar_t *wcstok(wchar_t *__restrict, const wchar_t *__restrict, wchar_t **__restrict); +wchar_t *wmemchr(const wchar_t *, wchar_t, size_t); + +size_t wcslen(const wchar_t *); +wchar_t *wmemset(wchar_t *, wchar_t, size_t); + +// [7.28.5] Wide date/time functions + +/* POSIX says: + * The tag tm is declared as naming an incomplete structure type, the contents of which are + * described in the header <time.h>. */ +struct tm; +size_t wcsftime(wchar_t *__restrict, size_t, const wchar_t *__restrict, + const struct tm *__restrict); + +// [7.28.6] Wide conversion functions + +wint_t btowc(int c); +int wctob(wint_t); + +int mbsinit(const mbstate_t *); +size_t mbrlen(const char *__restrict, size_t, mbstate_t *__restrict); +size_t mbrtowc(wchar_t *__restrict, const char *__restrict, size_t, mbstate_t *__restrict); +size_t wcrtomb(char *__restrict, wchar_t, mbstate_t *__restrict); +size_t mbsrtowcs(wchar_t *__restrict, const char **__restrict, size_t, mbstate_t *__restrict); +size_t mbsnrtowcs(wchar_t *__restrict, const char **__restrict, size_t, size_t, mbstate_t *__restrict); +size_t wcsrtombs(char *__restrict, const wchar_t **__restrict, size_t, mbstate_t *__restrict); +size_t wcsnrtombs(char *__restrict, const wchar_t **__restrict, size_t, size_t, mbstate_t *__restrict); + +// POSIX extensions +int wcwidth(wchar_t wc); +int wcswidth(const wchar_t *, size_t); +wchar_t *wcsdup(const wchar_t *s); +int wcsncasecmp(const wchar_t*, const wchar_t*, size_t); +int wcscasecmp(const wchar_t *, const wchar_t *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _WCHAR_H diff --git a/lib/mlibc/options/ansi/include/wctype.h b/lib/mlibc/options/ansi/include/wctype.h new file mode 100644 index 0000000..df5d37a --- /dev/null +++ b/lib/mlibc/options/ansi/include/wctype.h @@ -0,0 +1,52 @@ +#ifndef _WCTYPE_H +#define _WCTYPE_H + +#include <mlibc-config.h> +#include <bits/wint_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +typedef unsigned long wctype_t; +typedef unsigned long wctrans_t; + +#ifndef __MLIBC_ABI_ONLY + +// [C11/7.30.2.2] Extensible wide character classification functions. + +int iswalnum(wint_t); +int iswalpha(wint_t); +int iswblank(wint_t); +int iswcntrl(wint_t); +int iswdigit(wint_t); +int iswgraph(wint_t); +int iswlower(wint_t); +int iswprint(wint_t); +int iswpunct(wint_t); +int iswspace(wint_t); +int iswupper(wint_t); +int iswxdigit(wint_t); + +wctype_t wctype(const char *); +int iswctype(wint_t, wctype_t); + +// [C11/7.30.3] Wide character case mapping utilities. + +wint_t towlower(wint_t); +wint_t towupper(wint_t); + +wctrans_t wctrans(const char *); +wint_t towctrans(wint_t, wctrans_t); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_wctype.h> +#endif + +#endif // _WCTYPE_H diff --git a/lib/mlibc/options/ansi/meson.build b/lib/mlibc/options/ansi/meson.build new file mode 100644 index 0000000..ae1d3ad --- /dev/null +++ b/lib/mlibc/options/ansi/meson.build @@ -0,0 +1,326 @@ + +if disable_ansi_option + subdir_done() +endif + +ansi_sources = files( + 'generic/stdlib-stubs.cpp', + 'generic/assert-stubs.cpp', + 'generic/complex-stubs.c', + + 'generic/complex/csqrt.c', + 'generic/complex/csinhf.c', + 'generic/complex/ccoshf.c', + 'generic/complex/cacosh.c', + 'generic/complex/casinf.c', + 'generic/complex/clogf.c', + 'generic/complex/csqrtf.c', + 'generic/complex/cimag.c', + 'generic/complex/catanh.c', + 'generic/complex/carg.c', + 'generic/complex/cproj.c', + 'generic/complex/cephes_subr.c', + 'generic/complex/ccos.c', + 'generic/complex/cexp.c', + 'generic/complex/crealf.c', + 'generic/complex/cabs.c', + 'generic/complex/csinh.c', + 'generic/complex/casinhf.c', + 'generic/complex/cephes_subrf.c', + 'generic/complex/creal.c', + 'generic/complex/casin.c', + 'generic/complex/conjf.c', + 'generic/complex/cpowf.c', + 'generic/complex/cacosf.c', + 'generic/complex/csinf.c', + 'generic/complex/ctanh.c', + 'generic/complex/ctanhf.c', + 'generic/complex/cargf.c', + 'generic/complex/cabsf.c', + 'generic/complex/cpow.c', + 'generic/complex/csin.c', + 'generic/complex/cprojf.c', + 'generic/complex/catan.c', + 'generic/complex/ctanf.c', + 'generic/complex/ctan.c', + 'generic/complex/clog.c', + 'generic/complex/catanf.c', + 'generic/complex/cacos.c', + 'generic/complex/cexpf.c', + 'generic/complex/ccosh.c', + 'generic/complex/cimagf.c', + 'generic/complex/cacoshf.c', + 'generic/complex/conj.c', + 'generic/complex/catanhf.c', + 'generic/complex/ccosf.c', + 'generic/complex/casinh.c', + + 'generic/ctype-stubs.cpp', + 'generic/environment.cpp', + 'generic/errno-stubs.cpp', + 'generic/fenv-stubs.cpp', + 'generic/file-io.cpp', + 'generic/inttypes-stubs.cpp', + 'generic/locale-stubs.cpp', + 'generic/signal-stubs.cpp', + 'generic/stdio-stubs.cpp', + 'generic/stdlib-stubs.cpp', + 'generic/string-stubs.cpp', + 'generic/threads.cpp', + 'generic/time-stubs.cpp', + 'generic/uchar.cpp', + 'generic/wchar-stubs.cpp', + 'generic/wctype.cpp', +) + +if not no_headers + install_headers( + 'include/alloca.h', + 'include/assert.h', + 'include/complex.h', + 'include/ctype.h', + 'include/errno.h', + 'include/fenv.h', + 'include/inttypes.h', + 'include/limits.h', + 'include/locale.h', + 'include/math.h', + 'include/setjmp.h', + 'include/signal.h', + 'include/stdc-predef.h', + 'include/stdio.h', + 'include/stdlib.h', + 'include/string.h', + 'include/threads.h', + 'include/time.h', + 'include/uchar.h', + 'include/wchar.h', + 'include/wctype.h', + ) + install_headers( + 'include/bits/ansi/timespec.h', + 'include/bits/ansi/time_t.h', + 'include/bits/ansi/fenv.h', + subdir: 'bits/ansi' + ) +endif + +if not headers_only + libc_sublibs += static_library('mlibc-musl-math', + 'musl-generic-math/acos.c', + 'musl-generic-math/acosf.c', + 'musl-generic-math/acosh.c', + 'musl-generic-math/acoshf.c', + 'musl-generic-math/acoshl.c', + 'musl-generic-math/acosl.c', + 'musl-generic-math/asin.c', + 'musl-generic-math/asinf.c', + 'musl-generic-math/asinh.c', + 'musl-generic-math/asinhf.c', + 'musl-generic-math/asinhl.c', + 'musl-generic-math/asinl.c', + 'musl-generic-math/atan2.c', + 'musl-generic-math/atan2f.c', + 'musl-generic-math/atan2l.c', + 'musl-generic-math/atan.c', + 'musl-generic-math/atanf.c', + 'musl-generic-math/atanh.c', + 'musl-generic-math/atanhf.c', + 'musl-generic-math/atanhl.c', + 'musl-generic-math/atanl.c', + 'musl-generic-math/cbrt.c', + 'musl-generic-math/cbrtf.c', + 'musl-generic-math/cbrtl.c', + 'musl-generic-math/ceil.c', + 'musl-generic-math/ceilf.c', + 'musl-generic-math/ceill.c', + 'musl-generic-math/copysign.c', + 'musl-generic-math/copysignf.c', + 'musl-generic-math/copysignl.c', + 'musl-generic-math/__cos.c', + 'musl-generic-math/cos.c', + 'musl-generic-math/__cosdf.c', + 'musl-generic-math/cosf.c', + 'musl-generic-math/cosh.c', + 'musl-generic-math/coshf.c', + 'musl-generic-math/coshl.c', + 'musl-generic-math/__cosl.c', + 'musl-generic-math/cosl.c', + 'musl-generic-math/erf.c', + 'musl-generic-math/erff.c', + 'musl-generic-math/erfl.c', + 'musl-generic-math/exp10.c', + 'musl-generic-math/exp10f.c', + 'musl-generic-math/exp10l.c', + 'musl-generic-math/exp2.c', + 'musl-generic-math/exp2f.c', + 'musl-generic-math/exp2l.c', + 'musl-generic-math/exp.c', + 'musl-generic-math/expf.c', + 'musl-generic-math/expl.c', + 'musl-generic-math/expm1.c', + 'musl-generic-math/expm1f.c', + 'musl-generic-math/expm1l.c', + 'musl-generic-math/__expo2.c', + 'musl-generic-math/__expo2f.c', + 'musl-generic-math/fabs.c', + 'musl-generic-math/fabsf.c', + 'musl-generic-math/fabsl.c', + 'musl-generic-math/fdim.c', + 'musl-generic-math/fdimf.c', + 'musl-generic-math/fdiml.c', + 'musl-generic-math/finite.c', + 'musl-generic-math/finitef.c', + 'musl-generic-math/floor.c', + 'musl-generic-math/floorf.c', + 'musl-generic-math/floorl.c', + 'musl-generic-math/fma.c', + 'musl-generic-math/fmaf.c', + 'musl-generic-math/fmal.c', + 'musl-generic-math/fmax.c', + 'musl-generic-math/fmaxf.c', + 'musl-generic-math/fmaxl.c', + 'musl-generic-math/fmin.c', + 'musl-generic-math/fminf.c', + 'musl-generic-math/fminl.c', + 'musl-generic-math/fmod.c', + 'musl-generic-math/fmodf.c', + 'musl-generic-math/fmodl.c', + 'musl-generic-math/__fpclassify.c', + 'musl-generic-math/__fpclassifyf.c', + 'musl-generic-math/__fpclassifyl.c', + 'musl-generic-math/frexp.c', + 'musl-generic-math/frexpf.c', + 'musl-generic-math/frexpl.c', + 'musl-generic-math/hypot.c', + 'musl-generic-math/hypotf.c', + 'musl-generic-math/hypotl.c', + 'musl-generic-math/ilogb.c', + 'musl-generic-math/ilogbf.c', + 'musl-generic-math/ilogbl.c', + 'musl-generic-math/__invtrigl.c', + 'musl-generic-math/j0.c', + 'musl-generic-math/j0f.c', + 'musl-generic-math/j1.c', + 'musl-generic-math/j1f.c', + 'musl-generic-math/jn.c', + 'musl-generic-math/jnf.c', + 'musl-generic-math/ldexp.c', + 'musl-generic-math/ldexpf.c', + 'musl-generic-math/ldexpl.c', + 'musl-generic-math/lgamma.c', + 'musl-generic-math/lgammaf.c', + 'musl-generic-math/lgammaf_r.c', + 'musl-generic-math/lgammal.c', + 'musl-generic-math/lgamma_r.c', + 'musl-generic-math/llrint.c', + 'musl-generic-math/llrintf.c', + 'musl-generic-math/llrintl.c', + 'musl-generic-math/llround.c', + 'musl-generic-math/llroundf.c', + 'musl-generic-math/llroundl.c', + 'musl-generic-math/log10.c', + 'musl-generic-math/log10f.c', + 'musl-generic-math/log10l.c', + 'musl-generic-math/log1p.c', + 'musl-generic-math/log1pf.c', + 'musl-generic-math/log1pl.c', + 'musl-generic-math/log2.c', + 'musl-generic-math/log2f.c', + 'musl-generic-math/log2l.c', + 'musl-generic-math/logb.c', + 'musl-generic-math/logbf.c', + 'musl-generic-math/logbl.c', + 'musl-generic-math/log.c', + 'musl-generic-math/logf.c', + 'musl-generic-math/logl.c', + 'musl-generic-math/lrint.c', + 'musl-generic-math/lrintf.c', + 'musl-generic-math/lrintl.c', + 'musl-generic-math/lround.c', + 'musl-generic-math/lroundf.c', + 'musl-generic-math/lroundl.c', + 'musl-generic-math/modf.c', + 'musl-generic-math/modff.c', + 'musl-generic-math/modfl.c', + 'musl-generic-math/nan.c', + 'musl-generic-math/nanf.c', + 'musl-generic-math/nanl.c', + 'musl-generic-math/nearbyint.c', + 'musl-generic-math/nearbyintf.c', + 'musl-generic-math/nearbyintl.c', + 'musl-generic-math/nextafter.c', + 'musl-generic-math/nextafterf.c', + 'musl-generic-math/nextafterl.c', + 'musl-generic-math/nexttoward.c', + 'musl-generic-math/nexttowardf.c', + 'musl-generic-math/nexttowardl.c', + 'musl-generic-math/__polevll.c', + 'musl-generic-math/pow.c', + 'musl-generic-math/powf.c', + 'musl-generic-math/powl.c', + 'musl-generic-math/remainder.c', + 'musl-generic-math/remainderf.c', + 'musl-generic-math/remainderl.c', + 'musl-generic-math/__rem_pio2.c', + 'musl-generic-math/__rem_pio2f.c', + 'musl-generic-math/__rem_pio2_large.c', + 'musl-generic-math/__rem_pio2l.c', + 'musl-generic-math/remquo.c', + 'musl-generic-math/remquof.c', + 'musl-generic-math/remquol.c', + 'musl-generic-math/rint.c', + 'musl-generic-math/rintf.c', + 'musl-generic-math/rintl.c', + 'musl-generic-math/round.c', + 'musl-generic-math/roundf.c', + 'musl-generic-math/roundl.c', + 'musl-generic-math/scalb.c', + 'musl-generic-math/scalbf.c', + 'musl-generic-math/scalbln.c', + 'musl-generic-math/scalblnf.c', + 'musl-generic-math/scalblnl.c', + 'musl-generic-math/scalbn.c', + 'musl-generic-math/scalbnf.c', + 'musl-generic-math/scalbnl.c', + 'musl-generic-math/__signbit.c', + 'musl-generic-math/__signbitf.c', + 'musl-generic-math/__signbitl.c', + 'musl-generic-math/signgam.c', + 'musl-generic-math/significand.c', + 'musl-generic-math/significandf.c', + 'musl-generic-math/__sin.c', + 'musl-generic-math/sin.c', + 'musl-generic-math/sincos.c', + 'musl-generic-math/sincosf.c', + 'musl-generic-math/sincosl.c', + 'musl-generic-math/__sindf.c', + 'musl-generic-math/sinf.c', + 'musl-generic-math/sinh.c', + 'musl-generic-math/sinhf.c', + 'musl-generic-math/sinhl.c', + 'musl-generic-math/__sinl.c', + 'musl-generic-math/sinl.c', + 'musl-generic-math/sqrt.c', + 'musl-generic-math/sqrtf.c', + 'musl-generic-math/sqrtl.c', + 'musl-generic-math/__tan.c', + 'musl-generic-math/tan.c', + 'musl-generic-math/__tandf.c', + 'musl-generic-math/tanf.c', + 'musl-generic-math/tanh.c', + 'musl-generic-math/tanhf.c', + 'musl-generic-math/tanhl.c', + 'musl-generic-math/__tanl.c', + 'musl-generic-math/tanl.c', + 'musl-generic-math/tgamma.c', + 'musl-generic-math/tgammaf.c', + 'musl-generic-math/tgammal.c', + 'musl-generic-math/trunc.c', + 'musl-generic-math/truncf.c', + 'musl-generic-math/truncl.c', + pic: true, + include_directories: libc_include_dirs, + dependencies: libc_deps, + c_args: ['-Wno-unused', '-Wno-implicit', '-Wno-parentheses', '-Wno-sign-compare', '-Wno-attributes', '-Wno-unknown-pragmas', '-Wno-maybe-uninitialized']) +endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__cos.c b/lib/mlibc/options/ansi/musl-generic-math/__cos.c new file mode 100644 index 0000000..46cefb3 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__cos.c @@ -0,0 +1,71 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_cos.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * __cos( x, y ) + * kernel cos function on [-pi/4, pi/4], pi/4 ~ 0.785398164 + * Input x is assumed to be bounded by ~pi/4 in magnitude. + * Input y is the tail of x. + * + * Algorithm + * 1. Since cos(-x) = cos(x), we need only to consider positive x. + * 2. if x < 2^-27 (hx<0x3e400000 0), return 1 with inexact if x!=0. + * 3. cos(x) is approximated by a polynomial of degree 14 on + * [0,pi/4] + * 4 14 + * cos(x) ~ 1 - x*x/2 + C1*x + ... + C6*x + * where the remez error is + * + * | 2 4 6 8 10 12 14 | -58 + * |cos(x)-(1-.5*x +C1*x +C2*x +C3*x +C4*x +C5*x +C6*x )| <= 2 + * | | + * + * 4 6 8 10 12 14 + * 4. let r = C1*x +C2*x +C3*x +C4*x +C5*x +C6*x , then + * cos(x) ~ 1 - x*x/2 + r + * since cos(x+y) ~ cos(x) - sin(x)*y + * ~ cos(x) - x*y, + * a correction term is necessary in cos(x) and hence + * cos(x+y) = 1 - (x*x/2 - (r - x*y)) + * For better accuracy, rearrange to + * cos(x+y) ~ w + (tmp + (r-x*y)) + * where w = 1 - x*x/2 and tmp is a tiny correction term + * (1 - x*x/2 == w + tmp exactly in infinite precision). + * The exactness of w + tmp in infinite precision depends on w + * and tmp having the same precision as x. If they have extra + * precision due to compiler bugs, then the extra precision is + * only good provided it is retained in all terms of the final + * expression for cos(). Retention happens in all cases tested + * under FreeBSD, so don't pessimize things by forcibly clipping + * any extra precision in w. + */ + +#include "libm.h" + +static const double +C1 = 4.16666666666666019037e-02, /* 0x3FA55555, 0x5555554C */ +C2 = -1.38888888888741095749e-03, /* 0xBF56C16C, 0x16C15177 */ +C3 = 2.48015872894767294178e-05, /* 0x3EFA01A0, 0x19CB1590 */ +C4 = -2.75573143513906633035e-07, /* 0xBE927E4F, 0x809C52AD */ +C5 = 2.08757232129817482790e-09, /* 0x3E21EE9E, 0xBDB4B1C4 */ +C6 = -1.13596475577881948265e-11; /* 0xBDA8FAE9, 0xBE8838D4 */ + +double __cos(double x, double y) +{ + double_t hz,z,r,w; + + z = x*x; + w = z*z; + r = z*(C1+z*(C2+z*C3)) + w*w*(C4+z*(C5+z*C6)); + hz = 0.5*z; + w = 1.0-hz; + return w + (((1.0-w)-hz) + (z*r-x*y)); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__cosdf.c b/lib/mlibc/options/ansi/musl-generic-math/__cosdf.c new file mode 100644 index 0000000..2124989 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__cosdf.c @@ -0,0 +1,35 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_cosf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Debugged and optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* |cos(x) - c(x)| < 2**-34.1 (~[-5.37e-11, 5.295e-11]). */ +static const double +C0 = -0x1ffffffd0c5e81.0p-54, /* -0.499999997251031003120 */ +C1 = 0x155553e1053a42.0p-57, /* 0.0416666233237390631894 */ +C2 = -0x16c087e80f1e27.0p-62, /* -0.00138867637746099294692 */ +C3 = 0x199342e0ee5069.0p-68; /* 0.0000243904487962774090654 */ + +float __cosdf(double x) +{ + double_t r, w, z; + + /* Try to optimize for parallel evaluation as in __tandf.c. */ + z = x*x; + w = z*z; + r = C2+z*C3; + return ((1.0+z*C0) + w*C1) + (w*z)*r; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__cosl.c b/lib/mlibc/options/ansi/musl-generic-math/__cosl.c new file mode 100644 index 0000000..fa522dd --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__cosl.c @@ -0,0 +1,96 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/k_cosl.c */ +/* origin: FreeBSD /usr/src/lib/msun/ld128/k_cosl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * Copyright (c) 2008 Steven G. Kargl, David Schultz, Bruce D. Evans. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + + +#include "libm.h" + +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#if LDBL_MANT_DIG == 64 +/* + * ld80 version of __cos.c. See __cos.c for most comments. + */ +/* + * Domain [-0.7854, 0.7854], range ~[-2.43e-23, 2.425e-23]: + * |cos(x) - c(x)| < 2**-75.1 + * + * The coefficients of c(x) were generated by a pari-gp script using + * a Remez algorithm that searches for the best higher coefficients + * after rounding leading coefficients to a specified precision. + * + * Simpler methods like Chebyshev or basic Remez barely suffice for + * cos() in 64-bit precision, because we want the coefficient of x^2 + * to be precisely -0.5 so that multiplying by it is exact, and plain + * rounding of the coefficients of a good polynomial approximation only + * gives this up to about 64-bit precision. Plain rounding also gives + * a mediocre approximation for the coefficient of x^4, but a rounding + * error of 0.5 ulps for this coefficient would only contribute ~0.01 + * ulps to the final error, so this is unimportant. Rounding errors in + * higher coefficients are even less important. + * + * In fact, coefficients above the x^4 one only need to have 53-bit + * precision, and this is more efficient. We get this optimization + * almost for free from the complications needed to search for the best + * higher coefficients. + */ +static const long double +C1 = 0.0416666666666666666136L; /* 0xaaaaaaaaaaaaaa9b.0p-68 */ +static const double +C2 = -0.0013888888888888874, /* -0x16c16c16c16c10.0p-62 */ +C3 = 0.000024801587301571716, /* 0x1a01a01a018e22.0p-68 */ +C4 = -0.00000027557319215507120, /* -0x127e4fb7602f22.0p-74 */ +C5 = 0.0000000020876754400407278, /* 0x11eed8caaeccf1.0p-81 */ +C6 = -1.1470297442401303e-11, /* -0x19393412bd1529.0p-89 */ +C7 = 4.7383039476436467e-14; /* 0x1aac9d9af5c43e.0p-97 */ +#define POLY(z) (z*(C1+z*(C2+z*(C3+z*(C4+z*(C5+z*(C6+z*C7))))))) +#elif LDBL_MANT_DIG == 113 +/* + * ld128 version of __cos.c. See __cos.c for most comments. + */ +/* + * Domain [-0.7854, 0.7854], range ~[-1.80e-37, 1.79e-37]: + * |cos(x) - c(x))| < 2**-122.0 + * + * 113-bit precision requires more care than 64-bit precision, since + * simple methods give a minimax polynomial with coefficient for x^2 + * that is 1 ulp below 0.5, but we want it to be precisely 0.5. See + * above for more details. + */ +static const long double +C1 = 0.04166666666666666666666666666666658424671L, +C2 = -0.001388888888888888888888888888863490893732L, +C3 = 0.00002480158730158730158730158600795304914210L, +C4 = -0.2755731922398589065255474947078934284324e-6L, +C5 = 0.2087675698786809897659225313136400793948e-8L, +C6 = -0.1147074559772972315817149986812031204775e-10L, +C7 = 0.4779477332386808976875457937252120293400e-13L; +static const double +C8 = -0.1561920696721507929516718307820958119868e-15, +C9 = 0.4110317413744594971475941557607804508039e-18, +C10 = -0.8896592467191938803288521958313920156409e-21, +C11 = 0.1601061435794535138244346256065192782581e-23; +#define POLY(z) (z*(C1+z*(C2+z*(C3+z*(C4+z*(C5+z*(C6+z*(C7+ \ + z*(C8+z*(C9+z*(C10+z*C11))))))))))) +#endif + +long double __cosl(long double x, long double y) +{ + long double hz,z,r,w; + + z = x*x; + r = POLY(z); + hz = 0.5*z; + w = 1.0-hz; + return w + (((1.0-w)-hz) + (z*r-x*y)); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__expo2.c b/lib/mlibc/options/ansi/musl-generic-math/__expo2.c new file mode 100644 index 0000000..740ac68 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__expo2.c @@ -0,0 +1,16 @@ +#include "libm.h" + +/* k is such that k*ln2 has minimal relative error and x - kln2 > log(DBL_MIN) */ +static const int k = 2043; +static const double kln2 = 0x1.62066151add8bp+10; + +/* exp(x)/2 for x >= log(DBL_MAX), slightly better than 0.5*exp(x/2)*exp(x/2) */ +double __expo2(double x) +{ + double scale; + + /* note that k is odd and scale*scale overflows */ + INSERT_WORDS(scale, (uint32_t)(0x3ff + k/2) << 20, 0); + /* exp(x - k ln2) * 2**(k-1) */ + return exp(x - kln2) * scale * scale; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__expo2f.c b/lib/mlibc/options/ansi/musl-generic-math/__expo2f.c new file mode 100644 index 0000000..5163e41 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__expo2f.c @@ -0,0 +1,16 @@ +#include "libm.h" + +/* k is such that k*ln2 has minimal relative error and x - kln2 > log(FLT_MIN) */ +static const int k = 235; +static const float kln2 = 0x1.45c778p+7f; + +/* expf(x)/2 for x >= log(FLT_MAX), slightly better than 0.5f*expf(x/2)*expf(x/2) */ +float __expo2f(float x) +{ + float scale; + + /* note that k is odd and scale*scale overflows */ + SET_FLOAT_WORD(scale, (uint32_t)(0x7f + k/2) << 23); + /* exp(x - k ln2) * 2**(k-1) */ + return expf(x - kln2) * scale * scale; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__fpclassify.c b/lib/mlibc/options/ansi/musl-generic-math/__fpclassify.c new file mode 100644 index 0000000..f7c0e2d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__fpclassify.c @@ -0,0 +1,11 @@ +#include <math.h> +#include <stdint.h> + +int __fpclassify(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i>>52 & 0x7ff; + if (!e) return u.i<<1 ? FP_SUBNORMAL : FP_ZERO; + if (e==0x7ff) return u.i<<12 ? FP_NAN : FP_INFINITE; + return FP_NORMAL; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__fpclassifyf.c b/lib/mlibc/options/ansi/musl-generic-math/__fpclassifyf.c new file mode 100644 index 0000000..fd00eb1 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__fpclassifyf.c @@ -0,0 +1,11 @@ +#include <math.h> +#include <stdint.h> + +int __fpclassifyf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = u.i>>23 & 0xff; + if (!e) return u.i<<1 ? FP_SUBNORMAL : FP_ZERO; + if (e==0xff) return u.i<<9 ? FP_NAN : FP_INFINITE; + return FP_NORMAL; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__fpclassifyl.c b/lib/mlibc/options/ansi/musl-generic-math/__fpclassifyl.c new file mode 100644 index 0000000..481c0b9 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__fpclassifyl.c @@ -0,0 +1,34 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +int __fpclassifyl(long double x) +{ + return __fpclassify(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +int __fpclassifyl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + int msb = u.i.m>>63; + if (!e && !msb) + return u.i.m ? FP_SUBNORMAL : FP_ZERO; + if (!msb) + return FP_NAN; + if (e == 0x7fff) + return u.i.m << 1 ? FP_NAN : FP_INFINITE; + return FP_NORMAL; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +int __fpclassifyl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + u.i.se = 0; + if (!e) + return u.i2.lo | u.i2.hi ? FP_SUBNORMAL : FP_ZERO; + if (e == 0x7fff) + return u.i2.lo | u.i2.hi ? FP_NAN : FP_INFINITE; + return FP_NORMAL; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__invtrigl.c b/lib/mlibc/options/ansi/musl-generic-math/__invtrigl.c new file mode 100644 index 0000000..48f83aa --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__invtrigl.c @@ -0,0 +1,63 @@ +#include <float.h> +#include "__invtrigl.h" + +#if LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +static const long double +pS0 = 1.66666666666666666631e-01L, +pS1 = -4.16313987993683104320e-01L, +pS2 = 3.69068046323246813704e-01L, +pS3 = -1.36213932016738603108e-01L, +pS4 = 1.78324189708471965733e-02L, +pS5 = -2.19216428382605211588e-04L, +pS6 = -7.10526623669075243183e-06L, +qS1 = -2.94788392796209867269e+00L, +qS2 = 3.27309890266528636716e+00L, +qS3 = -1.68285799854822427013e+00L, +qS4 = 3.90699412641738801874e-01L, +qS5 = -3.14365703596053263322e-02L; + +const long double pio2_hi = 1.57079632679489661926L; +const long double pio2_lo = -2.50827880633416601173e-20L; + +/* used in asinl() and acosl() */ +/* R(x^2) is a rational approximation of (asin(x)-x)/x^3 with Remez algorithm */ +long double __invtrigl_R(long double z) +{ + long double p, q; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*(pS5+z*pS6)))))); + q = 1.0+z*(qS1+z*(qS2+z*(qS3+z*(qS4+z*qS5)))); + return p/q; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +static const long double +pS0 = 1.66666666666666666666666666666700314e-01L, +pS1 = -7.32816946414566252574527475428622708e-01L, +pS2 = 1.34215708714992334609030036562143589e+00L, +pS3 = -1.32483151677116409805070261790752040e+00L, +pS4 = 7.61206183613632558824485341162121989e-01L, +pS5 = -2.56165783329023486777386833928147375e-01L, +pS6 = 4.80718586374448793411019434585413855e-02L, +pS7 = -4.42523267167024279410230886239774718e-03L, +pS8 = 1.44551535183911458253205638280410064e-04L, +pS9 = -2.10558957916600254061591040482706179e-07L, +qS1 = -4.84690167848739751544716485245697428e+00L, +qS2 = 9.96619113536172610135016921140206980e+00L, +qS3 = -1.13177895428973036660836798461641458e+01L, +qS4 = 7.74004374389488266169304117714658761e+00L, +qS5 = -3.25871986053534084709023539900339905e+00L, +qS6 = 8.27830318881232209752469022352928864e-01L, +qS7 = -1.18768052702942805423330715206348004e-01L, +qS8 = 8.32600764660522313269101537926539470e-03L, +qS9 = -1.99407384882605586705979504567947007e-04L; + +const long double pio2_hi = 1.57079632679489661923132169163975140L; +const long double pio2_lo = 4.33590506506189051239852201302167613e-35L; + +long double __invtrigl_R(long double z) +{ + long double p, q; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*(pS5+z*(pS6+z*(pS7+z*(pS8+z*pS9))))))))); + q = 1.0+z*(qS1+z*(qS2+z*(qS3+z*(qS4+z*(qS5+z*(qS6+z*(qS7+z*(qS8+z*qS9)))))))); + return p/q; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__invtrigl.h b/lib/mlibc/options/ansi/musl-generic-math/__invtrigl.h new file mode 100644 index 0000000..6dedac3 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__invtrigl.h @@ -0,0 +1,11 @@ +/* shared by acosl, asinl and atan2l */ +#define pio2_hi __pio2_hi +#define pio2_lo __pio2_lo + +#ifndef __MLIBC_ABI_ONLY + +extern const long double pio2_hi, pio2_lo; + +long double __invtrigl_R(long double z); + +#endif /* !__MLIBC_ABI_ONLY */ diff --git a/lib/mlibc/options/ansi/musl-generic-math/__polevll.c b/lib/mlibc/options/ansi/musl-generic-math/__polevll.c new file mode 100644 index 0000000..ce1a840 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__polevll.c @@ -0,0 +1,93 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/polevll.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Evaluate polynomial + * + * + * SYNOPSIS: + * + * int N; + * long double x, y, coef[N+1], polevl[]; + * + * y = polevll( x, coef, N ); + * + * + * DESCRIPTION: + * + * Evaluates polynomial of degree N: + * + * 2 N + * y = C + C x + C x +...+ C x + * 0 1 2 N + * + * Coefficients are stored in reverse order: + * + * coef[0] = C , ..., coef[N] = C . + * N 0 + * + * The function p1evll() assumes that coef[N] = 1.0 and is + * omitted from the array. Its calling arguments are + * otherwise the same as polevll(). + * + * + * SPEED: + * + * In the interest of speed, there are no checks for out + * of bounds arithmetic. This routine is used by most of + * the functions in the library. Depending on available + * equipment features, the user may wish to rewrite the + * program in microcode or assembly language. + * + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +#else +/* + * Polynomial evaluator: + * P[0] x^n + P[1] x^(n-1) + ... + P[n] + */ +long double __polevll(long double x, const long double *P, int n) +{ + long double y; + + y = *P++; + do { + y = y * x + *P++; + } while (--n); + + return y; +} + +/* + * Polynomial evaluator: + * x^n + P[0] x^(n-1) + P[1] x^(n-2) + ... + P[n] + */ +long double __p1evll(long double x, const long double *P, int n) +{ + long double y; + + n -= 1; + y = x + *P++; + do { + y = y * x + *P++; + } while (--n); + + return y; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2.c b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2.c new file mode 100644 index 0000000..d403f81 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2.c @@ -0,0 +1,177 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_rem_pio2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + * Optimized by Bruce D. Evans. + */ +/* __rem_pio2(x,y) + * + * return the remainder of x rem pi/2 in y[0]+y[1] + * use __rem_pio2_large() for large x + */ + +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif + +/* + * invpio2: 53 bits of 2/pi + * pio2_1: first 33 bit of pi/2 + * pio2_1t: pi/2 - pio2_1 + * pio2_2: second 33 bit of pi/2 + * pio2_2t: pi/2 - (pio2_1+pio2_2) + * pio2_3: third 33 bit of pi/2 + * pio2_3t: pi/2 - (pio2_1+pio2_2+pio2_3) + */ +static const double +toint = 1.5/EPS, +invpio2 = 6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */ +pio2_1 = 1.57079632673412561417e+00, /* 0x3FF921FB, 0x54400000 */ +pio2_1t = 6.07710050650619224932e-11, /* 0x3DD0B461, 0x1A626331 */ +pio2_2 = 6.07710050630396597660e-11, /* 0x3DD0B461, 0x1A600000 */ +pio2_2t = 2.02226624879595063154e-21, /* 0x3BA3198A, 0x2E037073 */ +pio2_3 = 2.02226624871116645580e-21, /* 0x3BA3198A, 0x2E000000 */ +pio2_3t = 8.47842766036889956997e-32; /* 0x397B839A, 0x252049C1 */ + +/* caller must handle the case when reduction is not needed: |x| ~<= pi/4 */ +int __rem_pio2(double x, double *y) +{ + union {double f; uint64_t i;} u = {x}; + double_t z,w,t,r,fn; + double tx[3],ty[2]; + uint32_t ix; + int sign, n, ex, ey, i; + + sign = u.i>>63; + ix = u.i>>32 & 0x7fffffff; + if (ix <= 0x400f6a7a) { /* |x| ~<= 5pi/4 */ + if ((ix & 0xfffff) == 0x921fb) /* |x| ~= pi/2 or 2pi/2 */ + goto medium; /* cancellation -- use medium case */ + if (ix <= 0x4002d97c) { /* |x| ~<= 3pi/4 */ + if (!sign) { + z = x - pio2_1; /* one round good to 85 bits */ + y[0] = z - pio2_1t; + y[1] = (z-y[0]) - pio2_1t; + return 1; + } else { + z = x + pio2_1; + y[0] = z + pio2_1t; + y[1] = (z-y[0]) + pio2_1t; + return -1; + } + } else { + if (!sign) { + z = x - 2*pio2_1; + y[0] = z - 2*pio2_1t; + y[1] = (z-y[0]) - 2*pio2_1t; + return 2; + } else { + z = x + 2*pio2_1; + y[0] = z + 2*pio2_1t; + y[1] = (z-y[0]) + 2*pio2_1t; + return -2; + } + } + } + if (ix <= 0x401c463b) { /* |x| ~<= 9pi/4 */ + if (ix <= 0x4015fdbc) { /* |x| ~<= 7pi/4 */ + if (ix == 0x4012d97c) /* |x| ~= 3pi/2 */ + goto medium; + if (!sign) { + z = x - 3*pio2_1; + y[0] = z - 3*pio2_1t; + y[1] = (z-y[0]) - 3*pio2_1t; + return 3; + } else { + z = x + 3*pio2_1; + y[0] = z + 3*pio2_1t; + y[1] = (z-y[0]) + 3*pio2_1t; + return -3; + } + } else { + if (ix == 0x401921fb) /* |x| ~= 4pi/2 */ + goto medium; + if (!sign) { + z = x - 4*pio2_1; + y[0] = z - 4*pio2_1t; + y[1] = (z-y[0]) - 4*pio2_1t; + return 4; + } else { + z = x + 4*pio2_1; + y[0] = z + 4*pio2_1t; + y[1] = (z-y[0]) + 4*pio2_1t; + return -4; + } + } + } + if (ix < 0x413921fb) { /* |x| ~< 2^20*(pi/2), medium size */ +medium: + /* rint(x/(pi/2)), Assume round-to-nearest. */ + fn = (double_t)x*invpio2 + toint - toint; + n = (int32_t)fn; + r = x - fn*pio2_1; + w = fn*pio2_1t; /* 1st round, good to 85 bits */ + y[0] = r - w; + u.f = y[0]; + ey = u.i>>52 & 0x7ff; + ex = ix>>20; + if (ex - ey > 16) { /* 2nd round, good to 118 bits */ + t = r; + w = fn*pio2_2; + r = t - w; + w = fn*pio2_2t - ((t-r)-w); + y[0] = r - w; + u.f = y[0]; + ey = u.i>>52 & 0x7ff; + if (ex - ey > 49) { /* 3rd round, good to 151 bits, covers all cases */ + t = r; + w = fn*pio2_3; + r = t - w; + w = fn*pio2_3t - ((t-r)-w); + y[0] = r - w; + } + } + y[1] = (r - y[0]) - w; + return n; + } + /* + * all other (large) arguments + */ + if (ix >= 0x7ff00000) { /* x is inf or NaN */ + y[0] = y[1] = x - x; + return 0; + } + /* set z = scalbn(|x|,-ilogb(x)+23) */ + u.f = x; + u.i &= (uint64_t)-1>>12; + u.i |= (uint64_t)(0x3ff + 23)<<52; + z = u.f; + for (i=0; i < 2; i++) { + tx[i] = (double)(int32_t)z; + z = (z-tx[i])*0x1p24; + } + tx[i] = z; + /* skip zero terms, first term is non-zero */ + while (tx[i] == 0.0) + i--; + n = __rem_pio2_large(tx,ty,(int)(ix>>20)-(0x3ff+23),i+1,1); + if (sign) { + y[0] = -ty[0]; + y[1] = -ty[1]; + return -n; + } + y[0] = ty[0]; + y[1] = ty[1]; + return n; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2_large.c b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2_large.c new file mode 100644 index 0000000..958f28c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2_large.c @@ -0,0 +1,442 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_rem_pio2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * __rem_pio2_large(x,y,e0,nx,prec) + * double x[],y[]; int e0,nx,prec; + * + * __rem_pio2_large return the last three digits of N with + * y = x - N*pi/2 + * so that |y| < pi/2. + * + * The method is to compute the integer (mod 8) and fraction parts of + * (2/pi)*x without doing the full multiplication. In general we + * skip the part of the product that are known to be a huge integer ( + * more accurately, = 0 mod 8 ). Thus the number of operations are + * independent of the exponent of the input. + * + * (2/pi) is represented by an array of 24-bit integers in ipio2[]. + * + * Input parameters: + * x[] The input value (must be positive) is broken into nx + * pieces of 24-bit integers in double precision format. + * x[i] will be the i-th 24 bit of x. The scaled exponent + * of x[0] is given in input parameter e0 (i.e., x[0]*2^e0 + * match x's up to 24 bits. + * + * Example of breaking a double positive z into x[0]+x[1]+x[2]: + * e0 = ilogb(z)-23 + * z = scalbn(z,-e0) + * for i = 0,1,2 + * x[i] = floor(z) + * z = (z-x[i])*2**24 + * + * + * y[] ouput result in an array of double precision numbers. + * The dimension of y[] is: + * 24-bit precision 1 + * 53-bit precision 2 + * 64-bit precision 2 + * 113-bit precision 3 + * The actual value is the sum of them. Thus for 113-bit + * precison, one may have to do something like: + * + * long double t,w,r_head, r_tail; + * t = (long double)y[2] + (long double)y[1]; + * w = (long double)y[0]; + * r_head = t+w; + * r_tail = w - (r_head - t); + * + * e0 The exponent of x[0]. Must be <= 16360 or you need to + * expand the ipio2 table. + * + * nx dimension of x[] + * + * prec an integer indicating the precision: + * 0 24 bits (single) + * 1 53 bits (double) + * 2 64 bits (extended) + * 3 113 bits (quad) + * + * External function: + * double scalbn(), floor(); + * + * + * Here is the description of some local variables: + * + * jk jk+1 is the initial number of terms of ipio2[] needed + * in the computation. The minimum and recommended value + * for jk is 3,4,4,6 for single, double, extended, and quad. + * jk+1 must be 2 larger than you might expect so that our + * recomputation test works. (Up to 24 bits in the integer + * part (the 24 bits of it that we compute) and 23 bits in + * the fraction part may be lost to cancelation before we + * recompute.) + * + * jz local integer variable indicating the number of + * terms of ipio2[] used. + * + * jx nx - 1 + * + * jv index for pointing to the suitable ipio2[] for the + * computation. In general, we want + * ( 2^e0*x[0] * ipio2[jv-1]*2^(-24jv) )/8 + * is an integer. Thus + * e0-3-24*jv >= 0 or (e0-3)/24 >= jv + * Hence jv = max(0,(e0-3)/24). + * + * jp jp+1 is the number of terms in PIo2[] needed, jp = jk. + * + * q[] double array with integral value, representing the + * 24-bits chunk of the product of x and 2/pi. + * + * q0 the corresponding exponent of q[0]. Note that the + * exponent for q[i] would be q0-24*i. + * + * PIo2[] double precision array, obtained by cutting pi/2 + * into 24 bits chunks. + * + * f[] ipio2[] in floating point + * + * iq[] integer array by breaking up q[] in 24-bits chunk. + * + * fq[] final product of x*(2/pi) in fq[0],..,fq[jk] + * + * ih integer. If >0 it indicates q[] is >= 0.5, hence + * it also indicates the *sign* of the result. + * + */ +/* + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "libm.h" + +static const int init_jk[] = {3,4,4,6}; /* initial value for jk */ + +/* + * Table of constants for 2/pi, 396 Hex digits (476 decimal) of 2/pi + * + * integer array, contains the (24*i)-th to (24*i+23)-th + * bit of 2/pi after binary point. The corresponding + * floating value is + * + * ipio2[i] * 2^(-24(i+1)). + * + * NB: This table must have at least (e0-3)/24 + jk terms. + * For quad precision (e0 <= 16360, jk = 6), this is 686. + */ +static const int32_t ipio2[] = { +0xA2F983, 0x6E4E44, 0x1529FC, 0x2757D1, 0xF534DD, 0xC0DB62, +0x95993C, 0x439041, 0xFE5163, 0xABDEBB, 0xC561B7, 0x246E3A, +0x424DD2, 0xE00649, 0x2EEA09, 0xD1921C, 0xFE1DEB, 0x1CB129, +0xA73EE8, 0x8235F5, 0x2EBB44, 0x84E99C, 0x7026B4, 0x5F7E41, +0x3991D6, 0x398353, 0x39F49C, 0x845F8B, 0xBDF928, 0x3B1FF8, +0x97FFDE, 0x05980F, 0xEF2F11, 0x8B5A0A, 0x6D1F6D, 0x367ECF, +0x27CB09, 0xB74F46, 0x3F669E, 0x5FEA2D, 0x7527BA, 0xC7EBE5, +0xF17B3D, 0x0739F7, 0x8A5292, 0xEA6BFB, 0x5FB11F, 0x8D5D08, +0x560330, 0x46FC7B, 0x6BABF0, 0xCFBC20, 0x9AF436, 0x1DA9E3, +0x91615E, 0xE61B08, 0x659985, 0x5F14A0, 0x68408D, 0xFFD880, +0x4D7327, 0x310606, 0x1556CA, 0x73A8C9, 0x60E27B, 0xC08C6B, + +#if LDBL_MAX_EXP > 1024 +0x47C419, 0xC367CD, 0xDCE809, 0x2A8359, 0xC4768B, 0x961CA6, +0xDDAF44, 0xD15719, 0x053EA5, 0xFF0705, 0x3F7E33, 0xE832C2, +0xDE4F98, 0x327DBB, 0xC33D26, 0xEF6B1E, 0x5EF89F, 0x3A1F35, +0xCAF27F, 0x1D87F1, 0x21907C, 0x7C246A, 0xFA6ED5, 0x772D30, +0x433B15, 0xC614B5, 0x9D19C3, 0xC2C4AD, 0x414D2C, 0x5D000C, +0x467D86, 0x2D71E3, 0x9AC69B, 0x006233, 0x7CD2B4, 0x97A7B4, +0xD55537, 0xF63ED7, 0x1810A3, 0xFC764D, 0x2A9D64, 0xABD770, +0xF87C63, 0x57B07A, 0xE71517, 0x5649C0, 0xD9D63B, 0x3884A7, +0xCB2324, 0x778AD6, 0x23545A, 0xB91F00, 0x1B0AF1, 0xDFCE19, +0xFF319F, 0x6A1E66, 0x615799, 0x47FBAC, 0xD87F7E, 0xB76522, +0x89E832, 0x60BFE6, 0xCDC4EF, 0x09366C, 0xD43F5D, 0xD7DE16, +0xDE3B58, 0x929BDE, 0x2822D2, 0xE88628, 0x4D58E2, 0x32CAC6, +0x16E308, 0xCB7DE0, 0x50C017, 0xA71DF3, 0x5BE018, 0x34132E, +0x621283, 0x014883, 0x5B8EF5, 0x7FB0AD, 0xF2E91E, 0x434A48, +0xD36710, 0xD8DDAA, 0x425FAE, 0xCE616A, 0xA4280A, 0xB499D3, +0xF2A606, 0x7F775C, 0x83C2A3, 0x883C61, 0x78738A, 0x5A8CAF, +0xBDD76F, 0x63A62D, 0xCBBFF4, 0xEF818D, 0x67C126, 0x45CA55, +0x36D9CA, 0xD2A828, 0x8D61C2, 0x77C912, 0x142604, 0x9B4612, +0xC459C4, 0x44C5C8, 0x91B24D, 0xF31700, 0xAD43D4, 0xE54929, +0x10D5FD, 0xFCBE00, 0xCC941E, 0xEECE70, 0xF53E13, 0x80F1EC, +0xC3E7B3, 0x28F8C7, 0x940593, 0x3E71C1, 0xB3092E, 0xF3450B, +0x9C1288, 0x7B20AB, 0x9FB52E, 0xC29247, 0x2F327B, 0x6D550C, +0x90A772, 0x1FE76B, 0x96CB31, 0x4A1679, 0xE27941, 0x89DFF4, +0x9794E8, 0x84E6E2, 0x973199, 0x6BED88, 0x365F5F, 0x0EFDBB, +0xB49A48, 0x6CA467, 0x427271, 0x325D8D, 0xB8159F, 0x09E5BC, +0x25318D, 0x3974F7, 0x1C0530, 0x010C0D, 0x68084B, 0x58EE2C, +0x90AA47, 0x02E774, 0x24D6BD, 0xA67DF7, 0x72486E, 0xEF169F, +0xA6948E, 0xF691B4, 0x5153D1, 0xF20ACF, 0x339820, 0x7E4BF5, +0x6863B2, 0x5F3EDD, 0x035D40, 0x7F8985, 0x295255, 0xC06437, +0x10D86D, 0x324832, 0x754C5B, 0xD4714E, 0x6E5445, 0xC1090B, +0x69F52A, 0xD56614, 0x9D0727, 0x50045D, 0xDB3BB4, 0xC576EA, +0x17F987, 0x7D6B49, 0xBA271D, 0x296996, 0xACCCC6, 0x5414AD, +0x6AE290, 0x89D988, 0x50722C, 0xBEA404, 0x940777, 0x7030F3, +0x27FC00, 0xA871EA, 0x49C266, 0x3DE064, 0x83DD97, 0x973FA3, +0xFD9443, 0x8C860D, 0xDE4131, 0x9D3992, 0x8C70DD, 0xE7B717, +0x3BDF08, 0x2B3715, 0xA0805C, 0x93805A, 0x921110, 0xD8E80F, +0xAF806C, 0x4BFFDB, 0x0F9038, 0x761859, 0x15A562, 0xBBCB61, +0xB989C7, 0xBD4010, 0x04F2D2, 0x277549, 0xF6B6EB, 0xBB22DB, +0xAA140A, 0x2F2689, 0x768364, 0x333B09, 0x1A940E, 0xAA3A51, +0xC2A31D, 0xAEEDAF, 0x12265C, 0x4DC26D, 0x9C7A2D, 0x9756C0, +0x833F03, 0xF6F009, 0x8C402B, 0x99316D, 0x07B439, 0x15200C, +0x5BC3D8, 0xC492F5, 0x4BADC6, 0xA5CA4E, 0xCD37A7, 0x36A9E6, +0x9492AB, 0x6842DD, 0xDE6319, 0xEF8C76, 0x528B68, 0x37DBFC, +0xABA1AE, 0x3115DF, 0xA1AE00, 0xDAFB0C, 0x664D64, 0xB705ED, +0x306529, 0xBF5657, 0x3AFF47, 0xB9F96A, 0xF3BE75, 0xDF9328, +0x3080AB, 0xF68C66, 0x15CB04, 0x0622FA, 0x1DE4D9, 0xA4B33D, +0x8F1B57, 0x09CD36, 0xE9424E, 0xA4BE13, 0xB52333, 0x1AAAF0, +0xA8654F, 0xA5C1D2, 0x0F3F0B, 0xCD785B, 0x76F923, 0x048B7B, +0x721789, 0x53A6C6, 0xE26E6F, 0x00EBEF, 0x584A9B, 0xB7DAC4, +0xBA66AA, 0xCFCF76, 0x1D02D1, 0x2DF1B1, 0xC1998C, 0x77ADC3, +0xDA4886, 0xA05DF7, 0xF480C6, 0x2FF0AC, 0x9AECDD, 0xBC5C3F, +0x6DDED0, 0x1FC790, 0xB6DB2A, 0x3A25A3, 0x9AAF00, 0x9353AD, +0x0457B6, 0xB42D29, 0x7E804B, 0xA707DA, 0x0EAA76, 0xA1597B, +0x2A1216, 0x2DB7DC, 0xFDE5FA, 0xFEDB89, 0xFDBE89, 0x6C76E4, +0xFCA906, 0x70803E, 0x156E85, 0xFF87FD, 0x073E28, 0x336761, +0x86182A, 0xEABD4D, 0xAFE7B3, 0x6E6D8F, 0x396795, 0x5BBF31, +0x48D784, 0x16DF30, 0x432DC7, 0x356125, 0xCE70C9, 0xB8CB30, +0xFD6CBF, 0xA200A4, 0xE46C05, 0xA0DD5A, 0x476F21, 0xD21262, +0x845CB9, 0x496170, 0xE0566B, 0x015299, 0x375550, 0xB7D51E, +0xC4F133, 0x5F6E13, 0xE4305D, 0xA92E85, 0xC3B21D, 0x3632A1, +0xA4B708, 0xD4B1EA, 0x21F716, 0xE4698F, 0x77FF27, 0x80030C, +0x2D408D, 0xA0CD4F, 0x99A520, 0xD3A2B3, 0x0A5D2F, 0x42F9B4, +0xCBDA11, 0xD0BE7D, 0xC1DB9B, 0xBD17AB, 0x81A2CA, 0x5C6A08, +0x17552E, 0x550027, 0xF0147F, 0x8607E1, 0x640B14, 0x8D4196, +0xDEBE87, 0x2AFDDA, 0xB6256B, 0x34897B, 0xFEF305, 0x9EBFB9, +0x4F6A68, 0xA82A4A, 0x5AC44F, 0xBCF82D, 0x985AD7, 0x95C7F4, +0x8D4D0D, 0xA63A20, 0x5F57A4, 0xB13F14, 0x953880, 0x0120CC, +0x86DD71, 0xB6DEC9, 0xF560BF, 0x11654D, 0x6B0701, 0xACB08C, +0xD0C0B2, 0x485551, 0x0EFB1E, 0xC37295, 0x3B06A3, 0x3540C0, +0x7BDC06, 0xCC45E0, 0xFA294E, 0xC8CAD6, 0x41F3E8, 0xDE647C, +0xD8649B, 0x31BED9, 0xC397A4, 0xD45877, 0xC5E369, 0x13DAF0, +0x3C3ABA, 0x461846, 0x5F7555, 0xF5BDD2, 0xC6926E, 0x5D2EAC, +0xED440E, 0x423E1C, 0x87C461, 0xE9FD29, 0xF3D6E7, 0xCA7C22, +0x35916F, 0xC5E008, 0x8DD7FF, 0xE26A6E, 0xC6FDB0, 0xC10893, +0x745D7C, 0xB2AD6B, 0x9D6ECD, 0x7B723E, 0x6A11C6, 0xA9CFF7, +0xDF7329, 0xBAC9B5, 0x5100B7, 0x0DB2E2, 0x24BA74, 0x607DE5, +0x8AD874, 0x2C150D, 0x0C1881, 0x94667E, 0x162901, 0x767A9F, +0xBEFDFD, 0xEF4556, 0x367ED9, 0x13D9EC, 0xB9BA8B, 0xFC97C4, +0x27A831, 0xC36EF1, 0x36C594, 0x56A8D8, 0xB5A8B4, 0x0ECCCF, +0x2D8912, 0x34576F, 0x89562C, 0xE3CE99, 0xB920D6, 0xAA5E6B, +0x9C2A3E, 0xCC5F11, 0x4A0BFD, 0xFBF4E1, 0x6D3B8E, 0x2C86E2, +0x84D4E9, 0xA9B4FC, 0xD1EEEF, 0xC9352E, 0x61392F, 0x442138, +0xC8D91B, 0x0AFC81, 0x6A4AFB, 0xD81C2F, 0x84B453, 0x8C994E, +0xCC2254, 0xDC552A, 0xD6C6C0, 0x96190B, 0xB8701A, 0x649569, +0x605A26, 0xEE523F, 0x0F117F, 0x11B5F4, 0xF5CBFC, 0x2DBC34, +0xEEBC34, 0xCC5DE8, 0x605EDD, 0x9B8E67, 0xEF3392, 0xB817C9, +0x9B5861, 0xBC57E1, 0xC68351, 0x103ED8, 0x4871DD, 0xDD1C2D, +0xA118AF, 0x462C21, 0xD7F359, 0x987AD9, 0xC0549E, 0xFA864F, +0xFC0656, 0xAE79E5, 0x362289, 0x22AD38, 0xDC9367, 0xAAE855, +0x382682, 0x9BE7CA, 0xA40D51, 0xB13399, 0x0ED7A9, 0x480569, +0xF0B265, 0xA7887F, 0x974C88, 0x36D1F9, 0xB39221, 0x4A827B, +0x21CF98, 0xDC9F40, 0x5547DC, 0x3A74E1, 0x42EB67, 0xDF9DFE, +0x5FD45E, 0xA4677B, 0x7AACBA, 0xA2F655, 0x23882B, 0x55BA41, +0x086E59, 0x862A21, 0x834739, 0xE6E389, 0xD49EE5, 0x40FB49, +0xE956FF, 0xCA0F1C, 0x8A59C5, 0x2BFA94, 0xC5C1D3, 0xCFC50F, +0xAE5ADB, 0x86C547, 0x624385, 0x3B8621, 0x94792C, 0x876110, +0x7B4C2A, 0x1A2C80, 0x12BF43, 0x902688, 0x893C78, 0xE4C4A8, +0x7BDBE5, 0xC23AC4, 0xEAF426, 0x8A67F7, 0xBF920D, 0x2BA365, +0xB1933D, 0x0B7CBD, 0xDC51A4, 0x63DD27, 0xDDE169, 0x19949A, +0x9529A8, 0x28CE68, 0xB4ED09, 0x209F44, 0xCA984E, 0x638270, +0x237C7E, 0x32B90F, 0x8EF5A7, 0xE75614, 0x08F121, 0x2A9DB5, +0x4D7E6F, 0x5119A5, 0xABF9B5, 0xD6DF82, 0x61DD96, 0x023616, +0x9F3AC4, 0xA1A283, 0x6DED72, 0x7A8D39, 0xA9B882, 0x5C326B, +0x5B2746, 0xED3400, 0x7700D2, 0x55F4FC, 0x4D5901, 0x8071E0, +#endif +}; + +static const double PIo2[] = { + 1.57079625129699707031e+00, /* 0x3FF921FB, 0x40000000 */ + 7.54978941586159635335e-08, /* 0x3E74442D, 0x00000000 */ + 5.39030252995776476554e-15, /* 0x3CF84698, 0x80000000 */ + 3.28200341580791294123e-22, /* 0x3B78CC51, 0x60000000 */ + 1.27065575308067607349e-29, /* 0x39F01B83, 0x80000000 */ + 1.22933308981111328932e-36, /* 0x387A2520, 0x40000000 */ + 2.73370053816464559624e-44, /* 0x36E38222, 0x80000000 */ + 2.16741683877804819444e-51, /* 0x3569F31D, 0x00000000 */ +}; + +int __rem_pio2_large(double *x, double *y, int e0, int nx, int prec) +{ + int32_t jz,jx,jv,jp,jk,carry,n,iq[20],i,j,k,m,q0,ih; + double z,fw,f[20],fq[20],q[20]; + + /* initialize jk*/ + jk = init_jk[prec]; + jp = jk; + + /* determine jx,jv,q0, note that 3>q0 */ + jx = nx-1; + jv = (e0-3)/24; if(jv<0) jv=0; + q0 = e0-24*(jv+1); + + /* set up f[0] to f[jx+jk] where f[jx+jk] = ipio2[jv+jk] */ + j = jv-jx; m = jx+jk; + for (i=0; i<=m; i++,j++) + f[i] = j<0 ? 0.0 : (double)ipio2[j]; + + /* compute q[0],q[1],...q[jk] */ + for (i=0; i<=jk; i++) { + for (j=0,fw=0.0; j<=jx; j++) + fw += x[j]*f[jx+i-j]; + q[i] = fw; + } + + jz = jk; +recompute: + /* distill q[] into iq[] reversingly */ + for (i=0,j=jz,z=q[jz]; j>0; i++,j--) { + fw = (double)(int32_t)(0x1p-24*z); + iq[i] = (int32_t)(z - 0x1p24*fw); + z = q[j-1]+fw; + } + + /* compute n */ + z = scalbn(z,q0); /* actual value of z */ + z -= 8.0*floor(z*0.125); /* trim off integer >= 8 */ + n = (int32_t)z; + z -= (double)n; + ih = 0; + if (q0 > 0) { /* need iq[jz-1] to determine n */ + i = iq[jz-1]>>(24-q0); n += i; + iq[jz-1] -= i<<(24-q0); + ih = iq[jz-1]>>(23-q0); + } + else if (q0 == 0) ih = iq[jz-1]>>23; + else if (z >= 0.5) ih = 2; + + if (ih > 0) { /* q > 0.5 */ + n += 1; carry = 0; + for (i=0; i<jz; i++) { /* compute 1-q */ + j = iq[i]; + if (carry == 0) { + if (j != 0) { + carry = 1; + iq[i] = 0x1000000 - j; + } + } else + iq[i] = 0xffffff - j; + } + if (q0 > 0) { /* rare case: chance is 1 in 12 */ + switch(q0) { + case 1: + iq[jz-1] &= 0x7fffff; break; + case 2: + iq[jz-1] &= 0x3fffff; break; + } + } + if (ih == 2) { + z = 1.0 - z; + if (carry != 0) + z -= scalbn(1.0,q0); + } + } + + /* check if recomputation is needed */ + if (z == 0.0) { + j = 0; + for (i=jz-1; i>=jk; i--) j |= iq[i]; + if (j == 0) { /* need recomputation */ + for (k=1; iq[jk-k]==0; k++); /* k = no. of terms needed */ + + for (i=jz+1; i<=jz+k; i++) { /* add q[jz+1] to q[jz+k] */ + f[jx+i] = (double)ipio2[jv+i]; + for (j=0,fw=0.0; j<=jx; j++) + fw += x[j]*f[jx+i-j]; + q[i] = fw; + } + jz += k; + goto recompute; + } + } + + /* chop off zero terms */ + if (z == 0.0) { + jz -= 1; + q0 -= 24; + while (iq[jz] == 0) { + jz--; + q0 -= 24; + } + } else { /* break z into 24-bit if necessary */ + z = scalbn(z,-q0); + if (z >= 0x1p24) { + fw = (double)(int32_t)(0x1p-24*z); + iq[jz] = (int32_t)(z - 0x1p24*fw); + jz += 1; + q0 += 24; + iq[jz] = (int32_t)fw; + } else + iq[jz] = (int32_t)z; + } + + /* convert integer "bit" chunk to floating-point value */ + fw = scalbn(1.0,q0); + for (i=jz; i>=0; i--) { + q[i] = fw*(double)iq[i]; + fw *= 0x1p-24; + } + + /* compute PIo2[0,...,jp]*q[jz,...,0] */ + for(i=jz; i>=0; i--) { + for (fw=0.0,k=0; k<=jp && k<=jz-i; k++) + fw += PIo2[k]*q[i+k]; + fq[jz-i] = fw; + } + + /* compress fq[] into y[] */ + switch(prec) { + case 0: + fw = 0.0; + for (i=jz; i>=0; i--) + fw += fq[i]; + y[0] = ih==0 ? fw : -fw; + break; + case 1: + case 2: + fw = 0.0; + for (i=jz; i>=0; i--) + fw += fq[i]; + // TODO: drop excess precision here once double_t is used + fw = (double)fw; + y[0] = ih==0 ? fw : -fw; + fw = fq[0]-fw; + for (i=1; i<=jz; i++) + fw += fq[i]; + y[1] = ih==0 ? fw : -fw; + break; + case 3: /* painful */ + for (i=jz; i>0; i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (i=jz; i>1; i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (fw=0.0,i=jz; i>=2; i--) + fw += fq[i]; + if (ih==0) { + y[0] = fq[0]; y[1] = fq[1]; y[2] = fw; + } else { + y[0] = -fq[0]; y[1] = -fq[1]; y[2] = -fw; + } + } + return n&7; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2f.c b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2f.c new file mode 100644 index 0000000..4473c1c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2f.c @@ -0,0 +1,75 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_rem_pio2f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Debugged and optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* __rem_pio2f(x,y) + * + * return the remainder of x rem pi/2 in *y + * use double precision for everything except passing x + * use __rem_pio2_large() for large x + */ + +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif + +/* + * invpio2: 53 bits of 2/pi + * pio2_1: first 25 bits of pi/2 + * pio2_1t: pi/2 - pio2_1 + */ +static const double +toint = 1.5/EPS, +invpio2 = 6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */ +pio2_1 = 1.57079631090164184570e+00, /* 0x3FF921FB, 0x50000000 */ +pio2_1t = 1.58932547735281966916e-08; /* 0x3E5110b4, 0x611A6263 */ + +int __rem_pio2f(float x, double *y) +{ + union {float f; uint32_t i;} u = {x}; + double tx[1],ty[1]; + double_t fn; + uint32_t ix; + int n, sign, e0; + + ix = u.i & 0x7fffffff; + /* 25+53 bit pi is good enough for medium size */ + if (ix < 0x4dc90fdb) { /* |x| ~< 2^28*(pi/2), medium size */ + /* Use a specialized rint() to get fn. Assume round-to-nearest. */ + fn = (double_t)x*invpio2 + toint - toint; + n = (int32_t)fn; + *y = x - fn*pio2_1 - fn*pio2_1t; + return n; + } + if(ix>=0x7f800000) { /* x is inf or NaN */ + *y = x-x; + return 0; + } + /* scale x into [2^23, 2^24-1] */ + sign = u.i>>31; + e0 = (ix>>23) - (0x7f+23); /* e0 = ilogb(|x|)-23, positive */ + u.i = ix - (e0<<23); + tx[0] = u.f; + n = __rem_pio2_large(tx,ty,e0,1,0); + if (sign) { + *y = -ty[0]; + return -n; + } + *y = ty[0]; + return n; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2l.c b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2l.c new file mode 100644 index 0000000..77255bd --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2l.c @@ -0,0 +1,141 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/e_rem_pio2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * Copyright (c) 2008 Steven G. Kargl, David Schultz, Bruce D. Evans. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + * Optimized by Bruce D. Evans. + */ +#include "libm.h" +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +/* ld80 and ld128 version of __rem_pio2(x,y) + * + * return the remainder of x rem pi/2 in y[0]+y[1] + * use __rem_pio2_large() for large x + */ + +static const long double toint = 1.5/LDBL_EPSILON; + +#if LDBL_MANT_DIG == 64 +/* u ~< 0x1p25*pi/2 */ +#define SMALL(u) (((u.i.se & 0x7fffU)<<16 | u.i.m>>48) < ((0x3fff + 25)<<16 | 0x921f>>1 | 0x8000)) +#define QUOBITS(x) ((uint32_t)(int32_t)x & 0x7fffffff) +#define ROUND1 22 +#define ROUND2 61 +#define NX 3 +#define NY 2 +/* + * invpio2: 64 bits of 2/pi + * pio2_1: first 39 bits of pi/2 + * pio2_1t: pi/2 - pio2_1 + * pio2_2: second 39 bits of pi/2 + * pio2_2t: pi/2 - (pio2_1+pio2_2) + * pio2_3: third 39 bits of pi/2 + * pio2_3t: pi/2 - (pio2_1+pio2_2+pio2_3) + */ +static const double +pio2_1 = 1.57079632679597125389e+00, /* 0x3FF921FB, 0x54444000 */ +pio2_2 = -1.07463465549783099519e-12, /* -0x12e7b967674000.0p-92 */ +pio2_3 = 6.36831716351370313614e-25; /* 0x18a2e037074000.0p-133 */ +static const long double +invpio2 = 6.36619772367581343076e-01L, /* 0xa2f9836e4e44152a.0p-64 */ +pio2_1t = -1.07463465549719416346e-12L, /* -0x973dcb3b399d747f.0p-103 */ +pio2_2t = 6.36831716351095013979e-25L, /* 0xc51701b839a25205.0p-144 */ +pio2_3t = -2.75299651904407171810e-37L; /* -0xbb5bf6c7ddd660ce.0p-185 */ +#elif LDBL_MANT_DIG == 113 +/* u ~< 0x1p45*pi/2 */ +#define SMALL(u) (((u.i.se & 0x7fffU)<<16 | u.i.top) < ((0x3fff + 45)<<16 | 0x921f)) +#define QUOBITS(x) ((uint32_t)(int64_t)x & 0x7fffffff) +#define ROUND1 51 +#define ROUND2 119 +#define NX 5 +#define NY 3 +static const long double +invpio2 = 6.3661977236758134307553505349005747e-01L, /* 0x145f306dc9c882a53f84eafa3ea6a.0p-113 */ +pio2_1 = 1.5707963267948966192292994253909555e+00L, /* 0x1921fb54442d18469800000000000.0p-112 */ +pio2_1t = 2.0222662487959507323996846200947577e-21L, /* 0x13198a2e03707344a4093822299f3.0p-181 */ +pio2_2 = 2.0222662487959507323994779168837751e-21L, /* 0x13198a2e03707344a400000000000.0p-181 */ +pio2_2t = 2.0670321098263988236496903051604844e-43L, /* 0x127044533e63a0105df531d89cd91.0p-254 */ +pio2_3 = 2.0670321098263988236499468110329591e-43L, /* 0x127044533e63a0105e00000000000.0p-254 */ +pio2_3t = -2.5650587247459238361625433492959285e-65L; /* -0x159c4ec64ddaeb5f78671cbfb2210.0p-327 */ +#endif + +int __rem_pio2l(long double x, long double *y) +{ + union ldshape u,uz; + long double z,w,t,r,fn; + double tx[NX],ty[NY]; + int ex,ey,n,i; + + u.f = x; + ex = u.i.se & 0x7fff; + if (SMALL(u)) { + /* rint(x/(pi/2)), Assume round-to-nearest. */ + fn = x*invpio2 + toint - toint; + n = QUOBITS(fn); + r = x-fn*pio2_1; + w = fn*pio2_1t; /* 1st round good to 102/180 bits (ld80/ld128) */ + y[0] = r-w; + u.f = y[0]; + ey = u.i.se & 0x7fff; + if (ex - ey > ROUND1) { /* 2nd iteration needed, good to 141/248 (ld80/ld128) */ + t = r; + w = fn*pio2_2; + r = t-w; + w = fn*pio2_2t-((t-r)-w); + y[0] = r-w; + u.f = y[0]; + ey = u.i.se & 0x7fff; + if (ex - ey > ROUND2) { /* 3rd iteration, good to 180/316 bits */ + t = r; /* will cover all possible cases (not verified for ld128) */ + w = fn*pio2_3; + r = t-w; + w = fn*pio2_3t-((t-r)-w); + y[0] = r-w; + } + } + y[1] = (r - y[0]) - w; + return n; + } + /* + * all other (large) arguments + */ + if (ex == 0x7fff) { /* x is inf or NaN */ + y[0] = y[1] = x - x; + return 0; + } + /* set z = scalbn(|x|,-ilogb(x)+23) */ + uz.f = x; + uz.i.se = 0x3fff + 23; + z = uz.f; + for (i=0; i < NX - 1; i++) { + tx[i] = (double)(int32_t)z; + z = (z-tx[i])*0x1p24; + } + tx[i] = z; + while (tx[i] == 0) + i--; + n = __rem_pio2_large(tx, ty, ex-0x3fff-23, i+1, NY); + w = ty[1]; + if (NY == 3) + w += ty[2]; + r = ty[0] + w; + /* TODO: for ld128 this does not follow the recommendation of the + comments of __rem_pio2_large which seem wrong if |ty[0]| > |ty[1]+ty[2]| */ + w -= r - ty[0]; + if (u.i.se >> 15) { + y[0] = -r; + y[1] = -w; + return -n; + } + y[0] = r; + y[1] = w; + return n; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__signbit.c b/lib/mlibc/options/ansi/musl-generic-math/__signbit.c new file mode 100644 index 0000000..e700b6b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__signbit.c @@ -0,0 +1,13 @@ +#include "libm.h" + +// FIXME: macro in math.h +int __signbit(double x) +{ + union { + double d; + uint64_t i; + } y = { x }; + return y.i>>63; +} + + diff --git a/lib/mlibc/options/ansi/musl-generic-math/__signbitf.c b/lib/mlibc/options/ansi/musl-generic-math/__signbitf.c new file mode 100644 index 0000000..40ad3cf --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__signbitf.c @@ -0,0 +1,11 @@ +#include "libm.h" + +// FIXME: macro in math.h +int __signbitf(float x) +{ + union { + float f; + uint32_t i; + } y = { x }; + return y.i>>31; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__signbitl.c b/lib/mlibc/options/ansi/musl-generic-math/__signbitl.c new file mode 100644 index 0000000..63b3dc5 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__signbitl.c @@ -0,0 +1,14 @@ +#include "libm.h" + +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +int __signbitl(long double x) +{ + union ldshape u = {x}; + return u.i.se >> 15; +} +#elif LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +int __signbitl(long double x) +{ + return __signbit(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__sin.c b/lib/mlibc/options/ansi/musl-generic-math/__sin.c new file mode 100644 index 0000000..4030949 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__sin.c @@ -0,0 +1,64 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_sin.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* __sin( x, y, iy) + * kernel sin function on ~[-pi/4, pi/4] (except on -0), pi/4 ~ 0.7854 + * Input x is assumed to be bounded by ~pi/4 in magnitude. + * Input y is the tail of x. + * Input iy indicates whether y is 0. (if iy=0, y assume to be 0). + * + * Algorithm + * 1. Since sin(-x) = -sin(x), we need only to consider positive x. + * 2. Callers must return sin(-0) = -0 without calling here since our + * odd polynomial is not evaluated in a way that preserves -0. + * Callers may do the optimization sin(x) ~ x for tiny x. + * 3. sin(x) is approximated by a polynomial of degree 13 on + * [0,pi/4] + * 3 13 + * sin(x) ~ x + S1*x + ... + S6*x + * where + * + * |sin(x) 2 4 6 8 10 12 | -58 + * |----- - (1+S1*x +S2*x +S3*x +S4*x +S5*x +S6*x )| <= 2 + * | x | + * + * 4. sin(x+y) = sin(x) + sin'(x')*y + * ~ sin(x) + (1-x*x/2)*y + * For better accuracy, let + * 3 2 2 2 2 + * r = x *(S2+x *(S3+x *(S4+x *(S5+x *S6)))) + * then 3 2 + * sin(x) = x + (S1*x + (x *(r-y/2)+y)) + */ + +#include "libm.h" + +static const double +S1 = -1.66666666666666324348e-01, /* 0xBFC55555, 0x55555549 */ +S2 = 8.33333333332248946124e-03, /* 0x3F811111, 0x1110F8A6 */ +S3 = -1.98412698298579493134e-04, /* 0xBF2A01A0, 0x19C161D5 */ +S4 = 2.75573137070700676789e-06, /* 0x3EC71DE3, 0x57B1FE7D */ +S5 = -2.50507602534068634195e-08, /* 0xBE5AE5E6, 0x8A2B9CEB */ +S6 = 1.58969099521155010221e-10; /* 0x3DE5D93A, 0x5ACFD57C */ + +double __sin(double x, double y, int iy) +{ + double_t z,r,v,w; + + z = x*x; + w = z*z; + r = S2 + z*(S3 + z*S4) + z*w*(S5 + z*S6); + v = z*x; + if (iy == 0) + return x + v*(S1 + z*r); + else + return x - ((z*(0.5*y - v*r) - y) - v*S1); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__sindf.c b/lib/mlibc/options/ansi/musl-generic-math/__sindf.c new file mode 100644 index 0000000..8fec2a3 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__sindf.c @@ -0,0 +1,36 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_sinf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* |sin(x)/x - s(x)| < 2**-37.5 (~[-4.89e-12, 4.824e-12]). */ +static const double +S1 = -0x15555554cbac77.0p-55, /* -0.166666666416265235595 */ +S2 = 0x111110896efbb2.0p-59, /* 0.0083333293858894631756 */ +S3 = -0x1a00f9e2cae774.0p-65, /* -0.000198393348360966317347 */ +S4 = 0x16cd878c3b46a7.0p-71; /* 0.0000027183114939898219064 */ + +float __sindf(double x) +{ + double_t r, s, w, z; + + /* Try to optimize for parallel evaluation as in __tandf.c. */ + z = x*x; + w = z*z; + r = S3 + z*S4; + s = z*x; + return (x + s*(S1 + z*S2)) + s*w*r; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__sinl.c b/lib/mlibc/options/ansi/musl-generic-math/__sinl.c new file mode 100644 index 0000000..2525bbe --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__sinl.c @@ -0,0 +1,78 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/k_sinl.c */ +/* origin: FreeBSD /usr/src/lib/msun/ld128/k_sinl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * Copyright (c) 2008 Steven G. Kargl, David Schultz, Bruce D. Evans. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#if LDBL_MANT_DIG == 64 +/* + * ld80 version of __sin.c. See __sin.c for most comments. + */ +/* + * Domain [-0.7854, 0.7854], range ~[-1.89e-22, 1.915e-22] + * |sin(x)/x - s(x)| < 2**-72.1 + * + * See __cosl.c for more details about the polynomial. + */ +static const long double +S1 = -0.166666666666666666671L; /* -0xaaaaaaaaaaaaaaab.0p-66 */ +static const double +S2 = 0.0083333333333333332, /* 0x11111111111111.0p-59 */ +S3 = -0.00019841269841269427, /* -0x1a01a01a019f81.0p-65 */ +S4 = 0.0000027557319223597490, /* 0x171de3a55560f7.0p-71 */ +S5 = -0.000000025052108218074604, /* -0x1ae64564f16cad.0p-78 */ +S6 = 1.6059006598854211e-10, /* 0x161242b90243b5.0p-85 */ +S7 = -7.6429779983024564e-13, /* -0x1ae42ebd1b2e00.0p-93 */ +S8 = 2.6174587166648325e-15; /* 0x179372ea0b3f64.0p-101 */ +#define POLY(z) (S2+z*(S3+z*(S4+z*(S5+z*(S6+z*(S7+z*S8)))))) +#elif LDBL_MANT_DIG == 113 +/* + * ld128 version of __sin.c. See __sin.c for most comments. + */ +/* + * Domain [-0.7854, 0.7854], range ~[-1.53e-37, 1.659e-37] + * |sin(x)/x - s(x)| < 2**-122.1 + * + * See __cosl.c for more details about the polynomial. + */ +static const long double +S1 = -0.16666666666666666666666666666666666606732416116558L, +S2 = 0.0083333333333333333333333333333331135404851288270047L, +S3 = -0.00019841269841269841269841269839935785325638310428717L, +S4 = 0.27557319223985890652557316053039946268333231205686e-5L, +S5 = -0.25052108385441718775048214826384312253862930064745e-7L, +S6 = 0.16059043836821614596571832194524392581082444805729e-9L, +S7 = -0.76471637318198151807063387954939213287488216303768e-12L, +S8 = 0.28114572543451292625024967174638477283187397621303e-14L; +static const double +S9 = -0.82206352458348947812512122163446202498005154296863e-17, +S10 = 0.19572940011906109418080609928334380560135358385256e-19, +S11 = -0.38680813379701966970673724299207480965452616911420e-22, +S12 = 0.64038150078671872796678569586315881020659912139412e-25; +#define POLY(z) (S2+z*(S3+z*(S4+z*(S5+z*(S6+z*(S7+z*(S8+ \ + z*(S9+z*(S10+z*(S11+z*S12)))))))))) +#endif + +long double __sinl(long double x, long double y, int iy) +{ + long double z,r,v; + + z = x*x; + v = z*x; + r = POLY(z); + if (iy == 0) + return x+v*(S1+z*r); + return x-((z*(0.5*y-v*r)-y)-v*S1); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__tan.c b/lib/mlibc/options/ansi/musl-generic-math/__tan.c new file mode 100644 index 0000000..8019844 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__tan.c @@ -0,0 +1,110 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_tan.c */ +/* + * ==================================================== + * Copyright 2004 Sun Microsystems, Inc. All Rights Reserved. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* __tan( x, y, k ) + * kernel tan function on ~[-pi/4, pi/4] (except on -0), pi/4 ~ 0.7854 + * Input x is assumed to be bounded by ~pi/4 in magnitude. + * Input y is the tail of x. + * Input odd indicates whether tan (if odd = 0) or -1/tan (if odd = 1) is returned. + * + * Algorithm + * 1. Since tan(-x) = -tan(x), we need only to consider positive x. + * 2. Callers must return tan(-0) = -0 without calling here since our + * odd polynomial is not evaluated in a way that preserves -0. + * Callers may do the optimization tan(x) ~ x for tiny x. + * 3. tan(x) is approximated by a odd polynomial of degree 27 on + * [0,0.67434] + * 3 27 + * tan(x) ~ x + T1*x + ... + T13*x + * where + * + * |tan(x) 2 4 26 | -59.2 + * |----- - (1+T1*x +T2*x +.... +T13*x )| <= 2 + * | x | + * + * Note: tan(x+y) = tan(x) + tan'(x)*y + * ~ tan(x) + (1+x*x)*y + * Therefore, for better accuracy in computing tan(x+y), let + * 3 2 2 2 2 + * r = x *(T2+x *(T3+x *(...+x *(T12+x *T13)))) + * then + * 3 2 + * tan(x+y) = x + (T1*x + (x *(r+y)+y)) + * + * 4. For x in [0.67434,pi/4], let y = pi/4 - x, then + * tan(x) = tan(pi/4-y) = (1-tan(y))/(1+tan(y)) + * = 1 - 2*(tan(y) - (tan(y)^2)/(1+tan(y))) + */ + +#include "libm.h" + +static const double T[] = { + 3.33333333333334091986e-01, /* 3FD55555, 55555563 */ + 1.33333333333201242699e-01, /* 3FC11111, 1110FE7A */ + 5.39682539762260521377e-02, /* 3FABA1BA, 1BB341FE */ + 2.18694882948595424599e-02, /* 3F9664F4, 8406D637 */ + 8.86323982359930005737e-03, /* 3F8226E3, E96E8493 */ + 3.59207910759131235356e-03, /* 3F6D6D22, C9560328 */ + 1.45620945432529025516e-03, /* 3F57DBC8, FEE08315 */ + 5.88041240820264096874e-04, /* 3F4344D8, F2F26501 */ + 2.46463134818469906812e-04, /* 3F3026F7, 1A8D1068 */ + 7.81794442939557092300e-05, /* 3F147E88, A03792A6 */ + 7.14072491382608190305e-05, /* 3F12B80F, 32F0A7E9 */ + -1.85586374855275456654e-05, /* BEF375CB, DB605373 */ + 2.59073051863633712884e-05, /* 3EFB2A70, 74BF7AD4 */ +}, +pio4 = 7.85398163397448278999e-01, /* 3FE921FB, 54442D18 */ +pio4lo = 3.06161699786838301793e-17; /* 3C81A626, 33145C07 */ + +double __tan(double x, double y, int odd) +{ + double_t z, r, v, w, s, a; + double w0, a0; + uint32_t hx; + int big, sign; + + GET_HIGH_WORD(hx,x); + big = (hx&0x7fffffff) >= 0x3FE59428; /* |x| >= 0.6744 */ + if (big) { + sign = hx>>31; + if (sign) { + x = -x; + y = -y; + } + x = (pio4 - x) + (pio4lo - y); + y = 0.0; + } + z = x * x; + w = z * z; + /* + * Break x^5*(T[1]+x^2*T[2]+...) into + * x^5(T[1]+x^4*T[3]+...+x^20*T[11]) + + * x^5(x^2*(T[2]+x^4*T[4]+...+x^22*[T12])) + */ + r = T[1] + w*(T[3] + w*(T[5] + w*(T[7] + w*(T[9] + w*T[11])))); + v = z*(T[2] + w*(T[4] + w*(T[6] + w*(T[8] + w*(T[10] + w*T[12]))))); + s = z * x; + r = y + z*(s*(r + v) + y) + s*T[0]; + w = x + r; + if (big) { + s = 1 - 2*odd; + v = s - 2.0 * (x + (r - w*w/(w + s))); + return sign ? -v : v; + } + if (!odd) + return w; + /* -1.0/(x+r) has up to 2ulp error, so compute it accurately */ + w0 = w; + SET_LOW_WORD(w0, 0); + v = r - (w0 - x); /* w0+v = r+x */ + a0 = a = -1.0 / w; + SET_LOW_WORD(a0, 0); + return a0 + a*(1.0 + a0*w0 + a0*v); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__tandf.c b/lib/mlibc/options/ansi/musl-generic-math/__tandf.c new file mode 100644 index 0000000..25047ee --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__tandf.c @@ -0,0 +1,54 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_tanf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright 2004 Sun Microsystems, Inc. All Rights Reserved. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* |tan(x)/x - t(x)| < 2**-25.5 (~[-2e-08, 2e-08]). */ +static const double T[] = { + 0x15554d3418c99f.0p-54, /* 0.333331395030791399758 */ + 0x1112fd38999f72.0p-55, /* 0.133392002712976742718 */ + 0x1b54c91d865afe.0p-57, /* 0.0533812378445670393523 */ + 0x191df3908c33ce.0p-58, /* 0.0245283181166547278873 */ + 0x185dadfcecf44e.0p-61, /* 0.00297435743359967304927 */ + 0x1362b9bf971bcd.0p-59, /* 0.00946564784943673166728 */ +}; + +float __tandf(double x, int odd) +{ + double_t z,r,w,s,t,u; + + z = x*x; + /* + * Split up the polynomial into small independent terms to give + * opportunities for parallel evaluation. The chosen splitting is + * micro-optimized for Athlons (XP, X64). It costs 2 multiplications + * relative to Horner's method on sequential machines. + * + * We add the small terms from lowest degree up for efficiency on + * non-sequential machines (the lowest degree terms tend to be ready + * earlier). Apart from this, we don't care about order of + * operations, and don't need to to care since we have precision to + * spare. However, the chosen splitting is good for accuracy too, + * and would give results as accurate as Horner's method if the + * small terms were added from highest degree down. + */ + r = T[4] + z*T[5]; + t = T[2] + z*T[3]; + w = z*z; + s = z*x; + u = T[0] + z*T[1]; + r = (x + s*u) + (s*w)*(t + w*r); + return odd ? -1.0/r : r; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__tanl.c b/lib/mlibc/options/ansi/musl-generic-math/__tanl.c new file mode 100644 index 0000000..54abc3d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__tanl.c @@ -0,0 +1,143 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/k_tanl.c */ +/* origin: FreeBSD /usr/src/lib/msun/ld128/k_tanl.c */ +/* + * ==================================================== + * Copyright 2004 Sun Microsystems, Inc. All Rights Reserved. + * Copyright (c) 2008 Steven G. Kargl, David Schultz, Bruce D. Evans. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#if LDBL_MANT_DIG == 64 +/* + * ld80 version of __tan.c. See __tan.c for most comments. + */ +/* + * Domain [-0.67434, 0.67434], range ~[-2.25e-22, 1.921e-22] + * |tan(x)/x - t(x)| < 2**-71.9 + * + * See __cosl.c for more details about the polynomial. + */ +static const long double +T3 = 0.333333333333333333180L, /* 0xaaaaaaaaaaaaaaa5.0p-65 */ +T5 = 0.133333333333333372290L, /* 0x88888888888893c3.0p-66 */ +T7 = 0.0539682539682504975744L, /* 0xdd0dd0dd0dc13ba2.0p-68 */ +pio4 = 0.785398163397448309628L, /* 0xc90fdaa22168c235.0p-64 */ +pio4lo = -1.25413940316708300586e-20L; /* -0xece675d1fc8f8cbb.0p-130 */ +static const double +T9 = 0.021869488536312216, /* 0x1664f4882cc1c2.0p-58 */ +T11 = 0.0088632355256619590, /* 0x1226e355c17612.0p-59 */ +T13 = 0.0035921281113786528, /* 0x1d6d3d185d7ff8.0p-61 */ +T15 = 0.0014558334756312418, /* 0x17da354aa3f96b.0p-62 */ +T17 = 0.00059003538700862256, /* 0x13559358685b83.0p-63 */ +T19 = 0.00023907843576635544, /* 0x1f56242026b5be.0p-65 */ +T21 = 0.000097154625656538905, /* 0x1977efc26806f4.0p-66 */ +T23 = 0.000038440165747303162, /* 0x14275a09b3ceac.0p-67 */ +T25 = 0.000018082171885432524, /* 0x12f5e563e5487e.0p-68 */ +T27 = 0.0000024196006108814377, /* 0x144c0d80cc6896.0p-71 */ +T29 = 0.0000078293456938132840, /* 0x106b59141a6cb3.0p-69 */ +T31 = -0.0000032609076735050182, /* -0x1b5abef3ba4b59.0p-71 */ +T33 = 0.0000023261313142559411; /* 0x13835436c0c87f.0p-71 */ +#define RPOLY(w) (T5 + w * (T9 + w * (T13 + w * (T17 + w * (T21 + \ + w * (T25 + w * (T29 + w * T33))))))) +#define VPOLY(w) (T7 + w * (T11 + w * (T15 + w * (T19 + w * (T23 + \ + w * (T27 + w * T31)))))) +#elif LDBL_MANT_DIG == 113 +/* + * ld128 version of __tan.c. See __tan.c for most comments. + */ +/* + * Domain [-0.67434, 0.67434], range ~[-3.37e-36, 1.982e-37] + * |tan(x)/x - t(x)| < 2**-117.8 (XXX should be ~1e-37) + * + * See __cosl.c for more details about the polynomial. + */ +static const long double +T3 = 0x1.5555555555555555555555555553p-2L, +T5 = 0x1.1111111111111111111111111eb5p-3L, +T7 = 0x1.ba1ba1ba1ba1ba1ba1ba1b694cd6p-5L, +T9 = 0x1.664f4882c10f9f32d6bbe09d8bcdp-6L, +T11 = 0x1.226e355e6c23c8f5b4f5762322eep-7L, +T13 = 0x1.d6d3d0e157ddfb5fed8e84e27b37p-9L, +T15 = 0x1.7da36452b75e2b5fce9ee7c2c92ep-10L, +T17 = 0x1.355824803674477dfcf726649efep-11L, +T19 = 0x1.f57d7734d1656e0aceb716f614c2p-13L, +T21 = 0x1.967e18afcb180ed942dfdc518d6cp-14L, +T23 = 0x1.497d8eea21e95bc7e2aa79b9f2cdp-15L, +T25 = 0x1.0b132d39f055c81be49eff7afd50p-16L, +T27 = 0x1.b0f72d33eff7bfa2fbc1059d90b6p-18L, +T29 = 0x1.5ef2daf21d1113df38d0fbc00267p-19L, +T31 = 0x1.1c77d6eac0234988cdaa04c96626p-20L, +T33 = 0x1.cd2a5a292b180e0bdd701057dfe3p-22L, +T35 = 0x1.75c7357d0298c01a31d0a6f7d518p-23L, +T37 = 0x1.2f3190f4718a9a520f98f50081fcp-24L, +pio4 = 0x1.921fb54442d18469898cc51701b8p-1L, +pio4lo = 0x1.cd129024e088a67cc74020bbea60p-116L; +static const double +T39 = 0.000000028443389121318352, /* 0x1e8a7592977938.0p-78 */ +T41 = 0.000000011981013102001973, /* 0x19baa1b1223219.0p-79 */ +T43 = 0.0000000038303578044958070, /* 0x107385dfb24529.0p-80 */ +T45 = 0.0000000034664378216909893, /* 0x1dc6c702a05262.0p-81 */ +T47 = -0.0000000015090641701997785, /* -0x19ecef3569ebb6.0p-82 */ +T49 = 0.0000000029449552300483952, /* 0x194c0668da786a.0p-81 */ +T51 = -0.0000000022006995706097711, /* -0x12e763b8845268.0p-81 */ +T53 = 0.0000000015468200913196612, /* 0x1a92fc98c29554.0p-82 */ +T55 = -0.00000000061311613386849674, /* -0x151106cbc779a9.0p-83 */ +T57 = 1.4912469681508012e-10; /* 0x147edbdba6f43a.0p-85 */ +#define RPOLY(w) (T5 + w * (T9 + w * (T13 + w * (T17 + w * (T21 + \ + w * (T25 + w * (T29 + w * (T33 + w * (T37 + w * (T41 + \ + w * (T45 + w * (T49 + w * (T53 + w * T57))))))))))))) +#define VPOLY(w) (T7 + w * (T11 + w * (T15 + w * (T19 + w * (T23 + \ + w * (T27 + w * (T31 + w * (T35 + w * (T39 + w * (T43 + \ + w * (T47 + w * (T51 + w * T55)))))))))))) +#endif + +long double __tanl(long double x, long double y, int odd) { + long double z, r, v, w, s, a, t; + int big, sign; + + big = fabsl(x) >= 0.67434; + if (big) { + sign = 0; + if (x < 0) { + sign = 1; + x = -x; + y = -y; + } + x = (pio4 - x) + (pio4lo - y); + y = 0.0; + } + z = x * x; + w = z * z; + r = RPOLY(w); + v = z * VPOLY(w); + s = z * x; + r = y + z * (s * (r + v) + y) + T3 * s; + w = x + r; + if (big) { + s = 1 - 2*odd; + v = s - 2.0 * (x + (r - w * w / (w + s))); + return sign ? -v : v; + } + if (!odd) + return w; + /* + * if allow error up to 2 ulp, simply return + * -1.0 / (x+r) here + */ + /* compute -1.0 / (x+r) accurately */ + z = w; + z = z + 0x1p32 - 0x1p32; + v = r - (z - x); /* z+v = r+x */ + t = a = -1.0 / w; /* a = -1.0/w */ + t = t + 0x1p32 - 0x1p32; + s = 1.0 + t * z; + return t + a * (s + t * v); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/acos.c b/lib/mlibc/options/ansi/musl-generic-math/acos.c new file mode 100644 index 0000000..ea9c87b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/acos.c @@ -0,0 +1,101 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_acos.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* acos(x) + * Method : + * acos(x) = pi/2 - asin(x) + * acos(-x) = pi/2 + asin(x) + * For |x|<=0.5 + * acos(x) = pi/2 - (x + x*x^2*R(x^2)) (see asin.c) + * For x>0.5 + * acos(x) = pi/2 - (pi/2 - 2asin(sqrt((1-x)/2))) + * = 2asin(sqrt((1-x)/2)) + * = 2s + 2s*z*R(z) ...z=(1-x)/2, s=sqrt(z) + * = 2f + (2c + 2s*z*R(z)) + * where f=hi part of s, and c = (z-f*f)/(s+f) is the correction term + * for f so that f+c ~ sqrt(z). + * For x<-0.5 + * acos(x) = pi - 2asin(sqrt((1-|x|)/2)) + * = pi - 0.5*(s+s*z*R(z)), where z=(1-|x|)/2,s=sqrt(z) + * + * Special cases: + * if x is NaN, return x itself; + * if |x|>1, return NaN with invalid signal. + * + * Function needed: sqrt + */ + +#include "libm.h" + +static const double +pio2_hi = 1.57079632679489655800e+00, /* 0x3FF921FB, 0x54442D18 */ +pio2_lo = 6.12323399573676603587e-17, /* 0x3C91A626, 0x33145C07 */ +pS0 = 1.66666666666666657415e-01, /* 0x3FC55555, 0x55555555 */ +pS1 = -3.25565818622400915405e-01, /* 0xBFD4D612, 0x03EB6F7D */ +pS2 = 2.01212532134862925881e-01, /* 0x3FC9C155, 0x0E884455 */ +pS3 = -4.00555345006794114027e-02, /* 0xBFA48228, 0xB5688F3B */ +pS4 = 7.91534994289814532176e-04, /* 0x3F49EFE0, 0x7501B288 */ +pS5 = 3.47933107596021167570e-05, /* 0x3F023DE1, 0x0DFDF709 */ +qS1 = -2.40339491173441421878e+00, /* 0xC0033A27, 0x1C8A2D4B */ +qS2 = 2.02094576023350569471e+00, /* 0x40002AE5, 0x9C598AC8 */ +qS3 = -6.88283971605453293030e-01, /* 0xBFE6066C, 0x1B8D0159 */ +qS4 = 7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */ + +static double R(double z) +{ + double_t p, q; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5))))); + q = 1.0+z*(qS1+z*(qS2+z*(qS3+z*qS4))); + return p/q; +} + +double acos(double x) +{ + double z,w,s,c,df; + uint32_t hx,ix; + + GET_HIGH_WORD(hx, x); + ix = hx & 0x7fffffff; + /* |x| >= 1 or nan */ + if (ix >= 0x3ff00000) { + uint32_t lx; + + GET_LOW_WORD(lx,x); + if ((ix-0x3ff00000 | lx) == 0) { + /* acos(1)=0, acos(-1)=pi */ + if (hx >> 31) + return 2*pio2_hi + 0x1p-120f; + return 0; + } + return 0/(x-x); + } + /* |x| < 0.5 */ + if (ix < 0x3fe00000) { + if (ix <= 0x3c600000) /* |x| < 2**-57 */ + return pio2_hi + 0x1p-120f; + return pio2_hi - (x - (pio2_lo-x*R(x*x))); + } + /* x < -0.5 */ + if (hx >> 31) { + z = (1.0+x)*0.5; + s = sqrt(z); + w = R(z)*s-pio2_lo; + return 2*(pio2_hi - (s+w)); + } + /* x > 0.5 */ + z = (1.0-x)*0.5; + s = sqrt(z); + df = s; + SET_LOW_WORD(df,0); + c = (z-df*df)/(s+df); + w = R(z)*s+c; + return 2*(df+w); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/acosf.c b/lib/mlibc/options/ansi/musl-generic-math/acosf.c new file mode 100644 index 0000000..8ee1a71 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/acosf.c @@ -0,0 +1,71 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_acosf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +pio2_hi = 1.5707962513e+00, /* 0x3fc90fda */ +pio2_lo = 7.5497894159e-08, /* 0x33a22168 */ +pS0 = 1.6666586697e-01, +pS1 = -4.2743422091e-02, +pS2 = -8.6563630030e-03, +qS1 = -7.0662963390e-01; + +static float R(float z) +{ + float_t p, q; + p = z*(pS0+z*(pS1+z*pS2)); + q = 1.0f+z*qS1; + return p/q; +} + +float acosf(float x) +{ + float z,w,s,c,df; + uint32_t hx,ix; + + GET_FLOAT_WORD(hx, x); + ix = hx & 0x7fffffff; + /* |x| >= 1 or nan */ + if (ix >= 0x3f800000) { + if (ix == 0x3f800000) { + if (hx >> 31) + return 2*pio2_hi + 0x1p-120f; + return 0; + } + return 0/(x-x); + } + /* |x| < 0.5 */ + if (ix < 0x3f000000) { + if (ix <= 0x32800000) /* |x| < 2**-26 */ + return pio2_hi + 0x1p-120f; + return pio2_hi - (x - (pio2_lo-x*R(x*x))); + } + /* x < -0.5 */ + if (hx >> 31) { + z = (1+x)*0.5f; + s = sqrtf(z); + w = R(z)*s-pio2_lo; + return 2*(pio2_hi - (s+w)); + } + /* x > 0.5 */ + z = (1-x)*0.5f; + s = sqrtf(z); + GET_FLOAT_WORD(hx,s); + SET_FLOAT_WORD(df,hx&0xfffff000); + c = (z-df*df)/(s+df); + w = R(z)*s+c; + return 2*(df+w); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/acosh.c b/lib/mlibc/options/ansi/musl-generic-math/acosh.c new file mode 100644 index 0000000..badbf90 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/acosh.c @@ -0,0 +1,24 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==2 +#undef sqrt +#define sqrt sqrtl +#endif + +/* acosh(x) = log(x + sqrt(x*x-1)) */ +double acosh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + unsigned e = u.i >> 52 & 0x7ff; + + /* x < 1 domain error is handled in the called functions */ + + if (e < 0x3ff + 1) + /* |x| < 2, up to 2ulp error in [1,1.125] */ + return log1p(x-1 + sqrt((x-1)*(x-1)+2*(x-1))); + if (e < 0x3ff + 26) + /* |x| < 0x1p26 */ + return log(2*x - 1/(x+sqrt(x*x-1))); + /* |x| >= 0x1p26 or nan */ + return log(x) + 0.693147180559945309417232121458176568; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/acoshf.c b/lib/mlibc/options/ansi/musl-generic-math/acoshf.c new file mode 100644 index 0000000..8a4ec4d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/acoshf.c @@ -0,0 +1,26 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==2 +#undef sqrtf +#define sqrtf sqrtl +#elif FLT_EVAL_METHOD==1 +#undef sqrtf +#define sqrtf sqrt +#endif + +/* acosh(x) = log(x + sqrt(x*x-1)) */ +float acoshf(float x) +{ + union {float f; uint32_t i;} u = {x}; + uint32_t a = u.i & 0x7fffffff; + + if (a < 0x3f800000+(1<<23)) + /* |x| < 2, invalid if x < 1 or nan */ + /* up to 2ulp error in [1,1.125] */ + return log1pf(x-1 + sqrtf((x-1)*(x-1)+2*(x-1))); + if (a < 0x3f800000+(12<<23)) + /* |x| < 0x1p12 */ + return logf(2*x - 1/(x+sqrtf(x*x-1))); + /* x >= 0x1p12 */ + return logf(x) + 0.693147180559945309417232121458176568f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/acoshl.c b/lib/mlibc/options/ansi/musl-generic-math/acoshl.c new file mode 100644 index 0000000..8d4b43f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/acoshl.c @@ -0,0 +1,29 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double acoshl(long double x) +{ + return acosh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* acosh(x) = log(x + sqrt(x*x-1)) */ +long double acoshl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + + if (e < 0x3fff + 1) + /* |x| < 2, invalid if x < 1 or nan */ + return log1pl(x-1 + sqrtl((x-1)*(x-1)+2*(x-1))); + if (e < 0x3fff + 32) + /* |x| < 0x1p32 */ + return logl(2*x - 1/(x+sqrtl(x*x-1))); + return logl(x) + 0.693147180559945309417232121458176568L; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double acoshl(long double x) +{ + return acosh(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/acosl.c b/lib/mlibc/options/ansi/musl-generic-math/acosl.c new file mode 100644 index 0000000..c03bdf0 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/acosl.c @@ -0,0 +1,67 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_acosl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in acos.c. + * Converted to long double by David Schultz <das@FreeBSD.ORG>. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double acosl(long double x) +{ + return acos(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#include "__invtrigl.h" +#if LDBL_MANT_DIG == 64 +#define CLEARBOTTOM(u) (u.i.m &= -1ULL << 32) +#elif LDBL_MANT_DIG == 113 +#define CLEARBOTTOM(u) (u.i.lo = 0) +#endif + +long double acosl(long double x) +{ + union ldshape u = {x}; + long double z, s, c, f; + uint16_t e = u.i.se & 0x7fff; + + /* |x| >= 1 or nan */ + if (e >= 0x3fff) { + if (x == 1) + return 0; + if (x == -1) + return 2*pio2_hi + 0x1p-120f; + return 0/(x-x); + } + /* |x| < 0.5 */ + if (e < 0x3fff - 1) { + if (e < 0x3fff - LDBL_MANT_DIG - 1) + return pio2_hi + 0x1p-120f; + return pio2_hi - (__invtrigl_R(x*x)*x - pio2_lo + x); + } + /* x < -0.5 */ + if (u.i.se >> 15) { + z = (1 + x)*0.5; + s = sqrtl(z); + return 2*(pio2_hi - (__invtrigl_R(z)*s - pio2_lo + s)); + } + /* x > 0.5 */ + z = (1 - x)*0.5; + s = sqrtl(z); + u.f = s; + CLEARBOTTOM(u); + f = u.f; + c = (z - f*f)/(s + f); + return 2*(__invtrigl_R(z)*s + c + f); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/asin.c b/lib/mlibc/options/ansi/musl-generic-math/asin.c new file mode 100644 index 0000000..c926b18 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/asin.c @@ -0,0 +1,107 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_asin.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* asin(x) + * Method : + * Since asin(x) = x + x^3/6 + x^5*3/40 + x^7*15/336 + ... + * we approximate asin(x) on [0,0.5] by + * asin(x) = x + x*x^2*R(x^2) + * where + * R(x^2) is a rational approximation of (asin(x)-x)/x^3 + * and its remez error is bounded by + * |(asin(x)-x)/x^3 - R(x^2)| < 2^(-58.75) + * + * For x in [0.5,1] + * asin(x) = pi/2-2*asin(sqrt((1-x)/2)) + * Let y = (1-x), z = y/2, s := sqrt(z), and pio2_hi+pio2_lo=pi/2; + * then for x>0.98 + * asin(x) = pi/2 - 2*(s+s*z*R(z)) + * = pio2_hi - (2*(s+s*z*R(z)) - pio2_lo) + * For x<=0.98, let pio4_hi = pio2_hi/2, then + * f = hi part of s; + * c = sqrt(z) - f = (z-f*f)/(s+f) ...f+c=sqrt(z) + * and + * asin(x) = pi/2 - 2*(s+s*z*R(z)) + * = pio4_hi+(pio4-2s)-(2s*z*R(z)-pio2_lo) + * = pio4_hi+(pio4-2f)-(2s*z*R(z)-(pio2_lo+2c)) + * + * Special cases: + * if x is NaN, return x itself; + * if |x|>1, return NaN with invalid signal. + * + */ + +#include "libm.h" + +static const double +pio2_hi = 1.57079632679489655800e+00, /* 0x3FF921FB, 0x54442D18 */ +pio2_lo = 6.12323399573676603587e-17, /* 0x3C91A626, 0x33145C07 */ +/* coefficients for R(x^2) */ +pS0 = 1.66666666666666657415e-01, /* 0x3FC55555, 0x55555555 */ +pS1 = -3.25565818622400915405e-01, /* 0xBFD4D612, 0x03EB6F7D */ +pS2 = 2.01212532134862925881e-01, /* 0x3FC9C155, 0x0E884455 */ +pS3 = -4.00555345006794114027e-02, /* 0xBFA48228, 0xB5688F3B */ +pS4 = 7.91534994289814532176e-04, /* 0x3F49EFE0, 0x7501B288 */ +pS5 = 3.47933107596021167570e-05, /* 0x3F023DE1, 0x0DFDF709 */ +qS1 = -2.40339491173441421878e+00, /* 0xC0033A27, 0x1C8A2D4B */ +qS2 = 2.02094576023350569471e+00, /* 0x40002AE5, 0x9C598AC8 */ +qS3 = -6.88283971605453293030e-01, /* 0xBFE6066C, 0x1B8D0159 */ +qS4 = 7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */ + +static double R(double z) +{ + double_t p, q; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5))))); + q = 1.0+z*(qS1+z*(qS2+z*(qS3+z*qS4))); + return p/q; +} + +double asin(double x) +{ + double z,r,s; + uint32_t hx,ix; + + GET_HIGH_WORD(hx, x); + ix = hx & 0x7fffffff; + /* |x| >= 1 or nan */ + if (ix >= 0x3ff00000) { + uint32_t lx; + GET_LOW_WORD(lx, x); + if ((ix-0x3ff00000 | lx) == 0) + /* asin(1) = +-pi/2 with inexact */ + return x*pio2_hi + 0x1p-120f; + return 0/(x-x); + } + /* |x| < 0.5 */ + if (ix < 0x3fe00000) { + /* if 0x1p-1022 <= |x| < 0x1p-26, avoid raising underflow */ + if (ix < 0x3e500000 && ix >= 0x00100000) + return x; + return x + x*R(x*x); + } + /* 1 > |x| >= 0.5 */ + z = (1 - fabs(x))*0.5; + s = sqrt(z); + r = R(z); + if (ix >= 0x3fef3333) { /* if |x| > 0.975 */ + x = pio2_hi-(2*(s+s*r)-pio2_lo); + } else { + double f,c; + /* f+c = sqrt(z) */ + f = s; + SET_LOW_WORD(f,0); + c = (z-f*f)/(s+f); + x = 0.5*pio2_hi - (2*s*r - (pio2_lo-2*c) - (0.5*pio2_hi-2*f)); + } + if (hx >> 31) + return -x; + return x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/asinf.c b/lib/mlibc/options/ansi/musl-generic-math/asinf.c new file mode 100644 index 0000000..bcd304a --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/asinf.c @@ -0,0 +1,61 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_asinf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +#include "libm.h" + +static const double +pio2 = 1.570796326794896558e+00; + +static const float +/* coefficients for R(x^2) */ +pS0 = 1.6666586697e-01, +pS1 = -4.2743422091e-02, +pS2 = -8.6563630030e-03, +qS1 = -7.0662963390e-01; + +static float R(float z) +{ + float_t p, q; + p = z*(pS0+z*(pS1+z*pS2)); + q = 1.0f+z*qS1; + return p/q; +} + +float asinf(float x) +{ + double s; + float z; + uint32_t hx,ix; + + GET_FLOAT_WORD(hx, x); + ix = hx & 0x7fffffff; + if (ix >= 0x3f800000) { /* |x| >= 1 */ + if (ix == 0x3f800000) /* |x| == 1 */ + return x*pio2 + 0x1p-120f; /* asin(+-1) = +-pi/2 with inexact */ + return 0/(x-x); /* asin(|x|>1) is NaN */ + } + if (ix < 0x3f000000) { /* |x| < 0.5 */ + /* if 0x1p-126 <= |x| < 0x1p-12, avoid raising underflow */ + if (ix < 0x39800000 && ix >= 0x00800000) + return x; + return x + x*R(x*x); + } + /* 1 > |x| >= 0.5 */ + z = (1 - fabsf(x))*0.5f; + s = sqrt(z); + x = pio2 - 2*(s+s*R(z)); + if (hx >> 31) + return -x; + return x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/asinh.c b/lib/mlibc/options/ansi/musl-generic-math/asinh.c new file mode 100644 index 0000000..0829f22 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/asinh.c @@ -0,0 +1,28 @@ +#include "libm.h" + +/* asinh(x) = sign(x)*log(|x|+sqrt(x*x+1)) ~= x - x^3/6 + o(x^5) */ +double asinh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + unsigned e = u.i >> 52 & 0x7ff; + unsigned s = u.i >> 63; + + /* |x| */ + u.i &= (uint64_t)-1/2; + x = u.f; + + if (e >= 0x3ff + 26) { + /* |x| >= 0x1p26 or inf or nan */ + x = log(x) + 0.693147180559945309417232121458176568; + } else if (e >= 0x3ff + 1) { + /* |x| >= 2 */ + x = log(2*x + 1/(sqrt(x*x+1)+x)); + } else if (e >= 0x3ff - 26) { + /* |x| >= 0x1p-26, up to 1.6ulp error in [0.125,0.5] */ + x = log1p(x + x*x/(sqrt(x*x+1)+1)); + } else { + /* |x| < 0x1p-26, raise inexact if x != 0 */ + FORCE_EVAL(x + 0x1p120f); + } + return s ? -x : x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/asinhf.c b/lib/mlibc/options/ansi/musl-generic-math/asinhf.c new file mode 100644 index 0000000..fc9f091 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/asinhf.c @@ -0,0 +1,28 @@ +#include "libm.h" + +/* asinh(x) = sign(x)*log(|x|+sqrt(x*x+1)) ~= x - x^3/6 + o(x^5) */ +float asinhf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + uint32_t i = u.i & 0x7fffffff; + unsigned s = u.i >> 31; + + /* |x| */ + u.i = i; + x = u.f; + + if (i >= 0x3f800000 + (12<<23)) { + /* |x| >= 0x1p12 or inf or nan */ + x = logf(x) + 0.693147180559945309417232121458176568f; + } else if (i >= 0x3f800000 + (1<<23)) { + /* |x| >= 2 */ + x = logf(2*x + 1/(sqrtf(x*x+1)+x)); + } else if (i >= 0x3f800000 - (12<<23)) { + /* |x| >= 0x1p-12, up to 1.6ulp error in [0.125,0.5] */ + x = log1pf(x + x*x/(sqrtf(x*x+1)+1)); + } else { + /* |x| < 0x1p-12, raise inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + } + return s ? -x : x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/asinhl.c b/lib/mlibc/options/ansi/musl-generic-math/asinhl.c new file mode 100644 index 0000000..8635f52 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/asinhl.c @@ -0,0 +1,41 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double asinhl(long double x) +{ + return asinh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* asinh(x) = sign(x)*log(|x|+sqrt(x*x+1)) ~= x - x^3/6 + o(x^5) */ +long double asinhl(long double x) +{ + union ldshape u = {x}; + unsigned e = u.i.se & 0x7fff; + unsigned s = u.i.se >> 15; + + /* |x| */ + u.i.se = e; + x = u.f; + + if (e >= 0x3fff + 32) { + /* |x| >= 0x1p32 or inf or nan */ + x = logl(x) + 0.693147180559945309417232121458176568L; + } else if (e >= 0x3fff + 1) { + /* |x| >= 2 */ + x = logl(2*x + 1/(sqrtl(x*x+1)+x)); + } else if (e >= 0x3fff - 32) { + /* |x| >= 0x1p-32 */ + x = log1pl(x + x*x/(sqrtl(x*x+1)+1)); + } else { + /* |x| < 0x1p-32, raise inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + } + return s ? -x : x; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double asinhl(long double x) +{ + return asinh(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/asinl.c b/lib/mlibc/options/ansi/musl-generic-math/asinl.c new file mode 100644 index 0000000..347c535 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/asinl.c @@ -0,0 +1,71 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_asinl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in asin.c. + * Converted to long double by David Schultz <das@FreeBSD.ORG>. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double asinl(long double x) +{ + return asin(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#include "__invtrigl.h" +#if LDBL_MANT_DIG == 64 +#define CLOSETO1(u) (u.i.m>>56 >= 0xf7) +#define CLEARBOTTOM(u) (u.i.m &= -1ULL << 32) +#elif LDBL_MANT_DIG == 113 +#define CLOSETO1(u) (u.i.top >= 0xee00) +#define CLEARBOTTOM(u) (u.i.lo = 0) +#endif + +long double asinl(long double x) +{ + union ldshape u = {x}; + long double z, r, s; + uint16_t e = u.i.se & 0x7fff; + int sign = u.i.se >> 15; + + if (e >= 0x3fff) { /* |x| >= 1 or nan */ + /* asin(+-1)=+-pi/2 with inexact */ + if (x == 1 || x == -1) + return x*pio2_hi + 0x1p-120f; + return 0/(x-x); + } + if (e < 0x3fff - 1) { /* |x| < 0.5 */ + if (e < 0x3fff - (LDBL_MANT_DIG+1)/2) { + /* return x with inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + return x; + } + return x + x*__invtrigl_R(x*x); + } + /* 1 > |x| >= 0.5 */ + z = (1.0 - fabsl(x))*0.5; + s = sqrtl(z); + r = __invtrigl_R(z); + if (CLOSETO1(u)) { + x = pio2_hi - (2*(s+s*r)-pio2_lo); + } else { + long double f, c; + u.f = s; + CLEARBOTTOM(u); + f = u.f; + c = (z - f*f)/(s + f); + x = 0.5*pio2_hi-(2*s*r - (pio2_lo-2*c) - (0.5*pio2_hi-2*f)); + } + return sign ? -x : x; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/atan.c b/lib/mlibc/options/ansi/musl-generic-math/atan.c new file mode 100644 index 0000000..63b0ab2 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atan.c @@ -0,0 +1,116 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_atan.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* atan(x) + * Method + * 1. Reduce x to positive by atan(x) = -atan(-x). + * 2. According to the integer k=4t+0.25 chopped, t=x, the argument + * is further reduced to one of the following intervals and the + * arctangent of t is evaluated by the corresponding formula: + * + * [0,7/16] atan(x) = t-t^3*(a1+t^2*(a2+...(a10+t^2*a11)...) + * [7/16,11/16] atan(x) = atan(1/2) + atan( (t-0.5)/(1+t/2) ) + * [11/16.19/16] atan(x) = atan( 1 ) + atan( (t-1)/(1+t) ) + * [19/16,39/16] atan(x) = atan(3/2) + atan( (t-1.5)/(1+1.5t) ) + * [39/16,INF] atan(x) = atan(INF) + atan( -1/t ) + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + + +#include "libm.h" + +static const double atanhi[] = { + 4.63647609000806093515e-01, /* atan(0.5)hi 0x3FDDAC67, 0x0561BB4F */ + 7.85398163397448278999e-01, /* atan(1.0)hi 0x3FE921FB, 0x54442D18 */ + 9.82793723247329054082e-01, /* atan(1.5)hi 0x3FEF730B, 0xD281F69B */ + 1.57079632679489655800e+00, /* atan(inf)hi 0x3FF921FB, 0x54442D18 */ +}; + +static const double atanlo[] = { + 2.26987774529616870924e-17, /* atan(0.5)lo 0x3C7A2B7F, 0x222F65E2 */ + 3.06161699786838301793e-17, /* atan(1.0)lo 0x3C81A626, 0x33145C07 */ + 1.39033110312309984516e-17, /* atan(1.5)lo 0x3C700788, 0x7AF0CBBD */ + 6.12323399573676603587e-17, /* atan(inf)lo 0x3C91A626, 0x33145C07 */ +}; + +static const double aT[] = { + 3.33333333333329318027e-01, /* 0x3FD55555, 0x5555550D */ + -1.99999999998764832476e-01, /* 0xBFC99999, 0x9998EBC4 */ + 1.42857142725034663711e-01, /* 0x3FC24924, 0x920083FF */ + -1.11111104054623557880e-01, /* 0xBFBC71C6, 0xFE231671 */ + 9.09088713343650656196e-02, /* 0x3FB745CD, 0xC54C206E */ + -7.69187620504482999495e-02, /* 0xBFB3B0F2, 0xAF749A6D */ + 6.66107313738753120669e-02, /* 0x3FB10D66, 0xA0D03D51 */ + -5.83357013379057348645e-02, /* 0xBFADDE2D, 0x52DEFD9A */ + 4.97687799461593236017e-02, /* 0x3FA97B4B, 0x24760DEB */ + -3.65315727442169155270e-02, /* 0xBFA2B444, 0x2C6A6C2F */ + 1.62858201153657823623e-02, /* 0x3F90AD3A, 0xE322DA11 */ +}; + +double atan(double x) +{ + double_t w,s1,s2,z; + uint32_t ix,sign; + int id; + + GET_HIGH_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + if (ix >= 0x44100000) { /* if |x| >= 2^66 */ + if (isnan(x)) + return x; + z = atanhi[3] + 0x1p-120f; + return sign ? -z : z; + } + if (ix < 0x3fdc0000) { /* |x| < 0.4375 */ + if (ix < 0x3e400000) { /* |x| < 2^-27 */ + if (ix < 0x00100000) + /* raise underflow for subnormal x */ + FORCE_EVAL((float)x); + return x; + } + id = -1; + } else { + x = fabs(x); + if (ix < 0x3ff30000) { /* |x| < 1.1875 */ + if (ix < 0x3fe60000) { /* 7/16 <= |x| < 11/16 */ + id = 0; + x = (2.0*x-1.0)/(2.0+x); + } else { /* 11/16 <= |x| < 19/16 */ + id = 1; + x = (x-1.0)/(x+1.0); + } + } else { + if (ix < 0x40038000) { /* |x| < 2.4375 */ + id = 2; + x = (x-1.5)/(1.0+1.5*x); + } else { /* 2.4375 <= |x| < 2^66 */ + id = 3; + x = -1.0/x; + } + } + } + /* end of argument reduction */ + z = x*x; + w = z*z; + /* break sum from i=0 to 10 aT[i]z**(i+1) into odd and even poly */ + s1 = z*(aT[0]+w*(aT[2]+w*(aT[4]+w*(aT[6]+w*(aT[8]+w*aT[10]))))); + s2 = w*(aT[1]+w*(aT[3]+w*(aT[5]+w*(aT[7]+w*aT[9])))); + if (id < 0) + return x - x*(s1+s2); + z = atanhi[id] - (x*(s1+s2) - atanlo[id] - x); + return sign ? -z : z; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/atan2.c b/lib/mlibc/options/ansi/musl-generic-math/atan2.c new file mode 100644 index 0000000..5a1903c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atan2.c @@ -0,0 +1,107 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_atan2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ +/* atan2(y,x) + * Method : + * 1. Reduce y to positive by atan2(y,x)=-atan2(-y,x). + * 2. Reduce x to positive by (if x and y are unexceptional): + * ARG (x+iy) = arctan(y/x) ... if x > 0, + * ARG (x+iy) = pi - arctan[y/(-x)] ... if x < 0, + * + * Special cases: + * + * ATAN2((anything), NaN ) is NaN; + * ATAN2(NAN , (anything) ) is NaN; + * ATAN2(+-0, +(anything but NaN)) is +-0 ; + * ATAN2(+-0, -(anything but NaN)) is +-pi ; + * ATAN2(+-(anything but 0 and NaN), 0) is +-pi/2; + * ATAN2(+-(anything but INF and NaN), +INF) is +-0 ; + * ATAN2(+-(anything but INF and NaN), -INF) is +-pi; + * ATAN2(+-INF,+INF ) is +-pi/4 ; + * ATAN2(+-INF,-INF ) is +-3pi/4; + * ATAN2(+-INF, (anything but,0,NaN, and INF)) is +-pi/2; + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "libm.h" + +static const double +pi = 3.1415926535897931160E+00, /* 0x400921FB, 0x54442D18 */ +pi_lo = 1.2246467991473531772E-16; /* 0x3CA1A626, 0x33145C07 */ + +double atan2(double y, double x) +{ + double z; + uint32_t m,lx,ly,ix,iy; + + if (isnan(x) || isnan(y)) + return x+y; + EXTRACT_WORDS(ix, lx, x); + EXTRACT_WORDS(iy, ly, y); + if ((ix-0x3ff00000 | lx) == 0) /* x = 1.0 */ + return atan(y); + m = ((iy>>31)&1) | ((ix>>30)&2); /* 2*sign(x)+sign(y) */ + ix = ix & 0x7fffffff; + iy = iy & 0x7fffffff; + + /* when y = 0 */ + if ((iy|ly) == 0) { + switch(m) { + case 0: + case 1: return y; /* atan(+-0,+anything)=+-0 */ + case 2: return pi; /* atan(+0,-anything) = pi */ + case 3: return -pi; /* atan(-0,-anything) =-pi */ + } + } + /* when x = 0 */ + if ((ix|lx) == 0) + return m&1 ? -pi/2 : pi/2; + /* when x is INF */ + if (ix == 0x7ff00000) { + if (iy == 0x7ff00000) { + switch(m) { + case 0: return pi/4; /* atan(+INF,+INF) */ + case 1: return -pi/4; /* atan(-INF,+INF) */ + case 2: return 3*pi/4; /* atan(+INF,-INF) */ + case 3: return -3*pi/4; /* atan(-INF,-INF) */ + } + } else { + switch(m) { + case 0: return 0.0; /* atan(+...,+INF) */ + case 1: return -0.0; /* atan(-...,+INF) */ + case 2: return pi; /* atan(+...,-INF) */ + case 3: return -pi; /* atan(-...,-INF) */ + } + } + } + /* |y/x| > 0x1p64 */ + if (ix+(64<<20) < iy || iy == 0x7ff00000) + return m&1 ? -pi/2 : pi/2; + + /* z = atan(|y/x|) without spurious underflow */ + if ((m&2) && iy+(64<<20) < ix) /* |y/x| < 0x1p-64, x<0 */ + z = 0; + else + z = atan(fabs(y/x)); + switch (m) { + case 0: return z; /* atan(+,+) */ + case 1: return -z; /* atan(-,+) */ + case 2: return pi - (z-pi_lo); /* atan(+,-) */ + default: /* case 3 */ + return (z-pi_lo) - pi; /* atan(-,-) */ + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/atan2f.c b/lib/mlibc/options/ansi/musl-generic-math/atan2f.c new file mode 100644 index 0000000..c634d00 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atan2f.c @@ -0,0 +1,83 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_atan2f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +pi = 3.1415927410e+00, /* 0x40490fdb */ +pi_lo = -8.7422776573e-08; /* 0xb3bbbd2e */ + +float atan2f(float y, float x) +{ + float z; + uint32_t m,ix,iy; + + if (isnan(x) || isnan(y)) + return x+y; + GET_FLOAT_WORD(ix, x); + GET_FLOAT_WORD(iy, y); + if (ix == 0x3f800000) /* x=1.0 */ + return atanf(y); + m = ((iy>>31)&1) | ((ix>>30)&2); /* 2*sign(x)+sign(y) */ + ix &= 0x7fffffff; + iy &= 0x7fffffff; + + /* when y = 0 */ + if (iy == 0) { + switch (m) { + case 0: + case 1: return y; /* atan(+-0,+anything)=+-0 */ + case 2: return pi; /* atan(+0,-anything) = pi */ + case 3: return -pi; /* atan(-0,-anything) =-pi */ + } + } + /* when x = 0 */ + if (ix == 0) + return m&1 ? -pi/2 : pi/2; + /* when x is INF */ + if (ix == 0x7f800000) { + if (iy == 0x7f800000) { + switch (m) { + case 0: return pi/4; /* atan(+INF,+INF) */ + case 1: return -pi/4; /* atan(-INF,+INF) */ + case 2: return 3*pi/4; /*atan(+INF,-INF)*/ + case 3: return -3*pi/4; /*atan(-INF,-INF)*/ + } + } else { + switch (m) { + case 0: return 0.0f; /* atan(+...,+INF) */ + case 1: return -0.0f; /* atan(-...,+INF) */ + case 2: return pi; /* atan(+...,-INF) */ + case 3: return -pi; /* atan(-...,-INF) */ + } + } + } + /* |y/x| > 0x1p26 */ + if (ix+(26<<23) < iy || iy == 0x7f800000) + return m&1 ? -pi/2 : pi/2; + + /* z = atan(|y/x|) with correct underflow */ + if ((m&2) && iy+(26<<23) < ix) /*|y/x| < 0x1p-26, x < 0 */ + z = 0.0; + else + z = atanf(fabsf(y/x)); + switch (m) { + case 0: return z; /* atan(+,+) */ + case 1: return -z; /* atan(-,+) */ + case 2: return pi - (z-pi_lo); /* atan(+,-) */ + default: /* case 3 */ + return (z-pi_lo) - pi; /* atan(-,-) */ + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/atan2l.c b/lib/mlibc/options/ansi/musl-generic-math/atan2l.c new file mode 100644 index 0000000..f0937a9 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atan2l.c @@ -0,0 +1,85 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_atan2l.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ +/* + * See comments in atan2.c. + * Converted to long double by David Schultz <das@FreeBSD.ORG>. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double atan2l(long double y, long double x) +{ + return atan2(y, x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#include "__invtrigl.h" + +long double atan2l(long double y, long double x) +{ + union ldshape ux, uy; + long double z; + int m, ex, ey; + + if (isnan(x) || isnan(y)) + return x+y; + if (x == 1) + return atanl(y); + ux.f = x; + uy.f = y; + ex = ux.i.se & 0x7fff; + ey = uy.i.se & 0x7fff; + m = 2*(ux.i.se>>15) | uy.i.se>>15; + if (y == 0) { + switch(m) { + case 0: + case 1: return y; /* atan(+-0,+anything)=+-0 */ + case 2: return 2*pio2_hi; /* atan(+0,-anything) = pi */ + case 3: return -2*pio2_hi; /* atan(-0,-anything) =-pi */ + } + } + if (x == 0) + return m&1 ? -pio2_hi : pio2_hi; + if (ex == 0x7fff) { + if (ey == 0x7fff) { + switch(m) { + case 0: return pio2_hi/2; /* atan(+INF,+INF) */ + case 1: return -pio2_hi/2; /* atan(-INF,+INF) */ + case 2: return 1.5*pio2_hi; /* atan(+INF,-INF) */ + case 3: return -1.5*pio2_hi; /* atan(-INF,-INF) */ + } + } else { + switch(m) { + case 0: return 0.0; /* atan(+...,+INF) */ + case 1: return -0.0; /* atan(-...,+INF) */ + case 2: return 2*pio2_hi; /* atan(+...,-INF) */ + case 3: return -2*pio2_hi; /* atan(-...,-INF) */ + } + } + } + if (ex+120 < ey || ey == 0x7fff) + return m&1 ? -pio2_hi : pio2_hi; + /* z = atan(|y/x|) without spurious underflow */ + if ((m&2) && ey+120 < ex) /* |y/x| < 0x1p-120, x<0 */ + z = 0.0; + else + z = atanl(fabsl(y/x)); + switch (m) { + case 0: return z; /* atan(+,+) */ + case 1: return -z; /* atan(-,+) */ + case 2: return 2*pio2_hi-(z-2*pio2_lo); /* atan(+,-) */ + default: /* case 3 */ + return (z-2*pio2_lo)-2*pio2_hi; /* atan(-,-) */ + } +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/atanf.c b/lib/mlibc/options/ansi/musl-generic-math/atanf.c new file mode 100644 index 0000000..178341b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atanf.c @@ -0,0 +1,94 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_atanf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + + +#include "libm.h" + +static const float atanhi[] = { + 4.6364760399e-01, /* atan(0.5)hi 0x3eed6338 */ + 7.8539812565e-01, /* atan(1.0)hi 0x3f490fda */ + 9.8279368877e-01, /* atan(1.5)hi 0x3f7b985e */ + 1.5707962513e+00, /* atan(inf)hi 0x3fc90fda */ +}; + +static const float atanlo[] = { + 5.0121582440e-09, /* atan(0.5)lo 0x31ac3769 */ + 3.7748947079e-08, /* atan(1.0)lo 0x33222168 */ + 3.4473217170e-08, /* atan(1.5)lo 0x33140fb4 */ + 7.5497894159e-08, /* atan(inf)lo 0x33a22168 */ +}; + +static const float aT[] = { + 3.3333328366e-01, + -1.9999158382e-01, + 1.4253635705e-01, + -1.0648017377e-01, + 6.1687607318e-02, +}; + +float atanf(float x) +{ + float_t w,s1,s2,z; + uint32_t ix,sign; + int id; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x4c800000) { /* if |x| >= 2**26 */ + if (isnan(x)) + return x; + z = atanhi[3] + 0x1p-120f; + return sign ? -z : z; + } + if (ix < 0x3ee00000) { /* |x| < 0.4375 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + if (ix < 0x00800000) + /* raise underflow for subnormal x */ + FORCE_EVAL(x*x); + return x; + } + id = -1; + } else { + x = fabsf(x); + if (ix < 0x3f980000) { /* |x| < 1.1875 */ + if (ix < 0x3f300000) { /* 7/16 <= |x| < 11/16 */ + id = 0; + x = (2.0f*x - 1.0f)/(2.0f + x); + } else { /* 11/16 <= |x| < 19/16 */ + id = 1; + x = (x - 1.0f)/(x + 1.0f); + } + } else { + if (ix < 0x401c0000) { /* |x| < 2.4375 */ + id = 2; + x = (x - 1.5f)/(1.0f + 1.5f*x); + } else { /* 2.4375 <= |x| < 2**26 */ + id = 3; + x = -1.0f/x; + } + } + } + /* end of argument reduction */ + z = x*x; + w = z*z; + /* break sum from i=0 to 10 aT[i]z**(i+1) into odd and even poly */ + s1 = z*(aT[0]+w*(aT[2]+w*aT[4])); + s2 = w*(aT[1]+w*aT[3]); + if (id < 0) + return x - x*(s1+s2); + z = atanhi[id] - ((x*(s1+s2) - atanlo[id]) - x); + return sign ? -z : z; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/atanh.c b/lib/mlibc/options/ansi/musl-generic-math/atanh.c new file mode 100644 index 0000000..63a035d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atanh.c @@ -0,0 +1,29 @@ +#include "libm.h" + +/* atanh(x) = log((1+x)/(1-x))/2 = log1p(2x/(1-x))/2 ~= x + x^3/3 + o(x^5) */ +double atanh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + unsigned e = u.i >> 52 & 0x7ff; + unsigned s = u.i >> 63; + double_t y; + + /* |x| */ + u.i &= (uint64_t)-1/2; + y = u.f; + + if (e < 0x3ff - 1) { + if (e < 0x3ff - 32) { + /* handle underflow */ + if (e == 0) + FORCE_EVAL((float)y); + } else { + /* |x| < 0.5, up to 1.7ulp error */ + y = 0.5*log1p(2*y + 2*y*y/(1-y)); + } + } else { + /* avoid overflow */ + y = 0.5*log1p(2*(y/(1-y))); + } + return s ? -y : y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/atanhf.c b/lib/mlibc/options/ansi/musl-generic-math/atanhf.c new file mode 100644 index 0000000..65f07c0 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atanhf.c @@ -0,0 +1,28 @@ +#include "libm.h" + +/* atanh(x) = log((1+x)/(1-x))/2 = log1p(2x/(1-x))/2 ~= x + x^3/3 + o(x^5) */ +float atanhf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + unsigned s = u.i >> 31; + float_t y; + + /* |x| */ + u.i &= 0x7fffffff; + y = u.f; + + if (u.i < 0x3f800000 - (1<<23)) { + if (u.i < 0x3f800000 - (32<<23)) { + /* handle underflow */ + if (u.i < (1<<23)) + FORCE_EVAL((float)(y*y)); + } else { + /* |x| < 0.5, up to 1.7ulp error */ + y = 0.5f*log1pf(2*y + 2*y*y/(1-y)); + } + } else { + /* avoid overflow */ + y = 0.5f*log1pf(2*(y/(1-y))); + } + return s ? -y : y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/atanhl.c b/lib/mlibc/options/ansi/musl-generic-math/atanhl.c new file mode 100644 index 0000000..87cd1cd --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atanhl.c @@ -0,0 +1,35 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double atanhl(long double x) +{ + return atanh(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +/* atanh(x) = log((1+x)/(1-x))/2 = log1p(2x/(1-x))/2 ~= x + x^3/3 + o(x^5) */ +long double atanhl(long double x) +{ + union ldshape u = {x}; + unsigned e = u.i.se & 0x7fff; + unsigned s = u.i.se >> 15; + + /* |x| */ + u.i.se = e; + x = u.f; + + if (e < 0x3ff - 1) { + if (e < 0x3ff - LDBL_MANT_DIG/2) { + /* handle underflow */ + if (e == 0) + FORCE_EVAL((float)x); + } else { + /* |x| < 0.5, up to 1.7ulp error */ + x = 0.5*log1pl(2*x + 2*x*x/(1-x)); + } + } else { + /* avoid overflow */ + x = 0.5*log1pl(2*(x/(1-x))); + } + return s ? -x : x; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/atanl.c b/lib/mlibc/options/ansi/musl-generic-math/atanl.c new file mode 100644 index 0000000..79a3edb --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atanl.c @@ -0,0 +1,184 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_atanl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in atan.c. + * Converted to long double by David Schultz <das@FreeBSD.ORG>. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double atanl(long double x) +{ + return atan(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +#if LDBL_MANT_DIG == 64 +#define EXPMAN(u) ((u.i.se & 0x7fff)<<8 | (u.i.m>>55 & 0xff)) + +static const long double atanhi[] = { + 4.63647609000806116202e-01L, + 7.85398163397448309628e-01L, + 9.82793723247329067960e-01L, + 1.57079632679489661926e+00L, +}; + +static const long double atanlo[] = { + 1.18469937025062860669e-20L, + -1.25413940316708300586e-20L, + 2.55232234165405176172e-20L, + -2.50827880633416601173e-20L, +}; + +static const long double aT[] = { + 3.33333333333333333017e-01L, + -1.99999999999999632011e-01L, + 1.42857142857046531280e-01L, + -1.11111111100562372733e-01L, + 9.09090902935647302252e-02L, + -7.69230552476207730353e-02L, + 6.66661718042406260546e-02L, + -5.88158892835030888692e-02L, + 5.25499891539726639379e-02L, + -4.70119845393155721494e-02L, + 4.03539201366454414072e-02L, + -2.91303858419364158725e-02L, + 1.24822046299269234080e-02L, +}; + +static long double T_even(long double x) +{ + return aT[0] + x * (aT[2] + x * (aT[4] + x * (aT[6] + + x * (aT[8] + x * (aT[10] + x * aT[12]))))); +} + +static long double T_odd(long double x) +{ + return aT[1] + x * (aT[3] + x * (aT[5] + x * (aT[7] + + x * (aT[9] + x * aT[11])))); +} +#elif LDBL_MANT_DIG == 113 +#define EXPMAN(u) ((u.i.se & 0x7fff)<<8 | u.i.top>>8) + +const long double atanhi[] = { + 4.63647609000806116214256231461214397e-01L, + 7.85398163397448309615660845819875699e-01L, + 9.82793723247329067985710611014666038e-01L, + 1.57079632679489661923132169163975140e+00L, +}; + +const long double atanlo[] = { + 4.89509642257333492668618435220297706e-36L, + 2.16795253253094525619926100651083806e-35L, + -2.31288434538183565909319952098066272e-35L, + 4.33590506506189051239852201302167613e-35L, +}; + +const long double aT[] = { + 3.33333333333333333333333333333333125e-01L, + -1.99999999999999999999999999999180430e-01L, + 1.42857142857142857142857142125269827e-01L, + -1.11111111111111111111110834490810169e-01L, + 9.09090909090909090908522355708623681e-02L, + -7.69230769230769230696553844935357021e-02L, + 6.66666666666666660390096773046256096e-02L, + -5.88235294117646671706582985209643694e-02L, + 5.26315789473666478515847092020327506e-02L, + -4.76190476189855517021024424991436144e-02L, + 4.34782608678695085948531993458097026e-02L, + -3.99999999632663469330634215991142368e-02L, + 3.70370363987423702891250829918659723e-02L, + -3.44827496515048090726669907612335954e-02L, + 3.22579620681420149871973710852268528e-02L, + -3.03020767654269261041647570626778067e-02L, + 2.85641979882534783223403715930946138e-02L, + -2.69824879726738568189929461383741323e-02L, + 2.54194698498808542954187110873675769e-02L, + -2.35083879708189059926183138130183215e-02L, + 2.04832358998165364349957325067131428e-02L, + -1.54489555488544397858507248612362957e-02L, + 8.64492360989278761493037861575248038e-03L, + -2.58521121597609872727919154569765469e-03L, +}; + +static long double T_even(long double x) +{ + return (aT[0] + x * (aT[2] + x * (aT[4] + x * (aT[6] + x * (aT[8] + + x * (aT[10] + x * (aT[12] + x * (aT[14] + x * (aT[16] + + x * (aT[18] + x * (aT[20] + x * aT[22]))))))))))); +} + +static long double T_odd(long double x) +{ + return (aT[1] + x * (aT[3] + x * (aT[5] + x * (aT[7] + x * (aT[9] + + x * (aT[11] + x * (aT[13] + x * (aT[15] + x * (aT[17] + + x * (aT[19] + x * (aT[21] + x * aT[23]))))))))))); +} +#endif + +long double atanl(long double x) +{ + union ldshape u = {x}; + long double w, s1, s2, z; + int id; + unsigned e = u.i.se & 0x7fff; + unsigned sign = u.i.se >> 15; + unsigned expman; + + if (e >= 0x3fff + LDBL_MANT_DIG + 1) { /* if |x| is large, atan(x)~=pi/2 */ + if (isnan(x)) + return x; + return sign ? -atanhi[3] : atanhi[3]; + } + /* Extract the exponent and the first few bits of the mantissa. */ + expman = EXPMAN(u); + if (expman < ((0x3fff - 2) << 8) + 0xc0) { /* |x| < 0.4375 */ + if (e < 0x3fff - (LDBL_MANT_DIG+1)/2) { /* if |x| is small, atanl(x)~=x */ + /* raise underflow if subnormal */ + if (e == 0) + FORCE_EVAL((float)x); + return x; + } + id = -1; + } else { + x = fabsl(x); + if (expman < (0x3fff << 8) + 0x30) { /* |x| < 1.1875 */ + if (expman < ((0x3fff - 1) << 8) + 0x60) { /* 7/16 <= |x| < 11/16 */ + id = 0; + x = (2.0*x-1.0)/(2.0+x); + } else { /* 11/16 <= |x| < 19/16 */ + id = 1; + x = (x-1.0)/(x+1.0); + } + } else { + if (expman < ((0x3fff + 1) << 8) + 0x38) { /* |x| < 2.4375 */ + id = 2; + x = (x-1.5)/(1.0+1.5*x); + } else { /* 2.4375 <= |x| */ + id = 3; + x = -1.0/x; + } + } + } + /* end of argument reduction */ + z = x*x; + w = z*z; + /* break sum aT[i]z**(i+1) into odd and even poly */ + s1 = z*T_even(w); + s2 = w*T_odd(w); + if (id < 0) + return x - x*(s1+s2); + z = atanhi[id] - ((x*(s1+s2) - atanlo[id]) - x); + return sign ? -z : z; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/cbrt.c b/lib/mlibc/options/ansi/musl-generic-math/cbrt.c new file mode 100644 index 0000000..7599d3e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/cbrt.c @@ -0,0 +1,103 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cbrt.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + * Optimized by Bruce D. Evans. + */ +/* cbrt(x) + * Return cube root of x + */ + +#include <math.h> +#include <stdint.h> + +static const uint32_t +B1 = 715094163, /* B1 = (1023-1023/3-0.03306235651)*2**20 */ +B2 = 696219795; /* B2 = (1023-1023/3-54/3-0.03306235651)*2**20 */ + +/* |1/cbrt(x) - p(x)| < 2**-23.5 (~[-7.93e-8, 7.929e-8]). */ +static const double +P0 = 1.87595182427177009643, /* 0x3ffe03e6, 0x0f61e692 */ +P1 = -1.88497979543377169875, /* 0xbffe28e0, 0x92f02420 */ +P2 = 1.621429720105354466140, /* 0x3ff9f160, 0x4a49d6c2 */ +P3 = -0.758397934778766047437, /* 0xbfe844cb, 0xbee751d9 */ +P4 = 0.145996192886612446982; /* 0x3fc2b000, 0xd4e4edd7 */ + +double cbrt(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t r,s,t,w; + uint32_t hx = u.i>>32 & 0x7fffffff; + + if (hx >= 0x7ff00000) /* cbrt(NaN,INF) is itself */ + return x+x; + + /* + * Rough cbrt to 5 bits: + * cbrt(2**e*(1+m) ~= 2**(e/3)*(1+(e%3+m)/3) + * where e is integral and >= 0, m is real and in [0, 1), and "/" and + * "%" are integer division and modulus with rounding towards minus + * infinity. The RHS is always >= the LHS and has a maximum relative + * error of about 1 in 16. Adding a bias of -0.03306235651 to the + * (e%3+m)/3 term reduces the error to about 1 in 32. With the IEEE + * floating point representation, for finite positive normal values, + * ordinary integer divison of the value in bits magically gives + * almost exactly the RHS of the above provided we first subtract the + * exponent bias (1023 for doubles) and later add it back. We do the + * subtraction virtually to keep e >= 0 so that ordinary integer + * division rounds towards minus infinity; this is also efficient. + */ + if (hx < 0x00100000) { /* zero or subnormal? */ + u.f = x*0x1p54; + hx = u.i>>32 & 0x7fffffff; + if (hx == 0) + return x; /* cbrt(0) is itself */ + hx = hx/3 + B2; + } else + hx = hx/3 + B1; + u.i &= 1ULL<<63; + u.i |= (uint64_t)hx << 32; + t = u.f; + + /* + * New cbrt to 23 bits: + * cbrt(x) = t*cbrt(x/t**3) ~= t*P(t**3/x) + * where P(r) is a polynomial of degree 4 that approximates 1/cbrt(r) + * to within 2**-23.5 when |r - 1| < 1/10. The rough approximation + * has produced t such than |t/cbrt(x) - 1| ~< 1/32, and cubing this + * gives us bounds for r = t**3/x. + * + * Try to optimize for parallel evaluation as in __tanf.c. + */ + r = (t*t)*(t/x); + t = t*((P0+r*(P1+r*P2))+((r*r)*r)*(P3+r*P4)); + + /* + * Round t away from zero to 23 bits (sloppily except for ensuring that + * the result is larger in magnitude than cbrt(x) but not much more than + * 2 23-bit ulps larger). With rounding towards zero, the error bound + * would be ~5/6 instead of ~4/6. With a maximum error of 2 23-bit ulps + * in the rounded t, the infinite-precision error in the Newton + * approximation barely affects third digit in the final error + * 0.667; the error in the rounded t can be up to about 3 23-bit ulps + * before the final error is larger than 0.667 ulps. + */ + u.f = t; + u.i = (u.i + 0x80000000) & 0xffffffffc0000000ULL; + t = u.f; + + /* one step Newton iteration to 53 bits with error < 0.667 ulps */ + s = t*t; /* t*t is exact */ + r = x/s; /* error <= 0.5 ulps; |r| < |t| */ + w = t+t; /* t+t is exact */ + r = (r-t)/(w+r); /* r-t is exact; w+r ~= 3*t */ + t = t+t*r; /* error <= 0.5 + 0.5/3 + epsilon */ + return t; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/cbrtf.c b/lib/mlibc/options/ansi/musl-generic-math/cbrtf.c new file mode 100644 index 0000000..89c2c86 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/cbrtf.c @@ -0,0 +1,66 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cbrtf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Debugged and optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* cbrtf(x) + * Return cube root of x + */ + +#include <math.h> +#include <stdint.h> + +static const unsigned +B1 = 709958130, /* B1 = (127-127.0/3-0.03306235651)*2**23 */ +B2 = 642849266; /* B2 = (127-127.0/3-24/3-0.03306235651)*2**23 */ + +float cbrtf(float x) +{ + double_t r,T; + union {float f; uint32_t i;} u = {x}; + uint32_t hx = u.i & 0x7fffffff; + + if (hx >= 0x7f800000) /* cbrt(NaN,INF) is itself */ + return x + x; + + /* rough cbrt to 5 bits */ + if (hx < 0x00800000) { /* zero or subnormal? */ + if (hx == 0) + return x; /* cbrt(+-0) is itself */ + u.f = x*0x1p24f; + hx = u.i & 0x7fffffff; + hx = hx/3 + B2; + } else + hx = hx/3 + B1; + u.i &= 0x80000000; + u.i |= hx; + + /* + * First step Newton iteration (solving t*t-x/t == 0) to 16 bits. In + * double precision so that its terms can be arranged for efficiency + * without causing overflow or underflow. + */ + T = u.f; + r = T*T*T; + T = T*((double_t)x+x+r)/(x+r+r); + + /* + * Second step Newton iteration to 47 bits. In double precision for + * efficiency and accuracy. + */ + r = T*T*T; + T = T*((double_t)x+x+r)/(x+r+r); + + /* rounding to 24 bits is perfect in round-to-nearest mode */ + return T; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/cbrtl.c b/lib/mlibc/options/ansi/musl-generic-math/cbrtl.c new file mode 100644 index 0000000..ceff913 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/cbrtl.c @@ -0,0 +1,124 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cbrtl.c */ +/*- + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * Copyright (c) 2009-2011, Bruce D. Evans, Steven G. Kargl, David Schultz. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + * The argument reduction and testing for exceptional cases was + * written by Steven G. Kargl with input from Bruce D. Evans + * and David A. Schultz. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double cbrtl(long double x) +{ + return cbrt(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +static const unsigned B1 = 709958130; /* B1 = (127-127.0/3-0.03306235651)*2**23 */ + +long double cbrtl(long double x) +{ + union ldshape u = {x}, v; + union {float f; uint32_t i;} uft; + long double r, s, t, w; + double_t dr, dt, dx; + float_t ft; + int e = u.i.se & 0x7fff; + int sign = u.i.se & 0x8000; + + /* + * If x = +-Inf, then cbrt(x) = +-Inf. + * If x = NaN, then cbrt(x) = NaN. + */ + if (e == 0x7fff) + return x + x; + if (e == 0) { + /* Adjust subnormal numbers. */ + u.f *= 0x1p120; + e = u.i.se & 0x7fff; + /* If x = +-0, then cbrt(x) = +-0. */ + if (e == 0) + return x; + e -= 120; + } + e -= 0x3fff; + u.i.se = 0x3fff; + x = u.f; + switch (e % 3) { + case 1: + case -2: + x *= 2; + e--; + break; + case 2: + case -1: + x *= 4; + e -= 2; + break; + } + v.f = 1.0; + v.i.se = sign | (0x3fff + e/3); + + /* + * The following is the guts of s_cbrtf, with the handling of + * special values removed and extra care for accuracy not taken, + * but with most of the extra accuracy not discarded. + */ + + /* ~5-bit estimate: */ + uft.f = x; + uft.i = (uft.i & 0x7fffffff)/3 + B1; + ft = uft.f; + + /* ~16-bit estimate: */ + dx = x; + dt = ft; + dr = dt * dt * dt; + dt = dt * (dx + dx + dr) / (dx + dr + dr); + + /* ~47-bit estimate: */ + dr = dt * dt * dt; + dt = dt * (dx + dx + dr) / (dx + dr + dr); + +#if LDBL_MANT_DIG == 64 + /* + * dt is cbrtl(x) to ~47 bits (after x has been reduced to 1 <= x < 8). + * Round it away from zero to 32 bits (32 so that t*t is exact, and + * away from zero for technical reasons). + */ + t = dt + (0x1.0p32L + 0x1.0p-31L) - 0x1.0p32; +#elif LDBL_MANT_DIG == 113 + /* + * Round dt away from zero to 47 bits. Since we don't trust the 47, + * add 2 47-bit ulps instead of 1 to round up. Rounding is slow and + * might be avoidable in this case, since on most machines dt will + * have been evaluated in 53-bit precision and the technical reasons + * for rounding up might not apply to either case in cbrtl() since + * dt is much more accurate than needed. + */ + t = dt + 0x2.0p-46 + 0x1.0p60L - 0x1.0p60; +#endif + + /* + * Final step Newton iteration to 64 or 113 bits with + * error < 0.667 ulps + */ + s = t*t; /* t*t is exact */ + r = x/s; /* error <= 0.5 ulps; |r| < |t| */ + w = t+t; /* t+t is exact */ + r = (r-t)/(w+r); /* r-t is exact; w+r ~= 3*t */ + t = t+t*r; /* error <= 0.5 + 0.5/3 + epsilon */ + + t *= v.f; + return t; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/ceil.c b/lib/mlibc/options/ansi/musl-generic-math/ceil.c new file mode 100644 index 0000000..b13e6f2 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ceil.c @@ -0,0 +1,31 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const double_t toint = 1/EPS; + +double ceil(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i >> 52 & 0x7ff; + double_t y; + + if (e >= 0x3ff+52 || x == 0) + return x; + /* y = int(x) - x, where int(x) is an integer neighbor of x */ + if (u.i >> 63) + y = x - toint + toint - x; + else + y = x + toint - toint - x; + /* special case because of non-nearest rounding modes */ + if (e <= 0x3ff-1) { + FORCE_EVAL(y); + return u.i >> 63 ? -0.0 : 1; + } + if (y < 0) + return x + y + 1; + return x + y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/ceilf.c b/lib/mlibc/options/ansi/musl-generic-math/ceilf.c new file mode 100644 index 0000000..869835f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ceilf.c @@ -0,0 +1,27 @@ +#include "libm.h" + +float ceilf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = (int)(u.i >> 23 & 0xff) - 0x7f; + uint32_t m; + + if (e >= 23) + return x; + if (e >= 0) { + m = 0x007fffff >> e; + if ((u.i & m) == 0) + return x; + FORCE_EVAL(x + 0x1p120f); + if (u.i >> 31 == 0) + u.i += m; + u.i &= ~m; + } else { + FORCE_EVAL(x + 0x1p120f); + if (u.i >> 31) + u.f = -0.0; + else if (u.i << 1) + u.f = 1.0; + } + return u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/ceill.c b/lib/mlibc/options/ansi/musl-generic-math/ceill.c new file mode 100644 index 0000000..60a8302 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ceill.c @@ -0,0 +1,34 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double ceill(long double x) +{ + return ceil(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double ceill(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1 || x == 0) + return x; + /* y = int(x) - x, where int(x) is an integer neighbor of x */ + if (u.i.se >> 15) + y = x - toint + toint - x; + else + y = x + toint - toint - x; + /* special case because of non-nearest rounding modes */ + if (e <= 0x3fff-1) { + FORCE_EVAL(y); + return u.i.se >> 15 ? -0.0 : 1; + } + if (y < 0) + return x + y + 1; + return x + y; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/copysign.c b/lib/mlibc/options/ansi/musl-generic-math/copysign.c new file mode 100644 index 0000000..b09331b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/copysign.c @@ -0,0 +1,8 @@ +#include "libm.h" + +double copysign(double x, double y) { + union {double f; uint64_t i;} ux={x}, uy={y}; + ux.i &= -1ULL/2; + ux.i |= uy.i & 1ULL<<63; + return ux.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/copysignf.c b/lib/mlibc/options/ansi/musl-generic-math/copysignf.c new file mode 100644 index 0000000..0af6ae9 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/copysignf.c @@ -0,0 +1,10 @@ +#include <math.h> +#include <stdint.h> + +float copysignf(float x, float y) +{ + union {float f; uint32_t i;} ux={x}, uy={y}; + ux.i &= 0x7fffffff; + ux.i |= uy.i & 0x80000000; + return ux.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/copysignl.c b/lib/mlibc/options/ansi/musl-generic-math/copysignl.c new file mode 100644 index 0000000..9dd933c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/copysignl.c @@ -0,0 +1,16 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double copysignl(long double x, long double y) +{ + return copysign(x, y); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double copysignl(long double x, long double y) +{ + union ldshape ux = {x}, uy = {y}; + ux.i.se &= 0x7fff; + ux.i.se |= uy.i.se & 0x8000; + return ux.f; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/cos.c b/lib/mlibc/options/ansi/musl-generic-math/cos.c new file mode 100644 index 0000000..ee97f68 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/cos.c @@ -0,0 +1,77 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cos.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* cos(x) + * Return cosine function of x. + * + * kernel function: + * __sin ... sine function on [-pi/4,pi/4] + * __cos ... cosine function on [-pi/4,pi/4] + * __rem_pio2 ... argument reduction routine + * + * Method. + * Let S,C and T denote the sin, cos and tan respectively on + * [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 + * in [-pi/4 , +pi/4], and let n = k mod 4. + * We have + * + * n sin(x) cos(x) tan(x) + * ---------------------------------------------------------- + * 0 S C T + * 1 C -S -1/T + * 2 -S -C T + * 3 -C S -1/T + * ---------------------------------------------------------- + * + * Special cases: + * Let trig be any of sin, cos, or tan. + * trig(+-INF) is NaN, with signals; + * trig(NaN) is that NaN; + * + * Accuracy: + * TRIG(x) returns trig(x) nearly rounded + */ + +#include "libm.h" + +double cos(double x) +{ + double y[2]; + uint32_t ix; + unsigned n; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* |x| ~< pi/4 */ + if (ix <= 0x3fe921fb) { + if (ix < 0x3e46a09e) { /* |x| < 2**-27 * sqrt(2) */ + /* raise inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + return 1.0; + } + return __cos(x, 0); + } + + /* cos(Inf or NaN) is NaN */ + if (ix >= 0x7ff00000) + return x-x; + + /* argument reduction */ + n = __rem_pio2(x, y); + switch (n&3) { + case 0: return __cos(y[0], y[1]); + case 1: return -__sin(y[0], y[1], 1); + case 2: return -__cos(y[0], y[1]); + default: + return __sin(y[0], y[1], 1); + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/cosf.c b/lib/mlibc/options/ansi/musl-generic-math/cosf.c new file mode 100644 index 0000000..23f3e5b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/cosf.c @@ -0,0 +1,78 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cosf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* Small multiples of pi/2 rounded to double precision. */ +static const double +c1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ +c2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ +c3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ +c4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + +float cosf(float x) +{ + double y; + uint32_t ix; + unsigned n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x != 0 */ + FORCE_EVAL(x + 0x1p120f); + return 1.0f; + } + return __cosdf(x); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix > 0x4016cbe3) /* |x| ~> 3*pi/4 */ + return -__cosdf(sign ? x+c2pio2 : x-c2pio2); + else { + if (sign) + return __sindf(x + c1pio2); + else + return __sindf(c1pio2 - x); + } + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix > 0x40afeddf) /* |x| ~> 7*pi/4 */ + return __cosdf(sign ? x+c4pio2 : x-c4pio2); + else { + if (sign) + return __sindf(-x - c3pio2); + else + return __sindf(x - c3pio2); + } + } + + /* cos(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x-x; + + /* general argument reduction needed */ + n = __rem_pio2f(x,&y); + switch (n&3) { + case 0: return __cosdf(y); + case 1: return __sindf(-y); + case 2: return -__cosdf(y); + default: + return __sindf(y); + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/cosh.c b/lib/mlibc/options/ansi/musl-generic-math/cosh.c new file mode 100644 index 0000000..100f823 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/cosh.c @@ -0,0 +1,40 @@ +#include "libm.h" + +/* cosh(x) = (exp(x) + 1/exp(x))/2 + * = 1 + 0.5*(exp(x)-1)*(exp(x)-1)/exp(x) + * = 1 + x*x/2 + o(x^4) + */ +double cosh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + uint32_t w; + double t; + + /* |x| */ + u.i &= (uint64_t)-1/2; + x = u.f; + w = u.i >> 32; + + /* |x| < log(2) */ + if (w < 0x3fe62e42) { + if (w < 0x3ff00000 - (26<<20)) { + /* raise inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + return 1; + } + t = expm1(x); + return 1 + t*t/(2*(1+t)); + } + + /* |x| < log(DBL_MAX) */ + if (w < 0x40862e42) { + t = exp(x); + /* note: if x>log(0x1p26) then the 1/t is not needed */ + return 0.5*(t + 1/t); + } + + /* |x| > log(DBL_MAX) or nan */ + /* note: the result is stored to handle overflow */ + t = __expo2(x); + return t; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/coshf.c b/lib/mlibc/options/ansi/musl-generic-math/coshf.c new file mode 100644 index 0000000..b09f2ee --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/coshf.c @@ -0,0 +1,33 @@ +#include "libm.h" + +float coshf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + uint32_t w; + float t; + + /* |x| */ + u.i &= 0x7fffffff; + x = u.f; + w = u.i; + + /* |x| < log(2) */ + if (w < 0x3f317217) { + if (w < 0x3f800000 - (12<<23)) { + FORCE_EVAL(x + 0x1p120f); + return 1; + } + t = expm1f(x); + return 1 + t*t/(2*(1+t)); + } + + /* |x| < log(FLT_MAX) */ + if (w < 0x42b17217) { + t = expf(x); + return 0.5f*(t + 1/t); + } + + /* |x| > log(FLT_MAX) or nan */ + t = __expo2f(x); + return t; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/coshl.c b/lib/mlibc/options/ansi/musl-generic-math/coshl.c new file mode 100644 index 0000000..06a56fe --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/coshl.c @@ -0,0 +1,47 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double coshl(long double x) +{ + return cosh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +long double coshl(long double x) +{ + union ldshape u = {x}; + unsigned ex = u.i.se & 0x7fff; + uint32_t w; + long double t; + + /* |x| */ + u.i.se = ex; + x = u.f; + w = u.i.m >> 32; + + /* |x| < log(2) */ + if (ex < 0x3fff-1 || (ex == 0x3fff-1 && w < 0xb17217f7)) { + if (ex < 0x3fff-32) { + FORCE_EVAL(x + 0x1p120f); + return 1; + } + t = expm1l(x); + return 1 + t*t/(2*(1+t)); + } + + /* |x| < log(LDBL_MAX) */ + if (ex < 0x3fff+13 || (ex == 0x3fff+13 && w < 0xb17217f7)) { + t = expl(x); + return 0.5*(t + 1/t); + } + + /* |x| > log(LDBL_MAX) or nan */ + t = expl(0.5*x); + return 0.5*t*t; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double coshl(long double x) +{ + return cosh(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/cosl.c b/lib/mlibc/options/ansi/musl-generic-math/cosl.c new file mode 100644 index 0000000..79c41c7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/cosl.c @@ -0,0 +1,39 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double cosl(long double x) { + return cos(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double cosl(long double x) +{ + union ldshape u = {x}; + unsigned n; + long double y[2], hi, lo; + + u.i.se &= 0x7fff; + if (u.i.se == 0x7fff) + return x - x; + x = u.f; + if (x < M_PI_4) { + if (u.i.se < 0x3fff - LDBL_MANT_DIG) + /* raise inexact if x!=0 */ + return 1.0 + x; + return __cosl(x, 0); + } + n = __rem_pio2l(x, y); + hi = y[0]; + lo = y[1]; + switch (n & 3) { + case 0: + return __cosl(hi, lo); + case 1: + return -__sinl(hi, lo, 1); + case 2: + return -__cosl(hi, lo); + case 3: + default: + return __sinl(hi, lo, 1); + } +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/erf.c b/lib/mlibc/options/ansi/musl-generic-math/erf.c new file mode 100644 index 0000000..2f30a29 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/erf.c @@ -0,0 +1,273 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_erf.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* double erf(double x) + * double erfc(double x) + * x + * 2 |\ + * erf(x) = --------- | exp(-t*t)dt + * sqrt(pi) \| + * 0 + * + * erfc(x) = 1-erf(x) + * Note that + * erf(-x) = -erf(x) + * erfc(-x) = 2 - erfc(x) + * + * Method: + * 1. For |x| in [0, 0.84375] + * erf(x) = x + x*R(x^2) + * erfc(x) = 1 - erf(x) if x in [-.84375,0.25] + * = 0.5 + ((0.5-x)-x*R) if x in [0.25,0.84375] + * where R = P/Q where P is an odd poly of degree 8 and + * Q is an odd poly of degree 10. + * -57.90 + * | R - (erf(x)-x)/x | <= 2 + * + * + * Remark. The formula is derived by noting + * erf(x) = (2/sqrt(pi))*(x - x^3/3 + x^5/10 - x^7/42 + ....) + * and that + * 2/sqrt(pi) = 1.128379167095512573896158903121545171688 + * is close to one. The interval is chosen because the fix + * point of erf(x) is near 0.6174 (i.e., erf(x)=x when x is + * near 0.6174), and by some experiment, 0.84375 is chosen to + * guarantee the error is less than one ulp for erf. + * + * 2. For |x| in [0.84375,1.25], let s = |x| - 1, and + * c = 0.84506291151 rounded to single (24 bits) + * erf(x) = sign(x) * (c + P1(s)/Q1(s)) + * erfc(x) = (1-c) - P1(s)/Q1(s) if x > 0 + * 1+(c+P1(s)/Q1(s)) if x < 0 + * |P1/Q1 - (erf(|x|)-c)| <= 2**-59.06 + * Remark: here we use the taylor series expansion at x=1. + * erf(1+s) = erf(1) + s*Poly(s) + * = 0.845.. + P1(s)/Q1(s) + * That is, we use rational approximation to approximate + * erf(1+s) - (c = (single)0.84506291151) + * Note that |P1/Q1|< 0.078 for x in [0.84375,1.25] + * where + * P1(s) = degree 6 poly in s + * Q1(s) = degree 6 poly in s + * + * 3. For x in [1.25,1/0.35(~2.857143)], + * erfc(x) = (1/x)*exp(-x*x-0.5625+R1/S1) + * erf(x) = 1 - erfc(x) + * where + * R1(z) = degree 7 poly in z, (z=1/x^2) + * S1(z) = degree 8 poly in z + * + * 4. For x in [1/0.35,28] + * erfc(x) = (1/x)*exp(-x*x-0.5625+R2/S2) if x > 0 + * = 2.0 - (1/x)*exp(-x*x-0.5625+R2/S2) if -6<x<0 + * = 2.0 - tiny (if x <= -6) + * erf(x) = sign(x)*(1.0 - erfc(x)) if x < 6, else + * erf(x) = sign(x)*(1.0 - tiny) + * where + * R2(z) = degree 6 poly in z, (z=1/x^2) + * S2(z) = degree 7 poly in z + * + * Note1: + * To compute exp(-x*x-0.5625+R/S), let s be a single + * precision number and s := x; then + * -x*x = -s*s + (s-x)*(s+x) + * exp(-x*x-0.5626+R/S) = + * exp(-s*s-0.5625)*exp((s-x)*(s+x)+R/S); + * Note2: + * Here 4 and 5 make use of the asymptotic series + * exp(-x*x) + * erfc(x) ~ ---------- * ( 1 + Poly(1/x^2) ) + * x*sqrt(pi) + * We use rational approximation to approximate + * g(s)=f(1/x^2) = log(erfc(x)*x) - x*x + 0.5625 + * Here is the error bound for R1/S1 and R2/S2 + * |R1/S1 - f(x)| < 2**(-62.57) + * |R2/S2 - f(x)| < 2**(-61.52) + * + * 5. For inf > x >= 28 + * erf(x) = sign(x) *(1 - tiny) (raise inexact) + * erfc(x) = tiny*tiny (raise underflow) if x > 0 + * = 2 - tiny if x<0 + * + * 7. Special case: + * erf(0) = 0, erf(inf) = 1, erf(-inf) = -1, + * erfc(0) = 1, erfc(inf) = 0, erfc(-inf) = 2, + * erfc/erf(NaN) is NaN + */ + +#include "libm.h" + +static const double +erx = 8.45062911510467529297e-01, /* 0x3FEB0AC1, 0x60000000 */ +/* + * Coefficients for approximation to erf on [0,0.84375] + */ +efx8 = 1.02703333676410069053e+00, /* 0x3FF06EBA, 0x8214DB69 */ +pp0 = 1.28379167095512558561e-01, /* 0x3FC06EBA, 0x8214DB68 */ +pp1 = -3.25042107247001499370e-01, /* 0xBFD4CD7D, 0x691CB913 */ +pp2 = -2.84817495755985104766e-02, /* 0xBF9D2A51, 0xDBD7194F */ +pp3 = -5.77027029648944159157e-03, /* 0xBF77A291, 0x236668E4 */ +pp4 = -2.37630166566501626084e-05, /* 0xBEF8EAD6, 0x120016AC */ +qq1 = 3.97917223959155352819e-01, /* 0x3FD97779, 0xCDDADC09 */ +qq2 = 6.50222499887672944485e-02, /* 0x3FB0A54C, 0x5536CEBA */ +qq3 = 5.08130628187576562776e-03, /* 0x3F74D022, 0xC4D36B0F */ +qq4 = 1.32494738004321644526e-04, /* 0x3F215DC9, 0x221C1A10 */ +qq5 = -3.96022827877536812320e-06, /* 0xBED09C43, 0x42A26120 */ +/* + * Coefficients for approximation to erf in [0.84375,1.25] + */ +pa0 = -2.36211856075265944077e-03, /* 0xBF6359B8, 0xBEF77538 */ +pa1 = 4.14856118683748331666e-01, /* 0x3FDA8D00, 0xAD92B34D */ +pa2 = -3.72207876035701323847e-01, /* 0xBFD7D240, 0xFBB8C3F1 */ +pa3 = 3.18346619901161753674e-01, /* 0x3FD45FCA, 0x805120E4 */ +pa4 = -1.10894694282396677476e-01, /* 0xBFBC6398, 0x3D3E28EC */ +pa5 = 3.54783043256182359371e-02, /* 0x3FA22A36, 0x599795EB */ +pa6 = -2.16637559486879084300e-03, /* 0xBF61BF38, 0x0A96073F */ +qa1 = 1.06420880400844228286e-01, /* 0x3FBB3E66, 0x18EEE323 */ +qa2 = 5.40397917702171048937e-01, /* 0x3FE14AF0, 0x92EB6F33 */ +qa3 = 7.18286544141962662868e-02, /* 0x3FB2635C, 0xD99FE9A7 */ +qa4 = 1.26171219808761642112e-01, /* 0x3FC02660, 0xE763351F */ +qa5 = 1.36370839120290507362e-02, /* 0x3F8BEDC2, 0x6B51DD1C */ +qa6 = 1.19844998467991074170e-02, /* 0x3F888B54, 0x5735151D */ +/* + * Coefficients for approximation to erfc in [1.25,1/0.35] + */ +ra0 = -9.86494403484714822705e-03, /* 0xBF843412, 0x600D6435 */ +ra1 = -6.93858572707181764372e-01, /* 0xBFE63416, 0xE4BA7360 */ +ra2 = -1.05586262253232909814e+01, /* 0xC0251E04, 0x41B0E726 */ +ra3 = -6.23753324503260060396e+01, /* 0xC04F300A, 0xE4CBA38D */ +ra4 = -1.62396669462573470355e+02, /* 0xC0644CB1, 0x84282266 */ +ra5 = -1.84605092906711035994e+02, /* 0xC067135C, 0xEBCCABB2 */ +ra6 = -8.12874355063065934246e+01, /* 0xC0545265, 0x57E4D2F2 */ +ra7 = -9.81432934416914548592e+00, /* 0xC023A0EF, 0xC69AC25C */ +sa1 = 1.96512716674392571292e+01, /* 0x4033A6B9, 0xBD707687 */ +sa2 = 1.37657754143519042600e+02, /* 0x4061350C, 0x526AE721 */ +sa3 = 4.34565877475229228821e+02, /* 0x407B290D, 0xD58A1A71 */ +sa4 = 6.45387271733267880336e+02, /* 0x40842B19, 0x21EC2868 */ +sa5 = 4.29008140027567833386e+02, /* 0x407AD021, 0x57700314 */ +sa6 = 1.08635005541779435134e+02, /* 0x405B28A3, 0xEE48AE2C */ +sa7 = 6.57024977031928170135e+00, /* 0x401A47EF, 0x8E484A93 */ +sa8 = -6.04244152148580987438e-02, /* 0xBFAEEFF2, 0xEE749A62 */ +/* + * Coefficients for approximation to erfc in [1/.35,28] + */ +rb0 = -9.86494292470009928597e-03, /* 0xBF843412, 0x39E86F4A */ +rb1 = -7.99283237680523006574e-01, /* 0xBFE993BA, 0x70C285DE */ +rb2 = -1.77579549177547519889e+01, /* 0xC031C209, 0x555F995A */ +rb3 = -1.60636384855821916062e+02, /* 0xC064145D, 0x43C5ED98 */ +rb4 = -6.37566443368389627722e+02, /* 0xC083EC88, 0x1375F228 */ +rb5 = -1.02509513161107724954e+03, /* 0xC0900461, 0x6A2E5992 */ +rb6 = -4.83519191608651397019e+02, /* 0xC07E384E, 0x9BDC383F */ +sb1 = 3.03380607434824582924e+01, /* 0x403E568B, 0x261D5190 */ +sb2 = 3.25792512996573918826e+02, /* 0x40745CAE, 0x221B9F0A */ +sb3 = 1.53672958608443695994e+03, /* 0x409802EB, 0x189D5118 */ +sb4 = 3.19985821950859553908e+03, /* 0x40A8FFB7, 0x688C246A */ +sb5 = 2.55305040643316442583e+03, /* 0x40A3F219, 0xCEDF3BE6 */ +sb6 = 4.74528541206955367215e+02, /* 0x407DA874, 0xE79FE763 */ +sb7 = -2.24409524465858183362e+01; /* 0xC03670E2, 0x42712D62 */ + +static double erfc1(double x) +{ + double_t s,P,Q; + + s = fabs(x) - 1; + P = pa0+s*(pa1+s*(pa2+s*(pa3+s*(pa4+s*(pa5+s*pa6))))); + Q = 1+s*(qa1+s*(qa2+s*(qa3+s*(qa4+s*(qa5+s*qa6))))); + return 1 - erx - P/Q; +} + +static double erfc2(uint32_t ix, double x) +{ + double_t s,R,S; + double z; + + if (ix < 0x3ff40000) /* |x| < 1.25 */ + return erfc1(x); + + x = fabs(x); + s = 1/(x*x); + if (ix < 0x4006db6d) { /* |x| < 1/.35 ~ 2.85714 */ + R = ra0+s*(ra1+s*(ra2+s*(ra3+s*(ra4+s*( + ra5+s*(ra6+s*ra7)))))); + S = 1.0+s*(sa1+s*(sa2+s*(sa3+s*(sa4+s*( + sa5+s*(sa6+s*(sa7+s*sa8))))))); + } else { /* |x| > 1/.35 */ + R = rb0+s*(rb1+s*(rb2+s*(rb3+s*(rb4+s*( + rb5+s*rb6))))); + S = 1.0+s*(sb1+s*(sb2+s*(sb3+s*(sb4+s*( + sb5+s*(sb6+s*sb7)))))); + } + z = x; + SET_LOW_WORD(z,0); + return exp(-z*z-0.5625)*exp((z-x)*(z+x)+R/S)/x; +} + +double erf(double x) +{ + double r,s,z,y; + uint32_t ix; + int sign; + + GET_HIGH_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7ff00000) { + /* erf(nan)=nan, erf(+-inf)=+-1 */ + return 1-2*sign + 1/x; + } + if (ix < 0x3feb0000) { /* |x| < 0.84375 */ + if (ix < 0x3e300000) { /* |x| < 2**-28 */ + /* avoid underflow */ + return 0.125*(8*x + efx8*x); + } + z = x*x; + r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4))); + s = 1.0+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5)))); + y = r/s; + return x + x*y; + } + if (ix < 0x40180000) /* 0.84375 <= |x| < 6 */ + y = 1 - erfc2(ix,x); + else + y = 1 - 0x1p-1022; + return sign ? -y : y; +} + +double erfc(double x) +{ + double r,s,z,y; + uint32_t ix; + int sign; + + GET_HIGH_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7ff00000) { + /* erfc(nan)=nan, erfc(+-inf)=0,2 */ + return 2*sign + 1/x; + } + if (ix < 0x3feb0000) { /* |x| < 0.84375 */ + if (ix < 0x3c700000) /* |x| < 2**-56 */ + return 1.0 - x; + z = x*x; + r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4))); + s = 1.0+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5)))); + y = r/s; + if (sign || ix < 0x3fd00000) { /* x < 1/4 */ + return 1.0 - (x+x*y); + } + return 0.5 - (x - 0.5 + x*y); + } + if (ix < 0x403c0000) { /* 0.84375 <= |x| < 28 */ + return sign ? 2 - erfc2(ix,x) : erfc2(ix,x); + } + return sign ? 2 - 0x1p-1022 : 0x1p-1022*0x1p-1022; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/erff.c b/lib/mlibc/options/ansi/musl-generic-math/erff.c new file mode 100644 index 0000000..ed5f397 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/erff.c @@ -0,0 +1,183 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_erff.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +erx = 8.4506291151e-01, /* 0x3f58560b */ +/* + * Coefficients for approximation to erf on [0,0.84375] + */ +efx8 = 1.0270333290e+00, /* 0x3f8375d4 */ +pp0 = 1.2837916613e-01, /* 0x3e0375d4 */ +pp1 = -3.2504209876e-01, /* 0xbea66beb */ +pp2 = -2.8481749818e-02, /* 0xbce9528f */ +pp3 = -5.7702702470e-03, /* 0xbbbd1489 */ +pp4 = -2.3763017452e-05, /* 0xb7c756b1 */ +qq1 = 3.9791721106e-01, /* 0x3ecbbbce */ +qq2 = 6.5022252500e-02, /* 0x3d852a63 */ +qq3 = 5.0813062117e-03, /* 0x3ba68116 */ +qq4 = 1.3249473704e-04, /* 0x390aee49 */ +qq5 = -3.9602282413e-06, /* 0xb684e21a */ +/* + * Coefficients for approximation to erf in [0.84375,1.25] + */ +pa0 = -2.3621185683e-03, /* 0xbb1acdc6 */ +pa1 = 4.1485610604e-01, /* 0x3ed46805 */ +pa2 = -3.7220788002e-01, /* 0xbebe9208 */ +pa3 = 3.1834661961e-01, /* 0x3ea2fe54 */ +pa4 = -1.1089469492e-01, /* 0xbde31cc2 */ +pa5 = 3.5478305072e-02, /* 0x3d1151b3 */ +pa6 = -2.1663755178e-03, /* 0xbb0df9c0 */ +qa1 = 1.0642088205e-01, /* 0x3dd9f331 */ +qa2 = 5.4039794207e-01, /* 0x3f0a5785 */ +qa3 = 7.1828655899e-02, /* 0x3d931ae7 */ +qa4 = 1.2617121637e-01, /* 0x3e013307 */ +qa5 = 1.3637083583e-02, /* 0x3c5f6e13 */ +qa6 = 1.1984500103e-02, /* 0x3c445aa3 */ +/* + * Coefficients for approximation to erfc in [1.25,1/0.35] + */ +ra0 = -9.8649440333e-03, /* 0xbc21a093 */ +ra1 = -6.9385856390e-01, /* 0xbf31a0b7 */ +ra2 = -1.0558626175e+01, /* 0xc128f022 */ +ra3 = -6.2375331879e+01, /* 0xc2798057 */ +ra4 = -1.6239666748e+02, /* 0xc322658c */ +ra5 = -1.8460508728e+02, /* 0xc3389ae7 */ +ra6 = -8.1287437439e+01, /* 0xc2a2932b */ +ra7 = -9.8143291473e+00, /* 0xc11d077e */ +sa1 = 1.9651271820e+01, /* 0x419d35ce */ +sa2 = 1.3765776062e+02, /* 0x4309a863 */ +sa3 = 4.3456588745e+02, /* 0x43d9486f */ +sa4 = 6.4538726807e+02, /* 0x442158c9 */ +sa5 = 4.2900814819e+02, /* 0x43d6810b */ +sa6 = 1.0863500214e+02, /* 0x42d9451f */ +sa7 = 6.5702495575e+00, /* 0x40d23f7c */ +sa8 = -6.0424413532e-02, /* 0xbd777f97 */ +/* + * Coefficients for approximation to erfc in [1/.35,28] + */ +rb0 = -9.8649431020e-03, /* 0xbc21a092 */ +rb1 = -7.9928326607e-01, /* 0xbf4c9dd4 */ +rb2 = -1.7757955551e+01, /* 0xc18e104b */ +rb3 = -1.6063638306e+02, /* 0xc320a2ea */ +rb4 = -6.3756646729e+02, /* 0xc41f6441 */ +rb5 = -1.0250950928e+03, /* 0xc480230b */ +rb6 = -4.8351919556e+02, /* 0xc3f1c275 */ +sb1 = 3.0338060379e+01, /* 0x41f2b459 */ +sb2 = 3.2579251099e+02, /* 0x43a2e571 */ +sb3 = 1.5367296143e+03, /* 0x44c01759 */ +sb4 = 3.1998581543e+03, /* 0x4547fdbb */ +sb5 = 2.5530502930e+03, /* 0x451f90ce */ +sb6 = 4.7452853394e+02, /* 0x43ed43a7 */ +sb7 = -2.2440952301e+01; /* 0xc1b38712 */ + +static float erfc1(float x) +{ + float_t s,P,Q; + + s = fabsf(x) - 1; + P = pa0+s*(pa1+s*(pa2+s*(pa3+s*(pa4+s*(pa5+s*pa6))))); + Q = 1+s*(qa1+s*(qa2+s*(qa3+s*(qa4+s*(qa5+s*qa6))))); + return 1 - erx - P/Q; +} + +static float erfc2(uint32_t ix, float x) +{ + float_t s,R,S; + float z; + + if (ix < 0x3fa00000) /* |x| < 1.25 */ + return erfc1(x); + + x = fabsf(x); + s = 1/(x*x); + if (ix < 0x4036db6d) { /* |x| < 1/0.35 */ + R = ra0+s*(ra1+s*(ra2+s*(ra3+s*(ra4+s*( + ra5+s*(ra6+s*ra7)))))); + S = 1.0f+s*(sa1+s*(sa2+s*(sa3+s*(sa4+s*( + sa5+s*(sa6+s*(sa7+s*sa8))))))); + } else { /* |x| >= 1/0.35 */ + R = rb0+s*(rb1+s*(rb2+s*(rb3+s*(rb4+s*( + rb5+s*rb6))))); + S = 1.0f+s*(sb1+s*(sb2+s*(sb3+s*(sb4+s*( + sb5+s*(sb6+s*sb7)))))); + } + GET_FLOAT_WORD(ix, x); + SET_FLOAT_WORD(z, ix&0xffffe000); + return expf(-z*z - 0.5625f) * expf((z-x)*(z+x) + R/S)/x; +} + +float erff(float x) +{ + float r,s,z,y; + uint32_t ix; + int sign; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7f800000) { + /* erf(nan)=nan, erf(+-inf)=+-1 */ + return 1-2*sign + 1/x; + } + if (ix < 0x3f580000) { /* |x| < 0.84375 */ + if (ix < 0x31800000) { /* |x| < 2**-28 */ + /*avoid underflow */ + return 0.125f*(8*x + efx8*x); + } + z = x*x; + r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4))); + s = 1+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5)))); + y = r/s; + return x + x*y; + } + if (ix < 0x40c00000) /* |x| < 6 */ + y = 1 - erfc2(ix,x); + else + y = 1 - 0x1p-120f; + return sign ? -y : y; +} + +float erfcf(float x) +{ + float r,s,z,y; + uint32_t ix; + int sign; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7f800000) { + /* erfc(nan)=nan, erfc(+-inf)=0,2 */ + return 2*sign + 1/x; + } + + if (ix < 0x3f580000) { /* |x| < 0.84375 */ + if (ix < 0x23800000) /* |x| < 2**-56 */ + return 1.0f - x; + z = x*x; + r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4))); + s = 1.0f+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5)))); + y = r/s; + if (sign || ix < 0x3e800000) /* x < 1/4 */ + return 1.0f - (x+x*y); + return 0.5f - (x - 0.5f + x*y); + } + if (ix < 0x41e00000) { /* |x| < 28 */ + return sign ? 2 - erfc2(ix,x) : erfc2(ix,x); + } + return sign ? 2 - 0x1p-120f : 0x1p-120f*0x1p-120f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/erfl.c b/lib/mlibc/options/ansi/musl-generic-math/erfl.c new file mode 100644 index 0000000..e267c23 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/erfl.c @@ -0,0 +1,353 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_erfl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* double erf(double x) + * double erfc(double x) + * x + * 2 |\ + * erf(x) = --------- | exp(-t*t)dt + * sqrt(pi) \| + * 0 + * + * erfc(x) = 1-erf(x) + * Note that + * erf(-x) = -erf(x) + * erfc(-x) = 2 - erfc(x) + * + * Method: + * 1. For |x| in [0, 0.84375] + * erf(x) = x + x*R(x^2) + * erfc(x) = 1 - erf(x) if x in [-.84375,0.25] + * = 0.5 + ((0.5-x)-x*R) if x in [0.25,0.84375] + * Remark. The formula is derived by noting + * erf(x) = (2/sqrt(pi))*(x - x^3/3 + x^5/10 - x^7/42 + ....) + * and that + * 2/sqrt(pi) = 1.128379167095512573896158903121545171688 + * is close to one. The interval is chosen because the fix + * point of erf(x) is near 0.6174 (i.e., erf(x)=x when x is + * near 0.6174), and by some experiment, 0.84375 is chosen to + * guarantee the error is less than one ulp for erf. + * + * 2. For |x| in [0.84375,1.25], let s = |x| - 1, and + * c = 0.84506291151 rounded to single (24 bits) + * erf(x) = sign(x) * (c + P1(s)/Q1(s)) + * erfc(x) = (1-c) - P1(s)/Q1(s) if x > 0 + * 1+(c+P1(s)/Q1(s)) if x < 0 + * Remark: here we use the taylor series expansion at x=1. + * erf(1+s) = erf(1) + s*Poly(s) + * = 0.845.. + P1(s)/Q1(s) + * Note that |P1/Q1|< 0.078 for x in [0.84375,1.25] + * + * 3. For x in [1.25,1/0.35(~2.857143)], + * erfc(x) = (1/x)*exp(-x*x-0.5625+R1(z)/S1(z)) + * z=1/x^2 + * erf(x) = 1 - erfc(x) + * + * 4. For x in [1/0.35,107] + * erfc(x) = (1/x)*exp(-x*x-0.5625+R2/S2) if x > 0 + * = 2.0 - (1/x)*exp(-x*x-0.5625+R2(z)/S2(z)) + * if -6.666<x<0 + * = 2.0 - tiny (if x <= -6.666) + * z=1/x^2 + * erf(x) = sign(x)*(1.0 - erfc(x)) if x < 6.666, else + * erf(x) = sign(x)*(1.0 - tiny) + * Note1: + * To compute exp(-x*x-0.5625+R/S), let s be a single + * precision number and s := x; then + * -x*x = -s*s + (s-x)*(s+x) + * exp(-x*x-0.5626+R/S) = + * exp(-s*s-0.5625)*exp((s-x)*(s+x)+R/S); + * Note2: + * Here 4 and 5 make use of the asymptotic series + * exp(-x*x) + * erfc(x) ~ ---------- * ( 1 + Poly(1/x^2) ) + * x*sqrt(pi) + * + * 5. For inf > x >= 107 + * erf(x) = sign(x) *(1 - tiny) (raise inexact) + * erfc(x) = tiny*tiny (raise underflow) if x > 0 + * = 2 - tiny if x<0 + * + * 7. Special case: + * erf(0) = 0, erf(inf) = 1, erf(-inf) = -1, + * erfc(0) = 1, erfc(inf) = 0, erfc(-inf) = 2, + * erfc/erf(NaN) is NaN + */ + + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double erfl(long double x) +{ + return erf(x); +} +long double erfcl(long double x) +{ + return erfc(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +static const long double +erx = 0.845062911510467529296875L, + +/* + * Coefficients for approximation to erf on [0,0.84375] + */ +/* 8 * (2/sqrt(pi) - 1) */ +efx8 = 1.0270333367641005911692712249723613735048E0L, +pp[6] = { + 1.122751350964552113068262337278335028553E6L, + -2.808533301997696164408397079650699163276E6L, + -3.314325479115357458197119660818768924100E5L, + -6.848684465326256109712135497895525446398E4L, + -2.657817695110739185591505062971929859314E3L, + -1.655310302737837556654146291646499062882E2L, +}, +qq[6] = { + 8.745588372054466262548908189000448124232E6L, + 3.746038264792471129367533128637019611485E6L, + 7.066358783162407559861156173539693900031E5L, + 7.448928604824620999413120955705448117056E4L, + 4.511583986730994111992253980546131408924E3L, + 1.368902937933296323345610240009071254014E2L, + /* 1.000000000000000000000000000000000000000E0 */ +}, + +/* + * Coefficients for approximation to erf in [0.84375,1.25] + */ +/* erf(x+1) = 0.845062911510467529296875 + pa(x)/qa(x) + -0.15625 <= x <= +.25 + Peak relative error 8.5e-22 */ +pa[8] = { + -1.076952146179812072156734957705102256059E0L, + 1.884814957770385593365179835059971587220E2L, + -5.339153975012804282890066622962070115606E1L, + 4.435910679869176625928504532109635632618E1L, + 1.683219516032328828278557309642929135179E1L, + -2.360236618396952560064259585299045804293E0L, + 1.852230047861891953244413872297940938041E0L, + 9.394994446747752308256773044667843200719E-2L, +}, +qa[7] = { + 4.559263722294508998149925774781887811255E2L, + 3.289248982200800575749795055149780689738E2L, + 2.846070965875643009598627918383314457912E2L, + 1.398715859064535039433275722017479994465E2L, + 6.060190733759793706299079050985358190726E1L, + 2.078695677795422351040502569964299664233E1L, + 4.641271134150895940966798357442234498546E0L, + /* 1.000000000000000000000000000000000000000E0 */ +}, + +/* + * Coefficients for approximation to erfc in [1.25,1/0.35] + */ +/* erfc(1/x) = x exp (-1/x^2 - 0.5625 + ra(x^2)/sa(x^2)) + 1/2.85711669921875 < 1/x < 1/1.25 + Peak relative error 3.1e-21 */ +ra[] = { + 1.363566591833846324191000679620738857234E-1L, + 1.018203167219873573808450274314658434507E1L, + 1.862359362334248675526472871224778045594E2L, + 1.411622588180721285284945138667933330348E3L, + 5.088538459741511988784440103218342840478E3L, + 8.928251553922176506858267311750789273656E3L, + 7.264436000148052545243018622742770549982E3L, + 2.387492459664548651671894725748959751119E3L, + 2.220916652813908085449221282808458466556E2L, +}, +sa[] = { + -1.382234625202480685182526402169222331847E1L, + -3.315638835627950255832519203687435946482E2L, + -2.949124863912936259747237164260785326692E3L, + -1.246622099070875940506391433635999693661E4L, + -2.673079795851665428695842853070996219632E4L, + -2.880269786660559337358397106518918220991E4L, + -1.450600228493968044773354186390390823713E4L, + -2.874539731125893533960680525192064277816E3L, + -1.402241261419067750237395034116942296027E2L, + /* 1.000000000000000000000000000000000000000E0 */ +}, + +/* + * Coefficients for approximation to erfc in [1/.35,107] + */ +/* erfc(1/x) = x exp (-1/x^2 - 0.5625 + rb(x^2)/sb(x^2)) + 1/6.6666259765625 < 1/x < 1/2.85711669921875 + Peak relative error 4.2e-22 */ +rb[] = { + -4.869587348270494309550558460786501252369E-5L, + -4.030199390527997378549161722412466959403E-3L, + -9.434425866377037610206443566288917589122E-2L, + -9.319032754357658601200655161585539404155E-1L, + -4.273788174307459947350256581445442062291E0L, + -8.842289940696150508373541814064198259278E0L, + -7.069215249419887403187988144752613025255E0L, + -1.401228723639514787920274427443330704764E0L, +}, +sb[] = { + 4.936254964107175160157544545879293019085E-3L, + 1.583457624037795744377163924895349412015E-1L, + 1.850647991850328356622940552450636420484E0L, + 9.927611557279019463768050710008450625415E0L, + 2.531667257649436709617165336779212114570E1L, + 2.869752886406743386458304052862814690045E1L, + 1.182059497870819562441683560749192539345E1L, + /* 1.000000000000000000000000000000000000000E0 */ +}, +/* erfc(1/x) = x exp (-1/x^2 - 0.5625 + rc(x^2)/sc(x^2)) + 1/107 <= 1/x <= 1/6.6666259765625 + Peak relative error 1.1e-21 */ +rc[] = { + -8.299617545269701963973537248996670806850E-5L, + -6.243845685115818513578933902532056244108E-3L, + -1.141667210620380223113693474478394397230E-1L, + -7.521343797212024245375240432734425789409E-1L, + -1.765321928311155824664963633786967602934E0L, + -1.029403473103215800456761180695263439188E0L, +}, +sc[] = { + 8.413244363014929493035952542677768808601E-3L, + 2.065114333816877479753334599639158060979E-1L, + 1.639064941530797583766364412782135680148E0L, + 4.936788463787115555582319302981666347450E0L, + 5.005177727208955487404729933261347679090E0L, + /* 1.000000000000000000000000000000000000000E0 */ +}; + +static long double erfc1(long double x) +{ + long double s,P,Q; + + s = fabsl(x) - 1; + P = pa[0] + s * (pa[1] + s * (pa[2] + + s * (pa[3] + s * (pa[4] + s * (pa[5] + s * (pa[6] + s * pa[7])))))); + Q = qa[0] + s * (qa[1] + s * (qa[2] + + s * (qa[3] + s * (qa[4] + s * (qa[5] + s * (qa[6] + s)))))); + return 1 - erx - P / Q; +} + +static long double erfc2(uint32_t ix, long double x) +{ + union ldshape u; + long double s,z,R,S; + + if (ix < 0x3fffa000) /* 0.84375 <= |x| < 1.25 */ + return erfc1(x); + + x = fabsl(x); + s = 1 / (x * x); + if (ix < 0x4000b6db) { /* 1.25 <= |x| < 2.857 ~ 1/.35 */ + R = ra[0] + s * (ra[1] + s * (ra[2] + s * (ra[3] + s * (ra[4] + + s * (ra[5] + s * (ra[6] + s * (ra[7] + s * ra[8]))))))); + S = sa[0] + s * (sa[1] + s * (sa[2] + s * (sa[3] + s * (sa[4] + + s * (sa[5] + s * (sa[6] + s * (sa[7] + s * (sa[8] + s)))))))); + } else if (ix < 0x4001d555) { /* 2.857 <= |x| < 6.6666259765625 */ + R = rb[0] + s * (rb[1] + s * (rb[2] + s * (rb[3] + s * (rb[4] + + s * (rb[5] + s * (rb[6] + s * rb[7])))))); + S = sb[0] + s * (sb[1] + s * (sb[2] + s * (sb[3] + s * (sb[4] + + s * (sb[5] + s * (sb[6] + s)))))); + } else { /* 6.666 <= |x| < 107 (erfc only) */ + R = rc[0] + s * (rc[1] + s * (rc[2] + s * (rc[3] + + s * (rc[4] + s * rc[5])))); + S = sc[0] + s * (sc[1] + s * (sc[2] + s * (sc[3] + + s * (sc[4] + s)))); + } + u.f = x; + u.i.m &= -1ULL << 40; + z = u.f; + return expl(-z*z - 0.5625) * expl((z - x) * (z + x) + R / S) / x; +} + +long double erfl(long double x) +{ + long double r, s, z, y; + union ldshape u = {x}; + uint32_t ix = (u.i.se & 0x7fffU)<<16 | u.i.m>>48; + int sign = u.i.se >> 15; + + if (ix >= 0x7fff0000) + /* erf(nan)=nan, erf(+-inf)=+-1 */ + return 1 - 2*sign + 1/x; + if (ix < 0x3ffed800) { /* |x| < 0.84375 */ + if (ix < 0x3fde8000) { /* |x| < 2**-33 */ + return 0.125 * (8 * x + efx8 * x); /* avoid underflow */ + } + z = x * x; + r = pp[0] + z * (pp[1] + + z * (pp[2] + z * (pp[3] + z * (pp[4] + z * pp[5])))); + s = qq[0] + z * (qq[1] + + z * (qq[2] + z * (qq[3] + z * (qq[4] + z * (qq[5] + z))))); + y = r / s; + return x + x * y; + } + if (ix < 0x4001d555) /* |x| < 6.6666259765625 */ + y = 1 - erfc2(ix,x); + else + y = 1 - 0x1p-16382L; + return sign ? -y : y; +} + +long double erfcl(long double x) +{ + long double r, s, z, y; + union ldshape u = {x}; + uint32_t ix = (u.i.se & 0x7fffU)<<16 | u.i.m>>48; + int sign = u.i.se >> 15; + + if (ix >= 0x7fff0000) + /* erfc(nan) = nan, erfc(+-inf) = 0,2 */ + return 2*sign + 1/x; + if (ix < 0x3ffed800) { /* |x| < 0.84375 */ + if (ix < 0x3fbe0000) /* |x| < 2**-65 */ + return 1.0 - x; + z = x * x; + r = pp[0] + z * (pp[1] + + z * (pp[2] + z * (pp[3] + z * (pp[4] + z * pp[5])))); + s = qq[0] + z * (qq[1] + + z * (qq[2] + z * (qq[3] + z * (qq[4] + z * (qq[5] + z))))); + y = r / s; + if (ix < 0x3ffd8000) /* x < 1/4 */ + return 1.0 - (x + x * y); + return 0.5 - (x - 0.5 + x * y); + } + if (ix < 0x4005d600) /* |x| < 107 */ + return sign ? 2 - erfc2(ix,x) : erfc2(ix,x); + y = 0x1p-16382L; + return sign ? 2 - y : y*y; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double erfl(long double x) +{ + return erf(x); +} +long double erfcl(long double x) +{ + return erfc(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/exp.c b/lib/mlibc/options/ansi/musl-generic-math/exp.c new file mode 100644 index 0000000..9ea672f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/exp.c @@ -0,0 +1,134 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_exp.c */ +/* + * ==================================================== + * Copyright (C) 2004 by Sun Microsystems, Inc. All rights reserved. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* exp(x) + * Returns the exponential of x. + * + * Method + * 1. Argument reduction: + * Reduce x to an r so that |r| <= 0.5*ln2 ~ 0.34658. + * Given x, find r and integer k such that + * + * x = k*ln2 + r, |r| <= 0.5*ln2. + * + * Here r will be represented as r = hi-lo for better + * accuracy. + * + * 2. Approximation of exp(r) by a special rational function on + * the interval [0,0.34658]: + * Write + * R(r**2) = r*(exp(r)+1)/(exp(r)-1) = 2 + r*r/6 - r**4/360 + ... + * We use a special Remez algorithm on [0,0.34658] to generate + * a polynomial of degree 5 to approximate R. The maximum error + * of this polynomial approximation is bounded by 2**-59. In + * other words, + * R(z) ~ 2.0 + P1*z + P2*z**2 + P3*z**3 + P4*z**4 + P5*z**5 + * (where z=r*r, and the values of P1 to P5 are listed below) + * and + * | 5 | -59 + * | 2.0+P1*z+...+P5*z - R(z) | <= 2 + * | | + * The computation of exp(r) thus becomes + * 2*r + * exp(r) = 1 + ---------- + * R(r) - r + * r*c(r) + * = 1 + r + ----------- (for better accuracy) + * 2 - c(r) + * where + * 2 4 10 + * c(r) = r - (P1*r + P2*r + ... + P5*r ). + * + * 3. Scale back to obtain exp(x): + * From step 1, we have + * exp(x) = 2^k * exp(r) + * + * Special cases: + * exp(INF) is INF, exp(NaN) is NaN; + * exp(-INF) is 0, and + * for finite argument, only exp(0)=1 is exact. + * + * Accuracy: + * according to an error analysis, the error is always less than + * 1 ulp (unit in the last place). + * + * Misc. info. + * For IEEE double + * if x > 709.782712893383973096 then exp(x) overflows + * if x < -745.133219101941108420 then exp(x) underflows + */ + +#include "libm.h" + +static const double +half[2] = {0.5,-0.5}, +ln2hi = 6.93147180369123816490e-01, /* 0x3fe62e42, 0xfee00000 */ +ln2lo = 1.90821492927058770002e-10, /* 0x3dea39ef, 0x35793c76 */ +invln2 = 1.44269504088896338700e+00, /* 0x3ff71547, 0x652b82fe */ +P1 = 1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */ +P2 = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */ +P3 = 6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */ +P4 = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */ +P5 = 4.13813679705723846039e-08; /* 0x3E663769, 0x72BEA4D0 */ + +double exp(double x) +{ + double_t hi, lo, c, xx, y; + int k, sign; + uint32_t hx; + + GET_HIGH_WORD(hx, x); + sign = hx>>31; + hx &= 0x7fffffff; /* high word of |x| */ + + /* special cases */ + if (hx >= 0x4086232b) { /* if |x| >= 708.39... */ + if (isnan(x)) + return x; + if (x > 709.782712893383973096) { + /* overflow if x!=inf */ + x *= 0x1p1023; + return x; + } + if (x < -708.39641853226410622) { + /* underflow if x!=-inf */ + FORCE_EVAL((float)(-0x1p-149/x)); + if (x < -745.13321910194110842) + return 0; + } + } + + /* argument reduction */ + if (hx > 0x3fd62e42) { /* if |x| > 0.5 ln2 */ + if (hx >= 0x3ff0a2b2) /* if |x| >= 1.5 ln2 */ + k = (int)(invln2*x + half[sign]); + else + k = 1 - sign - sign; + hi = x - k*ln2hi; /* k*ln2hi is exact here */ + lo = k*ln2lo; + x = hi - lo; + } else if (hx > 0x3e300000) { /* if |x| > 2**-28 */ + k = 0; + hi = x; + lo = 0; + } else { + /* inexact if x!=0 */ + FORCE_EVAL(0x1p1023 + x); + return 1 + x; + } + + /* x is now in primary range */ + xx = x*x; + c = x - xx*(P1+xx*(P2+xx*(P3+xx*(P4+xx*P5)))); + y = 1 + (x*c/(2-c) - lo + hi); + if (k == 0) + return y; + return scalbn(y, k); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/exp10.c b/lib/mlibc/options/ansi/musl-generic-math/exp10.c new file mode 100644 index 0000000..47b4dc7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/exp10.c @@ -0,0 +1,26 @@ +#define _GNU_SOURCE +#include <math.h> +#include <stdint.h> +#include "weak_alias.h" +//#include "libc.h" + +double exp10(double x) +{ + static const double p10[] = { + 1e-15, 1e-14, 1e-13, 1e-12, 1e-11, 1e-10, + 1e-9, 1e-8, 1e-7, 1e-6, 1e-5, 1e-4, 1e-3, 1e-2, 1e-1, + 1, 1e1, 1e2, 1e3, 1e4, 1e5, 1e6, 1e7, 1e8, 1e9, + 1e10, 1e11, 1e12, 1e13, 1e14, 1e15 + }; + double n, y = modf(x, &n); + union {double f; uint64_t i;} u = {n}; + /* fabs(n) < 16 without raising invalid on nan */ + if ((u.i>>52 & 0x7ff) < 0x3ff+4) { + if (!y) return p10[(int)n+15]; + y = exp2(3.32192809488736234787031942948939 * y); + return y * p10[(int)n+15]; + } + return pow(10.0, x); +} + +weak_alias(exp10, pow10); diff --git a/lib/mlibc/options/ansi/musl-generic-math/exp10f.c b/lib/mlibc/options/ansi/musl-generic-math/exp10f.c new file mode 100644 index 0000000..74f8909 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/exp10f.c @@ -0,0 +1,24 @@ +#define _GNU_SOURCE +#include <math.h> +#include <stdint.h> +#include "weak_alias.h" +//#include "libc.h" + +float exp10f(float x) +{ + static const float p10[] = { + 1e-7f, 1e-6f, 1e-5f, 1e-4f, 1e-3f, 1e-2f, 1e-1f, + 1, 1e1, 1e2, 1e3, 1e4, 1e5, 1e6, 1e7 + }; + float n, y = modff(x, &n); + union {float f; uint32_t i;} u = {n}; + /* fabsf(n) < 8 without raising invalid on nan */ + if ((u.i>>23 & 0xff) < 0x7f+3) { + if (!y) return p10[(int)n+7]; + y = exp2f(3.32192809488736234787031942948939f * y); + return y * p10[(int)n+7]; + } + return exp2(3.32192809488736234787031942948939 * x); +} + +weak_alias(exp10f, pow10f); diff --git a/lib/mlibc/options/ansi/musl-generic-math/exp10l.c b/lib/mlibc/options/ansi/musl-generic-math/exp10l.c new file mode 100644 index 0000000..f18e554 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/exp10l.c @@ -0,0 +1,34 @@ +#define _GNU_SOURCE +#include <float.h> +#include <math.h> +//#include "libc.h" +#include "libm.h" +#include "weak_alias.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double exp10l(long double x) +{ + return exp10(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double exp10l(long double x) +{ + static const long double p10[] = { + 1e-15L, 1e-14L, 1e-13L, 1e-12L, 1e-11L, 1e-10L, + 1e-9L, 1e-8L, 1e-7L, 1e-6L, 1e-5L, 1e-4L, 1e-3L, 1e-2L, 1e-1L, + 1, 1e1, 1e2, 1e3, 1e4, 1e5, 1e6, 1e7, 1e8, 1e9, + 1e10, 1e11, 1e12, 1e13, 1e14, 1e15 + }; + long double n, y = modfl(x, &n); + union ldshape u = {n}; + /* fabsl(n) < 16 without raising invalid on nan */ + if ((u.i.se & 0x7fff) < 0x3fff+4) { + if (!y) return p10[(int)n+15]; + y = exp2l(3.32192809488736234787031942948939L * y); + return y * p10[(int)n+15]; + } + return powl(10.0, x); +} +#endif + +weak_alias(exp10l, pow10l); diff --git a/lib/mlibc/options/ansi/musl-generic-math/exp2.c b/lib/mlibc/options/ansi/musl-generic-math/exp2.c new file mode 100644 index 0000000..e14adba --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/exp2.c @@ -0,0 +1,375 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_exp2.c */ +/*- + * Copyright (c) 2005 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#include "libm.h" + +#define TBLSIZE 256 + +static const double +redux = 0x1.8p52 / TBLSIZE, +P1 = 0x1.62e42fefa39efp-1, +P2 = 0x1.ebfbdff82c575p-3, +P3 = 0x1.c6b08d704a0a6p-5, +P4 = 0x1.3b2ab88f70400p-7, +P5 = 0x1.5d88003875c74p-10; + +static const double tbl[TBLSIZE * 2] = { +/* exp2(z + eps) eps */ + 0x1.6a09e667f3d5dp-1, 0x1.9880p-44, + 0x1.6b052fa751744p-1, 0x1.8000p-50, + 0x1.6c012750bd9fep-1, -0x1.8780p-45, + 0x1.6cfdcddd476bfp-1, 0x1.ec00p-46, + 0x1.6dfb23c651a29p-1, -0x1.8000p-50, + 0x1.6ef9298593ae3p-1, -0x1.c000p-52, + 0x1.6ff7df9519386p-1, -0x1.fd80p-45, + 0x1.70f7466f42da3p-1, -0x1.c880p-45, + 0x1.71f75e8ec5fc3p-1, 0x1.3c00p-46, + 0x1.72f8286eacf05p-1, -0x1.8300p-44, + 0x1.73f9a48a58152p-1, -0x1.0c00p-47, + 0x1.74fbd35d7ccfcp-1, 0x1.f880p-45, + 0x1.75feb564267f1p-1, 0x1.3e00p-47, + 0x1.77024b1ab6d48p-1, -0x1.7d00p-45, + 0x1.780694fde5d38p-1, -0x1.d000p-50, + 0x1.790b938ac1d00p-1, 0x1.3000p-49, + 0x1.7a11473eb0178p-1, -0x1.d000p-49, + 0x1.7b17b0976d060p-1, 0x1.0400p-45, + 0x1.7c1ed0130c133p-1, 0x1.0000p-53, + 0x1.7d26a62ff8636p-1, -0x1.6900p-45, + 0x1.7e2f336cf4e3bp-1, -0x1.2e00p-47, + 0x1.7f3878491c3e8p-1, -0x1.4580p-45, + 0x1.80427543e1b4ep-1, 0x1.3000p-44, + 0x1.814d2add1071ap-1, 0x1.f000p-47, + 0x1.82589994ccd7ep-1, -0x1.1c00p-45, + 0x1.8364c1eb942d0p-1, 0x1.9d00p-45, + 0x1.8471a4623cab5p-1, 0x1.7100p-43, + 0x1.857f4179f5bbcp-1, 0x1.2600p-45, + 0x1.868d99b4491afp-1, -0x1.2c40p-44, + 0x1.879cad931a395p-1, -0x1.3000p-45, + 0x1.88ac7d98a65b8p-1, -0x1.a800p-45, + 0x1.89bd0a4785800p-1, -0x1.d000p-49, + 0x1.8ace5422aa223p-1, 0x1.3280p-44, + 0x1.8be05bad619fap-1, 0x1.2b40p-43, + 0x1.8cf3216b54383p-1, -0x1.ed00p-45, + 0x1.8e06a5e08664cp-1, -0x1.0500p-45, + 0x1.8f1ae99157807p-1, 0x1.8280p-45, + 0x1.902fed0282c0ep-1, -0x1.cb00p-46, + 0x1.9145b0b91ff96p-1, -0x1.5e00p-47, + 0x1.925c353aa2ff9p-1, 0x1.5400p-48, + 0x1.93737b0cdc64ap-1, 0x1.7200p-46, + 0x1.948b82b5f98aep-1, -0x1.9000p-47, + 0x1.95a44cbc852cbp-1, 0x1.5680p-45, + 0x1.96bdd9a766f21p-1, -0x1.6d00p-44, + 0x1.97d829fde4e2ap-1, -0x1.1000p-47, + 0x1.98f33e47a23a3p-1, 0x1.d000p-45, + 0x1.9a0f170ca0604p-1, -0x1.8a40p-44, + 0x1.9b2bb4d53ff89p-1, 0x1.55c0p-44, + 0x1.9c49182a3f15bp-1, 0x1.6b80p-45, + 0x1.9d674194bb8c5p-1, -0x1.c000p-49, + 0x1.9e86319e3238ep-1, 0x1.7d00p-46, + 0x1.9fa5e8d07f302p-1, 0x1.6400p-46, + 0x1.a0c667b5de54dp-1, -0x1.5000p-48, + 0x1.a1e7aed8eb8f6p-1, 0x1.9e00p-47, + 0x1.a309bec4a2e27p-1, 0x1.ad80p-45, + 0x1.a42c980460a5dp-1, -0x1.af00p-46, + 0x1.a5503b23e259bp-1, 0x1.b600p-47, + 0x1.a674a8af46213p-1, 0x1.8880p-44, + 0x1.a799e1330b3a7p-1, 0x1.1200p-46, + 0x1.a8bfe53c12e8dp-1, 0x1.6c00p-47, + 0x1.a9e6b5579fcd2p-1, -0x1.9b80p-45, + 0x1.ab0e521356fb8p-1, 0x1.b700p-45, + 0x1.ac36bbfd3f381p-1, 0x1.9000p-50, + 0x1.ad5ff3a3c2780p-1, 0x1.4000p-49, + 0x1.ae89f995ad2a3p-1, -0x1.c900p-45, + 0x1.afb4ce622f367p-1, 0x1.6500p-46, + 0x1.b0e07298db790p-1, 0x1.fd40p-45, + 0x1.b20ce6c9a89a9p-1, 0x1.2700p-46, + 0x1.b33a2b84f1a4bp-1, 0x1.d470p-43, + 0x1.b468415b747e7p-1, -0x1.8380p-44, + 0x1.b59728de5593ap-1, 0x1.8000p-54, + 0x1.b6c6e29f1c56ap-1, 0x1.ad00p-47, + 0x1.b7f76f2fb5e50p-1, 0x1.e800p-50, + 0x1.b928cf22749b2p-1, -0x1.4c00p-47, + 0x1.ba5b030a10603p-1, -0x1.d700p-47, + 0x1.bb8e0b79a6f66p-1, 0x1.d900p-47, + 0x1.bcc1e904bc1ffp-1, 0x1.2a00p-47, + 0x1.bdf69c3f3a16fp-1, -0x1.f780p-46, + 0x1.bf2c25bd71db8p-1, -0x1.0a00p-46, + 0x1.c06286141b2e9p-1, -0x1.1400p-46, + 0x1.c199bdd8552e0p-1, 0x1.be00p-47, + 0x1.c2d1cd9fa64eep-1, -0x1.9400p-47, + 0x1.c40ab5fffd02fp-1, -0x1.ed00p-47, + 0x1.c544778fafd15p-1, 0x1.9660p-44, + 0x1.c67f12e57d0cbp-1, -0x1.a100p-46, + 0x1.c7ba88988c1b6p-1, -0x1.8458p-42, + 0x1.c8f6d9406e733p-1, -0x1.a480p-46, + 0x1.ca3405751c4dfp-1, 0x1.b000p-51, + 0x1.cb720dcef9094p-1, 0x1.1400p-47, + 0x1.ccb0f2e6d1689p-1, 0x1.0200p-48, + 0x1.cdf0b555dc412p-1, 0x1.3600p-48, + 0x1.cf3155b5bab3bp-1, -0x1.6900p-47, + 0x1.d072d4a0789bcp-1, 0x1.9a00p-47, + 0x1.d1b532b08c8fap-1, -0x1.5e00p-46, + 0x1.d2f87080d8a85p-1, 0x1.d280p-46, + 0x1.d43c8eacaa203p-1, 0x1.1a00p-47, + 0x1.d5818dcfba491p-1, 0x1.f000p-50, + 0x1.d6c76e862e6a1p-1, -0x1.3a00p-47, + 0x1.d80e316c9834ep-1, -0x1.cd80p-47, + 0x1.d955d71ff6090p-1, 0x1.4c00p-48, + 0x1.da9e603db32aep-1, 0x1.f900p-48, + 0x1.dbe7cd63a8325p-1, 0x1.9800p-49, + 0x1.dd321f301b445p-1, -0x1.5200p-48, + 0x1.de7d5641c05bfp-1, -0x1.d700p-46, + 0x1.dfc97337b9aecp-1, -0x1.6140p-46, + 0x1.e11676b197d5ep-1, 0x1.b480p-47, + 0x1.e264614f5a3e7p-1, 0x1.0ce0p-43, + 0x1.e3b333b16ee5cp-1, 0x1.c680p-47, + 0x1.e502ee78b3fb4p-1, -0x1.9300p-47, + 0x1.e653924676d68p-1, -0x1.5000p-49, + 0x1.e7a51fbc74c44p-1, -0x1.7f80p-47, + 0x1.e8f7977cdb726p-1, -0x1.3700p-48, + 0x1.ea4afa2a490e8p-1, 0x1.5d00p-49, + 0x1.eb9f4867ccae4p-1, 0x1.61a0p-46, + 0x1.ecf482d8e680dp-1, 0x1.5500p-48, + 0x1.ee4aaa2188514p-1, 0x1.6400p-51, + 0x1.efa1bee615a13p-1, -0x1.e800p-49, + 0x1.f0f9c1cb64106p-1, -0x1.a880p-48, + 0x1.f252b376bb963p-1, -0x1.c900p-45, + 0x1.f3ac948dd7275p-1, 0x1.a000p-53, + 0x1.f50765b6e4524p-1, -0x1.4f00p-48, + 0x1.f6632798844fdp-1, 0x1.a800p-51, + 0x1.f7bfdad9cbe38p-1, 0x1.abc0p-48, + 0x1.f91d802243c82p-1, -0x1.4600p-50, + 0x1.fa7c1819e908ep-1, -0x1.b0c0p-47, + 0x1.fbdba3692d511p-1, -0x1.0e00p-51, + 0x1.fd3c22b8f7194p-1, -0x1.0de8p-46, + 0x1.fe9d96b2a23eep-1, 0x1.e430p-49, + 0x1.0000000000000p+0, 0x0.0000p+0, + 0x1.00b1afa5abcbep+0, -0x1.3400p-52, + 0x1.0163da9fb3303p+0, -0x1.2170p-46, + 0x1.02168143b0282p+0, 0x1.a400p-52, + 0x1.02c9a3e77806cp+0, 0x1.f980p-49, + 0x1.037d42e11bbcap+0, -0x1.7400p-51, + 0x1.04315e86e7f89p+0, 0x1.8300p-50, + 0x1.04e5f72f65467p+0, -0x1.a3f0p-46, + 0x1.059b0d315855ap+0, -0x1.2840p-47, + 0x1.0650a0e3c1f95p+0, 0x1.1600p-48, + 0x1.0706b29ddf71ap+0, 0x1.5240p-46, + 0x1.07bd42b72a82dp+0, -0x1.9a00p-49, + 0x1.0874518759bd0p+0, 0x1.6400p-49, + 0x1.092bdf66607c8p+0, -0x1.0780p-47, + 0x1.09e3ecac6f383p+0, -0x1.8000p-54, + 0x1.0a9c79b1f3930p+0, 0x1.fa00p-48, + 0x1.0b5586cf988fcp+0, -0x1.ac80p-48, + 0x1.0c0f145e46c8ap+0, 0x1.9c00p-50, + 0x1.0cc922b724816p+0, 0x1.5200p-47, + 0x1.0d83b23395dd8p+0, -0x1.ad00p-48, + 0x1.0e3ec32d3d1f3p+0, 0x1.bac0p-46, + 0x1.0efa55fdfa9a6p+0, -0x1.4e80p-47, + 0x1.0fb66affed2f0p+0, -0x1.d300p-47, + 0x1.1073028d7234bp+0, 0x1.1500p-48, + 0x1.11301d0125b5bp+0, 0x1.c000p-49, + 0x1.11edbab5e2af9p+0, 0x1.6bc0p-46, + 0x1.12abdc06c31d5p+0, 0x1.8400p-49, + 0x1.136a814f2047dp+0, -0x1.ed00p-47, + 0x1.1429aaea92de9p+0, 0x1.8e00p-49, + 0x1.14e95934f3138p+0, 0x1.b400p-49, + 0x1.15a98c8a58e71p+0, 0x1.5300p-47, + 0x1.166a45471c3dfp+0, 0x1.3380p-47, + 0x1.172b83c7d5211p+0, 0x1.8d40p-45, + 0x1.17ed48695bb9fp+0, -0x1.5d00p-47, + 0x1.18af9388c8d93p+0, -0x1.c880p-46, + 0x1.1972658375d66p+0, 0x1.1f00p-46, + 0x1.1a35beb6fcba7p+0, 0x1.0480p-46, + 0x1.1af99f81387e3p+0, -0x1.7390p-43, + 0x1.1bbe084045d54p+0, 0x1.4e40p-45, + 0x1.1c82f95281c43p+0, -0x1.a200p-47, + 0x1.1d4873168b9b2p+0, 0x1.3800p-49, + 0x1.1e0e75eb44031p+0, 0x1.ac00p-49, + 0x1.1ed5022fcd938p+0, 0x1.1900p-47, + 0x1.1f9c18438cdf7p+0, -0x1.b780p-46, + 0x1.2063b88628d8fp+0, 0x1.d940p-45, + 0x1.212be3578a81ep+0, 0x1.8000p-50, + 0x1.21f49917ddd41p+0, 0x1.b340p-45, + 0x1.22bdda2791323p+0, 0x1.9f80p-46, + 0x1.2387a6e7561e7p+0, -0x1.9c80p-46, + 0x1.2451ffb821427p+0, 0x1.2300p-47, + 0x1.251ce4fb2a602p+0, -0x1.3480p-46, + 0x1.25e85711eceb0p+0, 0x1.2700p-46, + 0x1.26b4565e27d16p+0, 0x1.1d00p-46, + 0x1.2780e341de00fp+0, 0x1.1ee0p-44, + 0x1.284dfe1f5633ep+0, -0x1.4c00p-46, + 0x1.291ba7591bb30p+0, -0x1.3d80p-46, + 0x1.29e9df51fdf09p+0, 0x1.8b00p-47, + 0x1.2ab8a66d10e9bp+0, -0x1.27c0p-45, + 0x1.2b87fd0dada3ap+0, 0x1.a340p-45, + 0x1.2c57e39771af9p+0, -0x1.0800p-46, + 0x1.2d285a6e402d9p+0, -0x1.ed00p-47, + 0x1.2df961f641579p+0, -0x1.4200p-48, + 0x1.2ecafa93e2ecfp+0, -0x1.4980p-45, + 0x1.2f9d24abd8822p+0, -0x1.6300p-46, + 0x1.306fe0a31b625p+0, -0x1.2360p-44, + 0x1.31432edeea50bp+0, -0x1.0df8p-40, + 0x1.32170fc4cd7b8p+0, -0x1.2480p-45, + 0x1.32eb83ba8e9a2p+0, -0x1.5980p-45, + 0x1.33c08b2641766p+0, 0x1.ed00p-46, + 0x1.3496266e3fa27p+0, -0x1.c000p-50, + 0x1.356c55f929f0fp+0, -0x1.0d80p-44, + 0x1.36431a2de88b9p+0, 0x1.2c80p-45, + 0x1.371a7373aaa39p+0, 0x1.0600p-45, + 0x1.37f26231e74fep+0, -0x1.6600p-46, + 0x1.38cae6d05d838p+0, -0x1.ae00p-47, + 0x1.39a401b713ec3p+0, -0x1.4720p-43, + 0x1.3a7db34e5a020p+0, 0x1.8200p-47, + 0x1.3b57fbfec6e95p+0, 0x1.e800p-44, + 0x1.3c32dc313a8f2p+0, 0x1.f800p-49, + 0x1.3d0e544ede122p+0, -0x1.7a00p-46, + 0x1.3dea64c1234bbp+0, 0x1.6300p-45, + 0x1.3ec70df1c4eccp+0, -0x1.8a60p-43, + 0x1.3fa4504ac7e8cp+0, -0x1.cdc0p-44, + 0x1.40822c367a0bbp+0, 0x1.5b80p-45, + 0x1.4160a21f72e95p+0, 0x1.ec00p-46, + 0x1.423fb27094646p+0, -0x1.3600p-46, + 0x1.431f5d950a920p+0, 0x1.3980p-45, + 0x1.43ffa3f84b9ebp+0, 0x1.a000p-48, + 0x1.44e0860618919p+0, -0x1.6c00p-48, + 0x1.45c2042a7d201p+0, -0x1.bc00p-47, + 0x1.46a41ed1d0016p+0, -0x1.2800p-46, + 0x1.4786d668b3326p+0, 0x1.0e00p-44, + 0x1.486a2b5c13c00p+0, -0x1.d400p-45, + 0x1.494e1e192af04p+0, 0x1.c200p-47, + 0x1.4a32af0d7d372p+0, -0x1.e500p-46, + 0x1.4b17dea6db801p+0, 0x1.7800p-47, + 0x1.4bfdad53629e1p+0, -0x1.3800p-46, + 0x1.4ce41b817c132p+0, 0x1.0800p-47, + 0x1.4dcb299fddddbp+0, 0x1.c700p-45, + 0x1.4eb2d81d8ab96p+0, -0x1.ce00p-46, + 0x1.4f9b2769d2d02p+0, 0x1.9200p-46, + 0x1.508417f4531c1p+0, -0x1.8c00p-47, + 0x1.516daa2cf662ap+0, -0x1.a000p-48, + 0x1.5257de83f51eap+0, 0x1.a080p-43, + 0x1.5342b569d4edap+0, -0x1.6d80p-45, + 0x1.542e2f4f6ac1ap+0, -0x1.2440p-44, + 0x1.551a4ca5d94dbp+0, 0x1.83c0p-43, + 0x1.56070dde9116bp+0, 0x1.4b00p-45, + 0x1.56f4736b529dep+0, 0x1.15a0p-43, + 0x1.57e27dbe2c40ep+0, -0x1.9e00p-45, + 0x1.58d12d497c76fp+0, -0x1.3080p-45, + 0x1.59c0827ff0b4cp+0, 0x1.dec0p-43, + 0x1.5ab07dd485427p+0, -0x1.4000p-51, + 0x1.5ba11fba87af4p+0, 0x1.0080p-44, + 0x1.5c9268a59460bp+0, -0x1.6c80p-45, + 0x1.5d84590998e3fp+0, 0x1.69a0p-43, + 0x1.5e76f15ad20e1p+0, -0x1.b400p-46, + 0x1.5f6a320dcebcap+0, 0x1.7700p-46, + 0x1.605e1b976dcb8p+0, 0x1.6f80p-45, + 0x1.6152ae6cdf715p+0, 0x1.1000p-47, + 0x1.6247eb03a5531p+0, -0x1.5d00p-46, + 0x1.633dd1d1929b5p+0, -0x1.2d00p-46, + 0x1.6434634ccc313p+0, -0x1.a800p-49, + 0x1.652b9febc8efap+0, -0x1.8600p-45, + 0x1.6623882553397p+0, 0x1.1fe0p-40, + 0x1.671c1c708328ep+0, -0x1.7200p-44, + 0x1.68155d44ca97ep+0, 0x1.6800p-49, + 0x1.690f4b19e9471p+0, -0x1.9780p-45, +}; + +/* + * exp2(x): compute the base 2 exponential of x + * + * Accuracy: Peak error < 0.503 ulp for normalized results. + * + * Method: (accurate tables) + * + * Reduce x: + * x = k + y, for integer k and |y| <= 1/2. + * Thus we have exp2(x) = 2**k * exp2(y). + * + * Reduce y: + * y = i/TBLSIZE + z - eps[i] for integer i near y * TBLSIZE. + * Thus we have exp2(y) = exp2(i/TBLSIZE) * exp2(z - eps[i]), + * with |z - eps[i]| <= 2**-9 + 2**-39 for the table used. + * + * We compute exp2(i/TBLSIZE) via table lookup and exp2(z - eps[i]) via + * a degree-5 minimax polynomial with maximum error under 1.3 * 2**-61. + * The values in exp2t[] and eps[] are chosen such that + * exp2t[i] = exp2(i/TBLSIZE + eps[i]), and eps[i] is a small offset such + * that exp2t[i] is accurate to 2**-64. + * + * Note that the range of i is +-TBLSIZE/2, so we actually index the tables + * by i0 = i + TBLSIZE/2. For cache efficiency, exp2t[] and eps[] are + * virtual tables, interleaved in the real table tbl[]. + * + * This method is due to Gal, with many details due to Gal and Bachelis: + * + * Gal, S. and Bachelis, B. An Accurate Elementary Mathematical Library + * for the IEEE Floating Point Standard. TOMS 17(1), 26-46 (1991). + */ +double exp2(double x) +{ + double_t r, t, z; + uint32_t ix, i0; + union {double f; uint64_t i;} u = {x}; + union {uint32_t u; int32_t i;} k; + + /* Filter out exceptional cases. */ + ix = u.i>>32 & 0x7fffffff; + if (ix >= 0x408ff000) { /* |x| >= 1022 or nan */ + if (ix >= 0x40900000 && u.i>>63 == 0) { /* x >= 1024 or nan */ + /* overflow */ + x *= 0x1p1023; + return x; + } + if (ix >= 0x7ff00000) /* -inf or -nan */ + return -1/x; + if (u.i>>63) { /* x <= -1022 */ + /* underflow */ + if (x <= -1075 || x - 0x1p52 + 0x1p52 != x) + FORCE_EVAL((float)(-0x1p-149/x)); + if (x <= -1075) + return 0; + } + } else if (ix < 0x3c900000) { /* |x| < 0x1p-54 */ + return 1.0 + x; + } + + /* Reduce x, computing z, i0, and k. */ + u.f = x + redux; + i0 = u.i; + i0 += TBLSIZE / 2; + k.u = i0 / TBLSIZE * TBLSIZE; + k.i /= TBLSIZE; + i0 %= TBLSIZE; + u.f -= redux; + z = x - u.f; + + /* Compute r = exp2(y) = exp2t[i0] * p(z - eps[i]). */ + t = tbl[2*i0]; /* exp2t[i0] */ + z -= tbl[2*i0 + 1]; /* eps[i0] */ + r = t + t * z * (P1 + z * (P2 + z * (P3 + z * (P4 + z * P5)))); + + return scalbn(r, k.i); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/exp2f.c b/lib/mlibc/options/ansi/musl-generic-math/exp2f.c new file mode 100644 index 0000000..296b634 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/exp2f.c @@ -0,0 +1,126 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_exp2f.c */ +/*- + * Copyright (c) 2005 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#include "libm.h" + +#define TBLSIZE 16 + +static const float +redux = 0x1.8p23f / TBLSIZE, +P1 = 0x1.62e430p-1f, +P2 = 0x1.ebfbe0p-3f, +P3 = 0x1.c6b348p-5f, +P4 = 0x1.3b2c9cp-7f; + +static const double exp2ft[TBLSIZE] = { + 0x1.6a09e667f3bcdp-1, + 0x1.7a11473eb0187p-1, + 0x1.8ace5422aa0dbp-1, + 0x1.9c49182a3f090p-1, + 0x1.ae89f995ad3adp-1, + 0x1.c199bdd85529cp-1, + 0x1.d5818dcfba487p-1, + 0x1.ea4afa2a490dap-1, + 0x1.0000000000000p+0, + 0x1.0b5586cf9890fp+0, + 0x1.172b83c7d517bp+0, + 0x1.2387a6e756238p+0, + 0x1.306fe0a31b715p+0, + 0x1.3dea64c123422p+0, + 0x1.4bfdad5362a27p+0, + 0x1.5ab07dd485429p+0, +}; + +/* + * exp2f(x): compute the base 2 exponential of x + * + * Accuracy: Peak error < 0.501 ulp; location of peak: -0.030110927. + * + * Method: (equally-spaced tables) + * + * Reduce x: + * x = k + y, for integer k and |y| <= 1/2. + * Thus we have exp2f(x) = 2**k * exp2(y). + * + * Reduce y: + * y = i/TBLSIZE + z for integer i near y * TBLSIZE. + * Thus we have exp2(y) = exp2(i/TBLSIZE) * exp2(z), + * with |z| <= 2**-(TBLSIZE+1). + * + * We compute exp2(i/TBLSIZE) via table lookup and exp2(z) via a + * degree-4 minimax polynomial with maximum error under 1.4 * 2**-33. + * Using double precision for everything except the reduction makes + * roundoff error insignificant and simplifies the scaling step. + * + * This method is due to Tang, but I do not use his suggested parameters: + * + * Tang, P. Table-driven Implementation of the Exponential Function + * in IEEE Floating-Point Arithmetic. TOMS 15(2), 144-157 (1989). + */ +float exp2f(float x) +{ + double_t t, r, z; + union {float f; uint32_t i;} u = {x}; + union {double f; uint64_t i;} uk; + uint32_t ix, i0, k; + + /* Filter out exceptional cases. */ + ix = u.i & 0x7fffffff; + if (ix > 0x42fc0000) { /* |x| > 126 */ + if (ix > 0x7f800000) /* NaN */ + return x; + if (u.i >= 0x43000000 && u.i < 0x80000000) { /* x >= 128 */ + x *= 0x1p127f; + return x; + } + if (u.i >= 0x80000000) { /* x < -126 */ + if (u.i >= 0xc3160000 || (u.i & 0x0000ffff)) + FORCE_EVAL(-0x1p-149f/x); + if (u.i >= 0xc3160000) /* x <= -150 */ + return 0; + } + } else if (ix <= 0x33000000) { /* |x| <= 0x1p-25 */ + return 1.0f + x; + } + + /* Reduce x, computing z, i0, and k. */ + u.f = x + redux; + i0 = u.i; + i0 += TBLSIZE / 2; + k = i0 / TBLSIZE; + uk.i = (uint64_t)(0x3ff + k)<<52; + i0 &= TBLSIZE - 1; + u.f -= redux; + z = x - u.f; + /* Compute r = exp2(y) = exp2ft[i0] * p(z). */ + r = exp2ft[i0]; + t = r * z; + r = r + t * (P1 + z * P2) + t * (z * z) * (P3 + z * P4); + + /* Scale by 2**k */ + return r * uk.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/exp2l.c b/lib/mlibc/options/ansi/musl-generic-math/exp2l.c new file mode 100644 index 0000000..3565c1e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/exp2l.c @@ -0,0 +1,619 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/s_exp2l.c and /usr/src/lib/msun/ld128/s_exp2l.c */ +/*- + * Copyright (c) 2005-2008 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double exp2l(long double x) +{ + return exp2(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +#define TBLBITS 7 +#define TBLSIZE (1 << TBLBITS) + +static const double +redux = 0x1.8p63 / TBLSIZE, +P1 = 0x1.62e42fefa39efp-1, +P2 = 0x1.ebfbdff82c58fp-3, +P3 = 0x1.c6b08d7049fap-5, +P4 = 0x1.3b2ab6fba4da5p-7, +P5 = 0x1.5d8804780a736p-10, +P6 = 0x1.430918835e33dp-13; + +static const double tbl[TBLSIZE * 2] = { + 0x1.6a09e667f3bcdp-1, -0x1.bdd3413b2648p-55, + 0x1.6c012750bdabfp-1, -0x1.2895667ff0cp-57, + 0x1.6dfb23c651a2fp-1, -0x1.bbe3a683c88p-58, + 0x1.6ff7df9519484p-1, -0x1.83c0f25860fp-56, + 0x1.71f75e8ec5f74p-1, -0x1.16e4786887bp-56, + 0x1.73f9a48a58174p-1, -0x1.0a8d96c65d5p-55, + 0x1.75feb564267c9p-1, -0x1.0245957316ep-55, + 0x1.780694fde5d3fp-1, 0x1.866b80a0216p-55, + 0x1.7a11473eb0187p-1, -0x1.41577ee0499p-56, + 0x1.7c1ed0130c132p-1, 0x1.f124cd1164ep-55, + 0x1.7e2f336cf4e62p-1, 0x1.05d02ba157ap-57, + 0x1.80427543e1a12p-1, -0x1.27c86626d97p-55, + 0x1.82589994cce13p-1, -0x1.d4c1dd41533p-55, + 0x1.8471a4623c7adp-1, -0x1.8d684a341cep-56, + 0x1.868d99b4492edp-1, -0x1.fc6f89bd4f68p-55, + 0x1.88ac7d98a6699p-1, 0x1.994c2f37cb5p-55, + 0x1.8ace5422aa0dbp-1, 0x1.6e9f156864bp-55, + 0x1.8cf3216b5448cp-1, -0x1.0d55e32e9e4p-57, + 0x1.8f1ae99157736p-1, 0x1.5cc13a2e397p-56, + 0x1.9145b0b91ffc6p-1, -0x1.dd6792e5825p-55, + 0x1.93737b0cdc5e5p-1, -0x1.75fc781b58p-58, + 0x1.95a44cbc8520fp-1, -0x1.64b7c96a5fp-57, + 0x1.97d829fde4e5p-1, -0x1.d185b7c1b86p-55, + 0x1.9a0f170ca07bap-1, -0x1.173bd91cee6p-55, + 0x1.9c49182a3f09p-1, 0x1.c7c46b071f2p-57, + 0x1.9e86319e32323p-1, 0x1.824ca78e64cp-57, + 0x1.a0c667b5de565p-1, -0x1.359495d1cd5p-55, + 0x1.a309bec4a2d33p-1, 0x1.6305c7ddc368p-55, + 0x1.a5503b23e255dp-1, -0x1.d2f6edb8d42p-55, + 0x1.a799e1330b358p-1, 0x1.bcb7ecac564p-55, + 0x1.a9e6b5579fdbfp-1, 0x1.0fac90ef7fdp-55, + 0x1.ac36bbfd3f37ap-1, -0x1.f9234cae76dp-56, + 0x1.ae89f995ad3adp-1, 0x1.7a1cd345dcc8p-55, + 0x1.b0e07298db666p-1, -0x1.bdef54c80e4p-55, + 0x1.b33a2b84f15fbp-1, -0x1.2805e3084d8p-58, + 0x1.b59728de5593ap-1, -0x1.c71dfbbba6ep-55, + 0x1.b7f76f2fb5e47p-1, -0x1.5584f7e54acp-57, + 0x1.ba5b030a1064ap-1, -0x1.efcd30e5429p-55, + 0x1.bcc1e904bc1d2p-1, 0x1.23dd07a2d9fp-56, + 0x1.bf2c25bd71e09p-1, -0x1.efdca3f6b9c8p-55, + 0x1.c199bdd85529cp-1, 0x1.11065895049p-56, + 0x1.c40ab5fffd07ap-1, 0x1.b4537e083c6p-55, + 0x1.c67f12e57d14bp-1, 0x1.2884dff483c8p-55, + 0x1.c8f6d9406e7b5p-1, 0x1.1acbc48805cp-57, + 0x1.cb720dcef9069p-1, 0x1.503cbd1e94ap-57, + 0x1.cdf0b555dc3fap-1, -0x1.dd83b53829dp-56, + 0x1.d072d4a07897cp-1, -0x1.cbc3743797a8p-55, + 0x1.d2f87080d89f2p-1, -0x1.d487b719d858p-55, + 0x1.d5818dcfba487p-1, 0x1.2ed02d75b37p-56, + 0x1.d80e316c98398p-1, -0x1.11ec18bedep-55, + 0x1.da9e603db3285p-1, 0x1.c2300696db5p-55, + 0x1.dd321f301b46p-1, 0x1.2da5778f019p-55, + 0x1.dfc97337b9b5fp-1, -0x1.1a5cd4f184b8p-55, + 0x1.e264614f5a129p-1, -0x1.7b627817a148p-55, + 0x1.e502ee78b3ff6p-1, 0x1.39e8980a9cdp-56, + 0x1.e7a51fbc74c83p-1, 0x1.2d522ca0c8ep-55, + 0x1.ea4afa2a490dap-1, -0x1.e9c23179c288p-55, + 0x1.ecf482d8e67f1p-1, -0x1.c93f3b411ad8p-55, + 0x1.efa1bee615a27p-1, 0x1.dc7f486a4b68p-55, + 0x1.f252b376bba97p-1, 0x1.3a1a5bf0d8e8p-55, + 0x1.f50765b6e454p-1, 0x1.9d3e12dd8a18p-55, + 0x1.f7bfdad9cbe14p-1, -0x1.dbb12d00635p-55, + 0x1.fa7c1819e90d8p-1, 0x1.74853f3a593p-56, + 0x1.fd3c22b8f71f1p-1, 0x1.2eb74966578p-58, + 0x1p+0, 0x0p+0, + 0x1.0163da9fb3335p+0, 0x1.b61299ab8cd8p-54, + 0x1.02c9a3e778061p+0, -0x1.19083535b08p-56, + 0x1.04315e86e7f85p+0, -0x1.0a31c1977c98p-54, + 0x1.059b0d3158574p+0, 0x1.d73e2a475b4p-55, + 0x1.0706b29ddf6dep+0, -0x1.c91dfe2b13cp-55, + 0x1.0874518759bc8p+0, 0x1.186be4bb284p-57, + 0x1.09e3ecac6f383p+0, 0x1.14878183161p-54, + 0x1.0b5586cf9890fp+0, 0x1.8a62e4adc61p-54, + 0x1.0cc922b7247f7p+0, 0x1.01edc16e24f8p-54, + 0x1.0e3ec32d3d1a2p+0, 0x1.03a1727c58p-59, + 0x1.0fb66affed31bp+0, -0x1.b9bedc44ebcp-57, + 0x1.11301d0125b51p+0, -0x1.6c51039449bp-54, + 0x1.12abdc06c31ccp+0, -0x1.1b514b36ca8p-58, + 0x1.1429aaea92dep+0, -0x1.32fbf9af1368p-54, + 0x1.15a98c8a58e51p+0, 0x1.2406ab9eeabp-55, + 0x1.172b83c7d517bp+0, -0x1.19041b9d78ap-55, + 0x1.18af9388c8deap+0, -0x1.11023d1970f8p-54, + 0x1.1a35beb6fcb75p+0, 0x1.e5b4c7b4969p-55, + 0x1.1bbe084045cd4p+0, -0x1.95386352ef6p-54, + 0x1.1d4873168b9aap+0, 0x1.e016e00a264p-54, + 0x1.1ed5022fcd91dp+0, -0x1.1df98027bb78p-54, + 0x1.2063b88628cd6p+0, 0x1.dc775814a85p-55, + 0x1.21f49917ddc96p+0, 0x1.2a97e9494a6p-55, + 0x1.2387a6e756238p+0, 0x1.9b07eb6c7058p-54, + 0x1.251ce4fb2a63fp+0, 0x1.ac155bef4f5p-55, + 0x1.26b4565e27cddp+0, 0x1.2bd339940eap-55, + 0x1.284dfe1f56381p+0, -0x1.a4c3a8c3f0d8p-54, + 0x1.29e9df51fdee1p+0, 0x1.612e8afad12p-55, + 0x1.2b87fd0dad99p+0, -0x1.10adcd6382p-59, + 0x1.2d285a6e4030bp+0, 0x1.0024754db42p-54, + 0x1.2ecafa93e2f56p+0, 0x1.1ca0f45d524p-56, + 0x1.306fe0a31b715p+0, 0x1.6f46ad23183p-55, + 0x1.32170fc4cd831p+0, 0x1.a9ce78e1804p-55, + 0x1.33c08b26416ffp+0, 0x1.327218436598p-54, + 0x1.356c55f929ff1p+0, -0x1.b5cee5c4e46p-55, + 0x1.371a7373aa9cbp+0, -0x1.63aeabf42ebp-54, + 0x1.38cae6d05d866p+0, -0x1.e958d3c99048p-54, + 0x1.3a7db34e59ff7p+0, -0x1.5e436d661f6p-56, + 0x1.3c32dc313a8e5p+0, -0x1.efff8375d2ap-54, + 0x1.3dea64c123422p+0, 0x1.ada0911f09fp-55, + 0x1.3fa4504ac801cp+0, -0x1.7d023f956fap-54, + 0x1.4160a21f72e2ap+0, -0x1.ef3691c309p-58, + 0x1.431f5d950a897p+0, -0x1.1c7dde35f7ap-55, + 0x1.44e086061892dp+0, 0x1.89b7a04ef8p-59, + 0x1.46a41ed1d0057p+0, 0x1.c944bd1648a8p-54, + 0x1.486a2b5c13cdp+0, 0x1.3c1a3b69062p-56, + 0x1.4a32af0d7d3dep+0, 0x1.9cb62f3d1be8p-54, + 0x1.4bfdad5362a27p+0, 0x1.d4397afec42p-56, + 0x1.4dcb299fddd0dp+0, 0x1.8ecdbbc6a78p-54, + 0x1.4f9b2769d2ca7p+0, -0x1.4b309d25958p-54, + 0x1.516daa2cf6642p+0, -0x1.f768569bd94p-55, + 0x1.5342b569d4f82p+0, -0x1.07abe1db13dp-55, + 0x1.551a4ca5d920fp+0, -0x1.d689cefede6p-55, + 0x1.56f4736b527dap+0, 0x1.9bb2c011d938p-54, + 0x1.58d12d497c7fdp+0, 0x1.295e15b9a1ep-55, + 0x1.5ab07dd485429p+0, 0x1.6324c0546478p-54, + 0x1.5c9268a5946b7p+0, 0x1.c4b1b81698p-60, + 0x1.5e76f15ad2148p+0, 0x1.ba6f93080e68p-54, + 0x1.605e1b976dc09p+0, -0x1.3e2429b56de8p-54, + 0x1.6247eb03a5585p+0, -0x1.383c17e40b48p-54, + 0x1.6434634ccc32p+0, -0x1.c483c759d89p-55, + 0x1.6623882552225p+0, -0x1.bb60987591cp-54, + 0x1.68155d44ca973p+0, 0x1.038ae44f74p-57, +}; + +/* + * exp2l(x): compute the base 2 exponential of x + * + * Accuracy: Peak error < 0.511 ulp. + * + * Method: (equally-spaced tables) + * + * Reduce x: + * x = 2**k + y, for integer k and |y| <= 1/2. + * Thus we have exp2l(x) = 2**k * exp2(y). + * + * Reduce y: + * y = i/TBLSIZE + z for integer i near y * TBLSIZE. + * Thus we have exp2(y) = exp2(i/TBLSIZE) * exp2(z), + * with |z| <= 2**-(TBLBITS+1). + * + * We compute exp2(i/TBLSIZE) via table lookup and exp2(z) via a + * degree-6 minimax polynomial with maximum error under 2**-69. + * The table entries each have 104 bits of accuracy, encoded as + * a pair of double precision values. + */ +long double exp2l(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double r, z; + uint32_t i0; + union {uint32_t u; int32_t i;} k; + + /* Filter out exceptional cases. */ + if (e >= 0x3fff + 13) { /* |x| >= 8192 or x is NaN */ + if (u.i.se >= 0x3fff + 14 && u.i.se >> 15 == 0) + /* overflow */ + return x * 0x1p16383L; + if (e == 0x7fff) /* -inf or -nan */ + return -1/x; + if (x < -16382) { + if (x <= -16446 || x - 0x1p63 + 0x1p63 != x) + /* underflow */ + FORCE_EVAL((float)(-0x1p-149/x)); + if (x <= -16446) + return 0; + } + } else if (e < 0x3fff - 64) { + return 1 + x; + } + + /* + * Reduce x, computing z, i0, and k. The low bits of x + redux + * contain the 16-bit integer part of the exponent (k) followed by + * TBLBITS fractional bits (i0). We use bit tricks to extract these + * as integers, then set z to the remainder. + * + * Example: Suppose x is 0xabc.123456p0 and TBLBITS is 8. + * Then the low-order word of x + redux is 0x000abc12, + * We split this into k = 0xabc and i0 = 0x12 (adjusted to + * index into the table), then we compute z = 0x0.003456p0. + */ + u.f = x + redux; + i0 = u.i.m + TBLSIZE / 2; + k.u = i0 / TBLSIZE * TBLSIZE; + k.i /= TBLSIZE; + i0 %= TBLSIZE; + u.f -= redux; + z = x - u.f; + + /* Compute r = exp2l(y) = exp2lt[i0] * p(z). */ + long double t_hi = tbl[2*i0]; + long double t_lo = tbl[2*i0 + 1]; + /* XXX This gives > 1 ulp errors outside of FE_TONEAREST mode */ + r = t_lo + (t_hi + t_lo) * z * (P1 + z * (P2 + z * (P3 + z * (P4 + + z * (P5 + z * P6))))) + t_hi; + + return scalbnl(r, k.i); +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +#define TBLBITS 7 +#define TBLSIZE (1 << TBLBITS) + +static const long double + P1 = 0x1.62e42fefa39ef35793c7673007e6p-1L, + P2 = 0x1.ebfbdff82c58ea86f16b06ec9736p-3L, + P3 = 0x1.c6b08d704a0bf8b33a762bad3459p-5L, + P4 = 0x1.3b2ab6fba4e7729ccbbe0b4f3fc2p-7L, + P5 = 0x1.5d87fe78a67311071dee13fd11d9p-10L, + P6 = 0x1.430912f86c7876f4b663b23c5fe5p-13L; + +static const double + P7 = 0x1.ffcbfc588b041p-17, + P8 = 0x1.62c0223a5c7c7p-20, + P9 = 0x1.b52541ff59713p-24, + P10 = 0x1.e4cf56a391e22p-28, + redux = 0x1.8p112 / TBLSIZE; + +static const long double tbl[TBLSIZE] = { + 0x1.6a09e667f3bcc908b2fb1366dfeap-1L, + 0x1.6c012750bdabeed76a99800f4edep-1L, + 0x1.6dfb23c651a2ef220e2cbe1bc0d4p-1L, + 0x1.6ff7df9519483cf87e1b4f3e1e98p-1L, + 0x1.71f75e8ec5f73dd2370f2ef0b148p-1L, + 0x1.73f9a48a58173bd5c9a4e68ab074p-1L, + 0x1.75feb564267c8bf6e9aa33a489a8p-1L, + 0x1.780694fde5d3f619ae02808592a4p-1L, + 0x1.7a11473eb0186d7d51023f6ccb1ap-1L, + 0x1.7c1ed0130c1327c49334459378dep-1L, + 0x1.7e2f336cf4e62105d02ba1579756p-1L, + 0x1.80427543e1a11b60de67649a3842p-1L, + 0x1.82589994cce128acf88afab34928p-1L, + 0x1.8471a4623c7acce52f6b97c6444cp-1L, + 0x1.868d99b4492ec80e41d90ac2556ap-1L, + 0x1.88ac7d98a669966530bcdf2d4cc0p-1L, + 0x1.8ace5422aa0db5ba7c55a192c648p-1L, + 0x1.8cf3216b5448bef2aa1cd161c57ap-1L, + 0x1.8f1ae991577362b982745c72eddap-1L, + 0x1.9145b0b91ffc588a61b469f6b6a0p-1L, + 0x1.93737b0cdc5e4f4501c3f2540ae8p-1L, + 0x1.95a44cbc8520ee9b483695a0e7fep-1L, + 0x1.97d829fde4e4f8b9e920f91e8eb6p-1L, + 0x1.9a0f170ca07b9ba3109b8c467844p-1L, + 0x1.9c49182a3f0901c7c46b071f28dep-1L, + 0x1.9e86319e323231824ca78e64c462p-1L, + 0x1.a0c667b5de564b29ada8b8cabbacp-1L, + 0x1.a309bec4a2d3358c171f770db1f4p-1L, + 0x1.a5503b23e255c8b424491caf88ccp-1L, + 0x1.a799e1330b3586f2dfb2b158f31ep-1L, + 0x1.a9e6b5579fdbf43eb243bdff53a2p-1L, + 0x1.ac36bbfd3f379c0db966a3126988p-1L, + 0x1.ae89f995ad3ad5e8734d17731c80p-1L, + 0x1.b0e07298db66590842acdfc6fb4ep-1L, + 0x1.b33a2b84f15faf6bfd0e7bd941b0p-1L, + 0x1.b59728de559398e3881111648738p-1L, + 0x1.b7f76f2fb5e46eaa7b081ab53ff6p-1L, + 0x1.ba5b030a10649840cb3c6af5b74cp-1L, + 0x1.bcc1e904bc1d2247ba0f45b3d06cp-1L, + 0x1.bf2c25bd71e088408d7025190cd0p-1L, + 0x1.c199bdd85529c2220cb12a0916bap-1L, + 0x1.c40ab5fffd07a6d14df820f17deap-1L, + 0x1.c67f12e57d14b4a2137fd20f2a26p-1L, + 0x1.c8f6d9406e7b511acbc48805c3f6p-1L, + 0x1.cb720dcef90691503cbd1e949d0ap-1L, + 0x1.cdf0b555dc3f9c44f8958fac4f12p-1L, + 0x1.d072d4a07897b8d0f22f21a13792p-1L, + 0x1.d2f87080d89f18ade123989ea50ep-1L, + 0x1.d5818dcfba48725da05aeb66dff8p-1L, + 0x1.d80e316c98397bb84f9d048807a0p-1L, + 0x1.da9e603db3285708c01a5b6d480cp-1L, + 0x1.dd321f301b4604b695de3c0630c0p-1L, + 0x1.dfc97337b9b5eb968cac39ed284cp-1L, + 0x1.e264614f5a128a12761fa17adc74p-1L, + 0x1.e502ee78b3ff6273d130153992d0p-1L, + 0x1.e7a51fbc74c834b548b2832378a4p-1L, + 0x1.ea4afa2a490d9858f73a18f5dab4p-1L, + 0x1.ecf482d8e67f08db0312fb949d50p-1L, + 0x1.efa1bee615a27771fd21a92dabb6p-1L, + 0x1.f252b376bba974e8696fc3638f24p-1L, + 0x1.f50765b6e4540674f84b762861a6p-1L, + 0x1.f7bfdad9cbe138913b4bfe72bd78p-1L, + 0x1.fa7c1819e90d82e90a7e74b26360p-1L, + 0x1.fd3c22b8f71f10975ba4b32bd006p-1L, + 0x1.0000000000000000000000000000p+0L, + 0x1.0163da9fb33356d84a66ae336e98p+0L, + 0x1.02c9a3e778060ee6f7caca4f7a18p+0L, + 0x1.04315e86e7f84bd738f9a20da442p+0L, + 0x1.059b0d31585743ae7c548eb68c6ap+0L, + 0x1.0706b29ddf6ddc6dc403a9d87b1ep+0L, + 0x1.0874518759bc808c35f25d942856p+0L, + 0x1.09e3ecac6f3834521e060c584d5cp+0L, + 0x1.0b5586cf9890f6298b92b7184200p+0L, + 0x1.0cc922b7247f7407b705b893dbdep+0L, + 0x1.0e3ec32d3d1a2020742e4f8af794p+0L, + 0x1.0fb66affed31af232091dd8a169ep+0L, + 0x1.11301d0125b50a4ebbf1aed9321cp+0L, + 0x1.12abdc06c31cbfb92bad324d6f84p+0L, + 0x1.1429aaea92ddfb34101943b2588ep+0L, + 0x1.15a98c8a58e512480d573dd562aep+0L, + 0x1.172b83c7d517adcdf7c8c50eb162p+0L, + 0x1.18af9388c8de9bbbf70b9a3c269cp+0L, + 0x1.1a35beb6fcb753cb698f692d2038p+0L, + 0x1.1bbe084045cd39ab1e72b442810ep+0L, + 0x1.1d4873168b9aa7805b8028990be8p+0L, + 0x1.1ed5022fcd91cb8819ff61121fbep+0L, + 0x1.2063b88628cd63b8eeb0295093f6p+0L, + 0x1.21f49917ddc962552fd29294bc20p+0L, + 0x1.2387a6e75623866c1fadb1c159c0p+0L, + 0x1.251ce4fb2a63f3582ab7de9e9562p+0L, + 0x1.26b4565e27cdd257a673281d3068p+0L, + 0x1.284dfe1f5638096cf15cf03c9fa0p+0L, + 0x1.29e9df51fdee12c25d15f5a25022p+0L, + 0x1.2b87fd0dad98ffddea46538fca24p+0L, + 0x1.2d285a6e4030b40091d536d0733ep+0L, + 0x1.2ecafa93e2f5611ca0f45d5239a4p+0L, + 0x1.306fe0a31b7152de8d5a463063bep+0L, + 0x1.32170fc4cd8313539cf1c3009330p+0L, + 0x1.33c08b26416ff4c9c8610d96680ep+0L, + 0x1.356c55f929ff0c94623476373be4p+0L, + 0x1.371a7373aa9caa7145502f45452ap+0L, + 0x1.38cae6d05d86585a9cb0d9bed530p+0L, + 0x1.3a7db34e59ff6ea1bc9299e0a1fep+0L, + 0x1.3c32dc313a8e484001f228b58cf0p+0L, + 0x1.3dea64c12342235b41223e13d7eep+0L, + 0x1.3fa4504ac801ba0bf701aa417b9cp+0L, + 0x1.4160a21f72e29f84325b8f3dbacap+0L, + 0x1.431f5d950a896dc704439410b628p+0L, + 0x1.44e086061892d03136f409df0724p+0L, + 0x1.46a41ed1d005772512f459229f0ap+0L, + 0x1.486a2b5c13cd013c1a3b69062f26p+0L, + 0x1.4a32af0d7d3de672d8bcf46f99b4p+0L, + 0x1.4bfdad5362a271d4397afec42e36p+0L, + 0x1.4dcb299fddd0d63b36ef1a9e19dep+0L, + 0x1.4f9b2769d2ca6ad33d8b69aa0b8cp+0L, + 0x1.516daa2cf6641c112f52c84d6066p+0L, + 0x1.5342b569d4f81df0a83c49d86bf4p+0L, + 0x1.551a4ca5d920ec52ec620243540cp+0L, + 0x1.56f4736b527da66ecb004764e61ep+0L, + 0x1.58d12d497c7fd252bc2b7343d554p+0L, + 0x1.5ab07dd48542958c93015191e9a8p+0L, + 0x1.5c9268a5946b701c4b1b81697ed4p+0L, + 0x1.5e76f15ad21486e9be4c20399d12p+0L, + 0x1.605e1b976dc08b076f592a487066p+0L, + 0x1.6247eb03a5584b1f0fa06fd2d9eap+0L, + 0x1.6434634ccc31fc76f8714c4ee122p+0L, + 0x1.66238825522249127d9e29b92ea2p+0L, + 0x1.68155d44ca973081c57227b9f69ep+0L, +}; + +static const float eps[TBLSIZE] = { + -0x1.5c50p-101, + -0x1.5d00p-106, + 0x1.8e90p-102, + -0x1.5340p-103, + 0x1.1bd0p-102, + -0x1.4600p-105, + -0x1.7a40p-104, + 0x1.d590p-102, + -0x1.d590p-101, + 0x1.b100p-103, + -0x1.0d80p-105, + 0x1.6b00p-103, + -0x1.9f00p-105, + 0x1.c400p-103, + 0x1.e120p-103, + -0x1.c100p-104, + -0x1.9d20p-103, + 0x1.a800p-108, + 0x1.4c00p-106, + -0x1.9500p-106, + 0x1.6900p-105, + -0x1.29d0p-100, + 0x1.4c60p-103, + 0x1.13a0p-102, + -0x1.5b60p-103, + -0x1.1c40p-103, + 0x1.db80p-102, + 0x1.91a0p-102, + 0x1.dc00p-105, + 0x1.44c0p-104, + 0x1.9710p-102, + 0x1.8760p-103, + -0x1.a720p-103, + 0x1.ed20p-103, + -0x1.49c0p-102, + -0x1.e000p-111, + 0x1.86a0p-103, + 0x1.2b40p-103, + -0x1.b400p-108, + 0x1.1280p-99, + -0x1.02d8p-102, + -0x1.e3d0p-103, + -0x1.b080p-105, + -0x1.f100p-107, + -0x1.16c0p-105, + -0x1.1190p-103, + -0x1.a7d2p-100, + 0x1.3450p-103, + -0x1.67c0p-105, + 0x1.4b80p-104, + -0x1.c4e0p-103, + 0x1.6000p-108, + -0x1.3f60p-105, + 0x1.93f0p-104, + 0x1.5fe0p-105, + 0x1.6f80p-107, + -0x1.7600p-106, + 0x1.21e0p-106, + -0x1.3a40p-106, + -0x1.40c0p-104, + -0x1.9860p-105, + -0x1.5d40p-108, + -0x1.1d70p-106, + 0x1.2760p-105, + 0x0.0000p+0, + 0x1.21e2p-104, + -0x1.9520p-108, + -0x1.5720p-106, + -0x1.4810p-106, + -0x1.be00p-109, + 0x1.0080p-105, + -0x1.5780p-108, + -0x1.d460p-105, + -0x1.6140p-105, + 0x1.4630p-104, + 0x1.ad50p-103, + 0x1.82e0p-105, + 0x1.1d3cp-101, + 0x1.6100p-107, + 0x1.ec30p-104, + 0x1.f200p-108, + 0x1.0b40p-103, + 0x1.3660p-102, + 0x1.d9d0p-103, + -0x1.02d0p-102, + 0x1.b070p-103, + 0x1.b9c0p-104, + -0x1.01c0p-103, + -0x1.dfe0p-103, + 0x1.1b60p-104, + -0x1.ae94p-101, + -0x1.3340p-104, + 0x1.b3d8p-102, + -0x1.6e40p-105, + -0x1.3670p-103, + 0x1.c140p-104, + 0x1.1840p-101, + 0x1.1ab0p-102, + -0x1.a400p-104, + 0x1.1f00p-104, + -0x1.7180p-103, + 0x1.4ce0p-102, + 0x1.9200p-107, + -0x1.54c0p-103, + 0x1.1b80p-105, + -0x1.1828p-101, + 0x1.5720p-102, + -0x1.a060p-100, + 0x1.9160p-102, + 0x1.a280p-104, + 0x1.3400p-107, + 0x1.2b20p-102, + 0x1.7800p-108, + 0x1.cfd0p-101, + 0x1.2ef0p-102, + -0x1.2760p-99, + 0x1.b380p-104, + 0x1.0048p-101, + -0x1.60b0p-102, + 0x1.a1ccp-100, + -0x1.a640p-104, + -0x1.08a0p-101, + 0x1.7e60p-102, + 0x1.22c0p-103, + -0x1.7200p-106, + 0x1.f0f0p-102, + 0x1.eb4ep-99, + 0x1.c6e0p-103, +}; + +/* + * exp2l(x): compute the base 2 exponential of x + * + * Accuracy: Peak error < 0.502 ulp. + * + * Method: (accurate tables) + * + * Reduce x: + * x = 2**k + y, for integer k and |y| <= 1/2. + * Thus we have exp2(x) = 2**k * exp2(y). + * + * Reduce y: + * y = i/TBLSIZE + z - eps[i] for integer i near y * TBLSIZE. + * Thus we have exp2(y) = exp2(i/TBLSIZE) * exp2(z - eps[i]), + * with |z - eps[i]| <= 2**-8 + 2**-98 for the table used. + * + * We compute exp2(i/TBLSIZE) via table lookup and exp2(z - eps[i]) via + * a degree-10 minimax polynomial with maximum error under 2**-120. + * The values in exp2t[] and eps[] are chosen such that + * exp2t[i] = exp2(i/TBLSIZE + eps[i]), and eps[i] is a small offset such + * that exp2t[i] is accurate to 2**-122. + * + * Note that the range of i is +-TBLSIZE/2, so we actually index the tables + * by i0 = i + TBLSIZE/2. + * + * This method is due to Gal, with many details due to Gal and Bachelis: + * + * Gal, S. and Bachelis, B. An Accurate Elementary Mathematical Library + * for the IEEE Floating Point Standard. TOMS 17(1), 26-46 (1991). + */ +long double +exp2l(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double r, z, t; + uint32_t i0; + union {uint32_t u; int32_t i;} k; + + /* Filter out exceptional cases. */ + if (e >= 0x3fff + 14) { /* |x| >= 16384 or x is NaN */ + if (u.i.se >= 0x3fff + 15 && u.i.se >> 15 == 0) + /* overflow */ + return x * 0x1p16383L; + if (e == 0x7fff) /* -inf or -nan */ + return -1/x; + if (x < -16382) { + if (x <= -16495 || x - 0x1p112 + 0x1p112 != x) + /* underflow */ + FORCE_EVAL((float)(-0x1p-149/x)); + if (x <= -16446) + return 0; + } + } else if (e < 0x3fff - 114) { + return 1 + x; + } + + /* + * Reduce x, computing z, i0, and k. The low bits of x + redux + * contain the 16-bit integer part of the exponent (k) followed by + * TBLBITS fractional bits (i0). We use bit tricks to extract these + * as integers, then set z to the remainder. + * + * Example: Suppose x is 0xabc.123456p0 and TBLBITS is 8. + * Then the low-order word of x + redux is 0x000abc12, + * We split this into k = 0xabc and i0 = 0x12 (adjusted to + * index into the table), then we compute z = 0x0.003456p0. + */ + u.f = x + redux; + i0 = u.i2.lo + TBLSIZE / 2; + k.u = i0 / TBLSIZE * TBLSIZE; + k.i /= TBLSIZE; + i0 %= TBLSIZE; + u.f -= redux; + z = x - u.f; + + /* Compute r = exp2(y) = exp2t[i0] * p(z - eps[i]). */ + t = tbl[i0]; + z -= eps[i0]; + r = t + t * z * (P1 + z * (P2 + z * (P3 + z * (P4 + z * (P5 + z * (P6 + + z * (P7 + z * (P8 + z * (P9 + z * P10))))))))); + + return scalbnl(r, k.i); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/expf.c b/lib/mlibc/options/ansi/musl-generic-math/expf.c new file mode 100644 index 0000000..feee2b0 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/expf.c @@ -0,0 +1,83 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_expf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +half[2] = {0.5,-0.5}, +ln2hi = 6.9314575195e-1f, /* 0x3f317200 */ +ln2lo = 1.4286067653e-6f, /* 0x35bfbe8e */ +invln2 = 1.4426950216e+0f, /* 0x3fb8aa3b */ +/* + * Domain [-0.34568, 0.34568], range ~[-4.278e-9, 4.447e-9]: + * |x*(exp(x)+1)/(exp(x)-1) - p(x)| < 2**-27.74 + */ +P1 = 1.6666625440e-1f, /* 0xaaaa8f.0p-26 */ +P2 = -2.7667332906e-3f; /* -0xb55215.0p-32 */ + +float expf(float x) +{ + float_t hi, lo, c, xx, y; + int k, sign; + uint32_t hx; + + GET_FLOAT_WORD(hx, x); + sign = hx >> 31; /* sign bit of x */ + hx &= 0x7fffffff; /* high word of |x| */ + + /* special cases */ + if (hx >= 0x42aeac50) { /* if |x| >= -87.33655f or NaN */ + if (hx > 0x7f800000) /* NaN */ + return x; + if (hx >= 0x42b17218 && !sign) { /* x >= 88.722839f */ + /* overflow */ + x *= 0x1p127f; + return x; + } + if (sign) { + /* underflow */ + FORCE_EVAL(-0x1p-149f/x); + if (hx >= 0x42cff1b5) /* x <= -103.972084f */ + return 0; + } + } + + /* argument reduction */ + if (hx > 0x3eb17218) { /* if |x| > 0.5 ln2 */ + if (hx > 0x3f851592) /* if |x| > 1.5 ln2 */ + k = invln2*x + half[sign]; + else + k = 1 - sign - sign; + hi = x - k*ln2hi; /* k*ln2hi is exact here */ + lo = k*ln2lo; + x = hi - lo; + } else if (hx > 0x39000000) { /* |x| > 2**-14 */ + k = 0; + hi = x; + lo = 0; + } else { + /* raise inexact */ + FORCE_EVAL(0x1p127f + x); + return 1 + x; + } + + /* x is now in primary range */ + xx = x*x; + c = x - xx*(P1+xx*P2); + y = 1 + (x*c/(2-c) - lo + hi); + if (k == 0) + return y; + return scalbnf(y, k); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/expl.c b/lib/mlibc/options/ansi/musl-generic-math/expl.c new file mode 100644 index 0000000..0a7f44f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/expl.c @@ -0,0 +1,128 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_expl.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Exponential function, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, expl(); + * + * y = expl( x ); + * + * + * DESCRIPTION: + * + * Returns e (2.71828...) raised to the x power. + * + * Range reduction is accomplished by separating the argument + * into an integer k and fraction f such that + * + * x k f + * e = 2 e. + * + * A Pade' form of degree 5/6 is used to approximate exp(f) - 1 + * in the basic range [-0.5 ln 2, 0.5 ln 2]. + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE +-10000 50000 1.12e-19 2.81e-20 + * + * + * Error amplification in the exponential function can be + * a serious matter. The error propagation involves + * exp( X(1+delta) ) = exp(X) ( 1 + X*delta + ... ), + * which shows that a 1 lsb error in representing X produces + * a relative error of X times 1 lsb in the function. + * While the routine gives an accurate result for arguments + * that are exactly represented by a long double precision + * computer number, the result contains amplified roundoff + * error for large arguments not exactly represented. + * + * + * ERROR MESSAGES: + * + * message condition value returned + * exp underflow x < MINLOG 0.0 + * exp overflow x > MAXLOG MAXNUM + * + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double expl(long double x) +{ + return exp(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 + +static const long double P[3] = { + 1.2617719307481059087798E-4L, + 3.0299440770744196129956E-2L, + 9.9999999999999999991025E-1L, +}; +static const long double Q[4] = { + 3.0019850513866445504159E-6L, + 2.5244834034968410419224E-3L, + 2.2726554820815502876593E-1L, + 2.0000000000000000000897E0L, +}; +static const long double +LN2HI = 6.9314575195312500000000E-1L, +LN2LO = 1.4286068203094172321215E-6L, +LOG2E = 1.4426950408889634073599E0L; + +long double expl(long double x) +{ + long double px, xx; + int k; + + if (isnan(x)) + return x; + if (x > 11356.5234062941439488L) /* x > ln(2^16384 - 0.5) */ + return x * 0x1p16383L; + if (x < -11399.4985314888605581L) /* x < ln(2^-16446) */ + return -0x1p-16445L/x; + + /* Express e**x = e**f 2**k + * = e**(f + k ln(2)) + */ + px = floorl(LOG2E * x + 0.5); + k = px; + x -= px * LN2HI; + x -= px * LN2LO; + + /* rational approximation of the fractional part: + * e**x = 1 + 2x P(x**2)/(Q(x**2) - x P(x**2)) + */ + xx = x * x; + px = x * __polevll(xx, P, 2); + x = px/(__polevll(xx, Q, 3) - px); + x = 1.0 + 2.0 * x; + return scalbnl(x, k); +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double expl(long double x) +{ + return exp(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/expm1.c b/lib/mlibc/options/ansi/musl-generic-math/expm1.c new file mode 100644 index 0000000..ac1e61e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/expm1.c @@ -0,0 +1,201 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_expm1.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* expm1(x) + * Returns exp(x)-1, the exponential of x minus 1. + * + * Method + * 1. Argument reduction: + * Given x, find r and integer k such that + * + * x = k*ln2 + r, |r| <= 0.5*ln2 ~ 0.34658 + * + * Here a correction term c will be computed to compensate + * the error in r when rounded to a floating-point number. + * + * 2. Approximating expm1(r) by a special rational function on + * the interval [0,0.34658]: + * Since + * r*(exp(r)+1)/(exp(r)-1) = 2+ r^2/6 - r^4/360 + ... + * we define R1(r*r) by + * r*(exp(r)+1)/(exp(r)-1) = 2+ r^2/6 * R1(r*r) + * That is, + * R1(r**2) = 6/r *((exp(r)+1)/(exp(r)-1) - 2/r) + * = 6/r * ( 1 + 2.0*(1/(exp(r)-1) - 1/r)) + * = 1 - r^2/60 + r^4/2520 - r^6/100800 + ... + * We use a special Remez algorithm on [0,0.347] to generate + * a polynomial of degree 5 in r*r to approximate R1. The + * maximum error of this polynomial approximation is bounded + * by 2**-61. In other words, + * R1(z) ~ 1.0 + Q1*z + Q2*z**2 + Q3*z**3 + Q4*z**4 + Q5*z**5 + * where Q1 = -1.6666666666666567384E-2, + * Q2 = 3.9682539681370365873E-4, + * Q3 = -9.9206344733435987357E-6, + * Q4 = 2.5051361420808517002E-7, + * Q5 = -6.2843505682382617102E-9; + * z = r*r, + * with error bounded by + * | 5 | -61 + * | 1.0+Q1*z+...+Q5*z - R1(z) | <= 2 + * | | + * + * expm1(r) = exp(r)-1 is then computed by the following + * specific way which minimize the accumulation rounding error: + * 2 3 + * r r [ 3 - (R1 + R1*r/2) ] + * expm1(r) = r + --- + --- * [--------------------] + * 2 2 [ 6 - r*(3 - R1*r/2) ] + * + * To compensate the error in the argument reduction, we use + * expm1(r+c) = expm1(r) + c + expm1(r)*c + * ~ expm1(r) + c + r*c + * Thus c+r*c will be added in as the correction terms for + * expm1(r+c). Now rearrange the term to avoid optimization + * screw up: + * ( 2 2 ) + * ({ ( r [ R1 - (3 - R1*r/2) ] ) } r ) + * expm1(r+c)~r - ({r*(--- * [--------------------]-c)-c} - --- ) + * ({ ( 2 [ 6 - r*(3 - R1*r/2) ] ) } 2 ) + * ( ) + * + * = r - E + * 3. Scale back to obtain expm1(x): + * From step 1, we have + * expm1(x) = either 2^k*[expm1(r)+1] - 1 + * = or 2^k*[expm1(r) + (1-2^-k)] + * 4. Implementation notes: + * (A). To save one multiplication, we scale the coefficient Qi + * to Qi*2^i, and replace z by (x^2)/2. + * (B). To achieve maximum accuracy, we compute expm1(x) by + * (i) if x < -56*ln2, return -1.0, (raise inexact if x!=inf) + * (ii) if k=0, return r-E + * (iii) if k=-1, return 0.5*(r-E)-0.5 + * (iv) if k=1 if r < -0.25, return 2*((r+0.5)- E) + * else return 1.0+2.0*(r-E); + * (v) if (k<-2||k>56) return 2^k(1-(E-r)) - 1 (or exp(x)-1) + * (vi) if k <= 20, return 2^k((1-2^-k)-(E-r)), else + * (vii) return 2^k(1-((E+2^-k)-r)) + * + * Special cases: + * expm1(INF) is INF, expm1(NaN) is NaN; + * expm1(-INF) is -1, and + * for finite argument, only expm1(0)=0 is exact. + * + * Accuracy: + * according to an error analysis, the error is always less than + * 1 ulp (unit in the last place). + * + * Misc. info. + * For IEEE double + * if x > 7.09782712893383973096e+02 then expm1(x) overflow + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "libm.h" + +static const double +o_threshold = 7.09782712893383973096e+02, /* 0x40862E42, 0xFEFA39EF */ +ln2_hi = 6.93147180369123816490e-01, /* 0x3fe62e42, 0xfee00000 */ +ln2_lo = 1.90821492927058770002e-10, /* 0x3dea39ef, 0x35793c76 */ +invln2 = 1.44269504088896338700e+00, /* 0x3ff71547, 0x652b82fe */ +/* Scaled Q's: Qn_here = 2**n * Qn_above, for R(2*z) where z = hxs = x*x/2: */ +Q1 = -3.33333333333331316428e-02, /* BFA11111 111110F4 */ +Q2 = 1.58730158725481460165e-03, /* 3F5A01A0 19FE5585 */ +Q3 = -7.93650757867487942473e-05, /* BF14CE19 9EAADBB7 */ +Q4 = 4.00821782732936239552e-06, /* 3ED0CFCA 86E65239 */ +Q5 = -2.01099218183624371326e-07; /* BE8AFDB7 6E09C32D */ + +double expm1(double x) +{ + double_t y,hi,lo,c,t,e,hxs,hfx,r1,twopk; + union {double f; uint64_t i;} u = {x}; + uint32_t hx = u.i>>32 & 0x7fffffff; + int k, sign = u.i>>63; + + /* filter out huge and non-finite argument */ + if (hx >= 0x4043687A) { /* if |x|>=56*ln2 */ + if (isnan(x)) + return x; + if (sign) + return -1; + if (x > o_threshold) { + x *= 0x1p1023; + return x; + } + } + + /* argument reduction */ + if (hx > 0x3fd62e42) { /* if |x| > 0.5 ln2 */ + if (hx < 0x3FF0A2B2) { /* and |x| < 1.5 ln2 */ + if (!sign) { + hi = x - ln2_hi; + lo = ln2_lo; + k = 1; + } else { + hi = x + ln2_hi; + lo = -ln2_lo; + k = -1; + } + } else { + k = invln2*x + (sign ? -0.5 : 0.5); + t = k; + hi = x - t*ln2_hi; /* t*ln2_hi is exact here */ + lo = t*ln2_lo; + } + x = hi-lo; + c = (hi-x)-lo; + } else if (hx < 0x3c900000) { /* |x| < 2**-54, return x */ + if (hx < 0x00100000) + FORCE_EVAL((float)x); + return x; + } else + k = 0; + + /* x is now in primary range */ + hfx = 0.5*x; + hxs = x*hfx; + r1 = 1.0+hxs*(Q1+hxs*(Q2+hxs*(Q3+hxs*(Q4+hxs*Q5)))); + t = 3.0-r1*hfx; + e = hxs*((r1-t)/(6.0 - x*t)); + if (k == 0) /* c is 0 */ + return x - (x*e-hxs); + e = x*(e-c) - c; + e -= hxs; + /* exp(x) ~ 2^k (x_reduced - e + 1) */ + if (k == -1) + return 0.5*(x-e) - 0.5; + if (k == 1) { + if (x < -0.25) + return -2.0*(e-(x+0.5)); + return 1.0+2.0*(x-e); + } + u.i = (uint64_t)(0x3ff + k)<<52; /* 2^k */ + twopk = u.f; + if (k < 0 || k > 56) { /* suffice to return exp(x)-1 */ + y = x - e + 1.0; + if (k == 1024) + y = y*2.0*0x1p1023; + else + y = y*twopk; + return y - 1.0; + } + u.i = (uint64_t)(0x3ff - k)<<52; /* 2^-k */ + if (k < 20) + y = (x-e+(1-u.f))*twopk; + else + y = (x-(e+u.f)+1)*twopk; + return y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/expm1f.c b/lib/mlibc/options/ansi/musl-generic-math/expm1f.c new file mode 100644 index 0000000..297e0b4 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/expm1f.c @@ -0,0 +1,111 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_expm1f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +o_threshold = 8.8721679688e+01, /* 0x42b17180 */ +ln2_hi = 6.9313812256e-01, /* 0x3f317180 */ +ln2_lo = 9.0580006145e-06, /* 0x3717f7d1 */ +invln2 = 1.4426950216e+00, /* 0x3fb8aa3b */ +/* + * Domain [-0.34568, 0.34568], range ~[-6.694e-10, 6.696e-10]: + * |6 / x * (1 + 2 * (1 / (exp(x) - 1) - 1 / x)) - q(x)| < 2**-30.04 + * Scaled coefficients: Qn_here = 2**n * Qn_for_q (see s_expm1.c): + */ +Q1 = -3.3333212137e-2, /* -0x888868.0p-28 */ +Q2 = 1.5807170421e-3; /* 0xcf3010.0p-33 */ + +float expm1f(float x) +{ + float_t y,hi,lo,c,t,e,hxs,hfx,r1,twopk; + union {float f; uint32_t i;} u = {x}; + uint32_t hx = u.i & 0x7fffffff; + int k, sign = u.i >> 31; + + /* filter out huge and non-finite argument */ + if (hx >= 0x4195b844) { /* if |x|>=27*ln2 */ + if (hx > 0x7f800000) /* NaN */ + return x; + if (sign) + return -1; + if (x > o_threshold) { + x *= 0x1p127f; + return x; + } + } + + /* argument reduction */ + if (hx > 0x3eb17218) { /* if |x| > 0.5 ln2 */ + if (hx < 0x3F851592) { /* and |x| < 1.5 ln2 */ + if (!sign) { + hi = x - ln2_hi; + lo = ln2_lo; + k = 1; + } else { + hi = x + ln2_hi; + lo = -ln2_lo; + k = -1; + } + } else { + k = invln2*x + (sign ? -0.5f : 0.5f); + t = k; + hi = x - t*ln2_hi; /* t*ln2_hi is exact here */ + lo = t*ln2_lo; + } + x = hi-lo; + c = (hi-x)-lo; + } else if (hx < 0x33000000) { /* when |x|<2**-25, return x */ + if (hx < 0x00800000) + FORCE_EVAL(x*x); + return x; + } else + k = 0; + + /* x is now in primary range */ + hfx = 0.5f*x; + hxs = x*hfx; + r1 = 1.0f+hxs*(Q1+hxs*Q2); + t = 3.0f - r1*hfx; + e = hxs*((r1-t)/(6.0f - x*t)); + if (k == 0) /* c is 0 */ + return x - (x*e-hxs); + e = x*(e-c) - c; + e -= hxs; + /* exp(x) ~ 2^k (x_reduced - e + 1) */ + if (k == -1) + return 0.5f*(x-e) - 0.5f; + if (k == 1) { + if (x < -0.25f) + return -2.0f*(e-(x+0.5f)); + return 1.0f + 2.0f*(x-e); + } + u.i = (0x7f+k)<<23; /* 2^k */ + twopk = u.f; + if (k < 0 || k > 56) { /* suffice to return exp(x)-1 */ + y = x - e + 1.0f; + if (k == 128) + y = y*2.0f*0x1p127f; + else + y = y*twopk; + return y - 1.0f; + } + u.i = (0x7f-k)<<23; /* 2^-k */ + if (k < 23) + y = (x-e+(1-u.f))*twopk; + else + y = (x-(e+u.f)+1)*twopk; + return y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/expm1l.c b/lib/mlibc/options/ansi/musl-generic-math/expm1l.c new file mode 100644 index 0000000..d171507 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/expm1l.c @@ -0,0 +1,123 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_expm1l.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Exponential function, minus 1 + * Long double precision + * + * + * SYNOPSIS: + * + * long double x, y, expm1l(); + * + * y = expm1l( x ); + * + * + * DESCRIPTION: + * + * Returns e (2.71828...) raised to the x power, minus 1. + * + * Range reduction is accomplished by separating the argument + * into an integer k and fraction f such that + * + * x k f + * e = 2 e. + * + * An expansion x + .5 x^2 + x^3 R(x) approximates exp(f) - 1 + * in the basic range [-0.5 ln 2, 0.5 ln 2]. + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE -45,+maxarg 200,000 1.2e-19 2.5e-20 + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double expm1l(long double x) +{ + return expm1(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 + +/* exp(x) - 1 = x + 0.5 x^2 + x^3 P(x)/Q(x) + -.5 ln 2 < x < .5 ln 2 + Theoretical peak relative error = 3.4e-22 */ +static const long double +P0 = -1.586135578666346600772998894928250240826E4L, +P1 = 2.642771505685952966904660652518429479531E3L, +P2 = -3.423199068835684263987132888286791620673E2L, +P3 = 1.800826371455042224581246202420972737840E1L, +P4 = -5.238523121205561042771939008061958820811E-1L, +Q0 = -9.516813471998079611319047060563358064497E4L, +Q1 = 3.964866271411091674556850458227710004570E4L, +Q2 = -7.207678383830091850230366618190187434796E3L, +Q3 = 7.206038318724600171970199625081491823079E2L, +Q4 = -4.002027679107076077238836622982900945173E1L, +/* Q5 = 1.000000000000000000000000000000000000000E0 */ +/* C1 + C2 = ln 2 */ +C1 = 6.93145751953125E-1L, +C2 = 1.428606820309417232121458176568075500134E-6L, +/* ln 2^-65 */ +minarg = -4.5054566736396445112120088E1L, +/* ln 2^16384 */ +maxarg = 1.1356523406294143949492E4L; + +long double expm1l(long double x) +{ + long double px, qx, xx; + int k; + + if (isnan(x)) + return x; + if (x > maxarg) + return x*0x1p16383L; /* overflow, unless x==inf */ + if (x == 0.0) + return x; + if (x < minarg) + return -1.0; + + xx = C1 + C2; + /* Express x = ln 2 (k + remainder), remainder not exceeding 1/2. */ + px = floorl(0.5 + x / xx); + k = px; + /* remainder times ln 2 */ + x -= px * C1; + x -= px * C2; + + /* Approximate exp(remainder ln 2).*/ + px = (((( P4 * x + P3) * x + P2) * x + P1) * x + P0) * x; + qx = (((( x + Q4) * x + Q3) * x + Q2) * x + Q1) * x + Q0; + xx = x * x; + qx = x + (0.5 * xx + xx * px / qx); + + /* exp(x) = exp(k ln 2) exp(remainder ln 2) = 2^k exp(remainder ln 2). + We have qx = exp(remainder ln 2) - 1, so + exp(x) - 1 = 2^k (qx + 1) - 1 = 2^k qx + 2^k - 1. */ + px = scalbnl(1.0, k); + x = px * qx + (px - 1.0); + return x; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double expm1l(long double x) +{ + return expm1(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/fabs.c b/lib/mlibc/options/ansi/musl-generic-math/fabs.c new file mode 100644 index 0000000..e8258cf --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fabs.c @@ -0,0 +1,9 @@ +#include <math.h> +#include <stdint.h> + +double fabs(double x) +{ + union {double f; uint64_t i;} u = {x}; + u.i &= -1ULL/2; + return u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fabsf.c b/lib/mlibc/options/ansi/musl-generic-math/fabsf.c new file mode 100644 index 0000000..4efc8d6 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fabsf.c @@ -0,0 +1,9 @@ +#include <math.h> +#include <stdint.h> + +float fabsf(float x) +{ + union {float f; uint32_t i;} u = {x}; + u.i &= 0x7fffffff; + return u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fabsl.c b/lib/mlibc/options/ansi/musl-generic-math/fabsl.c new file mode 100644 index 0000000..c4f36ec --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fabsl.c @@ -0,0 +1,15 @@ +#include "libm.h" +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fabsl(long double x) +{ + return fabs(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double fabsl(long double x) +{ + union ldshape u = {x}; + + u.i.se &= 0x7fff; + return u.f; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/fdim.c b/lib/mlibc/options/ansi/musl-generic-math/fdim.c new file mode 100644 index 0000000..9585460 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fdim.c @@ -0,0 +1,10 @@ +#include <math.h> + +double fdim(double x, double y) +{ + if (isnan(x)) + return x; + if (isnan(y)) + return y; + return x > y ? x - y : 0; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fdimf.c b/lib/mlibc/options/ansi/musl-generic-math/fdimf.c new file mode 100644 index 0000000..543c364 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fdimf.c @@ -0,0 +1,10 @@ +#include <math.h> + +float fdimf(float x, float y) +{ + if (isnan(x)) + return x; + if (isnan(y)) + return y; + return x > y ? x - y : 0; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fdiml.c b/lib/mlibc/options/ansi/musl-generic-math/fdiml.c new file mode 100644 index 0000000..62e29b7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fdiml.c @@ -0,0 +1,18 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fdiml(long double x, long double y) +{ + return fdim(x, y); +} +#else +long double fdiml(long double x, long double y) +{ + if (isnan(x)) + return x; + if (isnan(y)) + return y; + return x > y ? x - y : 0; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/finite.c b/lib/mlibc/options/ansi/musl-generic-math/finite.c new file mode 100644 index 0000000..25a0575 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/finite.c @@ -0,0 +1,7 @@ +#define _GNU_SOURCE +#include <math.h> + +int finite(double x) +{ + return isfinite(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/finitef.c b/lib/mlibc/options/ansi/musl-generic-math/finitef.c new file mode 100644 index 0000000..2c4c771 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/finitef.c @@ -0,0 +1,7 @@ +#define _GNU_SOURCE +#include <math.h> + +int finitef(float x) +{ + return isfinite(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/floor.c b/lib/mlibc/options/ansi/musl-generic-math/floor.c new file mode 100644 index 0000000..14a31cd --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/floor.c @@ -0,0 +1,31 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const double_t toint = 1/EPS; + +double floor(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i >> 52 & 0x7ff; + double_t y; + + if (e >= 0x3ff+52 || x == 0) + return x; + /* y = int(x) - x, where int(x) is an integer neighbor of x */ + if (u.i >> 63) + y = x - toint + toint - x; + else + y = x + toint - toint - x; + /* special case because of non-nearest rounding modes */ + if (e <= 0x3ff-1) { + FORCE_EVAL(y); + return u.i >> 63 ? -1 : 0; + } + if (y > 0) + return x + y - 1; + return x + y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/floorf.c b/lib/mlibc/options/ansi/musl-generic-math/floorf.c new file mode 100644 index 0000000..dceec73 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/floorf.c @@ -0,0 +1,27 @@ +#include "libm.h" + +float floorf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = (int)(u.i >> 23 & 0xff) - 0x7f; + uint32_t m; + + if (e >= 23) + return x; + if (e >= 0) { + m = 0x007fffff >> e; + if ((u.i & m) == 0) + return x; + FORCE_EVAL(x + 0x1p120f); + if (u.i >> 31) + u.i += m; + u.i &= ~m; + } else { + FORCE_EVAL(x + 0x1p120f); + if (u.i >> 31 == 0) + u.i = 0; + else if (u.i << 1) + u.f = -1.0; + } + return u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/floorl.c b/lib/mlibc/options/ansi/musl-generic-math/floorl.c new file mode 100644 index 0000000..16aaec4 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/floorl.c @@ -0,0 +1,34 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double floorl(long double x) +{ + return floor(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double floorl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1 || x == 0) + return x; + /* y = int(x) - x, where int(x) is an integer neighbor of x */ + if (u.i.se >> 15) + y = x - toint + toint - x; + else + y = x + toint - toint - x; + /* special case because of non-nearest rounding modes */ + if (e <= 0x3fff-1) { + FORCE_EVAL(y); + return u.i.se >> 15 ? -1 : 0; + } + if (y > 0) + return x + y - 1; + return x + y; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/fma.c b/lib/mlibc/options/ansi/musl-generic-math/fma.c new file mode 100644 index 0000000..f65eab7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fma.c @@ -0,0 +1,194 @@ +#include <stdint.h> +#include <float.h> +#include <math.h> + +static inline int a_clz_64(uint64_t x) +{ + uint32_t y; + int r; + if (x>>32) y=x>>32, r=0; else y=x, r=32; + if (y>>16) y>>=16; else r |= 16; + if (y>>8) y>>=8; else r |= 8; + if (y>>4) y>>=4; else r |= 4; + if (y>>2) y>>=2; else r |= 2; + return r | !(y>>1); +} + +#define ASUINT64(x) ((union {double f; uint64_t i;}){x}).i +#define ZEROINFNAN (0x7ff-0x3ff-52-1) + +struct num { uint64_t m; int e; int sign; }; + +static struct num normalize(double x) +{ + uint64_t ix = ASUINT64(x); + int e = ix>>52; + int sign = e & 0x800; + e &= 0x7ff; + if (!e) { + ix = ASUINT64(x*0x1p63); + e = ix>>52 & 0x7ff; + e = e ? e-63 : 0x800; + } + ix &= (1ull<<52)-1; + ix |= 1ull<<52; + ix <<= 1; + e -= 0x3ff + 52 + 1; + return (struct num){ix,e,sign}; +} + +static void mul(uint64_t *hi, uint64_t *lo, uint64_t x, uint64_t y) +{ + uint64_t t1,t2,t3; + uint64_t xlo = (uint32_t)x, xhi = x>>32; + uint64_t ylo = (uint32_t)y, yhi = y>>32; + + t1 = xlo*ylo; + t2 = xlo*yhi + xhi*ylo; + t3 = xhi*yhi; + *lo = t1 + (t2<<32); + *hi = t3 + (t2>>32) + (t1 > *lo); +} + +double fma(double x, double y, double z) +{ + #pragma STDC FENV_ACCESS ON + + /* normalize so top 10bits and last bit are 0 */ + struct num nx, ny, nz; + nx = normalize(x); + ny = normalize(y); + nz = normalize(z); + + if (nx.e >= ZEROINFNAN || ny.e >= ZEROINFNAN) + return x*y + z; + if (nz.e >= ZEROINFNAN) { + if (nz.e > ZEROINFNAN) /* z==0 */ + return x*y + z; + return z; + } + + /* mul: r = x*y */ + uint64_t rhi, rlo, zhi, zlo; + mul(&rhi, &rlo, nx.m, ny.m); + /* either top 20 or 21 bits of rhi and last 2 bits of rlo are 0 */ + + /* align exponents */ + int e = nx.e + ny.e; + int d = nz.e - e; + /* shift bits z<<=kz, r>>=kr, so kz+kr == d, set e = e+kr (== ez-kz) */ + if (d > 0) { + if (d < 64) { + zlo = nz.m<<d; + zhi = nz.m>>64-d; + } else { + zlo = 0; + zhi = nz.m; + e = nz.e - 64; + d -= 64; + if (d == 0) { + } else if (d < 64) { + rlo = rhi<<64-d | rlo>>d | !!(rlo<<64-d); + rhi = rhi>>d; + } else { + rlo = 1; + rhi = 0; + } + } + } else { + zhi = 0; + d = -d; + if (d == 0) { + zlo = nz.m; + } else if (d < 64) { + zlo = nz.m>>d | !!(nz.m<<64-d); + } else { + zlo = 1; + } + } + + /* add */ + int sign = nx.sign^ny.sign; + int samesign = !(sign^nz.sign); + int nonzero = 1; + if (samesign) { + /* r += z */ + rlo += zlo; + rhi += zhi + (rlo < zlo); + } else { + /* r -= z */ + uint64_t t = rlo; + rlo -= zlo; + rhi = rhi - zhi - (t < rlo); + if (rhi>>63) { + rlo = -rlo; + rhi = -rhi-!!rlo; + sign = !sign; + } + nonzero = !!rhi; + } + + /* set rhi to top 63bit of the result (last bit is sticky) */ + if (nonzero) { + e += 64; + d = a_clz_64(rhi)-1; + /* note: d > 0 */ + rhi = rhi<<d | rlo>>64-d | !!(rlo<<d); + } else if (rlo) { + d = a_clz_64(rlo)-1; + if (d < 0) + rhi = rlo>>1 | (rlo&1); + else + rhi = rlo<<d; + } else { + /* exact +-0 */ + return x*y + z; + } + e -= d; + + /* convert to double */ + int64_t i = rhi; /* i is in [1<<62,(1<<63)-1] */ + if (sign) + i = -i; + double r = i; /* |r| is in [0x1p62,0x1p63] */ + + if (e < -1022-62) { + /* result is subnormal before rounding */ + if (e == -1022-63) { + double c = 0x1p63; + if (sign) + c = -c; + if (r == c) { + /* min normal after rounding, underflow depends + on arch behaviour which can be imitated by + a double to float conversion */ + float fltmin = 0x0.ffffff8p-63*FLT_MIN * r; + return DBL_MIN/FLT_MIN * fltmin; + } + /* one bit is lost when scaled, add another top bit to + only round once at conversion if it is inexact */ + if (rhi << 53) { + i = rhi>>1 | (rhi&1) | 1ull<<62; + if (sign) + i = -i; + r = i; + r = 2*r - c; /* remove top bit */ + + /* raise underflow portably, such that it + cannot be optimized away */ + { + double_t tiny = DBL_MIN/FLT_MIN * r; + r += (double)(tiny*tiny) * (r-r); + } + } + } else { + /* only round once when scaled */ + d = 10; + i = ( rhi>>d | !!(rhi<<64-d) ) << d; + if (sign) + i = -i; + r = i; + } + } + return scalbn(r, e); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmaf.c b/lib/mlibc/options/ansi/musl-generic-math/fmaf.c new file mode 100644 index 0000000..aa57feb --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmaf.c @@ -0,0 +1,93 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_fmaf.c */ +/*- + * Copyright (c) 2005-2011 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#include <fenv.h> +#include <math.h> +#include <stdint.h> + +/* + * Fused multiply-add: Compute x * y + z with a single rounding error. + * + * A double has more than twice as much precision than a float, so + * direct double-precision arithmetic suffices, except where double + * rounding occurs. + */ +float fmaf(float x, float y, float z) +{ + #pragma STDC FENV_ACCESS ON + double xy, result; + union {double f; uint64_t i;} u; + int e; + + xy = (double)x * y; + result = xy + z; + u.f = result; + e = u.i>>52 & 0x7ff; + /* Common case: The double precision result is fine. */ + if ((u.i & 0x1fffffff) != 0x10000000 || /* not a halfway case */ + e == 0x7ff || /* NaN */ + result - xy == z || /* exact */ + fegetround() != FE_TONEAREST) /* not round-to-nearest */ + { + /* + underflow may not be raised correctly, example: + fmaf(0x1p-120f, 0x1p-120f, 0x1p-149f) + */ +#if defined(FE_INEXACT) && defined(FE_UNDERFLOW) + if (e < 0x3ff-126 && e >= 0x3ff-149 && fetestexcept(FE_INEXACT)) { + feclearexcept(FE_INEXACT); + /* TODO: gcc and clang bug workaround */ + volatile float vz = z; + result = xy + vz; + if (fetestexcept(FE_INEXACT)) + feraiseexcept(FE_UNDERFLOW); + else + feraiseexcept(FE_INEXACT); + } +#endif + z = result; + return z; + } + + /* + * If result is inexact, and exactly halfway between two float values, + * we need to adjust the low-order bit in the direction of the error. + */ +#ifdef FE_TOWARDZERO + fesetround(FE_TOWARDZERO); +#endif + volatile double vxy = xy; /* XXX work around gcc CSE bug */ + double adjusted_result = vxy + z; + fesetround(FE_TONEAREST); + if (result == adjusted_result) { + u.f = adjusted_result; + u.i++; + adjusted_result = u.f; + } + z = adjusted_result; + return z; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmal.c b/lib/mlibc/options/ansi/musl-generic-math/fmal.c new file mode 100644 index 0000000..4506aac --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmal.c @@ -0,0 +1,293 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_fmal.c */ +/*- + * Copyright (c) 2005-2011 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + + +#include "libm.h" +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fmal(long double x, long double y, long double z) +{ + return fma(x, y, z); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#include <fenv.h> +#if LDBL_MANT_DIG == 64 +#define LASTBIT(u) (u.i.m & 1) +#define SPLIT (0x1p32L + 1) +#elif LDBL_MANT_DIG == 113 +#define LASTBIT(u) (u.i.lo & 1) +#define SPLIT (0x1p57L + 1) +#endif + +/* + * A struct dd represents a floating-point number with twice the precision + * of a long double. We maintain the invariant that "hi" stores the high-order + * bits of the result. + */ +struct dd { + long double hi; + long double lo; +}; + +/* + * Compute a+b exactly, returning the exact result in a struct dd. We assume + * that both a and b are finite, but make no assumptions about their relative + * magnitudes. + */ +static inline struct dd dd_add(long double a, long double b) +{ + struct dd ret; + long double s; + + ret.hi = a + b; + s = ret.hi - a; + ret.lo = (a - (ret.hi - s)) + (b - s); + return (ret); +} + +/* + * Compute a+b, with a small tweak: The least significant bit of the + * result is adjusted into a sticky bit summarizing all the bits that + * were lost to rounding. This adjustment negates the effects of double + * rounding when the result is added to another number with a higher + * exponent. For an explanation of round and sticky bits, see any reference + * on FPU design, e.g., + * + * J. Coonen. An Implementation Guide to a Proposed Standard for + * Floating-Point Arithmetic. Computer, vol. 13, no. 1, Jan 1980. + */ +static inline long double add_adjusted(long double a, long double b) +{ + struct dd sum; + union ldshape u; + + sum = dd_add(a, b); + if (sum.lo != 0) { + u.f = sum.hi; + if (!LASTBIT(u)) + sum.hi = nextafterl(sum.hi, INFINITY * sum.lo); + } + return (sum.hi); +} + +/* + * Compute ldexp(a+b, scale) with a single rounding error. It is assumed + * that the result will be subnormal, and care is taken to ensure that + * double rounding does not occur. + */ +static inline long double add_and_denormalize(long double a, long double b, int scale) +{ + struct dd sum; + int bits_lost; + union ldshape u; + + sum = dd_add(a, b); + + /* + * If we are losing at least two bits of accuracy to denormalization, + * then the first lost bit becomes a round bit, and we adjust the + * lowest bit of sum.hi to make it a sticky bit summarizing all the + * bits in sum.lo. With the sticky bit adjusted, the hardware will + * break any ties in the correct direction. + * + * If we are losing only one bit to denormalization, however, we must + * break the ties manually. + */ + if (sum.lo != 0) { + u.f = sum.hi; + bits_lost = -u.i.se - scale + 1; + if ((bits_lost != 1) ^ LASTBIT(u)) + sum.hi = nextafterl(sum.hi, INFINITY * sum.lo); + } + return scalbnl(sum.hi, scale); +} + +/* + * Compute a*b exactly, returning the exact result in a struct dd. We assume + * that both a and b are normalized, so no underflow or overflow will occur. + * The current rounding mode must be round-to-nearest. + */ +static inline struct dd dd_mul(long double a, long double b) +{ + struct dd ret; + long double ha, hb, la, lb, p, q; + + p = a * SPLIT; + ha = a - p; + ha += p; + la = a - ha; + + p = b * SPLIT; + hb = b - p; + hb += p; + lb = b - hb; + + p = ha * hb; + q = ha * lb + la * hb; + + ret.hi = p + q; + ret.lo = p - ret.hi + q + la * lb; + return (ret); +} + +/* + * Fused multiply-add: Compute x * y + z with a single rounding error. + * + * We use scaling to avoid overflow/underflow, along with the + * canonical precision-doubling technique adapted from: + * + * Dekker, T. A Floating-Point Technique for Extending the + * Available Precision. Numer. Math. 18, 224-242 (1971). + */ +long double fmal(long double x, long double y, long double z) +{ + #pragma STDC FENV_ACCESS ON + long double xs, ys, zs, adj; + struct dd xy, r; + int oround; + int ex, ey, ez; + int spread; + + /* + * Handle special cases. The order of operations and the particular + * return values here are crucial in handling special cases involving + * infinities, NaNs, overflows, and signed zeroes correctly. + */ + if (!isfinite(x) || !isfinite(y)) + return (x * y + z); + if (!isfinite(z)) + return (z); + if (x == 0.0 || y == 0.0) + return (x * y + z); + if (z == 0.0) + return (x * y); + + xs = frexpl(x, &ex); + ys = frexpl(y, &ey); + zs = frexpl(z, &ez); + oround = fegetround(); + spread = ex + ey - ez; + + /* + * If x * y and z are many orders of magnitude apart, the scaling + * will overflow, so we handle these cases specially. Rounding + * modes other than FE_TONEAREST are painful. + */ + if (spread < -LDBL_MANT_DIG) { +#ifdef FE_INEXACT + feraiseexcept(FE_INEXACT); +#endif +#ifdef FE_UNDERFLOW + if (!isnormal(z)) + feraiseexcept(FE_UNDERFLOW); +#endif + switch (oround) { + default: /* FE_TONEAREST */ + return (z); +#ifdef FE_TOWARDZERO + case FE_TOWARDZERO: + if (x > 0.0 ^ y < 0.0 ^ z < 0.0) + return (z); + else + return (nextafterl(z, 0)); +#endif +#ifdef FE_DOWNWARD + case FE_DOWNWARD: + if (x > 0.0 ^ y < 0.0) + return (z); + else + return (nextafterl(z, -INFINITY)); +#endif +#ifdef FE_UPWARD + case FE_UPWARD: + if (x > 0.0 ^ y < 0.0) + return (nextafterl(z, INFINITY)); + else + return (z); +#endif + } + } + if (spread <= LDBL_MANT_DIG * 2) + zs = scalbnl(zs, -spread); + else + zs = copysignl(LDBL_MIN, zs); + + fesetround(FE_TONEAREST); + + /* + * Basic approach for round-to-nearest: + * + * (xy.hi, xy.lo) = x * y (exact) + * (r.hi, r.lo) = xy.hi + z (exact) + * adj = xy.lo + r.lo (inexact; low bit is sticky) + * result = r.hi + adj (correctly rounded) + */ + xy = dd_mul(xs, ys); + r = dd_add(xy.hi, zs); + + spread = ex + ey; + + if (r.hi == 0.0) { + /* + * When the addends cancel to 0, ensure that the result has + * the correct sign. + */ + fesetround(oround); + volatile long double vzs = zs; /* XXX gcc CSE bug workaround */ + return xy.hi + vzs + scalbnl(xy.lo, spread); + } + + if (oround != FE_TONEAREST) { + /* + * There is no need to worry about double rounding in directed + * rounding modes. + * But underflow may not be raised correctly, example in downward rounding: + * fmal(0x1.0000000001p-16000L, 0x1.0000000001p-400L, -0x1p-16440L) + */ + long double ret; +#if defined(FE_INEXACT) && defined(FE_UNDERFLOW) + int e = fetestexcept(FE_INEXACT); + feclearexcept(FE_INEXACT); +#endif + fesetround(oround); + adj = r.lo + xy.lo; + ret = scalbnl(r.hi + adj, spread); +#if defined(FE_INEXACT) && defined(FE_UNDERFLOW) + if (ilogbl(ret) < -16382 && fetestexcept(FE_INEXACT)) + feraiseexcept(FE_UNDERFLOW); + else if (e) + feraiseexcept(FE_INEXACT); +#endif + return ret; + } + + adj = add_adjusted(r.lo, xy.lo); + if (spread + ilogbl(r.hi) > -16383) + return scalbnl(r.hi + adj, spread); + else + return add_and_denormalize(r.hi, adj, spread); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmax.c b/lib/mlibc/options/ansi/musl-generic-math/fmax.c new file mode 100644 index 0000000..94f0caa --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmax.c @@ -0,0 +1,13 @@ +#include <math.h> + +double fmax(double x, double y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? y : x; + return x < y ? y : x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmaxf.c b/lib/mlibc/options/ansi/musl-generic-math/fmaxf.c new file mode 100644 index 0000000..695d817 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmaxf.c @@ -0,0 +1,13 @@ +#include <math.h> + +float fmaxf(float x, float y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeroes, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? y : x; + return x < y ? y : x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmaxl.c b/lib/mlibc/options/ansi/musl-generic-math/fmaxl.c new file mode 100644 index 0000000..4b03158 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmaxl.c @@ -0,0 +1,21 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fmaxl(long double x, long double y) +{ + return fmax(x, y); +} +#else +long double fmaxl(long double x, long double y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? y : x; + return x < y ? y : x; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmin.c b/lib/mlibc/options/ansi/musl-generic-math/fmin.c new file mode 100644 index 0000000..08a8fd1 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmin.c @@ -0,0 +1,13 @@ +#include <math.h> + +double fmin(double x, double y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? x : y; + return x < y ? x : y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fminf.c b/lib/mlibc/options/ansi/musl-generic-math/fminf.c new file mode 100644 index 0000000..3573c7d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fminf.c @@ -0,0 +1,13 @@ +#include <math.h> + +float fminf(float x, float y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? x : y; + return x < y ? x : y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fminl.c b/lib/mlibc/options/ansi/musl-generic-math/fminl.c new file mode 100644 index 0000000..69bc24a --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fminl.c @@ -0,0 +1,21 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fminl(long double x, long double y) +{ + return fmin(x, y); +} +#else +long double fminl(long double x, long double y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? x : y; + return x < y ? x : y; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmod.c b/lib/mlibc/options/ansi/musl-generic-math/fmod.c new file mode 100644 index 0000000..6849722 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmod.c @@ -0,0 +1,68 @@ +#include <math.h> +#include <stdint.h> + +double fmod(double x, double y) +{ + union {double f; uint64_t i;} ux = {x}, uy = {y}; + int ex = ux.i>>52 & 0x7ff; + int ey = uy.i>>52 & 0x7ff; + int sx = ux.i>>63; + uint64_t i; + + /* in the followings uxi should be ux.i, but then gcc wrongly adds */ + /* float load/store to inner loops ruining performance and code size */ + uint64_t uxi = ux.i; + + if (uy.i<<1 == 0 || isnan(y) || ex == 0x7ff) + return (x*y)/(x*y); + if (uxi<<1 <= uy.i<<1) { + if (uxi<<1 == uy.i<<1) + return 0*x; + return x; + } + + /* normalize x and y */ + if (!ex) { + for (i = uxi<<12; i>>63 == 0; ex--, i <<= 1); + uxi <<= -ex + 1; + } else { + uxi &= -1ULL >> 12; + uxi |= 1ULL << 52; + } + if (!ey) { + for (i = uy.i<<12; i>>63 == 0; ey--, i <<= 1); + uy.i <<= -ey + 1; + } else { + uy.i &= -1ULL >> 12; + uy.i |= 1ULL << 52; + } + + /* x mod y */ + for (; ex > ey; ex--) { + i = uxi - uy.i; + if (i >> 63 == 0) { + if (i == 0) + return 0*x; + uxi = i; + } + uxi <<= 1; + } + i = uxi - uy.i; + if (i >> 63 == 0) { + if (i == 0) + return 0*x; + uxi = i; + } + for (; uxi>>52 == 0; uxi <<= 1, ex--); + + /* scale result */ + if (ex > 0) { + uxi -= 1ULL << 52; + uxi |= (uint64_t)ex << 52; + } else { + uxi >>= -ex + 1; + } + uxi |= (uint64_t)sx << 63; + ux.i = uxi; + return ux.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmodf.c b/lib/mlibc/options/ansi/musl-generic-math/fmodf.c new file mode 100644 index 0000000..ff58f93 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmodf.c @@ -0,0 +1,65 @@ +#include <math.h> +#include <stdint.h> + +float fmodf(float x, float y) +{ + union {float f; uint32_t i;} ux = {x}, uy = {y}; + int ex = ux.i>>23 & 0xff; + int ey = uy.i>>23 & 0xff; + uint32_t sx = ux.i & 0x80000000; + uint32_t i; + uint32_t uxi = ux.i; + + if (uy.i<<1 == 0 || isnan(y) || ex == 0xff) + return (x*y)/(x*y); + if (uxi<<1 <= uy.i<<1) { + if (uxi<<1 == uy.i<<1) + return 0*x; + return x; + } + + /* normalize x and y */ + if (!ex) { + for (i = uxi<<9; i>>31 == 0; ex--, i <<= 1); + uxi <<= -ex + 1; + } else { + uxi &= -1U >> 9; + uxi |= 1U << 23; + } + if (!ey) { + for (i = uy.i<<9; i>>31 == 0; ey--, i <<= 1); + uy.i <<= -ey + 1; + } else { + uy.i &= -1U >> 9; + uy.i |= 1U << 23; + } + + /* x mod y */ + for (; ex > ey; ex--) { + i = uxi - uy.i; + if (i >> 31 == 0) { + if (i == 0) + return 0*x; + uxi = i; + } + uxi <<= 1; + } + i = uxi - uy.i; + if (i >> 31 == 0) { + if (i == 0) + return 0*x; + uxi = i; + } + for (; uxi>>23 == 0; uxi <<= 1, ex--); + + /* scale result up */ + if (ex > 0) { + uxi -= 1U << 23; + uxi |= (uint32_t)ex << 23; + } else { + uxi >>= -ex + 1; + } + uxi |= sx; + ux.i = uxi; + return ux.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmodl.c b/lib/mlibc/options/ansi/musl-generic-math/fmodl.c new file mode 100644 index 0000000..9f5b873 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmodl.c @@ -0,0 +1,105 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fmodl(long double x, long double y) +{ + return fmod(x, y); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double fmodl(long double x, long double y) +{ + union ldshape ux = {x}, uy = {y}; + int ex = ux.i.se & 0x7fff; + int ey = uy.i.se & 0x7fff; + int sx = ux.i.se & 0x8000; + + if (y == 0 || isnan(y) || ex == 0x7fff) + return (x*y)/(x*y); + ux.i.se = ex; + uy.i.se = ey; + if (ux.f <= uy.f) { + if (ux.f == uy.f) + return 0*x; + return x; + } + + /* normalize x and y */ + if (!ex) { + ux.f *= 0x1p120f; + ex = ux.i.se - 120; + } + if (!ey) { + uy.f *= 0x1p120f; + ey = uy.i.se - 120; + } + + /* x mod y */ +#if LDBL_MANT_DIG == 64 + uint64_t i, mx, my; + mx = ux.i.m; + my = uy.i.m; + for (; ex > ey; ex--) { + i = mx - my; + if (mx >= my) { + if (i == 0) + return 0*x; + mx = 2*i; + } else if (2*mx < mx) { + mx = 2*mx - my; + } else { + mx = 2*mx; + } + } + i = mx - my; + if (mx >= my) { + if (i == 0) + return 0*x; + mx = i; + } + for (; mx >> 63 == 0; mx *= 2, ex--); + ux.i.m = mx; +#elif LDBL_MANT_DIG == 113 + uint64_t hi, lo, xhi, xlo, yhi, ylo; + xhi = (ux.i2.hi & -1ULL>>16) | 1ULL<<48; + yhi = (uy.i2.hi & -1ULL>>16) | 1ULL<<48; + xlo = ux.i2.lo; + ylo = uy.i2.lo; + for (; ex > ey; ex--) { + hi = xhi - yhi; + lo = xlo - ylo; + if (xlo < ylo) + hi -= 1; + if (hi >> 63 == 0) { + if ((hi|lo) == 0) + return 0*x; + xhi = 2*hi + (lo>>63); + xlo = 2*lo; + } else { + xhi = 2*xhi + (xlo>>63); + xlo = 2*xlo; + } + } + hi = xhi - yhi; + lo = xlo - ylo; + if (xlo < ylo) + hi -= 1; + if (hi >> 63 == 0) { + if ((hi|lo) == 0) + return 0*x; + xhi = hi; + xlo = lo; + } + for (; xhi >> 48 == 0; xhi = 2*xhi + (xlo>>63), xlo = 2*xlo, ex--); + ux.i2.hi = xhi; + ux.i2.lo = xlo; +#endif + + /* scale result */ + if (ex <= 0) { + ux.i.se = (ex+120)|sx; + ux.f *= 0x1p-120f; + } else + ux.i.se = ex|sx; + return ux.f; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/frexp.c b/lib/mlibc/options/ansi/musl-generic-math/frexp.c new file mode 100644 index 0000000..27b6266 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/frexp.c @@ -0,0 +1,23 @@ +#include <math.h> +#include <stdint.h> + +double frexp(double x, int *e) +{ + union { double d; uint64_t i; } y = { x }; + int ee = y.i>>52 & 0x7ff; + + if (!ee) { + if (x) { + x = frexp(x*0x1p64, e); + *e -= 64; + } else *e = 0; + return x; + } else if (ee == 0x7ff) { + return x; + } + + *e = ee - 0x3fe; + y.i &= 0x800fffffffffffffull; + y.i |= 0x3fe0000000000000ull; + return y.d; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/frexpf.c b/lib/mlibc/options/ansi/musl-generic-math/frexpf.c new file mode 100644 index 0000000..0787097 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/frexpf.c @@ -0,0 +1,23 @@ +#include <math.h> +#include <stdint.h> + +float frexpf(float x, int *e) +{ + union { float f; uint32_t i; } y = { x }; + int ee = y.i>>23 & 0xff; + + if (!ee) { + if (x) { + x = frexpf(x*0x1p64, e); + *e -= 64; + } else *e = 0; + return x; + } else if (ee == 0xff) { + return x; + } + + *e = ee - 0x7e; + y.i &= 0x807ffffful; + y.i |= 0x3f000000ul; + return y.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/frexpl.c b/lib/mlibc/options/ansi/musl-generic-math/frexpl.c new file mode 100644 index 0000000..3c1b553 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/frexpl.c @@ -0,0 +1,29 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double frexpl(long double x, int *e) +{ + return frexp(x, e); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double frexpl(long double x, int *e) +{ + union ldshape u = {x}; + int ee = u.i.se & 0x7fff; + + if (!ee) { + if (x) { + x = frexpl(x*0x1p120, e); + *e -= 120; + } else *e = 0; + return x; + } else if (ee == 0x7fff) { + return x; + } + + *e = ee - 0x3ffe; + u.i.se &= 0x8000; + u.i.se |= 0x3ffe; + return u.f; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/hypot.c b/lib/mlibc/options/ansi/musl-generic-math/hypot.c new file mode 100644 index 0000000..6071bf1 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/hypot.c @@ -0,0 +1,67 @@ +#include <math.h> +#include <stdint.h> +#include <float.h> + +#if FLT_EVAL_METHOD > 1U && LDBL_MANT_DIG == 64 +#define SPLIT (0x1p32 + 1) +#else +#define SPLIT (0x1p27 + 1) +#endif + +static void sq(double_t *hi, double_t *lo, double x) +{ + double_t xh, xl, xc; + + xc = (double_t)x*SPLIT; + xh = x - xc + xc; + xl = x - xh; + *hi = (double_t)x*x; + *lo = xh*xh - *hi + 2*xh*xl + xl*xl; +} + +double hypot(double x, double y) +{ + union {double f; uint64_t i;} ux = {x}, uy = {y}, ut; + int ex, ey; + double_t hx, lx, hy, ly, z; + + /* arrange |x| >= |y| */ + ux.i &= -1ULL>>1; + uy.i &= -1ULL>>1; + if (ux.i < uy.i) { + ut = ux; + ux = uy; + uy = ut; + } + + /* special cases */ + ex = ux.i>>52; + ey = uy.i>>52; + x = ux.f; + y = uy.f; + /* note: hypot(inf,nan) == inf */ + if (ey == 0x7ff) + return y; + if (ex == 0x7ff || uy.i == 0) + return x; + /* note: hypot(x,y) ~= x + y*y/x/2 with inexact for small y/x */ + /* 64 difference is enough for ld80 double_t */ + if (ex - ey > 64) + return x + y; + + /* precise sqrt argument in nearest rounding mode without overflow */ + /* xh*xh must not overflow and xl*xl must not underflow in sq */ + z = 1; + if (ex > 0x3ff+510) { + z = 0x1p700; + x *= 0x1p-700; + y *= 0x1p-700; + } else if (ey < 0x3ff-450) { + z = 0x1p-700; + x *= 0x1p700; + y *= 0x1p700; + } + sq(&hx, &lx, x); + sq(&hy, &ly, y); + return z*sqrt(ly+lx+hy+hx); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/hypotf.c b/lib/mlibc/options/ansi/musl-generic-math/hypotf.c new file mode 100644 index 0000000..2fc214b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/hypotf.c @@ -0,0 +1,35 @@ +#include <math.h> +#include <stdint.h> + +float hypotf(float x, float y) +{ + union {float f; uint32_t i;} ux = {x}, uy = {y}, ut; + float_t z; + + ux.i &= -1U>>1; + uy.i &= -1U>>1; + if (ux.i < uy.i) { + ut = ux; + ux = uy; + uy = ut; + } + + x = ux.f; + y = uy.f; + if (uy.i == 0xff<<23) + return y; + if (ux.i >= 0xff<<23 || uy.i == 0 || ux.i - uy.i >= 25<<23) + return x + y; + + z = 1; + if (ux.i >= (0x7f+60)<<23) { + z = 0x1p90f; + x *= 0x1p-90f; + y *= 0x1p-90f; + } else if (uy.i < (0x7f-60)<<23) { + z = 0x1p-90f; + x *= 0x1p90f; + y *= 0x1p90f; + } + return z*sqrtf((double)x*x + (double)y*y); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/hypotl.c b/lib/mlibc/options/ansi/musl-generic-math/hypotl.c new file mode 100644 index 0000000..479aa92 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/hypotl.c @@ -0,0 +1,66 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double hypotl(long double x, long double y) +{ + return hypot(x, y); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#if LDBL_MANT_DIG == 64 +#define SPLIT (0x1p32L+1) +#elif LDBL_MANT_DIG == 113 +#define SPLIT (0x1p57L+1) +#endif + +static void sq(long double *hi, long double *lo, long double x) +{ + long double xh, xl, xc; + xc = x*SPLIT; + xh = x - xc + xc; + xl = x - xh; + *hi = x*x; + *lo = xh*xh - *hi + 2*xh*xl + xl*xl; +} + +long double hypotl(long double x, long double y) +{ + union ldshape ux = {x}, uy = {y}; + int ex, ey; + long double hx, lx, hy, ly, z; + + ux.i.se &= 0x7fff; + uy.i.se &= 0x7fff; + if (ux.i.se < uy.i.se) { + ex = uy.i.se; + ey = ux.i.se; + x = uy.f; + y = ux.f; + } else { + ex = ux.i.se; + ey = uy.i.se; + x = ux.f; + y = uy.f; + } + + if (ex == 0x7fff && isinf(y)) + return y; + if (ex == 0x7fff || y == 0) + return x; + if (ex - ey > LDBL_MANT_DIG) + return x + y; + + z = 1; + if (ex > 0x3fff+8000) { + z = 0x1p10000L; + x *= 0x1p-10000L; + y *= 0x1p-10000L; + } else if (ey < 0x3fff-8000) { + z = 0x1p-10000L; + x *= 0x1p10000L; + y *= 0x1p10000L; + } + sq(&hx, &lx, x); + sq(&hy, &ly, y); + return z*sqrtl(ly+lx+hy+hx); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/ilogb.c b/lib/mlibc/options/ansi/musl-generic-math/ilogb.c new file mode 100644 index 0000000..64d4015 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ilogb.c @@ -0,0 +1,26 @@ +#include <limits.h> +#include "libm.h" + +int ilogb(double x) +{ + #pragma STDC FENV_ACCESS ON + union {double f; uint64_t i;} u = {x}; + uint64_t i = u.i; + int e = i>>52 & 0x7ff; + + if (!e) { + i <<= 12; + if (i == 0) { + FORCE_EVAL(0/0.0f); + return FP_ILOGB0; + } + /* subnormal x */ + for (e = -0x3ff; i>>63 == 0; e--, i<<=1); + return e; + } + if (e == 0x7ff) { + FORCE_EVAL(0/0.0f); + return i<<12 ? FP_ILOGBNAN : INT_MAX; + } + return e - 0x3ff; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/ilogbf.c b/lib/mlibc/options/ansi/musl-generic-math/ilogbf.c new file mode 100644 index 0000000..e23ba20 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ilogbf.c @@ -0,0 +1,26 @@ +#include <limits.h> +#include "libm.h" + +int ilogbf(float x) +{ + #pragma STDC FENV_ACCESS ON + union {float f; uint32_t i;} u = {x}; + uint32_t i = u.i; + int e = i>>23 & 0xff; + + if (!e) { + i <<= 9; + if (i == 0) { + FORCE_EVAL(0/0.0f); + return FP_ILOGB0; + } + /* subnormal x */ + for (e = -0x7f; i>>31 == 0; e--, i<<=1); + return e; + } + if (e == 0xff) { + FORCE_EVAL(0/0.0f); + return i<<9 ? FP_ILOGBNAN : INT_MAX; + } + return e - 0x7f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/ilogbl.c b/lib/mlibc/options/ansi/musl-generic-math/ilogbl.c new file mode 100644 index 0000000..7b1a9cf --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ilogbl.c @@ -0,0 +1,55 @@ +#include <limits.h> +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +int ilogbl(long double x) +{ + return ilogb(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +int ilogbl(long double x) +{ + #pragma STDC FENV_ACCESS ON + union ldshape u = {x}; + uint64_t m = u.i.m; + int e = u.i.se & 0x7fff; + + if (!e) { + if (m == 0) { + FORCE_EVAL(0/0.0f); + return FP_ILOGB0; + } + /* subnormal x */ + for (e = -0x3fff+1; m>>63 == 0; e--, m<<=1); + return e; + } + if (e == 0x7fff) { + FORCE_EVAL(0/0.0f); + return m<<1 ? FP_ILOGBNAN : INT_MAX; + } + return e - 0x3fff; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +int ilogbl(long double x) +{ + #pragma STDC FENV_ACCESS ON + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + + if (!e) { + if (x == 0) { + FORCE_EVAL(0/0.0f); + return FP_ILOGB0; + } + /* subnormal x */ + x *= 0x1p120; + return ilogbl(x) - 120; + } + if (e == 0x7fff) { + FORCE_EVAL(0/0.0f); + u.i.se = 0; + return u.f ? FP_ILOGBNAN : INT_MAX; + } + return e - 0x3fff; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/j0.c b/lib/mlibc/options/ansi/musl-generic-math/j0.c new file mode 100644 index 0000000..d722d94 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/j0.c @@ -0,0 +1,375 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_j0.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* j0(x), y0(x) + * Bessel function of the first and second kinds of order zero. + * Method -- j0(x): + * 1. For tiny x, we use j0(x) = 1 - x^2/4 + x^4/64 - ... + * 2. Reduce x to |x| since j0(x)=j0(-x), and + * for x in (0,2) + * j0(x) = 1-z/4+ z^2*R0/S0, where z = x*x; + * (precision: |j0-1+z/4-z^2R0/S0 |<2**-63.67 ) + * for x in (2,inf) + * j0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)-q0(x)*sin(x0)) + * where x0 = x-pi/4. It is better to compute sin(x0),cos(x0) + * as follow: + * cos(x0) = cos(x)cos(pi/4)+sin(x)sin(pi/4) + * = 1/sqrt(2) * (cos(x) + sin(x)) + * sin(x0) = sin(x)cos(pi/4)-cos(x)sin(pi/4) + * = 1/sqrt(2) * (sin(x) - cos(x)) + * (To avoid cancellation, use + * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) + * to compute the worse one.) + * + * 3 Special cases + * j0(nan)= nan + * j0(0) = 1 + * j0(inf) = 0 + * + * Method -- y0(x): + * 1. For x<2. + * Since + * y0(x) = 2/pi*(j0(x)*(ln(x/2)+Euler) + x^2/4 - ...) + * therefore y0(x)-2/pi*j0(x)*ln(x) is an even function. + * We use the following function to approximate y0, + * y0(x) = U(z)/V(z) + (2/pi)*(j0(x)*ln(x)), z= x^2 + * where + * U(z) = u00 + u01*z + ... + u06*z^6 + * V(z) = 1 + v01*z + ... + v04*z^4 + * with absolute approximation error bounded by 2**-72. + * Note: For tiny x, U/V = u0 and j0(x)~1, hence + * y0(tiny) = u0 + (2/pi)*ln(tiny), (choose tiny<2**-27) + * 2. For x>=2. + * y0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)+q0(x)*sin(x0)) + * where x0 = x-pi/4. It is better to compute sin(x0),cos(x0) + * by the method mentioned above. + * 3. Special cases: y0(0)=-inf, y0(x<0)=NaN, y0(inf)=0. + */ + +#include "libm.h" + +static double pzero(double), qzero(double); + +static const double +invsqrtpi = 5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */ +tpi = 6.36619772367581382433e-01; /* 0x3FE45F30, 0x6DC9C883 */ + +/* common method when |x|>=2 */ +static double common(uint32_t ix, double x, int y0) +{ + double s,c,ss,cc,z; + + /* + * j0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x-pi/4)-q0(x)*sin(x-pi/4)) + * y0(x) = sqrt(2/(pi*x))*(p0(x)*sin(x-pi/4)+q0(x)*cos(x-pi/4)) + * + * sin(x-pi/4) = (sin(x) - cos(x))/sqrt(2) + * cos(x-pi/4) = (sin(x) + cos(x))/sqrt(2) + * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) + */ + s = sin(x); + c = cos(x); + if (y0) + c = -c; + cc = s+c; + /* avoid overflow in 2*x, big ulp error when x>=0x1p1023 */ + if (ix < 0x7fe00000) { + ss = s-c; + z = -cos(2*x); + if (s*c < 0) + cc = z/ss; + else + ss = z/cc; + if (ix < 0x48000000) { + if (y0) + ss = -ss; + cc = pzero(x)*cc-qzero(x)*ss; + } + } + return invsqrtpi*cc/sqrt(x); +} + +/* R0/S0 on [0, 2.00] */ +static const double +R02 = 1.56249999999999947958e-02, /* 0x3F8FFFFF, 0xFFFFFFFD */ +R03 = -1.89979294238854721751e-04, /* 0xBF28E6A5, 0xB61AC6E9 */ +R04 = 1.82954049532700665670e-06, /* 0x3EBEB1D1, 0x0C503919 */ +R05 = -4.61832688532103189199e-09, /* 0xBE33D5E7, 0x73D63FCE */ +S01 = 1.56191029464890010492e-02, /* 0x3F8FFCE8, 0x82C8C2A4 */ +S02 = 1.16926784663337450260e-04, /* 0x3F1EA6D2, 0xDD57DBF4 */ +S03 = 5.13546550207318111446e-07, /* 0x3EA13B54, 0xCE84D5A9 */ +S04 = 1.16614003333790000205e-09; /* 0x3E1408BC, 0xF4745D8F */ + +double j0(double x) +{ + double z,r,s; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* j0(+-inf)=0, j0(nan)=nan */ + if (ix >= 0x7ff00000) + return 1/(x*x); + x = fabs(x); + + if (ix >= 0x40000000) { /* |x| >= 2 */ + /* large ulp error near zeros: 2.4, 5.52, 8.6537,.. */ + return common(ix,x,0); + } + + /* 1 - x*x/4 + x*x*R(x^2)/S(x^2) */ + if (ix >= 0x3f200000) { /* |x| >= 2**-13 */ + /* up to 4ulp error close to 2 */ + z = x*x; + r = z*(R02+z*(R03+z*(R04+z*R05))); + s = 1+z*(S01+z*(S02+z*(S03+z*S04))); + return (1+x/2)*(1-x/2) + z*(r/s); + } + + /* 1 - x*x/4 */ + /* prevent underflow */ + /* inexact should be raised when x!=0, this is not done correctly */ + if (ix >= 0x38000000) /* |x| >= 2**-127 */ + x = 0.25*x*x; + return 1 - x; +} + +static const double +u00 = -7.38042951086872317523e-02, /* 0xBFB2E4D6, 0x99CBD01F */ +u01 = 1.76666452509181115538e-01, /* 0x3FC69D01, 0x9DE9E3FC */ +u02 = -1.38185671945596898896e-02, /* 0xBF8C4CE8, 0xB16CFA97 */ +u03 = 3.47453432093683650238e-04, /* 0x3F36C54D, 0x20B29B6B */ +u04 = -3.81407053724364161125e-06, /* 0xBECFFEA7, 0x73D25CAD */ +u05 = 1.95590137035022920206e-08, /* 0x3E550057, 0x3B4EABD4 */ +u06 = -3.98205194132103398453e-11, /* 0xBDC5E43D, 0x693FB3C8 */ +v01 = 1.27304834834123699328e-02, /* 0x3F8A1270, 0x91C9C71A */ +v02 = 7.60068627350353253702e-05, /* 0x3F13ECBB, 0xF578C6C1 */ +v03 = 2.59150851840457805467e-07, /* 0x3E91642D, 0x7FF202FD */ +v04 = 4.41110311332675467403e-10; /* 0x3DFE5018, 0x3BD6D9EF */ + +double y0(double x) +{ + double z,u,v; + uint32_t ix,lx; + + EXTRACT_WORDS(ix, lx, x); + + /* y0(nan)=nan, y0(<0)=nan, y0(0)=-inf, y0(inf)=0 */ + if ((ix<<1 | lx) == 0) + return -1/0.0; + if (ix>>31) + return 0/0.0; + if (ix >= 0x7ff00000) + return 1/x; + + if (ix >= 0x40000000) { /* x >= 2 */ + /* large ulp errors near zeros: 3.958, 7.086,.. */ + return common(ix,x,1); + } + + /* U(x^2)/V(x^2) + (2/pi)*j0(x)*log(x) */ + if (ix >= 0x3e400000) { /* x >= 2**-27 */ + /* large ulp error near the first zero, x ~= 0.89 */ + z = x*x; + u = u00+z*(u01+z*(u02+z*(u03+z*(u04+z*(u05+z*u06))))); + v = 1.0+z*(v01+z*(v02+z*(v03+z*v04))); + return u/v + tpi*(j0(x)*log(x)); + } + return u00 + tpi*log(x); +} + +/* The asymptotic expansions of pzero is + * 1 - 9/128 s^2 + 11025/98304 s^4 - ..., where s = 1/x. + * For x >= 2, We approximate pzero by + * pzero(x) = 1 + (R/S) + * where R = pR0 + pR1*s^2 + pR2*s^4 + ... + pR5*s^10 + * S = 1 + pS0*s^2 + ... + pS4*s^10 + * and + * | pzero(x)-1-R/S | <= 2 ** ( -60.26) + */ +static const double pR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ + -7.03124999999900357484e-02, /* 0xBFB1FFFF, 0xFFFFFD32 */ + -8.08167041275349795626e+00, /* 0xC02029D0, 0xB44FA779 */ + -2.57063105679704847262e+02, /* 0xC0701102, 0x7B19E863 */ + -2.48521641009428822144e+03, /* 0xC0A36A6E, 0xCD4DCAFC */ + -5.25304380490729545272e+03, /* 0xC0B4850B, 0x36CC643D */ +}; +static const double pS8[5] = { + 1.16534364619668181717e+02, /* 0x405D2233, 0x07A96751 */ + 3.83374475364121826715e+03, /* 0x40ADF37D, 0x50596938 */ + 4.05978572648472545552e+04, /* 0x40E3D2BB, 0x6EB6B05F */ + 1.16752972564375915681e+05, /* 0x40FC810F, 0x8F9FA9BD */ + 4.76277284146730962675e+04, /* 0x40E74177, 0x4F2C49DC */ +}; + +static const double pR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + -1.14125464691894502584e-11, /* 0xBDA918B1, 0x47E495CC */ + -7.03124940873599280078e-02, /* 0xBFB1FFFF, 0xE69AFBC6 */ + -4.15961064470587782438e+00, /* 0xC010A370, 0xF90C6BBF */ + -6.76747652265167261021e+01, /* 0xC050EB2F, 0x5A7D1783 */ + -3.31231299649172967747e+02, /* 0xC074B3B3, 0x6742CC63 */ + -3.46433388365604912451e+02, /* 0xC075A6EF, 0x28A38BD7 */ +}; +static const double pS5[5] = { + 6.07539382692300335975e+01, /* 0x404E6081, 0x0C98C5DE */ + 1.05125230595704579173e+03, /* 0x40906D02, 0x5C7E2864 */ + 5.97897094333855784498e+03, /* 0x40B75AF8, 0x8FBE1D60 */ + 9.62544514357774460223e+03, /* 0x40C2CCB8, 0xFA76FA38 */ + 2.40605815922939109441e+03, /* 0x40A2CC1D, 0xC70BE864 */ +}; + +static const double pR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ + -2.54704601771951915620e-09, /* 0xBE25E103, 0x6FE1AA86 */ + -7.03119616381481654654e-02, /* 0xBFB1FFF6, 0xF7C0E24B */ + -2.40903221549529611423e+00, /* 0xC00345B2, 0xAEA48074 */ + -2.19659774734883086467e+01, /* 0xC035F74A, 0x4CB94E14 */ + -5.80791704701737572236e+01, /* 0xC04D0A22, 0x420A1A45 */ + -3.14479470594888503854e+01, /* 0xC03F72AC, 0xA892D80F */ +}; +static const double pS3[5] = { + 3.58560338055209726349e+01, /* 0x4041ED92, 0x84077DD3 */ + 3.61513983050303863820e+02, /* 0x40769839, 0x464A7C0E */ + 1.19360783792111533330e+03, /* 0x4092A66E, 0x6D1061D6 */ + 1.12799679856907414432e+03, /* 0x40919FFC, 0xB8C39B7E */ + 1.73580930813335754692e+02, /* 0x4065B296, 0xFC379081 */ +}; + +static const double pR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + -8.87534333032526411254e-08, /* 0xBE77D316, 0xE927026D */ + -7.03030995483624743247e-02, /* 0xBFB1FF62, 0x495E1E42 */ + -1.45073846780952986357e+00, /* 0xBFF73639, 0x8A24A843 */ + -7.63569613823527770791e+00, /* 0xC01E8AF3, 0xEDAFA7F3 */ + -1.11931668860356747786e+01, /* 0xC02662E6, 0xC5246303 */ + -3.23364579351335335033e+00, /* 0xC009DE81, 0xAF8FE70F */ +}; +static const double pS2[5] = { + 2.22202997532088808441e+01, /* 0x40363865, 0x908B5959 */ + 1.36206794218215208048e+02, /* 0x4061069E, 0x0EE8878F */ + 2.70470278658083486789e+02, /* 0x4070E786, 0x42EA079B */ + 1.53875394208320329881e+02, /* 0x40633C03, 0x3AB6FAFF */ + 1.46576176948256193810e+01, /* 0x402D50B3, 0x44391809 */ +}; + +static double pzero(double x) +{ + const double *p,*q; + double_t z,r,s; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x40200000){p = pR8; q = pS8;} + else if (ix >= 0x40122E8B){p = pR5; q = pS5;} + else if (ix >= 0x4006DB6D){p = pR3; q = pS3;} + else /*ix >= 0x40000000*/ {p = pR2; q = pS2;} + z = 1.0/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4])))); + return 1.0 + r/s; +} + + +/* For x >= 8, the asymptotic expansions of qzero is + * -1/8 s + 75/1024 s^3 - ..., where s = 1/x. + * We approximate pzero by + * qzero(x) = s*(-1.25 + (R/S)) + * where R = qR0 + qR1*s^2 + qR2*s^4 + ... + qR5*s^10 + * S = 1 + qS0*s^2 + ... + qS5*s^12 + * and + * | qzero(x)/s +1.25-R/S | <= 2 ** ( -61.22) + */ +static const double qR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ + 7.32421874999935051953e-02, /* 0x3FB2BFFF, 0xFFFFFE2C */ + 1.17682064682252693899e+01, /* 0x40278952, 0x5BB334D6 */ + 5.57673380256401856059e+02, /* 0x40816D63, 0x15301825 */ + 8.85919720756468632317e+03, /* 0x40C14D99, 0x3E18F46D */ + 3.70146267776887834771e+04, /* 0x40E212D4, 0x0E901566 */ +}; +static const double qS8[6] = { + 1.63776026895689824414e+02, /* 0x406478D5, 0x365B39BC */ + 8.09834494656449805916e+03, /* 0x40BFA258, 0x4E6B0563 */ + 1.42538291419120476348e+05, /* 0x41016652, 0x54D38C3F */ + 8.03309257119514397345e+05, /* 0x412883DA, 0x83A52B43 */ + 8.40501579819060512818e+05, /* 0x4129A66B, 0x28DE0B3D */ + -3.43899293537866615225e+05, /* 0xC114FD6D, 0x2C9530C5 */ +}; + +static const double qR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + 1.84085963594515531381e-11, /* 0x3DB43D8F, 0x29CC8CD9 */ + 7.32421766612684765896e-02, /* 0x3FB2BFFF, 0xD172B04C */ + 5.83563508962056953777e+00, /* 0x401757B0, 0xB9953DD3 */ + 1.35111577286449829671e+02, /* 0x4060E392, 0x0A8788E9 */ + 1.02724376596164097464e+03, /* 0x40900CF9, 0x9DC8C481 */ + 1.98997785864605384631e+03, /* 0x409F17E9, 0x53C6E3A6 */ +}; +static const double qS5[6] = { + 8.27766102236537761883e+01, /* 0x4054B1B3, 0xFB5E1543 */ + 2.07781416421392987104e+03, /* 0x40A03BA0, 0xDA21C0CE */ + 1.88472887785718085070e+04, /* 0x40D267D2, 0x7B591E6D */ + 5.67511122894947329769e+04, /* 0x40EBB5E3, 0x97E02372 */ + 3.59767538425114471465e+04, /* 0x40E19118, 0x1F7A54A0 */ + -5.35434275601944773371e+03, /* 0xC0B4EA57, 0xBEDBC609 */ +}; + +static const double qR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ + 4.37741014089738620906e-09, /* 0x3E32CD03, 0x6ADECB82 */ + 7.32411180042911447163e-02, /* 0x3FB2BFEE, 0x0E8D0842 */ + 3.34423137516170720929e+00, /* 0x400AC0FC, 0x61149CF5 */ + 4.26218440745412650017e+01, /* 0x40454F98, 0x962DAEDD */ + 1.70808091340565596283e+02, /* 0x406559DB, 0xE25EFD1F */ + 1.66733948696651168575e+02, /* 0x4064D77C, 0x81FA21E0 */ +}; +static const double qS3[6] = { + 4.87588729724587182091e+01, /* 0x40486122, 0xBFE343A6 */ + 7.09689221056606015736e+02, /* 0x40862D83, 0x86544EB3 */ + 3.70414822620111362994e+03, /* 0x40ACF04B, 0xE44DFC63 */ + 6.46042516752568917582e+03, /* 0x40B93C6C, 0xD7C76A28 */ + 2.51633368920368957333e+03, /* 0x40A3A8AA, 0xD94FB1C0 */ + -1.49247451836156386662e+02, /* 0xC062A7EB, 0x201CF40F */ +}; + +static const double qR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + 1.50444444886983272379e-07, /* 0x3E84313B, 0x54F76BDB */ + 7.32234265963079278272e-02, /* 0x3FB2BEC5, 0x3E883E34 */ + 1.99819174093815998816e+00, /* 0x3FFFF897, 0xE727779C */ + 1.44956029347885735348e+01, /* 0x402CFDBF, 0xAAF96FE5 */ + 3.16662317504781540833e+01, /* 0x403FAA8E, 0x29FBDC4A */ + 1.62527075710929267416e+01, /* 0x403040B1, 0x71814BB4 */ +}; +static const double qS2[6] = { + 3.03655848355219184498e+01, /* 0x403E5D96, 0xF7C07AED */ + 2.69348118608049844624e+02, /* 0x4070D591, 0xE4D14B40 */ + 8.44783757595320139444e+02, /* 0x408A6645, 0x22B3BF22 */ + 8.82935845112488550512e+02, /* 0x408B977C, 0x9C5CC214 */ + 2.12666388511798828631e+02, /* 0x406A9553, 0x0E001365 */ + -5.31095493882666946917e+00, /* 0xC0153E6A, 0xF8B32931 */ +}; + +static double qzero(double x) +{ + const double *p,*q; + double_t s,r,z; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x40200000){p = qR8; q = qS8;} + else if (ix >= 0x40122E8B){p = qR5; q = qS5;} + else if (ix >= 0x4006DB6D){p = qR3; q = qS3;} + else /*ix >= 0x40000000*/ {p = qR2; q = qS2;} + z = 1.0/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5]))))); + return (-.125 + r/s)/x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/j0f.c b/lib/mlibc/options/ansi/musl-generic-math/j0f.c new file mode 100644 index 0000000..fab554a --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/j0f.c @@ -0,0 +1,314 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_j0f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include "libm.h" + +static float pzerof(float), qzerof(float); + +static const float +invsqrtpi = 5.6418961287e-01, /* 0x3f106ebb */ +tpi = 6.3661974669e-01; /* 0x3f22f983 */ + +static float common(uint32_t ix, float x, int y0) +{ + float z,s,c,ss,cc; + /* + * j0(x) = 1/sqrt(pi) * (P(0,x)*cc - Q(0,x)*ss) / sqrt(x) + * y0(x) = 1/sqrt(pi) * (P(0,x)*ss + Q(0,x)*cc) / sqrt(x) + */ + s = sinf(x); + c = cosf(x); + if (y0) + c = -c; + cc = s+c; + if (ix < 0x7f000000) { + ss = s-c; + z = -cosf(2*x); + if (s*c < 0) + cc = z/ss; + else + ss = z/cc; + if (ix < 0x58800000) { + if (y0) + ss = -ss; + cc = pzerof(x)*cc-qzerof(x)*ss; + } + } + return invsqrtpi*cc/sqrtf(x); +} + +/* R0/S0 on [0, 2.00] */ +static const float +R02 = 1.5625000000e-02, /* 0x3c800000 */ +R03 = -1.8997929874e-04, /* 0xb947352e */ +R04 = 1.8295404516e-06, /* 0x35f58e88 */ +R05 = -4.6183270541e-09, /* 0xb19eaf3c */ +S01 = 1.5619102865e-02, /* 0x3c7fe744 */ +S02 = 1.1692678527e-04, /* 0x38f53697 */ +S03 = 5.1354652442e-07, /* 0x3509daa6 */ +S04 = 1.1661400734e-09; /* 0x30a045e8 */ + +float j0f(float x) +{ + float z,r,s; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x7f800000) + return 1/(x*x); + x = fabsf(x); + + if (ix >= 0x40000000) { /* |x| >= 2 */ + /* large ulp error near zeros */ + return common(ix, x, 0); + } + if (ix >= 0x3a000000) { /* |x| >= 2**-11 */ + /* up to 4ulp error near 2 */ + z = x*x; + r = z*(R02+z*(R03+z*(R04+z*R05))); + s = 1+z*(S01+z*(S02+z*(S03+z*S04))); + return (1+x/2)*(1-x/2) + z*(r/s); + } + if (ix >= 0x21800000) /* |x| >= 2**-60 */ + x = 0.25f*x*x; + return 1 - x; +} + +static const float +u00 = -7.3804296553e-02, /* 0xbd9726b5 */ +u01 = 1.7666645348e-01, /* 0x3e34e80d */ +u02 = -1.3818567619e-02, /* 0xbc626746 */ +u03 = 3.4745343146e-04, /* 0x39b62a69 */ +u04 = -3.8140706238e-06, /* 0xb67ff53c */ +u05 = 1.9559013964e-08, /* 0x32a802ba */ +u06 = -3.9820518410e-11, /* 0xae2f21eb */ +v01 = 1.2730483897e-02, /* 0x3c509385 */ +v02 = 7.6006865129e-05, /* 0x389f65e0 */ +v03 = 2.5915085189e-07, /* 0x348b216c */ +v04 = 4.4111031494e-10; /* 0x2ff280c2 */ + +float y0f(float x) +{ + float z,u,v; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + if ((ix & 0x7fffffff) == 0) + return -1/0.0f; + if (ix>>31) + return 0/0.0f; + if (ix >= 0x7f800000) + return 1/x; + if (ix >= 0x40000000) { /* |x| >= 2.0 */ + /* large ulp error near zeros */ + return common(ix,x,1); + } + if (ix >= 0x39000000) { /* x >= 2**-13 */ + /* large ulp error at x ~= 0.89 */ + z = x*x; + u = u00+z*(u01+z*(u02+z*(u03+z*(u04+z*(u05+z*u06))))); + v = 1+z*(v01+z*(v02+z*(v03+z*v04))); + return u/v + tpi*(j0f(x)*logf(x)); + } + return u00 + tpi*logf(x); +} + +/* The asymptotic expansions of pzero is + * 1 - 9/128 s^2 + 11025/98304 s^4 - ..., where s = 1/x. + * For x >= 2, We approximate pzero by + * pzero(x) = 1 + (R/S) + * where R = pR0 + pR1*s^2 + pR2*s^4 + ... + pR5*s^10 + * S = 1 + pS0*s^2 + ... + pS4*s^10 + * and + * | pzero(x)-1-R/S | <= 2 ** ( -60.26) + */ +static const float pR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.0000000000e+00, /* 0x00000000 */ + -7.0312500000e-02, /* 0xbd900000 */ + -8.0816707611e+00, /* 0xc1014e86 */ + -2.5706311035e+02, /* 0xc3808814 */ + -2.4852163086e+03, /* 0xc51b5376 */ + -5.2530439453e+03, /* 0xc5a4285a */ +}; +static const float pS8[5] = { + 1.1653436279e+02, /* 0x42e91198 */ + 3.8337448730e+03, /* 0x456f9beb */ + 4.0597855469e+04, /* 0x471e95db */ + 1.1675296875e+05, /* 0x47e4087c */ + 4.7627726562e+04, /* 0x473a0bba */ +}; +static const float pR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + -1.1412546255e-11, /* 0xad48c58a */ + -7.0312492549e-02, /* 0xbd8fffff */ + -4.1596107483e+00, /* 0xc0851b88 */ + -6.7674766541e+01, /* 0xc287597b */ + -3.3123129272e+02, /* 0xc3a59d9b */ + -3.4643338013e+02, /* 0xc3ad3779 */ +}; +static const float pS5[5] = { + 6.0753936768e+01, /* 0x42730408 */ + 1.0512523193e+03, /* 0x44836813 */ + 5.9789707031e+03, /* 0x45bad7c4 */ + 9.6254453125e+03, /* 0x461665c8 */ + 2.4060581055e+03, /* 0x451660ee */ +}; + +static const float pR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ + -2.5470459075e-09, /* 0xb12f081b */ + -7.0311963558e-02, /* 0xbd8fffb8 */ + -2.4090321064e+00, /* 0xc01a2d95 */ + -2.1965976715e+01, /* 0xc1afba52 */ + -5.8079170227e+01, /* 0xc2685112 */ + -3.1447946548e+01, /* 0xc1fb9565 */ +}; +static const float pS3[5] = { + 3.5856033325e+01, /* 0x420f6c94 */ + 3.6151397705e+02, /* 0x43b4c1ca */ + 1.1936077881e+03, /* 0x44953373 */ + 1.1279968262e+03, /* 0x448cffe6 */ + 1.7358093262e+02, /* 0x432d94b8 */ +}; + +static const float pR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + -8.8753431271e-08, /* 0xb3be98b7 */ + -7.0303097367e-02, /* 0xbd8ffb12 */ + -1.4507384300e+00, /* 0xbfb9b1cc */ + -7.6356959343e+00, /* 0xc0f4579f */ + -1.1193166733e+01, /* 0xc1331736 */ + -3.2336456776e+00, /* 0xc04ef40d */ +}; +static const float pS2[5] = { + 2.2220300674e+01, /* 0x41b1c32d */ + 1.3620678711e+02, /* 0x430834f0 */ + 2.7047027588e+02, /* 0x43873c32 */ + 1.5387539673e+02, /* 0x4319e01a */ + 1.4657617569e+01, /* 0x416a859a */ +}; + +static float pzerof(float x) +{ + const float *p,*q; + float_t z,r,s; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x41000000){p = pR8; q = pS8;} + else if (ix >= 0x409173eb){p = pR5; q = pS5;} + else if (ix >= 0x4036d917){p = pR3; q = pS3;} + else /*ix >= 0x40000000*/ {p = pR2; q = pS2;} + z = 1.0f/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0f+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4])))); + return 1.0f + r/s; +} + + +/* For x >= 8, the asymptotic expansions of qzero is + * -1/8 s + 75/1024 s^3 - ..., where s = 1/x. + * We approximate pzero by + * qzero(x) = s*(-1.25 + (R/S)) + * where R = qR0 + qR1*s^2 + qR2*s^4 + ... + qR5*s^10 + * S = 1 + qS0*s^2 + ... + qS5*s^12 + * and + * | qzero(x)/s +1.25-R/S | <= 2 ** ( -61.22) + */ +static const float qR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.0000000000e+00, /* 0x00000000 */ + 7.3242187500e-02, /* 0x3d960000 */ + 1.1768206596e+01, /* 0x413c4a93 */ + 5.5767340088e+02, /* 0x440b6b19 */ + 8.8591972656e+03, /* 0x460a6cca */ + 3.7014625000e+04, /* 0x471096a0 */ +}; +static const float qS8[6] = { + 1.6377603149e+02, /* 0x4323c6aa */ + 8.0983447266e+03, /* 0x45fd12c2 */ + 1.4253829688e+05, /* 0x480b3293 */ + 8.0330925000e+05, /* 0x49441ed4 */ + 8.4050156250e+05, /* 0x494d3359 */ + -3.4389928125e+05, /* 0xc8a7eb69 */ +}; + +static const float qR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + 1.8408595828e-11, /* 0x2da1ec79 */ + 7.3242180049e-02, /* 0x3d95ffff */ + 5.8356351852e+00, /* 0x40babd86 */ + 1.3511157227e+02, /* 0x43071c90 */ + 1.0272437744e+03, /* 0x448067cd */ + 1.9899779053e+03, /* 0x44f8bf4b */ +}; +static const float qS5[6] = { + 8.2776611328e+01, /* 0x42a58da0 */ + 2.0778142090e+03, /* 0x4501dd07 */ + 1.8847289062e+04, /* 0x46933e94 */ + 5.6751113281e+04, /* 0x475daf1d */ + 3.5976753906e+04, /* 0x470c88c1 */ + -5.3543427734e+03, /* 0xc5a752be */ +}; + +static const float qR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ + 4.3774099900e-09, /* 0x3196681b */ + 7.3241114616e-02, /* 0x3d95ff70 */ + 3.3442313671e+00, /* 0x405607e3 */ + 4.2621845245e+01, /* 0x422a7cc5 */ + 1.7080809021e+02, /* 0x432acedf */ + 1.6673394775e+02, /* 0x4326bbe4 */ +}; +static const float qS3[6] = { + 4.8758872986e+01, /* 0x42430916 */ + 7.0968920898e+02, /* 0x44316c1c */ + 3.7041481934e+03, /* 0x4567825f */ + 6.4604252930e+03, /* 0x45c9e367 */ + 2.5163337402e+03, /* 0x451d4557 */ + -1.4924745178e+02, /* 0xc3153f59 */ +}; + +static const float qR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + 1.5044444979e-07, /* 0x342189db */ + 7.3223426938e-02, /* 0x3d95f62a */ + 1.9981917143e+00, /* 0x3fffc4bf */ + 1.4495602608e+01, /* 0x4167edfd */ + 3.1666231155e+01, /* 0x41fd5471 */ + 1.6252708435e+01, /* 0x4182058c */ +}; +static const float qS2[6] = { + 3.0365585327e+01, /* 0x41f2ecb8 */ + 2.6934811401e+02, /* 0x4386ac8f */ + 8.4478375244e+02, /* 0x44533229 */ + 8.8293585205e+02, /* 0x445cbbe5 */ + 2.1266638184e+02, /* 0x4354aa98 */ + -5.3109550476e+00, /* 0xc0a9f358 */ +}; + +static float qzerof(float x) +{ + const float *p,*q; + float_t s,r,z; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x41000000){p = qR8; q = qS8;} + else if (ix >= 0x409173eb){p = qR5; q = qS5;} + else if (ix >= 0x4036d917){p = qR3; q = qS3;} + else /*ix >= 0x40000000*/ {p = qR2; q = qS2;} + z = 1.0f/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0f+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5]))))); + return (-.125f + r/s)/x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/j1.c b/lib/mlibc/options/ansi/musl-generic-math/j1.c new file mode 100644 index 0000000..df724d1 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/j1.c @@ -0,0 +1,362 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_j1.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* j1(x), y1(x) + * Bessel function of the first and second kinds of order zero. + * Method -- j1(x): + * 1. For tiny x, we use j1(x) = x/2 - x^3/16 + x^5/384 - ... + * 2. Reduce x to |x| since j1(x)=-j1(-x), and + * for x in (0,2) + * j1(x) = x/2 + x*z*R0/S0, where z = x*x; + * (precision: |j1/x - 1/2 - R0/S0 |<2**-61.51 ) + * for x in (2,inf) + * j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x1)-q1(x)*sin(x1)) + * y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1)) + * where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1) + * as follow: + * cos(x1) = cos(x)cos(3pi/4)+sin(x)sin(3pi/4) + * = 1/sqrt(2) * (sin(x) - cos(x)) + * sin(x1) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4) + * = -1/sqrt(2) * (sin(x) + cos(x)) + * (To avoid cancellation, use + * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) + * to compute the worse one.) + * + * 3 Special cases + * j1(nan)= nan + * j1(0) = 0 + * j1(inf) = 0 + * + * Method -- y1(x): + * 1. screen out x<=0 cases: y1(0)=-inf, y1(x<0)=NaN + * 2. For x<2. + * Since + * y1(x) = 2/pi*(j1(x)*(ln(x/2)+Euler)-1/x-x/2+5/64*x^3-...) + * therefore y1(x)-2/pi*j1(x)*ln(x)-1/x is an odd function. + * We use the following function to approximate y1, + * y1(x) = x*U(z)/V(z) + (2/pi)*(j1(x)*ln(x)-1/x), z= x^2 + * where for x in [0,2] (abs err less than 2**-65.89) + * U(z) = U0[0] + U0[1]*z + ... + U0[4]*z^4 + * V(z) = 1 + v0[0]*z + ... + v0[4]*z^5 + * Note: For tiny x, 1/x dominate y1 and hence + * y1(tiny) = -2/pi/tiny, (choose tiny<2**-54) + * 3. For x>=2. + * y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1)) + * where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1) + * by method mentioned above. + */ + +#include "libm.h" + +static double pone(double), qone(double); + +static const double +invsqrtpi = 5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */ +tpi = 6.36619772367581382433e-01; /* 0x3FE45F30, 0x6DC9C883 */ + +static double common(uint32_t ix, double x, int y1, int sign) +{ + double z,s,c,ss,cc; + + /* + * j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x-3pi/4)-q1(x)*sin(x-3pi/4)) + * y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x-3pi/4)+q1(x)*cos(x-3pi/4)) + * + * sin(x-3pi/4) = -(sin(x) + cos(x))/sqrt(2) + * cos(x-3pi/4) = (sin(x) - cos(x))/sqrt(2) + * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) + */ + s = sin(x); + if (y1) + s = -s; + c = cos(x); + cc = s-c; + if (ix < 0x7fe00000) { + /* avoid overflow in 2*x */ + ss = -s-c; + z = cos(2*x); + if (s*c > 0) + cc = z/ss; + else + ss = z/cc; + if (ix < 0x48000000) { + if (y1) + ss = -ss; + cc = pone(x)*cc-qone(x)*ss; + } + } + if (sign) + cc = -cc; + return invsqrtpi*cc/sqrt(x); +} + +/* R0/S0 on [0,2] */ +static const double +r00 = -6.25000000000000000000e-02, /* 0xBFB00000, 0x00000000 */ +r01 = 1.40705666955189706048e-03, /* 0x3F570D9F, 0x98472C61 */ +r02 = -1.59955631084035597520e-05, /* 0xBEF0C5C6, 0xBA169668 */ +r03 = 4.96727999609584448412e-08, /* 0x3E6AAAFA, 0x46CA0BD9 */ +s01 = 1.91537599538363460805e-02, /* 0x3F939D0B, 0x12637E53 */ +s02 = 1.85946785588630915560e-04, /* 0x3F285F56, 0xB9CDF664 */ +s03 = 1.17718464042623683263e-06, /* 0x3EB3BFF8, 0x333F8498 */ +s04 = 5.04636257076217042715e-09, /* 0x3E35AC88, 0xC97DFF2C */ +s05 = 1.23542274426137913908e-11; /* 0x3DAB2ACF, 0xCFB97ED8 */ + +double j1(double x) +{ + double z,r,s; + uint32_t ix; + int sign; + + GET_HIGH_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7ff00000) + return 1/(x*x); + if (ix >= 0x40000000) /* |x| >= 2 */ + return common(ix, fabs(x), 0, sign); + if (ix >= 0x38000000) { /* |x| >= 2**-127 */ + z = x*x; + r = z*(r00+z*(r01+z*(r02+z*r03))); + s = 1+z*(s01+z*(s02+z*(s03+z*(s04+z*s05)))); + z = r/s; + } else + /* avoid underflow, raise inexact if x!=0 */ + z = x; + return (0.5 + z)*x; +} + +static const double U0[5] = { + -1.96057090646238940668e-01, /* 0xBFC91866, 0x143CBC8A */ + 5.04438716639811282616e-02, /* 0x3FA9D3C7, 0x76292CD1 */ + -1.91256895875763547298e-03, /* 0xBF5F55E5, 0x4844F50F */ + 2.35252600561610495928e-05, /* 0x3EF8AB03, 0x8FA6B88E */ + -9.19099158039878874504e-08, /* 0xBE78AC00, 0x569105B8 */ +}; +static const double V0[5] = { + 1.99167318236649903973e-02, /* 0x3F94650D, 0x3F4DA9F0 */ + 2.02552581025135171496e-04, /* 0x3F2A8C89, 0x6C257764 */ + 1.35608801097516229404e-06, /* 0x3EB6C05A, 0x894E8CA6 */ + 6.22741452364621501295e-09, /* 0x3E3ABF1D, 0x5BA69A86 */ + 1.66559246207992079114e-11, /* 0x3DB25039, 0xDACA772A */ +}; + +double y1(double x) +{ + double z,u,v; + uint32_t ix,lx; + + EXTRACT_WORDS(ix, lx, x); + /* y1(nan)=nan, y1(<0)=nan, y1(0)=-inf, y1(inf)=0 */ + if ((ix<<1 | lx) == 0) + return -1/0.0; + if (ix>>31) + return 0/0.0; + if (ix >= 0x7ff00000) + return 1/x; + + if (ix >= 0x40000000) /* x >= 2 */ + return common(ix, x, 1, 0); + if (ix < 0x3c900000) /* x < 2**-54 */ + return -tpi/x; + z = x*x; + u = U0[0]+z*(U0[1]+z*(U0[2]+z*(U0[3]+z*U0[4]))); + v = 1+z*(V0[0]+z*(V0[1]+z*(V0[2]+z*(V0[3]+z*V0[4])))); + return x*(u/v) + tpi*(j1(x)*log(x)-1/x); +} + +/* For x >= 8, the asymptotic expansions of pone is + * 1 + 15/128 s^2 - 4725/2^15 s^4 - ..., where s = 1/x. + * We approximate pone by + * pone(x) = 1 + (R/S) + * where R = pr0 + pr1*s^2 + pr2*s^4 + ... + pr5*s^10 + * S = 1 + ps0*s^2 + ... + ps4*s^10 + * and + * | pone(x)-1-R/S | <= 2 ** ( -60.06) + */ + +static const double pr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ + 1.17187499999988647970e-01, /* 0x3FBDFFFF, 0xFFFFFCCE */ + 1.32394806593073575129e+01, /* 0x402A7A9D, 0x357F7FCE */ + 4.12051854307378562225e+02, /* 0x4079C0D4, 0x652EA590 */ + 3.87474538913960532227e+03, /* 0x40AE457D, 0xA3A532CC */ + 7.91447954031891731574e+03, /* 0x40BEEA7A, 0xC32782DD */ +}; +static const double ps8[5] = { + 1.14207370375678408436e+02, /* 0x405C8D45, 0x8E656CAC */ + 3.65093083420853463394e+03, /* 0x40AC85DC, 0x964D274F */ + 3.69562060269033463555e+04, /* 0x40E20B86, 0x97C5BB7F */ + 9.76027935934950801311e+04, /* 0x40F7D42C, 0xB28F17BB */ + 3.08042720627888811578e+04, /* 0x40DE1511, 0x697A0B2D */ +}; + +static const double pr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + 1.31990519556243522749e-11, /* 0x3DAD0667, 0xDAE1CA7D */ + 1.17187493190614097638e-01, /* 0x3FBDFFFF, 0xE2C10043 */ + 6.80275127868432871736e+00, /* 0x401B3604, 0x6E6315E3 */ + 1.08308182990189109773e+02, /* 0x405B13B9, 0x452602ED */ + 5.17636139533199752805e+02, /* 0x40802D16, 0xD052D649 */ + 5.28715201363337541807e+02, /* 0x408085B8, 0xBB7E0CB7 */ +}; +static const double ps5[5] = { + 5.92805987221131331921e+01, /* 0x404DA3EA, 0xA8AF633D */ + 9.91401418733614377743e+02, /* 0x408EFB36, 0x1B066701 */ + 5.35326695291487976647e+03, /* 0x40B4E944, 0x5706B6FB */ + 7.84469031749551231769e+03, /* 0x40BEA4B0, 0xB8A5BB15 */ + 1.50404688810361062679e+03, /* 0x40978030, 0x036F5E51 */ +}; + +static const double pr3[6] = { + 3.02503916137373618024e-09, /* 0x3E29FC21, 0xA7AD9EDD */ + 1.17186865567253592491e-01, /* 0x3FBDFFF5, 0x5B21D17B */ + 3.93297750033315640650e+00, /* 0x400F76BC, 0xE85EAD8A */ + 3.51194035591636932736e+01, /* 0x40418F48, 0x9DA6D129 */ + 9.10550110750781271918e+01, /* 0x4056C385, 0x4D2C1837 */ + 4.85590685197364919645e+01, /* 0x4048478F, 0x8EA83EE5 */ +}; +static const double ps3[5] = { + 3.47913095001251519989e+01, /* 0x40416549, 0xA134069C */ + 3.36762458747825746741e+02, /* 0x40750C33, 0x07F1A75F */ + 1.04687139975775130551e+03, /* 0x40905B7C, 0x5037D523 */ + 8.90811346398256432622e+02, /* 0x408BD67D, 0xA32E31E9 */ + 1.03787932439639277504e+02, /* 0x4059F26D, 0x7C2EED53 */ +}; + +static const double pr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + 1.07710830106873743082e-07, /* 0x3E7CE9D4, 0xF65544F4 */ + 1.17176219462683348094e-01, /* 0x3FBDFF42, 0xBE760D83 */ + 2.36851496667608785174e+00, /* 0x4002F2B7, 0xF98FAEC0 */ + 1.22426109148261232917e+01, /* 0x40287C37, 0x7F71A964 */ + 1.76939711271687727390e+01, /* 0x4031B1A8, 0x177F8EE2 */ + 5.07352312588818499250e+00, /* 0x40144B49, 0xA574C1FE */ +}; +static const double ps2[5] = { + 2.14364859363821409488e+01, /* 0x40356FBD, 0x8AD5ECDC */ + 1.25290227168402751090e+02, /* 0x405F5293, 0x14F92CD5 */ + 2.32276469057162813669e+02, /* 0x406D08D8, 0xD5A2DBD9 */ + 1.17679373287147100768e+02, /* 0x405D6B7A, 0xDA1884A9 */ + 8.36463893371618283368e+00, /* 0x4020BAB1, 0xF44E5192 */ +}; + +static double pone(double x) +{ + const double *p,*q; + double_t z,r,s; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x40200000){p = pr8; q = ps8;} + else if (ix >= 0x40122E8B){p = pr5; q = ps5;} + else if (ix >= 0x4006DB6D){p = pr3; q = ps3;} + else /*ix >= 0x40000000*/ {p = pr2; q = ps2;} + z = 1.0/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4])))); + return 1.0+ r/s; +} + +/* For x >= 8, the asymptotic expansions of qone is + * 3/8 s - 105/1024 s^3 - ..., where s = 1/x. + * We approximate pone by + * qone(x) = s*(0.375 + (R/S)) + * where R = qr1*s^2 + qr2*s^4 + ... + qr5*s^10 + * S = 1 + qs1*s^2 + ... + qs6*s^12 + * and + * | qone(x)/s -0.375-R/S | <= 2 ** ( -61.13) + */ + +static const double qr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ + -1.02539062499992714161e-01, /* 0xBFBA3FFF, 0xFFFFFDF3 */ + -1.62717534544589987888e+01, /* 0xC0304591, 0xA26779F7 */ + -7.59601722513950107896e+02, /* 0xC087BCD0, 0x53E4B576 */ + -1.18498066702429587167e+04, /* 0xC0C724E7, 0x40F87415 */ + -4.84385124285750353010e+04, /* 0xC0E7A6D0, 0x65D09C6A */ +}; +static const double qs8[6] = { + 1.61395369700722909556e+02, /* 0x40642CA6, 0xDE5BCDE5 */ + 7.82538599923348465381e+03, /* 0x40BE9162, 0xD0D88419 */ + 1.33875336287249578163e+05, /* 0x4100579A, 0xB0B75E98 */ + 7.19657723683240939863e+05, /* 0x4125F653, 0x72869C19 */ + 6.66601232617776375264e+05, /* 0x412457D2, 0x7719AD5C */ + -2.94490264303834643215e+05, /* 0xC111F969, 0x0EA5AA18 */ +}; + +static const double qr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + -2.08979931141764104297e-11, /* 0xBDB6FA43, 0x1AA1A098 */ + -1.02539050241375426231e-01, /* 0xBFBA3FFF, 0xCB597FEF */ + -8.05644828123936029840e+00, /* 0xC0201CE6, 0xCA03AD4B */ + -1.83669607474888380239e+02, /* 0xC066F56D, 0x6CA7B9B0 */ + -1.37319376065508163265e+03, /* 0xC09574C6, 0x6931734F */ + -2.61244440453215656817e+03, /* 0xC0A468E3, 0x88FDA79D */ +}; +static const double qs5[6] = { + 8.12765501384335777857e+01, /* 0x405451B2, 0xFF5A11B2 */ + 1.99179873460485964642e+03, /* 0x409F1F31, 0xE77BF839 */ + 1.74684851924908907677e+04, /* 0x40D10F1F, 0x0D64CE29 */ + 4.98514270910352279316e+04, /* 0x40E8576D, 0xAABAD197 */ + 2.79480751638918118260e+04, /* 0x40DB4B04, 0xCF7C364B */ + -4.71918354795128470869e+03, /* 0xC0B26F2E, 0xFCFFA004 */ +}; + +static const double qr3[6] = { + -5.07831226461766561369e-09, /* 0xBE35CFA9, 0xD38FC84F */ + -1.02537829820837089745e-01, /* 0xBFBA3FEB, 0x51AEED54 */ + -4.61011581139473403113e+00, /* 0xC01270C2, 0x3302D9FF */ + -5.78472216562783643212e+01, /* 0xC04CEC71, 0xC25D16DA */ + -2.28244540737631695038e+02, /* 0xC06C87D3, 0x4718D55F */ + -2.19210128478909325622e+02, /* 0xC06B66B9, 0x5F5C1BF6 */ +}; +static const double qs3[6] = { + 4.76651550323729509273e+01, /* 0x4047D523, 0xCCD367E4 */ + 6.73865112676699709482e+02, /* 0x40850EEB, 0xC031EE3E */ + 3.38015286679526343505e+03, /* 0x40AA684E, 0x448E7C9A */ + 5.54772909720722782367e+03, /* 0x40B5ABBA, 0xA61D54A6 */ + 1.90311919338810798763e+03, /* 0x409DBC7A, 0x0DD4DF4B */ + -1.35201191444307340817e+02, /* 0xC060E670, 0x290A311F */ +}; + +static const double qr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + -1.78381727510958865572e-07, /* 0xBE87F126, 0x44C626D2 */ + -1.02517042607985553460e-01, /* 0xBFBA3E8E, 0x9148B010 */ + -2.75220568278187460720e+00, /* 0xC0060484, 0x69BB4EDA */ + -1.96636162643703720221e+01, /* 0xC033A9E2, 0xC168907F */ + -4.23253133372830490089e+01, /* 0xC04529A3, 0xDE104AAA */ + -2.13719211703704061733e+01, /* 0xC0355F36, 0x39CF6E52 */ +}; +static const double qs2[6] = { + 2.95333629060523854548e+01, /* 0x403D888A, 0x78AE64FF */ + 2.52981549982190529136e+02, /* 0x406F9F68, 0xDB821CBA */ + 7.57502834868645436472e+02, /* 0x4087AC05, 0xCE49A0F7 */ + 7.39393205320467245656e+02, /* 0x40871B25, 0x48D4C029 */ + 1.55949003336666123687e+02, /* 0x40637E5E, 0x3C3ED8D4 */ + -4.95949898822628210127e+00, /* 0xC013D686, 0xE71BE86B */ +}; + +static double qone(double x) +{ + const double *p,*q; + double_t s,r,z; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x40200000){p = qr8; q = qs8;} + else if (ix >= 0x40122E8B){p = qr5; q = qs5;} + else if (ix >= 0x4006DB6D){p = qr3; q = qs3;} + else /*ix >= 0x40000000*/ {p = qr2; q = qs2;} + z = 1.0/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5]))))); + return (.375 + r/s)/x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/j1f.c b/lib/mlibc/options/ansi/musl-generic-math/j1f.c new file mode 100644 index 0000000..3434c53 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/j1f.c @@ -0,0 +1,310 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_j1f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include "libm.h" + +static float ponef(float), qonef(float); + +static const float +invsqrtpi = 5.6418961287e-01, /* 0x3f106ebb */ +tpi = 6.3661974669e-01; /* 0x3f22f983 */ + +static float common(uint32_t ix, float x, int y1, int sign) +{ + double z,s,c,ss,cc; + + s = sinf(x); + if (y1) + s = -s; + c = cosf(x); + cc = s-c; + if (ix < 0x7f000000) { + ss = -s-c; + z = cosf(2*x); + if (s*c > 0) + cc = z/ss; + else + ss = z/cc; + if (ix < 0x58800000) { + if (y1) + ss = -ss; + cc = ponef(x)*cc-qonef(x)*ss; + } + } + if (sign) + cc = -cc; + return invsqrtpi*cc/sqrtf(x); +} + +/* R0/S0 on [0,2] */ +static const float +r00 = -6.2500000000e-02, /* 0xbd800000 */ +r01 = 1.4070566976e-03, /* 0x3ab86cfd */ +r02 = -1.5995563444e-05, /* 0xb7862e36 */ +r03 = 4.9672799207e-08, /* 0x335557d2 */ +s01 = 1.9153760746e-02, /* 0x3c9ce859 */ +s02 = 1.8594678841e-04, /* 0x3942fab6 */ +s03 = 1.1771846857e-06, /* 0x359dffc2 */ +s04 = 5.0463624390e-09, /* 0x31ad6446 */ +s05 = 1.2354227016e-11; /* 0x2d59567e */ + +float j1f(float x) +{ + float z,r,s; + uint32_t ix; + int sign; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7f800000) + return 1/(x*x); + if (ix >= 0x40000000) /* |x| >= 2 */ + return common(ix, fabsf(x), 0, sign); + if (ix >= 0x39000000) { /* |x| >= 2**-13 */ + z = x*x; + r = z*(r00+z*(r01+z*(r02+z*r03))); + s = 1+z*(s01+z*(s02+z*(s03+z*(s04+z*s05)))); + z = 0.5f + r/s; + } else + z = 0.5f; + return z*x; +} + +static const float U0[5] = { + -1.9605709612e-01, /* 0xbe48c331 */ + 5.0443872809e-02, /* 0x3d4e9e3c */ + -1.9125689287e-03, /* 0xbafaaf2a */ + 2.3525259166e-05, /* 0x37c5581c */ + -9.1909917899e-08, /* 0xb3c56003 */ +}; +static const float V0[5] = { + 1.9916731864e-02, /* 0x3ca3286a */ + 2.0255257550e-04, /* 0x3954644b */ + 1.3560879779e-06, /* 0x35b602d4 */ + 6.2274145840e-09, /* 0x31d5f8eb */ + 1.6655924903e-11, /* 0x2d9281cf */ +}; + +float y1f(float x) +{ + float z,u,v; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + if ((ix & 0x7fffffff) == 0) + return -1/0.0f; + if (ix>>31) + return 0/0.0f; + if (ix >= 0x7f800000) + return 1/x; + if (ix >= 0x40000000) /* |x| >= 2.0 */ + return common(ix,x,1,0); + if (ix < 0x33000000) /* x < 2**-25 */ + return -tpi/x; + z = x*x; + u = U0[0]+z*(U0[1]+z*(U0[2]+z*(U0[3]+z*U0[4]))); + v = 1.0f+z*(V0[0]+z*(V0[1]+z*(V0[2]+z*(V0[3]+z*V0[4])))); + return x*(u/v) + tpi*(j1f(x)*logf(x)-1.0f/x); +} + +/* For x >= 8, the asymptotic expansions of pone is + * 1 + 15/128 s^2 - 4725/2^15 s^4 - ..., where s = 1/x. + * We approximate pone by + * pone(x) = 1 + (R/S) + * where R = pr0 + pr1*s^2 + pr2*s^4 + ... + pr5*s^10 + * S = 1 + ps0*s^2 + ... + ps4*s^10 + * and + * | pone(x)-1-R/S | <= 2 ** ( -60.06) + */ + +static const float pr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.0000000000e+00, /* 0x00000000 */ + 1.1718750000e-01, /* 0x3df00000 */ + 1.3239480972e+01, /* 0x4153d4ea */ + 4.1205184937e+02, /* 0x43ce06a3 */ + 3.8747453613e+03, /* 0x45722bed */ + 7.9144794922e+03, /* 0x45f753d6 */ +}; +static const float ps8[5] = { + 1.1420736694e+02, /* 0x42e46a2c */ + 3.6509309082e+03, /* 0x45642ee5 */ + 3.6956207031e+04, /* 0x47105c35 */ + 9.7602796875e+04, /* 0x47bea166 */ + 3.0804271484e+04, /* 0x46f0a88b */ +}; + +static const float pr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + 1.3199052094e-11, /* 0x2d68333f */ + 1.1718749255e-01, /* 0x3defffff */ + 6.8027510643e+00, /* 0x40d9b023 */ + 1.0830818176e+02, /* 0x42d89dca */ + 5.1763616943e+02, /* 0x440168b7 */ + 5.2871520996e+02, /* 0x44042dc6 */ +}; +static const float ps5[5] = { + 5.9280597687e+01, /* 0x426d1f55 */ + 9.9140142822e+02, /* 0x4477d9b1 */ + 5.3532670898e+03, /* 0x45a74a23 */ + 7.8446904297e+03, /* 0x45f52586 */ + 1.5040468750e+03, /* 0x44bc0180 */ +}; + +static const float pr3[6] = { + 3.0250391081e-09, /* 0x314fe10d */ + 1.1718686670e-01, /* 0x3defffab */ + 3.9329774380e+00, /* 0x407bb5e7 */ + 3.5119403839e+01, /* 0x420c7a45 */ + 9.1055007935e+01, /* 0x42b61c2a */ + 4.8559066772e+01, /* 0x42423c7c */ +}; +static const float ps3[5] = { + 3.4791309357e+01, /* 0x420b2a4d */ + 3.3676245117e+02, /* 0x43a86198 */ + 1.0468714600e+03, /* 0x4482dbe3 */ + 8.9081134033e+02, /* 0x445eb3ed */ + 1.0378793335e+02, /* 0x42cf936c */ +}; + +static const float pr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + 1.0771083225e-07, /* 0x33e74ea8 */ + 1.1717621982e-01, /* 0x3deffa16 */ + 2.3685150146e+00, /* 0x401795c0 */ + 1.2242610931e+01, /* 0x4143e1bc */ + 1.7693971634e+01, /* 0x418d8d41 */ + 5.0735230446e+00, /* 0x40a25a4d */ +}; +static const float ps2[5] = { + 2.1436485291e+01, /* 0x41ab7dec */ + 1.2529022980e+02, /* 0x42fa9499 */ + 2.3227647400e+02, /* 0x436846c7 */ + 1.1767937469e+02, /* 0x42eb5bd7 */ + 8.3646392822e+00, /* 0x4105d590 */ +}; + +static float ponef(float x) +{ + const float *p,*q; + float_t z,r,s; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x41000000){p = pr8; q = ps8;} + else if (ix >= 0x409173eb){p = pr5; q = ps5;} + else if (ix >= 0x4036d917){p = pr3; q = ps3;} + else /*ix >= 0x40000000*/ {p = pr2; q = ps2;} + z = 1.0f/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0f+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4])))); + return 1.0f + r/s; +} + +/* For x >= 8, the asymptotic expansions of qone is + * 3/8 s - 105/1024 s^3 - ..., where s = 1/x. + * We approximate pone by + * qone(x) = s*(0.375 + (R/S)) + * where R = qr1*s^2 + qr2*s^4 + ... + qr5*s^10 + * S = 1 + qs1*s^2 + ... + qs6*s^12 + * and + * | qone(x)/s -0.375-R/S | <= 2 ** ( -61.13) + */ + +static const float qr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.0000000000e+00, /* 0x00000000 */ + -1.0253906250e-01, /* 0xbdd20000 */ + -1.6271753311e+01, /* 0xc1822c8d */ + -7.5960174561e+02, /* 0xc43de683 */ + -1.1849806641e+04, /* 0xc639273a */ + -4.8438511719e+04, /* 0xc73d3683 */ +}; +static const float qs8[6] = { + 1.6139537048e+02, /* 0x43216537 */ + 7.8253862305e+03, /* 0x45f48b17 */ + 1.3387534375e+05, /* 0x4802bcd6 */ + 7.1965775000e+05, /* 0x492fb29c */ + 6.6660125000e+05, /* 0x4922be94 */ + -2.9449025000e+05, /* 0xc88fcb48 */ +}; + +static const float qr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + -2.0897993405e-11, /* 0xadb7d219 */ + -1.0253904760e-01, /* 0xbdd1fffe */ + -8.0564479828e+00, /* 0xc100e736 */ + -1.8366960144e+02, /* 0xc337ab6b */ + -1.3731937256e+03, /* 0xc4aba633 */ + -2.6124443359e+03, /* 0xc523471c */ +}; +static const float qs5[6] = { + 8.1276550293e+01, /* 0x42a28d98 */ + 1.9917987061e+03, /* 0x44f8f98f */ + 1.7468484375e+04, /* 0x468878f8 */ + 4.9851425781e+04, /* 0x4742bb6d */ + 2.7948074219e+04, /* 0x46da5826 */ + -4.7191835938e+03, /* 0xc5937978 */ +}; + +static const float qr3[6] = { + -5.0783124372e-09, /* 0xb1ae7d4f */ + -1.0253783315e-01, /* 0xbdd1ff5b */ + -4.6101160049e+00, /* 0xc0938612 */ + -5.7847221375e+01, /* 0xc267638e */ + -2.2824453735e+02, /* 0xc3643e9a */ + -2.1921012878e+02, /* 0xc35b35cb */ +}; +static const float qs3[6] = { + 4.7665153503e+01, /* 0x423ea91e */ + 6.7386511230e+02, /* 0x4428775e */ + 3.3801528320e+03, /* 0x45534272 */ + 5.5477290039e+03, /* 0x45ad5dd5 */ + 1.9031191406e+03, /* 0x44ede3d0 */ + -1.3520118713e+02, /* 0xc3073381 */ +}; + +static const float qr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + -1.7838172539e-07, /* 0xb43f8932 */ + -1.0251704603e-01, /* 0xbdd1f475 */ + -2.7522056103e+00, /* 0xc0302423 */ + -1.9663616180e+01, /* 0xc19d4f16 */ + -4.2325313568e+01, /* 0xc2294d1f */ + -2.1371921539e+01, /* 0xc1aaf9b2 */ +}; +static const float qs2[6] = { + 2.9533363342e+01, /* 0x41ec4454 */ + 2.5298155212e+02, /* 0x437cfb47 */ + 7.5750280762e+02, /* 0x443d602e */ + 7.3939318848e+02, /* 0x4438d92a */ + 1.5594900513e+02, /* 0x431bf2f2 */ + -4.9594988823e+00, /* 0xc09eb437 */ +}; + +static float qonef(float x) +{ + const float *p,*q; + float_t s,r,z; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x41000000){p = qr8; q = qs8;} + else if (ix >= 0x409173eb){p = qr5; q = qs5;} + else if (ix >= 0x4036d917){p = qr3; q = qs3;} + else /*ix >= 0x40000000*/ {p = qr2; q = qs2;} + z = 1.0f/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0f+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5]))))); + return (.375f + r/s)/x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/jn.c b/lib/mlibc/options/ansi/musl-generic-math/jn.c new file mode 100644 index 0000000..4878a54 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/jn.c @@ -0,0 +1,280 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_jn.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * jn(n, x), yn(n, x) + * floating point Bessel's function of the 1st and 2nd kind + * of order n + * + * Special cases: + * y0(0)=y1(0)=yn(n,0) = -inf with division by zero signal; + * y0(-ve)=y1(-ve)=yn(n,-ve) are NaN with invalid signal. + * Note 2. About jn(n,x), yn(n,x) + * For n=0, j0(x) is called, + * for n=1, j1(x) is called, + * for n<=x, forward recursion is used starting + * from values of j0(x) and j1(x). + * for n>x, a continued fraction approximation to + * j(n,x)/j(n-1,x) is evaluated and then backward + * recursion is used starting from a supposed value + * for j(n,x). The resulting value of j(0,x) is + * compared with the actual value to correct the + * supposed value of j(n,x). + * + * yn(n,x) is similar in all respects, except + * that forward recursion is used for all + * values of n>1. + */ + +#include "libm.h" + +static const double invsqrtpi = 5.64189583547756279280e-01; /* 0x3FE20DD7, 0x50429B6D */ + +double jn(int n, double x) +{ + uint32_t ix, lx; + int nm1, i, sign; + double a, b, temp; + + EXTRACT_WORDS(ix, lx, x); + sign = ix>>31; + ix &= 0x7fffffff; + + if ((ix | (lx|-lx)>>31) > 0x7ff00000) /* nan */ + return x; + + /* J(-n,x) = (-1)^n * J(n, x), J(n, -x) = (-1)^n * J(n, x) + * Thus, J(-n,x) = J(n,-x) + */ + /* nm1 = |n|-1 is used instead of |n| to handle n==INT_MIN */ + if (n == 0) + return j0(x); + if (n < 0) { + nm1 = -(n+1); + x = -x; + sign ^= 1; + } else + nm1 = n-1; + if (nm1 == 0) + return j1(x); + + sign &= n; /* even n: 0, odd n: signbit(x) */ + x = fabs(x); + if ((ix|lx) == 0 || ix == 0x7ff00000) /* if x is 0 or inf */ + b = 0.0; + else if (nm1 < x) { + /* Safe to use J(n+1,x)=2n/x *J(n,x)-J(n-1,x) */ + if (ix >= 0x52d00000) { /* x > 2**302 */ + /* (x >> n**2) + * Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi) + * Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi) + * Let s=sin(x), c=cos(x), + * xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then + * + * n sin(xn)*sqt2 cos(xn)*sqt2 + * ---------------------------------- + * 0 s-c c+s + * 1 -s-c -c+s + * 2 -s+c -c-s + * 3 s+c c-s + */ + switch(nm1&3) { + case 0: temp = -cos(x)+sin(x); break; + case 1: temp = -cos(x)-sin(x); break; + case 2: temp = cos(x)-sin(x); break; + default: + case 3: temp = cos(x)+sin(x); break; + } + b = invsqrtpi*temp/sqrt(x); + } else { + a = j0(x); + b = j1(x); + for (i=0; i<nm1; ) { + i++; + temp = b; + b = b*(2.0*i/x) - a; /* avoid underflow */ + a = temp; + } + } + } else { + if (ix < 0x3e100000) { /* x < 2**-29 */ + /* x is tiny, return the first Taylor expansion of J(n,x) + * J(n,x) = 1/n!*(x/2)^n - ... + */ + if (nm1 > 32) /* underflow */ + b = 0.0; + else { + temp = x*0.5; + b = temp; + a = 1.0; + for (i=2; i<=nm1+1; i++) { + a *= (double)i; /* a = n! */ + b *= temp; /* b = (x/2)^n */ + } + b = b/a; + } + } else { + /* use backward recurrence */ + /* x x^2 x^2 + * J(n,x)/J(n-1,x) = ---- ------ ------ ..... + * 2n - 2(n+1) - 2(n+2) + * + * 1 1 1 + * (for large x) = ---- ------ ------ ..... + * 2n 2(n+1) 2(n+2) + * -- - ------ - ------ - + * x x x + * + * Let w = 2n/x and h=2/x, then the above quotient + * is equal to the continued fraction: + * 1 + * = ----------------------- + * 1 + * w - ----------------- + * 1 + * w+h - --------- + * w+2h - ... + * + * To determine how many terms needed, let + * Q(0) = w, Q(1) = w(w+h) - 1, + * Q(k) = (w+k*h)*Q(k-1) - Q(k-2), + * When Q(k) > 1e4 good for single + * When Q(k) > 1e9 good for double + * When Q(k) > 1e17 good for quadruple + */ + /* determine k */ + double t,q0,q1,w,h,z,tmp,nf; + int k; + + nf = nm1 + 1.0; + w = 2*nf/x; + h = 2/x; + z = w+h; + q0 = w; + q1 = w*z - 1.0; + k = 1; + while (q1 < 1.0e9) { + k += 1; + z += h; + tmp = z*q1 - q0; + q0 = q1; + q1 = tmp; + } + for (t=0.0, i=k; i>=0; i--) + t = 1/(2*(i+nf)/x - t); + a = t; + b = 1.0; + /* estimate log((2/x)^n*n!) = n*log(2/x)+n*ln(n) + * Hence, if n*(log(2n/x)) > ... + * single 8.8722839355e+01 + * double 7.09782712893383973096e+02 + * long double 1.1356523406294143949491931077970765006170e+04 + * then recurrent value may overflow and the result is + * likely underflow to zero + */ + tmp = nf*log(fabs(w)); + if (tmp < 7.09782712893383973096e+02) { + for (i=nm1; i>0; i--) { + temp = b; + b = b*(2.0*i)/x - a; + a = temp; + } + } else { + for (i=nm1; i>0; i--) { + temp = b; + b = b*(2.0*i)/x - a; + a = temp; + /* scale b to avoid spurious overflow */ + if (b > 0x1p500) { + a /= b; + t /= b; + b = 1.0; + } + } + } + z = j0(x); + w = j1(x); + if (fabs(z) >= fabs(w)) + b = t*z/b; + else + b = t*w/a; + } + } + return sign ? -b : b; +} + + +double yn(int n, double x) +{ + uint32_t ix, lx, ib; + int nm1, sign, i; + double a, b, temp; + + EXTRACT_WORDS(ix, lx, x); + sign = ix>>31; + ix &= 0x7fffffff; + + if ((ix | (lx|-lx)>>31) > 0x7ff00000) /* nan */ + return x; + if (sign && (ix|lx)!=0) /* x < 0 */ + return 0/0.0; + if (ix == 0x7ff00000) + return 0.0; + + if (n == 0) + return y0(x); + if (n < 0) { + nm1 = -(n+1); + sign = n&1; + } else { + nm1 = n-1; + sign = 0; + } + if (nm1 == 0) + return sign ? -y1(x) : y1(x); + + if (ix >= 0x52d00000) { /* x > 2**302 */ + /* (x >> n**2) + * Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi) + * Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi) + * Let s=sin(x), c=cos(x), + * xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then + * + * n sin(xn)*sqt2 cos(xn)*sqt2 + * ---------------------------------- + * 0 s-c c+s + * 1 -s-c -c+s + * 2 -s+c -c-s + * 3 s+c c-s + */ + switch(nm1&3) { + case 0: temp = -sin(x)-cos(x); break; + case 1: temp = -sin(x)+cos(x); break; + case 2: temp = sin(x)+cos(x); break; + default: + case 3: temp = sin(x)-cos(x); break; + } + b = invsqrtpi*temp/sqrt(x); + } else { + a = y0(x); + b = y1(x); + /* quit if b is -inf */ + GET_HIGH_WORD(ib, b); + for (i=0; i<nm1 && ib!=0xfff00000; ){ + i++; + temp = b; + b = (2.0*i/x)*b - a; + GET_HIGH_WORD(ib, b); + a = temp; + } + } + return sign ? -b : b; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/jnf.c b/lib/mlibc/options/ansi/musl-generic-math/jnf.c new file mode 100644 index 0000000..f63c062 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/jnf.c @@ -0,0 +1,202 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_jnf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include "libm.h" + +float jnf(int n, float x) +{ + uint32_t ix; + int nm1, sign, i; + float a, b, temp; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix > 0x7f800000) /* nan */ + return x; + + /* J(-n,x) = J(n,-x), use |n|-1 to avoid overflow in -n */ + if (n == 0) + return j0f(x); + if (n < 0) { + nm1 = -(n+1); + x = -x; + sign ^= 1; + } else + nm1 = n-1; + if (nm1 == 0) + return j1f(x); + + sign &= n; /* even n: 0, odd n: signbit(x) */ + x = fabsf(x); + if (ix == 0 || ix == 0x7f800000) /* if x is 0 or inf */ + b = 0.0f; + else if (nm1 < x) { + /* Safe to use J(n+1,x)=2n/x *J(n,x)-J(n-1,x) */ + a = j0f(x); + b = j1f(x); + for (i=0; i<nm1; ){ + i++; + temp = b; + b = b*(2.0f*i/x) - a; + a = temp; + } + } else { + if (ix < 0x35800000) { /* x < 2**-20 */ + /* x is tiny, return the first Taylor expansion of J(n,x) + * J(n,x) = 1/n!*(x/2)^n - ... + */ + if (nm1 > 8) /* underflow */ + nm1 = 8; + temp = 0.5f * x; + b = temp; + a = 1.0f; + for (i=2; i<=nm1+1; i++) { + a *= (float)i; /* a = n! */ + b *= temp; /* b = (x/2)^n */ + } + b = b/a; + } else { + /* use backward recurrence */ + /* x x^2 x^2 + * J(n,x)/J(n-1,x) = ---- ------ ------ ..... + * 2n - 2(n+1) - 2(n+2) + * + * 1 1 1 + * (for large x) = ---- ------ ------ ..... + * 2n 2(n+1) 2(n+2) + * -- - ------ - ------ - + * x x x + * + * Let w = 2n/x and h=2/x, then the above quotient + * is equal to the continued fraction: + * 1 + * = ----------------------- + * 1 + * w - ----------------- + * 1 + * w+h - --------- + * w+2h - ... + * + * To determine how many terms needed, let + * Q(0) = w, Q(1) = w(w+h) - 1, + * Q(k) = (w+k*h)*Q(k-1) - Q(k-2), + * When Q(k) > 1e4 good for single + * When Q(k) > 1e9 good for double + * When Q(k) > 1e17 good for quadruple + */ + /* determine k */ + float t,q0,q1,w,h,z,tmp,nf; + int k; + + nf = nm1+1.0f; + w = 2*nf/x; + h = 2/x; + z = w+h; + q0 = w; + q1 = w*z - 1.0f; + k = 1; + while (q1 < 1.0e4f) { + k += 1; + z += h; + tmp = z*q1 - q0; + q0 = q1; + q1 = tmp; + } + for (t=0.0f, i=k; i>=0; i--) + t = 1.0f/(2*(i+nf)/x-t); + a = t; + b = 1.0f; + /* estimate log((2/x)^n*n!) = n*log(2/x)+n*ln(n) + * Hence, if n*(log(2n/x)) > ... + * single 8.8722839355e+01 + * double 7.09782712893383973096e+02 + * long double 1.1356523406294143949491931077970765006170e+04 + * then recurrent value may overflow and the result is + * likely underflow to zero + */ + tmp = nf*logf(fabsf(w)); + if (tmp < 88.721679688f) { + for (i=nm1; i>0; i--) { + temp = b; + b = 2.0f*i*b/x - a; + a = temp; + } + } else { + for (i=nm1; i>0; i--){ + temp = b; + b = 2.0f*i*b/x - a; + a = temp; + /* scale b to avoid spurious overflow */ + if (b > 0x1p60f) { + a /= b; + t /= b; + b = 1.0f; + } + } + } + z = j0f(x); + w = j1f(x); + if (fabsf(z) >= fabsf(w)) + b = t*z/b; + else + b = t*w/a; + } + } + return sign ? -b : b; +} + +float ynf(int n, float x) +{ + uint32_t ix, ib; + int nm1, sign, i; + float a, b, temp; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix > 0x7f800000) /* nan */ + return x; + if (sign && ix != 0) /* x < 0 */ + return 0/0.0f; + if (ix == 0x7f800000) + return 0.0f; + + if (n == 0) + return y0f(x); + if (n < 0) { + nm1 = -(n+1); + sign = n&1; + } else { + nm1 = n-1; + sign = 0; + } + if (nm1 == 0) + return sign ? -y1f(x) : y1f(x); + + a = y0f(x); + b = y1f(x); + /* quit if b is -inf */ + GET_FLOAT_WORD(ib,b); + for (i = 0; i < nm1 && ib != 0xff800000; ) { + i++; + temp = b; + b = (2.0f*i/x)*b - a; + GET_FLOAT_WORD(ib, b); + a = temp; + } + return sign ? -b : b; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/ldexp.c b/lib/mlibc/options/ansi/musl-generic-math/ldexp.c new file mode 100644 index 0000000..f4d1cd6 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ldexp.c @@ -0,0 +1,6 @@ +#include <math.h> + +double ldexp(double x, int n) +{ + return scalbn(x, n); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/ldexpf.c b/lib/mlibc/options/ansi/musl-generic-math/ldexpf.c new file mode 100644 index 0000000..3bad5f3 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ldexpf.c @@ -0,0 +1,6 @@ +#include <math.h> + +float ldexpf(float x, int n) +{ + return scalbnf(x, n); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/ldexpl.c b/lib/mlibc/options/ansi/musl-generic-math/ldexpl.c new file mode 100644 index 0000000..fd145cc --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ldexpl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long double ldexpl(long double x, int n) +{ + return scalbnl(x, n); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/lgamma.c b/lib/mlibc/options/ansi/musl-generic-math/lgamma.c new file mode 100644 index 0000000..e25ec8e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lgamma.c @@ -0,0 +1,9 @@ +#include <math.h> + +extern int __signgam; +double __lgamma_r(double, int *); + +double lgamma(double x) +{ + return __lgamma_r(x, &__signgam); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/lgamma_r.c b/lib/mlibc/options/ansi/musl-generic-math/lgamma_r.c new file mode 100644 index 0000000..84596a3 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lgamma_r.c @@ -0,0 +1,285 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_lgamma_r.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ +/* lgamma_r(x, signgamp) + * Reentrant version of the logarithm of the Gamma function + * with user provide pointer for the sign of Gamma(x). + * + * Method: + * 1. Argument Reduction for 0 < x <= 8 + * Since gamma(1+s)=s*gamma(s), for x in [0,8], we may + * reduce x to a number in [1.5,2.5] by + * lgamma(1+s) = log(s) + lgamma(s) + * for example, + * lgamma(7.3) = log(6.3) + lgamma(6.3) + * = log(6.3*5.3) + lgamma(5.3) + * = log(6.3*5.3*4.3*3.3*2.3) + lgamma(2.3) + * 2. Polynomial approximation of lgamma around its + * minimun ymin=1.461632144968362245 to maintain monotonicity. + * On [ymin-0.23, ymin+0.27] (i.e., [1.23164,1.73163]), use + * Let z = x-ymin; + * lgamma(x) = -1.214862905358496078218 + z^2*poly(z) + * where + * poly(z) is a 14 degree polynomial. + * 2. Rational approximation in the primary interval [2,3] + * We use the following approximation: + * s = x-2.0; + * lgamma(x) = 0.5*s + s*P(s)/Q(s) + * with accuracy + * |P/Q - (lgamma(x)-0.5s)| < 2**-61.71 + * Our algorithms are based on the following observation + * + * zeta(2)-1 2 zeta(3)-1 3 + * lgamma(2+s) = s*(1-Euler) + --------- * s - --------- * s + ... + * 2 3 + * + * where Euler = 0.5771... is the Euler constant, which is very + * close to 0.5. + * + * 3. For x>=8, we have + * lgamma(x)~(x-0.5)log(x)-x+0.5*log(2pi)+1/(12x)-1/(360x**3)+.... + * (better formula: + * lgamma(x)~(x-0.5)*(log(x)-1)-.5*(log(2pi)-1) + ...) + * Let z = 1/x, then we approximation + * f(z) = lgamma(x) - (x-0.5)(log(x)-1) + * by + * 3 5 11 + * w = w0 + w1*z + w2*z + w3*z + ... + w6*z + * where + * |w - f(z)| < 2**-58.74 + * + * 4. For negative x, since (G is gamma function) + * -x*G(-x)*G(x) = pi/sin(pi*x), + * we have + * G(x) = pi/(sin(pi*x)*(-x)*G(-x)) + * since G(-x) is positive, sign(G(x)) = sign(sin(pi*x)) for x<0 + * Hence, for x<0, signgam = sign(sin(pi*x)) and + * lgamma(x) = log(|Gamma(x)|) + * = log(pi/(|x*sin(pi*x)|)) - lgamma(-x); + * Note: one should avoid compute pi*(-x) directly in the + * computation of sin(pi*(-x)). + * + * 5. Special Cases + * lgamma(2+s) ~ s*(1-Euler) for tiny s + * lgamma(1) = lgamma(2) = 0 + * lgamma(x) ~ -log(|x|) for tiny x + * lgamma(0) = lgamma(neg.integer) = inf and raise divide-by-zero + * lgamma(inf) = inf + * lgamma(-inf) = inf (bug for bug compatible with C99!?) + * + */ + +#include "libm.h" +#include "weak_alias.h" +//#include "libc.h" + +static const double +pi = 3.14159265358979311600e+00, /* 0x400921FB, 0x54442D18 */ +a0 = 7.72156649015328655494e-02, /* 0x3FB3C467, 0xE37DB0C8 */ +a1 = 3.22467033424113591611e-01, /* 0x3FD4A34C, 0xC4A60FAD */ +a2 = 6.73523010531292681824e-02, /* 0x3FB13E00, 0x1A5562A7 */ +a3 = 2.05808084325167332806e-02, /* 0x3F951322, 0xAC92547B */ +a4 = 7.38555086081402883957e-03, /* 0x3F7E404F, 0xB68FEFE8 */ +a5 = 2.89051383673415629091e-03, /* 0x3F67ADD8, 0xCCB7926B */ +a6 = 1.19270763183362067845e-03, /* 0x3F538A94, 0x116F3F5D */ +a7 = 5.10069792153511336608e-04, /* 0x3F40B6C6, 0x89B99C00 */ +a8 = 2.20862790713908385557e-04, /* 0x3F2CF2EC, 0xED10E54D */ +a9 = 1.08011567247583939954e-04, /* 0x3F1C5088, 0x987DFB07 */ +a10 = 2.52144565451257326939e-05, /* 0x3EFA7074, 0x428CFA52 */ +a11 = 4.48640949618915160150e-05, /* 0x3F07858E, 0x90A45837 */ +tc = 1.46163214496836224576e+00, /* 0x3FF762D8, 0x6356BE3F */ +tf = -1.21486290535849611461e-01, /* 0xBFBF19B9, 0xBCC38A42 */ +/* tt = -(tail of tf) */ +tt = -3.63867699703950536541e-18, /* 0xBC50C7CA, 0xA48A971F */ +t0 = 4.83836122723810047042e-01, /* 0x3FDEF72B, 0xC8EE38A2 */ +t1 = -1.47587722994593911752e-01, /* 0xBFC2E427, 0x8DC6C509 */ +t2 = 6.46249402391333854778e-02, /* 0x3FB08B42, 0x94D5419B */ +t3 = -3.27885410759859649565e-02, /* 0xBFA0C9A8, 0xDF35B713 */ +t4 = 1.79706750811820387126e-02, /* 0x3F9266E7, 0x970AF9EC */ +t5 = -1.03142241298341437450e-02, /* 0xBF851F9F, 0xBA91EC6A */ +t6 = 6.10053870246291332635e-03, /* 0x3F78FCE0, 0xE370E344 */ +t7 = -3.68452016781138256760e-03, /* 0xBF6E2EFF, 0xB3E914D7 */ +t8 = 2.25964780900612472250e-03, /* 0x3F6282D3, 0x2E15C915 */ +t9 = -1.40346469989232843813e-03, /* 0xBF56FE8E, 0xBF2D1AF1 */ +t10 = 8.81081882437654011382e-04, /* 0x3F4CDF0C, 0xEF61A8E9 */ +t11 = -5.38595305356740546715e-04, /* 0xBF41A610, 0x9C73E0EC */ +t12 = 3.15632070903625950361e-04, /* 0x3F34AF6D, 0x6C0EBBF7 */ +t13 = -3.12754168375120860518e-04, /* 0xBF347F24, 0xECC38C38 */ +t14 = 3.35529192635519073543e-04, /* 0x3F35FD3E, 0xE8C2D3F4 */ +u0 = -7.72156649015328655494e-02, /* 0xBFB3C467, 0xE37DB0C8 */ +u1 = 6.32827064025093366517e-01, /* 0x3FE4401E, 0x8B005DFF */ +u2 = 1.45492250137234768737e+00, /* 0x3FF7475C, 0xD119BD6F */ +u3 = 9.77717527963372745603e-01, /* 0x3FEF4976, 0x44EA8450 */ +u4 = 2.28963728064692451092e-01, /* 0x3FCD4EAE, 0xF6010924 */ +u5 = 1.33810918536787660377e-02, /* 0x3F8B678B, 0xBF2BAB09 */ +v1 = 2.45597793713041134822e+00, /* 0x4003A5D7, 0xC2BD619C */ +v2 = 2.12848976379893395361e+00, /* 0x40010725, 0xA42B18F5 */ +v3 = 7.69285150456672783825e-01, /* 0x3FE89DFB, 0xE45050AF */ +v4 = 1.04222645593369134254e-01, /* 0x3FBAAE55, 0xD6537C88 */ +v5 = 3.21709242282423911810e-03, /* 0x3F6A5ABB, 0x57D0CF61 */ +s0 = -7.72156649015328655494e-02, /* 0xBFB3C467, 0xE37DB0C8 */ +s1 = 2.14982415960608852501e-01, /* 0x3FCB848B, 0x36E20878 */ +s2 = 3.25778796408930981787e-01, /* 0x3FD4D98F, 0x4F139F59 */ +s3 = 1.46350472652464452805e-01, /* 0x3FC2BB9C, 0xBEE5F2F7 */ +s4 = 2.66422703033638609560e-02, /* 0x3F9B481C, 0x7E939961 */ +s5 = 1.84028451407337715652e-03, /* 0x3F5E26B6, 0x7368F239 */ +s6 = 3.19475326584100867617e-05, /* 0x3F00BFEC, 0xDD17E945 */ +r1 = 1.39200533467621045958e+00, /* 0x3FF645A7, 0x62C4AB74 */ +r2 = 7.21935547567138069525e-01, /* 0x3FE71A18, 0x93D3DCDC */ +r3 = 1.71933865632803078993e-01, /* 0x3FC601ED, 0xCCFBDF27 */ +r4 = 1.86459191715652901344e-02, /* 0x3F9317EA, 0x742ED475 */ +r5 = 7.77942496381893596434e-04, /* 0x3F497DDA, 0xCA41A95B */ +r6 = 7.32668430744625636189e-06, /* 0x3EDEBAF7, 0xA5B38140 */ +w0 = 4.18938533204672725052e-01, /* 0x3FDACFE3, 0x90C97D69 */ +w1 = 8.33333333333329678849e-02, /* 0x3FB55555, 0x5555553B */ +w2 = -2.77777777728775536470e-03, /* 0xBF66C16C, 0x16B02E5C */ +w3 = 7.93650558643019558500e-04, /* 0x3F4A019F, 0x98CF38B6 */ +w4 = -5.95187557450339963135e-04, /* 0xBF4380CB, 0x8C0FE741 */ +w5 = 8.36339918996282139126e-04, /* 0x3F4B67BA, 0x4CDAD5D1 */ +w6 = -1.63092934096575273989e-03; /* 0xBF5AB89D, 0x0B9E43E4 */ + +/* sin(pi*x) assuming x > 2^-100, if sin(pi*x)==0 the sign is arbitrary */ +static double sin_pi(double x) +{ + int n; + + /* spurious inexact if odd int */ + x = 2.0*(x*0.5 - floor(x*0.5)); /* x mod 2.0 */ + + n = (int)(x*4.0); + n = (n+1)/2; + x -= n*0.5f; + x *= pi; + + switch (n) { + default: /* case 4: */ + case 0: return __sin(x, 0.0, 0); + case 1: return __cos(x, 0.0); + case 2: return __sin(-x, 0.0, 0); + case 3: return -__cos(x, 0.0); + } +} + +double __lgamma_r(double x, int *signgamp) +{ + union {double f; uint64_t i;} u = {x}; + double_t t,y,z,nadj,p,p1,p2,p3,q,r,w; + uint32_t ix; + int sign,i; + + /* purge off +-inf, NaN, +-0, tiny and negative arguments */ + *signgamp = 1; + sign = u.i>>63; + ix = u.i>>32 & 0x7fffffff; + if (ix >= 0x7ff00000) + return x*x; + if (ix < (0x3ff-70)<<20) { /* |x|<2**-70, return -log(|x|) */ + if(sign) { + x = -x; + *signgamp = -1; + } + return -log(x); + } + if (sign) { + x = -x; + t = sin_pi(x); + if (t == 0.0) /* -integer */ + return 1.0/(x-x); + if (t > 0.0) + *signgamp = -1; + else + t = -t; + nadj = log(pi/(t*x)); + } + + /* purge off 1 and 2 */ + if ((ix == 0x3ff00000 || ix == 0x40000000) && (uint32_t)u.i == 0) + r = 0; + /* for x < 2.0 */ + else if (ix < 0x40000000) { + if (ix <= 0x3feccccc) { /* lgamma(x) = lgamma(x+1)-log(x) */ + r = -log(x); + if (ix >= 0x3FE76944) { + y = 1.0 - x; + i = 0; + } else if (ix >= 0x3FCDA661) { + y = x - (tc-1.0); + i = 1; + } else { + y = x; + i = 2; + } + } else { + r = 0.0; + if (ix >= 0x3FFBB4C3) { /* [1.7316,2] */ + y = 2.0 - x; + i = 0; + } else if(ix >= 0x3FF3B4C4) { /* [1.23,1.73] */ + y = x - tc; + i = 1; + } else { + y = x - 1.0; + i = 2; + } + } + switch (i) { + case 0: + z = y*y; + p1 = a0+z*(a2+z*(a4+z*(a6+z*(a8+z*a10)))); + p2 = z*(a1+z*(a3+z*(a5+z*(a7+z*(a9+z*a11))))); + p = y*p1+p2; + r += (p-0.5*y); + break; + case 1: + z = y*y; + w = z*y; + p1 = t0+w*(t3+w*(t6+w*(t9 +w*t12))); /* parallel comp */ + p2 = t1+w*(t4+w*(t7+w*(t10+w*t13))); + p3 = t2+w*(t5+w*(t8+w*(t11+w*t14))); + p = z*p1-(tt-w*(p2+y*p3)); + r += tf + p; + break; + case 2: + p1 = y*(u0+y*(u1+y*(u2+y*(u3+y*(u4+y*u5))))); + p2 = 1.0+y*(v1+y*(v2+y*(v3+y*(v4+y*v5)))); + r += -0.5*y + p1/p2; + } + } else if (ix < 0x40200000) { /* x < 8.0 */ + i = (int)x; + y = x - (double)i; + p = y*(s0+y*(s1+y*(s2+y*(s3+y*(s4+y*(s5+y*s6)))))); + q = 1.0+y*(r1+y*(r2+y*(r3+y*(r4+y*(r5+y*r6))))); + r = 0.5*y+p/q; + z = 1.0; /* lgamma(1+s) = log(s) + lgamma(s) */ + switch (i) { + case 7: z *= y + 6.0; /* FALLTHRU */ + case 6: z *= y + 5.0; /* FALLTHRU */ + case 5: z *= y + 4.0; /* FALLTHRU */ + case 4: z *= y + 3.0; /* FALLTHRU */ + case 3: z *= y + 2.0; /* FALLTHRU */ + r += log(z); + break; + } + } else if (ix < 0x43900000) { /* 8.0 <= x < 2**58 */ + t = log(x); + z = 1.0/x; + y = z*z; + w = w0+z*(w1+y*(w2+y*(w3+y*(w4+y*(w5+y*w6))))); + r = (x-0.5)*(t-1.0)+w; + } else /* 2**58 <= x <= inf */ + r = x*(log(x)-1.0); + if (sign) + r = nadj - r; + return r; +} + +weak_alias(__lgamma_r, lgamma_r); diff --git a/lib/mlibc/options/ansi/musl-generic-math/lgammaf.c b/lib/mlibc/options/ansi/musl-generic-math/lgammaf.c new file mode 100644 index 0000000..badb6df --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lgammaf.c @@ -0,0 +1,9 @@ +#include <math.h> + +extern int __signgam; +float __lgammaf_r(float, int *); + +float lgammaf(float x) +{ + return __lgammaf_r(x, &__signgam); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/lgammaf_r.c b/lib/mlibc/options/ansi/musl-generic-math/lgammaf_r.c new file mode 100644 index 0000000..f73e89d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lgammaf_r.c @@ -0,0 +1,220 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_lgammaf_r.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" +#include "weak_alias.h" +//#include "libc.h" + +static const float +pi = 3.1415927410e+00, /* 0x40490fdb */ +a0 = 7.7215664089e-02, /* 0x3d9e233f */ +a1 = 3.2246702909e-01, /* 0x3ea51a66 */ +a2 = 6.7352302372e-02, /* 0x3d89f001 */ +a3 = 2.0580807701e-02, /* 0x3ca89915 */ +a4 = 7.3855509982e-03, /* 0x3bf2027e */ +a5 = 2.8905137442e-03, /* 0x3b3d6ec6 */ +a6 = 1.1927076848e-03, /* 0x3a9c54a1 */ +a7 = 5.1006977446e-04, /* 0x3a05b634 */ +a8 = 2.2086278477e-04, /* 0x39679767 */ +a9 = 1.0801156895e-04, /* 0x38e28445 */ +a10 = 2.5214456400e-05, /* 0x37d383a2 */ +a11 = 4.4864096708e-05, /* 0x383c2c75 */ +tc = 1.4616321325e+00, /* 0x3fbb16c3 */ +tf = -1.2148628384e-01, /* 0xbdf8cdcd */ +/* tt = -(tail of tf) */ +tt = 6.6971006518e-09, /* 0x31e61c52 */ +t0 = 4.8383611441e-01, /* 0x3ef7b95e */ +t1 = -1.4758771658e-01, /* 0xbe17213c */ +t2 = 6.4624942839e-02, /* 0x3d845a15 */ +t3 = -3.2788541168e-02, /* 0xbd064d47 */ +t4 = 1.7970675603e-02, /* 0x3c93373d */ +t5 = -1.0314224288e-02, /* 0xbc28fcfe */ +t6 = 6.1005386524e-03, /* 0x3bc7e707 */ +t7 = -3.6845202558e-03, /* 0xbb7177fe */ +t8 = 2.2596477065e-03, /* 0x3b141699 */ +t9 = -1.4034647029e-03, /* 0xbab7f476 */ +t10 = 8.8108185446e-04, /* 0x3a66f867 */ +t11 = -5.3859531181e-04, /* 0xba0d3085 */ +t12 = 3.1563205994e-04, /* 0x39a57b6b */ +t13 = -3.1275415677e-04, /* 0xb9a3f927 */ +t14 = 3.3552918467e-04, /* 0x39afe9f7 */ +u0 = -7.7215664089e-02, /* 0xbd9e233f */ +u1 = 6.3282704353e-01, /* 0x3f2200f4 */ +u2 = 1.4549225569e+00, /* 0x3fba3ae7 */ +u3 = 9.7771751881e-01, /* 0x3f7a4bb2 */ +u4 = 2.2896373272e-01, /* 0x3e6a7578 */ +u5 = 1.3381091878e-02, /* 0x3c5b3c5e */ +v1 = 2.4559779167e+00, /* 0x401d2ebe */ +v2 = 2.1284897327e+00, /* 0x4008392d */ +v3 = 7.6928514242e-01, /* 0x3f44efdf */ +v4 = 1.0422264785e-01, /* 0x3dd572af */ +v5 = 3.2170924824e-03, /* 0x3b52d5db */ +s0 = -7.7215664089e-02, /* 0xbd9e233f */ +s1 = 2.1498242021e-01, /* 0x3e5c245a */ +s2 = 3.2577878237e-01, /* 0x3ea6cc7a */ +s3 = 1.4635047317e-01, /* 0x3e15dce6 */ +s4 = 2.6642270386e-02, /* 0x3cda40e4 */ +s5 = 1.8402845599e-03, /* 0x3af135b4 */ +s6 = 3.1947532989e-05, /* 0x3805ff67 */ +r1 = 1.3920053244e+00, /* 0x3fb22d3b */ +r2 = 7.2193557024e-01, /* 0x3f38d0c5 */ +r3 = 1.7193385959e-01, /* 0x3e300f6e */ +r4 = 1.8645919859e-02, /* 0x3c98bf54 */ +r5 = 7.7794247773e-04, /* 0x3a4beed6 */ +r6 = 7.3266842264e-06, /* 0x36f5d7bd */ +w0 = 4.1893854737e-01, /* 0x3ed67f1d */ +w1 = 8.3333335817e-02, /* 0x3daaaaab */ +w2 = -2.7777778450e-03, /* 0xbb360b61 */ +w3 = 7.9365057172e-04, /* 0x3a500cfd */ +w4 = -5.9518753551e-04, /* 0xba1c065c */ +w5 = 8.3633989561e-04, /* 0x3a5b3dd2 */ +w6 = -1.6309292987e-03; /* 0xbad5c4e8 */ + +/* sin(pi*x) assuming x > 2^-100, if sin(pi*x)==0 the sign is arbitrary */ +static float sin_pi(float x) +{ + double_t y; + int n; + + /* spurious inexact if odd int */ + x = 2*(x*0.5f - floorf(x*0.5f)); /* x mod 2.0 */ + + n = (int)(x*4); + n = (n+1)/2; + y = x - n*0.5f; + y *= 3.14159265358979323846; + switch (n) { + default: /* case 4: */ + case 0: return __sindf(y); + case 1: return __cosdf(y); + case 2: return __sindf(-y); + case 3: return -__cosdf(y); + } +} + +float __lgammaf_r(float x, int *signgamp) +{ + union {float f; uint32_t i;} u = {x}; + float t,y,z,nadj,p,p1,p2,p3,q,r,w; + uint32_t ix; + int i,sign; + + /* purge off +-inf, NaN, +-0, tiny and negative arguments */ + *signgamp = 1; + sign = u.i>>31; + ix = u.i & 0x7fffffff; + if (ix >= 0x7f800000) + return x*x; + if (ix < 0x35000000) { /* |x| < 2**-21, return -log(|x|) */ + if (sign) { + *signgamp = -1; + x = -x; + } + return -logf(x); + } + if (sign) { + x = -x; + t = sin_pi(x); + if (t == 0.0f) /* -integer */ + return 1.0f/(x-x); + if (t > 0.0f) + *signgamp = -1; + else + t = -t; + nadj = logf(pi/(t*x)); + } + + /* purge off 1 and 2 */ + if (ix == 0x3f800000 || ix == 0x40000000) + r = 0; + /* for x < 2.0 */ + else if (ix < 0x40000000) { + if (ix <= 0x3f666666) { /* lgamma(x) = lgamma(x+1)-log(x) */ + r = -logf(x); + if (ix >= 0x3f3b4a20) { + y = 1.0f - x; + i = 0; + } else if (ix >= 0x3e6d3308) { + y = x - (tc-1.0f); + i = 1; + } else { + y = x; + i = 2; + } + } else { + r = 0.0f; + if (ix >= 0x3fdda618) { /* [1.7316,2] */ + y = 2.0f - x; + i = 0; + } else if (ix >= 0x3F9da620) { /* [1.23,1.73] */ + y = x - tc; + i = 1; + } else { + y = x - 1.0f; + i = 2; + } + } + switch(i) { + case 0: + z = y*y; + p1 = a0+z*(a2+z*(a4+z*(a6+z*(a8+z*a10)))); + p2 = z*(a1+z*(a3+z*(a5+z*(a7+z*(a9+z*a11))))); + p = y*p1+p2; + r += p - 0.5f*y; + break; + case 1: + z = y*y; + w = z*y; + p1 = t0+w*(t3+w*(t6+w*(t9 +w*t12))); /* parallel comp */ + p2 = t1+w*(t4+w*(t7+w*(t10+w*t13))); + p3 = t2+w*(t5+w*(t8+w*(t11+w*t14))); + p = z*p1-(tt-w*(p2+y*p3)); + r += (tf + p); + break; + case 2: + p1 = y*(u0+y*(u1+y*(u2+y*(u3+y*(u4+y*u5))))); + p2 = 1.0f+y*(v1+y*(v2+y*(v3+y*(v4+y*v5)))); + r += -0.5f*y + p1/p2; + } + } else if (ix < 0x41000000) { /* x < 8.0 */ + i = (int)x; + y = x - (float)i; + p = y*(s0+y*(s1+y*(s2+y*(s3+y*(s4+y*(s5+y*s6)))))); + q = 1.0f+y*(r1+y*(r2+y*(r3+y*(r4+y*(r5+y*r6))))); + r = 0.5f*y+p/q; + z = 1.0f; /* lgamma(1+s) = log(s) + lgamma(s) */ + switch (i) { + case 7: z *= y + 6.0f; /* FALLTHRU */ + case 6: z *= y + 5.0f; /* FALLTHRU */ + case 5: z *= y + 4.0f; /* FALLTHRU */ + case 4: z *= y + 3.0f; /* FALLTHRU */ + case 3: z *= y + 2.0f; /* FALLTHRU */ + r += logf(z); + break; + } + } else if (ix < 0x5c800000) { /* 8.0 <= x < 2**58 */ + t = logf(x); + z = 1.0f/x; + y = z*z; + w = w0+z*(w1+y*(w2+y*(w3+y*(w4+y*(w5+y*w6))))); + r = (x-0.5f)*(t-1.0f)+w; + } else /* 2**58 <= x <= inf */ + r = x*(logf(x)-1.0f); + if (sign) + r = nadj - r; + return r; +} + +weak_alias(__lgammaf_r, lgammaf_r); diff --git a/lib/mlibc/options/ansi/musl-generic-math/lgammal.c b/lib/mlibc/options/ansi/musl-generic-math/lgammal.c new file mode 100644 index 0000000..f0bea36 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lgammal.c @@ -0,0 +1,361 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_lgammal.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* lgammal(x) + * Reentrant version of the logarithm of the Gamma function + * with user provide pointer for the sign of Gamma(x). + * + * Method: + * 1. Argument Reduction for 0 < x <= 8 + * Since gamma(1+s)=s*gamma(s), for x in [0,8], we may + * reduce x to a number in [1.5,2.5] by + * lgamma(1+s) = log(s) + lgamma(s) + * for example, + * lgamma(7.3) = log(6.3) + lgamma(6.3) + * = log(6.3*5.3) + lgamma(5.3) + * = log(6.3*5.3*4.3*3.3*2.3) + lgamma(2.3) + * 2. Polynomial approximation of lgamma around its + * minimun ymin=1.461632144968362245 to maintain monotonicity. + * On [ymin-0.23, ymin+0.27] (i.e., [1.23164,1.73163]), use + * Let z = x-ymin; + * lgamma(x) = -1.214862905358496078218 + z^2*poly(z) + * 2. Rational approximation in the primary interval [2,3] + * We use the following approximation: + * s = x-2.0; + * lgamma(x) = 0.5*s + s*P(s)/Q(s) + * Our algorithms are based on the following observation + * + * zeta(2)-1 2 zeta(3)-1 3 + * lgamma(2+s) = s*(1-Euler) + --------- * s - --------- * s + ... + * 2 3 + * + * where Euler = 0.5771... is the Euler constant, which is very + * close to 0.5. + * + * 3. For x>=8, we have + * lgamma(x)~(x-0.5)log(x)-x+0.5*log(2pi)+1/(12x)-1/(360x**3)+.... + * (better formula: + * lgamma(x)~(x-0.5)*(log(x)-1)-.5*(log(2pi)-1) + ...) + * Let z = 1/x, then we approximation + * f(z) = lgamma(x) - (x-0.5)(log(x)-1) + * by + * 3 5 11 + * w = w0 + w1*z + w2*z + w3*z + ... + w6*z + * + * 4. For negative x, since (G is gamma function) + * -x*G(-x)*G(x) = pi/sin(pi*x), + * we have + * G(x) = pi/(sin(pi*x)*(-x)*G(-x)) + * since G(-x) is positive, sign(G(x)) = sign(sin(pi*x)) for x<0 + * Hence, for x<0, signgam = sign(sin(pi*x)) and + * lgamma(x) = log(|Gamma(x)|) + * = log(pi/(|x*sin(pi*x)|)) - lgamma(-x); + * Note: one should avoid compute pi*(-x) directly in the + * computation of sin(pi*(-x)). + * + * 5. Special Cases + * lgamma(2+s) ~ s*(1-Euler) for tiny s + * lgamma(1)=lgamma(2)=0 + * lgamma(x) ~ -log(x) for tiny x + * lgamma(0) = lgamma(inf) = inf + * lgamma(-integer) = +-inf + * + */ + +#define _GNU_SOURCE +#include "libm.h" +#include "weak_alias.h" +//#include "libc.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +double __lgamma_r(double x, int *sg); + +long double __lgammal_r(long double x, int *sg) +{ + return __lgamma_r(x, sg); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +static const long double +pi = 3.14159265358979323846264L, + +/* lgam(1+x) = 0.5 x + x a(x)/b(x) + -0.268402099609375 <= x <= 0 + peak relative error 6.6e-22 */ +a0 = -6.343246574721079391729402781192128239938E2L, +a1 = 1.856560238672465796768677717168371401378E3L, +a2 = 2.404733102163746263689288466865843408429E3L, +a3 = 8.804188795790383497379532868917517596322E2L, +a4 = 1.135361354097447729740103745999661157426E2L, +a5 = 3.766956539107615557608581581190400021285E0L, + +b0 = 8.214973713960928795704317259806842490498E3L, +b1 = 1.026343508841367384879065363925870888012E4L, +b2 = 4.553337477045763320522762343132210919277E3L, +b3 = 8.506975785032585797446253359230031874803E2L, +b4 = 6.042447899703295436820744186992189445813E1L, +/* b5 = 1.000000000000000000000000000000000000000E0 */ + + +tc = 1.4616321449683623412626595423257213284682E0L, +tf = -1.2148629053584961146050602565082954242826E-1, /* double precision */ +/* tt = (tail of tf), i.e. tf + tt has extended precision. */ +tt = 3.3649914684731379602768989080467587736363E-18L, +/* lgam ( 1.4616321449683623412626595423257213284682E0 ) = +-1.2148629053584960809551455717769158215135617312999903886372437313313530E-1 */ + +/* lgam (x + tc) = tf + tt + x g(x)/h(x) + -0.230003726999612341262659542325721328468 <= x + <= 0.2699962730003876587373404576742786715318 + peak relative error 2.1e-21 */ +g0 = 3.645529916721223331888305293534095553827E-18L, +g1 = 5.126654642791082497002594216163574795690E3L, +g2 = 8.828603575854624811911631336122070070327E3L, +g3 = 5.464186426932117031234820886525701595203E3L, +g4 = 1.455427403530884193180776558102868592293E3L, +g5 = 1.541735456969245924860307497029155838446E2L, +g6 = 4.335498275274822298341872707453445815118E0L, + +h0 = 1.059584930106085509696730443974495979641E4L, +h1 = 2.147921653490043010629481226937850618860E4L, +h2 = 1.643014770044524804175197151958100656728E4L, +h3 = 5.869021995186925517228323497501767586078E3L, +h4 = 9.764244777714344488787381271643502742293E2L, +h5 = 6.442485441570592541741092969581997002349E1L, +/* h6 = 1.000000000000000000000000000000000000000E0 */ + + +/* lgam (x+1) = -0.5 x + x u(x)/v(x) + -0.100006103515625 <= x <= 0.231639862060546875 + peak relative error 1.3e-21 */ +u0 = -8.886217500092090678492242071879342025627E1L, +u1 = 6.840109978129177639438792958320783599310E2L, +u2 = 2.042626104514127267855588786511809932433E3L, +u3 = 1.911723903442667422201651063009856064275E3L, +u4 = 7.447065275665887457628865263491667767695E2L, +u5 = 1.132256494121790736268471016493103952637E2L, +u6 = 4.484398885516614191003094714505960972894E0L, + +v0 = 1.150830924194461522996462401210374632929E3L, +v1 = 3.399692260848747447377972081399737098610E3L, +v2 = 3.786631705644460255229513563657226008015E3L, +v3 = 1.966450123004478374557778781564114347876E3L, +v4 = 4.741359068914069299837355438370682773122E2L, +v5 = 4.508989649747184050907206782117647852364E1L, +/* v6 = 1.000000000000000000000000000000000000000E0 */ + + +/* lgam (x+2) = .5 x + x s(x)/r(x) + 0 <= x <= 1 + peak relative error 7.2e-22 */ +s0 = 1.454726263410661942989109455292824853344E6L, +s1 = -3.901428390086348447890408306153378922752E6L, +s2 = -6.573568698209374121847873064292963089438E6L, +s3 = -3.319055881485044417245964508099095984643E6L, +s4 = -7.094891568758439227560184618114707107977E5L, +s5 = -6.263426646464505837422314539808112478303E4L, +s6 = -1.684926520999477529949915657519454051529E3L, + +r0 = -1.883978160734303518163008696712983134698E7L, +r1 = -2.815206082812062064902202753264922306830E7L, +r2 = -1.600245495251915899081846093343626358398E7L, +r3 = -4.310526301881305003489257052083370058799E6L, +r4 = -5.563807682263923279438235987186184968542E5L, +r5 = -3.027734654434169996032905158145259713083E4L, +r6 = -4.501995652861105629217250715790764371267E2L, +/* r6 = 1.000000000000000000000000000000000000000E0 */ + + +/* lgam(x) = ( x - 0.5 ) * log(x) - x + LS2PI + 1/x w(1/x^2) + x >= 8 + Peak relative error 1.51e-21 +w0 = LS2PI - 0.5 */ +w0 = 4.189385332046727417803e-1L, +w1 = 8.333333333333331447505E-2L, +w2 = -2.777777777750349603440E-3L, +w3 = 7.936507795855070755671E-4L, +w4 = -5.952345851765688514613E-4L, +w5 = 8.412723297322498080632E-4L, +w6 = -1.880801938119376907179E-3L, +w7 = 4.885026142432270781165E-3L; + +/* sin(pi*x) assuming x > 2^-1000, if sin(pi*x)==0 the sign is arbitrary */ +static long double sin_pi(long double x) +{ + int n; + + /* spurious inexact if odd int */ + x *= 0.5; + x = 2.0*(x - floorl(x)); /* x mod 2.0 */ + + n = (int)(x*4.0); + n = (n+1)/2; + x -= n*0.5f; + x *= pi; + + switch (n) { + default: /* case 4: */ + case 0: return __sinl(x, 0.0, 0); + case 1: return __cosl(x, 0.0); + case 2: return __sinl(-x, 0.0, 0); + case 3: return -__cosl(x, 0.0); + } +} + +long double __lgammal_r(long double x, int *sg) { + long double t, y, z, nadj, p, p1, p2, q, r, w; + union ldshape u = {x}; + uint32_t ix = (u.i.se & 0x7fffU)<<16 | u.i.m>>48; + int sign = u.i.se >> 15; + int i; + + *sg = 1; + + /* purge off +-inf, NaN, +-0, tiny and negative arguments */ + if (ix >= 0x7fff0000) + return x * x; + if (ix < 0x3fc08000) { /* |x|<2**-63, return -log(|x|) */ + if (sign) { + *sg = -1; + x = -x; + } + return -logl(x); + } + if (sign) { + x = -x; + t = sin_pi(x); + if (t == 0.0) + return 1.0 / (x-x); /* -integer */ + if (t > 0.0) + *sg = -1; + else + t = -t; + nadj = logl(pi / (t * x)); + } + + /* purge off 1 and 2 (so the sign is ok with downward rounding) */ + if ((ix == 0x3fff8000 || ix == 0x40008000) && u.i.m == 0) { + r = 0; + } else if (ix < 0x40008000) { /* x < 2.0 */ + if (ix <= 0x3ffee666) { /* 8.99993896484375e-1 */ + /* lgamma(x) = lgamma(x+1) - log(x) */ + r = -logl(x); + if (ix >= 0x3ffebb4a) { /* 7.31597900390625e-1 */ + y = x - 1.0; + i = 0; + } else if (ix >= 0x3ffced33) { /* 2.31639862060546875e-1 */ + y = x - (tc - 1.0); + i = 1; + } else { /* x < 0.23 */ + y = x; + i = 2; + } + } else { + r = 0.0; + if (ix >= 0x3fffdda6) { /* 1.73162841796875 */ + /* [1.7316,2] */ + y = x - 2.0; + i = 0; + } else if (ix >= 0x3fff9da6) { /* 1.23162841796875 */ + /* [1.23,1.73] */ + y = x - tc; + i = 1; + } else { + /* [0.9, 1.23] */ + y = x - 1.0; + i = 2; + } + } + switch (i) { + case 0: + p1 = a0 + y * (a1 + y * (a2 + y * (a3 + y * (a4 + y * a5)))); + p2 = b0 + y * (b1 + y * (b2 + y * (b3 + y * (b4 + y)))); + r += 0.5 * y + y * p1/p2; + break; + case 1: + p1 = g0 + y * (g1 + y * (g2 + y * (g3 + y * (g4 + y * (g5 + y * g6))))); + p2 = h0 + y * (h1 + y * (h2 + y * (h3 + y * (h4 + y * (h5 + y))))); + p = tt + y * p1/p2; + r += (tf + p); + break; + case 2: + p1 = y * (u0 + y * (u1 + y * (u2 + y * (u3 + y * (u4 + y * (u5 + y * u6)))))); + p2 = v0 + y * (v1 + y * (v2 + y * (v3 + y * (v4 + y * (v5 + y))))); + r += (-0.5 * y + p1 / p2); + } + } else if (ix < 0x40028000) { /* 8.0 */ + /* x < 8.0 */ + i = (int)x; + y = x - (double)i; + p = y * (s0 + y * (s1 + y * (s2 + y * (s3 + y * (s4 + y * (s5 + y * s6)))))); + q = r0 + y * (r1 + y * (r2 + y * (r3 + y * (r4 + y * (r5 + y * (r6 + y)))))); + r = 0.5 * y + p / q; + z = 1.0; + /* lgamma(1+s) = log(s) + lgamma(s) */ + switch (i) { + case 7: + z *= (y + 6.0); /* FALLTHRU */ + case 6: + z *= (y + 5.0); /* FALLTHRU */ + case 5: + z *= (y + 4.0); /* FALLTHRU */ + case 4: + z *= (y + 3.0); /* FALLTHRU */ + case 3: + z *= (y + 2.0); /* FALLTHRU */ + r += logl(z); + break; + } + } else if (ix < 0x40418000) { /* 2^66 */ + /* 8.0 <= x < 2**66 */ + t = logl(x); + z = 1.0 / x; + y = z * z; + w = w0 + z * (w1 + y * (w2 + y * (w3 + y * (w4 + y * (w5 + y * (w6 + y * w7)))))); + r = (x - 0.5) * (t - 1.0) + w; + } else /* 2**66 <= x <= inf */ + r = x * (logl(x) - 1.0); + if (sign) + r = nadj - r; + return r; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +double __lgamma_r(double x, int *sg); + +long double __lgammal_r(long double x, int *sg) +{ + return __lgamma_r(x, sg); +} +#endif + +extern int __signgam; + +long double lgammal(long double x) +{ + return __lgammal_r(x, &__signgam); +} + +weak_alias(__lgammal_r, lgammal_r); diff --git a/lib/mlibc/options/ansi/musl-generic-math/libm.h b/lib/mlibc/options/ansi/musl-generic-math/libm.h new file mode 100644 index 0000000..8120292 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/libm.h @@ -0,0 +1,186 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/math_private.h */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#ifndef _LIBM_H +#define _LIBM_H + +#include <stdint.h> +#include <float.h> +#include <math.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 && __BYTE_ORDER == __LITTLE_ENDIAN +union ldshape { + long double f; + struct { + uint64_t m; + uint16_t se; + } i; +}; +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 && __BYTE_ORDER == __LITTLE_ENDIAN +union ldshape { + long double f; + struct { + uint64_t lo; + uint32_t mid; + uint16_t top; + uint16_t se; + } i; + struct { + uint64_t lo; + uint64_t hi; + } i2; +}; +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 && __BYTE_ORDER == __BIG_ENDIAN +union ldshape { + long double f; + struct { + uint16_t se; + uint16_t top; + uint32_t mid; + uint64_t lo; + } i; + struct { + uint64_t hi; + uint64_t lo; + } i2; +}; +#else +#error Unsupported long double representation +#endif + +#define FORCE_EVAL(x) do { \ + if (sizeof(x) == sizeof(float)) { \ + volatile float __x; \ + __x = (x); \ + } else if (sizeof(x) == sizeof(double)) { \ + volatile double __x; \ + __x = (x); \ + } else { \ + volatile long double __x; \ + __x = (x); \ + } \ +} while(0) + +/* Get two 32 bit ints from a double. */ +#define EXTRACT_WORDS(hi,lo,d) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + (hi) = __u.i >> 32; \ + (lo) = (uint32_t)__u.i; \ +} while (0) + +/* Get the more significant 32 bit int from a double. */ +#define GET_HIGH_WORD(hi,d) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + (hi) = __u.i >> 32; \ +} while (0) + +/* Get the less significant 32 bit int from a double. */ +#define GET_LOW_WORD(lo,d) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + (lo) = (uint32_t)__u.i; \ +} while (0) + +/* Set a double from two 32 bit ints. */ +#define INSERT_WORDS(d,hi,lo) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.i = ((uint64_t)(hi)<<32) | (uint32_t)(lo); \ + (d) = __u.f; \ +} while (0) + +/* Set the more significant 32 bits of a double from an int. */ +#define SET_HIGH_WORD(d,hi) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + __u.i &= 0xffffffff; \ + __u.i |= (uint64_t)(hi) << 32; \ + (d) = __u.f; \ +} while (0) + +/* Set the less significant 32 bits of a double from an int. */ +#define SET_LOW_WORD(d,lo) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + __u.i &= 0xffffffff00000000ull; \ + __u.i |= (uint32_t)(lo); \ + (d) = __u.f; \ +} while (0) + +/* Get a 32 bit int from a float. */ +#define GET_FLOAT_WORD(w,d) \ +do { \ + union {float f; uint32_t i;} __u; \ + __u.f = (d); \ + (w) = __u.i; \ +} while (0) + +/* Set a float from a 32 bit int. */ +#define SET_FLOAT_WORD(d,w) \ +do { \ + union {float f; uint32_t i;} __u; \ + __u.i = (w); \ + (d) = __u.f; \ +} while (0) + +#undef __CMPLX +#undef CMPLX +#undef CMPLXF +#undef CMPLXL + +#define __CMPLX(x, y, t) \ + ((union { _Complex t __z; t __xy[2]; }){.__xy = {(x),(y)}}.__z) + +#define CMPLX(x, y) __CMPLX(x, y, double) +#define CMPLXF(x, y) __CMPLX(x, y, float) +#define CMPLXL(x, y) __CMPLX(x, y, long double) + +#ifndef __MLIBC_ABI_ONLY + +/* fdlibm kernel functions */ + +int __rem_pio2_large(double*,double*,int,int,int); + +int __rem_pio2(double,double*); +double __sin(double,double,int); +double __cos(double,double); +double __tan(double,double,int); +double __expo2(double); +//double complex __ldexp_cexp(double complex,int); + +int __rem_pio2f(float,double*); +float __sindf(double); +float __cosdf(double); +float __tandf(double,int); +float __expo2f(float); +//float complex __ldexp_cexpf(float complex,int); + +int __rem_pio2l(long double, long double *); +long double __sinl(long double, long double, int); +long double __cosl(long double, long double); +long double __tanl(long double, long double, int); + +/* polynomial evaluation */ +long double __polevll(long double, const long double *, int); +long double __p1evll(long double, const long double *, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/llrint.c b/lib/mlibc/options/ansi/musl-generic-math/llrint.c new file mode 100644 index 0000000..4f583ae --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/llrint.c @@ -0,0 +1,8 @@ +#include <math.h> + +/* uses LLONG_MAX > 2^53, see comments in lrint.c */ + +long long llrint(double x) +{ + return rint(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/llrintf.c b/lib/mlibc/options/ansi/musl-generic-math/llrintf.c new file mode 100644 index 0000000..96949a0 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/llrintf.c @@ -0,0 +1,8 @@ +#include <math.h> + +/* uses LLONG_MAX > 2^24, see comments in lrint.c */ + +long long llrintf(float x) +{ + return rintf(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/llrintl.c b/lib/mlibc/options/ansi/musl-generic-math/llrintl.c new file mode 100644 index 0000000..3449f6f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/llrintl.c @@ -0,0 +1,36 @@ +#include <limits.h> +#include <fenv.h> +#include "libm.h" + + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long long llrintl(long double x) +{ + return llrint(x); +} +#elif defined(FE_INEXACT) +/* +see comments in lrint.c + +Note that if LLONG_MAX == 0x7fffffffffffffff && LDBL_MANT_DIG == 64 +then x == 2**63 - 0.5 is the only input that overflows and +raises inexact (with tonearest or upward rounding mode) +*/ +long long llrintl(long double x) +{ + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); + x = rintl(x); + if (!e && (x > LLONG_MAX || x < LLONG_MIN)) + feclearexcept(FE_INEXACT); + /* conversion */ + return x; +} +#else +long long llrintl(long double x) +{ + return rintl(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/llround.c b/lib/mlibc/options/ansi/musl-generic-math/llround.c new file mode 100644 index 0000000..4d94787 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/llround.c @@ -0,0 +1,6 @@ +#include <math.h> + +long long llround(double x) +{ + return round(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/llroundf.c b/lib/mlibc/options/ansi/musl-generic-math/llroundf.c new file mode 100644 index 0000000..19eb77e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/llroundf.c @@ -0,0 +1,6 @@ +#include <math.h> + +long long llroundf(float x) +{ + return roundf(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/llroundl.c b/lib/mlibc/options/ansi/musl-generic-math/llroundl.c new file mode 100644 index 0000000..2c2ee5e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/llroundl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long long llroundl(long double x) +{ + return roundl(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log.c b/lib/mlibc/options/ansi/musl-generic-math/log.c new file mode 100644 index 0000000..e61e113 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log.c @@ -0,0 +1,118 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* log(x) + * Return the logarithm of x + * + * Method : + * 1. Argument Reduction: find k and f such that + * x = 2^k * (1+f), + * where sqrt(2)/2 < 1+f < sqrt(2) . + * + * 2. Approximation of log(1+f). + * Let s = f/(2+f) ; based on log(1+f) = log(1+s) - log(1-s) + * = 2s + 2/3 s**3 + 2/5 s**5 + ....., + * = 2s + s*R + * We use a special Remez algorithm on [0,0.1716] to generate + * a polynomial of degree 14 to approximate R The maximum error + * of this polynomial approximation is bounded by 2**-58.45. In + * other words, + * 2 4 6 8 10 12 14 + * R(z) ~ Lg1*s +Lg2*s +Lg3*s +Lg4*s +Lg5*s +Lg6*s +Lg7*s + * (the values of Lg1 to Lg7 are listed in the program) + * and + * | 2 14 | -58.45 + * | Lg1*s +...+Lg7*s - R(z) | <= 2 + * | | + * Note that 2s = f - s*f = f - hfsq + s*hfsq, where hfsq = f*f/2. + * In order to guarantee error in log below 1ulp, we compute log + * by + * log(1+f) = f - s*(f - R) (if f is not too large) + * log(1+f) = f - (hfsq - s*(hfsq+R)). (better accuracy) + * + * 3. Finally, log(x) = k*ln2 + log(1+f). + * = k*ln2_hi+(f-(hfsq-(s*(hfsq+R)+k*ln2_lo))) + * Here ln2 is split into two floating point number: + * ln2_hi + ln2_lo, + * where n*ln2_hi is always exact for |n| < 2000. + * + * Special cases: + * log(x) is NaN with signal if x < 0 (including -INF) ; + * log(+INF) is +INF; log(0) is -INF with signal; + * log(NaN) is that NaN with no signal. + * + * Accuracy: + * according to an error analysis, the error is always less than + * 1 ulp (unit in the last place). + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include <math.h> +#include <stdint.h> + +static const double +ln2_hi = 6.93147180369123816490e-01, /* 3fe62e42 fee00000 */ +ln2_lo = 1.90821492927058770002e-10, /* 3dea39ef 35793c76 */ +Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ +Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ +Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ +Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ +Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ +Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ +Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + +double log(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t hfsq,f,s,z,R,w,t1,t2,dk; + uint32_t hx; + int k; + + hx = u.i>>32; + k = 0; + if (hx < 0x00100000 || hx>>31) { + if (u.i<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (hx>>31) + return (x-x)/0.0; /* log(-#) = NaN */ + /* subnormal number, scale x up */ + k -= 54; + x *= 0x1p54; + u.f = x; + hx = u.i>>32; + } else if (hx >= 0x7ff00000) { + return x; + } else if (hx == 0x3ff00000 && u.i<<32 == 0) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + hx += 0x3ff00000 - 0x3fe6a09e; + k += (int)(hx>>20) - 0x3ff; + hx = (hx&0x000fffff) + 0x3fe6a09e; + u.i = (uint64_t)hx<<32 | (u.i&0xffffffff); + x = u.f; + + f = x - 1.0; + hfsq = 0.5*f*f; + s = f/(2.0+f); + z = s*s; + w = z*z; + t1 = w*(Lg2+w*(Lg4+w*Lg6)); + t2 = z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + R = t2 + t1; + dk = k; + return s*(hfsq+R) + dk*ln2_lo - hfsq + f + dk*ln2_hi; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log10.c b/lib/mlibc/options/ansi/musl-generic-math/log10.c new file mode 100644 index 0000000..8102687 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log10.c @@ -0,0 +1,101 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log10.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * Return the base 10 logarithm of x. See log.c for most comments. + * + * Reduce x to 2^k (1+f) and calculate r = log(1+f) - f + f*f/2 + * as in log.c, then combine and scale in extra precision: + * log10(x) = (f - f*f/2 + r)/log(10) + k*log10(2) + */ + +#include <math.h> +#include <stdint.h> + +static const double +ivln10hi = 4.34294481878168880939e-01, /* 0x3fdbcb7b, 0x15200000 */ +ivln10lo = 2.50829467116452752298e-11, /* 0x3dbb9438, 0xca9aadd5 */ +log10_2hi = 3.01029995663611771306e-01, /* 0x3FD34413, 0x509F6000 */ +log10_2lo = 3.69423907715893078616e-13, /* 0x3D59FEF3, 0x11F12B36 */ +Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ +Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ +Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ +Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ +Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ +Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ +Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + +double log10(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t hfsq,f,s,z,R,w,t1,t2,dk,y,hi,lo,val_hi,val_lo; + uint32_t hx; + int k; + + hx = u.i>>32; + k = 0; + if (hx < 0x00100000 || hx>>31) { + if (u.i<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (hx>>31) + return (x-x)/0.0; /* log(-#) = NaN */ + /* subnormal number, scale x up */ + k -= 54; + x *= 0x1p54; + u.f = x; + hx = u.i>>32; + } else if (hx >= 0x7ff00000) { + return x; + } else if (hx == 0x3ff00000 && u.i<<32 == 0) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + hx += 0x3ff00000 - 0x3fe6a09e; + k += (int)(hx>>20) - 0x3ff; + hx = (hx&0x000fffff) + 0x3fe6a09e; + u.i = (uint64_t)hx<<32 | (u.i&0xffffffff); + x = u.f; + + f = x - 1.0; + hfsq = 0.5*f*f; + s = f/(2.0+f); + z = s*s; + w = z*z; + t1 = w*(Lg2+w*(Lg4+w*Lg6)); + t2 = z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + R = t2 + t1; + + /* See log2.c for details. */ + /* hi+lo = f - hfsq + s*(hfsq+R) ~ log(1+f) */ + hi = f - hfsq; + u.f = hi; + u.i &= (uint64_t)-1<<32; + hi = u.f; + lo = f - hi - hfsq + s*(hfsq+R); + + /* val_hi+val_lo ~ log10(1+f) + k*log10(2) */ + val_hi = hi*ivln10hi; + dk = k; + y = dk*log10_2hi; + val_lo = dk*log10_2lo + (lo+hi)*ivln10lo + lo*ivln10hi; + + /* + * Extra precision in for adding y is not strictly needed + * since there is no very large cancellation near x = sqrt(2) or + * x = 1/sqrt(2), but we do it anyway since it costs little on CPUs + * with some parallelism and it reduces the error for many args. + */ + w = y + val_hi; + val_lo += (y - w) + val_hi; + val_hi = w; + + return val_lo + val_hi; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log10f.c b/lib/mlibc/options/ansi/musl-generic-math/log10f.c new file mode 100644 index 0000000..9ca2f01 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log10f.c @@ -0,0 +1,77 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log10f.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in log10.c. + */ + +#include <math.h> +#include <stdint.h> + +static const float +ivln10hi = 4.3432617188e-01, /* 0x3ede6000 */ +ivln10lo = -3.1689971365e-05, /* 0xb804ead9 */ +log10_2hi = 3.0102920532e-01, /* 0x3e9a2080 */ +log10_2lo = 7.9034151668e-07, /* 0x355427db */ +/* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ +Lg1 = 0xaaaaaa.0p-24, /* 0.66666662693 */ +Lg2 = 0xccce13.0p-25, /* 0.40000972152 */ +Lg3 = 0x91e9ee.0p-25, /* 0.28498786688 */ +Lg4 = 0xf89e26.0p-26; /* 0.24279078841 */ + +float log10f(float x) +{ + union {float f; uint32_t i;} u = {x}; + float_t hfsq,f,s,z,R,w,t1,t2,dk,hi,lo; + uint32_t ix; + int k; + + ix = u.i; + k = 0; + if (ix < 0x00800000 || ix>>31) { /* x < 2**-126 */ + if (ix<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (ix>>31) + return (x-x)/0.0f; /* log(-#) = NaN */ + /* subnormal number, scale up x */ + k -= 25; + x *= 0x1p25f; + u.f = x; + ix = u.i; + } else if (ix >= 0x7f800000) { + return x; + } else if (ix == 0x3f800000) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + ix += 0x3f800000 - 0x3f3504f3; + k += (int)(ix>>23) - 0x7f; + ix = (ix&0x007fffff) + 0x3f3504f3; + u.i = ix; + x = u.f; + + f = x - 1.0f; + s = f/(2.0f + f); + z = s*s; + w = z*z; + t1= w*(Lg2+w*Lg4); + t2= z*(Lg1+w*Lg3); + R = t2 + t1; + hfsq = 0.5f*f*f; + + hi = f - hfsq; + u.f = hi; + u.i &= 0xfffff000; + hi = u.f; + lo = f - hi - hfsq + s*(hfsq+R); + dk = k; + return dk*log10_2lo + (lo+hi)*ivln10lo + lo*ivln10hi + hi*ivln10hi + dk*log10_2hi; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log10l.c b/lib/mlibc/options/ansi/musl-generic-math/log10l.c new file mode 100644 index 0000000..63dcc28 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log10l.c @@ -0,0 +1,191 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_log10l.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Common logarithm, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, log10l(); + * + * y = log10l( x ); + * + * + * DESCRIPTION: + * + * Returns the base 10 logarithm of x. + * + * The argument is separated into its exponent and fractional + * parts. If the exponent is between -1 and +1, the logarithm + * of the fraction is approximated by + * + * log(1+x) = x - 0.5 x**2 + x**3 P(x)/Q(x). + * + * Otherwise, setting z = 2(x-1)/x+1), + * + * log(x) = z + z**3 P(z)/Q(z). + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE 0.5, 2.0 30000 9.0e-20 2.6e-20 + * IEEE exp(+-10000) 30000 6.0e-20 2.3e-20 + * + * In the tests over the interval exp(+-10000), the logarithms + * of the random arguments were uniformly distributed over + * [-10000, +10000]. + * + * ERROR MESSAGES: + * + * log singularity: x = 0; returns MINLOG + * log domain: x < 0; returns MINLOG + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double log10l(long double x) +{ + return log10(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* Coefficients for log(1+x) = x - x**2/2 + x**3 P(x)/Q(x) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.2e-22 + */ +static const long double P[] = { + 4.9962495940332550844739E-1L, + 1.0767376367209449010438E1L, + 7.7671073698359539859595E1L, + 2.5620629828144409632571E2L, + 4.2401812743503691187826E2L, + 3.4258224542413922935104E2L, + 1.0747524399916215149070E2L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0,*/ + 2.3479774160285863271658E1L, + 1.9444210022760132894510E2L, + 7.7952888181207260646090E2L, + 1.6911722418503949084863E3L, + 2.0307734695595183428202E3L, + 1.2695660352705325274404E3L, + 3.2242573199748645407652E2L, +}; + +/* Coefficients for log(x) = z + z^3 P(z^2)/Q(z^2), + * where z = 2(x-1)/(x+1) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.16e-22 + */ +static const long double R[4] = { + 1.9757429581415468984296E-3L, +-7.1990767473014147232598E-1L, + 1.0777257190312272158094E1L, +-3.5717684488096787370998E1L, +}; +static const long double S[4] = { +/* 1.00000000000000000000E0L,*/ +-2.6201045551331104417768E1L, + 1.9361891836232102174846E2L, +-4.2861221385716144629696E2L, +}; +/* log10(2) */ +#define L102A 0.3125L +#define L102B -1.1470004336018804786261e-2L +/* log10(e) */ +#define L10EA 0.5L +#define L10EB -6.5705518096748172348871e-2L + +#define SQRTH 0.70710678118654752440L + +long double log10l(long double x) +{ + long double y, z; + int e; + + if (isnan(x)) + return x; + if(x <= 0.0) { + if(x == 0.0) + return -1.0 / (x*x); + return (x - x) / 0.0; + } + if (x == INFINITY) + return INFINITY; + /* separate mantissa from exponent */ + /* Note, frexp is used so that denormal numbers + * will be handled properly. + */ + x = frexpl(x, &e); + + /* logarithm using log(x) = z + z**3 P(z)/Q(z), + * where z = 2(x-1)/x+1) + */ + if (e > 2 || e < -2) { + if (x < SQRTH) { /* 2(2x-1)/(2x+1) */ + e -= 1; + z = x - 0.5; + y = 0.5 * z + 0.5; + } else { /* 2 (x-1)/(x+1) */ + z = x - 0.5; + z -= 0.5; + y = 0.5 * x + 0.5; + } + x = z / y; + z = x*x; + y = x * (z * __polevll(z, R, 3) / __p1evll(z, S, 3)); + goto done; + } + + /* logarithm using log(1+x) = x - .5x**2 + x**3 P(x)/Q(x) */ + if (x < SQRTH) { + e -= 1; + x = 2.0*x - 1.0; + } else { + x = x - 1.0; + } + z = x*x; + y = x * (z * __polevll(x, P, 6) / __p1evll(x, Q, 7)); + y = y - 0.5*z; + +done: + /* Multiply log of fraction by log10(e) + * and base 2 exponent by log10(2). + * + * ***CAUTION*** + * + * This sequence of operations is critical and it may + * be horribly defeated by some compiler optimizers. + */ + z = y * (L10EB); + z += x * (L10EB); + z += e * (L102B); + z += y * (L10EA); + z += x * (L10EA); + z += e * (L102A); + return z; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double log10l(long double x) +{ + return log10(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/log1p.c b/lib/mlibc/options/ansi/musl-generic-math/log1p.c new file mode 100644 index 0000000..0097134 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log1p.c @@ -0,0 +1,122 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_log1p.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* double log1p(double x) + * Return the natural logarithm of 1+x. + * + * Method : + * 1. Argument Reduction: find k and f such that + * 1+x = 2^k * (1+f), + * where sqrt(2)/2 < 1+f < sqrt(2) . + * + * Note. If k=0, then f=x is exact. However, if k!=0, then f + * may not be representable exactly. In that case, a correction + * term is need. Let u=1+x rounded. Let c = (1+x)-u, then + * log(1+x) - log(u) ~ c/u. Thus, we proceed to compute log(u), + * and add back the correction term c/u. + * (Note: when x > 2**53, one can simply return log(x)) + * + * 2. Approximation of log(1+f): See log.c + * + * 3. Finally, log1p(x) = k*ln2 + log(1+f) + c/u. See log.c + * + * Special cases: + * log1p(x) is NaN with signal if x < -1 (including -INF) ; + * log1p(+INF) is +INF; log1p(-1) is -INF with signal; + * log1p(NaN) is that NaN with no signal. + * + * Accuracy: + * according to an error analysis, the error is always less than + * 1 ulp (unit in the last place). + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + * + * Note: Assuming log() return accurate answer, the following + * algorithm can be used to compute log1p(x) to within a few ULP: + * + * u = 1+x; + * if(u==1.0) return x ; else + * return log(u)*(x/(u-1.0)); + * + * See HP-15C Advanced Functions Handbook, p.193. + */ + +#include "libm.h" + +static const double +ln2_hi = 6.93147180369123816490e-01, /* 3fe62e42 fee00000 */ +ln2_lo = 1.90821492927058770002e-10, /* 3dea39ef 35793c76 */ +Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ +Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ +Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ +Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ +Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ +Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ +Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + +double log1p(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t hfsq,f,c,s,z,R,w,t1,t2,dk; + uint32_t hx,hu; + int k; + + hx = u.i>>32; + k = 1; + if (hx < 0x3fda827a || hx>>31) { /* 1+x < sqrt(2)+ */ + if (hx >= 0xbff00000) { /* x <= -1.0 */ + if (x == -1) + return x/0.0; /* log1p(-1) = -inf */ + return (x-x)/0.0; /* log1p(x<-1) = NaN */ + } + if (hx<<1 < 0x3ca00000<<1) { /* |x| < 2**-53 */ + /* underflow if subnormal */ + if ((hx&0x7ff00000) == 0) + FORCE_EVAL((float)x); + return x; + } + if (hx <= 0xbfd2bec4) { /* sqrt(2)/2- <= 1+x < sqrt(2)+ */ + k = 0; + c = 0; + f = x; + } + } else if (hx >= 0x7ff00000) + return x; + if (k) { + u.f = 1 + x; + hu = u.i>>32; + hu += 0x3ff00000 - 0x3fe6a09e; + k = (int)(hu>>20) - 0x3ff; + /* correction term ~ log(1+x)-log(u), avoid underflow in c/u */ + if (k < 54) { + c = k >= 2 ? 1-(u.f-x) : x-(u.f-1); + c /= u.f; + } else + c = 0; + /* reduce u into [sqrt(2)/2, sqrt(2)] */ + hu = (hu&0x000fffff) + 0x3fe6a09e; + u.i = (uint64_t)hu<<32 | (u.i&0xffffffff); + f = u.f - 1; + } + hfsq = 0.5*f*f; + s = f/(2.0+f); + z = s*s; + w = z*z; + t1 = w*(Lg2+w*(Lg4+w*Lg6)); + t2 = z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + R = t2 + t1; + dk = k; + return s*(hfsq+R) + (dk*ln2_lo+c) - hfsq + f + dk*ln2_hi; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log1pf.c b/lib/mlibc/options/ansi/musl-generic-math/log1pf.c new file mode 100644 index 0000000..23985c3 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log1pf.c @@ -0,0 +1,77 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_log1pf.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +ln2_hi = 6.9313812256e-01, /* 0x3f317180 */ +ln2_lo = 9.0580006145e-06, /* 0x3717f7d1 */ +/* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ +Lg1 = 0xaaaaaa.0p-24, /* 0.66666662693 */ +Lg2 = 0xccce13.0p-25, /* 0.40000972152 */ +Lg3 = 0x91e9ee.0p-25, /* 0.28498786688 */ +Lg4 = 0xf89e26.0p-26; /* 0.24279078841 */ + +float log1pf(float x) +{ + union {float f; uint32_t i;} u = {x}; + float_t hfsq,f,c,s,z,R,w,t1,t2,dk; + uint32_t ix,iu; + int k; + + ix = u.i; + k = 1; + if (ix < 0x3ed413d0 || ix>>31) { /* 1+x < sqrt(2)+ */ + if (ix >= 0xbf800000) { /* x <= -1.0 */ + if (x == -1) + return x/0.0f; /* log1p(-1)=+inf */ + return (x-x)/0.0f; /* log1p(x<-1)=NaN */ + } + if (ix<<1 < 0x33800000<<1) { /* |x| < 2**-24 */ + /* underflow if subnormal */ + if ((ix&0x7f800000) == 0) + FORCE_EVAL(x*x); + return x; + } + if (ix <= 0xbe95f619) { /* sqrt(2)/2- <= 1+x < sqrt(2)+ */ + k = 0; + c = 0; + f = x; + } + } else if (ix >= 0x7f800000) + return x; + if (k) { + u.f = 1 + x; + iu = u.i; + iu += 0x3f800000 - 0x3f3504f3; + k = (int)(iu>>23) - 0x7f; + /* correction term ~ log(1+x)-log(u), avoid underflow in c/u */ + if (k < 25) { + c = k >= 2 ? 1-(u.f-x) : x-(u.f-1); + c /= u.f; + } else + c = 0; + /* reduce u into [sqrt(2)/2, sqrt(2)] */ + iu = (iu&0x007fffff) + 0x3f3504f3; + u.i = iu; + f = u.f - 1; + } + s = f/(2.0f + f); + z = s*s; + w = z*z; + t1= w*(Lg2+w*Lg4); + t2= z*(Lg1+w*Lg3); + R = t2 + t1; + hfsq = 0.5f*f*f; + dk = k; + return s*(hfsq+R) + (dk*ln2_lo+c) - hfsq + f + dk*ln2_hi; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log1pl.c b/lib/mlibc/options/ansi/musl-generic-math/log1pl.c new file mode 100644 index 0000000..141b5f0 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log1pl.c @@ -0,0 +1,177 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/s_log1pl.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Relative error logarithm + * Natural logarithm of 1+x, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, log1pl(); + * + * y = log1pl( x ); + * + * + * DESCRIPTION: + * + * Returns the base e (2.718...) logarithm of 1+x. + * + * The argument 1+x is separated into its exponent and fractional + * parts. If the exponent is between -1 and +1, the logarithm + * of the fraction is approximated by + * + * log(1+x) = x - 0.5 x^2 + x^3 P(x)/Q(x). + * + * Otherwise, setting z = 2(x-1)/x+1), + * + * log(x) = z + z^3 P(z)/Q(z). + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE -1.0, 9.0 100000 8.2e-20 2.5e-20 + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double log1pl(long double x) +{ + return log1p(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* Coefficients for log(1+x) = x - x^2 / 2 + x^3 P(x)/Q(x) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 2.32e-20 + */ +static const long double P[] = { + 4.5270000862445199635215E-5L, + 4.9854102823193375972212E-1L, + 6.5787325942061044846969E0L, + 2.9911919328553073277375E1L, + 6.0949667980987787057556E1L, + 5.7112963590585538103336E1L, + 2.0039553499201281259648E1L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0,*/ + 1.5062909083469192043167E1L, + 8.3047565967967209469434E1L, + 2.2176239823732856465394E2L, + 3.0909872225312059774938E2L, + 2.1642788614495947685003E2L, + 6.0118660497603843919306E1L, +}; + +/* Coefficients for log(x) = z + z^3 P(z^2)/Q(z^2), + * where z = 2(x-1)/(x+1) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.16e-22 + */ +static const long double R[4] = { + 1.9757429581415468984296E-3L, +-7.1990767473014147232598E-1L, + 1.0777257190312272158094E1L, +-3.5717684488096787370998E1L, +}; +static const long double S[4] = { +/* 1.00000000000000000000E0L,*/ +-2.6201045551331104417768E1L, + 1.9361891836232102174846E2L, +-4.2861221385716144629696E2L, +}; +static const long double C1 = 6.9314575195312500000000E-1L; +static const long double C2 = 1.4286068203094172321215E-6L; + +#define SQRTH 0.70710678118654752440L + +long double log1pl(long double xm1) +{ + long double x, y, z; + int e; + + if (isnan(xm1)) + return xm1; + if (xm1 == INFINITY) + return xm1; + if (xm1 == 0.0) + return xm1; + + x = xm1 + 1.0; + + /* Test for domain errors. */ + if (x <= 0.0) { + if (x == 0.0) + return -1/(x*x); /* -inf with divbyzero */ + return 0/0.0f; /* nan with invalid */ + } + + /* Separate mantissa from exponent. + Use frexp so that denormal numbers will be handled properly. */ + x = frexpl(x, &e); + + /* logarithm using log(x) = z + z^3 P(z)/Q(z), + where z = 2(x-1)/x+1) */ + if (e > 2 || e < -2) { + if (x < SQRTH) { /* 2(2x-1)/(2x+1) */ + e -= 1; + z = x - 0.5; + y = 0.5 * z + 0.5; + } else { /* 2 (x-1)/(x+1) */ + z = x - 0.5; + z -= 0.5; + y = 0.5 * x + 0.5; + } + x = z / y; + z = x*x; + z = x * (z * __polevll(z, R, 3) / __p1evll(z, S, 3)); + z = z + e * C2; + z = z + x; + z = z + e * C1; + return z; + } + + /* logarithm using log(1+x) = x - .5x**2 + x**3 P(x)/Q(x) */ + if (x < SQRTH) { + e -= 1; + if (e != 0) + x = 2.0 * x - 1.0; + else + x = xm1; + } else { + if (e != 0) + x = x - 1.0; + else + x = xm1; + } + z = x*x; + y = x * (z * __polevll(x, P, 6) / __p1evll(x, Q, 6)); + y = y + e * C2; + z = y - 0.5 * z; + z = z + x; + z = z + e * C1; + return z; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double log1pl(long double x) +{ + return log1p(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/log2.c b/lib/mlibc/options/ansi/musl-generic-math/log2.c new file mode 100644 index 0000000..0aafad4 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log2.c @@ -0,0 +1,122 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * Return the base 2 logarithm of x. See log.c for most comments. + * + * Reduce x to 2^k (1+f) and calculate r = log(1+f) - f + f*f/2 + * as in log.c, then combine and scale in extra precision: + * log2(x) = (f - f*f/2 + r)/log(2) + k + */ + +#include <math.h> +#include <stdint.h> + +static const double +ivln2hi = 1.44269504072144627571e+00, /* 0x3ff71547, 0x65200000 */ +ivln2lo = 1.67517131648865118353e-10, /* 0x3de705fc, 0x2eefa200 */ +Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ +Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ +Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ +Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ +Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ +Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ +Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + +double log2(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t hfsq,f,s,z,R,w,t1,t2,y,hi,lo,val_hi,val_lo; + uint32_t hx; + int k; + + hx = u.i>>32; + k = 0; + if (hx < 0x00100000 || hx>>31) { + if (u.i<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (hx>>31) + return (x-x)/0.0; /* log(-#) = NaN */ + /* subnormal number, scale x up */ + k -= 54; + x *= 0x1p54; + u.f = x; + hx = u.i>>32; + } else if (hx >= 0x7ff00000) { + return x; + } else if (hx == 0x3ff00000 && u.i<<32 == 0) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + hx += 0x3ff00000 - 0x3fe6a09e; + k += (int)(hx>>20) - 0x3ff; + hx = (hx&0x000fffff) + 0x3fe6a09e; + u.i = (uint64_t)hx<<32 | (u.i&0xffffffff); + x = u.f; + + f = x - 1.0; + hfsq = 0.5*f*f; + s = f/(2.0+f); + z = s*s; + w = z*z; + t1 = w*(Lg2+w*(Lg4+w*Lg6)); + t2 = z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + R = t2 + t1; + + /* + * f-hfsq must (for args near 1) be evaluated in extra precision + * to avoid a large cancellation when x is near sqrt(2) or 1/sqrt(2). + * This is fairly efficient since f-hfsq only depends on f, so can + * be evaluated in parallel with R. Not combining hfsq with R also + * keeps R small (though not as small as a true `lo' term would be), + * so that extra precision is not needed for terms involving R. + * + * Compiler bugs involving extra precision used to break Dekker's + * theorem for spitting f-hfsq as hi+lo, unless double_t was used + * or the multi-precision calculations were avoided when double_t + * has extra precision. These problems are now automatically + * avoided as a side effect of the optimization of combining the + * Dekker splitting step with the clear-low-bits step. + * + * y must (for args near sqrt(2) and 1/sqrt(2)) be added in extra + * precision to avoid a very large cancellation when x is very near + * these values. Unlike the above cancellations, this problem is + * specific to base 2. It is strange that adding +-1 is so much + * harder than adding +-ln2 or +-log10_2. + * + * This uses Dekker's theorem to normalize y+val_hi, so the + * compiler bugs are back in some configurations, sigh. And I + * don't want to used double_t to avoid them, since that gives a + * pessimization and the support for avoiding the pessimization + * is not yet available. + * + * The multi-precision calculations for the multiplications are + * routine. + */ + + /* hi+lo = f - hfsq + s*(hfsq+R) ~ log(1+f) */ + hi = f - hfsq; + u.f = hi; + u.i &= (uint64_t)-1<<32; + hi = u.f; + lo = f - hi - hfsq + s*(hfsq+R); + + val_hi = hi*ivln2hi; + val_lo = (lo+hi)*ivln2lo + lo*ivln2hi; + + /* spadd(val_hi, val_lo, y), except for not using double_t: */ + y = k; + w = y + val_hi; + val_lo += (y - w) + val_hi; + val_hi = w; + + return val_lo + val_hi; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log2f.c b/lib/mlibc/options/ansi/musl-generic-math/log2f.c new file mode 100644 index 0000000..b3e305f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log2f.c @@ -0,0 +1,74 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log2f.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in log2.c. + */ + +#include <math.h> +#include <stdint.h> + +static const float +ivln2hi = 1.4428710938e+00, /* 0x3fb8b000 */ +ivln2lo = -1.7605285393e-04, /* 0xb9389ad4 */ +/* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ +Lg1 = 0xaaaaaa.0p-24, /* 0.66666662693 */ +Lg2 = 0xccce13.0p-25, /* 0.40000972152 */ +Lg3 = 0x91e9ee.0p-25, /* 0.28498786688 */ +Lg4 = 0xf89e26.0p-26; /* 0.24279078841 */ + +float log2f(float x) +{ + union {float f; uint32_t i;} u = {x}; + float_t hfsq,f,s,z,R,w,t1,t2,hi,lo; + uint32_t ix; + int k; + + ix = u.i; + k = 0; + if (ix < 0x00800000 || ix>>31) { /* x < 2**-126 */ + if (ix<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (ix>>31) + return (x-x)/0.0f; /* log(-#) = NaN */ + /* subnormal number, scale up x */ + k -= 25; + x *= 0x1p25f; + u.f = x; + ix = u.i; + } else if (ix >= 0x7f800000) { + return x; + } else if (ix == 0x3f800000) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + ix += 0x3f800000 - 0x3f3504f3; + k += (int)(ix>>23) - 0x7f; + ix = (ix&0x007fffff) + 0x3f3504f3; + u.i = ix; + x = u.f; + + f = x - 1.0f; + s = f/(2.0f + f); + z = s*s; + w = z*z; + t1= w*(Lg2+w*Lg4); + t2= z*(Lg1+w*Lg3); + R = t2 + t1; + hfsq = 0.5f*f*f; + + hi = f - hfsq; + u.f = hi; + u.i &= 0xfffff000; + hi = u.f; + lo = f - hi - hfsq + s*(hfsq+R); + return (lo+hi)*ivln2lo + lo*ivln2hi + hi*ivln2hi + k; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log2l.c b/lib/mlibc/options/ansi/musl-generic-math/log2l.c new file mode 100644 index 0000000..722b451 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log2l.c @@ -0,0 +1,182 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_log2l.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Base 2 logarithm, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, log2l(); + * + * y = log2l( x ); + * + * + * DESCRIPTION: + * + * Returns the base 2 logarithm of x. + * + * The argument is separated into its exponent and fractional + * parts. If the exponent is between -1 and +1, the (natural) + * logarithm of the fraction is approximated by + * + * log(1+x) = x - 0.5 x**2 + x**3 P(x)/Q(x). + * + * Otherwise, setting z = 2(x-1)/x+1), + * + * log(x) = z + z**3 P(z)/Q(z). + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE 0.5, 2.0 30000 9.8e-20 2.7e-20 + * IEEE exp(+-10000) 70000 5.4e-20 2.3e-20 + * + * In the tests over the interval exp(+-10000), the logarithms + * of the random arguments were uniformly distributed over + * [-10000, +10000]. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double log2l(long double x) +{ + return log2(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* Coefficients for ln(1+x) = x - x**2/2 + x**3 P(x)/Q(x) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.2e-22 + */ +static const long double P[] = { + 4.9962495940332550844739E-1L, + 1.0767376367209449010438E1L, + 7.7671073698359539859595E1L, + 2.5620629828144409632571E2L, + 4.2401812743503691187826E2L, + 3.4258224542413922935104E2L, + 1.0747524399916215149070E2L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0,*/ + 2.3479774160285863271658E1L, + 1.9444210022760132894510E2L, + 7.7952888181207260646090E2L, + 1.6911722418503949084863E3L, + 2.0307734695595183428202E3L, + 1.2695660352705325274404E3L, + 3.2242573199748645407652E2L, +}; + +/* Coefficients for log(x) = z + z^3 P(z^2)/Q(z^2), + * where z = 2(x-1)/(x+1) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.16e-22 + */ +static const long double R[4] = { + 1.9757429581415468984296E-3L, +-7.1990767473014147232598E-1L, + 1.0777257190312272158094E1L, +-3.5717684488096787370998E1L, +}; +static const long double S[4] = { +/* 1.00000000000000000000E0L,*/ +-2.6201045551331104417768E1L, + 1.9361891836232102174846E2L, +-4.2861221385716144629696E2L, +}; +/* log2(e) - 1 */ +#define LOG2EA 4.4269504088896340735992e-1L + +#define SQRTH 0.70710678118654752440L + +long double log2l(long double x) +{ + long double y, z; + int e; + + if (isnan(x)) + return x; + if (x == INFINITY) + return x; + if (x <= 0.0) { + if (x == 0.0) + return -1/(x*x); /* -inf with divbyzero */ + return 0/0.0f; /* nan with invalid */ + } + + /* separate mantissa from exponent */ + /* Note, frexp is used so that denormal numbers + * will be handled properly. + */ + x = frexpl(x, &e); + + /* logarithm using log(x) = z + z**3 P(z)/Q(z), + * where z = 2(x-1)/x+1) + */ + if (e > 2 || e < -2) { + if (x < SQRTH) { /* 2(2x-1)/(2x+1) */ + e -= 1; + z = x - 0.5; + y = 0.5 * z + 0.5; + } else { /* 2 (x-1)/(x+1) */ + z = x - 0.5; + z -= 0.5; + y = 0.5 * x + 0.5; + } + x = z / y; + z = x*x; + y = x * (z * __polevll(z, R, 3) / __p1evll(z, S, 3)); + goto done; + } + + /* logarithm using log(1+x) = x - .5x**2 + x**3 P(x)/Q(x) */ + if (x < SQRTH) { + e -= 1; + x = 2.0*x - 1.0; + } else { + x = x - 1.0; + } + z = x*x; + y = x * (z * __polevll(x, P, 6) / __p1evll(x, Q, 7)); + y = y - 0.5*z; + +done: + /* Multiply log of fraction by log2(e) + * and base 2 exponent by 1 + * + * ***CAUTION*** + * + * This sequence of operations is critical and it may + * be horribly defeated by some compiler optimizers. + */ + z = y * LOG2EA; + z += x * LOG2EA; + z += y; + z += x; + z += e; + return z; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double log2l(long double x) +{ + return log2(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/logb.c b/lib/mlibc/options/ansi/musl-generic-math/logb.c new file mode 100644 index 0000000..7f8bdfa --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/logb.c @@ -0,0 +1,17 @@ +#include <math.h> + +/* +special cases: + logb(+-0) = -inf, and raise divbyzero + logb(+-inf) = +inf + logb(nan) = nan +*/ + +double logb(double x) +{ + if (!isfinite(x)) + return x * x; + if (x == 0) + return -1/(x*x); + return ilogb(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/logbf.c b/lib/mlibc/options/ansi/musl-generic-math/logbf.c new file mode 100644 index 0000000..a0a0b5e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/logbf.c @@ -0,0 +1,10 @@ +#include <math.h> + +float logbf(float x) +{ + if (!isfinite(x)) + return x * x; + if (x == 0) + return -1/(x*x); + return ilogbf(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/logbl.c b/lib/mlibc/options/ansi/musl-generic-math/logbl.c new file mode 100644 index 0000000..962973a --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/logbl.c @@ -0,0 +1,16 @@ +#include <math.h> +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double logbl(long double x) +{ + return logb(x); +} +#else +long double logbl(long double x) +{ + if (!isfinite(x)) + return x * x; + if (x == 0) + return -1/(x*x); + return ilogbl(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/logf.c b/lib/mlibc/options/ansi/musl-generic-math/logf.c new file mode 100644 index 0000000..52230a1 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/logf.c @@ -0,0 +1,69 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_logf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include <math.h> +#include <stdint.h> + +static const float +ln2_hi = 6.9313812256e-01, /* 0x3f317180 */ +ln2_lo = 9.0580006145e-06, /* 0x3717f7d1 */ +/* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ +Lg1 = 0xaaaaaa.0p-24, /* 0.66666662693 */ +Lg2 = 0xccce13.0p-25, /* 0.40000972152 */ +Lg3 = 0x91e9ee.0p-25, /* 0.28498786688 */ +Lg4 = 0xf89e26.0p-26; /* 0.24279078841 */ + +float logf(float x) +{ + union {float f; uint32_t i;} u = {x}; + float_t hfsq,f,s,z,R,w,t1,t2,dk; + uint32_t ix; + int k; + + ix = u.i; + k = 0; + if (ix < 0x00800000 || ix>>31) { /* x < 2**-126 */ + if (ix<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (ix>>31) + return (x-x)/0.0f; /* log(-#) = NaN */ + /* subnormal number, scale up x */ + k -= 25; + x *= 0x1p25f; + u.f = x; + ix = u.i; + } else if (ix >= 0x7f800000) { + return x; + } else if (ix == 0x3f800000) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + ix += 0x3f800000 - 0x3f3504f3; + k += (int)(ix>>23) - 0x7f; + ix = (ix&0x007fffff) + 0x3f3504f3; + u.i = ix; + x = u.f; + + f = x - 1.0f; + s = f/(2.0f + f); + z = s*s; + w = z*z; + t1= w*(Lg2+w*Lg4); + t2= z*(Lg1+w*Lg3); + R = t2 + t1; + hfsq = 0.5f*f*f; + dk = k; + return s*(hfsq+R) + dk*ln2_lo - hfsq + f + dk*ln2_hi; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/logl.c b/lib/mlibc/options/ansi/musl-generic-math/logl.c new file mode 100644 index 0000000..5d53659 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/logl.c @@ -0,0 +1,175 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_logl.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Natural logarithm, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, logl(); + * + * y = logl( x ); + * + * + * DESCRIPTION: + * + * Returns the base e (2.718...) logarithm of x. + * + * The argument is separated into its exponent and fractional + * parts. If the exponent is between -1 and +1, the logarithm + * of the fraction is approximated by + * + * log(1+x) = x - 0.5 x**2 + x**3 P(x)/Q(x). + * + * Otherwise, setting z = 2(x-1)/(x+1), + * + * log(x) = log(1+z/2) - log(1-z/2) = z + z**3 P(z)/Q(z). + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE 0.5, 2.0 150000 8.71e-20 2.75e-20 + * IEEE exp(+-10000) 100000 5.39e-20 2.34e-20 + * + * In the tests over the interval exp(+-10000), the logarithms + * of the random arguments were uniformly distributed over + * [-10000, +10000]. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double logl(long double x) +{ + return log(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* Coefficients for log(1+x) = x - x**2/2 + x**3 P(x)/Q(x) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 2.32e-20 + */ +static const long double P[] = { + 4.5270000862445199635215E-5L, + 4.9854102823193375972212E-1L, + 6.5787325942061044846969E0L, + 2.9911919328553073277375E1L, + 6.0949667980987787057556E1L, + 5.7112963590585538103336E1L, + 2.0039553499201281259648E1L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0,*/ + 1.5062909083469192043167E1L, + 8.3047565967967209469434E1L, + 2.2176239823732856465394E2L, + 3.0909872225312059774938E2L, + 2.1642788614495947685003E2L, + 6.0118660497603843919306E1L, +}; + +/* Coefficients for log(x) = z + z^3 P(z^2)/Q(z^2), + * where z = 2(x-1)/(x+1) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.16e-22 + */ +static const long double R[4] = { + 1.9757429581415468984296E-3L, +-7.1990767473014147232598E-1L, + 1.0777257190312272158094E1L, +-3.5717684488096787370998E1L, +}; +static const long double S[4] = { +/* 1.00000000000000000000E0L,*/ +-2.6201045551331104417768E1L, + 1.9361891836232102174846E2L, +-4.2861221385716144629696E2L, +}; +static const long double C1 = 6.9314575195312500000000E-1L; +static const long double C2 = 1.4286068203094172321215E-6L; + +#define SQRTH 0.70710678118654752440L + +long double logl(long double x) +{ + long double y, z; + int e; + + if (isnan(x)) + return x; + if (x == INFINITY) + return x; + if (x <= 0.0) { + if (x == 0.0) + return -1/(x*x); /* -inf with divbyzero */ + return 0/0.0f; /* nan with invalid */ + } + + /* separate mantissa from exponent */ + /* Note, frexp is used so that denormal numbers + * will be handled properly. + */ + x = frexpl(x, &e); + + /* logarithm using log(x) = z + z**3 P(z)/Q(z), + * where z = 2(x-1)/(x+1) + */ + if (e > 2 || e < -2) { + if (x < SQRTH) { /* 2(2x-1)/(2x+1) */ + e -= 1; + z = x - 0.5; + y = 0.5 * z + 0.5; + } else { /* 2 (x-1)/(x+1) */ + z = x - 0.5; + z -= 0.5; + y = 0.5 * x + 0.5; + } + x = z / y; + z = x*x; + z = x * (z * __polevll(z, R, 3) / __p1evll(z, S, 3)); + z = z + e * C2; + z = z + x; + z = z + e * C1; + return z; + } + + /* logarithm using log(1+x) = x - .5x**2 + x**3 P(x)/Q(x) */ + if (x < SQRTH) { + e -= 1; + x = 2.0*x - 1.0; + } else { + x = x - 1.0; + } + z = x*x; + y = x * (z * __polevll(x, P, 6) / __p1evll(x, Q, 6)); + y = y + e * C2; + z = y - 0.5*z; + /* Note, the sum of above terms does not exceed x/4, + * so it contributes at most about 1/4 lsb to the error. + */ + z = z + x; + z = z + e * C1; /* This sum has an error of 1/2 lsb. */ + return z; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double logl(long double x) +{ + return log(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/lrint.c b/lib/mlibc/options/ansi/musl-generic-math/lrint.c new file mode 100644 index 0000000..bdca8b7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lrint.c @@ -0,0 +1,46 @@ +#include <limits.h> +#include <fenv.h> +#include "libm.h" + +/* +If the result cannot be represented (overflow, nan), then +lrint raises the invalid exception. + +Otherwise if the input was not an integer then the inexact +exception is raised. + +C99 is a bit vague about whether inexact exception is +allowed to be raised when invalid is raised. +(F.9 explicitly allows spurious inexact exceptions, F.9.6.5 +does not make it clear if that rule applies to lrint, but +IEEE 754r 7.8 seems to forbid spurious inexact exception in +the ineger conversion functions) + +So we try to make sure that no spurious inexact exception is +raised in case of an overflow. + +If the bit size of long > precision of double, then there +cannot be inexact rounding in case the result overflows, +otherwise LONG_MAX and LONG_MIN can be represented exactly +as a double. +*/ + +#if LONG_MAX < 1U<<53 && defined(FE_INEXACT) +long lrint(double x) +{ + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); + x = rint(x); + if (!e && (x > LONG_MAX || x < LONG_MIN)) + feclearexcept(FE_INEXACT); + /* conversion */ + return x; +} +#else +long lrint(double x) +{ + return rint(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/lrintf.c b/lib/mlibc/options/ansi/musl-generic-math/lrintf.c new file mode 100644 index 0000000..ca0b6a4 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lrintf.c @@ -0,0 +1,8 @@ +#include <math.h> + +/* uses LONG_MAX > 2^24, see comments in lrint.c */ + +long lrintf(float x) +{ + return rintf(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/lrintl.c b/lib/mlibc/options/ansi/musl-generic-math/lrintl.c new file mode 100644 index 0000000..b2a8106 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lrintl.c @@ -0,0 +1,36 @@ +#include <limits.h> +#include <fenv.h> +#include "libm.h" + + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long lrintl(long double x) +{ + return lrint(x); +} +#elif defined(FE_INEXACT) +/* +see comments in lrint.c + +Note that if LONG_MAX == 0x7fffffffffffffff && LDBL_MANT_DIG == 64 +then x == 2**63 - 0.5 is the only input that overflows and +raises inexact (with tonearest or upward rounding mode) +*/ +long lrintl(long double x) +{ + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); + x = rintl(x); + if (!e && (x > LONG_MAX || x < LONG_MIN)) + feclearexcept(FE_INEXACT); + /* conversion */ + return x; +} +#else +long lrintl(long double x) +{ + return rintl(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/lround.c b/lib/mlibc/options/ansi/musl-generic-math/lround.c new file mode 100644 index 0000000..b8b7954 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lround.c @@ -0,0 +1,6 @@ +#include <math.h> + +long lround(double x) +{ + return round(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/lroundf.c b/lib/mlibc/options/ansi/musl-generic-math/lroundf.c new file mode 100644 index 0000000..c4707e7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lroundf.c @@ -0,0 +1,6 @@ +#include <math.h> + +long lroundf(float x) +{ + return roundf(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/lroundl.c b/lib/mlibc/options/ansi/musl-generic-math/lroundl.c new file mode 100644 index 0000000..094fdf6 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lroundl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long lroundl(long double x) +{ + return roundl(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/modf.c b/lib/mlibc/options/ansi/musl-generic-math/modf.c new file mode 100644 index 0000000..1c8a1db --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/modf.c @@ -0,0 +1,34 @@ +#include "libm.h" + +double modf(double x, double *iptr) +{ + union {double f; uint64_t i;} u = {x}; + uint64_t mask; + int e = (int)(u.i>>52 & 0x7ff) - 0x3ff; + + /* no fractional part */ + if (e >= 52) { + *iptr = x; + if (e == 0x400 && u.i<<12 != 0) /* nan */ + return x; + u.i &= 1ULL<<63; + return u.f; + } + + /* no integral part*/ + if (e < 0) { + u.i &= 1ULL<<63; + *iptr = u.f; + return x; + } + + mask = -1ULL>>12>>e; + if ((u.i & mask) == 0) { + *iptr = x; + u.i &= 1ULL<<63; + return u.f; + } + u.i &= ~mask; + *iptr = u.f; + return x - u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/modff.c b/lib/mlibc/options/ansi/musl-generic-math/modff.c new file mode 100644 index 0000000..639514e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/modff.c @@ -0,0 +1,34 @@ +#include "libm.h" + +float modff(float x, float *iptr) +{ + union {float f; uint32_t i;} u = {x}; + uint32_t mask; + int e = (int)(u.i>>23 & 0xff) - 0x7f; + + /* no fractional part */ + if (e >= 23) { + *iptr = x; + if (e == 0x80 && u.i<<9 != 0) { /* nan */ + return x; + } + u.i &= 0x80000000; + return u.f; + } + /* no integral part */ + if (e < 0) { + u.i &= 0x80000000; + *iptr = u.f; + return x; + } + + mask = 0x007fffff>>e; + if ((u.i & mask) == 0) { + *iptr = x; + u.i &= 0x80000000; + return u.f; + } + u.i &= ~mask; + *iptr = u.f; + return x - u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/modfl.c b/lib/mlibc/options/ansi/musl-generic-math/modfl.c new file mode 100644 index 0000000..a47b192 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/modfl.c @@ -0,0 +1,53 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double modfl(long double x, long double *iptr) +{ + double d; + long double r; + + r = modf(x, &d); + *iptr = d; + return r; +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double modfl(long double x, long double *iptr) +{ + union ldshape u = {x}; + int e = (u.i.se & 0x7fff) - 0x3fff; + int s = u.i.se >> 15; + long double absx; + long double y; + + /* no fractional part */ + if (e >= LDBL_MANT_DIG-1) { + *iptr = x; + if (isnan(x)) + return x; + return s ? -0.0 : 0.0; + } + + /* no integral part*/ + if (e < 0) { + *iptr = s ? -0.0 : 0.0; + return x; + } + + /* raises spurious inexact */ + absx = s ? -x : x; + y = absx + toint - toint - absx; + if (y == 0) { + *iptr = x; + return s ? -0.0 : 0.0; + } + if (y > 0) + y -= 1; + if (s) + y = -y; + *iptr = x + y; + return -y; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/nan.c b/lib/mlibc/options/ansi/musl-generic-math/nan.c new file mode 100644 index 0000000..9e0826c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nan.c @@ -0,0 +1,6 @@ +#include <math.h> + +double nan(const char *s) +{ + return NAN; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nanf.c b/lib/mlibc/options/ansi/musl-generic-math/nanf.c new file mode 100644 index 0000000..752ce54 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nanf.c @@ -0,0 +1,6 @@ +#include <math.h> + +float nanf(const char *s) +{ + return NAN; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nanl.c b/lib/mlibc/options/ansi/musl-generic-math/nanl.c new file mode 100644 index 0000000..969af56 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nanl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long double nanl(const char *s) +{ + return NAN; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nearbyint.c b/lib/mlibc/options/ansi/musl-generic-math/nearbyint.c new file mode 100644 index 0000000..f4e8aac --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nearbyint.c @@ -0,0 +1,20 @@ +#include <fenv.h> +#include <math.h> + +/* nearbyint is the same as rint, but it must not raise the inexact exception */ + +double nearbyint(double x) +{ +#ifdef FE_INEXACT + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); +#endif + x = rint(x); +#ifdef FE_INEXACT + if (!e) + feclearexcept(FE_INEXACT); +#endif + return x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nearbyintf.c b/lib/mlibc/options/ansi/musl-generic-math/nearbyintf.c new file mode 100644 index 0000000..092e9ff --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nearbyintf.c @@ -0,0 +1,18 @@ +#include <fenv.h> +#include <math.h> + +float nearbyintf(float x) +{ +#ifdef FE_INEXACT + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); +#endif + x = rintf(x); +#ifdef FE_INEXACT + if (!e) + feclearexcept(FE_INEXACT); +#endif + return x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nearbyintl.c b/lib/mlibc/options/ansi/musl-generic-math/nearbyintl.c new file mode 100644 index 0000000..8285249 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nearbyintl.c @@ -0,0 +1,26 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double nearbyintl(long double x) +{ + return nearbyint(x); +} +#else +#include <fenv.h> +long double nearbyintl(long double x) +{ +#ifdef FE_INEXACT + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); +#endif + x = rintl(x); +#ifdef FE_INEXACT + if (!e) + feclearexcept(FE_INEXACT); +#endif + return x; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/nextafter.c b/lib/mlibc/options/ansi/musl-generic-math/nextafter.c new file mode 100644 index 0000000..ab5795a --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nextafter.c @@ -0,0 +1,31 @@ +#include "libm.h" + +double nextafter(double x, double y) +{ + union {double f; uint64_t i;} ux={x}, uy={y}; + uint64_t ax, ay; + int e; + + if (isnan(x) || isnan(y)) + return x + y; + if (ux.i == uy.i) + return y; + ax = ux.i & -1ULL/2; + ay = uy.i & -1ULL/2; + if (ax == 0) { + if (ay == 0) + return y; + ux.i = (uy.i & 1ULL<<63) | 1; + } else if (ax > ay || ((ux.i ^ uy.i) & 1ULL<<63)) + ux.i--; + else + ux.i++; + e = ux.i >> 52 & 0x7ff; + /* raise overflow if ux.f is infinite and x is finite */ + if (e == 0x7ff) + FORCE_EVAL(x+x); + /* raise underflow if ux.f is subnormal or zero */ + if (e == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nextafterf.c b/lib/mlibc/options/ansi/musl-generic-math/nextafterf.c new file mode 100644 index 0000000..75a09f7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nextafterf.c @@ -0,0 +1,30 @@ +#include "libm.h" + +float nextafterf(float x, float y) +{ + union {float f; uint32_t i;} ux={x}, uy={y}; + uint32_t ax, ay, e; + + if (isnan(x) || isnan(y)) + return x + y; + if (ux.i == uy.i) + return y; + ax = ux.i & 0x7fffffff; + ay = uy.i & 0x7fffffff; + if (ax == 0) { + if (ay == 0) + return y; + ux.i = (uy.i & 0x80000000) | 1; + } else if (ax > ay || ((ux.i ^ uy.i) & 0x80000000)) + ux.i--; + else + ux.i++; + e = ux.i & 0x7f800000; + /* raise overflow if ux.f is infinite and x is finite */ + if (e == 0x7f800000) + FORCE_EVAL(x+x); + /* raise underflow if ux.f is subnormal or zero */ + if (e == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nextafterl.c b/lib/mlibc/options/ansi/musl-generic-math/nextafterl.c new file mode 100644 index 0000000..37e858f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nextafterl.c @@ -0,0 +1,75 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double nextafterl(long double x, long double y) +{ + return nextafter(x, y); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +long double nextafterl(long double x, long double y) +{ + union ldshape ux, uy; + + if (isnan(x) || isnan(y)) + return x + y; + if (x == y) + return y; + ux.f = x; + if (x == 0) { + uy.f = y; + ux.i.m = 1; + ux.i.se = uy.i.se & 0x8000; + } else if ((x < y) == !(ux.i.se & 0x8000)) { + ux.i.m++; + if (ux.i.m << 1 == 0) { + ux.i.m = 1ULL << 63; + ux.i.se++; + } + } else { + if (ux.i.m << 1 == 0) { + ux.i.se--; + if (ux.i.se) + ux.i.m = 0; + } + ux.i.m--; + } + /* raise overflow if ux is infinite and x is finite */ + if ((ux.i.se & 0x7fff) == 0x7fff) + return x + x; + /* raise underflow if ux is subnormal or zero */ + if ((ux.i.se & 0x7fff) == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +long double nextafterl(long double x, long double y) +{ + union ldshape ux, uy; + + if (isnan(x) || isnan(y)) + return x + y; + if (x == y) + return y; + ux.f = x; + if (x == 0) { + uy.f = y; + ux.i.lo = 1; + ux.i.se = uy.i.se & 0x8000; + } else if ((x < y) == !(ux.i.se & 0x8000)) { + ux.i2.lo++; + if (ux.i2.lo == 0) + ux.i2.hi++; + } else { + if (ux.i2.lo == 0) + ux.i2.hi--; + ux.i2.lo--; + } + /* raise overflow if ux is infinite and x is finite */ + if ((ux.i.se & 0x7fff) == 0x7fff) + return x + x; + /* raise underflow if ux is subnormal or zero */ + if ((ux.i.se & 0x7fff) == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/nexttoward.c b/lib/mlibc/options/ansi/musl-generic-math/nexttoward.c new file mode 100644 index 0000000..827ee5c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nexttoward.c @@ -0,0 +1,42 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +double nexttoward(double x, long double y) +{ + return nextafter(x, y); +} +#else +double nexttoward(double x, long double y) +{ + union {double f; uint64_t i;} ux = {x}; + int e; + + if (isnan(x) || isnan(y)) + return x + y; + if (x == y) + return y; + if (x == 0) { + ux.i = 1; + if (signbit(y)) + ux.i |= 1ULL<<63; + } else if (x < y) { + if (signbit(x)) + ux.i--; + else + ux.i++; + } else { + if (signbit(x)) + ux.i++; + else + ux.i--; + } + e = ux.i>>52 & 0x7ff; + /* raise overflow if ux.f is infinite and x is finite */ + if (e == 0x7ff) + FORCE_EVAL(x+x); + /* raise underflow if ux.f is subnormal or zero */ + if (e == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/nexttowardf.c b/lib/mlibc/options/ansi/musl-generic-math/nexttowardf.c new file mode 100644 index 0000000..bbf172f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nexttowardf.c @@ -0,0 +1,35 @@ +#include "libm.h" + +float nexttowardf(float x, long double y) +{ + union {float f; uint32_t i;} ux = {x}; + uint32_t e; + + if (isnan(x) || isnan(y)) + return x + y; + if (x == y) + return y; + if (x == 0) { + ux.i = 1; + if (signbit(y)) + ux.i |= 0x80000000; + } else if (x < y) { + if (signbit(x)) + ux.i--; + else + ux.i++; + } else { + if (signbit(x)) + ux.i++; + else + ux.i--; + } + e = ux.i & 0x7f800000; + /* raise overflow if ux.f is infinite and x is finite */ + if (e == 0x7f800000) + FORCE_EVAL(x+x); + /* raise underflow if ux.f is subnormal or zero */ + if (e == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nexttowardl.c b/lib/mlibc/options/ansi/musl-generic-math/nexttowardl.c new file mode 100644 index 0000000..67a6340 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nexttowardl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long double nexttowardl(long double x, long double y) +{ + return nextafterl(x, y); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/pow.c b/lib/mlibc/options/ansi/musl-generic-math/pow.c new file mode 100644 index 0000000..3ddc1b6 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/pow.c @@ -0,0 +1,328 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_pow.c */ +/* + * ==================================================== + * Copyright (C) 2004 by Sun Microsystems, Inc. All rights reserved. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* pow(x,y) return x**y + * + * n + * Method: Let x = 2 * (1+f) + * 1. Compute and return log2(x) in two pieces: + * log2(x) = w1 + w2, + * where w1 has 53-24 = 29 bit trailing zeros. + * 2. Perform y*log2(x) = n+y' by simulating muti-precision + * arithmetic, where |y'|<=0.5. + * 3. Return x**y = 2**n*exp(y'*log2) + * + * Special cases: + * 1. (anything) ** 0 is 1 + * 2. 1 ** (anything) is 1 + * 3. (anything except 1) ** NAN is NAN + * 4. NAN ** (anything except 0) is NAN + * 5. +-(|x| > 1) ** +INF is +INF + * 6. +-(|x| > 1) ** -INF is +0 + * 7. +-(|x| < 1) ** +INF is +0 + * 8. +-(|x| < 1) ** -INF is +INF + * 9. -1 ** +-INF is 1 + * 10. +0 ** (+anything except 0, NAN) is +0 + * 11. -0 ** (+anything except 0, NAN, odd integer) is +0 + * 12. +0 ** (-anything except 0, NAN) is +INF, raise divbyzero + * 13. -0 ** (-anything except 0, NAN, odd integer) is +INF, raise divbyzero + * 14. -0 ** (+odd integer) is -0 + * 15. -0 ** (-odd integer) is -INF, raise divbyzero + * 16. +INF ** (+anything except 0,NAN) is +INF + * 17. +INF ** (-anything except 0,NAN) is +0 + * 18. -INF ** (+odd integer) is -INF + * 19. -INF ** (anything) = -0 ** (-anything), (anything except odd integer) + * 20. (anything) ** 1 is (anything) + * 21. (anything) ** -1 is 1/(anything) + * 22. (-anything) ** (integer) is (-1)**(integer)*(+anything**integer) + * 23. (-anything except 0 and inf) ** (non-integer) is NAN + * + * Accuracy: + * pow(x,y) returns x**y nearly rounded. In particular + * pow(integer,integer) + * always returns the correct integer provided it is + * representable. + * + * Constants : + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "libm.h" + +static const double +bp[] = {1.0, 1.5,}, +dp_h[] = { 0.0, 5.84962487220764160156e-01,}, /* 0x3FE2B803, 0x40000000 */ +dp_l[] = { 0.0, 1.35003920212974897128e-08,}, /* 0x3E4CFDEB, 0x43CFD006 */ +two53 = 9007199254740992.0, /* 0x43400000, 0x00000000 */ +huge = 1.0e300, +tiny = 1.0e-300, +/* poly coefs for (3/2)*(log(x)-2s-2/3*s**3 */ +L1 = 5.99999999999994648725e-01, /* 0x3FE33333, 0x33333303 */ +L2 = 4.28571428578550184252e-01, /* 0x3FDB6DB6, 0xDB6FABFF */ +L3 = 3.33333329818377432918e-01, /* 0x3FD55555, 0x518F264D */ +L4 = 2.72728123808534006489e-01, /* 0x3FD17460, 0xA91D4101 */ +L5 = 2.30660745775561754067e-01, /* 0x3FCD864A, 0x93C9DB65 */ +L6 = 2.06975017800338417784e-01, /* 0x3FCA7E28, 0x4A454EEF */ +P1 = 1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */ +P2 = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */ +P3 = 6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */ +P4 = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */ +P5 = 4.13813679705723846039e-08, /* 0x3E663769, 0x72BEA4D0 */ +lg2 = 6.93147180559945286227e-01, /* 0x3FE62E42, 0xFEFA39EF */ +lg2_h = 6.93147182464599609375e-01, /* 0x3FE62E43, 0x00000000 */ +lg2_l = -1.90465429995776804525e-09, /* 0xBE205C61, 0x0CA86C39 */ +ovt = 8.0085662595372944372e-017, /* -(1024-log2(ovfl+.5ulp)) */ +cp = 9.61796693925975554329e-01, /* 0x3FEEC709, 0xDC3A03FD =2/(3ln2) */ +cp_h = 9.61796700954437255859e-01, /* 0x3FEEC709, 0xE0000000 =(float)cp */ +cp_l = -7.02846165095275826516e-09, /* 0xBE3E2FE0, 0x145B01F5 =tail of cp_h*/ +ivln2 = 1.44269504088896338700e+00, /* 0x3FF71547, 0x652B82FE =1/ln2 */ +ivln2_h = 1.44269502162933349609e+00, /* 0x3FF71547, 0x60000000 =24b 1/ln2*/ +ivln2_l = 1.92596299112661746887e-08; /* 0x3E54AE0B, 0xF85DDF44 =1/ln2 tail*/ + +double pow(double x, double y) +{ + double z,ax,z_h,z_l,p_h,p_l; + double y1,t1,t2,r,s,t,u,v,w; + int32_t i,j,k,yisint,n; + int32_t hx,hy,ix,iy; + uint32_t lx,ly; + + EXTRACT_WORDS(hx, lx, x); + EXTRACT_WORDS(hy, ly, y); + ix = hx & 0x7fffffff; + iy = hy & 0x7fffffff; + + /* x**0 = 1, even if x is NaN */ + if ((iy|ly) == 0) + return 1.0; + /* 1**y = 1, even if y is NaN */ + if (hx == 0x3ff00000 && lx == 0) + return 1.0; + /* NaN if either arg is NaN */ + if (ix > 0x7ff00000 || (ix == 0x7ff00000 && lx != 0) || + iy > 0x7ff00000 || (iy == 0x7ff00000 && ly != 0)) + return x + y; + + /* determine if y is an odd int when x < 0 + * yisint = 0 ... y is not an integer + * yisint = 1 ... y is an odd int + * yisint = 2 ... y is an even int + */ + yisint = 0; + if (hx < 0) { + if (iy >= 0x43400000) + yisint = 2; /* even integer y */ + else if (iy >= 0x3ff00000) { + k = (iy>>20) - 0x3ff; /* exponent */ + if (k > 20) { + uint32_t j = ly>>(52-k); + if ((j<<(52-k)) == ly) + yisint = 2 - (j&1); + } else if (ly == 0) { + uint32_t j = iy>>(20-k); + if ((j<<(20-k)) == iy) + yisint = 2 - (j&1); + } + } + } + + /* special value of y */ + if (ly == 0) { + if (iy == 0x7ff00000) { /* y is +-inf */ + if (((ix-0x3ff00000)|lx) == 0) /* (-1)**+-inf is 1 */ + return 1.0; + else if (ix >= 0x3ff00000) /* (|x|>1)**+-inf = inf,0 */ + return hy >= 0 ? y : 0.0; + else /* (|x|<1)**+-inf = 0,inf */ + return hy >= 0 ? 0.0 : -y; + } + if (iy == 0x3ff00000) { /* y is +-1 */ + if (hy >= 0) + return x; + y = 1/x; +#if FLT_EVAL_METHOD!=0 + { + union {double f; uint64_t i;} u = {y}; + uint64_t i = u.i & -1ULL/2; + if (i>>52 == 0 && (i&(i-1))) + FORCE_EVAL((float)y); + } +#endif + return y; + } + if (hy == 0x40000000) /* y is 2 */ + return x*x; + if (hy == 0x3fe00000) { /* y is 0.5 */ + if (hx >= 0) /* x >= +0 */ + return sqrt(x); + } + } + + ax = fabs(x); + /* special value of x */ + if (lx == 0) { + if (ix == 0x7ff00000 || ix == 0 || ix == 0x3ff00000) { /* x is +-0,+-inf,+-1 */ + z = ax; + if (hy < 0) /* z = (1/|x|) */ + z = 1.0/z; + if (hx < 0) { + if (((ix-0x3ff00000)|yisint) == 0) { + z = (z-z)/(z-z); /* (-1)**non-int is NaN */ + } else if (yisint == 1) + z = -z; /* (x<0)**odd = -(|x|**odd) */ + } + return z; + } + } + + s = 1.0; /* sign of result */ + if (hx < 0) { + if (yisint == 0) /* (x<0)**(non-int) is NaN */ + return (x-x)/(x-x); + if (yisint == 1) /* (x<0)**(odd int) */ + s = -1.0; + } + + /* |y| is huge */ + if (iy > 0x41e00000) { /* if |y| > 2**31 */ + if (iy > 0x43f00000) { /* if |y| > 2**64, must o/uflow */ + if (ix <= 0x3fefffff) + return hy < 0 ? huge*huge : tiny*tiny; + if (ix >= 0x3ff00000) + return hy > 0 ? huge*huge : tiny*tiny; + } + /* over/underflow if x is not close to one */ + if (ix < 0x3fefffff) + return hy < 0 ? s*huge*huge : s*tiny*tiny; + if (ix > 0x3ff00000) + return hy > 0 ? s*huge*huge : s*tiny*tiny; + /* now |1-x| is tiny <= 2**-20, suffice to compute + log(x) by x-x^2/2+x^3/3-x^4/4 */ + t = ax - 1.0; /* t has 20 trailing zeros */ + w = (t*t)*(0.5 - t*(0.3333333333333333333333-t*0.25)); + u = ivln2_h*t; /* ivln2_h has 21 sig. bits */ + v = t*ivln2_l - w*ivln2; + t1 = u + v; + SET_LOW_WORD(t1, 0); + t2 = v - (t1-u); + } else { + double ss,s2,s_h,s_l,t_h,t_l; + n = 0; + /* take care subnormal number */ + if (ix < 0x00100000) { + ax *= two53; + n -= 53; + GET_HIGH_WORD(ix,ax); + } + n += ((ix)>>20) - 0x3ff; + j = ix & 0x000fffff; + /* determine interval */ + ix = j | 0x3ff00000; /* normalize ix */ + if (j <= 0x3988E) /* |x|<sqrt(3/2) */ + k = 0; + else if (j < 0xBB67A) /* |x|<sqrt(3) */ + k = 1; + else { + k = 0; + n += 1; + ix -= 0x00100000; + } + SET_HIGH_WORD(ax, ix); + + /* compute ss = s_h+s_l = (x-1)/(x+1) or (x-1.5)/(x+1.5) */ + u = ax - bp[k]; /* bp[0]=1.0, bp[1]=1.5 */ + v = 1.0/(ax+bp[k]); + ss = u*v; + s_h = ss; + SET_LOW_WORD(s_h, 0); + /* t_h=ax+bp[k] High */ + t_h = 0.0; + SET_HIGH_WORD(t_h, ((ix>>1)|0x20000000) + 0x00080000 + (k<<18)); + t_l = ax - (t_h-bp[k]); + s_l = v*((u-s_h*t_h)-s_h*t_l); + /* compute log(ax) */ + s2 = ss*ss; + r = s2*s2*(L1+s2*(L2+s2*(L3+s2*(L4+s2*(L5+s2*L6))))); + r += s_l*(s_h+ss); + s2 = s_h*s_h; + t_h = 3.0 + s2 + r; + SET_LOW_WORD(t_h, 0); + t_l = r - ((t_h-3.0)-s2); + /* u+v = ss*(1+...) */ + u = s_h*t_h; + v = s_l*t_h + t_l*ss; + /* 2/(3log2)*(ss+...) */ + p_h = u + v; + SET_LOW_WORD(p_h, 0); + p_l = v - (p_h-u); + z_h = cp_h*p_h; /* cp_h+cp_l = 2/(3*log2) */ + z_l = cp_l*p_h+p_l*cp + dp_l[k]; + /* log2(ax) = (ss+..)*2/(3*log2) = n + dp_h + z_h + z_l */ + t = (double)n; + t1 = ((z_h + z_l) + dp_h[k]) + t; + SET_LOW_WORD(t1, 0); + t2 = z_l - (((t1 - t) - dp_h[k]) - z_h); + } + + /* split up y into y1+y2 and compute (y1+y2)*(t1+t2) */ + y1 = y; + SET_LOW_WORD(y1, 0); + p_l = (y-y1)*t1 + y*t2; + p_h = y1*t1; + z = p_l + p_h; + EXTRACT_WORDS(j, i, z); + if (j >= 0x40900000) { /* z >= 1024 */ + if (((j-0x40900000)|i) != 0) /* if z > 1024 */ + return s*huge*huge; /* overflow */ + if (p_l + ovt > z - p_h) + return s*huge*huge; /* overflow */ + } else if ((j&0x7fffffff) >= 0x4090cc00) { /* z <= -1075 */ // FIXME: instead of abs(j) use unsigned j + if (((j-0xc090cc00)|i) != 0) /* z < -1075 */ + return s*tiny*tiny; /* underflow */ + if (p_l <= z - p_h) + return s*tiny*tiny; /* underflow */ + } + /* + * compute 2**(p_h+p_l) + */ + i = j & 0x7fffffff; + k = (i>>20) - 0x3ff; + n = 0; + if (i > 0x3fe00000) { /* if |z| > 0.5, set n = [z+0.5] */ + n = j + (0x00100000>>(k+1)); + k = ((n&0x7fffffff)>>20) - 0x3ff; /* new k for n */ + t = 0.0; + SET_HIGH_WORD(t, n & ~(0x000fffff>>k)); + n = ((n&0x000fffff)|0x00100000)>>(20-k); + if (j < 0) + n = -n; + p_h -= t; + } + t = p_l + p_h; + SET_LOW_WORD(t, 0); + u = t*lg2_h; + v = (p_l-(t-p_h))*lg2 + t*lg2_l; + z = u + v; + w = v - (z-u); + t = z*z; + t1 = z - t*(P1+t*(P2+t*(P3+t*(P4+t*P5)))); + r = (z*t1)/(t1-2.0) - (w + z*w); + z = 1.0 - (r-z); + GET_HIGH_WORD(j, z); + j += n<<20; + if ((j>>20) <= 0) /* subnormal output */ + z = scalbn(z,n); + else + SET_HIGH_WORD(z, j); + return s*z; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/powf.c b/lib/mlibc/options/ansi/musl-generic-math/powf.c new file mode 100644 index 0000000..427c896 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/powf.c @@ -0,0 +1,259 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_powf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +bp[] = {1.0, 1.5,}, +dp_h[] = { 0.0, 5.84960938e-01,}, /* 0x3f15c000 */ +dp_l[] = { 0.0, 1.56322085e-06,}, /* 0x35d1cfdc */ +two24 = 16777216.0, /* 0x4b800000 */ +huge = 1.0e30, +tiny = 1.0e-30, +/* poly coefs for (3/2)*(log(x)-2s-2/3*s**3 */ +L1 = 6.0000002384e-01, /* 0x3f19999a */ +L2 = 4.2857143283e-01, /* 0x3edb6db7 */ +L3 = 3.3333334327e-01, /* 0x3eaaaaab */ +L4 = 2.7272811532e-01, /* 0x3e8ba305 */ +L5 = 2.3066075146e-01, /* 0x3e6c3255 */ +L6 = 2.0697501302e-01, /* 0x3e53f142 */ +P1 = 1.6666667163e-01, /* 0x3e2aaaab */ +P2 = -2.7777778450e-03, /* 0xbb360b61 */ +P3 = 6.6137559770e-05, /* 0x388ab355 */ +P4 = -1.6533901999e-06, /* 0xb5ddea0e */ +P5 = 4.1381369442e-08, /* 0x3331bb4c */ +lg2 = 6.9314718246e-01, /* 0x3f317218 */ +lg2_h = 6.93145752e-01, /* 0x3f317200 */ +lg2_l = 1.42860654e-06, /* 0x35bfbe8c */ +ovt = 4.2995665694e-08, /* -(128-log2(ovfl+.5ulp)) */ +cp = 9.6179670095e-01, /* 0x3f76384f =2/(3ln2) */ +cp_h = 9.6191406250e-01, /* 0x3f764000 =12b cp */ +cp_l = -1.1736857402e-04, /* 0xb8f623c6 =tail of cp_h */ +ivln2 = 1.4426950216e+00, /* 0x3fb8aa3b =1/ln2 */ +ivln2_h = 1.4426879883e+00, /* 0x3fb8aa00 =16b 1/ln2*/ +ivln2_l = 7.0526075433e-06; /* 0x36eca570 =1/ln2 tail*/ + +float powf(float x, float y) +{ + float z,ax,z_h,z_l,p_h,p_l; + float y1,t1,t2,r,s,sn,t,u,v,w; + int32_t i,j,k,yisint,n; + int32_t hx,hy,ix,iy,is; + + GET_FLOAT_WORD(hx, x); + GET_FLOAT_WORD(hy, y); + ix = hx & 0x7fffffff; + iy = hy & 0x7fffffff; + + /* x**0 = 1, even if x is NaN */ + if (iy == 0) + return 1.0f; + /* 1**y = 1, even if y is NaN */ + if (hx == 0x3f800000) + return 1.0f; + /* NaN if either arg is NaN */ + if (ix > 0x7f800000 || iy > 0x7f800000) + return x + y; + + /* determine if y is an odd int when x < 0 + * yisint = 0 ... y is not an integer + * yisint = 1 ... y is an odd int + * yisint = 2 ... y is an even int + */ + yisint = 0; + if (hx < 0) { + if (iy >= 0x4b800000) + yisint = 2; /* even integer y */ + else if (iy >= 0x3f800000) { + k = (iy>>23) - 0x7f; /* exponent */ + j = iy>>(23-k); + if ((j<<(23-k)) == iy) + yisint = 2 - (j & 1); + } + } + + /* special value of y */ + if (iy == 0x7f800000) { /* y is +-inf */ + if (ix == 0x3f800000) /* (-1)**+-inf is 1 */ + return 1.0f; + else if (ix > 0x3f800000) /* (|x|>1)**+-inf = inf,0 */ + return hy >= 0 ? y : 0.0f; + else /* (|x|<1)**+-inf = 0,inf */ + return hy >= 0 ? 0.0f: -y; + } + if (iy == 0x3f800000) /* y is +-1 */ + return hy >= 0 ? x : 1.0f/x; + if (hy == 0x40000000) /* y is 2 */ + return x*x; + if (hy == 0x3f000000) { /* y is 0.5 */ + if (hx >= 0) /* x >= +0 */ + return sqrtf(x); + } + + ax = fabsf(x); + /* special value of x */ + if (ix == 0x7f800000 || ix == 0 || ix == 0x3f800000) { /* x is +-0,+-inf,+-1 */ + z = ax; + if (hy < 0) /* z = (1/|x|) */ + z = 1.0f/z; + if (hx < 0) { + if (((ix-0x3f800000)|yisint) == 0) { + z = (z-z)/(z-z); /* (-1)**non-int is NaN */ + } else if (yisint == 1) + z = -z; /* (x<0)**odd = -(|x|**odd) */ + } + return z; + } + + sn = 1.0f; /* sign of result */ + if (hx < 0) { + if (yisint == 0) /* (x<0)**(non-int) is NaN */ + return (x-x)/(x-x); + if (yisint == 1) /* (x<0)**(odd int) */ + sn = -1.0f; + } + + /* |y| is huge */ + if (iy > 0x4d000000) { /* if |y| > 2**27 */ + /* over/underflow if x is not close to one */ + if (ix < 0x3f7ffff8) + return hy < 0 ? sn*huge*huge : sn*tiny*tiny; + if (ix > 0x3f800007) + return hy > 0 ? sn*huge*huge : sn*tiny*tiny; + /* now |1-x| is tiny <= 2**-20, suffice to compute + log(x) by x-x^2/2+x^3/3-x^4/4 */ + t = ax - 1; /* t has 20 trailing zeros */ + w = (t*t)*(0.5f - t*(0.333333333333f - t*0.25f)); + u = ivln2_h*t; /* ivln2_h has 16 sig. bits */ + v = t*ivln2_l - w*ivln2; + t1 = u + v; + GET_FLOAT_WORD(is, t1); + SET_FLOAT_WORD(t1, is & 0xfffff000); + t2 = v - (t1-u); + } else { + float s2,s_h,s_l,t_h,t_l; + n = 0; + /* take care subnormal number */ + if (ix < 0x00800000) { + ax *= two24; + n -= 24; + GET_FLOAT_WORD(ix, ax); + } + n += ((ix)>>23) - 0x7f; + j = ix & 0x007fffff; + /* determine interval */ + ix = j | 0x3f800000; /* normalize ix */ + if (j <= 0x1cc471) /* |x|<sqrt(3/2) */ + k = 0; + else if (j < 0x5db3d7) /* |x|<sqrt(3) */ + k = 1; + else { + k = 0; + n += 1; + ix -= 0x00800000; + } + SET_FLOAT_WORD(ax, ix); + + /* compute s = s_h+s_l = (x-1)/(x+1) or (x-1.5)/(x+1.5) */ + u = ax - bp[k]; /* bp[0]=1.0, bp[1]=1.5 */ + v = 1.0f/(ax+bp[k]); + s = u*v; + s_h = s; + GET_FLOAT_WORD(is, s_h); + SET_FLOAT_WORD(s_h, is & 0xfffff000); + /* t_h=ax+bp[k] High */ + is = ((ix>>1) & 0xfffff000) | 0x20000000; + SET_FLOAT_WORD(t_h, is + 0x00400000 + (k<<21)); + t_l = ax - (t_h - bp[k]); + s_l = v*((u - s_h*t_h) - s_h*t_l); + /* compute log(ax) */ + s2 = s*s; + r = s2*s2*(L1+s2*(L2+s2*(L3+s2*(L4+s2*(L5+s2*L6))))); + r += s_l*(s_h+s); + s2 = s_h*s_h; + t_h = 3.0f + s2 + r; + GET_FLOAT_WORD(is, t_h); + SET_FLOAT_WORD(t_h, is & 0xfffff000); + t_l = r - ((t_h - 3.0f) - s2); + /* u+v = s*(1+...) */ + u = s_h*t_h; + v = s_l*t_h + t_l*s; + /* 2/(3log2)*(s+...) */ + p_h = u + v; + GET_FLOAT_WORD(is, p_h); + SET_FLOAT_WORD(p_h, is & 0xfffff000); + p_l = v - (p_h - u); + z_h = cp_h*p_h; /* cp_h+cp_l = 2/(3*log2) */ + z_l = cp_l*p_h + p_l*cp+dp_l[k]; + /* log2(ax) = (s+..)*2/(3*log2) = n + dp_h + z_h + z_l */ + t = (float)n; + t1 = (((z_h + z_l) + dp_h[k]) + t); + GET_FLOAT_WORD(is, t1); + SET_FLOAT_WORD(t1, is & 0xfffff000); + t2 = z_l - (((t1 - t) - dp_h[k]) - z_h); + } + + /* split up y into y1+y2 and compute (y1+y2)*(t1+t2) */ + GET_FLOAT_WORD(is, y); + SET_FLOAT_WORD(y1, is & 0xfffff000); + p_l = (y-y1)*t1 + y*t2; + p_h = y1*t1; + z = p_l + p_h; + GET_FLOAT_WORD(j, z); + if (j > 0x43000000) /* if z > 128 */ + return sn*huge*huge; /* overflow */ + else if (j == 0x43000000) { /* if z == 128 */ + if (p_l + ovt > z - p_h) + return sn*huge*huge; /* overflow */ + } else if ((j&0x7fffffff) > 0x43160000) /* z < -150 */ // FIXME: check should be (uint32_t)j > 0xc3160000 + return sn*tiny*tiny; /* underflow */ + else if (j == 0xc3160000) { /* z == -150 */ + if (p_l <= z-p_h) + return sn*tiny*tiny; /* underflow */ + } + /* + * compute 2**(p_h+p_l) + */ + i = j & 0x7fffffff; + k = (i>>23) - 0x7f; + n = 0; + if (i > 0x3f000000) { /* if |z| > 0.5, set n = [z+0.5] */ + n = j + (0x00800000>>(k+1)); + k = ((n&0x7fffffff)>>23) - 0x7f; /* new k for n */ + SET_FLOAT_WORD(t, n & ~(0x007fffff>>k)); + n = ((n&0x007fffff)|0x00800000)>>(23-k); + if (j < 0) + n = -n; + p_h -= t; + } + t = p_l + p_h; + GET_FLOAT_WORD(is, t); + SET_FLOAT_WORD(t, is & 0xffff8000); + u = t*lg2_h; + v = (p_l-(t-p_h))*lg2 + t*lg2_l; + z = u + v; + w = v - (z - u); + t = z*z; + t1 = z - t*(P1+t*(P2+t*(P3+t*(P4+t*P5)))); + r = (z*t1)/(t1-2.0f) - (w+z*w); + z = 1.0f - (r - z); + GET_FLOAT_WORD(j, z); + j += n<<23; + if ((j>>23) <= 0) /* subnormal output */ + z = scalbnf(z, n); + else + SET_FLOAT_WORD(z, j); + return sn*z; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/powl.c b/lib/mlibc/options/ansi/musl-generic-math/powl.c new file mode 100644 index 0000000..5b6da07 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/powl.c @@ -0,0 +1,522 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_powl.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* powl.c + * + * Power function, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, z, powl(); + * + * z = powl( x, y ); + * + * + * DESCRIPTION: + * + * Computes x raised to the yth power. Analytically, + * + * x**y = exp( y log(x) ). + * + * Following Cody and Waite, this program uses a lookup table + * of 2**-i/32 and pseudo extended precision arithmetic to + * obtain several extra bits of accuracy in both the logarithm + * and the exponential. + * + * + * ACCURACY: + * + * The relative error of pow(x,y) can be estimated + * by y dl ln(2), where dl is the absolute error of + * the internally computed base 2 logarithm. At the ends + * of the approximation interval the logarithm equal 1/32 + * and its relative error is about 1 lsb = 1.1e-19. Hence + * the predicted relative error in the result is 2.3e-21 y . + * + * Relative error: + * arithmetic domain # trials peak rms + * + * IEEE +-1000 40000 2.8e-18 3.7e-19 + * .001 < x < 1000, with log(x) uniformly distributed. + * -1000 < y < 1000, y uniformly distributed. + * + * IEEE 0,8700 60000 6.5e-18 1.0e-18 + * 0.99 < x < 1.01, 0 < y < 8700, uniformly distributed. + * + * + * ERROR MESSAGES: + * + * message condition value returned + * pow overflow x**y > MAXNUM INFINITY + * pow underflow x**y < 1/MAXNUM 0.0 + * pow domain x<0 and y noninteger 0.0 + * + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double powl(long double x, long double y) +{ + return pow(x, y); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 + +/* Table size */ +#define NXT 32 + +/* log(1+x) = x - .5x^2 + x^3 * P(z)/Q(z) + * on the domain 2^(-1/32) - 1 <= x <= 2^(1/32) - 1 + */ +static const long double P[] = { + 8.3319510773868690346226E-4L, + 4.9000050881978028599627E-1L, + 1.7500123722550302671919E0L, + 1.4000100839971580279335E0L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0L,*/ + 5.2500282295834889175431E0L, + 8.4000598057587009834666E0L, + 4.2000302519914740834728E0L, +}; +/* A[i] = 2^(-i/32), rounded to IEEE long double precision. + * If i is even, A[i] + B[i/2] gives additional accuracy. + */ +static const long double A[33] = { + 1.0000000000000000000000E0L, + 9.7857206208770013448287E-1L, + 9.5760328069857364691013E-1L, + 9.3708381705514995065011E-1L, + 9.1700404320467123175367E-1L, + 8.9735453750155359320742E-1L, + 8.7812608018664974155474E-1L, + 8.5930964906123895780165E-1L, + 8.4089641525371454301892E-1L, + 8.2287773907698242225554E-1L, + 8.0524516597462715409607E-1L, + 7.8799042255394324325455E-1L, + 7.7110541270397041179298E-1L, + 7.5458221379671136985669E-1L, + 7.3841307296974965571198E-1L, + 7.2259040348852331001267E-1L, + 7.0710678118654752438189E-1L, + 6.9195494098191597746178E-1L, + 6.7712777346844636413344E-1L, + 6.6261832157987064729696E-1L, + 6.4841977732550483296079E-1L, + 6.3452547859586661129850E-1L, + 6.2092890603674202431705E-1L, + 6.0762367999023443907803E-1L, + 5.9460355750136053334378E-1L, + 5.8186242938878875689693E-1L, + 5.6939431737834582684856E-1L, + 5.5719337129794626814472E-1L, + 5.4525386633262882960438E-1L, + 5.3357020033841180906486E-1L, + 5.2213689121370692017331E-1L, + 5.1094857432705833910408E-1L, + 5.0000000000000000000000E-1L, +}; +static const long double B[17] = { + 0.0000000000000000000000E0L, + 2.6176170809902549338711E-20L, +-1.0126791927256478897086E-20L, + 1.3438228172316276937655E-21L, + 1.2207982955417546912101E-20L, +-6.3084814358060867200133E-21L, + 1.3164426894366316434230E-20L, +-1.8527916071632873716786E-20L, + 1.8950325588932570796551E-20L, + 1.5564775779538780478155E-20L, + 6.0859793637556860974380E-21L, +-2.0208749253662532228949E-20L, + 1.4966292219224761844552E-20L, + 3.3540909728056476875639E-21L, +-8.6987564101742849540743E-22L, +-1.2327176863327626135542E-20L, + 0.0000000000000000000000E0L, +}; + +/* 2^x = 1 + x P(x), + * on the interval -1/32 <= x <= 0 + */ +static const long double R[] = { + 1.5089970579127659901157E-5L, + 1.5402715328927013076125E-4L, + 1.3333556028915671091390E-3L, + 9.6181291046036762031786E-3L, + 5.5504108664798463044015E-2L, + 2.4022650695910062854352E-1L, + 6.9314718055994530931447E-1L, +}; + +#define MEXP (NXT*16384.0L) +/* The following if denormal numbers are supported, else -MEXP: */ +#define MNEXP (-NXT*(16384.0L+64.0L)) +/* log2(e) - 1 */ +#define LOG2EA 0.44269504088896340735992L + +#define F W +#define Fa Wa +#define Fb Wb +#define G W +#define Ga Wa +#define Gb u +#define H W +#define Ha Wb +#define Hb Wb + +static const long double MAXLOGL = 1.1356523406294143949492E4L; +static const long double MINLOGL = -1.13994985314888605586758E4L; +static const long double LOGE2L = 6.9314718055994530941723E-1L; +static const long double huge = 0x1p10000L; +/* XXX Prevent gcc from erroneously constant folding this. */ +static const volatile long double twom10000 = 0x1p-10000L; + +static long double reducl(long double); +static long double powil(long double, int); + +long double powl(long double x, long double y) +{ + /* double F, Fa, Fb, G, Ga, Gb, H, Ha, Hb */ + int i, nflg, iyflg, yoddint; + long e; + volatile long double z=0; + long double w=0, W=0, Wa=0, Wb=0, ya=0, yb=0, u=0; + + /* make sure no invalid exception is raised by nan comparision */ + if (isnan(x)) { + if (!isnan(y) && y == 0.0) + return 1.0; + return x; + } + if (isnan(y)) { + if (x == 1.0) + return 1.0; + return y; + } + if (x == 1.0) + return 1.0; /* 1**y = 1, even if y is nan */ + if (x == -1.0 && !isfinite(y)) + return 1.0; /* -1**inf = 1 */ + if (y == 0.0) + return 1.0; /* x**0 = 1, even if x is nan */ + if (y == 1.0) + return x; + if (y >= LDBL_MAX) { + if (x > 1.0 || x < -1.0) + return INFINITY; + if (x != 0.0) + return 0.0; + } + if (y <= -LDBL_MAX) { + if (x > 1.0 || x < -1.0) + return 0.0; + if (x != 0.0 || y == -INFINITY) + return INFINITY; + } + if (x >= LDBL_MAX) { + if (y > 0.0) + return INFINITY; + return 0.0; + } + + w = floorl(y); + + /* Set iyflg to 1 if y is an integer. */ + iyflg = 0; + if (w == y) + iyflg = 1; + + /* Test for odd integer y. */ + yoddint = 0; + if (iyflg) { + ya = fabsl(y); + ya = floorl(0.5 * ya); + yb = 0.5 * fabsl(w); + if( ya != yb ) + yoddint = 1; + } + + if (x <= -LDBL_MAX) { + if (y > 0.0) { + if (yoddint) + return -INFINITY; + return INFINITY; + } + if (y < 0.0) { + if (yoddint) + return -0.0; + return 0.0; + } + } + nflg = 0; /* (x<0)**(odd int) */ + if (x <= 0.0) { + if (x == 0.0) { + if (y < 0.0) { + if (signbit(x) && yoddint) + /* (-0.0)**(-odd int) = -inf, divbyzero */ + return -1.0/0.0; + /* (+-0.0)**(negative) = inf, divbyzero */ + return 1.0/0.0; + } + if (signbit(x) && yoddint) + return -0.0; + return 0.0; + } + if (iyflg == 0) + return (x - x) / (x - x); /* (x<0)**(non-int) is NaN */ + /* (x<0)**(integer) */ + if (yoddint) + nflg = 1; /* negate result */ + x = -x; + } + /* (+integer)**(integer) */ + if (iyflg && floorl(x) == x && fabsl(y) < 32768.0) { + w = powil(x, (int)y); + return nflg ? -w : w; + } + + /* separate significand from exponent */ + x = frexpl(x, &i); + e = i; + + /* find significand in antilog table A[] */ + i = 1; + if (x <= A[17]) + i = 17; + if (x <= A[i+8]) + i += 8; + if (x <= A[i+4]) + i += 4; + if (x <= A[i+2]) + i += 2; + if (x >= A[1]) + i = -1; + i += 1; + + /* Find (x - A[i])/A[i] + * in order to compute log(x/A[i]): + * + * log(x) = log( a x/a ) = log(a) + log(x/a) + * + * log(x/a) = log(1+v), v = x/a - 1 = (x-a)/a + */ + x -= A[i]; + x -= B[i/2]; + x /= A[i]; + + /* rational approximation for log(1+v): + * + * log(1+v) = v - v**2/2 + v**3 P(v) / Q(v) + */ + z = x*x; + w = x * (z * __polevll(x, P, 3) / __p1evll(x, Q, 3)); + w = w - 0.5*z; + + /* Convert to base 2 logarithm: + * multiply by log2(e) = 1 + LOG2EA + */ + z = LOG2EA * w; + z += w; + z += LOG2EA * x; + z += x; + + /* Compute exponent term of the base 2 logarithm. */ + w = -i; + w /= NXT; + w += e; + /* Now base 2 log of x is w + z. */ + + /* Multiply base 2 log by y, in extended precision. */ + + /* separate y into large part ya + * and small part yb less than 1/NXT + */ + ya = reducl(y); + yb = y - ya; + + /* (w+z)(ya+yb) + * = w*ya + w*yb + z*y + */ + F = z * y + w * yb; + Fa = reducl(F); + Fb = F - Fa; + + G = Fa + w * ya; + Ga = reducl(G); + Gb = G - Ga; + + H = Fb + Gb; + Ha = reducl(H); + w = (Ga + Ha) * NXT; + + /* Test the power of 2 for overflow */ + if (w > MEXP) + return huge * huge; /* overflow */ + if (w < MNEXP) + return twom10000 * twom10000; /* underflow */ + + e = w; + Hb = H - Ha; + + if (Hb > 0.0) { + e += 1; + Hb -= 1.0/NXT; /*0.0625L;*/ + } + + /* Now the product y * log2(x) = Hb + e/NXT. + * + * Compute base 2 exponential of Hb, + * where -0.0625 <= Hb <= 0. + */ + z = Hb * __polevll(Hb, R, 6); /* z = 2**Hb - 1 */ + + /* Express e/NXT as an integer plus a negative number of (1/NXT)ths. + * Find lookup table entry for the fractional power of 2. + */ + if (e < 0) + i = 0; + else + i = 1; + i = e/NXT + i; + e = NXT*i - e; + w = A[e]; + z = w * z; /* 2**-e * ( 1 + (2**Hb-1) ) */ + z = z + w; + z = scalbnl(z, i); /* multiply by integer power of 2 */ + + if (nflg) + z = -z; + return z; +} + + +/* Find a multiple of 1/NXT that is within 1/NXT of x. */ +static long double reducl(long double x) +{ + long double t; + + t = x * NXT; + t = floorl(t); + t = t / NXT; + return t; +} + +/* + * Positive real raised to integer power, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, powil(); + * int n; + * + * y = powil( x, n ); + * + * + * DESCRIPTION: + * + * Returns argument x>0 raised to the nth power. + * The routine efficiently decomposes n as a sum of powers of + * two. The desired power is a product of two-to-the-kth + * powers of x. Thus to compute the 32767 power of x requires + * 28 multiplications instead of 32767 multiplications. + * + * + * ACCURACY: + * + * Relative error: + * arithmetic x domain n domain # trials peak rms + * IEEE .001,1000 -1022,1023 50000 4.3e-17 7.8e-18 + * IEEE 1,2 -1022,1023 20000 3.9e-17 7.6e-18 + * IEEE .99,1.01 0,8700 10000 3.6e-16 7.2e-17 + * + * Returns MAXNUM on overflow, zero on underflow. + */ + +static long double powil(long double x, int nn) +{ + long double ww, y; + long double s; + int n, e, sign, lx; + + if (nn == 0) + return 1.0; + + if (nn < 0) { + sign = -1; + n = -nn; + } else { + sign = 1; + n = nn; + } + + /* Overflow detection */ + + /* Calculate approximate logarithm of answer */ + s = x; + s = frexpl( s, &lx); + e = (lx - 1)*n; + if ((e == 0) || (e > 64) || (e < -64)) { + s = (s - 7.0710678118654752e-1L) / (s + 7.0710678118654752e-1L); + s = (2.9142135623730950L * s - 0.5 + lx) * nn * LOGE2L; + } else { + s = LOGE2L * e; + } + + if (s > MAXLOGL) + return huge * huge; /* overflow */ + + if (s < MINLOGL) + return twom10000 * twom10000; /* underflow */ + /* Handle tiny denormal answer, but with less accuracy + * since roundoff error in 1.0/x will be amplified. + * The precise demarcation should be the gradual underflow threshold. + */ + if (s < -MAXLOGL+2.0) { + x = 1.0/x; + sign = -sign; + } + + /* First bit of the power */ + if (n & 1) + y = x; + else + y = 1.0; + + ww = x; + n >>= 1; + while (n) { + ww = ww * ww; /* arg to the 2-to-the-kth power */ + if (n & 1) /* if that bit is set, then include in product */ + y *= ww; + n >>= 1; + } + + if (sign < 0) + y = 1.0/y; + return y; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double powl(long double x, long double y) +{ + return pow(x, y); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/remainder.c b/lib/mlibc/options/ansi/musl-generic-math/remainder.c new file mode 100644 index 0000000..e4abcd7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/remainder.c @@ -0,0 +1,11 @@ +#include <math.h> +#include "weak_alias.h" +//#include "libc.h" + +double remainder(double x, double y) +{ + int q; + return remquo(x, y, &q); +} + +weak_alias(remainder, drem); diff --git a/lib/mlibc/options/ansi/musl-generic-math/remainderf.c b/lib/mlibc/options/ansi/musl-generic-math/remainderf.c new file mode 100644 index 0000000..e1fcdaa --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/remainderf.c @@ -0,0 +1,11 @@ +#include <math.h> +#include "weak_alias.h" +//#include "libc.h" + +float remainderf(float x, float y) +{ + int q; + return remquof(x, y, &q); +} + +weak_alias(remainderf, dremf); diff --git a/lib/mlibc/options/ansi/musl-generic-math/remainderl.c b/lib/mlibc/options/ansi/musl-generic-math/remainderl.c new file mode 100644 index 0000000..2a13c1d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/remainderl.c @@ -0,0 +1,15 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double remainderl(long double x, long double y) +{ + return remainder(x, y); +} +#else +long double remainderl(long double x, long double y) +{ + int q; + return remquol(x, y, &q); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/remquo.c b/lib/mlibc/options/ansi/musl-generic-math/remquo.c new file mode 100644 index 0000000..59d5ad5 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/remquo.c @@ -0,0 +1,82 @@ +#include <math.h> +#include <stdint.h> + +double remquo(double x, double y, int *quo) +{ + union {double f; uint64_t i;} ux = {x}, uy = {y}; + int ex = ux.i>>52 & 0x7ff; + int ey = uy.i>>52 & 0x7ff; + int sx = ux.i>>63; + int sy = uy.i>>63; + uint32_t q; + uint64_t i; + uint64_t uxi = ux.i; + + *quo = 0; + if (uy.i<<1 == 0 || isnan(y) || ex == 0x7ff) + return (x*y)/(x*y); + if (ux.i<<1 == 0) + return x; + + /* normalize x and y */ + if (!ex) { + for (i = uxi<<12; i>>63 == 0; ex--, i <<= 1); + uxi <<= -ex + 1; + } else { + uxi &= -1ULL >> 12; + uxi |= 1ULL << 52; + } + if (!ey) { + for (i = uy.i<<12; i>>63 == 0; ey--, i <<= 1); + uy.i <<= -ey + 1; + } else { + uy.i &= -1ULL >> 12; + uy.i |= 1ULL << 52; + } + + q = 0; + if (ex < ey) { + if (ex+1 == ey) + goto end; + return x; + } + + /* x mod y */ + for (; ex > ey; ex--) { + i = uxi - uy.i; + if (i >> 63 == 0) { + uxi = i; + q++; + } + uxi <<= 1; + q <<= 1; + } + i = uxi - uy.i; + if (i >> 63 == 0) { + uxi = i; + q++; + } + if (uxi == 0) + ex = -60; + else + for (; uxi>>52 == 0; uxi <<= 1, ex--); +end: + /* scale result and decide between |x| and |x|-|y| */ + if (ex > 0) { + uxi -= 1ULL << 52; + uxi |= (uint64_t)ex << 52; + } else { + uxi >>= -ex + 1; + } + ux.i = uxi; + x = ux.f; + if (sy) + y = -y; + if (ex == ey || (ex+1 == ey && (2*x > y || (2*x == y && q%2)))) { + x -= y; + q++; + } + q &= 0x7fffffff; + *quo = sx^sy ? -(int)q : (int)q; + return sx ? -x : x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/remquof.c b/lib/mlibc/options/ansi/musl-generic-math/remquof.c new file mode 100644 index 0000000..2f41ff7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/remquof.c @@ -0,0 +1,82 @@ +#include <math.h> +#include <stdint.h> + +float remquof(float x, float y, int *quo) +{ + union {float f; uint32_t i;} ux = {x}, uy = {y}; + int ex = ux.i>>23 & 0xff; + int ey = uy.i>>23 & 0xff; + int sx = ux.i>>31; + int sy = uy.i>>31; + uint32_t q; + uint32_t i; + uint32_t uxi = ux.i; + + *quo = 0; + if (uy.i<<1 == 0 || isnan(y) || ex == 0xff) + return (x*y)/(x*y); + if (ux.i<<1 == 0) + return x; + + /* normalize x and y */ + if (!ex) { + for (i = uxi<<9; i>>31 == 0; ex--, i <<= 1); + uxi <<= -ex + 1; + } else { + uxi &= -1U >> 9; + uxi |= 1U << 23; + } + if (!ey) { + for (i = uy.i<<9; i>>31 == 0; ey--, i <<= 1); + uy.i <<= -ey + 1; + } else { + uy.i &= -1U >> 9; + uy.i |= 1U << 23; + } + + q = 0; + if (ex < ey) { + if (ex+1 == ey) + goto end; + return x; + } + + /* x mod y */ + for (; ex > ey; ex--) { + i = uxi - uy.i; + if (i >> 31 == 0) { + uxi = i; + q++; + } + uxi <<= 1; + q <<= 1; + } + i = uxi - uy.i; + if (i >> 31 == 0) { + uxi = i; + q++; + } + if (uxi == 0) + ex = -30; + else + for (; uxi>>23 == 0; uxi <<= 1, ex--); +end: + /* scale result and decide between |x| and |x|-|y| */ + if (ex > 0) { + uxi -= 1U << 23; + uxi |= (uint32_t)ex << 23; + } else { + uxi >>= -ex + 1; + } + ux.i = uxi; + x = ux.f; + if (sy) + y = -y; + if (ex == ey || (ex+1 == ey && (2*x > y || (2*x == y && q%2)))) { + x -= y; + q++; + } + q &= 0x7fffffff; + *quo = sx^sy ? -(int)q : (int)q; + return sx ? -x : x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/remquol.c b/lib/mlibc/options/ansi/musl-generic-math/remquol.c new file mode 100644 index 0000000..9b065c0 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/remquol.c @@ -0,0 +1,124 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double remquol(long double x, long double y, int *quo) +{ + return remquo(x, y, quo); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double remquol(long double x, long double y, int *quo) +{ + union ldshape ux = {x}, uy = {y}; + int ex = ux.i.se & 0x7fff; + int ey = uy.i.se & 0x7fff; + int sx = ux.i.se >> 15; + int sy = uy.i.se >> 15; + uint32_t q; + + *quo = 0; + if (y == 0 || isnan(y) || ex == 0x7fff) + return (x*y)/(x*y); + if (x == 0) + return x; + + /* normalize x and y */ + if (!ex) { + ux.i.se = ex; + ux.f *= 0x1p120f; + ex = ux.i.se - 120; + } + if (!ey) { + uy.i.se = ey; + uy.f *= 0x1p120f; + ey = uy.i.se - 120; + } + + q = 0; + if (ex >= ey) { + /* x mod y */ +#if LDBL_MANT_DIG == 64 + uint64_t i, mx, my; + mx = ux.i.m; + my = uy.i.m; + for (; ex > ey; ex--) { + i = mx - my; + if (mx >= my) { + mx = 2*i; + q++; + q <<= 1; + } else if (2*mx < mx) { + mx = 2*mx - my; + q <<= 1; + q++; + } else { + mx = 2*mx; + q <<= 1; + } + } + i = mx - my; + if (mx >= my) { + mx = i; + q++; + } + if (mx == 0) + ex = -120; + else + for (; mx >> 63 == 0; mx *= 2, ex--); + ux.i.m = mx; +#elif LDBL_MANT_DIG == 113 + uint64_t hi, lo, xhi, xlo, yhi, ylo; + xhi = (ux.i2.hi & -1ULL>>16) | 1ULL<<48; + yhi = (uy.i2.hi & -1ULL>>16) | 1ULL<<48; + xlo = ux.i2.lo; + ylo = ux.i2.lo; + for (; ex > ey; ex--) { + hi = xhi - yhi; + lo = xlo - ylo; + if (xlo < ylo) + hi -= 1; + if (hi >> 63 == 0) { + xhi = 2*hi + (lo>>63); + xlo = 2*lo; + q++; + } else { + xhi = 2*xhi + (xlo>>63); + xlo = 2*xlo; + } + q <<= 1; + } + hi = xhi - yhi; + lo = xlo - ylo; + if (xlo < ylo) + hi -= 1; + if (hi >> 63 == 0) { + xhi = hi; + xlo = lo; + q++; + } + if ((xhi|xlo) == 0) + ex = -120; + else + for (; xhi >> 48 == 0; xhi = 2*xhi + (xlo>>63), xlo = 2*xlo, ex--); + ux.i2.hi = xhi; + ux.i2.lo = xlo; +#endif + } + + /* scale result and decide between |x| and |x|-|y| */ + if (ex <= 0) { + ux.i.se = ex + 120; + ux.f *= 0x1p-120f; + } else + ux.i.se = ex; + x = ux.f; + if (sy) + y = -y; + if (ex == ey || (ex+1 == ey && (2*x > y || (2*x == y && q%2)))) { + x -= y; + q++; + } + q &= 0x7fffffff; + *quo = sx^sy ? -(int)q : (int)q; + return sx ? -x : x; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/rint.c b/lib/mlibc/options/ansi/musl-generic-math/rint.c new file mode 100644 index 0000000..fbba390 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/rint.c @@ -0,0 +1,28 @@ +#include <float.h> +#include <math.h> +#include <stdint.h> + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const double_t toint = 1/EPS; + +double rint(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i>>52 & 0x7ff; + int s = u.i>>63; + double_t y; + + if (e >= 0x3ff+52) + return x; + if (s) + y = x - toint + toint; + else + y = x + toint - toint; + if (y == 0) + return s ? -0.0 : 0; + return y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/rintf.c b/lib/mlibc/options/ansi/musl-generic-math/rintf.c new file mode 100644 index 0000000..9047688 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/rintf.c @@ -0,0 +1,30 @@ +#include <float.h> +#include <math.h> +#include <stdint.h> + +#if FLT_EVAL_METHOD==0 +#define EPS FLT_EPSILON +#elif FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const float_t toint = 1/EPS; + +float rintf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = u.i>>23 & 0xff; + int s = u.i>>31; + float_t y; + + if (e >= 0x7f+23) + return x; + if (s) + y = x - toint + toint; + else + y = x + toint - toint; + if (y == 0) + return s ? -0.0f : 0.0f; + return y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/rintl.c b/lib/mlibc/options/ansi/musl-generic-math/rintl.c new file mode 100644 index 0000000..374327d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/rintl.c @@ -0,0 +1,29 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double rintl(long double x) +{ + return rint(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double rintl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + int s = u.i.se >> 15; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1) + return x; + if (s) + y = x - toint + toint; + else + y = x + toint - toint; + if (y == 0) + return 0*x; + return y; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/round.c b/lib/mlibc/options/ansi/musl-generic-math/round.c new file mode 100644 index 0000000..130d58d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/round.c @@ -0,0 +1,35 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const double_t toint = 1/EPS; + +double round(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i >> 52 & 0x7ff; + double_t y; + + if (e >= 0x3ff+52) + return x; + if (u.i >> 63) + x = -x; + if (e < 0x3ff-1) { + /* raise inexact if x!=0 */ + FORCE_EVAL(x + toint); + return 0*u.f; + } + y = x + toint - toint - x; + if (y > 0.5) + y = y + x - 1; + else if (y <= -0.5) + y = y + x + 1; + else + y = y + x; + if (u.i >> 63) + y = -y; + return y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/roundf.c b/lib/mlibc/options/ansi/musl-generic-math/roundf.c new file mode 100644 index 0000000..e8210af --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/roundf.c @@ -0,0 +1,36 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==0 +#define EPS FLT_EPSILON +#elif FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const float_t toint = 1/EPS; + +float roundf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = u.i >> 23 & 0xff; + float_t y; + + if (e >= 0x7f+23) + return x; + if (u.i >> 31) + x = -x; + if (e < 0x7f-1) { + FORCE_EVAL(x + toint); + return 0*u.f; + } + y = x + toint - toint - x; + if (y > 0.5f) + y = y + x - 1; + else if (y <= -0.5f) + y = y + x + 1; + else + y = y + x; + if (u.i >> 31) + y = -y; + return y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/roundl.c b/lib/mlibc/options/ansi/musl-generic-math/roundl.c new file mode 100644 index 0000000..f4ff682 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/roundl.c @@ -0,0 +1,37 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double roundl(long double x) +{ + return round(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double roundl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1) + return x; + if (u.i.se >> 15) + x = -x; + if (e < 0x3fff-1) { + FORCE_EVAL(x + toint); + return 0*u.f; + } + y = x + toint - toint - x; + if (y > 0.5) + y = y + x - 1; + else if (y <= -0.5) + y = y + x + 1; + else + y = y + x; + if (u.i.se >> 15) + y = -y; + return y; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalb.c b/lib/mlibc/options/ansi/musl-generic-math/scalb.c new file mode 100644 index 0000000..efe69e6 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalb.c @@ -0,0 +1,35 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_scalb.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * scalb(x, fn) is provide for + * passing various standard test suite. One + * should use scalbn() instead. + */ + +#define _GNU_SOURCE +#include <math.h> + +double scalb(double x, double fn) +{ + if (isnan(x) || isnan(fn)) + return x*fn; + if (!isfinite(fn)) { + if (fn > 0.0) + return x*fn; + else + return x/(-fn); + } + if (rint(fn) != fn) return (fn-fn)/(fn-fn); + if ( fn > 65000.0) return scalbn(x, 65000); + if (-fn > 65000.0) return scalbn(x,-65000); + return scalbn(x,(int)fn); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalbf.c b/lib/mlibc/options/ansi/musl-generic-math/scalbf.c new file mode 100644 index 0000000..f44ed5b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalbf.c @@ -0,0 +1,32 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_scalbf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include <math.h> + +float scalbf(float x, float fn) +{ + if (isnan(x) || isnan(fn)) return x*fn; + if (!isfinite(fn)) { + if (fn > 0.0f) + return x*fn; + else + return x/(-fn); + } + if (rintf(fn) != fn) return (fn-fn)/(fn-fn); + if ( fn > 65000.0f) return scalbnf(x, 65000); + if (-fn > 65000.0f) return scalbnf(x,-65000); + return scalbnf(x,(int)fn); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalbln.c b/lib/mlibc/options/ansi/musl-generic-math/scalbln.c new file mode 100644 index 0000000..4fb3d06 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalbln.c @@ -0,0 +1,12 @@ +#include <limits.h> +#include <math.h> +#include "libm.h" + +double scalbln(double x, long n) +{ + if (n > INT_MAX) + n = INT_MAX; + else if (n < INT_MIN) + n = INT_MIN; + return scalbn(x, n); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalblnf.c b/lib/mlibc/options/ansi/musl-generic-math/scalblnf.c new file mode 100644 index 0000000..b6bdeed --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalblnf.c @@ -0,0 +1,12 @@ +#include <limits.h> +#include <math.h> +#include "libm.h" + +float scalblnf(float x, long n) +{ + if (n > INT_MAX) + n = INT_MAX; + else if (n < INT_MIN) + n = INT_MIN; + return scalbnf(x, n); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalblnl.c b/lib/mlibc/options/ansi/musl-generic-math/scalblnl.c new file mode 100644 index 0000000..b1a0f7f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalblnl.c @@ -0,0 +1,20 @@ +#include <limits.h> +#include <math.h> +#include <float.h> +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double scalblnl(long double x, long n) +{ + return scalbln(x, n); +} +#else +long double scalblnl(long double x, long n) +{ + if (n > INT_MAX) + n = INT_MAX; + else if (n < INT_MIN) + n = INT_MIN; + return scalbnl(x, n); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalbn.c b/lib/mlibc/options/ansi/musl-generic-math/scalbn.c new file mode 100644 index 0000000..182f561 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalbn.c @@ -0,0 +1,33 @@ +#include <math.h> +#include <stdint.h> + +double scalbn(double x, int n) +{ + union {double f; uint64_t i;} u; + double_t y = x; + + if (n > 1023) { + y *= 0x1p1023; + n -= 1023; + if (n > 1023) { + y *= 0x1p1023; + n -= 1023; + if (n > 1023) + n = 1023; + } + } else if (n < -1022) { + /* make sure final n < -53 to avoid double + rounding in the subnormal range */ + y *= 0x1p-1022 * 0x1p53; + n += 1022 - 53; + if (n < -1022) { + y *= 0x1p-1022 * 0x1p53; + n += 1022 - 53; + if (n < -1022) + n = -1022; + } + } + u.i = (uint64_t)(0x3ff+n)<<52; + x = y * u.f; + return x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalbnf.c b/lib/mlibc/options/ansi/musl-generic-math/scalbnf.c new file mode 100644 index 0000000..a5ad208 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalbnf.c @@ -0,0 +1,31 @@ +#include <math.h> +#include <stdint.h> + +float scalbnf(float x, int n) +{ + union {float f; uint32_t i;} u; + float_t y = x; + + if (n > 127) { + y *= 0x1p127f; + n -= 127; + if (n > 127) { + y *= 0x1p127f; + n -= 127; + if (n > 127) + n = 127; + } + } else if (n < -126) { + y *= 0x1p-126f * 0x1p24f; + n += 126 - 24; + if (n < -126) { + y *= 0x1p-126f * 0x1p24f; + n += 126 - 24; + if (n < -126) + n = -126; + } + } + u.i = (uint32_t)(0x7f+n)<<23; + x = y * u.f; + return x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalbnl.c b/lib/mlibc/options/ansi/musl-generic-math/scalbnl.c new file mode 100644 index 0000000..db44dab --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalbnl.c @@ -0,0 +1,36 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double scalbnl(long double x, int n) +{ + return scalbn(x, n); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double scalbnl(long double x, int n) +{ + union ldshape u; + + if (n > 16383) { + x *= 0x1p16383L; + n -= 16383; + if (n > 16383) { + x *= 0x1p16383L; + n -= 16383; + if (n > 16383) + n = 16383; + } + } else if (n < -16382) { + x *= 0x1p-16382L * 0x1p113L; + n += 16382 - 113; + if (n < -16382) { + x *= 0x1p-16382L * 0x1p113L; + n += 16382 - 113; + if (n < -16382) + n = -16382; + } + } + u.f = 1.0; + u.i.se = 0x3fff + n; + return x * u.f; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/signgam.c b/lib/mlibc/options/ansi/musl-generic-math/signgam.c new file mode 100644 index 0000000..3a5b9f7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/signgam.c @@ -0,0 +1,5 @@ +#include <math.h> +#include "weak_alias.h" +//#include "libc.h" + +int signgam = 0; diff --git a/lib/mlibc/options/ansi/musl-generic-math/significand.c b/lib/mlibc/options/ansi/musl-generic-math/significand.c new file mode 100644 index 0000000..40d9aa9 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/significand.c @@ -0,0 +1,7 @@ +#define _GNU_SOURCE +#include <math.h> + +double significand(double x) +{ + return scalbn(x, -ilogb(x)); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/significandf.c b/lib/mlibc/options/ansi/musl-generic-math/significandf.c new file mode 100644 index 0000000..8a697e1 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/significandf.c @@ -0,0 +1,7 @@ +#define _GNU_SOURCE +#include <math.h> + +float significandf(float x) +{ + return scalbnf(x, -ilogbf(x)); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sin.c b/lib/mlibc/options/ansi/musl-generic-math/sin.c new file mode 100644 index 0000000..055e215 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sin.c @@ -0,0 +1,78 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_sin.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* sin(x) + * Return sine function of x. + * + * kernel function: + * __sin ... sine function on [-pi/4,pi/4] + * __cos ... cose function on [-pi/4,pi/4] + * __rem_pio2 ... argument reduction routine + * + * Method. + * Let S,C and T denote the sin, cos and tan respectively on + * [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 + * in [-pi/4 , +pi/4], and let n = k mod 4. + * We have + * + * n sin(x) cos(x) tan(x) + * ---------------------------------------------------------- + * 0 S C T + * 1 C -S -1/T + * 2 -S -C T + * 3 -C S -1/T + * ---------------------------------------------------------- + * + * Special cases: + * Let trig be any of sin, cos, or tan. + * trig(+-INF) is NaN, with signals; + * trig(NaN) is that NaN; + * + * Accuracy: + * TRIG(x) returns trig(x) nearly rounded + */ + +#include "libm.h" + +double sin(double x) +{ + double y[2]; + uint32_t ix; + unsigned n; + + /* High word of x. */ + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* |x| ~< pi/4 */ + if (ix <= 0x3fe921fb) { + if (ix < 0x3e500000) { /* |x| < 2**-26 */ + /* raise inexact if x != 0 and underflow if subnormal*/ + FORCE_EVAL(ix < 0x00100000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __sin(x, 0.0, 0); + } + + /* sin(Inf or NaN) is NaN */ + if (ix >= 0x7ff00000) + return x - x; + + /* argument reduction needed */ + n = __rem_pio2(x, y); + switch (n&3) { + case 0: return __sin(y[0], y[1], 1); + case 1: return __cos(y[0], y[1]); + case 2: return -__sin(y[0], y[1], 1); + default: + return -__cos(y[0], y[1]); + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sincos.c b/lib/mlibc/options/ansi/musl-generic-math/sincos.c new file mode 100644 index 0000000..35b2d92 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sincos.c @@ -0,0 +1,69 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_sin.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include "libm.h" + +void sincos(double x, double *sin, double *cos) +{ + double y[2], s, c; + uint32_t ix; + unsigned n; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* |x| ~< pi/4 */ + if (ix <= 0x3fe921fb) { + /* if |x| < 2**-27 * sqrt(2) */ + if (ix < 0x3e46a09e) { + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00100000 ? x/0x1p120f : x+0x1p120f); + *sin = x; + *cos = 1.0; + return; + } + *sin = __sin(x, 0.0, 0); + *cos = __cos(x, 0.0); + return; + } + + /* sincos(Inf or NaN) is NaN */ + if (ix >= 0x7ff00000) { + *sin = *cos = x - x; + return; + } + + /* argument reduction needed */ + n = __rem_pio2(x, y); + s = __sin(y[0], y[1], 1); + c = __cos(y[0], y[1]); + switch (n&3) { + case 0: + *sin = s; + *cos = c; + break; + case 1: + *sin = c; + *cos = -s; + break; + case 2: + *sin = -s; + *cos = -c; + break; + case 3: + default: + *sin = -c; + *cos = s; + break; + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sincosf.c b/lib/mlibc/options/ansi/musl-generic-math/sincosf.c new file mode 100644 index 0000000..f8ca723 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sincosf.c @@ -0,0 +1,117 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_sinf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include "libm.h" + +/* Small multiples of pi/2 rounded to double precision. */ +static const double +s1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ +s2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ +s3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ +s4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + +void sincosf(float x, float *sin, float *cos) +{ + double y; + float_t s, c; + uint32_t ix; + unsigned n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + /* |x| ~<= pi/4 */ + if (ix <= 0x3f490fda) { + /* |x| < 2**-12 */ + if (ix < 0x39800000) { + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00100000 ? x/0x1p120f : x+0x1p120f); + *sin = x; + *cos = 1.0f; + return; + } + *sin = __sindf(x); + *cos = __cosdf(x); + return; + } + + /* |x| ~<= 5*pi/4 */ + if (ix <= 0x407b53d1) { + if (ix <= 0x4016cbe3) { /* |x| ~<= 3pi/4 */ + if (sign) { + *sin = -__cosdf(x + s1pio2); + *cos = __sindf(x + s1pio2); + } else { + *sin = __cosdf(s1pio2 - x); + *cos = __sindf(s1pio2 - x); + } + return; + } + /* -sin(x+c) is not correct if x+c could be 0: -0 vs +0 */ + *sin = -__sindf(sign ? x + s2pio2 : x - s2pio2); + *cos = -__cosdf(sign ? x + s2pio2 : x - s2pio2); + return; + } + + /* |x| ~<= 9*pi/4 */ + if (ix <= 0x40e231d5) { + if (ix <= 0x40afeddf) { /* |x| ~<= 7*pi/4 */ + if (sign) { + *sin = __cosdf(x + s3pio2); + *cos = -__sindf(x + s3pio2); + } else { + *sin = -__cosdf(x - s3pio2); + *cos = __sindf(x - s3pio2); + } + return; + } + *sin = __sindf(sign ? x + s4pio2 : x - s4pio2); + *cos = __cosdf(sign ? x + s4pio2 : x - s4pio2); + return; + } + + /* sin(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) { + *sin = *cos = x - x; + return; + } + + /* general argument reduction needed */ + n = __rem_pio2f(x, &y); + s = __sindf(y); + c = __cosdf(y); + switch (n&3) { + case 0: + *sin = s; + *cos = c; + break; + case 1: + *sin = c; + *cos = -s; + break; + case 2: + *sin = -s; + *cos = -c; + break; + case 3: + default: + *sin = -c; + *cos = s; + break; + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sincosl.c b/lib/mlibc/options/ansi/musl-generic-math/sincosl.c new file mode 100644 index 0000000..d3ac1c4 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sincosl.c @@ -0,0 +1,60 @@ +#define _GNU_SOURCE +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +void sincosl(long double x, long double *sin, long double *cos) +{ + double sind, cosd; + sincos(x, &sind, &cosd); + *sin = sind; + *cos = cosd; +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +void sincosl(long double x, long double *sin, long double *cos) +{ + union ldshape u = {x}; + unsigned n; + long double y[2], s, c; + + u.i.se &= 0x7fff; + if (u.i.se == 0x7fff) { + *sin = *cos = x - x; + return; + } + if (u.f < M_PI_4) { + if (u.i.se < 0x3fff - LDBL_MANT_DIG) { + /* raise underflow if subnormal */ + if (u.i.se == 0) FORCE_EVAL(x*0x1p-120f); + *sin = x; + /* raise inexact if x!=0 */ + *cos = 1.0 + x; + return; + } + *sin = __sinl(x, 0, 0); + *cos = __cosl(x, 0); + return; + } + n = __rem_pio2l(x, y); + s = __sinl(y[0], y[1], 1); + c = __cosl(y[0], y[1]); + switch (n & 3) { + case 0: + *sin = s; + *cos = c; + break; + case 1: + *sin = c; + *cos = -s; + break; + case 2: + *sin = -s; + *cos = -c; + break; + case 3: + default: + *sin = -c; + *cos = s; + break; + } +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/sinf.c b/lib/mlibc/options/ansi/musl-generic-math/sinf.c new file mode 100644 index 0000000..64e39f5 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sinf.c @@ -0,0 +1,76 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_sinf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* Small multiples of pi/2 rounded to double precision. */ +static const double +s1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ +s2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ +s3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ +s4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + +float sinf(float x) +{ + double y; + uint32_t ix; + int n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00800000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __sindf(x); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix <= 0x4016cbe3) { /* |x| ~<= 3pi/4 */ + if (sign) + return -__cosdf(x + s1pio2); + else + return __cosdf(x - s1pio2); + } + return __sindf(sign ? -(x + s2pio2) : -(x - s2pio2)); + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix <= 0x40afeddf) { /* |x| ~<= 7*pi/4 */ + if (sign) + return __cosdf(x + s3pio2); + else + return -__cosdf(x - s3pio2); + } + return __sindf(sign ? x + s4pio2 : x - s4pio2); + } + + /* sin(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x - x; + + /* general argument reduction needed */ + n = __rem_pio2f(x, &y); + switch (n&3) { + case 0: return __sindf(y); + case 1: return __cosdf(y); + case 2: return __sindf(-y); + default: + return -__cosdf(y); + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sinh.c b/lib/mlibc/options/ansi/musl-generic-math/sinh.c new file mode 100644 index 0000000..00022c4 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sinh.c @@ -0,0 +1,39 @@ +#include "libm.h" + +/* sinh(x) = (exp(x) - 1/exp(x))/2 + * = (exp(x)-1 + (exp(x)-1)/exp(x))/2 + * = x + x^3/6 + o(x^5) + */ +double sinh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + uint32_t w; + double t, h, absx; + + h = 0.5; + if (u.i >> 63) + h = -h; + /* |x| */ + u.i &= (uint64_t)-1/2; + absx = u.f; + w = u.i >> 32; + + /* |x| < log(DBL_MAX) */ + if (w < 0x40862e42) { + t = expm1(absx); + if (w < 0x3ff00000) { + if (w < 0x3ff00000 - (26<<20)) + /* note: inexact and underflow are raised by expm1 */ + /* note: this branch avoids spurious underflow */ + return x; + return h*(2*t - t*t/(t+1)); + } + /* note: |x|>log(0x1p26)+eps could be just h*exp(x) */ + return h*(t + t/(t+1)); + } + + /* |x| > log(DBL_MAX) or nan */ + /* note: the result is stored to handle overflow */ + t = 2*h*__expo2(absx); + return t; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sinhf.c b/lib/mlibc/options/ansi/musl-generic-math/sinhf.c new file mode 100644 index 0000000..6ad19ea --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sinhf.c @@ -0,0 +1,31 @@ +#include "libm.h" + +float sinhf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + uint32_t w; + float t, h, absx; + + h = 0.5; + if (u.i >> 31) + h = -h; + /* |x| */ + u.i &= 0x7fffffff; + absx = u.f; + w = u.i; + + /* |x| < log(FLT_MAX) */ + if (w < 0x42b17217) { + t = expm1f(absx); + if (w < 0x3f800000) { + if (w < 0x3f800000 - (12<<23)) + return x; + return h*(2*t - t*t/(t+1)); + } + return h*(t + t/(t+1)); + } + + /* |x| > logf(FLT_MAX) or nan */ + t = 2*h*__expo2f(absx); + return t; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sinhl.c b/lib/mlibc/options/ansi/musl-generic-math/sinhl.c new file mode 100644 index 0000000..b305d4d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sinhl.c @@ -0,0 +1,43 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double sinhl(long double x) +{ + return sinh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +long double sinhl(long double x) +{ + union ldshape u = {x}; + unsigned ex = u.i.se & 0x7fff; + long double h, t, absx; + + h = 0.5; + if (u.i.se & 0x8000) + h = -h; + /* |x| */ + u.i.se = ex; + absx = u.f; + + /* |x| < log(LDBL_MAX) */ + if (ex < 0x3fff+13 || (ex == 0x3fff+13 && u.i.m>>32 < 0xb17217f7)) { + t = expm1l(absx); + if (ex < 0x3fff) { + if (ex < 0x3fff-32) + return x; + return h*(2*t - t*t/(1+t)); + } + return h*(t + t/(t+1)); + } + + /* |x| > log(LDBL_MAX) or nan */ + t = expl(0.5*absx); + return h*t*t; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double sinhl(long double x) +{ + return sinh(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/sinl.c b/lib/mlibc/options/ansi/musl-generic-math/sinl.c new file mode 100644 index 0000000..9c0b16e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sinl.c @@ -0,0 +1,41 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double sinl(long double x) +{ + return sin(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double sinl(long double x) +{ + union ldshape u = {x}; + unsigned n; + long double y[2], hi, lo; + + u.i.se &= 0x7fff; + if (u.i.se == 0x7fff) + return x - x; + if (u.f < M_PI_4) { + if (u.i.se < 0x3fff - LDBL_MANT_DIG/2) { + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(u.i.se == 0 ? x*0x1p-120f : x+0x1p120f); + return x; + } + return __sinl(x, 0.0, 0); + } + n = __rem_pio2l(x, y); + hi = y[0]; + lo = y[1]; + switch (n & 3) { + case 0: + return __sinl(hi, lo, 1); + case 1: + return __cosl(hi, lo); + case 2: + return -__sinl(hi, lo, 1); + case 3: + default: + return -__cosl(hi, lo); + } +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/sqrt.c b/lib/mlibc/options/ansi/musl-generic-math/sqrt.c new file mode 100644 index 0000000..b277567 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sqrt.c @@ -0,0 +1,185 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_sqrt.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* sqrt(x) + * Return correctly rounded sqrt. + * ------------------------------------------ + * | Use the hardware sqrt if you have one | + * ------------------------------------------ + * Method: + * Bit by bit method using integer arithmetic. (Slow, but portable) + * 1. Normalization + * Scale x to y in [1,4) with even powers of 2: + * find an integer k such that 1 <= (y=x*2^(2k)) < 4, then + * sqrt(x) = 2^k * sqrt(y) + * 2. Bit by bit computation + * Let q = sqrt(y) truncated to i bit after binary point (q = 1), + * i 0 + * i+1 2 + * s = 2*q , and y = 2 * ( y - q ). (1) + * i i i i + * + * To compute q from q , one checks whether + * i+1 i + * + * -(i+1) 2 + * (q + 2 ) <= y. (2) + * i + * -(i+1) + * If (2) is false, then q = q ; otherwise q = q + 2 . + * i+1 i i+1 i + * + * With some algebric manipulation, it is not difficult to see + * that (2) is equivalent to + * -(i+1) + * s + 2 <= y (3) + * i i + * + * The advantage of (3) is that s and y can be computed by + * i i + * the following recurrence formula: + * if (3) is false + * + * s = s , y = y ; (4) + * i+1 i i+1 i + * + * otherwise, + * -i -(i+1) + * s = s + 2 , y = y - s - 2 (5) + * i+1 i i+1 i i + * + * One may easily use induction to prove (4) and (5). + * Note. Since the left hand side of (3) contain only i+2 bits, + * it does not necessary to do a full (53-bit) comparison + * in (3). + * 3. Final rounding + * After generating the 53 bits result, we compute one more bit. + * Together with the remainder, we can decide whether the + * result is exact, bigger than 1/2ulp, or less than 1/2ulp + * (it will never equal to 1/2ulp). + * The rounding mode can be detected by checking whether + * huge + tiny is equal to huge, and whether huge - tiny is + * equal to huge for some floating point number "huge" and "tiny". + * + * Special cases: + * sqrt(+-0) = +-0 ... exact + * sqrt(inf) = inf + * sqrt(-ve) = NaN ... with invalid signal + * sqrt(NaN) = NaN ... with invalid signal for signaling NaN + */ + +#include "libm.h" + +static const double tiny = 1.0e-300; + +double sqrt(double x) +{ + double z; + int32_t sign = (int)0x80000000; + int32_t ix0,s0,q,m,t,i; + uint32_t r,t1,s1,ix1,q1; + + EXTRACT_WORDS(ix0, ix1, x); + + /* take care of Inf and NaN */ + if ((ix0&0x7ff00000) == 0x7ff00000) { + return x*x + x; /* sqrt(NaN)=NaN, sqrt(+inf)=+inf, sqrt(-inf)=sNaN */ + } + /* take care of zero */ + if (ix0 <= 0) { + if (((ix0&~sign)|ix1) == 0) + return x; /* sqrt(+-0) = +-0 */ + if (ix0 < 0) + return (x-x)/(x-x); /* sqrt(-ve) = sNaN */ + } + /* normalize x */ + m = ix0>>20; + if (m == 0) { /* subnormal x */ + while (ix0 == 0) { + m -= 21; + ix0 |= (ix1>>11); + ix1 <<= 21; + } + for (i=0; (ix0&0x00100000) == 0; i++) + ix0<<=1; + m -= i - 1; + ix0 |= ix1>>(32-i); + ix1 <<= i; + } + m -= 1023; /* unbias exponent */ + ix0 = (ix0&0x000fffff)|0x00100000; + if (m & 1) { /* odd m, double x to make it even */ + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + } + m >>= 1; /* m = [m/2] */ + + /* generate sqrt(x) bit by bit */ + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + q = q1 = s0 = s1 = 0; /* [q,q1] = sqrt(x) */ + r = 0x00200000; /* r = moving bit from right to left */ + + while (r != 0) { + t = s0 + r; + if (t <= ix0) { + s0 = t + r; + ix0 -= t; + q += r; + } + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + r >>= 1; + } + + r = sign; + while (r != 0) { + t1 = s1 + r; + t = s0; + if (t < ix0 || (t == ix0 && t1 <= ix1)) { + s1 = t1 + r; + if ((t1&sign) == sign && (s1&sign) == 0) + s0++; + ix0 -= t; + if (ix1 < t1) + ix0--; + ix1 -= t1; + q1 += r; + } + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + r >>= 1; + } + + /* use floating add to find out rounding direction */ + if ((ix0|ix1) != 0) { + z = 1.0 - tiny; /* raise inexact flag */ + if (z >= 1.0) { + z = 1.0 + tiny; + if (q1 == (uint32_t)0xffffffff) { + q1 = 0; + q++; + } else if (z > 1.0) { + if (q1 == (uint32_t)0xfffffffe) + q++; + q1 += 2; + } else + q1 += q1 & 1; + } + } + ix0 = (q>>1) + 0x3fe00000; + ix1 = q1>>1; + if (q&1) + ix1 |= sign; + ix0 += m << 20; + INSERT_WORDS(z, ix0, ix1); + return z; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sqrtf.c b/lib/mlibc/options/ansi/musl-generic-math/sqrtf.c new file mode 100644 index 0000000..28cb4ad --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sqrtf.c @@ -0,0 +1,84 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_sqrtf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float tiny = 1.0e-30; + +float sqrtf(float x) +{ + float z; + int32_t sign = (int)0x80000000; + int32_t ix,s,q,m,t,i; + uint32_t r; + + GET_FLOAT_WORD(ix, x); + + /* take care of Inf and NaN */ + if ((ix&0x7f800000) == 0x7f800000) + return x*x + x; /* sqrt(NaN)=NaN, sqrt(+inf)=+inf, sqrt(-inf)=sNaN */ + + /* take care of zero */ + if (ix <= 0) { + if ((ix&~sign) == 0) + return x; /* sqrt(+-0) = +-0 */ + if (ix < 0) + return (x-x)/(x-x); /* sqrt(-ve) = sNaN */ + } + /* normalize x */ + m = ix>>23; + if (m == 0) { /* subnormal x */ + for (i = 0; (ix&0x00800000) == 0; i++) + ix<<=1; + m -= i - 1; + } + m -= 127; /* unbias exponent */ + ix = (ix&0x007fffff)|0x00800000; + if (m&1) /* odd m, double x to make it even */ + ix += ix; + m >>= 1; /* m = [m/2] */ + + /* generate sqrt(x) bit by bit */ + ix += ix; + q = s = 0; /* q = sqrt(x) */ + r = 0x01000000; /* r = moving bit from right to left */ + + while (r != 0) { + t = s + r; + if (t <= ix) { + s = t+r; + ix -= t; + q += r; + } + ix += ix; + r >>= 1; + } + + /* use floating add to find out rounding direction */ + if (ix != 0) { + z = 1.0f - tiny; /* raise inexact flag */ + if (z >= 1.0f) { + z = 1.0f + tiny; + if (z > 1.0f) + q += 2; + else + q += q & 1; + } + } + ix = (q>>1) + 0x3f000000; + ix += m << 23; + SET_FLOAT_WORD(z, ix); + return z; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sqrtl.c b/lib/mlibc/options/ansi/musl-generic-math/sqrtl.c new file mode 100644 index 0000000..83a8f80 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sqrtl.c @@ -0,0 +1,7 @@ +#include <math.h> + +long double sqrtl(long double x) +{ + /* FIXME: implement in C, this is for LDBL_MANT_DIG == 64 only */ + return sqrt(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/tan.c b/lib/mlibc/options/ansi/musl-generic-math/tan.c new file mode 100644 index 0000000..9c724a4 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tan.c @@ -0,0 +1,70 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_tan.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* tan(x) + * Return tangent function of x. + * + * kernel function: + * __tan ... tangent function on [-pi/4,pi/4] + * __rem_pio2 ... argument reduction routine + * + * Method. + * Let S,C and T denote the sin, cos and tan respectively on + * [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 + * in [-pi/4 , +pi/4], and let n = k mod 4. + * We have + * + * n sin(x) cos(x) tan(x) + * ---------------------------------------------------------- + * 0 S C T + * 1 C -S -1/T + * 2 -S -C T + * 3 -C S -1/T + * ---------------------------------------------------------- + * + * Special cases: + * Let trig be any of sin, cos, or tan. + * trig(+-INF) is NaN, with signals; + * trig(NaN) is that NaN; + * + * Accuracy: + * TRIG(x) returns trig(x) nearly rounded + */ + +#include "libm.h" + +double tan(double x) +{ + double y[2]; + uint32_t ix; + unsigned n; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* |x| ~< pi/4 */ + if (ix <= 0x3fe921fb) { + if (ix < 0x3e400000) { /* |x| < 2**-27 */ + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00100000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __tan(x, 0.0, 0); + } + + /* tan(Inf or NaN) is NaN */ + if (ix >= 0x7ff00000) + return x - x; + + /* argument reduction */ + n = __rem_pio2(x, y); + return __tan(y[0], y[1], n&1); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/tanf.c b/lib/mlibc/options/ansi/musl-generic-math/tanf.c new file mode 100644 index 0000000..aba1977 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tanf.c @@ -0,0 +1,64 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_tanf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* Small multiples of pi/2 rounded to double precision. */ +static const double +t1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ +t2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ +t3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ +t4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + +float tanf(float x) +{ + double y; + uint32_t ix; + unsigned n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00800000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __tandf(x, 0); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix <= 0x4016cbe3) /* |x| ~<= 3pi/4 */ + return __tandf((sign ? x+t1pio2 : x-t1pio2), 1); + else + return __tandf((sign ? x+t2pio2 : x-t2pio2), 0); + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix <= 0x40afeddf) /* |x| ~<= 7*pi/4 */ + return __tandf((sign ? x+t3pio2 : x-t3pio2), 1); + else + return __tandf((sign ? x+t4pio2 : x-t4pio2), 0); + } + + /* tan(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x - x; + + /* argument reduction */ + n = __rem_pio2f(x, &y); + return __tandf(y, n&1); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/tanh.c b/lib/mlibc/options/ansi/musl-generic-math/tanh.c new file mode 100644 index 0000000..20d6dbc --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tanh.c @@ -0,0 +1,45 @@ +#include "libm.h" + +/* tanh(x) = (exp(x) - exp(-x))/(exp(x) + exp(-x)) + * = (exp(2*x) - 1)/(exp(2*x) - 1 + 2) + * = (1 - exp(-2*x))/(exp(-2*x) - 1 + 2) + */ +double tanh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + uint32_t w; + int sign; + double_t t; + + /* x = |x| */ + sign = u.i >> 63; + u.i &= (uint64_t)-1/2; + x = u.f; + w = u.i >> 32; + + if (w > 0x3fe193ea) { + /* |x| > log(3)/2 ~= 0.5493 or nan */ + if (w > 0x40340000) { + /* |x| > 20 or nan */ + /* note: this branch avoids raising overflow */ + t = 1 - 0/x; + } else { + t = expm1(2*x); + t = 1 - 2/(t+2); + } + } else if (w > 0x3fd058ae) { + /* |x| > log(5/3)/2 ~= 0.2554 */ + t = expm1(2*x); + t = t/(t+2); + } else if (w >= 0x00100000) { + /* |x| >= 0x1p-1022, up to 2ulp error in [0.1,0.2554] */ + t = expm1(-2*x); + t = -t/(t+2); + } else { + /* |x| is subnormal */ + /* note: the branch above would not raise underflow in [0x1p-1023,0x1p-1022) */ + FORCE_EVAL((float)x); + t = x; + } + return sign ? -t : t; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/tanhf.c b/lib/mlibc/options/ansi/musl-generic-math/tanhf.c new file mode 100644 index 0000000..10636fb --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tanhf.c @@ -0,0 +1,39 @@ +#include "libm.h" + +float tanhf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + uint32_t w; + int sign; + float t; + + /* x = |x| */ + sign = u.i >> 31; + u.i &= 0x7fffffff; + x = u.f; + w = u.i; + + if (w > 0x3f0c9f54) { + /* |x| > log(3)/2 ~= 0.5493 or nan */ + if (w > 0x41200000) { + /* |x| > 10 */ + t = 1 + 0/x; + } else { + t = expm1f(2*x); + t = 1 - 2/(t+2); + } + } else if (w > 0x3e82c578) { + /* |x| > log(5/3)/2 ~= 0.2554 */ + t = expm1f(2*x); + t = t/(t+2); + } else if (w >= 0x00800000) { + /* |x| >= 0x1p-126 */ + t = expm1f(-2*x); + t = -t/(t+2); + } else { + /* |x| is subnormal */ + FORCE_EVAL(x*x); + t = x; + } + return sign ? -t : t; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/tanhl.c b/lib/mlibc/options/ansi/musl-generic-math/tanhl.c new file mode 100644 index 0000000..4e1aa9f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tanhl.c @@ -0,0 +1,48 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double tanhl(long double x) +{ + return tanh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +long double tanhl(long double x) +{ + union ldshape u = {x}; + unsigned ex = u.i.se & 0x7fff; + unsigned sign = u.i.se & 0x8000; + uint32_t w; + long double t; + + /* x = |x| */ + u.i.se = ex; + x = u.f; + w = u.i.m >> 32; + + if (ex > 0x3ffe || (ex == 0x3ffe && w > 0x8c9f53d5)) { + /* |x| > log(3)/2 ~= 0.5493 or nan */ + if (ex >= 0x3fff+5) { + /* |x| >= 32 */ + t = 1 + 0/(x + 0x1p-120f); + } else { + t = expm1l(2*x); + t = 1 - 2/(t+2); + } + } else if (ex > 0x3ffd || (ex == 0x3ffd && w > 0x82c577d4)) { + /* |x| > log(5/3)/2 ~= 0.2554 */ + t = expm1l(2*x); + t = t/(t+2); + } else { + /* |x| is small */ + t = expm1l(-2*x); + t = -t/(t+2); + } + return sign ? -t : t; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double tanhl(long double x) +{ + return tanh(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/tanl.c b/lib/mlibc/options/ansi/musl-generic-math/tanl.c new file mode 100644 index 0000000..6af0671 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tanl.c @@ -0,0 +1,29 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double tanl(long double x) +{ + return tan(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double tanl(long double x) +{ + union ldshape u = {x}; + long double y[2]; + unsigned n; + + u.i.se &= 0x7fff; + if (u.i.se == 0x7fff) + return x - x; + if (u.f < M_PI_4) { + if (u.i.se < 0x3fff - LDBL_MANT_DIG/2) { + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(u.i.se == 0 ? x*0x1p-120f : x+0x1p120f); + return x; + } + return __tanl(x, 0, 0); + } + n = __rem_pio2l(x, y); + return __tanl(y[0], y[1], n&1); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/tgamma.c b/lib/mlibc/options/ansi/musl-generic-math/tgamma.c new file mode 100644 index 0000000..28f6e0f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tgamma.c @@ -0,0 +1,222 @@ +/* +"A Precision Approximation of the Gamma Function" - Cornelius Lanczos (1964) +"Lanczos Implementation of the Gamma Function" - Paul Godfrey (2001) +"An Analysis of the Lanczos Gamma Approximation" - Glendon Ralph Pugh (2004) + +approximation method: + + (x - 0.5) S(x) +Gamma(x) = (x + g - 0.5) * ---------------- + exp(x + g - 0.5) + +with + a1 a2 a3 aN +S(x) ~= [ a0 + ----- + ----- + ----- + ... + ----- ] + x + 1 x + 2 x + 3 x + N + +with a0, a1, a2, a3,.. aN constants which depend on g. + +for x < 0 the following reflection formula is used: + +Gamma(x)*Gamma(-x) = -pi/(x sin(pi x)) + +most ideas and constants are from boost and python +*/ +#include "libm.h" + +static const double pi = 3.141592653589793238462643383279502884; + +/* sin(pi x) with x > 0x1p-100, if sin(pi*x)==0 the sign is arbitrary */ +static double sinpi(double x) +{ + int n; + + /* argument reduction: x = |x| mod 2 */ + /* spurious inexact when x is odd int */ + x = x * 0.5; + x = 2 * (x - floor(x)); + + /* reduce x into [-.25,.25] */ + n = 4 * x; + n = (n+1)/2; + x -= n * 0.5; + + x *= pi; + switch (n) { + default: /* case 4 */ + case 0: + return __sin(x, 0, 0); + case 1: + return __cos(x, 0); + case 2: + return __sin(-x, 0, 0); + case 3: + return -__cos(x, 0); + } +} + +#define N 12 +//static const double g = 6.024680040776729583740234375; +static const double gmhalf = 5.524680040776729583740234375; +static const double Snum[N+1] = { + 23531376880.410759688572007674451636754734846804940, + 42919803642.649098768957899047001988850926355848959, + 35711959237.355668049440185451547166705960488635843, + 17921034426.037209699919755754458931112671403265390, + 6039542586.3520280050642916443072979210699388420708, + 1439720407.3117216736632230727949123939715485786772, + 248874557.86205415651146038641322942321632125127801, + 31426415.585400194380614231628318205362874684987640, + 2876370.6289353724412254090516208496135991145378768, + 186056.26539522349504029498971604569928220784236328, + 8071.6720023658162106380029022722506138218516325024, + 210.82427775157934587250973392071336271166969580291, + 2.5066282746310002701649081771338373386264310793408, +}; +static const double Sden[N+1] = { + 0, 39916800, 120543840, 150917976, 105258076, 45995730, 13339535, + 2637558, 357423, 32670, 1925, 66, 1, +}; +/* n! for small integer n */ +static const double fact[] = { + 1, 1, 2, 6, 24, 120, 720, 5040.0, 40320.0, 362880.0, 3628800.0, 39916800.0, + 479001600.0, 6227020800.0, 87178291200.0, 1307674368000.0, 20922789888000.0, + 355687428096000.0, 6402373705728000.0, 121645100408832000.0, + 2432902008176640000.0, 51090942171709440000.0, 1124000727777607680000.0, +}; + +/* S(x) rational function for positive x */ +static double S(double x) +{ + double_t num = 0, den = 0; + int i; + + /* to avoid overflow handle large x differently */ + if (x < 8) + for (i = N; i >= 0; i--) { + num = num * x + Snum[i]; + den = den * x + Sden[i]; + } + else + for (i = 0; i <= N; i++) { + num = num / x + Snum[i]; + den = den / x + Sden[i]; + } + return num/den; +} + +double tgamma(double x) +{ + union {double f; uint64_t i;} u = {x}; + double absx, y; + double_t dy, z, r; + uint32_t ix = u.i>>32 & 0x7fffffff; + int sign = u.i>>63; + + /* special cases */ + if (ix >= 0x7ff00000) + /* tgamma(nan)=nan, tgamma(inf)=inf, tgamma(-inf)=nan with invalid */ + return x + INFINITY; + if (ix < (0x3ff-54)<<20) + /* |x| < 2^-54: tgamma(x) ~ 1/x, +-0 raises div-by-zero */ + return 1/x; + + /* integer arguments */ + /* raise inexact when non-integer */ + if (x == floor(x)) { + if (sign) + return 0/0.0; + if (x <= sizeof fact/sizeof *fact) + return fact[(int)x - 1]; + } + + /* x >= 172: tgamma(x)=inf with overflow */ + /* x =< -184: tgamma(x)=+-0 with underflow */ + if (ix >= 0x40670000) { /* |x| >= 184 */ + if (sign) { + FORCE_EVAL((float)(0x1p-126/x)); + if (floor(x) * 0.5 == floor(x * 0.5)) + return 0; + return -0.0; + } + x *= 0x1p1023; + return x; + } + + absx = sign ? -x : x; + + /* handle the error of x + g - 0.5 */ + y = absx + gmhalf; + if (absx > gmhalf) { + dy = y - absx; + dy -= gmhalf; + } else { + dy = y - gmhalf; + dy -= absx; + } + + z = absx - 0.5; + r = S(absx) * exp(-y); + if (x < 0) { + /* reflection formula for negative x */ + /* sinpi(absx) is not 0, integers are already handled */ + r = -pi / (sinpi(absx) * absx * r); + dy = -dy; + z = -z; + } + r += dy * (gmhalf+0.5) * r / y; + z = pow(y, 0.5*z); + y = r * z * z; + return y; +} + +#if 0 +double __lgamma_r(double x, int *sign) +{ + double r, absx; + + *sign = 1; + + /* special cases */ + if (!isfinite(x)) + /* lgamma(nan)=nan, lgamma(+-inf)=inf */ + return x*x; + + /* integer arguments */ + if (x == floor(x) && x <= 2) { + /* n <= 0: lgamma(n)=inf with divbyzero */ + /* n == 1,2: lgamma(n)=0 */ + if (x <= 0) + return 1/0.0; + return 0; + } + + absx = fabs(x); + + /* lgamma(x) ~ -log(|x|) for tiny |x| */ + if (absx < 0x1p-54) { + *sign = 1 - 2*!!signbit(x); + return -log(absx); + } + + /* use tgamma for smaller |x| */ + if (absx < 128) { + x = tgamma(x); + *sign = 1 - 2*!!signbit(x); + return log(fabs(x)); + } + + /* second term (log(S)-g) could be more precise here.. */ + /* or with stirling: (|x|-0.5)*(log(|x|)-1) + poly(1/|x|) */ + r = (absx-0.5)*(log(absx+gmhalf)-1) + (log(S(absx)) - (gmhalf+0.5)); + if (x < 0) { + /* reflection formula for negative x */ + x = sinpi(absx); + *sign = 2*!!signbit(x) - 1; + r = log(pi/(fabs(x)*absx)) - r; + } + return r; +} + +weak_alias(__lgamma_r, lgamma_r); +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/tgammaf.c b/lib/mlibc/options/ansi/musl-generic-math/tgammaf.c new file mode 100644 index 0000000..b4ca51c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tgammaf.c @@ -0,0 +1,6 @@ +#include <math.h> + +float tgammaf(float x) +{ + return tgamma(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/tgammal.c b/lib/mlibc/options/ansi/musl-generic-math/tgammal.c new file mode 100644 index 0000000..5336c5b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tgammal.c @@ -0,0 +1,281 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_tgammal.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Gamma function + * + * + * SYNOPSIS: + * + * long double x, y, tgammal(); + * + * y = tgammal( x ); + * + * + * DESCRIPTION: + * + * Returns gamma function of the argument. The result is + * correctly signed. + * + * Arguments |x| <= 13 are reduced by recurrence and the function + * approximated by a rational function of degree 7/8 in the + * interval (2,3). Large arguments are handled by Stirling's + * formula. Large negative arguments are made positive using + * a reflection formula. + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE -40,+40 10000 3.6e-19 7.9e-20 + * IEEE -1755,+1755 10000 4.8e-18 6.5e-19 + * + * Accuracy for large arguments is dominated by error in powl(). + * + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double tgammal(long double x) +{ + return tgamma(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* +tgamma(x+2) = tgamma(x+2) P(x)/Q(x) +0 <= x <= 1 +Relative error +n=7, d=8 +Peak error = 1.83e-20 +Relative error spread = 8.4e-23 +*/ +static const long double P[8] = { + 4.212760487471622013093E-5L, + 4.542931960608009155600E-4L, + 4.092666828394035500949E-3L, + 2.385363243461108252554E-2L, + 1.113062816019361559013E-1L, + 3.629515436640239168939E-1L, + 8.378004301573126728826E-1L, + 1.000000000000000000009E0L, +}; +static const long double Q[9] = { +-1.397148517476170440917E-5L, + 2.346584059160635244282E-4L, +-1.237799246653152231188E-3L, +-7.955933682494738320586E-4L, + 2.773706565840072979165E-2L, +-4.633887671244534213831E-2L, +-2.243510905670329164562E-1L, + 4.150160950588455434583E-1L, + 9.999999999999999999908E-1L, +}; + +/* +static const long double P[] = { +-3.01525602666895735709e0L, +-3.25157411956062339893e1L, +-2.92929976820724030353e2L, +-1.70730828800510297666e3L, +-7.96667499622741999770e3L, +-2.59780216007146401957e4L, +-5.99650230220855581642e4L, +-7.15743521530849602425e4L +}; +static const long double Q[] = { + 1.00000000000000000000e0L, +-1.67955233807178858919e1L, + 8.85946791747759881659e1L, + 5.69440799097468430177e1L, +-1.98526250512761318471e3L, + 3.31667508019495079814e3L, + 1.60577839621734713377e4L, +-2.97045081369399940529e4L, +-7.15743521530849602412e4L +}; +*/ +#define MAXGAML 1755.455L +/*static const long double LOGPI = 1.14472988584940017414L;*/ + +/* Stirling's formula for the gamma function +tgamma(x) = sqrt(2 pi) x^(x-.5) exp(-x) (1 + 1/x P(1/x)) +z(x) = x +13 <= x <= 1024 +Relative error +n=8, d=0 +Peak error = 9.44e-21 +Relative error spread = 8.8e-4 +*/ +static const long double STIR[9] = { + 7.147391378143610789273E-4L, +-2.363848809501759061727E-5L, +-5.950237554056330156018E-4L, + 6.989332260623193171870E-5L, + 7.840334842744753003862E-4L, +-2.294719747873185405699E-4L, +-2.681327161876304418288E-3L, + 3.472222222230075327854E-3L, + 8.333333333333331800504E-2L, +}; + +#define MAXSTIR 1024.0L +static const long double SQTPI = 2.50662827463100050242E0L; + +/* 1/tgamma(x) = z P(z) + * z(x) = 1/x + * 0 < x < 0.03125 + * Peak relative error 4.2e-23 + */ +static const long double S[9] = { +-1.193945051381510095614E-3L, + 7.220599478036909672331E-3L, +-9.622023360406271645744E-3L, +-4.219773360705915470089E-2L, + 1.665386113720805206758E-1L, +-4.200263503403344054473E-2L, +-6.558780715202540684668E-1L, + 5.772156649015328608253E-1L, + 1.000000000000000000000E0L, +}; + +/* 1/tgamma(-x) = z P(z) + * z(x) = 1/x + * 0 < x < 0.03125 + * Peak relative error 5.16e-23 + * Relative error spread = 2.5e-24 + */ +static const long double SN[9] = { + 1.133374167243894382010E-3L, + 7.220837261893170325704E-3L, + 9.621911155035976733706E-3L, +-4.219773343731191721664E-2L, +-1.665386113944413519335E-1L, +-4.200263503402112910504E-2L, + 6.558780715202536547116E-1L, + 5.772156649015328608727E-1L, +-1.000000000000000000000E0L, +}; + +static const long double PIL = 3.1415926535897932384626L; + +/* Gamma function computed by Stirling's formula. + */ +static long double stirf(long double x) +{ + long double y, w, v; + + w = 1.0/x; + /* For large x, use rational coefficients from the analytical expansion. */ + if (x > 1024.0) + w = (((((6.97281375836585777429E-5L * w + + 7.84039221720066627474E-4L) * w + - 2.29472093621399176955E-4L) * w + - 2.68132716049382716049E-3L) * w + + 3.47222222222222222222E-3L) * w + + 8.33333333333333333333E-2L) * w + + 1.0; + else + w = 1.0 + w * __polevll(w, STIR, 8); + y = expl(x); + if (x > MAXSTIR) { /* Avoid overflow in pow() */ + v = powl(x, 0.5L * x - 0.25L); + y = v * (v / y); + } else { + y = powl(x, x - 0.5L) / y; + } + y = SQTPI * y * w; + return y; +} + +long double tgammal(long double x) +{ + long double p, q, z; + + if (!isfinite(x)) + return x + INFINITY; + + q = fabsl(x); + if (q > 13.0) { + if (x < 0.0) { + p = floorl(q); + z = q - p; + if (z == 0) + return 0 / z; + if (q > MAXGAML) { + z = 0; + } else { + if (z > 0.5) { + p += 1.0; + z = q - p; + } + z = q * sinl(PIL * z); + z = fabsl(z) * stirf(q); + z = PIL/z; + } + if (0.5 * p == floorl(q * 0.5)) + z = -z; + } else if (x > MAXGAML) { + z = x * 0x1p16383L; + } else { + z = stirf(x); + } + return z; + } + + z = 1.0; + while (x >= 3.0) { + x -= 1.0; + z *= x; + } + while (x < -0.03125L) { + z /= x; + x += 1.0; + } + if (x <= 0.03125L) + goto small; + while (x < 2.0) { + z /= x; + x += 1.0; + } + if (x == 2.0) + return z; + + x -= 2.0; + p = __polevll(x, P, 7); + q = __polevll(x, Q, 8); + z = z * p / q; + return z; + +small: + /* z==1 if x was originally +-0 */ + if (x == 0 && z != 1) + return x / x; + if (x < 0.0) { + x = -x; + q = z / (x * __polevll(x, SN, 8)); + } else + q = z / (x * __polevll(x, S, 8)); + return q; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double tgammal(long double x) +{ + return tgamma(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/trunc.c b/lib/mlibc/options/ansi/musl-generic-math/trunc.c new file mode 100644 index 0000000..d13711b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/trunc.c @@ -0,0 +1,19 @@ +#include "libm.h" + +double trunc(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = (int)(u.i >> 52 & 0x7ff) - 0x3ff + 12; + uint64_t m; + + if (e >= 52 + 12) + return x; + if (e < 12) + e = 1; + m = -1ULL >> e; + if ((u.i & m) == 0) + return x; + FORCE_EVAL(x + 0x1p120f); + u.i &= ~m; + return u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/truncf.c b/lib/mlibc/options/ansi/musl-generic-math/truncf.c new file mode 100644 index 0000000..1a7d03c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/truncf.c @@ -0,0 +1,19 @@ +#include "libm.h" + +float truncf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = (int)(u.i >> 23 & 0xff) - 0x7f + 9; + uint32_t m; + + if (e >= 23 + 9) + return x; + if (e < 9) + e = 1; + m = -1U >> e; + if ((u.i & m) == 0) + return x; + FORCE_EVAL(x + 0x1p120f); + u.i &= ~m; + return u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/truncl.c b/lib/mlibc/options/ansi/musl-generic-math/truncl.c new file mode 100644 index 0000000..f07b193 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/truncl.c @@ -0,0 +1,34 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double truncl(long double x) +{ + return trunc(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double truncl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + int s = u.i.se >> 15; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1) + return x; + if (e <= 0x3fff-1) { + FORCE_EVAL(x + 0x1p120f); + return x*0; + } + /* y = int(|x|) - |x|, where int(|x|) is an integer neighbor of |x| */ + if (s) + x = -x; + y = x + toint - toint - x; + if (y > 0) + y -= 1; + x += y; + return s ? -x : x; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/weak_alias.h b/lib/mlibc/options/ansi/musl-generic-math/weak_alias.h new file mode 100644 index 0000000..785f9d1 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/weak_alias.h @@ -0,0 +1,7 @@ +#ifndef _WEAK_ALIAS_H +#define _WEAK_ALIAS_H + +#define weak_alias(name, alias_to) \ + extern __typeof (name) alias_to __attribute__((__weak__, __alias__(#name))); + +#endif diff --git a/lib/mlibc/options/bsd/generic/arpa-nameser-stubs.cpp b/lib/mlibc/options/bsd/generic/arpa-nameser-stubs.cpp new file mode 100644 index 0000000..e89f2bb --- /dev/null +++ b/lib/mlibc/options/bsd/generic/arpa-nameser-stubs.cpp @@ -0,0 +1,41 @@ +#include <errno.h> +#include <arpa/nameser.h> +#include <bits/ensure.h> +#include <mlibc/debug.hpp> + +// The ns_get* and ns_put* functions are taken from musl. +unsigned ns_get16(const unsigned char *cp) { + return cp[0] << 8 | cp[1]; +} + +unsigned long ns_get32(const unsigned char *cp) { + return (unsigned)cp[0] << 24 | cp[1] << 16 | cp[2] << 8 | cp[3]; +} + +void ns_put16(unsigned s, unsigned char *cp) { + *cp++ = s >> 8; + *cp++ = s; +} + +void ns_put32(unsigned long l, unsigned char *cp) { + *cp++ = l >> 24; + *cp++ = l >> 16; + *cp++ = l >> 8; + *cp++ = l; +} + +int ns_initparse(const unsigned char *, int, ns_msg *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int ns_parserr(ns_msg *, ns_sect, int, ns_rr *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int ns_name_uncompress(const unsigned char *, const unsigned char *, + const unsigned char *, char *, size_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/bsd/generic/ether.cpp b/lib/mlibc/options/bsd/generic/ether.cpp new file mode 100644 index 0000000..2619320 --- /dev/null +++ b/lib/mlibc/options/bsd/generic/ether.cpp @@ -0,0 +1,19 @@ +#include <stdio.h> +#include <bits/ensure.h> +#include <netinet/ether.h> + +char *ether_ntoa_r(const struct ether_addr *addr, char *buf) { + char *orig_ptr = buf; + + for(int i = 0; i < ETH_ALEN; i++) { + buf += sprintf(buf, i == 0 ? "%.2X" : ":%.2X", addr->ether_addr_octet[i]); + } + + return orig_ptr; +} + + +struct ether_addr *ether_aton(const char *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/bsd/generic/getopt.cpp b/lib/mlibc/options/bsd/generic/getopt.cpp new file mode 100644 index 0000000..cc124ef --- /dev/null +++ b/lib/mlibc/options/bsd/generic/getopt.cpp @@ -0,0 +1,8 @@ +#include <getopt.h> + +#if __MLIBC_GLIBC_OPTION + +int __optreset = 0; +extern int optreset __attribute__((__weak__, __alias__("__optreset"))); + +#endif //__MLIBC_GLIBC_OPTION diff --git a/lib/mlibc/options/bsd/include/arpa/nameser.h b/lib/mlibc/options/bsd/include/arpa/nameser.h new file mode 100644 index 0000000..aabb26d --- /dev/null +++ b/lib/mlibc/options/bsd/include/arpa/nameser.h @@ -0,0 +1,266 @@ +#ifndef _ARPA_NAMESER_H +#define _ARPA_NAMESER_H + +#include <stdint.h> +#include <bits/size_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#define NS_PACKETSZ 512 +#define NS_MAXDNAME 1025 +#define NS_MAXLABEL 63 + +typedef enum __ns_rcode { + ns_r_noerror = 0, + ns_r_formerr = 1, + ns_r_servfail = 2, + ns_r_nxdomain = 3, + ns_r_notimpl = 4, + ns_r_refused = 5, + ns_r_yxdomain = 6, + ns_r_yxrrset = 7, + ns_r_nxrrset = 8, + ns_r_notauth = 9, + ns_r_notzone = 10, + ns_r_max = 11, + ns_r_badvers = 16, + ns_r_badsig = 16, + ns_r_badkey = 17, + ns_r_badtime = 18 +} ns_rcode; + +typedef enum __ns_type { + ns_t_invalid = 0, + ns_t_a = 1, + ns_t_ns = 2, + ns_t_md = 3, + ns_t_mf = 4, + ns_t_cname = 5, + ns_t_soa = 6, + ns_t_mb = 7, + ns_t_mg = 8, + ns_t_mr = 9, + ns_t_null = 10, + ns_t_wks = 11, + ns_t_ptr = 12, + ns_t_hinfo = 13, + ns_t_minfo = 14, + ns_t_mx = 15, + ns_t_txt = 16, + ns_t_rp = 17, + ns_t_afsdb = 18, + ns_t_x25 = 19, + ns_t_isdn = 20, + ns_t_rt = 21, + ns_t_nsap = 22, + ns_t_nsap_ptr = 23, + ns_t_sig = 24, + ns_t_key = 25, + ns_t_px = 26, + ns_t_gpos = 27, + ns_t_aaaa = 28, + ns_t_loc = 29, + ns_t_nxt = 30, + ns_t_eid = 31, + ns_t_nimloc = 32, + ns_t_srv = 33, + ns_t_atma = 34, + ns_t_naptr = 35, + ns_t_kx = 36, + ns_t_cert = 37, + ns_t_a6 = 38, + ns_t_dname = 39, + ns_t_sink = 40, + ns_t_opt = 41, + ns_t_apl = 42, + ns_t_tkey = 249, + ns_t_tsig = 250, + ns_t_ixfr = 251, + ns_t_axfr = 252, + ns_t_mailb = 253, + ns_t_maila = 254, + ns_t_any = 255, + ns_t_zxfr = 256, + ns_t_max = 65536 +} ns_type; + +typedef enum __ns_class { + ns_c_invalid = 0, + ns_c_in = 1, + ns_c_2 = 2, + ns_c_chaos = 3, + ns_c_hs = 4, + ns_c_none = 254, + ns_c_any = 255, + ns_c_max = 65536 +} ns_class; + +typedef enum __ns_sect { + ns_s_qd = 0, + ns_s_zn = 0, + ns_s_an = 1, + ns_s_pr = 1, + ns_s_ns = 2, + ns_s_ud = 2, + ns_s_ar = 3, + ns_s_max = 4 +} ns_sect; + +typedef struct __ns_msg { + const unsigned char *_msg, *_eom; + uint16_t _id, _flags, _counts[ns_s_max]; + const unsigned char *_sections[ns_s_max]; + ns_sect _sect; + int _rrnum; + const unsigned char *_msg_ptr; +} ns_msg; + +#define ns_msg_id(handle) ((handle)._id + 0) +#define ns_msg_base(handle) ((handle)._msg + 0) +#define ns_msg_end(handle) ((handle)._eom + 0) +#define ns_msg_size(handle) ((handle)._eom - (handle)._msg) +#define ns_msg_count(handle, section) ((handle)._counts[section] + 0) + +typedef struct __ns_rr { + char name[NS_MAXDNAME]; + uint16_t type; + uint16_t rr_class; + uint32_t ttl; + uint16_t rdlength; + const unsigned char *rdata; +} ns_rr; + +#define ns_rr_name(rr) (((rr).name[0] != '\0') ? (rr).name : ".") +#define ns_rr_type(rr) ((ns_type)((rr).type + 0)) +#define ns_rr_class(rr) ((ns_class)((rr).rr_class + 0)) +#define ns_rr_ttl(rr) ((rr).ttl + 0) +#define ns_rr_rdlen(rr) ((rr).rdlength + 0) +#define ns_rr_rdata(rr) ((rr).rdata + 0) + +#ifndef __MLIBC_ABI_ONLY + +#define NS_GET16(s, cp) (void)((s) = ns_get16(((cp) += 2) - 2)) +#define NS_GET32(l, cp) (void)((l) = ns_get32(((cp) += 4) - 4)) +#define NS_PUT16(s, cp) ns_put16((s), ((cp) += 2) - 2) +#define NS_PUT32(l, cp) ns_put32((l), ((cp) += 4) - 4) + +unsigned ns_get16(const unsigned char *); +unsigned long ns_get32(const unsigned char *); +void ns_put16(unsigned, unsigned char *); +void ns_put32(unsigned long, unsigned char *); + +int ns_initparse(const unsigned char *msg, int msglen, ns_msg *handle); +int ns_parserr(ns_msg *msg, ns_sect section, int rrnum, ns_rr *rr); +int ns_name_uncompress(const unsigned char *msg, const unsigned char *eom, + const unsigned char *src, char *dst, size_t dstsize); + +#endif /* !__MLIBC_ABI_ONLY */ + +typedef struct { + unsigned id :16; +#if __BYTE_ORDER == __BIG_ENDIAN + unsigned qr: 1; + unsigned opcode: 4; + unsigned aa: 1; + unsigned tc: 1; + unsigned rd: 1; + unsigned ra: 1; + unsigned unused :1; + unsigned ad: 1; + unsigned cd: 1; + unsigned rcode :4; +#else + unsigned rd :1; + unsigned tc :1; + unsigned aa :1; + unsigned opcode :4; + unsigned qr :1; + unsigned rcode :4; + unsigned cd: 1; + unsigned ad: 1; + unsigned unused :1; + unsigned ra :1; +#endif + unsigned qdcount :16; + unsigned ancount :16; + unsigned nscount :16; + unsigned arcount :16; +} HEADER; + +#define PACKETSZ NS_PACKETSZ +#define MAXDNAME NS_MAXDNAME + +#define NOERROR ns_r_noerror +#define FORMERR ns_r_formerr +#define SERVFAIL ns_r_servfail +#define NXDOMAIN ns_r_nxdomain +#define NOTIMP ns_r_notimpl +#define REFUSED ns_r_refused +#define YXDOMAIN ns_r_yxdomain +#define YXRRSET ns_r_yxrrset +#define NXRRSET ns_r_nxrrset +#define NOTAUTH ns_r_notauth +#define NOTZONE ns_r_notzone + +#define T_A ns_t_a +#define T_NS ns_t_ns +#define T_MD ns_t_md +#define T_MF ns_t_mf +#define T_CNAME ns_t_cname +#define T_SOA ns_t_soa +#define T_MB ns_t_mb +#define T_MG ns_t_mg +#define T_MR ns_t_mr +#define T_NULL ns_t_null +#define T_WKS ns_t_wks +#define T_PTR ns_t_ptr +#define T_HINFO ns_t_hinfo +#define T_MINFO ns_t_minfo +#define T_MX ns_t_mx +#define T_TXT ns_t_txt +#define T_RP ns_t_rp +#define T_AFSDB ns_t_afsdb +#define T_X25 ns_t_x25 +#define T_ISDN ns_t_isdn +#define T_RT ns_t_rt +#define T_NSAP ns_t_nsap +#define T_NSAP_PTR ns_t_nsap_ptr +#define T_SIG ns_t_sig +#define T_KEY ns_t_key +#define T_PX ns_t_px +#define T_GPOS ns_t_gpos +#define T_AAAA ns_t_aaaa +#define T_LOC ns_t_loc +#define T_NXT ns_t_nxt +#define T_EID ns_t_eid +#define T_NIMLOC ns_t_nimloc +#define T_SRV ns_t_srv +#define T_ATMA ns_t_atma +#define T_NAPTR ns_t_naptr +#define T_A6 ns_t_a6 +#define T_DNAME ns_t_dname +#define T_TSIG ns_t_tsig +#define T_IXFR ns_t_ixfr +#define T_AXFR ns_t_axfr +#define T_MAILB ns_t_mailb +#define T_MAILA ns_t_maila +#define T_ANY ns_t_any + +#define C_IN ns_c_in +#define C_CHAOS ns_c_chaos +#define C_HS ns_c_hs +#define C_NONE ns_c_none +#define C_ANY ns_c_any + +#define GETSHORT NS_GET16 +#define GETLONG NS_GET32 +#define PUTSHORT NS_PUT16 +#define PUTLONG NS_PUT32 + +#ifdef __cplusplus +} +#endif + +#endif // _ARPA_NAMESER_H diff --git a/lib/mlibc/options/bsd/include/arpa/nameser_compat.h b/lib/mlibc/options/bsd/include/arpa/nameser_compat.h new file mode 100644 index 0000000..ee3b1a9 --- /dev/null +++ b/lib/mlibc/options/bsd/include/arpa/nameser_compat.h @@ -0,0 +1 @@ +#include <arpa/nameser.h> diff --git a/lib/mlibc/options/bsd/include/bits/bsd/bsd_unistd.h b/lib/mlibc/options/bsd/include/bits/bsd/bsd_unistd.h new file mode 100644 index 0000000..2fe0391 --- /dev/null +++ b/lib/mlibc/options/bsd/include/bits/bsd/bsd_unistd.h @@ -0,0 +1,20 @@ +#ifndef _BSD_UNISTD_H +#define _BSD_UNISTD_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <stdint.h> + +#ifndef __MLIBC_ABI_ONLY + +void *sbrk(intptr_t increment); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* _BSD_UNISTD_H */ diff --git a/lib/mlibc/options/bsd/include/fstab.h b/lib/mlibc/options/bsd/include/fstab.h new file mode 100644 index 0000000..2a445f0 --- /dev/null +++ b/lib/mlibc/options/bsd/include/fstab.h @@ -0,0 +1,23 @@ +#ifndef _FSTAB_H +#define _FSTAB_H + +#define _PATH_FSTAB "/etc/fstab" +#define FSTAB "/etc/fstab" + +#define FSTAB_RW "rw" +#define FSTAB_RQ "rq" +#define FSTAB_RO "ro" +#define FSTAB_SW "sw" +#define FSTAB_XX "xx" + +struct fstab { + char *fs_spec; + char *fs_file; + char *fs_vfstype; + char *fs_mntops; + const char *fs_type; + int fs_freq; + int fs_passno; +}; + +#endif /* _FSTAB_H */ diff --git a/lib/mlibc/options/bsd/include/mlibc/bsd-sysdeps.hpp b/lib/mlibc/options/bsd/include/mlibc/bsd-sysdeps.hpp new file mode 100644 index 0000000..de3ada0 --- /dev/null +++ b/lib/mlibc/options/bsd/include/mlibc/bsd-sysdeps.hpp @@ -0,0 +1,10 @@ +#ifndef MLIBC_BSD_SYSDEPS +#define MLIBC_BSD_SYSDEPS + +namespace [[gnu::visibility("hidden")]] mlibc { + +[[gnu::weak]] int sys_brk(void **out); + +} // namespace mlibc + +#endif // MLIBC_BSD_SYSDEPS diff --git a/lib/mlibc/options/bsd/include/netinet/ether.h b/lib/mlibc/options/bsd/include/netinet/ether.h new file mode 100644 index 0000000..4be14ad --- /dev/null +++ b/lib/mlibc/options/bsd/include/netinet/ether.h @@ -0,0 +1,23 @@ +#ifndef _NETINET_ETHER_H +#define _NETINET_ETHER_H + +#include <bits/ether_addr.h> +#include <netinet/if_ether.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +char *ether_ntoa_r(const struct ether_addr *p_a, char *x); + +struct ether_addr *ether_aton(const char *asc); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif //_NETINET_ETHER_H diff --git a/lib/mlibc/options/bsd/include/sys/queue.h b/lib/mlibc/options/bsd/include/sys/queue.h new file mode 100644 index 0000000..7006b05 --- /dev/null +++ b/lib/mlibc/options/bsd/include/sys/queue.h @@ -0,0 +1,574 @@ +/* + * Copyright (c) 1991, 1993 + * The Regents of the University of California. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. Neither the name of the University nor the names of its contributors + * may be used to endorse or promote products derived from this software + * without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE REGENTS AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + * + * @(#)queue.h 8.5 (Berkeley) 8/20/94 + */ + +#ifndef _SYS_QUEUE_H_ +#define _SYS_QUEUE_H_ + +/* + * This file defines five types of data structures: singly-linked lists, + * lists, simple queues, tail queues, and circular queues. + * + * A singly-linked list is headed by a single forward pointer. The + * elements are singly linked for minimum space and pointer manipulation + * overhead at the expense of O(n) removal for arbitrary elements. New + * elements can be added to the list after an existing element or at the + * head of the list. Elements being removed from the head of the list + * should use the explicit macro for this purpose for optimum + * efficiency. A singly-linked list may only be traversed in the forward + * direction. Singly-linked lists are ideal for applications with large + * datasets and few or no removals or for implementing a LIFO queue. + * + * A list is headed by a single forward pointer (or an array of forward + * pointers for a hash table header). The elements are doubly linked + * so that an arbitrary element can be removed without a need to + * traverse the list. New elements can be added to the list before + * or after an existing element or at the head of the list. A list + * may only be traversed in the forward direction. + * + * A simple queue is headed by a pair of pointers, one the head of the + * list and the other to the tail of the list. The elements are singly + * linked to save space, so elements can only be removed from the + * head of the list. New elements can be added to the list after + * an existing element, at the head of the list, or at the end of the + * list. A simple queue may only be traversed in the forward direction. + * + * A tail queue is headed by a pair of pointers, one to the head of the + * list and the other to the tail of the list. The elements are doubly + * linked so that an arbitrary element can be removed without a need to + * traverse the list. New elements can be added to the list before or + * after an existing element, at the head of the list, or at the end of + * the list. A tail queue may be traversed in either direction. + * + * A circle queue is headed by a pair of pointers, one to the head of the + * list and the other to the tail of the list. The elements are doubly + * linked so that an arbitrary element can be removed without a need to + * traverse the list. New elements can be added to the list before or after + * an existing element, at the head of the list, or at the end of the list. + * A circle queue may be traversed in either direction, but has a more + * complex end of list detection. + * + * For details on the use of these macros, see the queue(3) manual page. + */ + +/* + * List definitions. + */ +#define LIST_HEAD(name, type) \ +struct name { \ + struct type *lh_first; /* first element */ \ +} + +#define LIST_HEAD_INITIALIZER(head) \ + { NULL } + +#define LIST_ENTRY(type) \ +struct { \ + struct type *le_next; /* next element */ \ + struct type **le_prev; /* address of previous next element */ \ +} + +/* + * List functions. + */ +#define LIST_INIT(head) do { \ + (head)->lh_first = NULL; \ +} while (0) + +#define LIST_INSERT_AFTER(listelm, elm, field) do { \ + if (((elm)->field.le_next = (listelm)->field.le_next) != NULL) \ + (listelm)->field.le_next->field.le_prev = \ + &(elm)->field.le_next; \ + (listelm)->field.le_next = (elm); \ + (elm)->field.le_prev = &(listelm)->field.le_next; \ +} while (0) + +#define LIST_INSERT_BEFORE(listelm, elm, field) do { \ + (elm)->field.le_prev = (listelm)->field.le_prev; \ + (elm)->field.le_next = (listelm); \ + *(listelm)->field.le_prev = (elm); \ + (listelm)->field.le_prev = &(elm)->field.le_next; \ +} while (0) + +#define LIST_INSERT_HEAD(head, elm, field) do { \ + if (((elm)->field.le_next = (head)->lh_first) != NULL) \ + (head)->lh_first->field.le_prev = &(elm)->field.le_next;\ + (head)->lh_first = (elm); \ + (elm)->field.le_prev = &(head)->lh_first; \ +} while (0) + +#define LIST_REMOVE(elm, field) do { \ + if ((elm)->field.le_next != NULL) \ + (elm)->field.le_next->field.le_prev = \ + (elm)->field.le_prev; \ + *(elm)->field.le_prev = (elm)->field.le_next; \ +} while (0) + +#define LIST_FOREACH(var, head, field) \ + for ((var) = ((head)->lh_first); \ + (var); \ + (var) = ((var)->field.le_next)) + +/* + * List access methods. + */ +#define LIST_EMPTY(head) ((head)->lh_first == NULL) +#define LIST_FIRST(head) ((head)->lh_first) +#define LIST_NEXT(elm, field) ((elm)->field.le_next) + + +/* + * Singly-linked List definitions. + */ +#define SLIST_HEAD(name, type) \ +struct name { \ + struct type *slh_first; /* first element */ \ +} + +#define SLIST_HEAD_INITIALIZER(head) \ + { NULL } + +#define SLIST_ENTRY(type) \ +struct { \ + struct type *sle_next; /* next element */ \ +} + +/* + * Singly-linked List functions. + */ +#define SLIST_INIT(head) do { \ + (head)->slh_first = NULL; \ +} while (0) + +#define SLIST_INSERT_AFTER(slistelm, elm, field) do { \ + (elm)->field.sle_next = (slistelm)->field.sle_next; \ + (slistelm)->field.sle_next = (elm); \ +} while (0) + +#define SLIST_INSERT_HEAD(head, elm, field) do { \ + (elm)->field.sle_next = (head)->slh_first; \ + (head)->slh_first = (elm); \ +} while (0) + +#define SLIST_REMOVE_HEAD(head, field) do { \ + (head)->slh_first = (head)->slh_first->field.sle_next; \ +} while (0) + +#define SLIST_REMOVE(head, elm, type, field) do { \ + if ((head)->slh_first == (elm)) { \ + SLIST_REMOVE_HEAD((head), field); \ + } \ + else { \ + struct type *curelm = (head)->slh_first; \ + while(curelm->field.sle_next != (elm)) \ + curelm = curelm->field.sle_next; \ + curelm->field.sle_next = \ + curelm->field.sle_next->field.sle_next; \ + } \ +} while (0) + +#define SLIST_FOREACH(var, head, field) \ + for((var) = (head)->slh_first; (var); (var) = (var)->field.sle_next) + +/* + * Singly-linked List access methods. + */ +#define SLIST_EMPTY(head) ((head)->slh_first == NULL) +#define SLIST_FIRST(head) ((head)->slh_first) +#define SLIST_NEXT(elm, field) ((elm)->field.sle_next) + + +/* + * Singly-linked Tail queue declarations. + */ +#define STAILQ_HEAD(name, type) \ +struct name { \ + struct type *stqh_first; /* first element */ \ + struct type **stqh_last; /* addr of last next element */ \ +} + +#define STAILQ_HEAD_INITIALIZER(head) \ + { NULL, &(head).stqh_first } + +#define STAILQ_ENTRY(type) \ +struct { \ + struct type *stqe_next; /* next element */ \ +} + +/* + * Singly-linked Tail queue functions. + */ +#define STAILQ_INIT(head) do { \ + (head)->stqh_first = NULL; \ + (head)->stqh_last = &(head)->stqh_first; \ +} while (0) + +#define STAILQ_INSERT_HEAD(head, elm, field) do { \ + if (((elm)->field.stqe_next = (head)->stqh_first) == NULL) \ + (head)->stqh_last = &(elm)->field.stqe_next; \ + (head)->stqh_first = (elm); \ +} while (0) + +#define STAILQ_INSERT_TAIL(head, elm, field) do { \ + (elm)->field.stqe_next = NULL; \ + *(head)->stqh_last = (elm); \ + (head)->stqh_last = &(elm)->field.stqe_next; \ +} while (0) + +#define STAILQ_INSERT_AFTER(head, listelm, elm, field) do { \ + if (((elm)->field.stqe_next = (listelm)->field.stqe_next) == NULL)\ + (head)->stqh_last = &(elm)->field.stqe_next; \ + (listelm)->field.stqe_next = (elm); \ +} while (0) + +#define STAILQ_REMOVE_HEAD(head, field) do { \ + if (((head)->stqh_first = (head)->stqh_first->field.stqe_next) == NULL) \ + (head)->stqh_last = &(head)->stqh_first; \ +} while (0) + +#define STAILQ_REMOVE(head, elm, type, field) do { \ + if ((head)->stqh_first == (elm)) { \ + STAILQ_REMOVE_HEAD((head), field); \ + } else { \ + struct type *curelm = (head)->stqh_first; \ + while (curelm->field.stqe_next != (elm)) \ + curelm = curelm->field.stqe_next; \ + if ((curelm->field.stqe_next = \ + curelm->field.stqe_next->field.stqe_next) == NULL) \ + (head)->stqh_last = &(curelm)->field.stqe_next; \ + } \ +} while (0) + +#define STAILQ_FOREACH(var, head, field) \ + for ((var) = ((head)->stqh_first); \ + (var); \ + (var) = ((var)->field.stqe_next)) + +#define STAILQ_CONCAT(head1, head2) do { \ + if (!STAILQ_EMPTY((head2))) { \ + *(head1)->stqh_last = (head2)->stqh_first; \ + (head1)->stqh_last = (head2)->stqh_last; \ + STAILQ_INIT((head2)); \ + } \ +} while (0) + +/* + * Singly-linked Tail queue access methods. + */ +#define STAILQ_EMPTY(head) ((head)->stqh_first == NULL) +#define STAILQ_FIRST(head) ((head)->stqh_first) +#define STAILQ_NEXT(elm, field) ((elm)->field.stqe_next) + + +/* + * Simple queue definitions. + */ +#define SIMPLEQ_HEAD(name, type) \ +struct name { \ + struct type *sqh_first; /* first element */ \ + struct type **sqh_last; /* addr of last next element */ \ +} + +#define SIMPLEQ_HEAD_INITIALIZER(head) \ + { NULL, &(head).sqh_first } + +#define SIMPLEQ_ENTRY(type) \ +struct { \ + struct type *sqe_next; /* next element */ \ +} + +/* + * Simple queue functions. + */ +#define SIMPLEQ_INIT(head) do { \ + (head)->sqh_first = NULL; \ + (head)->sqh_last = &(head)->sqh_first; \ +} while (0) + +#define SIMPLEQ_INSERT_HEAD(head, elm, field) do { \ + if (((elm)->field.sqe_next = (head)->sqh_first) == NULL) \ + (head)->sqh_last = &(elm)->field.sqe_next; \ + (head)->sqh_first = (elm); \ +} while (0) + +#define SIMPLEQ_INSERT_TAIL(head, elm, field) do { \ + (elm)->field.sqe_next = NULL; \ + *(head)->sqh_last = (elm); \ + (head)->sqh_last = &(elm)->field.sqe_next; \ +} while (0) + +#define SIMPLEQ_INSERT_AFTER(head, listelm, elm, field) do { \ + if (((elm)->field.sqe_next = (listelm)->field.sqe_next) == NULL)\ + (head)->sqh_last = &(elm)->field.sqe_next; \ + (listelm)->field.sqe_next = (elm); \ +} while (0) + +#define SIMPLEQ_REMOVE_HEAD(head, field) do { \ + if (((head)->sqh_first = (head)->sqh_first->field.sqe_next) == NULL) \ + (head)->sqh_last = &(head)->sqh_first; \ +} while (0) + +#define SIMPLEQ_REMOVE(head, elm, type, field) do { \ + if ((head)->sqh_first == (elm)) { \ + SIMPLEQ_REMOVE_HEAD((head), field); \ + } else { \ + struct type *curelm = (head)->sqh_first; \ + while (curelm->field.sqe_next != (elm)) \ + curelm = curelm->field.sqe_next; \ + if ((curelm->field.sqe_next = \ + curelm->field.sqe_next->field.sqe_next) == NULL) \ + (head)->sqh_last = &(curelm)->field.sqe_next; \ + } \ +} while (0) + +#define SIMPLEQ_FOREACH(var, head, field) \ + for ((var) = ((head)->sqh_first); \ + (var); \ + (var) = ((var)->field.sqe_next)) + +/* + * Simple queue access methods. + */ +#define SIMPLEQ_EMPTY(head) ((head)->sqh_first == NULL) +#define SIMPLEQ_FIRST(head) ((head)->sqh_first) +#define SIMPLEQ_NEXT(elm, field) ((elm)->field.sqe_next) + + +/* + * Tail queue definitions. + */ +#define _TAILQ_HEAD(name, type, qual) \ +struct name { \ + qual type *tqh_first; /* first element */ \ + qual type *qual *tqh_last; /* addr of last next element */ \ +} +#define TAILQ_HEAD(name, type) _TAILQ_HEAD(name, struct type,) + +#define TAILQ_HEAD_INITIALIZER(head) \ + { NULL, &(head).tqh_first } + +#define _TAILQ_ENTRY(type, qual) \ +struct { \ + qual type *tqe_next; /* next element */ \ + qual type *qual *tqe_prev; /* address of previous next element */\ +} +#define TAILQ_ENTRY(type) _TAILQ_ENTRY(struct type,) + +/* + * Tail queue functions. + */ +#define TAILQ_INIT(head) do { \ + (head)->tqh_first = NULL; \ + (head)->tqh_last = &(head)->tqh_first; \ +} while (0) + +#define TAILQ_INSERT_HEAD(head, elm, field) do { \ + if (((elm)->field.tqe_next = (head)->tqh_first) != NULL) \ + (head)->tqh_first->field.tqe_prev = \ + &(elm)->field.tqe_next; \ + else \ + (head)->tqh_last = &(elm)->field.tqe_next; \ + (head)->tqh_first = (elm); \ + (elm)->field.tqe_prev = &(head)->tqh_first; \ +} while (0) + +#define TAILQ_INSERT_TAIL(head, elm, field) do { \ + (elm)->field.tqe_next = NULL; \ + (elm)->field.tqe_prev = (head)->tqh_last; \ + *(head)->tqh_last = (elm); \ + (head)->tqh_last = &(elm)->field.tqe_next; \ +} while (0) + +#define TAILQ_INSERT_AFTER(head, listelm, elm, field) do { \ + if (((elm)->field.tqe_next = (listelm)->field.tqe_next) != NULL)\ + (elm)->field.tqe_next->field.tqe_prev = \ + &(elm)->field.tqe_next; \ + else \ + (head)->tqh_last = &(elm)->field.tqe_next; \ + (listelm)->field.tqe_next = (elm); \ + (elm)->field.tqe_prev = &(listelm)->field.tqe_next; \ +} while (0) + +#define TAILQ_INSERT_BEFORE(listelm, elm, field) do { \ + (elm)->field.tqe_prev = (listelm)->field.tqe_prev; \ + (elm)->field.tqe_next = (listelm); \ + *(listelm)->field.tqe_prev = (elm); \ + (listelm)->field.tqe_prev = &(elm)->field.tqe_next; \ +} while (0) + +#define TAILQ_REMOVE(head, elm, field) do { \ + if (((elm)->field.tqe_next) != NULL) \ + (elm)->field.tqe_next->field.tqe_prev = \ + (elm)->field.tqe_prev; \ + else \ + (head)->tqh_last = (elm)->field.tqe_prev; \ + *(elm)->field.tqe_prev = (elm)->field.tqe_next; \ +} while (0) + +#define TAILQ_FOREACH(var, head, field) \ + for ((var) = ((head)->tqh_first); \ + (var); \ + (var) = ((var)->field.tqe_next)) + +#define TAILQ_FOREACH_REVERSE(var, head, headname, field) \ + for ((var) = (*(((struct headname *)((head)->tqh_last))->tqh_last)); \ + (var); \ + (var) = (*(((struct headname *)((var)->field.tqe_prev))->tqh_last))) + +#define TAILQ_CONCAT(head1, head2, field) do { \ + if (!TAILQ_EMPTY(head2)) { \ + *(head1)->tqh_last = (head2)->tqh_first; \ + (head2)->tqh_first->field.tqe_prev = (head1)->tqh_last; \ + (head1)->tqh_last = (head2)->tqh_last; \ + TAILQ_INIT((head2)); \ + } \ +} while (0) + +/* + * Tail queue access methods. + */ +#define TAILQ_EMPTY(head) ((head)->tqh_first == NULL) +#define TAILQ_FIRST(head) ((head)->tqh_first) +#define TAILQ_NEXT(elm, field) ((elm)->field.tqe_next) + +#define TAILQ_LAST(head, headname) \ + (*(((struct headname *)((head)->tqh_last))->tqh_last)) +#define TAILQ_PREV(elm, headname, field) \ + (*(((struct headname *)((elm)->field.tqe_prev))->tqh_last)) + + +/* + * Circular queue definitions. + */ +#define CIRCLEQ_HEAD(name, type) \ +struct name { \ + struct type *cqh_first; /* first element */ \ + struct type *cqh_last; /* last element */ \ +} + +#define CIRCLEQ_HEAD_INITIALIZER(head) \ + { (void *)&head, (void *)&head } + +#define CIRCLEQ_ENTRY(type) \ +struct { \ + struct type *cqe_next; /* next element */ \ + struct type *cqe_prev; /* previous element */ \ +} + +/* + * Circular queue functions. + */ +#define CIRCLEQ_INIT(head) do { \ + (head)->cqh_first = (void *)(head); \ + (head)->cqh_last = (void *)(head); \ +} while (0) + +#define CIRCLEQ_INSERT_AFTER(head, listelm, elm, field) do { \ + (elm)->field.cqe_next = (listelm)->field.cqe_next; \ + (elm)->field.cqe_prev = (listelm); \ + if ((listelm)->field.cqe_next == (void *)(head)) \ + (head)->cqh_last = (elm); \ + else \ + (listelm)->field.cqe_next->field.cqe_prev = (elm); \ + (listelm)->field.cqe_next = (elm); \ +} while (0) + +#define CIRCLEQ_INSERT_BEFORE(head, listelm, elm, field) do { \ + (elm)->field.cqe_next = (listelm); \ + (elm)->field.cqe_prev = (listelm)->field.cqe_prev; \ + if ((listelm)->field.cqe_prev == (void *)(head)) \ + (head)->cqh_first = (elm); \ + else \ + (listelm)->field.cqe_prev->field.cqe_next = (elm); \ + (listelm)->field.cqe_prev = (elm); \ +} while (0) + +#define CIRCLEQ_INSERT_HEAD(head, elm, field) do { \ + (elm)->field.cqe_next = (head)->cqh_first; \ + (elm)->field.cqe_prev = (void *)(head); \ + if ((head)->cqh_last == (void *)(head)) \ + (head)->cqh_last = (elm); \ + else \ + (head)->cqh_first->field.cqe_prev = (elm); \ + (head)->cqh_first = (elm); \ +} while (0) + +#define CIRCLEQ_INSERT_TAIL(head, elm, field) do { \ + (elm)->field.cqe_next = (void *)(head); \ + (elm)->field.cqe_prev = (head)->cqh_last; \ + if ((head)->cqh_first == (void *)(head)) \ + (head)->cqh_first = (elm); \ + else \ + (head)->cqh_last->field.cqe_next = (elm); \ + (head)->cqh_last = (elm); \ +} while (0) + +#define CIRCLEQ_REMOVE(head, elm, field) do { \ + if ((elm)->field.cqe_next == (void *)(head)) \ + (head)->cqh_last = (elm)->field.cqe_prev; \ + else \ + (elm)->field.cqe_next->field.cqe_prev = \ + (elm)->field.cqe_prev; \ + if ((elm)->field.cqe_prev == (void *)(head)) \ + (head)->cqh_first = (elm)->field.cqe_next; \ + else \ + (elm)->field.cqe_prev->field.cqe_next = \ + (elm)->field.cqe_next; \ +} while (0) + +#define CIRCLEQ_FOREACH(var, head, field) \ + for ((var) = ((head)->cqh_first); \ + (var) != (const void *)(head); \ + (var) = ((var)->field.cqe_next)) + +#define CIRCLEQ_FOREACH_REVERSE(var, head, field) \ + for ((var) = ((head)->cqh_last); \ + (var) != (const void *)(head); \ + (var) = ((var)->field.cqe_prev)) + +/* + * Circular queue access methods. + */ +#define CIRCLEQ_EMPTY(head) ((head)->cqh_first == (void *)(head)) +#define CIRCLEQ_FIRST(head) ((head)->cqh_first) +#define CIRCLEQ_LAST(head) ((head)->cqh_last) +#define CIRCLEQ_NEXT(elm, field) ((elm)->field.cqe_next) +#define CIRCLEQ_PREV(elm, field) ((elm)->field.cqe_prev) + +#define CIRCLEQ_LOOP_NEXT(head, elm, field) \ + (((elm)->field.cqe_next == (void *)(head)) \ + ? ((head)->cqh_first) \ + : (elm->field.cqe_next)) +#define CIRCLEQ_LOOP_PREV(head, elm, field) \ + (((elm)->field.cqe_prev == (void *)(head)) \ + ? ((head)->cqh_last) \ + : (elm->field.cqe_prev)) + +#endif // _SYS_QUEUE_H_ diff --git a/lib/mlibc/options/bsd/meson.build b/lib/mlibc/options/bsd/meson.build new file mode 100644 index 0000000..3a7c911 --- /dev/null +++ b/lib/mlibc/options/bsd/meson.build @@ -0,0 +1,32 @@ +if disable_bsd_option + subdir_done() +endif + +libc_sources += files( + 'generic/arpa-nameser-stubs.cpp', + 'generic/ether.cpp', + 'generic/getopt.cpp', +) + +if not no_headers + install_headers( + 'include/fstab.h', + ) + install_headers( + 'include/arpa/nameser.h', + 'include/arpa/nameser_compat.h', + subdir: 'arpa' + ) + install_headers( + 'include/sys/queue.h', + subdir: 'sys' + ) + install_headers( + 'include/netinet/ether.h', + subdir: 'netinet' + ) + install_headers( + 'include/bits/bsd/bsd_unistd.h', + subdir: 'bits/bsd' + ) +endif diff --git a/lib/mlibc/options/crypt/generic/crypt-stubs.cpp b/lib/mlibc/options/crypt/generic/crypt-stubs.cpp new file mode 100644 index 0000000..65e0d23 --- /dev/null +++ b/lib/mlibc/options/crypt/generic/crypt-stubs.cpp @@ -0,0 +1,7 @@ +#include <crypt.h> +#include <bits/ensure.h> + +char *crypt(const char *, const char *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/crypt/include/crypt.h b/lib/mlibc/options/crypt/include/crypt.h new file mode 100644 index 0000000..bf3a512 --- /dev/null +++ b/lib/mlibc/options/crypt/include/crypt.h @@ -0,0 +1,18 @@ +#ifndef _CRYPT_H +#define _CRYPT_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +char *crypt(const char *, const char *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _CRYPT_H diff --git a/lib/mlibc/options/crypt/meson.build b/lib/mlibc/options/crypt/meson.build new file mode 100644 index 0000000..a476f34 --- /dev/null +++ b/lib/mlibc/options/crypt/meson.build @@ -0,0 +1,13 @@ +if disable_crypt_option + subdir_done() +endif + +libc_sources += files( + 'generic/crypt-stubs.cpp', +) + +if not no_headers + install_headers( + 'include/crypt.h', + ) +endif diff --git a/lib/mlibc/options/elf/generic/phdr.cpp b/lib/mlibc/options/elf/generic/phdr.cpp new file mode 100644 index 0000000..334d52c --- /dev/null +++ b/lib/mlibc/options/elf/generic/phdr.cpp @@ -0,0 +1,10 @@ +#include <link.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> + +extern "C" int __dlapi_iterate_phdr(int (*)(struct dl_phdr_info*, size_t, void*), void *); + +int dl_iterate_phdr(int (*callback)(struct dl_phdr_info*, size_t, void*), void *data) { + return __dlapi_iterate_phdr(callback, data); +} diff --git a/lib/mlibc/options/elf/generic/startup.cpp b/lib/mlibc/options/elf/generic/startup.cpp new file mode 100644 index 0000000..d53881b --- /dev/null +++ b/lib/mlibc/options/elf/generic/startup.cpp @@ -0,0 +1,73 @@ + +#include <errno.h> +#include <string.h> +#include <stdint.h> +#include <stdlib.h> +#include <bits/ensure.h> +#include <mlibc/elf/startup.h> +#include <mlibc/environment.hpp> + +extern "C" size_t __init_array_start[]; +extern "C" size_t __init_array_end[]; +extern "C" size_t __preinit_array_start[]; +extern "C" size_t __preinit_array_end[]; + +static int constructors_ran_already = 0; + +struct global_constructor_guard { + global_constructor_guard() { + constructors_ran_already = 1; + } +}; + +static global_constructor_guard g; + +void __mlibc_run_constructors() { +/* + if (!constructors_ran_already) { + size_t constructor_count = (size_t)__init_array_end - (size_t)__init_array_start; + constructor_count /= sizeof(void*); + for (size_t i = 0; i < constructor_count; i++) { + void (*ptr)(void) = (void(*)(void))(__init_array_start[i]); + ptr(); + } + } +*/ +} + +namespace mlibc { + +void parse_exec_stack(void *opaque_sp, exec_stack_data *data) { + auto sp = reinterpret_cast<uintptr_t *>(opaque_sp); + data->argc = *sp++; + data->argv = reinterpret_cast<char **>(sp); + sp += data->argc; // Skip all arguments. + __ensure(!*sp); // Skip the terminating null element. + sp++; + data->envp = reinterpret_cast<char **>(sp); +} + +// TODO: This does not have to be here; we could also move it to options/internal. +void set_startup_data(int argc, char **argv, char **envp) { + if(argc) { + program_invocation_name = argv[0]; + + if(auto slash = strrchr(argv[0], '/'); slash) { + program_invocation_short_name = slash + 1; + }else{ + program_invocation_short_name = argv[0]; + } + } + + // Initialize environ. + // TODO: Copy the arguments instead of pointing to them? + auto ev = envp; + while(*ev) { + auto fail = mlibc::putenv(*ev); + __ensure(!fail); + ev++; + } +} + +} // namespace mlibc + diff --git a/lib/mlibc/options/elf/include/elf.h b/lib/mlibc/options/elf/include/elf.h new file mode 100644 index 0000000..68d70c2 --- /dev/null +++ b/lib/mlibc/options/elf/include/elf.h @@ -0,0 +1,667 @@ +#ifndef _ELF_H +#define _ELF_H + +#include <stdint.h> +#include <bits/inline-definition.h> +#include <abi-bits/auxv.h> + +#ifdef __cplusplus +extern "C" { +#endif + +// TODO: Convert the enums to #defines so that they work with #ifdef. + +#define ELFCLASS64 2 +#define ELFDATA2LSB 1 +#define ELFOSABI_SYSV 0 +#define EM_X86_64 62 + +#define SHF_WRITE 1 +#define SHF_ALLOC 2 +#define SHF_EXECINSTR 4 +#define SHF_STRINGS 32 +#define SHF_INFO_LINK 64 +#define SHF_TLS 1024 + +#define NT_AUXV 6 + +typedef uint64_t Elf64_Addr; +typedef uint64_t Elf64_Off; +typedef uint16_t Elf64_Half; +typedef uint32_t Elf64_Word; +typedef int32_t Elf64_Sword; +typedef uint64_t Elf64_Xword; +typedef int64_t Elf64_Sxword; +typedef uint16_t Elf64_Section; +typedef Elf64_Half Elf64_Versym; + +typedef uint32_t Elf32_Addr; +typedef uint32_t Elf32_Off; +typedef uint16_t Elf32_Half; +typedef uint32_t Elf32_Word; +typedef int32_t Elf32_Sword; +typedef uint64_t Elf32_Xword; +typedef int64_t Elf32_Sxword; +typedef uint16_t Elf32_Section; +typedef Elf32_Half Elf32_Versym; + +#define EI_NIDENT (16) + +typedef struct { + unsigned char e_ident[EI_NIDENT]; /* ELF identification */ + Elf32_Half e_type; /* Object file type */ + Elf32_Half e_machine; /* Machine type */ + Elf32_Word e_version; /* Object file version */ + Elf32_Addr e_entry; /* Entry point address */ + Elf32_Off e_phoff; /* Program header offset */ + Elf32_Off e_shoff; /* Section header offset */ + Elf32_Word e_flags; /* Processor-specific flags */ + Elf32_Half e_ehsize; /* ELF header size */ + Elf32_Half e_phentsize; /* Size of program header entry */ + Elf32_Half e_phnum; /* Number of program header entries */ + Elf32_Half e_shentsize; /* Size of section header entry */ + Elf32_Half e_shnum; /* Number of section header entries */ + Elf32_Half e_shstrndx; /* Section name string table index */ +} Elf32_Ehdr; + +typedef struct { + unsigned char e_ident[EI_NIDENT]; /* ELF identification */ + Elf64_Half e_type; /* Object file type */ + Elf64_Half e_machine; /* Machine type */ + Elf64_Word e_version; /* Object file version */ + Elf64_Addr e_entry; /* Entry point address */ + Elf64_Off e_phoff; /* Program header offset */ + Elf64_Off e_shoff; /* Section header offset */ + Elf64_Word e_flags; /* Processor-specific flags */ + Elf64_Half e_ehsize; /* ELF header size */ + Elf64_Half e_phentsize; /* Size of program header entry */ + Elf64_Half e_phnum; /* Number of program header entries */ + Elf64_Half e_shentsize; /* Size of section header entry */ + Elf64_Half e_shnum; /* Number of section header entries */ + Elf64_Half e_shstrndx; /* Section name string table index */ +} Elf64_Ehdr; + +typedef struct { + Elf32_Half vd_version; /* Version revision */ + Elf32_Half vd_flags; /* Version information */ + Elf32_Half vd_ndx; /* Version Index */ + Elf32_Half vd_cnt; /* Number of associated aux entries */ + Elf32_Word vd_hash; /* Version name hash value */ + Elf32_Word vd_aux; /* Offset in bytes to verdaux array */ + Elf32_Word vd_next; /* Offset in bytes to next verdef entry */ +} Elf32_Verdef; + +typedef struct { + Elf64_Half vd_version; /* Version revision */ + Elf64_Half vd_flags; /* Version information */ + Elf64_Half vd_ndx; /* Version Index */ + Elf64_Half vd_cnt; /* Number of associated aux entries */ + Elf64_Word vd_hash; /* Version name hash value */ + Elf64_Word vd_aux; /* Offset in bytes to verdaux array */ + Elf64_Word vd_next; /* Offset in bytes to next verdef entry */ +} Elf64_Verdef; + +typedef struct { + Elf32_Word vda_name; /* Version or dependency names */ + Elf32_Word vda_next; /* Offset in bytes to next verdaux entry */ +} Elf32_Verdaux; + +typedef struct { + Elf64_Word vda_name; /* Version or dependency names */ + Elf64_Word vda_next; /* Offset in bytes to next verdaux entry */ +} Elf64_Verdaux; + +typedef struct { + Elf64_Half vn_version; + Elf64_Half vn_cnt; + Elf64_Word vn_file; + Elf64_Word vn_aux; + Elf64_Word vn_next; +} Elf64_Verneed; + +typedef struct { + Elf64_Word vna_hash; + Elf64_Half vna_flags; + Elf64_Half vna_other; + Elf64_Word vna_name; + Elf64_Word vna_next; +} Elf64_Vernaux; + +typedef struct { + Elf64_Xword m_value; + Elf64_Xword m_info; + Elf64_Xword m_poffset; + Elf64_Half m_repeat; + Elf64_Half m_stride; +} Elf64_Move; + +typedef struct { + Elf64_Word l_name; + Elf64_Word l_time_stamp; + Elf64_Word l_checksum; + Elf64_Word l_version; + Elf64_Word l_flags; +} Elf64_Lib; + +enum { + ET_NONE = 0, + ET_REL = 1, + ET_EXEC = 2, + ET_DYN = 3, + ET_CORE = 4, +}; + +enum { + SHN_UNDEF = 0, + SHN_ABS = 0xFFF1 +}; + +enum { + STN_UNDEF = 0, +}; + +typedef struct { + Elf32_Word st_name; + Elf32_Addr st_value; + Elf32_Word st_size; + unsigned char st_info; + unsigned char st_other; + Elf32_Section st_shndx; +} Elf32_Sym; + +typedef struct { + Elf64_Word st_name; + unsigned char st_info; + unsigned char st_other; + Elf64_Half st_shndx; + Elf64_Addr st_value; + Elf64_Xword st_size; +} Elf64_Sym; + +__MLIBC_INLINE_DEFINITION unsigned char ELF64_ST_BIND(unsigned char info) { + return info >> 4; +} +__MLIBC_INLINE_DEFINITION unsigned char ELF64_ST_TYPE(unsigned char info) { + return info & 0x0F; +} +__MLIBC_INLINE_DEFINITION unsigned char ELF64_ST_INFO(unsigned char bind, unsigned char type) { + return (bind << 4) | type; +} + +typedef struct { + Elf64_Half si_boundto; + Elf64_Half si_flags; +} Elf64_Syminfo; + +__MLIBC_INLINE_DEFINITION unsigned char ELF32_ST_BIND(unsigned char info) { + return info >> 4; +} +__MLIBC_INLINE_DEFINITION unsigned char ELF32_ST_TYPE(unsigned char info) { + return info & 0xF; +} +__MLIBC_INLINE_DEFINITION unsigned char ELF32_ST_INFO(unsigned char bind, unsigned char type) { + return (bind << 4) | (type & 0xF); +} + +enum { + STB_GLOBAL = 1, + STB_WEAK = 2, + STB_GNU_UNIQUE = 10, + STB_LOPROC = 13, + STB_HIPROC = 15 +}; + +enum { + STT_OBJECT = 1, + STT_FUNC = 2, + STT_TLS = 6, + STT_LOPROC = 13, + STT_HIPROC = 15 +}; + +enum { + R_X86_64_NONE = 0, + R_X86_64_64 = 1, + R_X86_64_PC32 = 2, + R_X86_64_PLT32 = 4, + R_X86_64_COPY = 5, + R_X86_64_GLOB_DAT = 6, + R_X86_64_JUMP_SLOT = 7, + R_X86_64_RELATIVE = 8, + R_X86_64_GOTPCREL = 9, + R_X86_64_32 = 10, + R_X86_64_32S = 11, + R_X86_64_PC16 = 13, + R_X86_64_PC8 = 15, + R_X86_64_DTPMOD64 = 16, + R_X86_64_DTPOFF64 = 17, + R_X86_64_TPOFF64 = 18, + R_X86_64_PC64 = 24, + R_X86_64_GOTPC32 = 26, + R_X86_64_TLSDESC = 36, + R_X86_64_IRELATIVE = 37, +}; + +enum { + R_386_NONE = 0, + R_386_32 = 1, + R_386_PC32 = 2, + R_386_COPY = 5, + R_386_GLOB_DAT = 6, + R_386_JMP_SLOT = 7, + R_386_RELATIVE = 8, + R_386_TLS_TPOFF = 14, + R_386_TLS_DTPMOD32 = 35, + R_386_TLS_DTPOFF32 = 36, + R_386_TLS_DESC = 41, + R_386_IRELATIVE = 42, +}; + +enum { + R_AARCH64_NONE = 0, + R_AARCH64_ABS64 = 257, + R_AARCH64_COPY = 1024, + R_AARCH64_GLOB_DAT = 1025, + R_AARCH64_JUMP_SLOT = 1026, + R_AARCH64_RELATIVE = 1027, + R_AARCH64_TLS_DTPREL64 = 1028, + R_AARCH64_TLS_DTPMOD64 = 1029, + R_AARCH64_TLS_TPREL64 = 1030, + R_AARCH64_TLSDESC = 1031, + R_AARCH64_IRELATIVE = 1032, +}; + +#define R_AARCH64_TLS_DTPREL R_AARCH64_TLS_DTPREL64 +#define R_AARCH64_TLS_DTPMOD R_AARCH64_TLS_DTPMOD64 +#define R_AARCH64_TLS_TPREL R_AARCH64_TLS_TPREL64 + +enum { + R_RISCV_NONE = 0, + R_RISCV_32 = 1, + R_RISCV_64 = 2, + R_RISCV_RELATIVE = 3, + R_RISCV_COPY = 4, + R_RISCV_JUMP_SLOT = 5, + R_RISCV_TLS_DTPMOD32 = 6, + R_RISCV_TLS_DTPMOD64 = 7, + R_RISCV_TLS_DTPREL32 = 8, + R_RISCV_TLS_DTPREL64 = 9, + R_RISCV_TLS_TPREL32 = 10, + R_RISCV_TLS_TPREL64 = 11, + R_RISCV_TLSDESC = 12, // currently a draft but looking good + R_RISCV_IRELATIVE = 58 +}; + +typedef struct { + Elf32_Addr r_offset; + Elf32_Word r_info; +} Elf32_Rel; + +typedef struct { + Elf64_Addr r_offset; + uint64_t r_info; +} Elf64_Rel; + +typedef struct { + Elf32_Addr r_offset; + Elf32_Word r_info; + Elf32_Sword r_addend; +} Elf32_Rela; + +typedef struct { + Elf64_Addr r_offset; + Elf64_Xword r_info; + Elf64_Sxword r_addend; +} Elf64_Rela; + +typedef Elf32_Word Elf32_Relr; +typedef Elf64_Xword Elf64_Relr; + +__MLIBC_INLINE_DEFINITION Elf64_Xword ELF64_R_SYM(Elf64_Xword info) { + return info >> 32; +} +__MLIBC_INLINE_DEFINITION Elf64_Xword ELF64_R_TYPE(Elf64_Xword info) { + return info & 0xFFFFFFFF; +} +__MLIBC_INLINE_DEFINITION Elf64_Xword ELF64_R_INFO(Elf64_Xword sym, Elf64_Xword type) { + return ((((Elf64_Xword)(sym)) << 32) + (type)); +} + +__MLIBC_INLINE_DEFINITION Elf32_Word ELF32_R_SYM(Elf32_Word info) { + return info >> 8; +} +__MLIBC_INLINE_DEFINITION Elf32_Word ELF32_R_TYPE(Elf32_Word info) { + return info & 0xFF; +} + +enum { + PT_NULL = 0, + PT_LOAD = 1, + PT_DYNAMIC = 2, + PT_INTERP = 3, + PT_NOTE = 4, + PT_SHLIB = 5, + PT_PHDR = 6, + PT_TLS = 7, + PT_NUM = 8, + PT_LOOS = 0x60000000, + PT_GNU_EH_FRAME = 0x6474E550, + PT_GNU_STACK = 0x6474E551, + PT_GNU_RELRO = 0x6474E552, + PT_GNU_PROPERTY = 0x6474E553, + PT_SUNWBSS = 0x6ffffffa, + PT_SUNWSTACK = 0x6ffffffb, + PT_HISUNW = 0x6fffffff, + PT_HIOS = 0x6fffffff, + PT_LOPROC = 0x70000000, + PT_RISCV_ATTRIBUTES = 0x70000003, + PT_HIPROC = 0x7fffffff, +}; + +enum { + PF_X = 1, + PF_W = 2, + PF_R = 4 +}; + +typedef struct { + Elf32_Word p_type; /* Type of segment */ + Elf32_Off p_offset; /* Offset in file */ + Elf32_Addr p_vaddr; /* Virtual address in memory */ + Elf32_Addr p_paddr; /* Reserved */ + Elf32_Word p_filesz; /* Size of segment in file */ + Elf32_Word p_memsz; /* Size of segment in memory */ + Elf32_Word p_flags; /* Segment attributes */ + Elf32_Word p_align; /* Alignment of segment */ +} Elf32_Phdr; + +typedef struct { + Elf64_Word p_type; /* Type of segment */ + Elf64_Word p_flags; /* Segment attributes */ + Elf64_Off p_offset; /* Offset in file */ + Elf64_Addr p_vaddr; /* Virtual address in memory */ + Elf64_Addr p_paddr; /* Reserved */ + Elf64_Xword p_filesz; /* Size of segment in file */ + Elf64_Xword p_memsz; /* Size of segment in memory */ + Elf64_Xword p_align; /* Alignment of segment */ +} Elf64_Phdr; + +enum { + DT_NULL = 0, + DT_NEEDED = 1, + DT_PLTRELSZ = 2, + DT_PLTGOT = 3, + DT_HASH = 4, + DT_STRTAB = 5, + DT_SYMTAB = 6, + DT_RELA = 7, + DT_RELASZ = 8, + DT_RELAENT = 9, + DT_STRSZ = 10, + DT_SYMENT = 11, + DT_INIT = 12, + DT_FINI = 13, + DT_SONAME = 14, + DT_RPATH = 15, + DT_SYMBOLIC = 16, + DT_REL = 17, + DT_RELSZ = 18, + DT_RELENT = 19, + DT_TEXTREL = 22, + DT_BIND_NOW = 24, + DT_INIT_ARRAY = 25, + DT_FINI_ARRAY = 26, + DT_INIT_ARRAYSZ = 27, + DT_FINI_ARRAYSZ = 28, + DT_RUNPATH = 29, + DT_PLTREL = 20, + DT_DEBUG = 21, + DT_JMPREL = 23, + DT_FLAGS = 30, + DT_PREINIT_ARRAY = 32, + DT_PREINIT_ARRAYSZ = 33, + DT_RELRSZ = 35, + DT_RELR = 36, + DT_RELRENT = 37, + DT_LOOS = 0x6000000d, + DT_HIOS = 0x6ffff000, + DT_GNU_HASH = 0x6ffffef5, + DT_TLSDESC_PLT = 0x6ffffef6, + DT_TLSDESC_GOT = 0x6ffffef7, + DT_VERSYM = 0x6ffffff0, + DT_RELACOUNT = 0x6ffffff9, + DT_RELCOUNT = 0x6ffffffa, + DT_FLAGS_1 = 0x6ffffffb, + DT_VERDEF = 0x6ffffffc, + DT_VERDEFNUM = 0x6ffffffd, + DT_VERNEED = 0x6ffffffe, + DT_VERNEEDNUM = 0x6fffffff +}; + +enum { + // For DT_FLAGS. + DF_SYMBOLIC = 0x02, + DF_TEXTREL = 0x04, + DF_BIND_NOW = 0x08, + DF_STATIC_TLS = 0x10, + + // For DT_FLAGS_1. + DF_1_NOW = 0x00000001, + DF_1_NODELETE = 0x00000008, + DF_1_PIE = 0x08000000 +}; + +// Valid values for note segment descriptor files for core files +#define NT_PRSTATUS 1 +#define NT_FPREGSET 2 +#define NT_PRPSINFO 3 + +// Build ID bits as generated by ld --build-id +#define NT_GNU_BUILD_ID 3 + +typedef struct { + Elf32_Sword d_tag; + union { + Elf32_Word d_val; + Elf32_Addr d_ptr; + } d_un; +} Elf32_Dyn; + +typedef struct { + Elf64_Sxword d_tag; + union { + Elf64_Xword d_val; + Elf64_Addr d_ptr; + } d_un; +} Elf64_Dyn; + +typedef struct { + Elf32_Word sh_name; + Elf32_Word sh_type; + Elf32_Word sh_flags; + Elf32_Addr sh_addr; + Elf32_Off sh_offset; + Elf32_Word sh_size; + Elf32_Word sh_link; + Elf32_Word sh_info; + Elf32_Word sh_addralign; + Elf32_Word sh_entsize; +} Elf32_Shdr; + +typedef struct { + Elf64_Word sh_name; + Elf64_Word sh_type; + Elf64_Xword sh_flags; + Elf64_Addr sh_addr; + Elf64_Off sh_offset; + Elf64_Xword sh_size; + Elf64_Word sh_link; + Elf64_Word sh_info; + Elf64_Xword sh_addralign; + Elf64_Xword sh_entsize; +} Elf64_Shdr; + +typedef struct { + uint64_t a_type; + union { + uint64_t a_val; + } a_un; +} Elf64_auxv_t; + +typedef struct { + uint32_t a_type; + union { + uint32_t a_val; + } a_un; +} Elf32_auxv_t; + +typedef struct { + Elf32_Word n_namesz; + Elf32_Word n_descsz; + Elf32_Word n_type; +} Elf32_Nhdr; + +typedef struct { + Elf64_Word n_namesz; + Elf64_Word n_descsz; + Elf64_Word n_type; +} Elf64_Nhdr; + +/* ST_TYPE (subfield of st_info) values (symbol type) */ +#define STT_NOTYPE 0 +#define STT_OBJECT 1 +#define STT_FUNC 2 +#define STT_SECTION 3 +#define STT_FILE 4 + +/* ST_BIND (subfield of st_info) values (symbol binding) */ +#define STB_LOCAL 0 +#define STB_GLOBAL 1 +#define STB_WEAK 2 + +/* sh_type (section type) values */ +#define SHT_NULL 0 +#define SHT_PROGBITS 1 +#define SHT_SYMTAB 2 +#define SHT_STRTAB 3 +#define SHT_RELA 4 +#define SHT_HASH 5 +#define SHT_DYNAMIC 6 +#define SHT_NOTE 7 +#define SHT_NOBITS 8 +#define SHT_REL 9 +#define SHT_DYNSYM 11 +#define SHT_INIT_ARRAY 14 +#define SHT_FINI_ARRAY 15 +#define SHT_SYMTAB_SHNDX 18 + +/* special section indices */ +#define SHN_UNDEF 0 +#define SHN_LORESERVE 0xff00 +#define SHN_COMMON 0xfff2 +#define SHN_XINDEX 0xffff +#define SHN_HIRESERVE 0xff00 + +/* values for e_machine */ +#define EM_NONE 0 +#define EM_M32 1 +#define EM_SPARC 2 +#define EM_386 3 +#define EM_68K 4 +#define EM_MIPS 8 +#define EM_PARISC 15 +#define EM_PPC 20 +#define EM_PPC64 21 +#define EM_S390 22 +#define EM_ARM 40 +#define EM_SH 42 +#define EM_SPARCV9 43 +#define EM_IA_64 50 +#define EM_X86_64 62 +#define EM_BLACKFIN 106 +#define EM_AARCH64 183 +#define EM_RISCV 243 + +/* Linux notes this value as being interim; however applications are using this (Qt6), so we define it here. */ +#define EM_ALPHA 0x9026 + +/* values for e_version */ +#define EV_NONE 0 +#define EV_CURRENT 1 +#define EV_NUM 2 + +/* e_indent constants */ +#define EI_MAG0 0 +#define ELFMAG0 0x7f + +#define EI_MAG1 1 +#define ELFMAG1 'E' + +#define EI_MAG2 2 +#define ELFMAG2 'L' + +#define EI_MAG3 3 +#define ELFMAG3 'F' + +#define ELFMAG "\177ELF" +#define SELFMAG 4 + +#define EI_CLASS 4 +#define ELFCLASSNONE 0 +#define ELFCLASS32 1 +#define ELFCLASS64 2 +#define ELFCLASSNUM 3 + +#define EI_DATA 5 +#define ELFDATANONE 0 +#define ELFDATA2LSB 1 +#define ELFDATA2MSB 2 +#define ELFDATANUM 3 + +#define EI_VERSION 6 + +#define EI_OSABI 7 +#define ELFOSABI_HPUX 1 +#define ELFOSABI_NETBSD 2 +#define ELFOSABI_GNU 3 +#define ELFOSABI_LINUX ELFOSABI_GNU +#define ELFOSABI_SOLARIS 6 +#define ELFOSABI_AIX 7 +#define ELFOSABI_IRIX 8 +#define ELFOSABI_FREEBSD 9 +#define ELFOSABI_OPENBSD 12 + +#define EI_ABIVERSION 8 + +#define ELF_NOTE_GNU "GNU" + +/* Values for a_type + * these are standard values and shared across at least glibc, musl and freebsd + */ + +#define AT_NULL 0 +#define AT_IGNORE 1 +#define AT_EXECFD 2 +#define AT_PHDR 3 +#define AT_PHENT 4 +#define AT_PHNUM 5 +#define AT_PAGESZ 6 +#define AT_BASE 7 +#define AT_FLAGS 8 +#define AT_ENTRY 9 +#define AT_NOTELF 10 +#define AT_UID 11 +#define AT_EUID 12 +#define AT_GID 13 +#define AT_EGID 14 + +/* rtdl requires presence of some a_type (AT_*) values that are not standardized in the ELF spec */ +#if !defined(AT_EXECFN) || !defined(AT_RANDOM) || !defined(AT_SECURE) +#error "sysdeps' auxv.h is missing some defines that are required for rtdl operation" +#endif + +#ifdef __cplusplus +} +#endif + +#endif // _ELF_H diff --git a/lib/mlibc/options/elf/include/link.h b/lib/mlibc/options/elf/include/link.h new file mode 100644 index 0000000..65d54b9 --- /dev/null +++ b/lib/mlibc/options/elf/include/link.h @@ -0,0 +1,58 @@ +#ifndef _LINK_H +#define _LINK_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <elf.h> +#include <stddef.h> + +#if defined(__x86_64__) || defined(__aarch64__) \ + || (defined(__riscv) && __riscv_xlen == 64) +# define ElfW(type) Elf64_ ## type +#elif defined(__i386__) +# define ElfW(type) Elf32_ ## type +#else +# error Unknown architecture +#endif + +struct dl_phdr_info { + ElfW(Addr) dlpi_addr; + const char *dlpi_name; + const ElfW(Phdr) *dlpi_phdr; + ElfW(Half) dlpi_phnum; + unsigned long long int dlpi_adds; + unsigned long long int dlpi_subs; + size_t dlpi_tls_modid; + void *dlpi_tls_data; +}; + +struct link_map { + Elf64_Addr l_addr; + char *l_name; + ElfW(Dyn) *l_ld; + struct link_map *l_next, *l_prev; +}; + +struct r_debug { + int r_version; + struct link_map *r_map; + Elf64_Addr r_brk; + enum { RT_CONSISTENT, RT_ADD, RT_DELETE } r_state; + Elf64_Addr r_ldbase; +}; + +#ifndef __MLIBC_ABI_ONLY + +int dl_iterate_phdr(int (*callback)(struct dl_phdr_info*, size_t, void*), void* data); + +extern ElfW(Dyn) _DYNAMIC[]; + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _LINK_H diff --git a/lib/mlibc/options/elf/include/mlibc/elf/startup.h b/lib/mlibc/options/elf/include/mlibc/elf/startup.h new file mode 100644 index 0000000..7e8a8d7 --- /dev/null +++ b/lib/mlibc/options/elf/include/mlibc/elf/startup.h @@ -0,0 +1,28 @@ +#ifndef MLIBC_ELF_STARTUP +#define MLIBC_ELF_STARTUP + +#ifndef __MLIBC_ABI_ONLY + +void __mlibc_run_constructors(); + +#endif /* !__MLIBC_ABI_ONLY */ + +namespace mlibc { + +struct exec_stack_data { + int argc; + char **argv; + char **envp; +}; + +#ifndef __MLIBC_ABI_ONLY + +void parse_exec_stack(void *sp, exec_stack_data *data); + +void set_startup_data(int argc, char **argv, char **envp); + +#endif /* !__MLIBC_ABI_ONLY */ + +} // namespace mlibc + +#endif // MLIBC_ELF_STARTUP diff --git a/lib/mlibc/options/elf/meson.build b/lib/mlibc/options/elf/meson.build new file mode 100644 index 0000000..b096801 --- /dev/null +++ b/lib/mlibc/options/elf/meson.build @@ -0,0 +1,11 @@ +libc_sources += files( + 'generic/startup.cpp', + 'generic/phdr.cpp', +) + +if not no_headers + install_headers( + 'include/elf.h', + 'include/link.h', + ) +endif diff --git a/lib/mlibc/options/glibc/generic/err.cpp b/lib/mlibc/options/glibc/generic/err.cpp new file mode 100644 index 0000000..042c1d8 --- /dev/null +++ b/lib/mlibc/options/glibc/generic/err.cpp @@ -0,0 +1,64 @@ +#include <err.h> + +#include <errno.h> +#include <stdio.h> +#include <stdlib.h> + +// va_list + +void vwarn(const char *fmt, va_list params) { + fprintf(stderr, "%s: ", program_invocation_short_name); + if (fmt) { + vfprintf(stderr, fmt, params); + fwrite(": ", 1, 2, stderr); + } + perror(NULL); +} + +void vwarnx(const char *fmt, va_list params) { + fprintf(stderr, "%s: ", program_invocation_short_name); + if (fmt) { + vfprintf(stderr, fmt, params); + } + putc('\n', stderr); +} + +__attribute__((__noreturn__)) void verr(int status, const char *fmt, va_list params) { + vwarn(fmt, params); + exit(status); +} + +__attribute__((__noreturn__)) void verrx(int status, const char *fmt, va_list params) { + vwarnx(fmt, params); + exit(status); +} + +// variadic + +void warn(const char *fmt, ...) { + va_list params; + va_start(params, fmt); + vwarn(fmt, params); + va_end(params); +} + +void warnx(const char *fmt, ...) { + va_list params; + va_start(params, fmt); + vwarnx(fmt, params); + va_end(params); +} + +__attribute__((__noreturn__)) void err(int status, const char *fmt, ...) { + va_list params; + va_start(params, fmt); + verr(status, fmt, params); + va_end(params); +} + +__attribute__((__noreturn__)) void errx(int status, const char *fmt, ...) { + va_list params; + va_start(params, fmt); + verrx(status, fmt, params); + va_end(params); +} diff --git a/lib/mlibc/options/glibc/generic/error.cpp b/lib/mlibc/options/glibc/generic/error.cpp new file mode 100644 index 0000000..45203b2 --- /dev/null +++ b/lib/mlibc/options/glibc/generic/error.cpp @@ -0,0 +1,65 @@ +#include <stdio.h> +#include <stdarg.h> +#include <errno.h> +#include <string.h> +#include <stdlib.h> +#include <error.h> + +unsigned int error_message_count = 0; +int error_one_per_line = 0; +void (*error_print_progname)(void) = NULL; + +void error(int status, int errnum, const char *format, ...) { + va_list args; + va_start(args, format); + + error_message_count++; + + fflush(stdout); + if(error_print_progname) { + error_print_progname(); + } else { + fprintf(stderr, "%s: ", program_invocation_name); + } + vfprintf(stderr, format, args); + va_end(args); + + if(errnum) { + fprintf(stderr, ": %s\n", strerror(errnum)); + } + + if(status) { + exit(status); + } +} + +void error_at_line(int status, int errnum, const char *filename, unsigned int linenum, const char *format, ...) { + va_list args; + va_start(args, format); + + static bool first_call = true; + static unsigned int last_line = 0; + if(!(last_line == linenum && error_one_per_line && !first_call)) { + first_call = false; + last_line = linenum; + error_message_count++; + + fflush(stdout); + if(error_print_progname) { + error_print_progname(); + } else { + fprintf(stderr, "%s:", program_invocation_name); + } + fprintf(stderr, "%s:%u: ", filename, linenum); + vfprintf(stderr, format, args); + + if(errnum) { + fprintf(stderr, ": %s\n", strerror(errnum)); + } + } + va_end(args); + + if(status) { + exit(status); + } +} diff --git a/lib/mlibc/options/glibc/generic/execinfo.cpp b/lib/mlibc/options/glibc/generic/execinfo.cpp new file mode 100644 index 0000000..3474615 --- /dev/null +++ b/lib/mlibc/options/glibc/generic/execinfo.cpp @@ -0,0 +1,17 @@ +#include <execinfo.h> +#include <bits/ensure.h> + +int backtrace(void **, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +char **backtrace_symbols(void *const *, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void backtrace_symbols_fd(void *const *, int, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/glibc/generic/getopt-stubs.cpp b/lib/mlibc/options/glibc/generic/getopt-stubs.cpp new file mode 100644 index 0000000..d13d4eb --- /dev/null +++ b/lib/mlibc/options/glibc/generic/getopt-stubs.cpp @@ -0,0 +1,253 @@ +#include <assert.h> +#include <bits/ensure.h> +#include <getopt.h> +#include <stdio.h> +#include <stdlib.h> +#include <string.h> + +#include <frg/optional.hpp> +#include <mlibc/debug.hpp> + +char *optarg; +int optind = 1; +int opterr = 1; +int optopt; + +namespace { + +int __optpos = 1; + +enum GetoptMode { + Short, + Long, + LongOnly, +}; + +int getopt_common(int argc, char * const argv[], const char *optstring, const struct option *longopts, int *longindex, enum GetoptMode mode) { + auto longopt_consume = [&](const char *arg, char *s, int k, bool colon) -> frg::optional<int> { + // Consume the option and its argument. + if(longopts[k].has_arg == required_argument) { + if(s) { + // Consume the long option and its argument. + optarg = s + 1; + optind++; + }else if(argv[optind + 1]) { + // Consume the long option. + optind++; + + // Consume the option's argument. + optarg = argv[optind]; + optind++; + }else{ + /* If an error was detected, and the first character of optstring is not a colon, + and the external variable opterr is nonzero (which is the default), + getopt() prints an error message. */ + if(!colon && opterr) + fprintf(stderr, "--%s requires an argument.\n", arg); + /* If the first character of optstring is a colon (':'), then getopt() + returns ':' instead of '?' to indicate a missing option argument. */ + return colon ? ':' : '?'; + } + }else if(longopts[k].has_arg == optional_argument) { + if(s) { + // Consume the long option and its argument. + optarg = s + 1; + optind++; + }else{ + // Consume the long option. + optarg = nullptr; + optind++; + } + }else{ + __ensure(longopts[k].has_arg == no_argument); + + // Consume the long option. + optind++; + } + + return frg::null_opt; + }; + + bool colon = optstring[0] == ':'; + bool stop_at_first_nonarg = (optstring[0] == '+' || getenv("POSIXLY_CORRECT")); + + // glibc extension: Setting optind to zero causes a full reset. + // TODO: Should we really reset opterr and the other flags? + if(!optind +#if __MLIBC_BSD_OPTION + || optreset +#endif //__MLIBC_BSD_OPTION + ) { + optarg = nullptr; + optind = 1; + opterr = 1; + optopt = 0; + __optpos = 1; +#if __MLIBC_BSD_OPTION + optreset = 0; +#endif //__MLIBC_BSD_OPTION + } + + auto isOptionArg = [](char *arg){ + // If the first character of arg '-', and the arg is not exactly + // equal to "-" or "--", then the arg is an option argument. + return arg[0] == '-' && strcmp(arg, "-") && strcmp(arg, "--"); + }; + + while(optind < argc) { + char *arg = argv[optind]; + if(!isOptionArg(arg)) { + if(stop_at_first_nonarg) { + return -1; + } + + bool further_options = false; + int skip = optind; + + for(; skip < argc; ++skip) { + if(isOptionArg(argv[skip])) { + further_options = true; + break; + } + } + + if(further_options) { + optind += skip - optind; + continue; + } else { + optarg = nullptr; + return -1; + } + } + + if(arg[1] == '-') { + arg += 2; + + // Determine the end of the option name (vs. the start of the argument). + auto s = strchr(arg, '='); + size_t n = s ? (s - arg) : strlen(arg); + + int k = -1; + for(int i = 0; longopts[i].name; i++) { + if(strncmp(arg, longopts[i].name, n) || longopts[i].name[n]) + continue; + + if(k >= 0) { + if(opterr) + fprintf(stderr, "Multiple option declaration detected: %s\n", arg); + return '?'; + } + k = i; + } + + if(k == -1) { + if(opterr) + fprintf(stderr, "--%s is not a valid option.\n", arg); + return '?'; + } + + if(longindex) + *longindex = k; + + if(auto r = longopt_consume(arg, s, k, colon); r) + return r.value(); + + if(!longopts[k].flag) { + return longopts[k].val; + }else{ + *longopts[k].flag = longopts[k].val; + return 0; + } + }else{ + /* handle short options, i.e. options with only one dash prefixed; e.g. `program -s` */ + unsigned int i = __optpos; + while(true) { + if(mode == GetoptMode::LongOnly) { + const char *lo_arg = &arg[1]; + auto s = strchr(lo_arg, '='); + size_t n = s ? (s - lo_arg) : strlen(lo_arg); + int k = -1; + + for(int longopt = 0; longopts[longopt].name; longopt++) { + if(strncmp(lo_arg, longopts[longopt].name, n) || longopts[longopt].name[n]) + continue; + + if(k >= 0) { + if(opterr) + fprintf(stderr, "Multiple option declaration detected: %s\n", arg); + return '?'; + } + + k = longopt; + } + + if(k != -1) { + if(auto r = longopt_consume(lo_arg, s, k, colon); r) + return r.value(); + + if(!longopts[k].flag) { + return longopts[k].val; + }else{ + *longopts[k].flag = longopts[k].val; + return 0; + } + } + } + + auto opt = strchr(optstring, arg[i]); + if(opt) { + if(opt[1] == ':') { + bool required = (opt[2] != ':'); + + if(arg[i+1]) { + optarg = arg + i + 1; + } else if(optind + 1 < argc && argv[optind + 1] && (required || argv[optind + 1][0] != '-')) { + /* there is an argument to this short option, separated by a space */ + optarg = argv[optind + 1]; + optind++; + __optpos = 1; + } else if(!required) { + optarg = nullptr; + } else { + __optpos = 1; + optopt = arg[i]; + return colon ? ':' : '?'; + } + optind++; + } else { + if(arg[i+1]) { + __optpos++; + } else if(arg[i]) { + optind++; + } else { + return -1; + } + } + + return arg[i]; + } else { + /* If getopt() does not recognize an option character, it prints an error message to stderr, + stores the character in optopt, and returns '?'. The calling program may prevent + the error message by setting opterr to 0. */ + optopt = arg[1]; + if(opterr) + fprintf(stderr, "%s is not a valid option.\n", arg); + return '?'; + } + } + } + } + return -1; +} + +} + +int getopt_long(int argc, char * const argv[], const char *optstring, + const struct option *longopts, int *longindex) { + return getopt_common(argc, argv, optstring, longopts, longindex, GetoptMode::Long); +} + +int getopt_long_only(int argc, char * const argv[], const char *optstring, + const struct option *longopts, int *longindex) { + return getopt_common(argc, argv, optstring, longopts, longindex, GetoptMode::LongOnly); +} diff --git a/lib/mlibc/options/glibc/generic/glibc-assert.cpp b/lib/mlibc/options/glibc/generic/glibc-assert.cpp new file mode 100644 index 0000000..77cd498 --- /dev/null +++ b/lib/mlibc/options/glibc/generic/glibc-assert.cpp @@ -0,0 +1,14 @@ +#include <assert.h> +#include <stdio.h> +#include <stdlib.h> +#include <string.h> + +#include <bits/ensure.h> + +[[gnu::noreturn]] void __assert_fail_perror(int errno, const char *file, unsigned int line, + const char *function) { + char *errormsg = strerror(errno); + fprintf(stderr, "In function %s, file %s:%d: Errno '%s' failed!\n", + function, file, line, errormsg); + abort(); +} diff --git a/lib/mlibc/options/glibc/generic/glibc-signal.cpp b/lib/mlibc/options/glibc/generic/glibc-signal.cpp new file mode 100644 index 0000000..41bc455 --- /dev/null +++ b/lib/mlibc/options/glibc/generic/glibc-signal.cpp @@ -0,0 +1,14 @@ +#include <errno.h> +#include <signal.h> +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/glibc-sysdeps.hpp> + +int tgkill(int tgid, int tid, int sig) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_tgkill, -1); + if(int e = mlibc::sys_tgkill(tgid, tid, sig); e) { + errno = e; + return -1; + } + return 0; +} diff --git a/lib/mlibc/options/glibc/generic/gshadow.cpp b/lib/mlibc/options/glibc/generic/gshadow.cpp new file mode 100644 index 0000000..f93a47d --- /dev/null +++ b/lib/mlibc/options/glibc/generic/gshadow.cpp @@ -0,0 +1,7 @@ +#include <gshadow.h> +#include <bits/ensure.h> + +int getsgnam_r(const char *, struct sgrp *, char *, size_t, struct sgrp **) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/glibc/generic/malloc.cpp b/lib/mlibc/options/glibc/generic/malloc.cpp new file mode 100644 index 0000000..b5a4daf --- /dev/null +++ b/lib/mlibc/options/glibc/generic/malloc.cpp @@ -0,0 +1,6 @@ +#include <bits/glibc/glibc_malloc.h> +#include <mlibc/allocator.hpp> + +size_t malloc_usable_size(void *p) { + return getAllocator().get_size(p); +} diff --git a/lib/mlibc/options/glibc/generic/personality.cpp b/lib/mlibc/options/glibc/generic/personality.cpp new file mode 100644 index 0000000..3bfd9aa --- /dev/null +++ b/lib/mlibc/options/glibc/generic/personality.cpp @@ -0,0 +1,15 @@ +#include <bits/ensure.h> +#include <errno.h> +#include <mlibc/glibc-sysdeps.hpp> +#include <sys/personality.h> + +int personality(unsigned long persona) { + int out = 0; + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_personality, -1); + + if(int e = sysdep(persona, &out); e) { + errno = e; + return -1; + } + return out; +} diff --git a/lib/mlibc/options/glibc/generic/printf.cpp b/lib/mlibc/options/glibc/generic/printf.cpp new file mode 100644 index 0000000..4abb00d --- /dev/null +++ b/lib/mlibc/options/glibc/generic/printf.cpp @@ -0,0 +1,7 @@ +#include <bits/ensure.h> +#include <printf.h> + +size_t parse_printf_format(const char * __restrict, size_t, int * __restrict) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/glibc/generic/resolv-stubs.cpp b/lib/mlibc/options/glibc/generic/resolv-stubs.cpp new file mode 100644 index 0000000..7c0723e --- /dev/null +++ b/lib/mlibc/options/glibc/generic/resolv-stubs.cpp @@ -0,0 +1,36 @@ +#include <resolv.h> +#include <bits/ensure.h> +#include <mlibc/debug.hpp> + +int dn_expand(const unsigned char *, const unsigned char *, + const unsigned char *, char *, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int res_query(const char *, int, int, unsigned char *, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int res_init() { + mlibc::infoLogger() << "mlibc: res_init is a stub!" << frg::endlog; + return 0; +} + +int res_ninit(res_state) { + mlibc::infoLogger() << "mlibc: res_ninit is a stub!" << frg::endlog; + return 0; +} + +void res_nclose(res_state) { + mlibc::infoLogger() << "mlibc: res_nclose is a stub!" << frg::endlog; + return; +} + +/* This is completely unused, and exists purely to satisfy broken apps. */ + +struct __res_state *__res_state() { + static struct __res_state res; + return &res; +} diff --git a/lib/mlibc/options/glibc/generic/shadow-stubs.cpp b/lib/mlibc/options/glibc/generic/shadow-stubs.cpp new file mode 100644 index 0000000..9ce6584 --- /dev/null +++ b/lib/mlibc/options/glibc/generic/shadow-stubs.cpp @@ -0,0 +1,217 @@ +#include <shadow.h> +#include <errno.h> +#include <limits.h> +#include <pthread.h> +#include <stdlib.h> +#include <fcntl.h> +#include <unistd.h> +#include <sys/stat.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> + +/* + * The code in this file is largely based on or taken from musl. + * This includes: + * - xatol + * - __parsespent + * - cleanup + * - getspnam_r + * - getspnam + */ +#define NUM(n) ((n) == -1 ? 0 : -1), ((n) == -1 ? 0 : (n)) + +int putspent(const struct spwd *sp, FILE *f) { + auto str = [] (char *s) { + return ((s) ? (s) : ""); + }; + return fprintf(f, "%s:%s:%.*d:%.*d:%.*d:%.*d:%.*d:%.*d:%.*u\n", + str(sp->sp_namp), str(sp->sp_pwdp), NUM(sp->sp_lstchg), + NUM(sp->sp_min), NUM(sp->sp_max), NUM(sp->sp_warn), + NUM(sp->sp_inact), NUM(sp->sp_expire), NUM((int)sp->sp_flag)) < 0 ? -1 : 0; +} +#undef NUM + +static long xatol(char **s) { + long x; + if(**s == ':' || **s == '\n') { + return -1; + } + for(x = 0; (unsigned int)**s - '0' < 10U; ++*s) { + x = 10 * x + (**s - '0'); + } + return x; +} + +static int __parsespent(char *s, struct spwd *sp) { + sp->sp_namp = s; + if(!(s = strchr(s, ':'))) { + return -1; + } + *s = 0; + + sp->sp_pwdp = ++s; + if(!(s = strchr(s, ':'))) { + return -1; + } + *s = 0; + + s++; + sp->sp_lstchg = xatol(&s); + if(*s != ':') { + return -1; + } + + s++; + sp->sp_min = xatol(&s); + if(*s != ':') { + return -1; + } + + s++; + sp->sp_max = xatol(&s); + if(*s != ':') { + return -1; + } + + s++; + sp->sp_warn = xatol(&s); + if(*s != ':') { + return -1; + } + + s++; + sp->sp_inact = xatol(&s); + if(*s != ':') { + return -1; + } + + s++; + sp->sp_expire = xatol(&s); + if(*s != ':') { + return -1; + } + + s++; + sp->sp_flag = xatol(&s); + if(*s != '\n') { + return -1; + } + return 0; +} + +static void cleanup(void *p) { + fclose((FILE *)p); +} + +int getspnam_r(const char *name, struct spwd *sp, char *buf, size_t size, struct spwd **res) { + char path[20 + NAME_MAX]; + FILE *f = 0; + int rv = 0; + int fd; + size_t k, l = strlen(name); + int skip = 0; + int cs; + int orig_errno = errno; + + *res = 0; + + /* Disallow potentially-malicious user names */ + if(*name=='.' || strchr(name, '/') || !l) { + return errno = EINVAL; + } + + /* Buffer size must at least be able to hold name, plus some.. */ + if(size < l + 100) { + return errno = ERANGE; + } + + /* Protect against truncation */ + if(snprintf(path, sizeof path, "/etc/tcb/%s/shadow", name) >= (int)sizeof path) { + return errno = EINVAL; + } + + fd = open(path, O_RDONLY|O_NOFOLLOW|O_NONBLOCK|O_CLOEXEC); + if(fd >= 0) { + struct stat st = {}; + errno = EINVAL; + if(fstat(fd, &st) || !S_ISREG(st.st_mode) || !(f = fdopen(fd, "rb"))) { + pthread_setcancelstate(PTHREAD_CANCEL_DISABLE, &cs); + close(fd); + pthread_setcancelstate(cs, 0); + return errno; + } + } else { + if(errno != ENOENT && errno != ENOTDIR) { + return errno; + } + f = fopen("/etc/shadow", "rbe"); + if(!f) { + if(errno != ENOENT && errno != ENOTDIR) { + return errno; + } + return 0; + } + } + + pthread_cleanup_push(cleanup, f); + while(fgets(buf, size, f) && (k = strlen(buf)) > 0) { + if(skip || strncmp(name, buf, l) || buf[l] != ':') { + skip = buf[k - 1] != '\n'; + continue; + } + if(buf[k - 1] != '\n') { + rv = ERANGE; + break; + } + + if(__parsespent(buf, sp) < 0) { + continue; + } + *res = sp; + break; + } + pthread_cleanup_pop(1); + errno = rv ? rv : orig_errno; + return rv; +} + +int lckpwdf(void) { + mlibc::infoLogger() << "mlibc: lckpwdf is unimplemented like musl" << frg::endlog; + return 0; +} + +int ulckpwdf(void) { + mlibc::infoLogger() << "mlibc: ulckpwdf is unimplemented like musl" << frg::endlog; + return 0; +} + +// Musl defines LINE_LIM to 256 +#define LINE_LIM 256 + +struct spwd *getspnam(const char *name) { + static struct spwd sp; + static char *line; + struct spwd *res; + int e; + int orig_errno = errno; + + if(!line) { + line = (char *)malloc(LINE_LIM); + } + if(!line) { + return 0; + } + e = getspnam_r(name, &sp, line, LINE_LIM, &res); + errno = e ? e : orig_errno; + return res; +} + +struct spwd *fgetspent(FILE *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void endspent(void) { + mlibc::infoLogger() << "mlibc: endspent is a stub" << frg::endlog; +} diff --git a/lib/mlibc/options/glibc/generic/stdio_ext-stubs.cpp b/lib/mlibc/options/glibc/generic/stdio_ext-stubs.cpp new file mode 100644 index 0000000..b9b61fc --- /dev/null +++ b/lib/mlibc/options/glibc/generic/stdio_ext-stubs.cpp @@ -0,0 +1,64 @@ + +#include <stdio_ext.h> +#include <bits/ensure.h> +#include <mlibc/debug.hpp> + +size_t __fbufsize(FILE *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +size_t __fpending(FILE *file_base) { + __ensure(file_base->__dirty_end >= file_base->__dirty_begin); + return file_base->__dirty_end - file_base->__dirty_begin; +} + +int __flbf(FILE *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +int __freadable(FILE *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +int __fwritable(FILE *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int __freading(FILE *file_base) { + return file_base->__io_mode == 0; +} + +int __fwriting(FILE *file_base) { + return file_base->__io_mode == 1; +} + +int __fsetlocking(FILE *, int) { + mlibc::infoLogger() << "mlibc: __fsetlocking() is a no-op" << frg::endlog; + return FSETLOCKING_INTERNAL; +} + +void _flushlbf(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +// The following functions are defined by musl. + +size_t __freadahead(FILE *file_base) { + if(file_base->__io_mode != 0) { + mlibc::infoLogger() << "mlibc: __freadahead() called but file is not open for reading" << frg::endlog; + return 0; + } + return file_base->__valid_limit - file_base->__offset; +} +const char *__freadptr(FILE *, size_t *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +void __fseterr(FILE *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + diff --git a/lib/mlibc/options/glibc/generic/string.cpp b/lib/mlibc/options/glibc/generic/string.cpp new file mode 100644 index 0000000..19f77c7 --- /dev/null +++ b/lib/mlibc/options/glibc/generic/string.cpp @@ -0,0 +1,32 @@ +#ifndef _GNU_SOURCE +# define _GNU_SOURCE +#endif +#include <type_traits> +#include <string.h> + +/* This is a bit of a weird detail of the GNU implementation and C's lack of + * overloading and strictness: GNU takes const char * and returns a char * so + * that it autocasts to your desired constness, this function never actually + * modifies the string. + */ +char *__mlibc_gnu_basename_c(const char *path) { + char *basename_component = strrchr(path, '/'); + if (!basename_component) { + return const_cast<char *>(path); + } + return basename_component + 1; +} + + +/* GNU exposes these overloads, and as a result, we should probably have them + * checked, to make sure we actually match expectations. + */ +static_assert( + std::is_same_v<decltype(basename((const char *)nullptr)), const char*>, + "C++ overloads broken" +); + +static_assert( + std::is_same_v<decltype(basename((char *)nullptr)), char*>, + "C++ overloads broken" +); diff --git a/lib/mlibc/options/glibc/generic/sys-io.cpp b/lib/mlibc/options/glibc/generic/sys-io.cpp new file mode 100644 index 0000000..fbd9070 --- /dev/null +++ b/lib/mlibc/options/glibc/generic/sys-io.cpp @@ -0,0 +1,25 @@ +#include <errno.h> +#include <sys/io.h> + +#include <bits/ensure.h> +#include <mlibc/glibc-sysdeps.hpp> + +int ioperm(unsigned long int from, unsigned long int num, int turn_on) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_ioperm, -1); + + if(int e = sysdep(from, num, turn_on); e) { + errno = e; + return -1; + } + return 0; +} + +int iopl(int level) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_iopl, -1); + + if(int e = sysdep(level); e) { + errno = e; + return -1; + } + return 0; +} diff --git a/lib/mlibc/options/glibc/generic/sys-ioctl.cpp b/lib/mlibc/options/glibc/generic/sys-ioctl.cpp new file mode 100644 index 0000000..021d2a3 --- /dev/null +++ b/lib/mlibc/options/glibc/generic/sys-ioctl.cpp @@ -0,0 +1,21 @@ + +#include <errno.h> +#include <sys/ioctl.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/glibc-sysdeps.hpp> + +int ioctl(int fd, unsigned long request, ...) { + va_list args; + va_start(args, request); + int result; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_ioctl, -1); + void *arg = va_arg(args, void *); + if(int e = mlibc::sys_ioctl(fd, request, arg, &result); e) { + errno = e; + return -1; + } + return result; +} + diff --git a/lib/mlibc/options/glibc/generic/sys-timex.cpp b/lib/mlibc/options/glibc/generic/sys-timex.cpp new file mode 100644 index 0000000..6173399 --- /dev/null +++ b/lib/mlibc/options/glibc/generic/sys-timex.cpp @@ -0,0 +1,17 @@ +#include <bits/ensure.h> +#include <sys/timex.h> + +int adjtimex(struct timex *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int clock_adjtime(clockid_t, struct timex *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int ntp_adjtime(struct timex *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/glibc/include/ar.h b/lib/mlibc/options/glibc/include/ar.h new file mode 100644 index 0000000..c7a9f38 --- /dev/null +++ b/lib/mlibc/options/glibc/include/ar.h @@ -0,0 +1,27 @@ + +#ifndef _AR_H +#define _AR_H + +#define ARMAG "!<arch>\n" +#define SARMAG 8 +#define ARFMAG "`\n" + +#ifdef __cplusplus +extern "C" { +#endif + +struct ar_hdr { + char ar_name[16]; + char ar_date[12]; + char ar_uid[6]; + char ar_gid[6]; + char ar_mode[8]; + char ar_size[10]; + char ar_fmag[2]; +}; + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/lib/mlibc/options/glibc/include/bits/glibc/glibc_assert.h b/lib/mlibc/options/glibc/include/bits/glibc/glibc_assert.h new file mode 100644 index 0000000..4461c5e --- /dev/null +++ b/lib/mlibc/options/glibc/include/bits/glibc/glibc_assert.h @@ -0,0 +1,32 @@ +#ifndef MLIBC_GLIBC_ASSERT_H +#define MLIBC_GLIBC_ASSERT_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +__attribute__ ((__noreturn__)) void __assert_fail_perror(int errno, const char *file, unsigned int line, + const char *function); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* MLIBC_GLIBC_ASSERT_H */ + +#ifdef NDEBUG + +#undef assert_perror +#define assert_perror(ignore) ((void)0) + +#else /* NDEBUG */ + +#undef assert_perror +#define assert_perror(errno) (!(errno) \ + || (__assert_fail_perror((errno), __FILE__, __LINE__, __func__), 0)) + +#endif /* NDEBUG */ diff --git a/lib/mlibc/options/glibc/include/bits/glibc/glibc_icmp6.h b/lib/mlibc/options/glibc/include/bits/glibc/glibc_icmp6.h new file mode 100644 index 0000000..eafde16 --- /dev/null +++ b/lib/mlibc/options/glibc/include/bits/glibc/glibc_icmp6.h @@ -0,0 +1,21 @@ +#ifndef _GLIBC_NETINET_ICMP6_H +#define _GLIBC_NETINET_ICMP6_H + +#ifdef __cplusplus +extern "C" { +#endif + +#define ND_OPT_SOURCE_LINKADDR 1 +#define ND_OPT_TARGET_LINKADDR 2 +#define ND_OPT_PREFIX_INFORMATION 3 +#define ND_OPT_REDIRECTED_HEADER 4 +#define ND_OPT_MTU 5 +#define ND_OPT_RTR_ADV_INTERVAL 7 +#define ND_OPT_HOME_AGENT_INFO 8 + +#ifdef __cplusplus +} +#endif + +#endif /* _GLIBC_NETINET_ICMP6_H */ + diff --git a/lib/mlibc/options/glibc/include/bits/glibc/glibc_malloc.h b/lib/mlibc/options/glibc/include/bits/glibc/glibc_malloc.h new file mode 100644 index 0000000..7ce6c5e --- /dev/null +++ b/lib/mlibc/options/glibc/include/bits/glibc/glibc_malloc.h @@ -0,0 +1,17 @@ +#ifndef _GLIBC_MALLOC_H +#define _GLIBC_MALLOC_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/size_t.h> + +size_t malloc_usable_size(void *ptr); + +#ifdef __cplusplus +} +#endif + +#endif /* _GLIBC_MALLOC_H */ + diff --git a/lib/mlibc/options/glibc/include/bits/glibc/glibc_signal.h b/lib/mlibc/options/glibc/include/bits/glibc/glibc_signal.h new file mode 100644 index 0000000..4d34e20 --- /dev/null +++ b/lib/mlibc/options/glibc/include/bits/glibc/glibc_signal.h @@ -0,0 +1,24 @@ +#ifndef MLIBC_GLIBC_SIGNAL_H +#define MLIBC_GLIBC_SIGNAL_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int tgkill(int, int, int); + +#if defined(_GNU_SOURCE) + +typedef void (*sighandler_t)(int); + +#endif + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // MLIBC_GLIBC_SIGNAL_H diff --git a/lib/mlibc/options/glibc/include/endian.h b/lib/mlibc/options/glibc/include/endian.h new file mode 100644 index 0000000..00d5ee1 --- /dev/null +++ b/lib/mlibc/options/glibc/include/endian.h @@ -0,0 +1,54 @@ +#ifndef _ENDIAN_H +#define _ENDIAN_H + +#include <byteswap.h> + +#ifdef __GNUC__ +# define BYTE_ORDER __BYTE_ORDER__ +# define LITTLE_ENDIAN __ORDER_LITTLE_ENDIAN__ +# define BIG_ENDIAN __ORDER_BIG_ENDIAN__ +# define PDP_ENDIAN __ORDER_PDP_ENDIAN__ + +# define __BYTE_ORDER __BYTE_ORDER__ +#ifndef __LITTLE_ENDIAN // Linux kernel headers define this already +# define __LITTLE_ENDIAN __ORDER_LITTLE_ENDIAN__ +#endif +# define __BIG_ENDIAN __ORDER_BIG_ENDIAN__ +# define __PDP_ENDIAN __ORDER_PDP_ENDIAN__ +#else +# error "Unsupported compiler" +#endif + +#if BYTE_ORDER == LITTLE_ENDIAN +# define htobe16(x) __bswap_16(x) +# define htole16(x) (uint16_t)(x) +# define be16toh(x) __bswap_16(x) +# define le16toh(x) (uint16_t)(x) + +# define htobe32(x) __bswap_32(x) +# define htole32(x) (uint32_t)(x) +# define be32toh(x) __bswap_32(x) +# define le32toh(x) (uint32_t)(x) + +# define htobe64(x) __bswap_64(x) +# define htole64(x) (uint64_t)(x) +# define be64toh(x) __bswap_64(x) +# define le64toh(x) (uint64_t)(x) +#else +# define htobe16(x) (uint16_t)(x) +# define htole16(x) __bswap_16(x) +# define be16toh(x) (uint16_t)(x) +# define le16toh(x) __bswap_16(x) + +# define htobe32(x) (uint32_t)(x) +# define htole32(x) __bswap_32(x) +# define be32toh(x) (uint32_t)(x) +# define le32toh(x) __bswap_32(x) + +# define htobe64(x) (uint64_t)(x) +# define htole64(x) __bswap_64(x) +# define be64toh(x) (uint64_t)(x) +# define le64toh(x) __bswap_64(x) +#endif + +#endif // _ENDIAN_H diff --git a/lib/mlibc/options/glibc/include/err.h b/lib/mlibc/options/glibc/include/err.h new file mode 100644 index 0000000..c3757ab --- /dev/null +++ b/lib/mlibc/options/glibc/include/err.h @@ -0,0 +1,29 @@ +#ifndef _ERR_H +#define _ERR_H + +#include <stdarg.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +void warn(const char *, ...); +void vwarn(const char *, va_list); +void warnx(const char *, ...); +void vwarnx(const char *, va_list); + +__attribute__((__noreturn__)) void err(int, const char *, ...); +__attribute__((__noreturn__)) void verr(int, const char *, va_list); +__attribute__((__noreturn__)) void errx(int, const char *, ...); +__attribute__((__noreturn__)) void verrx(int, const char *, va_list); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _ERR_H + diff --git a/lib/mlibc/options/glibc/include/error.h b/lib/mlibc/options/glibc/include/error.h new file mode 100644 index 0000000..782101d --- /dev/null +++ b/lib/mlibc/options/glibc/include/error.h @@ -0,0 +1,25 @@ +#ifndef _ERROR_H +#define _ERROR_H + +#include <stdarg.h> + +#ifdef __cplusplus +extern "C"{ +#endif + +#ifndef __MLIBC_ABI_ONLY + +void error(int status, int errnum, const char *format, ...); +void error_at_line(int status, int errnum, const char *filename, unsigned int linenum, const char *format, ...); + +extern unsigned int error_message_count; +extern int error_one_per_line; +extern void (*error_print_progname)(void); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* _ERROR_H */ diff --git a/lib/mlibc/options/glibc/include/execinfo.h b/lib/mlibc/options/glibc/include/execinfo.h new file mode 100644 index 0000000..addbc4e --- /dev/null +++ b/lib/mlibc/options/glibc/include/execinfo.h @@ -0,0 +1,20 @@ +#ifndef _EXECINFO_H +#define _EXECINFO_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int backtrace(void **, int); +char **backtrace_symbols(void *const *, int); +void backtrace_symbols_fd(void *const *, int, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/lib/mlibc/options/glibc/include/features.h b/lib/mlibc/options/glibc/include/features.h new file mode 100644 index 0000000..382b684 --- /dev/null +++ b/lib/mlibc/options/glibc/include/features.h @@ -0,0 +1,6 @@ +#ifndef FEATURES_H +#define FEATURES_H + +// This header is a stub + +#endif diff --git a/lib/mlibc/options/glibc/include/getopt.h b/lib/mlibc/options/glibc/include/getopt.h new file mode 100644 index 0000000..5b24cc8 --- /dev/null +++ b/lib/mlibc/options/glibc/include/getopt.h @@ -0,0 +1,44 @@ + +#ifndef _GETOPT_H +#define _GETOPT_H + +#include <mlibc-config.h> + +#ifdef __cplusplus +extern "C" { +#endif + +struct option { + const char *name; + int has_arg; + int *flag; + int val; +}; + +#ifndef __MLIBC_ABI_ONLY + +extern char **environ; +extern char *optarg; +extern int optind; +extern int opterr; +extern int optopt; +#if __MLIBC_BSD_OPTION +extern int optreset; +#endif //__MLIBC_BSD_OPTION + +int getopt(int, char *const [], const char *); +int getopt_long(int, char *const[], const char *, const struct option *, int *); +int getopt_long_only(int, char *const[], const char *, const struct option *, int *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#define no_argument 0 +#define required_argument 1 +#define optional_argument 2 + +#ifdef __cplusplus +} +#endif + +#endif // _GETOPT_H + diff --git a/lib/mlibc/options/glibc/include/gshadow.h b/lib/mlibc/options/glibc/include/gshadow.h new file mode 100644 index 0000000..61ec91f --- /dev/null +++ b/lib/mlibc/options/glibc/include/gshadow.h @@ -0,0 +1,30 @@ +#ifndef _GSHADOW_H +#define _GSHADOW_H + +#include <paths.h> +#include <bits/size_t.h> + +#define GSHADOW _PATH_GSHADOW + +struct sgrp { + char *sg_namp; + char *sg_passwd; + char **sg_adm; + char **sg_mem; +}; + +#ifndef __MLIBC_ABI_ONLY + +#ifdef __cplusplus +extern "C" { +#endif + +int getsgnam_r(const char *name, struct sgrp *result_buf, char *buffer, size_t len, struct sgrp **result); + +#ifdef __cplusplus +} +#endif + +#endif /* !__MLIBC_ABI_ONLY */ + +#endif diff --git a/lib/mlibc/options/glibc/include/memory.h b/lib/mlibc/options/glibc/include/memory.h new file mode 100644 index 0000000..39adee7 --- /dev/null +++ b/lib/mlibc/options/glibc/include/memory.h @@ -0,0 +1,6 @@ +#ifndef _MEMORY_H +#define _MEMORY_H + +#include <string.h> + +#endif diff --git a/lib/mlibc/options/glibc/include/mlibc/glibc-sysdeps.hpp b/lib/mlibc/options/glibc/include/mlibc/glibc-sysdeps.hpp new file mode 100644 index 0000000..a3888ce --- /dev/null +++ b/lib/mlibc/options/glibc/include/mlibc/glibc-sysdeps.hpp @@ -0,0 +1,16 @@ +#ifndef MLIBC_GLIBC_SYSDEPS +#define MLIBC_GLIBC_SYSDEPS + +namespace [[gnu::visibility("hidden")]] mlibc { + +[[gnu::weak]] int sys_ioctl(int fd, unsigned long request, void *arg, int *result); +[[gnu::weak]] int sys_tgkill(int tgid, int tid, int sig); + +[[gnu::weak]] int sys_personality(unsigned long persona, int *out); + +[[gnu::weak]] int sys_ioperm(unsigned long int from, unsigned long int num, int turn_on); +[[gnu::weak]] int sys_iopl(int level); + +} // namespace mlibc + +#endif // MLIBC_GLIBC_SYSDEPS diff --git a/lib/mlibc/options/glibc/include/net/ethernet.h b/lib/mlibc/options/glibc/include/net/ethernet.h new file mode 100644 index 0000000..8dac98a --- /dev/null +++ b/lib/mlibc/options/glibc/include/net/ethernet.h @@ -0,0 +1,42 @@ +#ifndef _NET_ETHERNET_H +#define _NET_ETHERNET_H + +#include <bits/ether_addr.h> +#include <stdint.h> +#include <mlibc-config.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#if __MLIBC_LINUX_OPTION +# include <linux/if_ether.h> +#endif /* __MLIBC_LINUX_OPTION */ + +#define ETHERTYPE_PUP 0x0200 +#define ETHERTYPE_SPRITE 0x0500 +#define ETHERTYPE_IP 0x0800 +#define ETHERTYPE_ARP 0x0806 +#define ETHERTYPE_REVARP 0x8035 +#define ETHERTYPE_AT 0x809B +#define ETHERTYPE_AARP 0x80F3 +#define ETHERTYPE_VLAN 0x8100 +#define ETHERTYPE_IPX 0x8137 +#define ETHERTYPE_IPV6 0x86dd +#define ETHERTYPE_LOOPBACK 0x9000 + +struct ether_header { + uint8_t ether_dhost[6]; + uint8_t ether_shost[6]; + uint16_t ether_type; +}; + +#define ETHER_ADDR_LEN 6 + +#define ETHERTYPE_IP 0x0800 + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/lib/mlibc/options/glibc/include/net/if_ppp.h b/lib/mlibc/options/glibc/include/net/if_ppp.h new file mode 100644 index 0000000..55f46b5 --- /dev/null +++ b/lib/mlibc/options/glibc/include/net/if_ppp.h @@ -0,0 +1,23 @@ +#ifndef _NET_IF_PPP_H +#define _NET_IF_PPP_H + +#include <mlibc-config.h> + +#if __MLIBC_LINUX_OPTION +#include <asm/ioctl.h> +#include <linux/ppp_defs.h> + +#define PPPIOCGFLAGS _IOR('t', 90, int) +#define PPPIOCSFLAGS _IOW('t', 89, int) +#define PPPIOCGASYNCMAP _IOR('t', 88, int) +#define PPPIOCSASYNCMAP _IOW('t', 87, int) +#define PPPIOCGUNIT _IOR('t', 86, int) +#define PPPIOCSMRU _IOW('t', 82, int) +#define PPPIOCSMAXCID _IOW('t', 81, int) +#define PPPIOCGXASYNCMAP _IOR('t', 80, ext_accm) +#define PPPIOCSXASYNCMAP _IOW('t', 79, ext_accm) +#define PPPIOCGDEBUG _IOR('t', 65, int) +#define PPPIOCSDEBUG _IOW('t', 64, int) +#endif + +#endif /* _NET_IF_PPP_H */ diff --git a/lib/mlibc/options/glibc/include/net/route.h b/lib/mlibc/options/glibc/include/net/route.h new file mode 100644 index 0000000..7537241 --- /dev/null +++ b/lib/mlibc/options/glibc/include/net/route.h @@ -0,0 +1,35 @@ +#ifndef _NET_ROUTE_H +#define _NET_ROUTE_H + +#include <sys/socket.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#define RTF_HOST 0x0004 +#define RTF_REJECT 0x0200 + +struct rtentry { + unsigned long int rt_pad1; + struct sockaddr rt_dst; + struct sockaddr rt_gateway; + struct sockaddr rt_genmask; + unsigned short int rt_flags; + short int rt_pad2; + unsigned long int rt_pad3; + unsigned char rt_tos; + unsigned char rt_class; + short int rt_pad4[3]; + short int rt_metric; + char *rt_dev; + unsigned long int rt_mtu; + unsigned long int rt_window; + unsigned short int rt_irtt; +}; + +#ifdef __cplusplus +} +#endif + +#endif /* _NET_ROUTE_H */ diff --git a/lib/mlibc/options/glibc/include/netax25/ax25.h b/lib/mlibc/options/glibc/include/netax25/ax25.h new file mode 100644 index 0000000..3fb82da --- /dev/null +++ b/lib/mlibc/options/glibc/include/netax25/ax25.h @@ -0,0 +1,51 @@ +#ifndef _NETAX25_AX25_H +#define _NETAX25_AX25_H + +#include <mlibc-config.h> +#include <sys/socket.h> + +#define AX25_VALUES_IPDEFMODE 0 +#define AX25_VALUES_AXDEFMODE 1 +#define AX25_VALUES_NETROM 2 +#define AX25_VALUES_TEXT 3 +#define AX25_VALUES_BACKOFF 4 +#define AX25_VALUES_CONMODE 5 +#define AX25_VALUES_WINDOW 6 +#define AX25_VALUES_EWINDOW 7 +#define AX25_VALUES_T1 8 +#define AX25_VALUES_T2 9 +#define AX25_VALUES_T3 10 +#define AX25_VALUES_N2 11 +#define AX25_VALUES_DIGI 12 +#define AX25_VALUES_IDLE 13 +#define AX25_VALUES_PACLEN 14 +#define AX25_VALUES_IPMAXQUEUE 15 +#define AX25_MAX_VALUES 20 + +typedef struct { + char ax25_call[7]; +} ax25_address; + +struct sockaddr_ax25 { + sa_family_t sax25_family; + ax25_address sax25_call; + int sax25_ndigis; +}; + +struct ax25_parms_struct { + ax25_address port_addr; + unsigned short values[AX25_MAX_VALUES]; +}; + +#if __MLIBC_LINUX_OPTION +#include <abi-bits/ioctls.h> + +#define SIOCAX25GETUID (SIOCPROTOPRIVATE) +#define SIOCAX25ADDUID (SIOCPROTOPRIVATE + 1) +#define SIOCAX25DELUID (SIOCPROTOPRIVATE + 2) +#define SIOCAX25NOUID (SIOCPROTOPRIVATE + 3) +#define SIOCAX25GETPARMS (SIOCPROTOPRIVATE + 5) +#define SIOCAX25SETPARMS (SIOCPROTOPRIVATE + 6) +#endif /* __MLIBC_LINUX_OPTION */ + +#endif /* _NETAX25_AX25_H */ diff --git a/lib/mlibc/options/glibc/include/netinet/in_systm.h b/lib/mlibc/options/glibc/include/netinet/in_systm.h new file mode 100644 index 0000000..c98298f --- /dev/null +++ b/lib/mlibc/options/glibc/include/netinet/in_systm.h @@ -0,0 +1,7 @@ + +#ifndef _NETINET_IN_SYSTM_H +#define _NETINET_IN_SYSTM_H + + + +#endif // _NETINET_IN_SYSTM_H diff --git a/lib/mlibc/options/glibc/include/netipx/ipx.h b/lib/mlibc/options/glibc/include/netipx/ipx.h new file mode 100644 index 0000000..7b5c774 --- /dev/null +++ b/lib/mlibc/options/glibc/include/netipx/ipx.h @@ -0,0 +1,35 @@ +#ifndef _NETIPX_IPX_H +#define _NETIPX_IPX_H + +#include <mlibc-config.h> +#include <sys/socket.h> +#include <stdint.h> + +typedef struct ipx_config_data { + unsigned char ipxcfg_auto_select_primary; + unsigned char ipxcfg_auto_create_interfaces; +} ipx_config_data; + +#define IPX_TYPE 1 +#define IPX_NODE_LEN 6 + +struct sockaddr_ipx { + sa_family_t sipx_family; + uint16_t sipx_port; + uint32_t sipx_network; + unsigned char sipx_node[IPX_NODE_LEN]; + uint8_t sipx_type; + unsigned char sipx_zero; +}; + +#define SOL_IPX 256 + +#if __MLIBC_LINUX_OPTION +#include <abi-bits/ioctls.h> + +#define SIOCAIPXITFCRT (SIOCPROTOPRIVATE) +#define SIOCAIPXPRISLT (SIOCPROTOPRIVATE + 1) +#define SIOCIPXCFGDATA (SIOCPROTOPRIVATE + 2) +#endif + +#endif /* _NETIPX_IPX_H */ diff --git a/lib/mlibc/options/glibc/include/netrom/netrom.h b/lib/mlibc/options/glibc/include/netrom/netrom.h new file mode 100644 index 0000000..69497d9 --- /dev/null +++ b/lib/mlibc/options/glibc/include/netrom/netrom.h @@ -0,0 +1,27 @@ +#ifndef _NETROM_NETROM_H +#define _NETROM_NETROM_H + +#include <mlibc-config.h> + +struct nr_parms_struct { + unsigned int quality; + unsigned int obs_count; + unsigned int ttl; + unsigned int timeout; + unsigned int ack_delay; + unsigned int busy_delay; + unsigned int tries; + unsigned int window; + unsigned int paclen; +}; + +#if __MLIBC_LINUX_OPTION +#include <abi-bits/ioctls.h> + +#define SIOCNRGETPARMS (SIOCPROTOPRIVATE) +#define SIOCNRSETPARMS (SIOCPROTOPRIVATE + 1) +#define SIOCNRDECOBS (SIOCPROTOPRIVATE + 2) +#define SIOCNRRTCTL (SIOCPROTOPRIVATE + 3) +#endif + +#endif /* _NETROM_NETROM_H */ diff --git a/lib/mlibc/options/glibc/include/paths.h b/lib/mlibc/options/glibc/include/paths.h new file mode 100644 index 0000000..3d8a4a6 --- /dev/null +++ b/lib/mlibc/options/glibc/include/paths.h @@ -0,0 +1,41 @@ +// This file is taken from musl +// Path to original: include/paths.h + +#ifndef _PATHS_H +#define _PATHS_H + +#define _PATH_DEFPATH "/usr/local/bin:/bin:/usr/bin" +#define _PATH_STDPATH "/bin:/usr/bin:/sbin:/usr/sbin" + +#define _PATH_BSHELL "/bin/sh" +#define _PATH_CONSOLE "/dev/console" +#define _PATH_DEVNULL "/dev/null" +#define _PATH_GSHADOW "/etc/gshadow" +#define _PATH_KLOG "/proc/kmsg" +#define _PATH_LASTLOG "/var/log/lastlog" +#define _PATH_MAILDIR "/var/mail" +#define _PATH_MAN "/usr/share/man" +#define _PATH_MNTTAB "/etc/fstab" +#define _PATH_MOUNTED "/etc/mtab" +#define _PATH_NOLOGIN "/etc/nologin" +#define _PATH_PRESERVE "/var/lib" +#define _PATH_SENDMAIL "/usr/sbin/sendmail" +#define _PATH_SHADOW "/etc/shadow" +#define _PATH_SHELLS "/etc/shells" +#define _PATH_TTY "/dev/tty" +#define _PATH_UTMP "/dev/null/utmp" +#define _PATH_VI "/usr/bin/vi" +#define _PATH_WTMP "/dev/null/wtmp" + +#define _PATH_DEV "/dev/" +#define _PATH_TMP "/tmp/" +#define _PATH_VARDB "/var/lib/misc/" +#define _PATH_VARRUN "/var/run/" +#define _PATH_VARTMP "/var/tmp/" + +#ifdef _GNU_SOURCE +#define _PATH_UTMPX _PATH_UTMP +#define _PATH_WTMPX _PATH_WTMP +#endif + +#endif // _PATHS_H diff --git a/lib/mlibc/options/glibc/include/printf.h b/lib/mlibc/options/glibc/include/printf.h new file mode 100644 index 0000000..e7dd0d8 --- /dev/null +++ b/lib/mlibc/options/glibc/include/printf.h @@ -0,0 +1,41 @@ +#ifndef _PRINTF_H +#define _PRINTF_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <stddef.h> +#include <stdarg.h> + +#ifndef __MLIBC_ABI_ONLY + +// This seems to be a glibc thing, so constants are from glibc +size_t parse_printf_format(const char * __restrict, size_t, int * __restrict); + +#endif /* !__MLIBC_ABI_ONLY */ + +enum { + PA_INT, + PA_CHAR, + PA_WCHAR, + PA_STRING, + PA_WSTRING, + PA_POINTER, + PA_FLOAT, + PA_DOUBLE, + PA_LAST +}; + +#define PA_FLAG_MASK 0xff00 +#define PA_FLAG_LONG_LONG (1 << 8) +#define PA_FLAG_LONG_DOUBLE PA_FLAG_LONG_LONG +#define PA_FLAG_LONG (1 << 9) +#define PA_FLAG_SHORT (1 << 10) +#define PA_FLAG_PTR (1 << 11) + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/lib/mlibc/options/glibc/include/resolv.h b/lib/mlibc/options/glibc/include/resolv.h new file mode 100644 index 0000000..71b4fe5 --- /dev/null +++ b/lib/mlibc/options/glibc/include/resolv.h @@ -0,0 +1,73 @@ +#ifndef _RESOLV_H +#define _RESOLV_H + +#include <netinet/in.h> + +#define RES_INIT 0x00000001 +#define RES_DEBUG 0x00000002 +#define RES_USEVC 0x00000008 +#define RES_IGNTC 0x00000020 +#define RES_RECURSE 0x00000040 +#define RES_DEFNAMES 0x00000080 +#define RES_STAYOPEN 0x00000100 +#define RES_DNSRCH 0x00000200 + +#define MAXNS 3 +#define MAXDNSRCH 6 + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int dn_expand(const unsigned char *, const unsigned char *, + const unsigned char *, char *, int); + +int res_query(const char *, int, int, unsigned char *, int); + +int res_init(void); + +#endif /* !__MLIBC_ABI_ONLY */ + +/* From musl: Unused; purely for broken apps + * To avoid an massive struct, only add the items requested. */ +typedef struct __res_state { + int retrans; + int retry; + unsigned long options; + int nscount; + struct sockaddr_in nsaddr_list[MAXNS]; + char *dnsrch[MAXDNSRCH + 1]; + char defdname[256]; + unsigned ndots:4; + unsigned nsort:4; + union { + char pad[52]; + struct { + uint16_t nscount; + uint16_t nsmap[MAXNS]; + int nssocks[MAXNS]; + uint16_t nscount6; + uint16_t nsinit; + struct sockaddr_in6 *nsaddrs[MAXNS]; + unsigned int _initstamp[2]; + } _ext; + } _u; +} *res_state; + +#ifndef __MLIBC_ABI_ONLY + +struct __res_state *__res_state(void); +#define _res (*__res_state()) + +int res_ninit(res_state); +void res_nclose(res_state); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _RESOLV_H diff --git a/lib/mlibc/options/glibc/include/shadow.h b/lib/mlibc/options/glibc/include/shadow.h new file mode 100644 index 0000000..caad9cf --- /dev/null +++ b/lib/mlibc/options/glibc/include/shadow.h @@ -0,0 +1,42 @@ +#ifndef _SHADOW_H +#define _SHADOW_H + +#include <stdint.h> +#include <stdio.h> +#include <paths.h> + +#ifdef __cplusplus +extern "C" { +#endif + +struct spwd { + char *sp_namp; + char *sp_pwdp; + int32_t sp_lstchg; + int32_t sp_min; + int32_t sp_max; + int32_t sp_warn; + int32_t sp_inact; + int32_t sp_expire; + uint32_t sp_flag; +}; + +#define SHADOW _PATH_SHADOW + +#ifndef __MLIBC_ABI_ONLY + +int putspent(const struct spwd *, FILE *); +int lckpwdf(void); +int ulckpwdf(void); +struct spwd *getspnam(const char *); +int getspnam_r(const char *, struct spwd *, char *, size_t, struct spwd **); +struct spwd *fgetspent(FILE *); +void endspent(void); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/lib/mlibc/options/glibc/include/stdio_ext.h b/lib/mlibc/options/glibc/include/stdio_ext.h new file mode 100644 index 0000000..f22e05d --- /dev/null +++ b/lib/mlibc/options/glibc/include/stdio_ext.h @@ -0,0 +1,41 @@ +#ifndef _STDIO_EXT_H +#define _STDIO_EXT_H + +#include <stddef.h> +#include <stdio.h> + +#define FSETLOCKING_INTERNAL 1 +#define FSETLOCKING_BYCALLER 2 +#define FSETLOCKING_QUERY 3 + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +size_t __fbufsize(FILE *); +size_t __fpending(FILE *); +int __flbf(FILE *); +int __freadable(FILE *); +int __fwritable(FILE *); +int __freading(FILE *); +int __fwriting(FILE *); +int __fsetlocking(FILE *, int); +void __fpurge(FILE *); + +void _flushlbf(void); + +// The following functions are defined by musl. + +size_t __freadahead(FILE *); +const char *__freadptr(FILE *, size_t *); +void __fseterr(FILE *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _STDIO_EXT_H diff --git a/lib/mlibc/options/glibc/include/sys/dir.h b/lib/mlibc/options/glibc/include/sys/dir.h new file mode 100644 index 0000000..eff112c --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/dir.h @@ -0,0 +1,8 @@ +#ifndef _SYS_DIR_H +#define _SYS_DIR_H + +#include <dirent.h> + +#define direct dirent + +#endif diff --git a/lib/mlibc/options/glibc/include/sys/endian.h b/lib/mlibc/options/glibc/include/sys/endian.h new file mode 100644 index 0000000..e69de29 --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/endian.h diff --git a/lib/mlibc/options/glibc/include/sys/errno.h b/lib/mlibc/options/glibc/include/sys/errno.h new file mode 100644 index 0000000..339f4fc --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/errno.h @@ -0,0 +1 @@ +#include <errno.h> diff --git a/lib/mlibc/options/glibc/include/sys/io.h b/lib/mlibc/options/glibc/include/sys/io.h new file mode 100644 index 0000000..311b25f --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/io.h @@ -0,0 +1,108 @@ +#ifndef _SYS_IO_H +#define _SYS_IO_H + +#include <bits/inline-definition.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int ioperm(unsigned long int from, unsigned long int num, int turn_on); + +__attribute__((deprecated)) int iopl(int level); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __x86_64__ +__MLIBC_INLINE_DEFINITION unsigned char inb(unsigned short int port) { + unsigned char _v; + __asm__ __volatile__ ("inb %w1,%0":"=a" (_v):"Nd" (port)); + return _v; +} + +__MLIBC_INLINE_DEFINITION unsigned char inb_p(unsigned short int port) { + unsigned char _v; + __asm__ __volatile__ ("inb %w1,%0\noutb %%al,$0x80":"=a" (_v):"Nd" (port)); + return _v; +} + +__MLIBC_INLINE_DEFINITION unsigned short int inw(unsigned short int port) { + unsigned short _v; + __asm__ __volatile__ ("inw %w1,%0":"=a" (_v):"Nd" (port)); + return _v; +} + +__MLIBC_INLINE_DEFINITION unsigned short int inw_p(unsigned short int port) { + unsigned short int _v; + __asm__ __volatile__ ("inw %w1,%0\noutb %%al,$0x80":"=a" (_v):"Nd" (port)); + return _v; +} + +__MLIBC_INLINE_DEFINITION unsigned int inl(unsigned short int port) { + unsigned int _v; + __asm__ __volatile__ ("inl %w1,%0":"=a" (_v):"Nd" (port)); + return _v; +} + +__MLIBC_INLINE_DEFINITION unsigned int inl_p(unsigned short int port) { + unsigned int _v; + __asm__ __volatile__ ("inl %w1,%0\noutb %%al,$0x80":"=a" (_v):"Nd" (port)); + return _v; +} + +__MLIBC_INLINE_DEFINITION void outb(unsigned char value, unsigned short int port) { + __asm__ __volatile__ ("outb %b0,%w1": :"a" (value), "Nd" (port)); +} + +__MLIBC_INLINE_DEFINITION void outb_p(unsigned char value, unsigned short int port) { + __asm__ __volatile__ ("outb %b0,%w1\noutb %%al,$0x80": :"a" (value), "Nd" (port)); +} + +__MLIBC_INLINE_DEFINITION void outw(unsigned short int value, unsigned short int port) { + __asm__ __volatile__ ("outw %w0,%w1": :"a" (value), "Nd" (port)); +} + +__MLIBC_INLINE_DEFINITION void outw_p(unsigned short int value, unsigned short int port) { + __asm__ __volatile__ ("outw %w0,%w1\noutb %%al,$0x80": :"a" (value), "Nd" (port)); +} + +__MLIBC_INLINE_DEFINITION void outl(unsigned int value, unsigned short int port) { + __asm__ __volatile__ ("outl %0,%w1": :"a" (value), "Nd" (port)); +} + +__MLIBC_INLINE_DEFINITION void outl_p(unsigned int value, unsigned short int port) { + __asm__ __volatile__ ("outl %0,%w1\noutb %%al,$0x80": :"a" (value), "Nd" (port)); +} + +__MLIBC_INLINE_DEFINITION void insb(unsigned short int port, void *addr, unsigned long int count) { + __asm__ __volatile__ ("cld ; rep ; insb":"=D" (addr), "=c" (count) :"d" (port), "0" (addr), "1" (count)); +} + +__MLIBC_INLINE_DEFINITION void insw(unsigned short int port, void *addr, unsigned long int count) { + __asm__ __volatile__ ("cld ; rep ; insw":"=D" (addr), "=c" (count) :"d" (port), "0" (addr), "1" (count)); +} + +__MLIBC_INLINE_DEFINITION void insl(unsigned short int port, void *addr, unsigned long int count) { + __asm__ __volatile__ ("cld ; rep ; insl":"=D" (addr), "=c" (count) :"d" (port), "0" (addr), "1" (count)); +} + +__MLIBC_INLINE_DEFINITION void outsb(unsigned short int port, const void *addr, unsigned long int count) { + __asm__ __volatile__ ("cld ; rep ; outsb":"=S" (addr), "=c" (count) :"d" (port), "0" (addr), "1" (count)); +} + +__MLIBC_INLINE_DEFINITION void outsw(unsigned short int port, const void *addr, unsigned long int count) { + __asm__ __volatile__ ("cld ; rep ; outsw":"=S" (addr), "=c" (count) :"d" (port), "0" (addr), "1" (count)); +} + +__MLIBC_INLINE_DEFINITION void outsl(unsigned short int port, const void *addr, unsigned long int count) { + __asm__ __volatile__ ("cld ; rep ; outsl":"=S" (addr), "=c" (count) :"d" (port), "0" (addr), "1" (count)); +} +#endif + +#ifdef __cplusplus +} +#endif + +#endif /* _SYS_IO_H */ diff --git a/lib/mlibc/options/glibc/include/sys/ioctl.h b/lib/mlibc/options/glibc/include/sys/ioctl.h new file mode 100644 index 0000000..6121446 --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/ioctl.h @@ -0,0 +1,44 @@ +#ifndef _SYS_IOCTL_H +#define _SYS_IOCTL_H + +#include <mlibc-config.h> +#include <abi-bits/ioctls.h> + +// On Linux, sys/ioctl.h includes the termios ioctls. +#if __MLIBC_LINUX_OPTION +# include <asm/ioctls.h> +# include <bits/winsize.h> +# include <sys/ttydefaults.h> +#endif + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int ioctl(int fd, unsigned long request, ...); + +#endif /* !__MLIBC_ABI_ONLY */ + +#define FIONREAD 0x541B +#define FIONBIO 0x5421 +#define FIONCLEX 0x5450 +#define FIOCLEX 0x5451 + +#define SIOCGIFNAME 0x8910 +#define SIOCGIFCONF 0x8912 +#define SIOCGIFFLAGS 0x8913 +#define SIOCSIFFLAGS 0x8914 +#define SIOCGIFMTU 0x8921 +#define SIOCSIFMTU 0x8922 +#define SIOCGIFINDEX 0x8933 + +#define SIOCPROTOPRIVATE 0x89E0 +#define SIOCDEVPRIVATE 0x89F0 + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_IOCTL_H diff --git a/lib/mlibc/options/glibc/include/sys/kd.h b/lib/mlibc/options/glibc/include/sys/kd.h new file mode 100644 index 0000000..285c694 --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/kd.h @@ -0,0 +1,17 @@ +#ifndef _SYS_KD_H +#define _SYS_KD_H + +/* Make sure the <linux/types.h> header is not loaded. */ +#ifndef _LINUX_TYPES_H +# define _LINUX_TYPES_H 1 +# define __undef_LINUX_TYPES_H +#endif + +#include <linux/kd.h> + +#ifdef __undef_LINUX_TYPES_H +# undef _LINUX_TYPES_H +# undef __undef_LINUX_TYPES_H +#endif + +#endif /* _SYS_KD_H */ diff --git a/lib/mlibc/options/glibc/include/sys/mtio.h b/lib/mlibc/options/glibc/include/sys/mtio.h new file mode 100644 index 0000000..c2f9d98 --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/mtio.h @@ -0,0 +1,103 @@ +#ifndef _SYS_MTIO_H +#define _SYS_MTIO_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <mlibc-config.h> + +struct mtop { + short int mt_op; + int mt_count; +}; + +struct mtget { + long int mt_type; + long int mt_resid; + long int mt_dsreg; + long int mt_gstat; + long int mt_erreg; + int mt_fileno; + int mt_blkno; +}; + +struct mtpos { + long int mt_blkno; +}; + +struct mtconfiginfo { + long int mt_type; + long int ifc_type; + unsigned short int irqnr; + unsigned short int dmanr; + unsigned short int port; + + unsigned long int debug; + + unsigned have_dens:1; + unsigned have_bsf:1; + unsigned have_fsr:1; + unsigned have_bsr:1; + unsigned have_eod:1; + unsigned have_seek:1; + unsigned have_tell:1; + unsigned have_ras1:1; + unsigned have_ras2:1; + unsigned have_ras3:1; + unsigned have_qfa:1; + + unsigned pad1:5; + char reserved[10]; +}; + +#define MTRESET 0 +#define MTFSF 1 +#define MTBSF 2 +#define MTFSR 3 +#define MTBSR 4 +#define MTWEOF 5 +#define MTREW 6 +#define MTOFFL 7 +#define MTNOP 8 +#define MTRETEN 9 +#define MTBSFM 10 +#define MTFSFM 11 +#define MTEOM 12 +#define MTERASE 13 +#define MTRAS1 14 +#define MTRAS2 15 +#define MTRAS3 16 +#define MTSETBLK 20 +#define MTSETDENSITY 21 +#define MTSEEK 22 +#define MTTELL 23 +#define MTSETDRVBUFFER 24 +#define MTFSS 25 +#define MTBSS 26 +#define MTWSM 27 +#define MTLOCK 28 +#define MTUNLOCK 29 +#define MTLOAD 30 +#define MTUNLOAD 31 +#define MTCOMPRESSION 32 +#define MTSETPART 33 +#define MTMKPART 34 + +#define GMT_WR_PROT(x) ((x) & 0x04000000) + +#if __MLIBC_LINUX_OPTION +#include <asm/ioctl.h> + +#define MTIOCTOP _IOR('m', 1, struct mtop) +#define MTIOCGET _IOR('m', 2, struct mtget) +#define MTIOCPOS _IOR('m', 3, struct mtpos) +#define MTIOCGETCONFIG _IOR('m', 4, struct mtconfiginfo) +#define MTIOCSETCONFIG _IOR('m', 5, struct mtconfiginfo) +#endif + +#ifdef __cplusplus +} +#endif + +#endif /* _SYS_MTIO_H */ diff --git a/lib/mlibc/options/glibc/include/sys/personality.h b/lib/mlibc/options/glibc/include/sys/personality.h new file mode 100644 index 0000000..04563a0 --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/personality.h @@ -0,0 +1,58 @@ +#ifndef _SYS_PERSONALITY_H +#define _SYS_PERSONALITY_H + +#ifdef __cplusplus +extern "C" { +#endif + +enum { + UNAME26 = 0x0020000, + ADDR_NO_RANDOMIZE = 0x0040000, + FDPIC_FUNCPTRS = 0x0080000, + MMAP_PAGE_ZERO = 0x0100000, + ADDR_COMPAT_LAYOUT = 0x0200000, + READ_IMPLIES_EXEC = 0x0400000, + ADDR_LIMIT_32BIT = 0x0800000, + SHORT_INODE = 0x1000000, + WHOLE_SECONDS = 0x2000000, + STICKY_TIMEOUTS = 0x4000000, + ADDR_LIMIT_3GB = 0x8000000, +}; + +enum { + PER_LINUX = 0x0000, + PER_LINUX_32BIT = 0x0000 | ADDR_LIMIT_32BIT, + PER_LINUX_FDPIC = 0x0000 | FDPIC_FUNCPTRS, + PER_SVR4 = 0x0001 | STICKY_TIMEOUTS | MMAP_PAGE_ZERO, + PER_SVR3 = 0x0002 | STICKY_TIMEOUTS | SHORT_INODE, + PER_SCOSVR3 = 0x0003 | STICKY_TIMEOUTS | WHOLE_SECONDS | SHORT_INODE, + PER_OSR5 = 0x0003 | STICKY_TIMEOUTS | WHOLE_SECONDS, + PER_WYSEV386 = 0x0004 | STICKY_TIMEOUTS | SHORT_INODE, + PER_ISCR4 = 0x0005 | STICKY_TIMEOUTS, + PER_BSD = 0x0006, + PER_SUNOS = 0x0006 | STICKY_TIMEOUTS, + PER_XENIX = 0x0007 | STICKY_TIMEOUTS | SHORT_INODE, + PER_LINUX32 = 0x0008, + PER_LINUX32_3GB = 0x0008 | ADDR_LIMIT_3GB, + PER_IRIX32 = 0x0009 | STICKY_TIMEOUTS, + PER_IRIXN32 = 0x000a | STICKY_TIMEOUTS, + PER_IRIX64 = 0x000b | STICKY_TIMEOUTS, + PER_RISCOS = 0x000c, + PER_SOLARIS = 0x000d | STICKY_TIMEOUTS, + PER_UW7 = 0x000e | STICKY_TIMEOUTS | MMAP_PAGE_ZERO, + PER_OSF4 = 0x000f, + PER_HPUX = 0x0010, + PER_MASK = 0x00ff, +}; + +#ifndef __MLIBC_ABI_ONLY + +int personality(unsigned long persona); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_PERSONALITY_H diff --git a/lib/mlibc/options/glibc/include/sys/procfs.h b/lib/mlibc/options/glibc/include/sys/procfs.h new file mode 100644 index 0000000..b13a81d --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/procfs.h @@ -0,0 +1,54 @@ +#ifndef _SYS_PROCFS_H +#define _SYS_PROCFS_H + +#include <sys/user.h> +#include <sys/time.h> +#include <abi-bits/pid_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +typedef unsigned long long elf_greg_t; + +#define ELF_NGREG (sizeof (struct user_regs_struct) / sizeof (elf_greg_t)) +typedef elf_greg_t elf_gregset_t[ELF_NGREG]; + +typedef struct user_fpregs_struct elf_fpregset_t; +typedef struct user_regs_struct prgregset_t; +typedef struct user_fpregs_struct prfpregset_t; + +#define ELF_PRARGSZ 80 + +struct elf_siginfo { + int si_signo; + int si_code; + int si_errno; +}; + +struct elf_prstatus { + struct elf_siginfo pr_info; + short int pr_cursig; + unsigned long int pr_sigpend; + unsigned long int pr_sighold; + pid_t pr_pid; + pid_t pr_ppid; + pid_t pr_pgrp; + pid_t pr_sid; + struct timeval pr_utime; + struct timeval pr_stime; + struct timeval pr_cutime; + struct timeval pr_cstime; + elf_gregset_t pr_reg; + int pr_fpvalid; +}; + +typedef pid_t lwpid_t; +typedef void *psaddr_t; +typedef struct elf_prstatus prstatus_t; + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/lib/mlibc/options/glibc/include/sys/reg.h b/lib/mlibc/options/glibc/include/sys/reg.h new file mode 100644 index 0000000..c6e3429 --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/reg.h @@ -0,0 +1,36 @@ +#ifndef _SYS_REG_H +#define _SYS_REG_H + +#ifdef __x86_64__ +#define R15 0 +#define R14 1 +#define R13 2 +#define R12 3 +#define RBP 4 +#define RBX 5 +#define R11 6 +#define R10 7 +#define R9 8 +#define R8 9 +#define RAX 10 +#define RCX 11 +#define RDX 12 +#define RSI 13 +#define RDI 14 +#define ORIG_RAX 15 +#define RIP 16 +#define CS 17 +#define EFLAGS 18 +#define RSP 19 +#define SS 20 +#define FS_BASE 21 +#define GS_BASE 22 +#define DS 23 +#define ES 24 +#define FS 25 +#define GS 26 +#else +#error "Add architecture specific code here" +#endif + +#endif diff --git a/lib/mlibc/options/glibc/include/sys/signal.h b/lib/mlibc/options/glibc/include/sys/signal.h new file mode 100644 index 0000000..2e602da --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/signal.h @@ -0,0 +1 @@ +#include <signal.h> diff --git a/lib/mlibc/options/glibc/include/sys/timeb.h b/lib/mlibc/options/glibc/include/sys/timeb.h new file mode 100644 index 0000000..d27173b --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/timeb.h @@ -0,0 +1,14 @@ +#ifndef _SYS_TIMEB_H +#define _SYS_TIMEB_H + +#ifdef __cplusplus +extern "C" { +#endif + + + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_TIMEB_H diff --git a/lib/mlibc/options/glibc/include/sys/timex.h b/lib/mlibc/options/glibc/include/sys/timex.h new file mode 100644 index 0000000..97153ad --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/timex.h @@ -0,0 +1,78 @@ +#ifndef _SYS_TIMEX_H +#define _SYS_TIMEX_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <abi-bits/clockid_t.h> +#include <bits/posix/timeval.h> + +struct timex { + int modes; + long offset; + long freq; + long maxerror; + long esterror; + int status; + long constant; + long precision; + long tolerance; + struct timeval time; + long tick; + long ppsfreq; + long jitter; + int shift; + long stabil; + long jitcnt; + long calcnt; + long errcnt; + long stbcnt; + int tai; + int __padding[11]; +}; + +#define ADJ_OFFSET 0x0001 +#define ADJ_FREQUENCY 0x0002 +#define ADJ_MAXERROR 0x0004 +#define ADJ_ESTERROR 0x0008 +#define ADJ_STATUS 0x0010 +#define ADJ_TIMECONST 0x0020 +#define ADJ_TAI 0x0080 +#define ADJ_SETOFFSET 0x0100 +#define ADJ_MICRO 0x1000 +#define ADJ_NANO 0x2000 +#define ADJ_TICK 0x4000 +#define ADJ_OFFSET_SINGLESHOT 0x8001 +#define ADJ_OFFSET_SS_READ 0xa001 + +#define STA_PLL 0x0001 +#define STA_PPSFREQ 0x0002 +#define STA_PPSTIME 0x0004 +#define STA_FLL 0x0008 +#define STA_INS 0x0010 +#define STA_DEL 0x0020 +#define STA_UNSYNC 0x0040 +#define STA_FREQHOLD 0x0080 +#define STA_PPSSIGNAL 0x0100 +#define STA_PPSJITTER 0x0200 +#define STA_PPSWANDER 0x0400 +#define STA_PPSERROR 0x0800 +#define STA_CLOCKERR 0x1000 +#define STA_NANO 0x2000 +#define STA_MODE 0x4000 +#define STA_CLK 0x8000 + +#ifndef __MLIBC_ABI_ONLY + +int adjtimex(struct timex *); +int clock_adjtime(clockid_t clk_id, struct timex *buf); +int ntp_adjtime(struct timex *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_TIMEX_H diff --git a/lib/mlibc/options/glibc/include/sys/ucontext.h b/lib/mlibc/options/glibc/include/sys/ucontext.h new file mode 100644 index 0000000..b4798ee --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/ucontext.h @@ -0,0 +1,14 @@ +#ifndef _SYS_UCONTEXT_H +#define _SYS_UCONTEXT_H + +#ifdef __cplusplus +extern "C" { +#endif + + + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_UCONTEXT_H diff --git a/lib/mlibc/options/glibc/include/sys/user.h b/lib/mlibc/options/glibc/include/sys/user.h new file mode 100644 index 0000000..9a07ac6 --- /dev/null +++ b/lib/mlibc/options/glibc/include/sys/user.h @@ -0,0 +1,49 @@ +#ifndef _SYS_USER_H +#define _SYS_USER_H + +#include <stdint.h> + +#ifdef __cplusplus +extern "C" { +#endif + +typedef struct user_fpregs_struct { + uint16_t cwd, swd, ftw, fop; + uint64_t rip, rdp; + uint32_t mxcsr, mxcr_mask; + uint32_t st_space[32], xmm_space[64], padding[24]; +} elf_fpregset_t; + +struct user_regs_struct { + unsigned long r15, r14, r13, r12, rbp, rbx, r11, r10, r9, r8; + unsigned long rax, rcx, rdx, rsi, rdi, orig_rax, rip; + unsigned long cs, eflags, rsp, ss, fs_base, gs_base, ds, es, fs, gs; +}; + +struct user { + struct user_regs_struct regs; + int u_fpvalid; + struct user_fpregs_struct i387; + unsigned long u_tsize; + unsigned long u_dsize; + unsigned long u_ssize; + unsigned long start_code; + unsigned long start_stack; + long signal; + int reserved; + struct user_regs_struct *u_ar0; + struct user_fpregs_struct *u_fpstate; + unsigned long magic; + char u_comm[32]; + unsigned long u_debugreg[8]; +}; + +#ifdef __cplusplus +} +#endif + +#define PAGE_SHIFT 12 +#define PAGE_SIZE (1UL << PAGE_SHIFT) +#define PAGE_MASK (~(PAGE_SIZE - 1)) + +#endif diff --git a/lib/mlibc/options/glibc/include/sysexits.h b/lib/mlibc/options/glibc/include/sysexits.h new file mode 100644 index 0000000..f3bde25 --- /dev/null +++ b/lib/mlibc/options/glibc/include/sysexits.h @@ -0,0 +1,24 @@ +#ifndef _SYSEXITS_H +#define _SYSEXITS_H + +#define EX_OK 0 +#define EX_USAGE 64 +#define EX_DATAERR 65 +#define EX_NOINPUT 66 +#define EX_NOUSER 67 +#define EX_NOHOST 68 +#define EX_UNAVAILABLE 69 +#define EX_SOFTWARE 70 +#define EX_OSERR 71 +#define EX_OSFILE 72 +#define EX_CANTCREAT 73 +#define EX_IOERR 74 +#define EX_TEMPFAIL 75 +#define EX_PROTOCOL 76 +#define EX_NOPERM 77 +#define EX_CONFIG 78 + +#define EX__BASE 64 +#define EX__MAX 78 + +#endif // _SYSEXITS_H diff --git a/lib/mlibc/options/glibc/meson.build b/lib/mlibc/options/glibc/meson.build new file mode 100644 index 0000000..93bad85 --- /dev/null +++ b/lib/mlibc/options/glibc/meson.build @@ -0,0 +1,90 @@ +if disable_glibc_option + subdir_done() +endif +libc_sources += files( + 'generic/getopt-stubs.cpp', + 'generic/stdio_ext-stubs.cpp', + 'generic/sys-ioctl.cpp', + 'generic/err.cpp', + 'generic/error.cpp', + 'generic/resolv-stubs.cpp', + 'generic/shadow-stubs.cpp', + 'generic/printf.cpp', + 'generic/glibc-signal.cpp', + 'generic/execinfo.cpp', + 'generic/string.cpp', + 'generic/personality.cpp', + 'generic/gshadow.cpp', + 'generic/sys-timex.cpp', + 'generic/glibc-assert.cpp', + 'generic/malloc.cpp', + 'generic/sys-io.cpp', +) + +if not no_headers + install_headers( + 'include/getopt.h', + 'include/stdio_ext.h', + 'include/err.h', + 'include/error.h', + 'include/paths.h', + 'include/sysexits.h', + 'include/resolv.h', + 'include/endian.h', + 'include/ar.h', + 'include/shadow.h', + 'include/memory.h', + 'include/printf.h', + 'include/gshadow.h', + 'include/execinfo.h', + 'include/features.h' + ) + install_headers( + 'include/sys/dir.h', + 'include/sys/ioctl.h', + 'include/sys/user.h', + 'include/sys/procfs.h', + 'include/sys/reg.h', + 'include/sys/errno.h', + 'include/sys/signal.h', + 'include/sys/ucontext.h', + 'include/sys/personality.h', + 'include/sys/timeb.h', + 'include/sys/mtio.h', + 'include/sys/endian.h', + 'include/sys/timex.h', + 'include/sys/kd.h', + 'include/sys/io.h', + subdir: 'sys' + ) + install_headers( + 'include/net/ethernet.h', + 'include/net/route.h', + 'include/net/if_ppp.h', + subdir: 'net' + ) + install_headers( + 'include/netax25/ax25.h', + subdir: 'netax25' + ) + install_headers( + 'include/netipx/ipx.h', + subdir: 'netipx' + ) + install_headers( + 'include/netrom/netrom.h', + subdir: 'netrom' + ) + install_headers( + 'include/netinet/in_systm.h', + subdir: 'netinet' + ) + install_headers( + 'include/bits/glibc/glibc_signal.h', + 'include/bits/glibc/glibc_assert.h', + 'include/bits/glibc/glibc_malloc.h', + 'include/bits/glibc/glibc_icmp6.h', + subdir: 'bits/glibc' + ) +endif + diff --git a/lib/mlibc/options/iconv/generic/iconv-stubs.cpp b/lib/mlibc/options/iconv/generic/iconv-stubs.cpp new file mode 100644 index 0000000..ecaa7bf --- /dev/null +++ b/lib/mlibc/options/iconv/generic/iconv-stubs.cpp @@ -0,0 +1,34 @@ +#include <iconv.h> +#include <bits/ensure.h> +#include <mlibc/debug.hpp> + +size_t iconv(iconv_t cd, char **__restrict inbuf, size_t *__restrict inbytesleft, char **__restrict outbuf, size_t *__restrict outbytesleft) { + (void)inbytesleft; + (void)outbytesleft; + + mlibc::infoLogger() << "iconv() is unimplemented!" << frg::endlog; + if(cd == (iconv_t)1) { // UTF-8 to UTF-8 + mlibc::infoLogger() << "iconv() from and to are the same, memcpy it is" << frg::endlog; + memcpy(inbuf, outbuf, sizeof(inbuf)); + return sizeof(outbuf); + } + __ensure(!"iconv() not implemented"); + __builtin_unreachable(); +} + +int iconv_close(iconv_t) { + return 0; +} + +iconv_t iconv_open(const char *tocode, const char *fromcode) { + mlibc::infoLogger() << "iconv_open() is unimplemented! args: " << tocode << " and: " << fromcode << frg::endlog; + if(!strcmp(tocode, "UTF-8") && !strcmp(fromcode, "UTF-8")) { + mlibc::infoLogger() << "iconv_open() with UTF-8 on both is a no-op!" << frg::endlog; + iconv_t cd = (iconv_t)1; + return cd; + } + __ensure(!"iconv_open() not implemented"); + __builtin_unreachable(); +} + + diff --git a/lib/mlibc/options/iconv/include/iconv.h b/lib/mlibc/options/iconv/include/iconv.h new file mode 100644 index 0000000..68c1114 --- /dev/null +++ b/lib/mlibc/options/iconv/include/iconv.h @@ -0,0 +1,25 @@ +#ifndef _ICONV_H +#define _ICONV_H + +#include <bits/size_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +typedef void *iconv_t; + +#ifndef __MLIBC_ABI_ONLY + +size_t iconv(iconv_t, char **__restrict, size_t *__restrict, char **__restrict, size_t *__restrict); +int iconv_close(iconv_t); +iconv_t iconv_open(const char *, const char *); + +#endif /* !__MLIBC_ABI_ONLY */ + + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/lib/mlibc/options/iconv/meson.build b/lib/mlibc/options/iconv/meson.build new file mode 100644 index 0000000..079d868 --- /dev/null +++ b/lib/mlibc/options/iconv/meson.build @@ -0,0 +1,12 @@ +if disable_iconv_option + subdir_done() +endif +libc_sources += files( + 'generic/iconv-stubs.cpp', +) + +if not no_headers + install_headers( + 'include/iconv.h', + ) +endif diff --git a/lib/mlibc/options/internal/aarch64-include/mlibc/arch-defs.hpp b/lib/mlibc/options/internal/aarch64-include/mlibc/arch-defs.hpp new file mode 100644 index 0000000..0a4789f --- /dev/null +++ b/lib/mlibc/options/internal/aarch64-include/mlibc/arch-defs.hpp @@ -0,0 +1,12 @@ +#ifndef MLIBC_ARCH_DEFS_HPP +#define MLIBC_ARCH_DEFS_HPP + +#include <stddef.h> + +namespace mlibc { + +inline constexpr size_t page_size = 0x1000; + +} // namespace mlibc + +#endif // MLIBC_ARCH_DEFS_HPP diff --git a/lib/mlibc/options/internal/aarch64-include/mlibc/thread.hpp b/lib/mlibc/options/internal/aarch64-include/mlibc/thread.hpp new file mode 100644 index 0000000..b62d832 --- /dev/null +++ b/lib/mlibc/options/internal/aarch64-include/mlibc/thread.hpp @@ -0,0 +1,21 @@ +#pragma once + +#include <stdint.h> +#include <mlibc/tcb.hpp> + +namespace mlibc { + +inline Tcb *get_current_tcb() { + // On AArch64, TPIDR_EL0 points to 0x10 bytes before the first TLS block. + uintptr_t ptr; + asm ("mrs %0, tpidr_el0" : "=r"(ptr)); + return reinterpret_cast<Tcb *>(ptr + 0x10 - sizeof(Tcb)); +} + +inline uintptr_t get_sp() { + uintptr_t sp; + asm ("mov %0, sp" : "=r"(sp)); + return sp; +} + +} // namespace mlibc diff --git a/lib/mlibc/options/internal/aarch64/fenv.S b/lib/mlibc/options/internal/aarch64/fenv.S new file mode 100644 index 0000000..1b02e87 --- /dev/null +++ b/lib/mlibc/options/internal/aarch64/fenv.S @@ -0,0 +1,69 @@ +# The functions below are taken from musl. +.global fegetround +.type fegetround,%function +fegetround: + mrs x0, fpcr + and w0, w0, #0xc00000 + ret + +.global __fesetround +.hidden __fesetround +.type __fesetround,%function +__fesetround: + mrs x1, fpcr + bic w1, w1, #0xc00000 + orr w1, w1, w0 + msr fpcr, x1 + mov w0, #0 + ret + +.global fetestexcept +.type fetestexcept,%function +fetestexcept: + and w0, w0, #0x1f + mrs x1, fpsr + and w0, w0, w1 + ret + +.global feclearexcept +.type feclearexcept,%function +feclearexcept: + and w0, w0, #0x1f + mrs x1, fpsr + bic w1, w1, w0 + msr fpsr, x1 + mov w0, #0 + ret + +.global feraiseexcept +.type feraiseexcept,%function +feraiseexcept: + and w0, w0, #0x1f + mrs x1, fpsr + orr w1, w1, w0 + msr fpsr, x1 + mov w0, #0 + ret + +.global fegetenv +.type fegetenv,%function +fegetenv: + mrs x1, fpcr + mrs x2, fpsr + stp w1, w2, [x0] + mov w0, #0 + ret + +// TODO preserve some bits +.global fesetenv +.type fesetenv,%function +fesetenv: + mov x1, #0 + mov x2, #0 + cmn x0, #1 + b.eq 1f + ldp w1, w2, [x0] +1: msr fpcr, x1 + msr fpsr, x2 + mov w0, #0 + ret diff --git a/lib/mlibc/options/internal/aarch64/mlibc_crtbegin.S b/lib/mlibc/options/internal/aarch64/mlibc_crtbegin.S new file mode 100644 index 0000000..b99748b --- /dev/null +++ b/lib/mlibc/options/internal/aarch64/mlibc_crtbegin.S @@ -0,0 +1,29 @@ + +.section .data +.hidden __dso_handle +.global __dso_handle +__dso_handle: + .quad __dso_handle + +.section .init +.hidden _init +.global _init +_init: + +.section .fini +.hidden _fini +.global _fini +_fini: + +.section .ctors +.hidden __CTOR_LIST__ +.global __CTOR_LIST__ +__CTOR_LIST__: + +.section .dtors +.hidden __DTOR_LIST__ +.global __DTOR_LIST__ +__DTOR_LIST__: + +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/internal/aarch64/mlibc_crtend.S b/lib/mlibc/options/internal/aarch64/mlibc_crtend.S new file mode 100644 index 0000000..2bf6254 --- /dev/null +++ b/lib/mlibc/options/internal/aarch64/mlibc_crtend.S @@ -0,0 +1,22 @@ + +.hidden __mlibc_do_ctors +.hidden __mlibc_do_dtors + +.section .init + b __mlibc_do_ctors + +.section .fini + b __mlibc_do_dtors + +.section .ctors +.hidden __CTOR_END__ +.global __CTOR_END__ +__CTOR_END__: + +.section .dtors +.hidden __DTOR_END__ +.global __DTOR_END__ +__DTOR_END__: + +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/internal/aarch64/setjmp.S b/lib/mlibc/options/internal/aarch64/setjmp.S new file mode 100644 index 0000000..9dddaa8 --- /dev/null +++ b/lib/mlibc/options/internal/aarch64/setjmp.S @@ -0,0 +1,63 @@ +// vim: ft=arm64asm + +.extern __sigsetjmp + +.type __setjmp, "function" +__setjmp: + stp x19, x20, [x0, #0] + stp x21, x22, [x0, #16] + stp x23, x24, [x0, #24] + stp x25, x26, [x0, #32] + stp x27, x28, [x0, #48] + stp x29, x30, [x0, #64] + stp x29, x30, [x0, #80] + mov x4, sp + str x4, [x0, #96] + + stp d8, d9, [x0, #112] + stp d10, d11, [x0, #128] + stp d12, d13, [x0, #144] + stp d14, d15, [x0, #160] + + cbnz x2, 1f + + mov x0, xzr + ret +1: + b __sigsetjmp + +.global setjmp +.type setjmp, "function" +setjmp: + mov x2, xzr + b __setjmp + +.global sigsetjmp +.type sigsetjmp, "function" +sigsetjmp: + mov x2, #1 + b __setjmp + +.global longjmp +.type longjmp, "function" +longjmp: + ldp x19, x20, [x0, #0] + ldp x21, x22, [x0, #16] + ldp x23, x24, [x0, #24] + ldp x25, x26, [x0, #32] + ldp x27, x28, [x0, #48] + ldp x29, x30, [x0, #64] + ldp x29, x30, [x0, #80] + ldr x4, [x0, #96] + mov sp, x4 + + ldp d8, d9, [x0, #112] + ldp d10, d11, [x0, #128] + ldp d12, d13, [x0, #144] + ldp d14, d15, [x0, #160] + + cmp w1, 0 + csinc w0, w1, wzr, ne + br x30 +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/internal/gcc-extra/cxxabi.cpp b/lib/mlibc/options/internal/gcc-extra/cxxabi.cpp new file mode 100644 index 0000000..c5bd92f --- /dev/null +++ b/lib/mlibc/options/internal/gcc-extra/cxxabi.cpp @@ -0,0 +1,20 @@ + +#include <bits/ensure.h> + +// The cxxabi needs operator delete for *deleting* destructors, i.e., destructors that +// are called by delete expressions. We never use such expressions in mlibc. +// Note that G++ complains if we make the operator hidden, +// thus we use it's mangled name as a workaround. +#if defined(__clang__) + extern "C" [[gnu::visibility("hidden")]] void _ZdlPv() { // operator delete (void *, size_t) + __ensure(!"operator delete called! delete expressions cannot be used in mlibc."); + } +#else + extern "C" [[gnu::visibility("hidden")]] void _ZdlPvj() { // operator delete (void *, unsigned int) + __ensure(!"operator delete called! delete expressions cannot be used in mlibc."); + } + + extern "C" [[gnu::visibility("hidden")]] void _ZdlPvm() { // operator delete (void *, size_t) + __ensure(!"operator delete called! delete expressions cannot be used in mlibc."); + } +#endif
\ No newline at end of file diff --git a/lib/mlibc/options/internal/gcc/guard-abi.cpp b/lib/mlibc/options/internal/gcc/guard-abi.cpp new file mode 100644 index 0000000..945582a --- /dev/null +++ b/lib/mlibc/options/internal/gcc/guard-abi.cpp @@ -0,0 +1,68 @@ + +#include <stddef.h> +#include <stdint.h> +#include <string.h> + +#include <mlibc/debug.hpp> +#include <mlibc/internal-sysdeps.hpp> + +namespace { + +// Itanium ABI static initialization guard. +struct Guard { + // bit of the mutex member variable. + // indicates that the mutex is locked. + static constexpr int32_t locked = 1; + + void lock() { + uint32_t v = 0; + if(__atomic_compare_exchange_n(&mutex, &v, Guard::locked, false, + __ATOMIC_ACQUIRE, __ATOMIC_RELAXED)) + return; + + mlibc::sys_libc_log("__cxa_guard_acquire contention"); + __builtin_trap(); + } + + void unlock() { + __atomic_store_n(&mutex, 0, __ATOMIC_RELEASE); + } + + // the first byte's meaning is fixed by the ABI. + // it indicates whether initialization has already been completed. + uint8_t complete; + + // we use some of the remaining bytes to implement a mutex. + uint32_t mutex; +}; + +static_assert(sizeof(Guard) == sizeof(int64_t)); + +} // namespace { } + +extern "C" [[ gnu::visibility("hidden") ]] void __cxa_pure_virtual() { + mlibc::panicLogger() << "mlibc: Pure virtual function called from IP " + << (void *)__builtin_return_address(0) << frg::endlog; +} + +extern "C" [[ gnu::visibility("hidden") ]] int __cxa_guard_acquire(int64_t *ptr) { + auto guard = reinterpret_cast<Guard *>(ptr); + guard->lock(); + // relaxed ordering is sufficient because + // Guard::complete is only modified while the mutex is held. + if(__atomic_load_n(&guard->complete, __ATOMIC_RELAXED)) { + guard->unlock(); + return 0; + }else{ + return 1; + } +} + +extern "C" [[ gnu::visibility("hidden") ]] void __cxa_guard_release(int64_t *ptr) { + auto guard = reinterpret_cast<Guard *>(ptr); + // do a store-release so that compiler generated code can skip calling + // __cxa_guard_acquire by doing a load-acquire on Guard::complete. + __atomic_store_n(&guard->complete, 1, __ATOMIC_RELEASE); + guard->unlock(); +} + diff --git a/lib/mlibc/options/internal/gcc/initfini.cpp b/lib/mlibc/options/internal/gcc/initfini.cpp new file mode 100644 index 0000000..b329f38 --- /dev/null +++ b/lib/mlibc/options/internal/gcc/initfini.cpp @@ -0,0 +1,23 @@ + +#include <stddef.h> +#include <stdint.h> +#include <string.h> + +#include <mlibc/internal-sysdeps.hpp> +#include <mlibc/debug.hpp> + +typedef void (*InitPtr)(); + +extern InitPtr __CTOR_LIST__ [[ gnu::visibility("hidden") ]]; +extern InitPtr __CTOR_END__ [[ gnu::visibility("hidden") ]]; + +extern "C" [[ gnu::visibility("hidden") ]] void __mlibc_do_ctors() { + auto it = &__CTOR_LIST__; + while(it != &__CTOR_END__) + (*it++)(); +} + +extern "C" [[ gnu::visibility("hidden") ]] void __mlibc_do_dtors() { + mlibc::sys_libc_log("__mlibc_do_dtors() called"); +} + diff --git a/lib/mlibc/options/internal/gcc/stack_protector.cpp b/lib/mlibc/options/internal/gcc/stack_protector.cpp new file mode 100644 index 0000000..e5e50f0 --- /dev/null +++ b/lib/mlibc/options/internal/gcc/stack_protector.cpp @@ -0,0 +1,31 @@ +#include <stdint.h> +#include <string.h> +#include <mlibc/debug.hpp> +#include <mlibc/stack_protector.hpp> + +uintptr_t __stack_chk_guard = 0; + +namespace mlibc { + +void initStackGuard(void *entropy) { + if(entropy != nullptr) { + memcpy(&__stack_chk_guard, entropy, sizeof(__stack_chk_guard)); + } else { + // If no entropy is available, set it to the terminator canary + __stack_chk_guard = 0; + __stack_chk_guard |= ('\n' << 16); + __stack_chk_guard |= (255 << 24); + } +} + +} // namespace mlibc + +extern "C" [[noreturn]] void __stack_chk_fail() { + mlibc::panicLogger() << "Stack smashing detected!" << frg::endlog; + __builtin_unreachable(); +} + +extern "C" [[noreturn, gnu::visibility("hidden")]] void __stack_chk_fail_local() { + __stack_chk_fail(); +}; + diff --git a/lib/mlibc/options/internal/generic/allocator.cpp b/lib/mlibc/options/internal/generic/allocator.cpp new file mode 100644 index 0000000..d738212 --- /dev/null +++ b/lib/mlibc/options/internal/generic/allocator.cpp @@ -0,0 +1,196 @@ + +#include <string.h> + +#include <bits/ensure.h> +#include <frg/eternal.hpp> +#include <mlibc/allocator.hpp> +#include <mlibc/internal-sysdeps.hpp> +#include <internal-config.h> + +#if !MLIBC_DEBUG_ALLOCATOR + +// -------------------------------------------------------- +// Globals +// -------------------------------------------------------- + +MemoryAllocator &getAllocator() { + // use frg::eternal to prevent a call to __cxa_atexit(). + // this is necessary because __cxa_atexit() call this function. + static frg::eternal<VirtualAllocator> virtualAllocator; + static frg::eternal<MemoryPool> heap{virtualAllocator.get()}; + static frg::eternal<MemoryAllocator> singleton{&heap.get()}; + return singleton.get(); +} + +// -------------------------------------------------------- +// VirtualAllocator +// -------------------------------------------------------- + +uintptr_t VirtualAllocator::map(size_t length) { + void *ptr; + __ensure(!mlibc::sys_anon_allocate(length, &ptr)); + return (uintptr_t)ptr; +} + +void VirtualAllocator::unmap(uintptr_t address, size_t length) { + __ensure(!mlibc::sys_anon_free((void *)address, length)); +} + +#else + +namespace { + struct AllocatorMeta { + size_t allocatedSize; + size_t pagesSize; + frg::array<uint64_t, 4> magic; + }; + + constexpr frg::array<uint64_t, 4> allocatorMagic { + 0x6d4bbb9f3446e83f, 0x25e213a7a7f9f954, + 0x1a3c667586538bef, 0x994f34ff71c090bc + }; +} // namespace anonymous + +// Turn vm_unmap calls in free into vm_map(..., PROT_NONE, ...) calls to prevent +// those addresses from being reused. This is useful for detecting situations like this: +// 1. Allocate object X at address Y +// 2. Do some computation using object X +// 3. Free object X at address Y +// 4. Allocate object Z at address W, and it so happens that W == Y +// 5. Try to use object X, but the memory which was backing it now contains object Z +constexpr bool neverReleaseVa = false; +constexpr bool logAllocations = false; + +// Area before the returned allocated block (which exists due to us offseting +// the block to be as close to the edge of a page). +constexpr uint8_t offsetAreaValue = 'A'; +// Area which we return a pointer to in allocate and reallocate. +constexpr uint8_t allocatedAreaValue = 'B'; +// Area after the allocated block, which exists due to the alignment constraints. +constexpr uint8_t alignmentAreaValue = 'C'; +// Remaining area within the metadata page after the metadata. +constexpr uint8_t metaAreaValue = 'D'; + +// Alignment of the returned memory. +// TODO(qookie): Eventually accept alignment as an argument of allocate. +constexpr size_t pointerAlignment = 16; + +// TODO(qookie): Support this. Perhaps by overallocating by 2x and then picking +// an offset that guarantees the desired alignment. +static_assert(pointerAlignment <= 4096, "Pointer aligment of more than 4096 bytes is unsupported"); +static_assert(!(pointerAlignment & (pointerAlignment - 1)), + "Pointer aligment must be a power of 2"); + +constexpr size_t pageSize = 0x1000; + +void *MemoryAllocator::allocate(size_t size) { + size_t pg_size = (size + size_t{pageSize - 1}) & ~size_t{pageSize - 1}; + size_t offset = (pg_size - size) & ~size_t{pointerAlignment - 1}; + + void *ptr; + + // Two extra pages for metadata in front and guard page at the end + // Reserve the whole region as PROT_NONE... + if (int e = mlibc::sys_vm_map(nullptr, pg_size + pageSize * 2, PROT_NONE, MAP_ANONYMOUS | MAP_PRIVATE, -1, 0, &ptr)) + mlibc::panicLogger() << "sys_vm_map failed in MemoryAllocator::allocate (errno " << e << ")" << frg::endlog; + + // ...Then replace pages to make them accessible, excluding the guard page + if (int e = mlibc::sys_vm_map(ptr, pg_size + pageSize, PROT_READ | PROT_WRITE, MAP_ANONYMOUS | MAP_PRIVATE | MAP_FIXED, -1, 0, &ptr)) + mlibc::panicLogger() << "sys_vm_map failed in MemoryAllocator::allocate (errno " << e << ")" << frg::endlog; + + void *meta = ptr; + void *out_page = reinterpret_cast<void *>(reinterpret_cast<uintptr_t>(ptr) + pageSize); + void *out = reinterpret_cast<void *>(reinterpret_cast<uintptr_t>(out_page) + offset); + void *out_align_area = reinterpret_cast<void *>(reinterpret_cast<uintptr_t>(out) + size); + + AllocatorMeta metaData{size, pg_size, allocatorMagic}; + + memset(meta, metaAreaValue, pageSize); + memcpy(meta, &metaData, sizeof(AllocatorMeta)); + + memset(out_page, offsetAreaValue, offset); + memset(out, allocatedAreaValue, size); + memset(out_align_area, alignmentAreaValue, pg_size - offset - size); + + if constexpr (logAllocations) + mlibc::infoLogger() << "MemoryAllocator::allocate(" << size << ") = " << out << frg::endlog; + + return out; +} + +void MemoryAllocator::free(void *ptr) { + if (!ptr) + return; + + if constexpr (logAllocations) + mlibc::infoLogger() << "MemoryAllocator::free(" << ptr << ")" << frg::endlog; + + uintptr_t page_addr = reinterpret_cast<uintptr_t>(ptr) & ~size_t{pageSize - 1}; + AllocatorMeta *meta = reinterpret_cast<AllocatorMeta *>(page_addr - pageSize); + + if (meta->magic != allocatorMagic) + mlibc::panicLogger() << "Invalid allocator metadata magic in MemoryAllocator::free" << frg::endlog; + + deallocate(ptr, meta->allocatedSize); +} + +void MemoryAllocator::deallocate(void *ptr, size_t size) { + if (!ptr) + return; + + if constexpr (logAllocations) + mlibc::infoLogger() << "MemoryAllocator::deallocate(" << ptr << ", " << size << ")" << frg::endlog; + + uintptr_t page_addr = reinterpret_cast<uintptr_t>(ptr) & ~size_t{pageSize - 1}; + AllocatorMeta *meta = reinterpret_cast<AllocatorMeta *>(page_addr - pageSize); + + if (meta->magic != allocatorMagic) + mlibc::panicLogger() << "Invalid allocator metadata magic in MemoryAllocator::deallocate" << frg::endlog; + + if (size != meta->allocatedSize) + mlibc::panicLogger() << "Invalid allocated size in metadata in MemoryAllocator::deallocate (given " << size << ", stored " << meta->allocatedSize << ")" << frg::endlog; + + if constexpr (neverReleaseVa) { + void *unused; + if (int e = mlibc::sys_vm_map(meta, meta->pagesSize + pageSize * 2, PROT_NONE, MAP_ANONYMOUS | MAP_PRIVATE | MAP_FIXED, -1, 0, &unused)) + mlibc::panicLogger() << "sys_vm_map failed in MemoryAllocator::deallocate (errno " << e << ")" << frg::endlog; + } else { + if (int e = mlibc::sys_vm_unmap(meta, meta->pagesSize + pageSize * 2)) + mlibc::panicLogger() << "sys_vm_unmap failed in MemoryAllocator::deallocate (errno " << e << ")" << frg::endlog; + } +} + +void *MemoryAllocator::reallocate(void *ptr, size_t size) { + if (!size) { + free(ptr); + return nullptr; + } + + void *newArea = allocate(size); + + if (ptr) { + uintptr_t page_addr = reinterpret_cast<uintptr_t>(ptr) & ~size_t{pageSize - 1}; + AllocatorMeta *meta = reinterpret_cast<AllocatorMeta *>(page_addr - pageSize); + + if (meta->magic != allocatorMagic) + mlibc::panicLogger() << "Invalid allocator metadata magic in MemoryAllocator::reallocate" << frg::endlog; + + memcpy(newArea, ptr, frg::min(meta->allocatedSize, size)); + + deallocate(ptr, meta->allocatedSize); + } + + if constexpr (logAllocations) + mlibc::infoLogger() << "MemoryAllocator::reallocate(" << ptr << ", " << size << ") = " << newArea << frg::endlog; + + return newArea; +} + +MemoryAllocator &getAllocator() { + // use frg::eternal to prevent a call to __cxa_atexit(). + // this is necessary because __cxa_atexit() call this function. + static frg::eternal<MemoryAllocator> singleton{}; + return singleton.get(); +} + +#endif /* !MLIBC_DEBUG_ALLOCATOR */ diff --git a/lib/mlibc/options/internal/generic/charcode.cpp b/lib/mlibc/options/internal/generic/charcode.cpp new file mode 100644 index 0000000..e09d5cd --- /dev/null +++ b/lib/mlibc/options/internal/generic/charcode.cpp @@ -0,0 +1,244 @@ + +#include <bits/ensure.h> +#include <frg/string.hpp> +#include <mlibc/charcode.hpp> +#include <mlibc/debug.hpp> + +namespace mlibc { + +struct utf8_charcode { + static constexpr bool preserves_7bit_units = true; + static constexpr bool has_shift_states = false; + + struct decode_state { + decode_state() + : _progress{0}, _cpoint{0} { } + + auto progress() { return _progress; } + auto cpoint() { return _cpoint; } + + charcode_error operator() (code_seq<const char> &seq) { + auto uc = static_cast<unsigned char>(*seq.it); + if(!_progress) { + if(!(uc & 0b1000'0000)) { + // ASCII-compatible. + _cpoint = uc; + }else if((uc & 0b1110'0000) == 0b1100'0000) { + _cpoint = uc & 0b1'1111; + _progress = 1; + }else if((uc & 0b1111'0000) == 0b1110'0000) { + _cpoint = uc & 0b1111; + _progress = 2; + }else if((uc & 0b1111'1000) == 0b1111'0000) { + _cpoint = uc & 0b111; + _progress = 3; + }else{ + // If the highest two bits are 0b10, this is the second (or later) unit. + // Units with highest five bits = 0b11111 do not occur in valid UTF-8. + __ensure((uc & 0b1100'0000) == 0b1000'0000 + || (uc & 0b1111'1000) == 0b1111'1000); + return charcode_error::illegal_input; + } + }else{ + // TODO: Return an error. + __ensure((uc & 0b1100'0000) == 0b1000'0000); + _cpoint = (_cpoint << 6) | (uc & 0x3F); + --_progress; + } + ++seq.it; + return charcode_error::null; + } + + private: + int _progress; + codepoint _cpoint; + }; + + struct encode_state { + // Encodes a single character from wseq + the current state and stores it in nseq. + // TODO: Convert decode_state to the same strategy. + charcode_error operator() (code_seq<char> &nseq, code_seq<const codepoint> &wseq) { + auto wc = *wseq.it; + __ensure(wc <= 0x7F && "utf8_charcode cannot encode multibyte chars yet"); + *nseq.it = wc; + ++wseq.it; + ++nseq.it; + return charcode_error::null; + } + }; +}; + +polymorphic_charcode::~polymorphic_charcode() = default; + +// For *decoding, this class assumes that: +// - G::decode_state has members progress() and cpoint(). +// - G::decode_state::progress() >= 0 at all times. +// TODO: This will be needed on platforms like Windows, where wchar_t is UTF-16. +// TODO: There, we can use negative __mlibc_mbstate::progress to represent encoding to UTF-16. +// - If G::decode_state::progress() == 0, the code point (given by cpoint()) +// was decoded successfully. +template<typename G> +struct polymorphic_charcode_adapter : polymorphic_charcode { + polymorphic_charcode_adapter() + : polymorphic_charcode{G::preserves_7bit_units, G::has_shift_states} { } + + charcode_error decode(code_seq<const char> &nseq, code_seq<codepoint> &wseq, + __mlibc_mbstate &st) override { + __ensure(!st.__progress); // TODO: Update st with ds.progress() and ds.cpoint(). + + code_seq<const char> decode_nseq = nseq; + typename G::decode_state ds; + + while(decode_nseq && wseq) { + // Consume the next code unit. + if(auto e = ds(decode_nseq); e != charcode_error::null) + return e; + + // Produce a new code point. + if(!ds.progress()) { + // "Commit" consumed code units (as there was no decode error). + nseq.it = decode_nseq.it; + if(!ds.cpoint()) // Stop on null characters. + return charcode_error::null; + *wseq.it = ds.cpoint(); + ++wseq.it; + } + } + + if(ds.progress()) + return charcode_error::input_underflow; + return charcode_error::null; + } + + charcode_error decode_wtranscode(code_seq<const char> &nseq, code_seq<wchar_t> &wseq, + __mlibc_mbstate &st) override { + __ensure(!st.__progress); // TODO: Update st with ds.progress() and ds.cpoint(). + + code_seq<const char> decode_nseq = nseq; + typename G::decode_state ds; + + while(decode_nseq && wseq) { + // Consume the next code unit. + if(auto e = ds(decode_nseq); e != charcode_error::null) + return e; + + // Produce a new code point. + if(!ds.progress()) { + nseq.it = decode_nseq.it; + // "Commit" consumed code units (as there was no decode error). + if(!ds.cpoint()) // Stop on null characters. + return charcode_error::null; + *wseq.it = ds.cpoint(); + ++wseq.it; + } + } + + if(ds.progress()) + return charcode_error::input_underflow; + return charcode_error::null; + } + + charcode_error decode_wtranscode_length(code_seq<const char> &nseq, size_t *n, + __mlibc_mbstate &st) override { + __ensure(!st.__progress); // TODO: Update st with ds.progress() and ds.cpoint(). + + code_seq<const char> decode_nseq = nseq; + typename G::decode_state ds; + + *n = 0; + while(decode_nseq) { + // Consume the next code unit. + if(auto e = ds(decode_nseq); e != charcode_error::null) + return e; + + if(!ds.progress()) { + nseq.it = decode_nseq.it; + // "Commit" consumed code units (as there was no decode error). + if(!ds.cpoint()) // Stop on null code points. + return charcode_error::null; + ++(*n); + } + } + + if(ds.progress()) + return charcode_error::input_underflow; + return charcode_error::null; + } + + charcode_error encode_wtranscode(code_seq<char> &nseq, code_seq<const wchar_t> &wseq, + __mlibc_mbstate &st) override { + __ensure(!st.__progress); // TODO: Update st with es.progress() and es.cpoint(). + + code_seq<char> encode_nseq = nseq; + typename G::encode_state es; + + while(encode_nseq && wseq) { + codepoint cp = *wseq.it; + if(!cp) + return charcode_error::null; + + code_seq<const codepoint> cps{&cp, &cp + 1}; + if(auto e = es(encode_nseq, cps); e == charcode_error::dirty) { + continue; + }else if(e != charcode_error::null) { + return e; + } + __ensure(cps.it == cps.end); + ++wseq.it; + + // "Commit" produced code units (as there was no encode error). + nseq.it = encode_nseq.it; + } + + if(encode_nseq.it != nseq.it) + return charcode_error::output_overflow; + return charcode_error::null; + } + + charcode_error encode_wtranscode_length(code_seq<const wchar_t> &wseq, size_t *n, + __mlibc_mbstate &st) override { + __ensure(!st.__progress); // TODO: Update st with es.progress() and es.cpoint(). + + typename G::encode_state es; + + *n = 0; + while(wseq) { + char temp[4]; + code_seq<char> encode_nseq{temp, temp + 4}; + codepoint cp = *wseq.it; + if(!cp) + return charcode_error::null; + // Consume the next code unit. + code_seq<const codepoint> cps{&cp, &cp + 1}; + if(auto e = es(encode_nseq, cps); e == charcode_error::dirty) { + continue; + }else if(e != charcode_error::null) { + return e; + } + + ++(*n); + ++wseq.it; + } + + return charcode_error::null; + } +}; + +polymorphic_charcode *current_charcode() { + static polymorphic_charcode_adapter<utf8_charcode> global_charcode; + return &global_charcode; +} + +charcode_error wide_charcode::promote(wchar_t nc, codepoint &wc) { + // TODO: Allow non-identity encodings of wchar_t. + wc = nc; + return charcode_error::null; +} + +wide_charcode *platform_wide_charcode() { + static wide_charcode global_wide_charcode; + return &global_wide_charcode; +} + +} // namespace mlibc + diff --git a/lib/mlibc/options/internal/generic/charset.cpp b/lib/mlibc/options/internal/generic/charset.cpp new file mode 100644 index 0000000..c42b4f4 --- /dev/null +++ b/lib/mlibc/options/internal/generic/charset.cpp @@ -0,0 +1,144 @@ + +#include <bits/ensure.h> +#include <mlibc/charset.hpp> +#include <mlibc/debug.hpp> + +namespace mlibc { + +bool charset::is_ascii_superset() { + // TODO: For locales that change the meaning of ASCII chars, this needs to be changed. + return true; +} + +bool charset::is_alpha(codepoint c) { + if(c <= 0x7F && is_ascii_superset()) + return (c >= 'a' && c <= 'z') || (c >= 'A' && c <= 'Z'); + if(c > 0x7F) + mlibc::infoLogger() << "mlibc: charset::is_alpha() is not implemented" + " for the full Unicode charset" << frg::endlog; + return false; +} + +bool charset::is_digit(codepoint c) { + if(c <= 0x7F && is_ascii_superset()) + return c >= '0' && c <= '9'; + if(c > 0x7F) + mlibc::infoLogger() << "mlibc: charset::is_digit() is not implemented" + " for the full Unicode charset" << frg::endlog; + return false; +} + +bool charset::is_xdigit(codepoint c) { + if(c <= 0x7F && is_ascii_superset()) + return (c >= '0' && c <= '9') || (c >= 'a' && c <= 'f') || (c >= 'A' && c <= 'F'); + if(c > 0x7F) + mlibc::infoLogger() << "mlibc: charset::is_xdigit() is not implemented" + " for the full Unicode charset" << frg::endlog; + return false; +} + +bool charset::is_alnum(codepoint c) { + if(c <= 0x7F && is_ascii_superset()) + return (c >= '0' && c <= '9') || (c >= 'a' && c <= 'z') || (c >= 'A' && c <= 'Z'); + if(c > 0x7F) + mlibc::infoLogger() << "mlibc: charset::is_alnum() is not implemented" + " for the full Unicode charset" << frg::endlog; + return false; +} + +bool charset::is_punct(codepoint c) { + if(c <= 0x7F && is_ascii_superset()) + return c == '!' || c == '"' || c == '#' || c == '$' || c == '%' || c == '&' + || c == '\'' || c == '(' || c == ')' || c == '*' || c == '+' || c == ',' + || c == '-' || c == '.' || c == '/' + || c == ':' || c == ';' || c == '<' || c == '=' || c == '>' || c == '?' + || c == '@' + || c == '[' || c == '\\' || c == ']' || c == '^' || c == '_' || c == '`' + || c == '{' || c == '|' || c == '}' || c == '~'; + if(c > 0x7F) + mlibc::infoLogger() << "mlibc: charset::is_punct() is not implemented" + " for the full Unicode charset" << frg::endlog; + return false; +} + +bool charset::is_graph(codepoint c) { + if(c <= 0x7F && is_ascii_superset()) + return c >= 0x21 && c <= 0x7E; + if(c > 0x7F) + mlibc::infoLogger() << "mlibc: charset::is_graph() is not implemented" + " for the full Unicode charset" << frg::endlog; + return false; +} + +bool charset::is_blank(codepoint c) { + if(c <= 0x7F && is_ascii_superset()) + return c == ' ' || c == '\t'; + if(c > 0x7F) + mlibc::infoLogger() << "mlibc: charset::is_blank() is not implemented" + " for the full Unicode charset " << c << frg::endlog; + return false; +} + +bool charset::is_space(codepoint c) { + if(c <= 0x7F && is_ascii_superset()) + return c == ' ' || c == '\t' || c == '\n' || c == '\v' || c == '\f' || c == '\r'; + if(c > 0x7F) + mlibc::infoLogger() << "mlibc: charset::is_space() is not implemented" + " for the full Unicode charset" << frg::endlog; + return false; +} + +bool charset::is_print(codepoint c) { + if(c <= 0x7F && is_ascii_superset()) + return c >= 0x20 && c <= 0x7E; + if(c > 0x7F) + mlibc::infoLogger() << "mlibc: charset::is_print() is not implemented" + " for the full Unicode charset" << frg::endlog; + return false; +} + +bool charset::is_lower(codepoint c) { + if(c <= 0x7F && is_ascii_superset()) + return (c >= 'a' && c <= 'z'); + if(c > 0x7F) + mlibc::infoLogger() << "mlibc: charset::is_print() is not implemented" + " for the full Unicode charset" << frg::endlog; + return false; +} + +bool charset::is_upper(codepoint c) { + if(c <= 0x7F && is_ascii_superset()) + return (c >= 'A' && c <= 'Z'); + if(c > 0x7F) + mlibc::infoLogger() << "mlibc: charset::is_print() is not implemented" + " for the full Unicode charset" << frg::endlog; + return false; +} + +codepoint charset::to_lower(codepoint c) { + if(c <= 0x7F && is_ascii_superset()) + if(c >= 'A' && c <= 'Z') + return c - 'A' + 'a'; + if(c > 0x7F) + mlibc::infoLogger() << "mlibc: charset::to_lower() is not implemented" + " for the full Unicode charset" << frg::endlog; + return c; +} + +codepoint charset::to_upper(codepoint c) { + if(c <= 0x7F && is_ascii_superset()) + if(c >= 'a' && c <= 'z') + return c - 'a' + 'A'; + if(c > 0x7F) + mlibc::infoLogger() << "mlibc: charset::to_upper() is not implemented" + " for the full Unicode charset" << frg::endlog; + return c; +} + +charset *current_charset() { + static charset global_charset; + return &global_charset; +} + +} // namespace mlibc + diff --git a/lib/mlibc/options/internal/generic/debug.cpp b/lib/mlibc/options/internal/generic/debug.cpp new file mode 100644 index 0000000..19427c8 --- /dev/null +++ b/lib/mlibc/options/internal/generic/debug.cpp @@ -0,0 +1,22 @@ + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/internal-sysdeps.hpp> + +namespace mlibc { + +frg::stack_buffer_logger<InfoSink, 512> infoLogger; +frg::stack_buffer_logger<PanicSink, 512> panicLogger; + +void InfoSink::operator() (const char *message) { + sys_libc_log(message); +} + +void PanicSink::operator() (const char *message) { +// sys_libc_log("mlibc: Write to PanicSink"); + sys_libc_log(message); + sys_libc_panic(); +} + +} // namespace mlibc + diff --git a/lib/mlibc/options/internal/generic/ensure.cpp b/lib/mlibc/options/internal/generic/ensure.cpp new file mode 100644 index 0000000..57c953a --- /dev/null +++ b/lib/mlibc/options/internal/generic/ensure.cpp @@ -0,0 +1,18 @@ + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> + +void __ensure_fail(const char *assertion, const char *file, unsigned int line, + const char *function) { + mlibc::panicLogger() << "In function " << function + << ", file " << file << ":" << line << "\n" + << "__ensure(" << assertion << ") failed" << frg::endlog; +} + +void __ensure_warn(const char *assertion, const char *file, unsigned int line, + const char *function) { + mlibc::infoLogger() << "In function " << function + << ", file " << file << ":" << line << "\n" + << "__ensure(" << assertion << ") failed" << frg::endlog; +} + diff --git a/lib/mlibc/options/internal/generic/essential.cpp b/lib/mlibc/options/internal/generic/essential.cpp new file mode 100644 index 0000000..d00df1e --- /dev/null +++ b/lib/mlibc/options/internal/generic/essential.cpp @@ -0,0 +1,217 @@ +#include <string.h> +#include <stdint.h> + +namespace { + // Needed since we cannot declare a templated enum. + template<typename T> + struct word_helper { + using underlying [[gnu::aligned(1)]] = T; + enum class [[gnu::may_alias]] word_enum : underlying { }; + }; + + template<typename T> + using word = typename word_helper<T>::word_enum; + + template<typename T> + [[gnu::always_inline]] + inline word<T> alias_load(const unsigned char *&p) { + word<T> value = *reinterpret_cast<const word<T> *>(p); + p += sizeof(T); + return value; + } + + template<typename T> + [[gnu::always_inline]] + inline void alias_store(unsigned char *&p, word<T> value) { + *reinterpret_cast<word<T> *>(p) = value; + p += sizeof(T); + } + +#ifdef __LP64__ + void *forward_copy(void *__restrict dest, const void *__restrict src, size_t n) { + auto curDest = reinterpret_cast<unsigned char *>(dest); + auto curSrc = reinterpret_cast<const unsigned char *>(src); + + while(n >= 8 * 8) { + auto w1 = alias_load<uint64_t>(curSrc); + auto w2 = alias_load<uint64_t>(curSrc); + auto w3 = alias_load<uint64_t>(curSrc); + auto w4 = alias_load<uint64_t>(curSrc); + auto w5 = alias_load<uint64_t>(curSrc); + auto w6 = alias_load<uint64_t>(curSrc); + auto w7 = alias_load<uint64_t>(curSrc); + auto w8 = alias_load<uint64_t>(curSrc); + alias_store<uint64_t>(curDest, w1); + alias_store<uint64_t>(curDest, w2); + alias_store<uint64_t>(curDest, w3); + alias_store<uint64_t>(curDest, w4); + alias_store<uint64_t>(curDest, w5); + alias_store<uint64_t>(curDest, w6); + alias_store<uint64_t>(curDest, w7); + alias_store<uint64_t>(curDest, w8); + n -= 8 * 8; + } + if(n >= 4 * 8) { + auto w1 = alias_load<uint64_t>(curSrc); + auto w2 = alias_load<uint64_t>(curSrc); + auto w3 = alias_load<uint64_t>(curSrc); + auto w4 = alias_load<uint64_t>(curSrc); + alias_store<uint64_t>(curDest, w1); + alias_store<uint64_t>(curDest, w2); + alias_store<uint64_t>(curDest, w3); + alias_store<uint64_t>(curDest, w4); + n -= 4 * 8; + } + if(n >= 2 * 8) { + auto w1 = alias_load<uint64_t>(curSrc); + auto w2 = alias_load<uint64_t>(curSrc); + alias_store<uint64_t>(curDest, w1); + alias_store<uint64_t>(curDest, w2); + n -= 2 * 8; + } + if(n >= 8) { + auto w = alias_load<uint64_t>(curSrc); + alias_store<uint64_t>(curDest, w); + n -= 8; + } + if(n >= 4) { + auto w = alias_load<uint32_t>(curSrc); + alias_store<uint32_t>(curDest, w); + n -= 4; + } + if(n >= 2) { + auto w = alias_load<uint16_t>(curSrc); + alias_store<uint16_t>(curDest, w); + n -= 2; + } + if(n) + *curDest = *curSrc; + return dest; + } +#else // !__LP64__ + void *forward_copy(void *dest, const void *src, size_t n) { + for(size_t i = 0; i < n; i++) + ((char *)dest)[i] = ((const char *)src)[i]; + return dest; + } +#endif // __LP64__ / !__LP64__ +} + +// -------------------------------------------------------------------------------------- +// memcpy() implementation. +// -------------------------------------------------------------------------------------- + + +void *memcpy(void *__restrict dest, const void *__restrict src, size_t n) { + return forward_copy(dest, src, n); +} + + +// -------------------------------------------------------------------------------------- +// memset() implementation. +// -------------------------------------------------------------------------------------- + +#ifdef __LP64__ + +void *memset(void *dest, int val, size_t n) { + auto curDest = reinterpret_cast<unsigned char *>(dest); + unsigned char byte = val; + + // Get rid of misalignment. + while(n && (reinterpret_cast<uintptr_t>(curDest) & 7)) { + *curDest++ = byte; + --n; + } + + auto pattern64 = static_cast<word<uint64_t>>( + static_cast<uint64_t>(byte) + | (static_cast<uint64_t>(byte) << 8) + | (static_cast<uint64_t>(byte) << 16) + | (static_cast<uint64_t>(byte) << 24) + | (static_cast<uint64_t>(byte) << 32) + | (static_cast<uint64_t>(byte) << 40) + | (static_cast<uint64_t>(byte) << 48) + | (static_cast<uint64_t>(byte) << 56)); + + auto pattern32 = static_cast<word<uint32_t>>( + static_cast<uint32_t>(byte) + | (static_cast<uint32_t>(byte) << 8) + | (static_cast<uint32_t>(byte) << 16) + | (static_cast<uint32_t>(byte) << 24)); + + auto pattern16 = static_cast<word<uint16_t>>( + static_cast<uint16_t>(byte) + | (static_cast<uint16_t>(byte) << 8)); + + while(n >= 8 * 8) { + alias_store<uint64_t>(curDest, pattern64); + alias_store<uint64_t>(curDest, pattern64); + alias_store<uint64_t>(curDest, pattern64); + alias_store<uint64_t>(curDest, pattern64); + alias_store<uint64_t>(curDest, pattern64); + alias_store<uint64_t>(curDest, pattern64); + alias_store<uint64_t>(curDest, pattern64); + alias_store<uint64_t>(curDest, pattern64); + n -= 8 * 8; + } + if(n >= 4 * 8) { + alias_store<uint64_t>(curDest, pattern64); + alias_store<uint64_t>(curDest, pattern64); + alias_store<uint64_t>(curDest, pattern64); + alias_store<uint64_t>(curDest, pattern64); + n -= 4 * 8; + } + if(n >= 2 * 8) { + alias_store<uint64_t>(curDest, pattern64); + alias_store<uint64_t>(curDest, pattern64); + n -= 2 * 8; + } + if(n >= 8) { + alias_store<uint64_t>(curDest, pattern64); + n -= 8; + } + if(n >= 4) { + alias_store<uint32_t>(curDest, pattern32); + n -= 4; + } + if(n >= 2) { + alias_store<uint16_t>(curDest, pattern16); + n -= 2; + } + if(n) + *curDest = byte; + return dest; +} + +#else // !__LP64__ + +void *memset(void *dest, int byte, size_t count) { + for(size_t i = 0; i < count; i++) + ((char *)dest)[i] = (char)byte; + return dest; +} + +#endif // __LP64__ / !__LP64__ + +// -------------------------------------------------------------------------------------- +// "Non-optimized" functions. +// -------------------------------------------------------------------------------------- + +void *memmove(void *dest, const void *src, size_t size) { + char *dest_bytes = (char *)dest; + char *src_bytes = (char *)src; + if(dest_bytes < src_bytes) { + return forward_copy(dest, src, size); + }else if(dest_bytes > src_bytes) { + for(size_t i = 0; i < size; i++) + dest_bytes[size - i - 1] = src_bytes[size - i - 1]; + } + return dest; +} + +size_t strlen(const char *s) { + size_t len = 0; + for(size_t i = 0; s[i]; i++) + len++; + return len; +} diff --git a/lib/mlibc/options/internal/generic/frigg.cpp b/lib/mlibc/options/internal/generic/frigg.cpp new file mode 100644 index 0000000..7575c9c --- /dev/null +++ b/lib/mlibc/options/internal/generic/frigg.cpp @@ -0,0 +1,14 @@ + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/internal-sysdeps.hpp> + +extern "C" void frg_panic(const char *mstr) { +// mlibc::sys_libc_log("mlibc: Call to frg_panic"); + mlibc::sys_libc_log(mstr); + mlibc::sys_libc_panic(); +} + +extern "C" void frg_log(const char *mstr) { + mlibc::sys_libc_log(mstr); +} diff --git a/lib/mlibc/options/internal/generic/global-config.cpp b/lib/mlibc/options/internal/generic/global-config.cpp new file mode 100644 index 0000000..264a984 --- /dev/null +++ b/lib/mlibc/options/internal/generic/global-config.cpp @@ -0,0 +1,27 @@ +#include <stdlib.h> +#include <string.h> +#include <mlibc/global-config.hpp> + +namespace mlibc { + +struct GlobalConfigGuard { + GlobalConfigGuard(); +}; + +GlobalConfigGuard guard; + +GlobalConfigGuard::GlobalConfigGuard() { + // Force the config to be created during initialization of libc.so. + mlibc::globalConfig(); +} + +static bool envEnabled(const char *env) { + auto value = getenv(env); + return value && *value && *value != '0'; +} + +GlobalConfig::GlobalConfig() { + debugMalloc = envEnabled("MLIBC_DEBUG_MALLOC"); +} + +} diff --git a/lib/mlibc/options/internal/generic/inline-emitter.cpp b/lib/mlibc/options/internal/generic/inline-emitter.cpp new file mode 100644 index 0000000..bf81c0b --- /dev/null +++ b/lib/mlibc/options/internal/generic/inline-emitter.cpp @@ -0,0 +1,16 @@ +// This translation unit provides symbols for functions marked with __MLIBC_INLINE_DEFINITION. +// All headers with such functions must be included here. + +#define __MLIBC_EMIT_INLINE_DEFINITIONS + +#include <mlibc-config.h> + +#include <elf.h> + +#if __MLIBC_LINUX_OPTION +#include <sys/sysmacros.h> +#endif /* __MLIBC_LINUX_OPTION */ + +#ifndef MLIBC_BUILDING_RTDL +#include <math.h> +#endif diff --git a/lib/mlibc/options/internal/generic/locale.cpp b/lib/mlibc/options/internal/generic/locale.cpp new file mode 100644 index 0000000..7ba040f --- /dev/null +++ b/lib/mlibc/options/internal/generic/locale.cpp @@ -0,0 +1,87 @@ +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/locale.hpp> + +namespace mlibc { + +char *nl_langinfo(nl_item item) { + if(item == CODESET) { + return const_cast<char *>("UTF-8"); + } else if(item >= ABMON_1 && item <= ABMON_12) { + switch(item) { + case ABMON_1: return const_cast<char *>("Jan"); + case ABMON_2: return const_cast<char *>("Feb"); + case ABMON_3: return const_cast<char *>("Mar"); + case ABMON_4: return const_cast<char *>("Apr"); + case ABMON_5: return const_cast<char *>("May"); + case ABMON_6: return const_cast<char *>("Jun"); + case ABMON_7: return const_cast<char *>("Jul"); + case ABMON_8: return const_cast<char *>("Aug"); + case ABMON_9: return const_cast<char *>("Sep"); + case ABMON_10: return const_cast<char *>("Oct"); + case ABMON_11: return const_cast<char *>("Nov"); + case ABMON_12: return const_cast<char *>("Dec"); + default: + __ensure(!"ABMON_* constants don't seem to be contiguous!"); + __builtin_unreachable(); + } + } else if(item >= MON_1 && item <= MON_12) { + switch(item) { + case MON_1: return const_cast<char *>("January"); + case MON_2: return const_cast<char *>("Feburary"); + case MON_3: return const_cast<char *>("March"); + case MON_4: return const_cast<char *>("April"); + case MON_5: return const_cast<char *>("May"); + case MON_6: return const_cast<char *>("June"); + case MON_7: return const_cast<char *>("July"); + case MON_8: return const_cast<char *>("August"); + case MON_9: return const_cast<char *>("September"); + case MON_10: return const_cast<char *>("October"); + case MON_11: return const_cast<char *>("November"); + case MON_12: return const_cast<char *>("December"); + default: + __ensure(!"MON_* constants don't seem to be contiguous!"); + __builtin_unreachable(); + } + } else if(item == AM_STR) { + return const_cast<char *>("AM"); + } else if(item == PM_STR) { + return const_cast<char *>("PM"); + } else if(item >= DAY_1 && item <= DAY_7) { + switch(item) { + case DAY_1: return const_cast<char *>("Sunday"); + case DAY_2: return const_cast<char *>("Monday"); + case DAY_3: return const_cast<char *>("Tuesday"); + case DAY_4: return const_cast<char *>("Wednesday"); + case DAY_5: return const_cast<char *>("Thursday"); + case DAY_6: return const_cast<char *>("Friday"); + case DAY_7: return const_cast<char *>("Saturday"); + default: + __ensure(!"DAY_* constants don't seem to be contiguous!"); + __builtin_unreachable(); + } + } else if(item >= ABDAY_1 && item <= ABDAY_7) { + switch(item) { + case ABDAY_1: return const_cast<char *>("Sun"); + case ABDAY_2: return const_cast<char *>("Mon"); + case ABDAY_3: return const_cast<char *>("Tue"); + case ABDAY_4: return const_cast<char *>("Wed"); + case ABDAY_5: return const_cast<char *>("Thu"); + case ABDAY_6: return const_cast<char *>("Fri"); + case ABDAY_7: return const_cast<char *>("Sat"); + default: + __ensure(!"ABDAY_* constants don't seem to be contiguous!"); + __builtin_unreachable(); + } + }else if(item == D_FMT) { + return const_cast<char *>("%m/%d/%y"); + }else if(item == T_FMT) { + return const_cast<char *>("%H:%M:%S"); + }else{ + mlibc::infoLogger() << "mlibc: nl_langinfo item " + << item << " is not implemented properly" << frg::endlog; + return const_cast<char *>(""); + } +} + +} diff --git a/lib/mlibc/options/internal/generic/sigset.cpp b/lib/mlibc/options/internal/generic/sigset.cpp new file mode 100644 index 0000000..134277d --- /dev/null +++ b/lib/mlibc/options/internal/generic/sigset.cpp @@ -0,0 +1,37 @@ +#include <bits/sigset_t.h> +#include <bits/ensure.h> + +int sigemptyset(sigset_t *sigset) { + *sigset = 0; + return 0; +} + +int sigfillset(sigset_t *sigset) { + *sigset = ~sigset_t(0); + return 0; +} + +// TODO: Return EINVAL instead of __ensure()ing. + +int sigaddset(sigset_t *sigset, int sig) { + int signo = sig - 1; + // TODO: do not hard code CHAR_BITS + __ensure((unsigned int)signo < sizeof(sigset_t) * 8); + *sigset |= sigset_t(1) << signo; + return 0; +} + +int sigdelset(sigset_t *sigset, int sig) { + int signo = sig - 1; + // TODO: do not hard code CHAR_BITS + __ensure((unsigned int)signo < sizeof(sigset_t) * 8); + *sigset &= ~(sigset_t(1) << signo); + return 0; +} + +int sigismember(const sigset_t *set, int sig) { + int signo = sig - 1; + // TODO: do not hard code CHAR_BITS + __ensure((unsigned int)signo < sizeof(sigset_t) * 8); + return (*set) & (sigset_t(1) << signo); +} diff --git a/lib/mlibc/options/internal/generic/strings.cpp b/lib/mlibc/options/internal/generic/strings.cpp new file mode 100644 index 0000000..ce4f84b --- /dev/null +++ b/lib/mlibc/options/internal/generic/strings.cpp @@ -0,0 +1,22 @@ +#include <ctype.h> + +#include <mlibc/strings.hpp> + +namespace mlibc { + +int strncasecmp(const char *a, const char *b, size_t size) { + for(size_t i = 0; i < size; i++) { + unsigned char a_byte = tolower(a[i]); + unsigned char b_byte = tolower(b[i]); + if(!a_byte && !b_byte) + return 0; + // If only one char is null, one of the following cases applies. + if(a_byte < b_byte) + return -1; + if(a_byte > b_byte) + return 1; + } + return 0; +} + +} diff --git a/lib/mlibc/options/internal/generic/threads.cpp b/lib/mlibc/options/internal/generic/threads.cpp new file mode 100644 index 0000000..5f1168c --- /dev/null +++ b/lib/mlibc/options/internal/generic/threads.cpp @@ -0,0 +1,342 @@ +#include <abi-bits/errno.h> +#include <bits/threads.h> +#include <bits/ensure.h> +#include <mlibc/all-sysdeps.hpp> +#include <mlibc/debug.hpp> +#include <mlibc/lock.hpp> +#include <mlibc/threads.hpp> +#include <mlibc/tcb.hpp> + +extern "C" Tcb *__rtdl_allocateTcb(); + +namespace mlibc { + +int thread_create(struct __mlibc_thread_data **__restrict thread, const struct __mlibc_threadattr *__restrict attrp, void *entry, void *__restrict user_arg, bool returns_int) { + auto new_tcb = __rtdl_allocateTcb(); + pid_t tid; + struct __mlibc_threadattr attr = {}; + if (!attrp) + thread_attr_init(&attr); + else + attr = *attrp; + + if (attr.__mlibc_cpuset) + mlibc::infoLogger() << "pthread_create(): cpuset is ignored!" << frg::endlog; + if (attr.__mlibc_sigmaskset) + mlibc::infoLogger() << "pthread_create(): sigmask is ignored!" << frg::endlog; + + // TODO: due to alignment guarantees, the stackaddr and stacksize might change + // when the stack is allocated. Currently this isn't propagated to the TCB, + // but it should be. + void *stack = attr.__mlibc_stackaddr; + if (!mlibc::sys_prepare_stack) { + MLIBC_MISSING_SYSDEP(); + return ENOSYS; + } + int ret = mlibc::sys_prepare_stack(&stack, entry, + user_arg, new_tcb, &attr.__mlibc_stacksize, &attr.__mlibc_guardsize, &new_tcb->stackAddr); + if (ret) + return ret; + + if (!mlibc::sys_clone) { + MLIBC_MISSING_SYSDEP(); + return ENOSYS; + } + new_tcb->stackSize = attr.__mlibc_stacksize; + new_tcb->guardSize = attr.__mlibc_guardsize; + new_tcb->returnValueType = (returns_int) ? TcbThreadReturnValue::Integer : TcbThreadReturnValue::Pointer; + mlibc::sys_clone(new_tcb, &tid, stack); + *thread = reinterpret_cast<struct __mlibc_thread_data *>(new_tcb); + + __atomic_store_n(&new_tcb->tid, tid, __ATOMIC_RELAXED); + mlibc::sys_futex_wake(&new_tcb->tid); + + return 0; +} + +int thread_join(struct __mlibc_thread_data *thread, void *ret) { + auto tcb = reinterpret_cast<Tcb *>(thread); + + if (!__atomic_load_n(&tcb->isJoinable, __ATOMIC_ACQUIRE)) + return EINVAL; + + while (!__atomic_load_n(&tcb->didExit, __ATOMIC_ACQUIRE)) { + mlibc::sys_futex_wait(&tcb->didExit, 0, nullptr); + } + + if(ret && tcb->returnValueType == TcbThreadReturnValue::Pointer) + *reinterpret_cast<void **>(ret) = tcb->returnValue.voidPtr; + else if(ret && tcb->returnValueType == TcbThreadReturnValue::Integer) + *reinterpret_cast<int *>(ret) = tcb->returnValue.intVal; + + // FIXME: destroy tcb here, currently we leak it + + return 0; +} + +static constexpr size_t default_stacksize = 0x200000; +static constexpr size_t default_guardsize = 4096; + +int thread_attr_init(struct __mlibc_threadattr *attr) { + *attr = __mlibc_threadattr{}; + attr->__mlibc_stacksize = default_stacksize; + attr->__mlibc_guardsize = default_guardsize; + attr->__mlibc_detachstate = __MLIBC_THREAD_CREATE_JOINABLE; + return 0; +} + +static constexpr unsigned int mutexRecursive = 1; +static constexpr unsigned int mutexErrorCheck = 2; + +// TODO: either use uint32_t or determine the bit based on sizeof(int). +static constexpr unsigned int mutex_owner_mask = (static_cast<uint32_t>(1) << 30) - 1; +static constexpr unsigned int mutex_waiters_bit = static_cast<uint32_t>(1) << 31; + +// Only valid for the internal __mlibc_m mutex of wrlocks. +static constexpr unsigned int mutex_excl_bit = static_cast<uint32_t>(1) << 30; + +int thread_mutex_init(struct __mlibc_mutex *__restrict mutex, + const struct __mlibc_mutexattr *__restrict attr) { + auto type = attr ? attr->__mlibc_type : __MLIBC_THREAD_MUTEX_DEFAULT; + auto robust = attr ? attr->__mlibc_robust : __MLIBC_THREAD_MUTEX_STALLED; + auto protocol = attr ? attr->__mlibc_protocol : __MLIBC_THREAD_PRIO_NONE; + auto pshared = attr ? attr->__mlibc_pshared : __MLIBC_THREAD_PROCESS_PRIVATE; + + mutex->__mlibc_state = 0; + mutex->__mlibc_recursion = 0; + mutex->__mlibc_flags = 0; + mutex->__mlibc_prioceiling = 0; // TODO: We don't implement this. + + if(type == __MLIBC_THREAD_MUTEX_RECURSIVE) { + mutex->__mlibc_flags |= mutexRecursive; + }else if(type == __MLIBC_THREAD_MUTEX_ERRORCHECK) { + mutex->__mlibc_flags |= mutexErrorCheck; + }else{ + __ensure(type == __MLIBC_THREAD_MUTEX_NORMAL); + } + + // TODO: Other values aren't supported yet. + __ensure(robust == __MLIBC_THREAD_MUTEX_STALLED); + __ensure(protocol == __MLIBC_THREAD_PRIO_NONE); + __ensure(pshared == __MLIBC_THREAD_PROCESS_PRIVATE); + + return 0; +} + +int thread_mutex_destroy(struct __mlibc_mutex *mutex) { + __ensure(!mutex->__mlibc_state); + return 0; +} + +int thread_mutex_lock(struct __mlibc_mutex *mutex) { + unsigned int this_tid = mlibc::this_tid(); + unsigned int expected = 0; + while(true) { + if(!expected) { + // Try to take the mutex here. + if(__atomic_compare_exchange_n(&mutex->__mlibc_state, + &expected, this_tid, false, __ATOMIC_ACQUIRE, __ATOMIC_ACQUIRE)) { + __ensure(!mutex->__mlibc_recursion); + mutex->__mlibc_recursion = 1; + return 0; + } + }else{ + // If this (recursive) mutex is already owned by us, increment the recursion level. + if((expected & mutex_owner_mask) == this_tid) { + if(!(mutex->__mlibc_flags & mutexRecursive)) { + if (mutex->__mlibc_flags & mutexErrorCheck) + return EDEADLK; + else + mlibc::panicLogger() << "mlibc: pthread_mutex deadlock detected!" + << frg::endlog; + } + ++mutex->__mlibc_recursion; + return 0; + } + + // Wait on the futex if the waiters flag is set. + if(expected & mutex_waiters_bit) { + int e = mlibc::sys_futex_wait((int *)&mutex->__mlibc_state, expected, nullptr); + + // If the wait returns EAGAIN, that means that the mutex_waiters_bit was just unset by + // some other thread. In this case, we should loop back around. + if (e && e != EAGAIN) + mlibc::panicLogger() << "sys_futex_wait() failed with error code " << e << frg::endlog; + + // Opportunistically try to take the lock after we wake up. + expected = 0; + }else{ + // Otherwise we have to set the waiters flag first. + unsigned int desired = expected | mutex_waiters_bit; + if(__atomic_compare_exchange_n((int *)&mutex->__mlibc_state, + reinterpret_cast<int*>(&expected), desired, false, __ATOMIC_RELAXED, __ATOMIC_RELAXED)) + expected = desired; + } + } + } +} + +int thread_mutex_unlock(struct __mlibc_mutex *mutex) { + // Decrement the recursion level and unlock if we hit zero. + __ensure(mutex->__mlibc_recursion); + if(--mutex->__mlibc_recursion) + return 0; + + auto flags = mutex->__mlibc_flags; + + // Reset the mutex to the unlocked state. + auto state = __atomic_exchange_n(&mutex->__mlibc_state, 0, __ATOMIC_RELEASE); + + // After this point the mutex is unlocked, and therefore we cannot access its contents as it + // may have been destroyed by another thread. + + unsigned int this_tid = mlibc::this_tid(); + if ((flags & mutexErrorCheck) && (state & mutex_owner_mask) != this_tid) + return EPERM; + + if ((flags & mutexErrorCheck) && !(state & mutex_owner_mask)) + return EINVAL; + + __ensure((state & mutex_owner_mask) == this_tid); + + if(state & mutex_waiters_bit) { + // Wake the futex if there were waiters. Since the mutex might not exist at this location + // anymore, we must conservatively ignore EACCES and EINVAL which may occur as a result. + int e = mlibc::sys_futex_wake((int *)&mutex->__mlibc_state); + __ensure(e >= 0 || e == EACCES || e == EINVAL); + } + + return 0; +} + +int thread_mutexattr_init(struct __mlibc_mutexattr *attr) { + attr->__mlibc_type = __MLIBC_THREAD_MUTEX_DEFAULT; + attr->__mlibc_robust = __MLIBC_THREAD_MUTEX_STALLED; + attr->__mlibc_pshared = __MLIBC_THREAD_PROCESS_PRIVATE; + attr->__mlibc_protocol = __MLIBC_THREAD_PRIO_NONE; + return 0; +} + +int thread_mutexattr_destroy(struct __mlibc_mutexattr *attr) { + memset(attr, 0, sizeof(*attr)); + return 0; +} + +int thread_mutexattr_gettype(const struct __mlibc_mutexattr *__restrict attr, int *__restrict type) { + *type = attr->__mlibc_type; + return 0; +} + +int thread_mutexattr_settype(struct __mlibc_mutexattr *attr, int type) { + if (type != __MLIBC_THREAD_MUTEX_NORMAL && type != __MLIBC_THREAD_MUTEX_ERRORCHECK + && type != __MLIBC_THREAD_MUTEX_RECURSIVE) + return EINVAL; + + attr->__mlibc_type = type; + return 0; +} + +int thread_cond_init(struct __mlibc_cond *__restrict cond, const struct __mlibc_condattr *__restrict attr) { + auto clock = attr ? attr->__mlibc_clock : CLOCK_REALTIME; + auto pshared = attr ? attr->__mlibc_pshared : __MLIBC_THREAD_PROCESS_PRIVATE; + + cond->__mlibc_clock = clock; + cond->__mlibc_flags = pshared; + + __atomic_store_n(&cond->__mlibc_seq, 1, __ATOMIC_RELAXED); + + return 0; +} + +int thread_cond_destroy(struct __mlibc_cond *) { + return 0; +} + +int thread_cond_broadcast(struct __mlibc_cond *cond) { + __atomic_fetch_add(&cond->__mlibc_seq, 1, __ATOMIC_RELEASE); + if(int e = mlibc::sys_futex_wake((int *)&cond->__mlibc_seq); e) + __ensure(!"sys_futex_wake() failed"); + + return 0; +} + +int thread_cond_timedwait(struct __mlibc_cond *__restrict cond, __mlibc_mutex *__restrict mutex, + const struct timespec *__restrict abstime) { + // TODO: pshared isn't supported yet. + __ensure(cond->__mlibc_flags == 0); + + constexpr long nanos_per_second = 1'000'000'000; + if (abstime && (abstime->tv_nsec < 0 || abstime->tv_nsec >= nanos_per_second)) + return EINVAL; + + auto seq = __atomic_load_n(&cond->__mlibc_seq, __ATOMIC_ACQUIRE); + + // TODO: handle locking errors and cancellation properly. + while (true) { + if (thread_mutex_unlock(mutex)) + __ensure(!"Failed to unlock the mutex"); + + int e; + if (abstime) { + // Adjust for the fact that sys_futex_wait accepts a *timeout*, but + // pthread_cond_timedwait accepts an *absolute time*. + // Note: mlibc::sys_clock_get is available unconditionally. + struct timespec now; + if (mlibc::sys_clock_get(cond->__mlibc_clock, &now.tv_sec, &now.tv_nsec)) + __ensure(!"sys_clock_get() failed"); + + struct timespec timeout; + timeout.tv_sec = abstime->tv_sec - now.tv_sec; + timeout.tv_nsec = abstime->tv_nsec - now.tv_nsec; + + // Check if abstime has already passed. + if (timeout.tv_sec < 0 || (timeout.tv_sec == 0 && timeout.tv_nsec < 0)) { + if (thread_mutex_lock(mutex)) + __ensure(!"Failed to lock the mutex"); + return ETIMEDOUT; + } else if (timeout.tv_nsec >= nanos_per_second) { + timeout.tv_nsec -= nanos_per_second; + timeout.tv_sec++; + __ensure(timeout.tv_nsec < nanos_per_second); + } else if (timeout.tv_nsec < 0) { + timeout.tv_nsec += nanos_per_second; + timeout.tv_sec--; + __ensure(timeout.tv_nsec >= 0); + } + + e = mlibc::sys_futex_wait((int *)&cond->__mlibc_seq, seq, &timeout); + } else { + e = mlibc::sys_futex_wait((int *)&cond->__mlibc_seq, seq, nullptr); + } + + if (thread_mutex_lock(mutex)) + __ensure(!"Failed to lock the mutex"); + + // There are four cases to handle: + // 1. e == 0: this indicates a (potentially spurious) wakeup. The value of + // seq *must* be checked to distinguish these two cases. + // 2. e == EAGAIN: this indicates that the value of seq changed before we + // went to sleep. We don't need to check seq in this case. + // 3. e == EINTR: a signal was delivered. The man page allows us to choose + // whether to go to sleep again or to return 0, but we do the former + // to match other libcs. + // 4. e == ETIMEDOUT: this should only happen if abstime is set. + if (e == 0) { + auto cur_seq = __atomic_load_n(&cond->__mlibc_seq, __ATOMIC_ACQUIRE); + if (cur_seq > seq) + return 0; + } else if (e == EAGAIN) { + __ensure(__atomic_load_n(&cond->__mlibc_seq, __ATOMIC_ACQUIRE) > seq); + return 0; + } else if (e == EINTR) { + continue; + } else if (e == ETIMEDOUT) { + __ensure(abstime); + return ETIMEDOUT; + } else { + mlibc::panicLogger() << "sys_futex_wait() failed with error " << e << frg::endlog; + } + } +} + +} // namespace mlibc diff --git a/lib/mlibc/options/internal/generic/ubsan.cpp b/lib/mlibc/options/internal/generic/ubsan.cpp new file mode 100644 index 0000000..3491729 --- /dev/null +++ b/lib/mlibc/options/internal/generic/ubsan.cpp @@ -0,0 +1,254 @@ +#include <limits.h> +#include <mlibc/debug.hpp> + +#define FMT(obj) format_object((obj), opts, formatter) + +#define LOG_NAME_LOC(name, loc) "ubsan: " name " at " << loc << "\n " +#define LOG_LHS_RHS(lhs, rhs) "LHS = " << (lhs) << ", RHS = " << (rhs) + +struct SourceLocation { + const char *filename; + uint32_t line; + uint32_t column; +}; + +template<class F> +void format_object(const SourceLocation &loc, frg::format_options opts, F &formatter) { + FMT(loc.filename); + FMT(":"); + FMT(loc.line); + FMT(":"); + FMT(loc.column); +} + +using ValueHandle = uintptr_t; + +struct TypeDescriptor { + enum class Kind : uint16_t { + Integer = 0x0000, + Float = 0x0001, + Unknown = 0xffff + } kind; + + uint16_t info; + char name[]; + + unsigned bitWidthInt() const { + return 1 << (info >> 1); + } + + bool isInlineInt() const { + if (kind != Kind::Integer) + return false; + + auto inlineBits = sizeof(ValueHandle) * CHAR_BIT; + auto valueBits = bitWidthInt(); + return inlineBits <= valueBits; + } + + bool isSigned() const { + return info & 1; + } +}; + +template<class F> +void format_object(const TypeDescriptor &type, frg::format_options opts, F &formatter) { + FMT(type.name); +} + +struct Value { + const TypeDescriptor &type; + ValueHandle val; + + Value(const TypeDescriptor &type, ValueHandle val) : type(type), val(val) {} +}; + +template<class F> +void format_object(const Value &val, frg::format_options opts, F &formatter) { + if (val.type.isInlineInt() && val.type.isSigned()) { + auto signedValue = static_cast<int64_t>(val.val); + FMT(signedValue); + } else if (val.type.isInlineInt() && !val.type.isSigned()) { + auto unsignedValue = static_cast<uint64_t>(val.val); + FMT(unsignedValue); + } + + FMT(" ("); + FMT(val.type); + FMT(")"); +} + + +// --- Hook implementations --- + +struct TypeMismatch { + SourceLocation loc; + const TypeDescriptor &type; + unsigned char logAlignment; + unsigned char kind; +}; + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_type_mismatch_v1(TypeMismatch *tm, ValueHandle pointer) { + // TODO: Make this print more information. + mlibc::panicLogger() + << LOG_NAME_LOC("type mismatch", tm->loc) + << "accessed address " << (void *)pointer << " but type " + << tm->type << " requires alignment " << (1 << tm->logAlignment) + << frg::endlog; +} + +struct PointerOverflowData { + SourceLocation loc; +}; + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_pointer_overflow(PointerOverflowData *pod, ValueHandle base, ValueHandle result) { + (void)base; + (void)result; + mlibc::panicLogger() + << LOG_NAME_LOC("pointer overflow", pod->loc) + << frg::endlog; +} + +struct InvalidValueData { + SourceLocation loc; + const TypeDescriptor &type; +}; + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_load_invalid_value(InvalidValueData *ivd, ValueHandle value) { + (void)value; + mlibc::panicLogger() + << LOG_NAME_LOC("load of invalid value", ivd->loc) + << frg::endlog; +} + +struct OverflowData { + SourceLocation loc; + const TypeDescriptor &type; +}; + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_add_overflow(OverflowData *od, ValueHandle lhs, ValueHandle rhs) { + mlibc::panicLogger() + << LOG_NAME_LOC("add overflowed ", od->loc) + << LOG_LHS_RHS(Value(od->type, lhs), Value(od->type, rhs)) + << frg::endlog; +} + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_sub_overflow(OverflowData *od, ValueHandle lhs, ValueHandle rhs) { + mlibc::panicLogger() + << LOG_NAME_LOC("sub overflowed", od->loc) + << LOG_LHS_RHS(Value(od->type, lhs), Value(od->type, rhs)) + << frg::endlog; +} + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_mul_overflow(OverflowData *od, ValueHandle lhs, ValueHandle rhs) { + mlibc::panicLogger() + << LOG_NAME_LOC("mul overflowed", od->loc) + << LOG_LHS_RHS(Value(od->type, lhs), Value(od->type, rhs)) + << frg::endlog; +} + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_divrem_overflow(OverflowData *od, ValueHandle lhs, ValueHandle rhs) { + mlibc::panicLogger() + << LOG_NAME_LOC("divrem overflowed", od->loc) + << LOG_LHS_RHS(Value(od->type, lhs), Value(od->type, rhs)) + << frg::endlog; +} + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_negate_overflow(OverflowData *od, ValueHandle lhs, ValueHandle rhs) { + mlibc::panicLogger() + << LOG_NAME_LOC("negate overflowed", od->loc) + << LOG_LHS_RHS(Value(od->type, lhs), Value(od->type, rhs)) + << frg::endlog; +} + +struct ShiftOutOfBoundsData { + SourceLocation loc; + const TypeDescriptor &lhsType; + const TypeDescriptor &rhsType; +}; + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_shift_out_of_bounds(ShiftOutOfBoundsData *soob, ValueHandle lhs, ValueHandle rhs) { + mlibc::panicLogger() + << LOG_NAME_LOC("shift out of bounds", soob->loc) + << LOG_LHS_RHS(Value(soob->lhsType, lhs), Value(soob->rhsType, rhs)) + << frg::endlog; +} + +struct OutOfBoundsData { + SourceLocation loc; + const TypeDescriptor &arrayType; + const TypeDescriptor &indexType; +}; + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_out_of_bounds(OutOfBoundsData *oobd, ValueHandle data) { + (void)data; + mlibc::panicLogger() + << LOG_NAME_LOC("out of bounds access", oobd->loc) + << frg::endlog; +} + +struct UnreachableData { + SourceLocation loc; +}; + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_builtin_unreachable(UnreachableData *ubd) { + mlibc::panicLogger() + << LOG_NAME_LOC("reached __builtin_unreachable()", ubd->loc) + << frg::endlog; +} + +struct InvalidBuiltinData { + SourceLocation loc; + unsigned char kind; +}; + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_invalid_builtin(InvalidBuiltinData *ibd) { + mlibc::panicLogger() + << LOG_NAME_LOC("reached invalid builtin", ibd->loc) + << frg::endlog; +} + +struct VLABoundData { + SourceLocation loc; + const TypeDescriptor &type; +}; + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_vla_bound_not_positive(VLABoundData *vlabd) { + mlibc::panicLogger() + << LOG_NAME_LOC("VLA bound not positive", vlabd->loc) + << frg::endlog; +} + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_missing_return(UnreachableData *data) { + mlibc::panicLogger() + << LOG_NAME_LOC("reached end of a value-returning function without returning a value", data->loc) + << frg::endlog; +} + +struct NonNullArgData { + SourceLocation loc; + SourceLocation attr_loc; + int arg_index; +}; + +extern "C" [[gnu::visibility("hidden")]] +void __ubsan_handle_nonnull_arg(NonNullArgData *data) { + mlibc::panicLogger() + << LOG_NAME_LOC("null pointer passed to non-null argument", data->loc) + << "argument " << data->arg_index << " is required to be non-null in " + << data->attr_loc << frg::endlog; +} diff --git a/lib/mlibc/options/internal/include/bits/cpu_set.h b/lib/mlibc/options/internal/include/bits/cpu_set.h new file mode 100644 index 0000000..69f6923 --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/cpu_set.h @@ -0,0 +1,13 @@ +#ifndef _MLIBC_INTERNAL_CPU_SET_H +#define _MLIBC_INTERNAL_CPU_SET_H + +typedef unsigned long __cpu_mask; + +#define CPU_SETSIZE 1024 +#define __NCPUBITS (8 * sizeof(__cpu_mask)) + +typedef struct { + __cpu_mask __bits[CPU_SETSIZE / __NCPUBITS]; +} cpu_set_t; + +#endif /* _MLIBC_INTERNAL_CPU_SET_H */ diff --git a/lib/mlibc/options/internal/include/bits/ensure.h b/lib/mlibc/options/internal/include/bits/ensure.h new file mode 100644 index 0000000..f75a2e9 --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/ensure.h @@ -0,0 +1,45 @@ + +#ifndef MLIBC_ENSURE_H +#define MLIBC_ENSURE_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +void __ensure_fail(const char *assertion, const char *file, unsigned int line, + const char *function); + +void __ensure_warn(const char *assertion, const char *file, unsigned int line, + const char *function); + +#endif /* !__MLIBC_ABI_ONLY */ + +#define __ensure(assertion) do { if(!(assertion)) \ + __ensure_fail(#assertion, __FILE__, __LINE__, __func__); } while(0) + +#define MLIBC_UNIMPLEMENTED() __ensure_fail("Functionality is not implemented", \ + __FILE__, __LINE__, __func__) + +#define MLIBC_MISSING_SYSDEP() __ensure_warn("Library function fails due to missing sysdep", \ + __FILE__, __LINE__, __func__) + +#define MLIBC_CHECK_OR_ENOSYS(sysdep, ret) ({ \ + if (!(sysdep)) { \ + __ensure_warn("Library function fails due to missing sysdep", \ + __FILE__, __LINE__, __func__); \ + errno = ENOSYS; \ + return (ret); \ + } \ + sysdep; \ + }) + +#define MLIBC_STUB_BODY { MLIBC_UNIMPLEMENTED(); __builtin_unreachable(); } + +#ifdef __cplusplus +} +#endif + +#endif // MLIBC_ENSURE_H + diff --git a/lib/mlibc/options/internal/include/bits/ether_addr.h b/lib/mlibc/options/internal/include/bits/ether_addr.h new file mode 100644 index 0000000..1631e98 --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/ether_addr.h @@ -0,0 +1,10 @@ +#ifndef MLIBC_ETHER_ADDR_H +#define MLIBC_ETHER_ADDR_H + +#include <stdint.h> + +struct ether_addr { + uint8_t ether_addr_octet[6]; +} __attribute__((__packed__)); + +#endif // MLIBC_ETHER_ADDR_H diff --git a/lib/mlibc/options/internal/include/bits/inline-definition.h b/lib/mlibc/options/internal/include/bits/inline-definition.h new file mode 100644 index 0000000..ec4c4da --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/inline-definition.h @@ -0,0 +1,19 @@ +#ifndef MLIBC_INLINE_DEFINITION_H +#define MLIBC_INLINE_DEFINITION_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifdef __MLIBC_EMIT_INLINE_DEFINITIONS +#define __MLIBC_INLINE_DEFINITION +#else +#define __MLIBC_INLINE_DEFINITION __attribute__((__gnu_inline__)) extern __inline__ +#endif + +#ifdef __cplusplus +} +#endif + +#endif // MLIBC_INLINE_DEFINITION_H + diff --git a/lib/mlibc/options/internal/include/bits/machine.h b/lib/mlibc/options/internal/include/bits/machine.h new file mode 100644 index 0000000..371a94b --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/machine.h @@ -0,0 +1,86 @@ + +#ifndef MLIBC_MACHINE_H +#define MLIBC_MACHINE_H + +#include <stdint.h> + +#if defined (__i386__) +struct __mlibc_jmpbuf_register_state { + uint32_t ebx; + uint32_t ebp; + uint32_t esi; + uint32_t edi; + uint32_t esp; + uint32_t eip; +}; +#elif defined (__x86_64__) +struct __mlibc_jmpbuf_register_state { + uint64_t rbx; + uint64_t rbp; + uint64_t r12; + uint64_t r13; + uint64_t r14; + uint64_t r15; + uint64_t rsp; + uint64_t rip; +}; +#elif defined (__aarch64__) +struct __mlibc_jmpbuf_register_state { + uint64_t x19; + uint64_t x20; + uint64_t x21; + uint64_t x22; + uint64_t x23; + uint64_t x24; + uint64_t x25; + uint64_t x26; + uint64_t x27; + uint64_t x28; + uint64_t x29; + uint64_t x30; + uint64_t sp; + uint64_t pad; + uint64_t d8; + uint64_t d9; + uint64_t d10; + uint64_t d11; + uint64_t d12; + uint64_t d13; + uint64_t d14; + uint64_t d15; +}; +#elif defined (__riscv) && __riscv_xlen == 64 +struct __mlibc_jmpbuf_register_state { + uint64_t ra; + uint64_t s0; + uint64_t s1; + uint64_t s2; + uint64_t s3; + uint64_t s4; + uint64_t s5; + uint64_t s6; + uint64_t s7; + uint64_t s8; + uint64_t s9; + uint64_t s10; + uint64_t s11; + uint64_t sp; + double fs0; + double fs1; + double fs2; + double fs3; + double fs4; + double fs5; + double fs6; + double fs7; + double fs8; + double fs9; + double fs10; + double fs11; +}; +#else +# error "Missing architecture specific code" +#endif + +#endif // MLIBC_MACHINE_H + diff --git a/lib/mlibc/options/internal/include/bits/mbstate.h b/lib/mlibc/options/internal/include/bits/mbstate.h new file mode 100644 index 0000000..2bfb3eb --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/mbstate.h @@ -0,0 +1,12 @@ +#ifndef MLIBC_MBSTATE_H +#define MLIBC_MBSTATE_H + +struct __mlibc_mbstate { + short __progress; + short __shift; + unsigned int __cpoint; +}; + +#define __MLIBC_MBSTATE_INITIALIZER {0, 0, 0} + +#endif // MLIBC_MBSTATE_H diff --git a/lib/mlibc/options/internal/include/bits/nl_item.h b/lib/mlibc/options/internal/include/bits/nl_item.h new file mode 100644 index 0000000..dc882dc --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/nl_item.h @@ -0,0 +1,82 @@ + +#ifndef _NL_ITEM_H +#define _NL_ITEM_H + +#ifdef __cplusplus +extern "C" { +#endif + +typedef int nl_item; + +#define ABDAY_1 0x60000 +#define ABDAY_2 0x60001 +#define ABDAY_3 0x60002 +#define ABDAY_4 0x60003 +#define ABDAY_5 0x60004 +#define ABDAY_6 0x60005 +#define ABDAY_7 0x60006 + +#define DAY_1 0x60007 +#define DAY_2 0x60008 +#define DAY_3 0x60009 +#define DAY_4 0x6000A +#define DAY_5 0x6000B +#define DAY_6 0x6000C +#define DAY_7 0x6000D + +#define ABMON_1 0x6000E +#define ABMON_2 0x6000F +#define ABMON_3 0x60010 +#define ABMON_4 0x60011 +#define ABMON_5 0x60012 +#define ABMON_6 0x60013 +#define ABMON_7 0x60014 +#define ABMON_8 0x60015 +#define ABMON_9 0x60016 +#define ABMON_10 0x60017 +#define ABMON_11 0x60018 +#define ABMON_12 0x60019 + +#define MON_1 0x6001A +#define MON_2 0x6001B +#define MON_3 0x6001C +#define MON_4 0x6001D +#define MON_5 0x6001E +#define MON_6 0x6001F +#define MON_7 0x60020 +#define MON_8 0x60021 +#define MON_9 0x60022 +#define MON_10 0x60023 +#define MON_11 0x60024 +#define MON_12 0x60025 + +#define AM_STR 0x60026 +#define PM_STR 0x60027 + +#define D_T_FMT 0x60028 +#define D_FMT 0x60029 +#define T_FMT 0x6002A +#define T_FMT_AMPM 0x6002B + +#define ERA 0x6002C +#define ERA_D_FMT 0x6002D +#define ALT_DIGITS 0x6002E +#define ERA_D_T_FMT 0x6002F +#define ERA_T_FMT 0x60030 + +#define CODESET 0x30000 + +#define CRNCYSTR 0x40000 + +#define RADIXCHAR 0x50000 +#define THOUSEP 0x50001 + +#define YESEXPR 0x70000 +#define NOEXPR 0x70001 + +#ifdef __cplusplus +} +#endif + +#endif // _NL_ITEM_H + diff --git a/lib/mlibc/options/internal/include/bits/null.h b/lib/mlibc/options/internal/include/bits/null.h new file mode 100644 index 0000000..7d3fa7b --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/null.h @@ -0,0 +1,16 @@ + +#ifndef MLIBC_NULL_H +#define MLIBC_NULL_H + +#ifdef NULL +#undef NULL +#endif + +#ifndef __cplusplus +# define NULL ((void *)0) +#else +# define NULL 0 +#endif + +#endif // MLIBC_NULL_H + diff --git a/lib/mlibc/options/internal/include/bits/off_t.h b/lib/mlibc/options/internal/include/bits/off_t.h new file mode 100644 index 0000000..929fae9 --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/off_t.h @@ -0,0 +1,8 @@ +#ifndef MLIBC_OFF_T_H +#define MLIBC_OFF_T_H + +// TODO: use something like int64_t instead? +typedef long off_t; +typedef long off64_t; + +#endif // MLIBC_OFF_T_H diff --git a/lib/mlibc/options/internal/include/bits/sigset_t.h b/lib/mlibc/options/internal/include/bits/sigset_t.h new file mode 100644 index 0000000..bb86848 --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/sigset_t.h @@ -0,0 +1,25 @@ +#ifndef MLIBC_BITS_SIGSET_T_H +#define MLIBC_BITS_SIGSET_T_H + +#include <abi-bits/signal.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +// functions to manage sigset_t +int sigemptyset(sigset_t *); +int sigfillset(sigset_t *); +int sigaddset(sigset_t *, int); +int sigdelset(sigset_t *, int); +int sigismember(const sigset_t *set, int sig); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif //MLIBC_BITS_SIGSET_T_H diff --git a/lib/mlibc/options/internal/include/bits/size_t.h b/lib/mlibc/options/internal/include/bits/size_t.h new file mode 100644 index 0000000..46d7486 --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/size_t.h @@ -0,0 +1,6 @@ +#ifndef MLIBC_SIZE_T_H +#define MLIBC_SIZE_T_H + +typedef __SIZE_TYPE__ size_t; + +#endif // MLIBC_SIZE_T_H diff --git a/lib/mlibc/options/internal/include/bits/ssize_t.h b/lib/mlibc/options/internal/include/bits/ssize_t.h new file mode 100644 index 0000000..c450233 --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/ssize_t.h @@ -0,0 +1,15 @@ + +#ifndef MLIBC_SSIZE_T_H +#define MLIBC_SSIZE_T_H + +// TODO: use ptrdiff_t instead? +#if __UINTPTR_MAX__ == __UINT64_MAX__ +typedef long ssize_t; +#elif __UINTPTR_MAX__ == __UINT32_MAX__ +typedef int ssize_t; +#else +#error "unsupported architecture" +#endif + +#endif // MLIBC_SSIZE_T_H + diff --git a/lib/mlibc/options/internal/include/bits/threads.h b/lib/mlibc/options/internal/include/bits/threads.h new file mode 100644 index 0000000..3feb4c3 --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/threads.h @@ -0,0 +1,79 @@ +#ifndef _INTERNAL_THREADS_H +#define _INTERNAL_THREADS_H + +#include <abi-bits/clockid_t.h> +#include <bits/size_t.h> +#include <bits/cpu_set.h> +#include <bits/sigset_t.h> + +// values for pthread_attr_{get,set}detachstate(). +#define __MLIBC_THREAD_CREATE_JOINABLE 0 +#define __MLIBC_THREAD_CREATE_DETACHED 1 + +// values for pthread_mutexattr_{get,set}type(). +#define __MLIBC_THREAD_MUTEX_DEFAULT 0 +#define __MLIBC_THREAD_MUTEX_NORMAL 0 +#define __MLIBC_THREAD_MUTEX_ERRORCHECK 1 +#define __MLIBC_THREAD_MUTEX_RECURSIVE 2 + +// values for pthread_mutexattr_{get,set}pshared(). +#define __MLIBC_THREAD_PROCESS_PRIVATE 0 +#define __MLIBC_THREAD_PROCESS_SHARED 1 + +// values for pthread_mutexattr_{get,set}robust(). +#define __MLIBC_THREAD_MUTEX_STALLED 0 +#define __MLIBC_THREAD_MUTEX_ROBUST 1 + +// Values for pthread_mutexattr_{get,set}protocol() +#define __MLIBC_THREAD_PRIO_NONE 0 +#define __MLIBC_THREAD_PRIO_INHERIT 1 +#define __MLIBC_THREAD_PRIO_PROTECT 2 + +struct sched_param { + int sched_priority; +}; + +struct __mlibc_thread_data; + +struct __mlibc_threadattr { + size_t __mlibc_guardsize; + size_t __mlibc_stacksize; + void *__mlibc_stackaddr; + int __mlibc_detachstate; + int __mlibc_scope; + int __mlibc_inheritsched; + struct sched_param __mlibc_schedparam; + int __mlibc_schedpolicy; + cpu_set_t *__mlibc_cpuset; + size_t __mlibc_cpusetsize; + sigset_t __mlibc_sigmask; + int __mlibc_sigmaskset; +}; + +struct __mlibc_mutex { + unsigned int __mlibc_state; + unsigned int __mlibc_recursion; + unsigned int __mlibc_flags; + int __mlibc_prioceiling; +}; + +struct __mlibc_mutexattr { + int __mlibc_type; + int __mlibc_robust; + int __mlibc_protocol; + int __mlibc_pshared; + int __mlibc_prioceiling; +}; + +struct __mlibc_cond { + unsigned int __mlibc_seq; + unsigned int __mlibc_flags; + clockid_t __mlibc_clock; +}; + +struct __mlibc_condattr { + int __mlibc_pshared; + clockid_t __mlibc_clock; +}; + +#endif /* _INTERNAL_THREADS_H */ diff --git a/lib/mlibc/options/internal/include/bits/types.h b/lib/mlibc/options/internal/include/bits/types.h new file mode 100644 index 0000000..935c5e0 --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/types.h @@ -0,0 +1,319 @@ +#ifndef _MLIBC_INTERNAL_TYPES_H +#define _MLIBC_INTERNAL_TYPES_H + +typedef __UINT8_TYPE__ __mlibc_uint8; +typedef __UINT16_TYPE__ __mlibc_uint16; +typedef __UINT32_TYPE__ __mlibc_uint32; +typedef __UINT64_TYPE__ __mlibc_uint64; + +typedef __INT8_TYPE__ __mlibc_int8; +typedef __INT16_TYPE__ __mlibc_int16; +typedef __INT32_TYPE__ __mlibc_int32; +typedef __INT64_TYPE__ __mlibc_int64; + +// Clang and GCC have different mechanisms for INT32_C and friends. +#ifdef __clang__ +# define __MLIBC_C_EXPAND_JOIN(x, suffix) x ## suffix +# define __MLIBC_C_JOIN(x, suffix) __MLIBC_C_EXPAND_JOIN(x, suffix) + +# define __MLIBC_INT8_C(x) __MLIBC_C_JOIN(x, __INT8_C_SUFFIX__) +# define __MLIBC_INT16_C(x) __MLIBC_C_JOIN(x, __INT16_C_SUFFIX__) +# define __MLIBC_INT32_C(x) __MLIBC_C_JOIN(x, __INT32_C_SUFFIX__) +# define __MLIBC_INT64_C(x) __MLIBC_C_JOIN(x, __INT64_C_SUFFIX__) + +# define __MLIBC_UINT8_C(x) __MLIBC_C_JOIN(x, __UINT8_C_SUFFIX__) +# define __MLIBC_UINT16_C(x) __MLIBC_C_JOIN(x, __UINT16_C_SUFFIX__) +# define __MLIBC_UINT32_C(x) __MLIBC_C_JOIN(x, __UINT32_C_SUFFIX__) +# define __MLIBC_UINT64_C(x) __MLIBC_C_JOIN(x, __UINT64_C_SUFFIX__) + +# define __MLIBC_INTMAX_C(x) __MLIBC_C_JOIN(x, __INTMAX_C_SUFFIX__) +# define __MLIBC_UINTMAX_C(x) __MLIBC_C_JOIN(x, __UINTMAX_C_SUFFIX__) +#else +# define __MLIBC_INT8_C(x) __INT8_C(x) +# define __MLIBC_INT16_C(x) __INT16_C(x) +# define __MLIBC_INT32_C(x) __INT32_C(x) +# define __MLIBC_INT64_C(x) __INT64_C(x) + +# define __MLIBC_UINT8_C(x) __UINT8_C(x) +# define __MLIBC_UINT16_C(x) __UINT16_C(x) +# define __MLIBC_UINT32_C(x) __UINT32_C(x) +# define __MLIBC_UINT64_C(x) __UINT64_C(x) + +# define __MLIBC_INTMAX_C(x) __INTMAX_C(x) +# define __MLIBC_UINTMAX_C(x) __UINTMAX_C(x) +#endif + +#define __MLIBC_INT8_MAX __INT8_MAX__ +#define __MLIBC_INT16_MAX __INT16_MAX__ +#define __MLIBC_INT32_MAX __INT32_MAX__ +#define __MLIBC_INT64_MAX __INT64_MAX__ + +#define __MLIBC_INT8_MIN (-__MLIBC_INT8_MAX - 1) +#define __MLIBC_INT16_MIN (-__MLIBC_INT16_MAX - 1) +#define __MLIBC_INT32_MIN (-__MLIBC_INT32_MAX - 1) +#define __MLIBC_INT64_MIN (-__MLIBC_INT64_MAX - 1) + +#define __MLIBC_UINT8_MAX __UINT8_MAX__ +#define __MLIBC_UINT16_MAX __UINT16_MAX__ +#define __MLIBC_UINT32_MAX __UINT32_MAX__ +#define __MLIBC_UINT64_MAX __UINT64_MAX__ + +// Fast types (signed). + +#if defined (__i386__) + +typedef __mlibc_int8 __mlibc_int_fast8; +#define __MLIBC_INT_FAST8_C(x) __MLIBC_INT8_C(x) +#define __MLIBC_INT_FAST8_MAX __MLIBC_INT8_MAX +#define __MLIBC_INT_FAST8_MIN __MLIBC_INT8_MIN + +typedef __mlibc_int32 __mlibc_int_fast16; +#define __MLIBC_INT_FAST16_C(x) __MLIBC_INT32_C(x) +#define __MLIBC_INT_FAST16_MAX __MLIBC_INT32_MAX +#define __MLIBC_INT_FAST16_MIN __MLIBC_INT32_MIN + +typedef __mlibc_int32 __mlibc_int_fast32; +#define __MLIBC_INT_FAST32_C(x) __MLIBC_INT32_C(x) +#define __MLIBC_INT_FAST32_MAX __MLIBC_INT32_MAX +#define __MLIBC_INT_FAST32_MIN __MLIBC_INT32_MIN + +typedef __mlibc_int64 __mlibc_int_fast64; +#define __MLIBC_INT_FAST64_C(x) __MLIBC_INT64_C(x) +#define __MLIBC_INT_FAST64_MAX __MLIBC_INT64_MAX +#define __MLIBC_INT_FAST64_MIN __MLIBC_INT64_MIN + +#elif defined (__x86_64__) + +typedef __mlibc_int8 __mlibc_int_fast8; +#define __MLIBC_INT_FAST8_C(x) __MLIBC_INT8_C(x) +#define __MLIBC_INT_FAST8_MAX __MLIBC_INT8_MAX +#define __MLIBC_INT_FAST8_MIN __MLIBC_INT8_MIN + +typedef __mlibc_int64 __mlibc_int_fast16; +#define __MLIBC_INT_FAST16_C(x) __MLIBC_INT64_C(x) +#define __MLIBC_INT_FAST16_MAX __MLIBC_INT64_MAX +#define __MLIBC_INT_FAST16_MIN __MLIBC_INT64_MIN + +typedef __mlibc_int64 __mlibc_int_fast32; +#define __MLIBC_INT_FAST32_C(x) __MLIBC_INT64_C(x) +#define __MLIBC_INT_FAST32_MAX __MLIBC_INT64_MAX +#define __MLIBC_INT_FAST32_MIN __MLIBC_INT64_MIN + +typedef __mlibc_int64 __mlibc_int_fast64; +#define __MLIBC_INT_FAST64_C(x) __MLIBC_INT64_C(x) +#define __MLIBC_INT_FAST64_MAX __MLIBC_INT64_MAX +#define __MLIBC_INT_FAST64_MIN __MLIBC_INT64_MIN + +#elif defined (__aarch64__) + +typedef __mlibc_int8 __mlibc_int_fast8; +#define __MLIBC_INT_FAST8_C(x) __MLIBC_INT8_C(x) +#define __MLIBC_INT_FAST8_MAX __MLIBC_INT8_MAX +#define __MLIBC_INT_FAST8_MIN __MLIBC_INT8_MIN + +typedef __mlibc_int64 __mlibc_int_fast16; +#define __MLIBC_INT_FAST16_C(x) __MLIBC_INT64_C(x) +#define __MLIBC_INT_FAST16_MAX __MLIBC_INT64_MAX +#define __MLIBC_INT_FAST16_MIN __MLIBC_INT64_MIN + +typedef __mlibc_int64 __mlibc_int_fast32; +#define __MLIBC_INT_FAST32_C(x) __MLIBC_INT64_C(x) +#define __MLIBC_INT_FAST32_MAX __MLIBC_INT64_MAX +#define __MLIBC_INT_FAST32_MIN __MLIBC_INT64_MIN + +typedef __mlibc_int64 __mlibc_int_fast64; +#define __MLIBC_INT_FAST64_C(x) __MLIBC_INT64_C(x) +#define __MLIBC_INT_FAST64_MAX __MLIBC_INT64_MAX +#define __MLIBC_INT_FAST64_MIN __MLIBC_INT64_MIN + +#elif defined (__riscv) && __riscv_xlen == 64 + +typedef __mlibc_int8 __mlibc_int_fast8; +#define __MLIBC_INT_FAST8_C(x) __MLIBC_INT8_C(x) +#define __MLIBC_INT_FAST8_MAX __MLIBC_INT8_MAX +#define __MLIBC_INT_FAST8_MIN __MLIBC_INT8_MIN + +typedef __mlibc_int64 __mlibc_int_fast16; +#define __MLIBC_INT_FAST16_C(x) __MLIBC_INT64_C(x) +#define __MLIBC_INT_FAST16_MAX __MLIBC_INT64_MAX +#define __MLIBC_INT_FAST16_MIN __MLIBC_INT64_MIN + +typedef __mlibc_int64 __mlibc_int_fast32; +#define __MLIBC_INT_FAST32_C(x) __MLIBC_INT64_C(x) +#define __MLIBC_INT_FAST32_MAX __MLIBC_INT64_MAX +#define __MLIBC_INT_FAST32_MIN __MLIBC_INT64_MIN + +typedef __mlibc_int64 __mlibc_int_fast64; +#define __MLIBC_INT_FAST64_C(x) __MLIBC_INT64_C(x) +#define __MLIBC_INT_FAST64_MAX __MLIBC_INT64_MAX +#define __MLIBC_INT_FAST64_MIN __MLIBC_INT64_MIN + +#else +# error "Missing architecture specific code" +#endif + +// Fast types (unsigned). + +#if defined (__i386__) + +typedef __mlibc_uint8 __mlibc_uint_fast8; +#define __MLIBC_UINT_FAST8_C(x) __MLIBC_UINT8_C(x) +#define __MLIBC_UINT_FAST8_MAX __MLIBC_UINT8_MAX +#define __MLIBC_UINT_FAST8_MIN __MLIBC_UINT8_MIN + +typedef __mlibc_uint32 __mlibc_uint_fast16; +#define __MLIBC_UINT_FAST16_C(x) __MLIBC_UINT32_C(x) +#define __MLIBC_UINT_FAST16_MAX __MLIBC_UINT32_MAX +#define __MLIBC_UINT_FAST16_MIN __MLIBC_UINT32_MIN + +typedef __mlibc_uint32 __mlibc_uint_fast32; +#define __MLIBC_UINT_FAST32_C(x) __MLIBC_UINT32_C(x) +#define __MLIBC_UINT_FAST32_MAX __MLIBC_UINT32_MAX +#define __MLIBC_UINT_FAST32_MIN __MLIBC_UINT32_MIN + +typedef __mlibc_uint64 __mlibc_uint_fast64; +#define __MLIBC_UINT_FAST64_C(x) __MLIBC_UINT64_C(x) +#define __MLIBC_UINT_FAST64_MAX __MLIBC_UINT64_MAX +#define __MLIBC_UINT_FAST64_MIN __MLIBC_UINT64_MIN + +#elif defined (__x86_64__) + +typedef __mlibc_uint8 __mlibc_uint_fast8; +#define __MLIBC_UINT_FAST8_C(x) __MLIBC_UINT8_C(x) +#define __MLIBC_UINT_FAST8_MAX __MLIBC_UINT8_MAX +#define __MLIBC_UINT_FAST8_MIN __MLIBC_UINT8_MIN + +typedef __mlibc_uint64 __mlibc_uint_fast16; +#define __MLIBC_UINT_FAST16_C(x) __MLIBC_UINT64_C(x) +#define __MLIBC_UINT_FAST16_MAX __MLIBC_UINT64_MAX +#define __MLIBC_UINT_FAST16_MIN __MLIBC_UINT64_MIN + +typedef __mlibc_uint64 __mlibc_uint_fast32; +#define __MLIBC_UINT_FAST32_C(x) __MLIBC_UINT64_C(x) +#define __MLIBC_UINT_FAST32_MAX __MLIBC_UINT64_MAX +#define __MLIBC_UINT_FAST32_MIN __MLIBC_UINT64_MIN + +typedef __mlibc_uint64 __mlibc_uint_fast64; +#define __MLIBC_UINT_FAST64_C(x) __MLIBC_UINT64_C(x) +#define __MLIBC_UINT_FAST64_MAX __MLIBC_UINT64_MAX +#define __MLIBC_UINT_FAST64_MIN __MLIBC_UINT64_MIN + +#elif defined (__aarch64__) + +typedef __mlibc_uint8 __mlibc_uint_fast8; +#define __MLIBC_UINT_FAST8_C(x) __MLIBC_UINT8_C(x) +#define __MLIBC_UINT_FAST8_MAX __MLIBC_UINT8_MAX +#define __MLIBC_UINT_FAST8_MIN __MLIBC_UINT8_MIN + +typedef __mlibc_uint64 __mlibc_uint_fast16; +#define __MLIBC_UINT_FAST16_C(x) __MLIBC_UINT64_C(x) +#define __MLIBC_UINT_FAST16_MAX __MLIBC_UINT64_MAX +#define __MLIBC_UINT_FAST16_MIN __MLIBC_UINT64_MIN + +typedef __mlibc_uint64 __mlibc_uint_fast32; +#define __MLIBC_UINT_FAST32_C(x) __MLIBC_UINT64_C(x) +#define __MLIBC_UINT_FAST32_MAX __MLIBC_UINT64_MAX +#define __MLIBC_UINT_FAST32_MIN __MLIBC_UINT64_MIN + +typedef __mlibc_uint64 __mlibc_uint_fast64; +#define __MLIBC_UINT_FAST64_C(x) __MLIBC_UINT64_C(x) +#define __MLIBC_UINT_FAST64_MAX __MLIBC_UINT64_MAX +#define __MLIBC_UINT_FAST64_MIN __MLIBC_UINT64_MIN + +#elif defined (__riscv) && __riscv_xlen == 64 + +typedef __mlibc_uint8 __mlibc_uint_fast8; +#define __MLIBC_UINT_FAST8_C(x) __MLIBC_UINT8_C(x) +#define __MLIBC_UINT_FAST8_MAX __MLIBC_UINT8_MAX +#define __MLIBC_UINT_FAST8_MIN __MLIBC_UINT8_MIN + +typedef __mlibc_uint64 __mlibc_uint_fast16; +#define __MLIBC_UINT_FAST16_C(x) __MLIBC_UINT64_C(x) +#define __MLIBC_UINT_FAST16_MAX __MLIBC_UINT64_MAX +#define __MLIBC_UINT_FAST16_MIN __MLIBC_UINT64_MIN + +typedef __mlibc_uint64 __mlibc_uint_fast32; +#define __MLIBC_UINT_FAST32_C(x) __MLIBC_UINT64_C(x) +#define __MLIBC_UINT_FAST32_MAX __MLIBC_UINT64_MAX +#define __MLIBC_UINT_FAST32_MIN __MLIBC_UINT64_MIN + +typedef __mlibc_uint64 __mlibc_uint_fast64; +#define __MLIBC_UINT_FAST64_C(x) __MLIBC_UINT64_C(x) +#define __MLIBC_UINT_FAST64_MAX __MLIBC_UINT64_MAX +#define __MLIBC_UINT_FAST64_MIN __MLIBC_UINT64_MIN + +#else +# error "Missing architecture specific code" +#endif + +// Special types. + +typedef __INTMAX_TYPE__ __mlibc_intmax; +typedef __INTPTR_TYPE__ __mlibc_intptr; +typedef __PTRDIFF_TYPE__ __mlibc_ptrdiff; +#define __MLIBC_INTMAX_MAX __INTMAX_MAX__ +#define __MLIBC_INTMAX_MIN (-__INTMAX_MAX__ - 1) +#define __MLIBC_INTPTR_MAX __INTPTR_MAX__ +#define __MLIBC_INTPTR_MIN (-__INTPTR_MAX__ - 1) +#define __MLIBC_PTRDIFF_MAX __PTRDIFF_MAX__ +#define __MLIBC_PTRDIFF_MIN (-__PTRDIFF_MAX__ - 1) + +typedef __UINTMAX_TYPE__ __mlibc_uintmax; +typedef __UINTPTR_TYPE__ __mlibc_uintptr; +typedef __SIZE_TYPE__ __mlibc_size; +#define __MLIBC_UINTMAX_MAX __UINTMAX_MAX__ +#define __MLIBC_UINTPTR_MAX __UINTPTR_MAX__ +#define __MLIBC_SIZE_MAX __SIZE_MAX__ + +// Other limits. + +#define __MLIBC_WCHAR_MAX __WCHAR_MAX__ +#define __MLIBC_WCHAR_MIN __WCHAR_MIN__ + +#define __MLIBC_WINT_MAX __WINT_MAX__ +#define __MLIBC_WINT_MIN __WINT_MIN__ + +#define __MLIBC_SIG_ATOMIC_MAX __SIG_ATOMIC_MAX__ +#define __MLIBC_SIG_ATOMIC_MIN __SIG_ATOMIC_MIN__ + +// ---------------------------------------------------------------------------- +// Sanity checking. Make sure that we agree with the compiler's ABI. +// ---------------------------------------------------------------------------- + +#if defined(__cpp_static_assert) +# define __MLIBC_STATIC_ASSERT(c, text) static_assert(c, text) +#elif !defined(__cplusplus) +# define __MLIBC_STATIC_ASSERT(c, text) _Static_assert(c, text) +#else +# define __MLIBC_STATIC_ASSERT(c, text) +#endif + +#define __MLIBC_CHECK_TYPE(T1, T2) __MLIBC_STATIC_ASSERT(sizeof(T1) == sizeof(T2),\ + #T1 " != " #T2); + +// Least-width. +__MLIBC_CHECK_TYPE(__mlibc_int8, __INT_LEAST8_TYPE__); +__MLIBC_CHECK_TYPE(__mlibc_int16, __INT_LEAST16_TYPE__); +__MLIBC_CHECK_TYPE(__mlibc_int32, __INT_LEAST32_TYPE__); +__MLIBC_CHECK_TYPE(__mlibc_int64, __INT_LEAST64_TYPE__); + +__MLIBC_CHECK_TYPE(__mlibc_uint8, __UINT_LEAST8_TYPE__); +__MLIBC_CHECK_TYPE(__mlibc_uint16, __UINT_LEAST16_TYPE__); +__MLIBC_CHECK_TYPE(__mlibc_uint32, __UINT_LEAST32_TYPE__); +__MLIBC_CHECK_TYPE(__mlibc_uint64, __UINT_LEAST64_TYPE__); + +// Fast-width. +// Unfortunately, GCC and Clang disagree about fast types. +#ifndef __clang__ + __MLIBC_CHECK_TYPE(__mlibc_int_fast8, __INT_FAST8_TYPE__); + __MLIBC_CHECK_TYPE(__mlibc_int_fast16, __INT_FAST16_TYPE__); + __MLIBC_CHECK_TYPE(__mlibc_int_fast32, __INT_FAST32_TYPE__); + __MLIBC_CHECK_TYPE(__mlibc_int_fast64, __INT_FAST64_TYPE__); + + __MLIBC_CHECK_TYPE(__mlibc_uint_fast8, __UINT_FAST8_TYPE__); + __MLIBC_CHECK_TYPE(__mlibc_uint_fast16, __UINT_FAST16_TYPE__); + __MLIBC_CHECK_TYPE(__mlibc_uint_fast32, __UINT_FAST32_TYPE__); + __MLIBC_CHECK_TYPE(__mlibc_uint_fast64, __UINT_FAST64_TYPE__); +#endif + +#endif // _MLIBC_INTERNAL_TYPES_H diff --git a/lib/mlibc/options/internal/include/bits/wchar.h b/lib/mlibc/options/internal/include/bits/wchar.h new file mode 100644 index 0000000..a422ef7 --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/wchar.h @@ -0,0 +1,9 @@ +#ifndef MLIBC_WCHAR_H +#define MLIBC_WCHAR_H + +#include <bits/types.h> + +#define WCHAR_MAX __MLIBC_WCHAR_MAX +#define WCHAR_MIN __MLIBC_WCHAR_MIN + +#endif // MLIBC_WCHAR_H diff --git a/lib/mlibc/options/internal/include/bits/wchar_t.h b/lib/mlibc/options/internal/include/bits/wchar_t.h new file mode 100644 index 0000000..4eb4e9c --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/wchar_t.h @@ -0,0 +1,12 @@ + +#ifndef MLIBC_WCHAR_T_H +#define MLIBC_WCHAR_T_H + +#ifndef __cplusplus + +typedef __WCHAR_TYPE__ wchar_t; + +#endif + +#endif // MLIBC_WCHAR_T_H + diff --git a/lib/mlibc/options/internal/include/bits/winsize.h b/lib/mlibc/options/internal/include/bits/winsize.h new file mode 100644 index 0000000..7b3006a --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/winsize.h @@ -0,0 +1,13 @@ + +#ifndef MLIBC_WINSIZE_H +#define MLIBC_WINSIZE_H + +struct winsize { + unsigned short ws_row; + unsigned short ws_col; + unsigned short ws_xpixel; + unsigned short ws_ypixel; +}; + +#endif // MLIBC_WINSIZE_H + diff --git a/lib/mlibc/options/internal/include/bits/wint_t.h b/lib/mlibc/options/internal/include/bits/wint_t.h new file mode 100644 index 0000000..b4f57bf --- /dev/null +++ b/lib/mlibc/options/internal/include/bits/wint_t.h @@ -0,0 +1,6 @@ +#ifndef MLIBC_WINT_T_H +#define MLIBC_WINT_T_H + +typedef __WINT_TYPE__ wint_t; + +#endif // MLIBC_WINT_T_H diff --git a/lib/mlibc/options/internal/include/mlibc/all-sysdeps.hpp b/lib/mlibc/options/internal/include/mlibc/all-sysdeps.hpp new file mode 100644 index 0000000..7189286 --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/all-sysdeps.hpp @@ -0,0 +1,33 @@ +#ifndef MLIBC_ALL_SYSDEPS +#define MLIBC_ALL_SYSDEPS + +#include <mlibc-config.h> +#include <internal-config.h> + +#if __MLIBC_ANSI_OPTION +# include <mlibc/ansi-sysdeps.hpp> +#endif /* __MLIBC_ANSI_OPTION */ + +#if __MLIBC_POSIX_OPTION +# include <mlibc/posix-sysdeps.hpp> +#endif /* __MLIBC_POSIX_OPTION */ + +#if __MLIBC_LINUX_OPTION +# include <mlibc/linux-sysdeps.hpp> +#endif /* __MLIBC_LINUX_OPTION */ + +#if __MLIBC_GLIBC_OPTION +# include <mlibc/glibc-sysdeps.hpp> +#endif /* __MLIBC_GLIBC_OPTION */ + +#if __MLIBC_BSD_OPTION +# include <mlibc/bsd-sysdeps.hpp> +#endif /* __MLIBC_BSD_OPTION */ + +#if MLIBC_BUILDING_RTDL +# include <mlibc/rtdl-sysdeps.hpp> +#endif /* MLIBC_BUILDING_RTDL */ + +#include <mlibc/internal-sysdeps.hpp> + +#endif /* MLIBC_ALL_SYSDEPS */ diff --git a/lib/mlibc/options/internal/include/mlibc/allocator.hpp b/lib/mlibc/options/internal/include/mlibc/allocator.hpp new file mode 100644 index 0000000..5f9617e --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/allocator.hpp @@ -0,0 +1,37 @@ +#ifndef MLIBC_FRIGG_ALLOC +#define MLIBC_FRIGG_ALLOC + +#include <mlibc/lock.hpp> +#include <bits/ensure.h> +#include <frg/slab.hpp> +#include <internal-config.h> + +#if !MLIBC_DEBUG_ALLOCATOR + +struct VirtualAllocator { +public: + uintptr_t map(size_t length); + + void unmap(uintptr_t address, size_t length); +}; + +typedef frg::slab_pool<VirtualAllocator, FutexLock> MemoryPool; + +typedef frg::slab_allocator<VirtualAllocator, FutexLock> MemoryAllocator; + +MemoryAllocator &getAllocator(); + +#else + +struct MemoryAllocator { + void *allocate(size_t size); + void free(void *ptr); + void deallocate(void *ptr, size_t size); + void *reallocate(void *ptr, size_t size); +}; + +MemoryAllocator &getAllocator(); + +#endif // !MLIBC_DEBUG_ALLOCATOR + +#endif // MLIBC_FRIGG_ALLOC diff --git a/lib/mlibc/options/internal/include/mlibc/bitutil.hpp b/lib/mlibc/options/internal/include/mlibc/bitutil.hpp new file mode 100644 index 0000000..6d2b25e --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/bitutil.hpp @@ -0,0 +1,34 @@ +#ifndef MLIBC_BITUTIL +#define MLIBC_BITUTIL + +#include <stdint.h> + +namespace mlibc { + +template<typename T> +struct bit_util; + +template<> +struct bit_util<uint64_t> { + static uint64_t byteswap(uint64_t x) { + return __builtin_bswap64(x); + } +}; + +template<> +struct bit_util<uint32_t> { + static uint32_t byteswap(uint32_t x) { + return __builtin_bswap32(x); + } +}; + +template<> +struct bit_util<uint16_t> { + static uint16_t byteswap(uint16_t x) { + return __builtin_bswap16(x); + } +}; + +} // namespace mlibc + +#endif // MLIBC_BITUTIL diff --git a/lib/mlibc/options/internal/include/mlibc/charcode.hpp b/lib/mlibc/options/internal/include/mlibc/charcode.hpp new file mode 100644 index 0000000..67bd03d --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/charcode.hpp @@ -0,0 +1,124 @@ +#ifndef MLIBC_CHARCODE_HPP +#define MLIBC_CHARCODE_HPP + +#include <stddef.h> +#include <stdint.h> +#include <bits/ensure.h> +#include <bits/mbstate.h> +#include <mlibc/debug.hpp> + +namespace mlibc { + +enum class charcode_error { + null, + dirty, + illegal_input, + input_underflow, + output_overflow +}; + +template<typename C> +struct code_seq { + C *it; + const C *end; + + explicit operator bool () { + return it != end; + } +}; + +// Some encodings (e.g. the one defined in RFC 1843) have "shift states", +// i.e. escape sequences that switch between different encodings (e.g. between single-byte ASCII +// and 2-byte encoding of Chinese characters). +// TODO: Implement that using the __shift member of __mlibc_mbstate. + +typedef uint32_t codepoint; + +// The following class deals with decoding/encoding "code units" (of type char) +// to "code points" that are defined by unicode (of type codepoint). +// It also offers convenience functions to transcode to wchar_t, char16_t and char32_t. +// We assume that the encoding of wchar_t (and char16_t, char32_t) is fixed. +// char is allowed to have an arbitrary encoding. +// TODO: char16_t and char32_t variants are missing. +// TODO: For iconv(), first decode and then encode to the destination encoding. +struct polymorphic_charcode { + virtual ~polymorphic_charcode(); + + // Helper function to decode a single char. + charcode_error promote(char nc, codepoint &wc) { + auto uc = static_cast<unsigned char>(nc); + if(uc <= 0x7F && preserves_7bit_units) { + wc = uc; + return charcode_error::null; + } + + code_seq<const char> nseq{&nc, &nc + 1}; + code_seq<codepoint> wseq{&wc, &wc + 1}; + __mlibc_mbstate st = __MLIBC_MBSTATE_INITIALIZER; + + if(auto e = decode(nseq, wseq, st); e != charcode_error::null) + return e; + // This should have read/written exactly one code unit/code point. + __ensure(nseq.it == nseq.end); + __ensure(wseq.it == wseq.end); + return charcode_error::null; + } + + // Helper function to decode a single char. + charcode_error promote_wtranscode(char nc, wchar_t &wc) { + auto uc = static_cast<unsigned char>(nc); + if(uc <= 0x7F && preserves_7bit_units) { // TODO: Use "wtranscode_preserves_7bit_units". + wc = uc; + return charcode_error::null; + } + + code_seq<const char> nseq{&nc, &nc + 1}; + code_seq<wchar_t> wseq{&wc, &wc + 1}; + __mlibc_mbstate st = __MLIBC_MBSTATE_INITIALIZER; + + if(auto e = decode_wtranscode(nseq, wseq, st); e != charcode_error::null) + return e; + // This should have read/written exactly one code unit/code point. + __ensure(nseq.it == nseq.end); + __ensure(wseq.it == wseq.end); + return charcode_error::null; + } + + polymorphic_charcode(bool preserves_7bit_units_, bool has_shift_states_) + : preserves_7bit_units{preserves_7bit_units_}, has_shift_states{has_shift_states_} { } + + virtual charcode_error decode(code_seq<const char> &nseq, code_seq<codepoint> &wseq, + __mlibc_mbstate &st) = 0; + + virtual charcode_error decode_wtranscode(code_seq<const char> &nseq, code_seq<wchar_t> &wseq, + __mlibc_mbstate &st) = 0; + + virtual charcode_error decode_wtranscode_length(code_seq<const char> &nseq, size_t *n, + __mlibc_mbstate &st) = 0; + + virtual charcode_error encode_wtranscode(code_seq<char> &nseq, code_seq<const wchar_t> &wseq, + __mlibc_mbstate &st) = 0; + + virtual charcode_error encode_wtranscode_length(code_seq<const wchar_t> &wseq, size_t *n, + __mlibc_mbstate &st) = 0; + + // True if promotion only zero-extends units below 0x7F. + const bool preserves_7bit_units; + + // Whether the encoding has shift states. + const bool has_shift_states; +}; + +polymorphic_charcode *current_charcode(); + +// Similar to polymorphic_charcode but for wchar_t. Note that this encoding is fixed per-platform; +// thus, it does not need to be polymorphic. +struct wide_charcode { + charcode_error promote(wchar_t nc, codepoint &wc); +}; + +wide_charcode *platform_wide_charcode(); + +} // namespace mlibc + +#endif // MLIBC_CHARCODE_HPP diff --git a/lib/mlibc/options/internal/include/mlibc/charset.hpp b/lib/mlibc/options/internal/include/mlibc/charset.hpp new file mode 100644 index 0000000..a068f05 --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/charset.hpp @@ -0,0 +1,40 @@ +#ifndef MLIBC_CHARSET_HPP +#define MLIBC_CHARSET_HPP + +#include <mlibc/charcode.hpp> + +namespace mlibc { + +// Represents the charset of a certain locale. We define the charset as +// a set of characters, together with their properties and conversion rules +// *but not* their encoding (e.g. to UTF-8 or UTF-16). +struct charset { + // Returns true iif the meaning of the first 0x7F characters matches ASCII. + bool is_ascii_superset(); + + bool is_alpha(codepoint c); + bool is_digit(codepoint c); + bool is_xdigit(codepoint c); + bool is_alnum(codepoint c); + bool is_punct(codepoint c); + bool is_graph(codepoint c); + bool is_blank(codepoint c); + bool is_space(codepoint c); + bool is_print(codepoint c); + + bool is_lower(codepoint c); + bool is_upper(codepoint c); + codepoint to_lower(codepoint c); + codepoint to_upper(codepoint c); +}; + +charset *current_charset(); + +// The property if a character is a control character is locale-independent. +inline bool generic_is_control(codepoint c) { + return (c <= 0x1F) || (c == 0x7F) || (c >= 0x80 && c <= 0x9F); +} + +} // namespace mlibc + +#endif // MLIBC_CHARSET_HPP diff --git a/lib/mlibc/options/internal/include/mlibc/debug.hpp b/lib/mlibc/options/internal/include/mlibc/debug.hpp new file mode 100644 index 0000000..7067039 --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/debug.hpp @@ -0,0 +1,27 @@ +#ifndef MLIBC_DEBUG_HPP +#define MLIBC_DEBUG_HPP + +#include <frg/logging.hpp> + +namespace mlibc { + +struct InfoSink { + // constexpr so that this can be initialized statically. + constexpr InfoSink() = default; + + void operator() (const char *message); +}; + +struct PanicSink { + // constexpr so that this can be initialized statically. + constexpr PanicSink() = default; + + void operator() (const char *message); +}; + +extern frg::stack_buffer_logger<InfoSink, 512> infoLogger; +extern frg::stack_buffer_logger<PanicSink, 512> panicLogger; + +} // namespace mlibc + +#endif // MLIBC_DEBUG_HPP diff --git a/lib/mlibc/options/internal/include/mlibc/file-window.hpp b/lib/mlibc/options/internal/include/mlibc/file-window.hpp new file mode 100644 index 0000000..68c3ebf --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/file-window.hpp @@ -0,0 +1,64 @@ +#ifndef MLIBC_FILE_WINDOW +#define MLIBC_FILE_WINDOW + +#include <abi-bits/fcntl.h> +#include <mlibc/allocator.hpp> +#include <mlibc/debug.hpp> +#include <mlibc/internal-sysdeps.hpp> +#include <internal-config.h> + +struct file_window { + file_window(const char *path) { + int fd; + if(mlibc::sys_open("/etc/localtime", O_RDONLY, 0, &fd)) + mlibc::panicLogger() << "mlibc: Error opening file_window to " + << path << frg::endlog; + + if(!mlibc::sys_stat) { + MLIBC_MISSING_SYSDEP(); + __ensure(!"cannot proceed without sys_stat"); + } + struct stat info; + if(mlibc::sys_stat(mlibc::fsfd_target::fd, fd, "", 0, &info)) + mlibc::panicLogger() << "mlibc: Error getting TZinfo stats" << frg::endlog; + +#if MLIBC_MAP_FILE_WINDOWS + if(mlibc::sys_vm_map(nullptr, (size_t)info.st_size, PROT_READ, MAP_PRIVATE, + fd, 0, &_ptr)) + mlibc::panicLogger() << "mlibc: Error mapping TZinfo" << frg::endlog; +#else + _ptr = getAllocator().allocate(info.st_size); + __ensure(_ptr); + + size_t progress = 0; + size_t st_size = static_cast<size_t>(info.st_size); + while(progress < st_size) { + ssize_t chunk; + if(int e = mlibc::sys_read(fd, reinterpret_cast<char *>(_ptr) + progress, + st_size - progress, &chunk); e) + mlibc::panicLogger() << "mlibc: Read from file_window failed" << frg::endlog; + if(!chunk) + break; + progress += chunk; + } + if(progress != st_size) + mlibc::panicLogger() << "stat reports " << info.st_size << " but we only read " + << progress << " bytes" << frg::endlog; +#endif + + if(mlibc::sys_close(fd)) + mlibc::panicLogger() << "mlibc: Error closing TZinfo" << frg::endlog; + } + + // TODO: Write destructor to deallocate/unmap memory. + + void *get() { + return _ptr; + } + +private: + void *_ptr; +}; + +#endif // MLIBC_FILE_WINDOW + diff --git a/lib/mlibc/options/internal/include/mlibc/fsfd_target.hpp b/lib/mlibc/options/internal/include/mlibc/fsfd_target.hpp new file mode 100644 index 0000000..b577325 --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/fsfd_target.hpp @@ -0,0 +1,15 @@ +#ifndef MLIBC_FSFD_TARGET +#define MLIBC_FSFD_TARGET + +namespace mlibc { + +enum class fsfd_target { + none, + path, + fd, + fd_path +}; + +} // namespace mlibc + +#endif // MLIBC_FSFD_TARGET diff --git a/lib/mlibc/options/internal/include/mlibc/global-config.hpp b/lib/mlibc/options/internal/include/mlibc/global-config.hpp new file mode 100644 index 0000000..7eaed3c --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/global-config.hpp @@ -0,0 +1,19 @@ +#ifndef MLIBC_GLOBAL_CONFIG +#define MLIBC_GLOBAL_CONFIG + +namespace mlibc { + +struct GlobalConfig { + GlobalConfig(); + + bool debugMalloc; +}; + +inline const GlobalConfig &globalConfig() { + static GlobalConfig cached; + return cached; +} + +} + +#endif // MLIBC_GLOBAL_CONFIG diff --git a/lib/mlibc/options/internal/include/mlibc/internal-sysdeps.hpp b/lib/mlibc/options/internal/include/mlibc/internal-sysdeps.hpp new file mode 100644 index 0000000..02df713 --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/internal-sysdeps.hpp @@ -0,0 +1,41 @@ +#ifndef MLIBC_INTERNAL_SYSDEPS +#define MLIBC_INTERNAL_SYSDEPS + +#include <stddef.h> + +#include <abi-bits/seek-whence.h> +#include <abi-bits/vm-flags.h> +#include <bits/off_t.h> +#include <bits/ssize_t.h> +#include <abi-bits/stat.h> +#include <mlibc/fsfd_target.hpp> + +namespace [[gnu::visibility("hidden")]] mlibc { + +void sys_libc_log(const char *message); +[[noreturn]] void sys_libc_panic(); + +int sys_tcb_set(void *pointer); + +[[gnu::weak]] int sys_futex_tid(); +int sys_futex_wait(int *pointer, int expected, const struct timespec *time); +int sys_futex_wake(int *pointer); + +int sys_anon_allocate(size_t size, void **pointer); +int sys_anon_free(void *pointer, size_t size); + +int sys_open(const char *pathname, int flags, mode_t mode, int *fd); +int sys_read(int fd, void *buf, size_t count, ssize_t *bytes_read); +int sys_seek(int fd, off_t offset, int whence, off_t *new_offset); +int sys_close(int fd); + +[[gnu::weak]] int sys_stat(fsfd_target fsfdt, int fd, const char *path, int flags, + struct stat *statbuf); +// mlibc assumes that anonymous memory returned by sys_vm_map() is zeroed by the kernel / whatever is behind the sysdeps +int sys_vm_map(void *hint, size_t size, int prot, int flags, int fd, off_t offset, void **window); +int sys_vm_unmap(void *pointer, size_t size); +[[gnu::weak]] int sys_vm_protect(void *pointer, size_t size, int prot); + +} //namespace mlibc + +#endif // MLIBC_INTERNAL_SYSDEPS diff --git a/lib/mlibc/options/internal/include/mlibc/locale.hpp b/lib/mlibc/options/internal/include/mlibc/locale.hpp new file mode 100644 index 0000000..a46a2c3 --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/locale.hpp @@ -0,0 +1,12 @@ +#ifndef MLIBC_LOCALE +#define MLIBC_LOCALE + +#include <bits/nl_item.h> + +namespace mlibc { + +char *nl_langinfo(nl_item item); + +} // namespace mlibc + +#endif // MLIBC_LOCALE diff --git a/lib/mlibc/options/internal/include/mlibc/lock.hpp b/lib/mlibc/options/internal/include/mlibc/lock.hpp new file mode 100644 index 0000000..aa05079 --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/lock.hpp @@ -0,0 +1,124 @@ +#ifndef MLIBC_LOCK_HPP +#define MLIBC_LOCK_HPP + +#include <errno.h> +#include <stdint.h> +#include <mlibc/internal-sysdeps.hpp> +#include <mlibc/debug.hpp> +#include <mlibc/tid.hpp> +#include <bits/ensure.h> + +template<bool Recursive> +struct FutexLockImpl { + FutexLockImpl() : _state{0}, _recursion{0} { } + + FutexLockImpl(const FutexLockImpl &) = delete; + + FutexLockImpl &operator= (const FutexLockImpl &) = delete; + + static constexpr uint32_t waitersBit = (1 << 31); + static constexpr uint32_t ownerMask = (static_cast<uint32_t>(1) << 30) - 1; + + void lock() { + unsigned int this_tid = mlibc::this_tid(); + unsigned int expected = 0; + + while(true) { + if(!expected) { + // Try to take the mutex here. + if(__atomic_compare_exchange_n(&_state, + &expected, this_tid, false, __ATOMIC_ACQUIRE, __ATOMIC_ACQUIRE)) { + if constexpr (Recursive) { + __ensure(!_recursion); + _recursion = 1; + } + return; + } + }else{ + // If this (recursive) mutex is already owned by us, increment the recursion level. + if((expected & ownerMask) == this_tid) { + if constexpr (Recursive) + ++_recursion; + else + mlibc::panicLogger() << "mlibc: FutexLock deadlock detected!" << frg::endlog; + return; + } + + // Wait on the futex if the waiters flag is set. + if(expected & waitersBit) { + int e = mlibc::sys_futex_wait((int *)&_state, expected, nullptr); + + // If the wait returns EAGAIN, that means that the waitersBit was just unset by + // some other thread. In this case, we should loop back around. + if (e && e != EAGAIN) + mlibc::panicLogger() << "sys_futex_wait() failed with error code " << e << frg::endlog; + + // Opportunistically try to take the lock after we wake up. + expected = 0; + }else{ + // Otherwise we have to set the waiters flag first. + unsigned int desired = expected | waitersBit; + if(__atomic_compare_exchange_n((int *)&_state, + reinterpret_cast<int*>(&expected), desired, false, __ATOMIC_RELAXED, __ATOMIC_RELAXED)) + expected = desired; + } + } + } + } + + bool try_lock() { + unsigned int this_tid = mlibc::this_tid(); + unsigned int expected = __atomic_load_n(&_state, __ATOMIC_RELAXED); + + if(!expected) { + // Try to take the mutex here. + if(__atomic_compare_exchange_n(&_state, + &expected, this_tid, false, __ATOMIC_ACQUIRE, __ATOMIC_ACQUIRE)) { + if constexpr (Recursive) + _recursion = 1; + return true; + } + } else { + // If this (recursive) mutex is already owned by us, increment the recursion level. + if((expected & ownerMask) == this_tid) { + if constexpr (Recursive) { + __ensure(!_recursion); + ++_recursion; + return true; + } else { + return false; + } + } + } + + return false; + } + + void unlock() { + // Decrement the recursion level and unlock if we hit zero. + if constexpr (Recursive) { + __ensure(_recursion); + if(--_recursion) + return; + } + + // Reset the mutex to the unlocked state. + auto state = __atomic_exchange_n(&_state, 0, __ATOMIC_RELEASE); + __ensure((state & ownerMask) == mlibc::this_tid()); + + if(state & waitersBit) { + // Wake the futex if there were waiters. Since the mutex might not exist at this location + // anymore, we must conservatively ignore EACCES and EINVAL which may occur as a result. + int e = mlibc::sys_futex_wake((int *)&_state); + __ensure(e >= 0 || e == EACCES || e == EINVAL); + } + } +private: + uint32_t _state; + uint32_t _recursion; +}; + +using FutexLock = FutexLockImpl<false>; +using RecursiveFutexLock = FutexLockImpl<true>; + +#endif diff --git a/lib/mlibc/options/internal/include/mlibc/stack_protector.hpp b/lib/mlibc/options/internal/include/mlibc/stack_protector.hpp new file mode 100644 index 0000000..47290fc --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/stack_protector.hpp @@ -0,0 +1,10 @@ +#ifndef MLIBC_STACK_PROTECTOR_HPP +#define MLIBC_STACK_PROTECTOR_HPP + +namespace mlibc { + +void initStackGuard(void *); + +} // namespace mlibc + +#endif // MLIBC_STACK_PROTECTOR_HPP diff --git a/lib/mlibc/options/internal/include/mlibc/strings.hpp b/lib/mlibc/options/internal/include/mlibc/strings.hpp new file mode 100644 index 0000000..5a93c7c --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/strings.hpp @@ -0,0 +1,12 @@ +#ifndef MLIBC_STRINGS +#define MLIBC_STRINGS + +#include <bits/size_t.h> + +namespace mlibc { + +int strncasecmp(const char *a, const char *b, size_t size); + +} // namespace mlibc + +#endif // MLIBC_STRINGS diff --git a/lib/mlibc/options/internal/include/mlibc/strtofp.hpp b/lib/mlibc/options/internal/include/mlibc/strtofp.hpp new file mode 100644 index 0000000..f9c5e20 --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/strtofp.hpp @@ -0,0 +1,165 @@ +#ifndef MLIBC_STRTOFP_HPP +#define MLIBC_STRTOFP_HPP + +#include <string.h> +#include <bits/ensure.h> +#include <type_traits> + +namespace mlibc { + +template<typename T> +T strtofp(const char *str, char **endptr) { + if (strcmp(str, "INF") == 0 || strcmp(str, "inf") == 0) { + if (endptr) + *endptr = (char *)str + 3; + if constexpr (std::is_same_v<T, float>) + return __builtin_inff(); + else if constexpr (std::is_same_v<T, double>) + return __builtin_inf(); + else + return __builtin_infl(); + } else if (strcmp(str, "INFINITY") == 0 || strcmp(str, "infinity") == 0) { + if (endptr) + *endptr = (char *)str + 8; + if constexpr (std::is_same_v<T, float>) + return __builtin_inff(); + else if constexpr (std::is_same_v<T, double>) + return __builtin_inf(); + else + return __builtin_infl(); + } else if (strncmp(str, "NAN", 3) == 0 || strncmp(str, "nan", 3) == 0) { + if (endptr) + *endptr = (char *)str + 3; + if constexpr (std::is_same_v<T, float>) + return __builtin_nanf(""); + else if constexpr (std::is_same_v<T, double>) + return __builtin_nan(""); + else + return __builtin_nanl(""); + } + + bool negative = *str == '-'; + if (*str == '+' || *str == '-') + str++; + + bool hex = false; + if (*str == '0' && (*(str + 1) == 'x' || *(str + 1) == 'X')) { + str += 2; + hex = true; + } + + T result = static_cast<T>(0); + + const char *tmp = str; + + if (!hex) { + while (true) { + if (!isdigit(*tmp)) + break; + result *= static_cast<T>(10); + result += static_cast<T>(*tmp - '0'); + tmp++; + } + } else { + while (true) { + if (!isxdigit(*tmp)) + break; + result *= static_cast<T>(16); + result += static_cast<T>(*tmp <= '9' ? (*tmp - '0') : (tolower(*tmp) - 'a' + 10)); + tmp++; + } + } + + if (*tmp == '.') { + tmp++; + + if (!hex) { + T d = static_cast<T>(10); + + while (true) { + if (!isdigit(*tmp)) + break; + result += static_cast<T>(*tmp - '0') / d; + d *= static_cast<T>(10); + tmp++; + } + } else { + T d = static_cast<T>(16); + + while (true) { + if (!isxdigit(*tmp)) + break; + result += static_cast<T>(*tmp <= '9' ? (*tmp - '0') : (tolower(*tmp) - 'a' + 10)) / d; + d *= static_cast<T>(16); + tmp++; + } + } + } + + if (!hex) { + if (*tmp == 'e' || *tmp == 'E') { + tmp++; + + bool exp_negative = *tmp == '-'; + if (*tmp == '+' || *tmp == '-') + tmp++; + + int exp = 0; + while (true) { + if (!isdigit(*tmp)) + break; + exp *= 10; + exp += *tmp - '0'; + tmp++; + } + + if (!exp_negative) { + for (int i = 0; i < exp; ++i) { + result *= static_cast<T>(10); + } + } else { + for (int i = 0; i < exp; ++i) { + result /= static_cast<T>(10); + } + } + } + } else { + if (*tmp == 'p' || *tmp == 'P') { + tmp++; + + bool exp_negative = *tmp == '-'; + if (*tmp == '+' || *tmp == '-') + tmp++; + + int exp = 0; + while (true) { + if (!isdigit(*tmp)) + break; + exp *= 10; + exp += *tmp - '0'; + tmp++; + } + + if (!exp_negative) { + for (int i = 0; i < exp; ++i) { + result *= static_cast<T>(2); + } + } else { + for (int i = 0; i < exp; ++i) { + result /= static_cast<T>(2); + } + } + } + } + + if (endptr) + *endptr = const_cast<char *>(tmp); + if (negative) + result = -result; + + return result; +} + +} + +#endif // MLIBC_STRTOFP_HPP diff --git a/lib/mlibc/options/internal/include/mlibc/strtol.hpp b/lib/mlibc/options/internal/include/mlibc/strtol.hpp new file mode 100644 index 0000000..3b8fca9 --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/strtol.hpp @@ -0,0 +1,159 @@ +#ifndef MLIBC_STRTOL_HPP +#define MLIBC_STRTOL_HPP + +#include <type_traits> +#include <ctype.h> +#include <wctype.h> +#include <limits.h> + +namespace mlibc { + +template<typename T> struct int_limits {}; + +template<> +struct int_limits<long> { + static long max() { return LONG_MAX; } + static long min() { return LONG_MIN; } +}; + +template<> +struct int_limits<unsigned long> { + static unsigned long max() { return ULONG_MAX; } + static unsigned long min() { return 0; } +}; + +template<> +struct int_limits<long long> { + static long long max() { return LLONG_MAX; } + static long long min() { return LLONG_MIN; } +}; + +template<> +struct int_limits<unsigned long long> { + static unsigned long long max() { return ULLONG_MAX; } + static unsigned long long min() { return 0; } +}; + +template<typename T> struct char_detail {}; + +template<> +struct char_detail<char> { + static bool isSpace(char c) { return isspace(c); } + static bool isDigit(char c) { return isdigit(c); } + static bool isHexDigit(char c) { return isxdigit(c); } + static bool isLower(char c) { return islower(c); } + static bool isUpper(char c) { return isupper(c); } +}; + +template<> +struct char_detail<wchar_t> { + static bool isSpace(wchar_t c) { return iswspace(c); } + static bool isDigit(wchar_t c) { return iswdigit(c); } + static bool isHexDigit(wchar_t c) { return iswxdigit(c); } + static bool isLower(wchar_t c) { return iswlower(c); } + static bool isUpper(wchar_t c) { return iswupper(c); } +}; + +template<typename Char> Char widen(char c) { return static_cast<Char>(c); } + +template<typename Return, typename Char> +Return stringToInteger(const Char *__restrict nptr, Char **__restrict endptr, int baseInt) { + using UnsignedReturn = std::make_unsigned_t<Return>; + + auto base = static_cast<Return>(baseInt); + auto s = nptr; + + if (base < 0 || base == 1) { + if (endptr) + *endptr = const_cast<Char *>(nptr); + return 0; + } + + while (char_detail<Char>::isSpace(*s)) + s++; + + bool negative = false; + if (*s == widen<Char>('-')) { + negative = true; + s++; + } else if (*s == widen<Char>('+')) { + s++; + } + + + bool hasOctalPrefix = s[0] == widen<Char>('0'); + bool hasHexPrefix = hasOctalPrefix && (s[1] == widen<Char>('x') || s[1] == widen<Char>('X')); + + // There's two tricky cases we need to keep in mind here: + // 1. We should interpret "0x5" as hex 5 rather than octal 0. + // 2. We should interpret "0x" as octal 0 (and set endptr correctly). + // To deal with 2, we check the charcacter following the hex prefix. + if ((base == 0 || base == 16) && hasHexPrefix && char_detail<Char>::isHexDigit(s[2])) { + s += 2; + base = 16; + } else if ((base == 0 || base == 8) && hasOctalPrefix) { + base = 8; + } else if (base == 0) { + base = 10; + } + + // Compute the range of acceptable values. + UnsignedReturn cutoff, cutlim; + if (std::is_unsigned_v<Return>) { + cutoff = int_limits<Return>::max() / base; + cutlim = int_limits<Return>::max() % base; + } else { + Return co = negative ? int_limits<Return>::min() : int_limits<Return>::max(); + cutlim = negative ? -(co % base) : co % base; + co /= negative ? -base : base; + cutoff = co; + } + + UnsignedReturn totalValue = 0; + bool convertedAny = false; + bool outOfRange = false; + for (Char c = *s; c != widen<Char>('\0'); c = *++s) { + UnsignedReturn digitValue; + if (char_detail<Char>::isDigit(c)) + digitValue = c - widen<Char>('0'); + else if (char_detail<Char>::isUpper(c)) + digitValue = c - widen<Char>('A') + 10; + else if (char_detail<Char>::isLower(c)) + digitValue = c - widen<Char>('a') + 10; + else + break; + + if (digitValue >= static_cast<UnsignedReturn>(base)) + break; + + if (outOfRange) { + // The value is already known to be out of range, but we need to keep + // consuming characters until we can't (to set endptr correctly). + } else if (totalValue > cutoff || (totalValue == cutoff && digitValue > cutlim)) { + // The value will be out of range if we accumulate digitValue. + outOfRange = true; + } else { + totalValue = (totalValue * base) + digitValue; + convertedAny = true; + } + } + + if (endptr) + *endptr = const_cast<Char *>(convertedAny ? s : nptr); + + if (outOfRange) { + errno = ERANGE; + + if (std::is_unsigned_v<Return>) { + return int_limits<Return>::max(); + } else { + return negative ? int_limits<Return>::min() : int_limits<Return>::max(); + } + } + + return negative ? -totalValue : totalValue; +} + +} + +#endif // MLIBC_STRTOL_HPP diff --git a/lib/mlibc/options/internal/include/mlibc/tcb.hpp b/lib/mlibc/options/internal/include/mlibc/tcb.hpp new file mode 100644 index 0000000..92aad7a --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/tcb.hpp @@ -0,0 +1,180 @@ +#pragma once + +#include <stdint.h> +#include <limits.h> +#include <bits/size_t.h> +#include <frg/array.hpp> + +#include "elf.hpp" + +/* + * Explanation of cancellation bits: + * + * tcbCancelEnableBit and tcbCancelAsyncBit should be self-explanatory, + * they are set if cancellation is enabled, or asynchronous, respectively. + * + * tcbCancelTriggerBit is set whenever a cancellation is triggered, which is + * in pthread_cancel() or in the signal handler. This bit is used by + * pthread_testcancel() to check whether a cancellation has been requested, + * and also by cancellable syscalls. + * + * tcbCancelingBit is set when a cancellation is currently being handled. This + * is to avoid a situation in which a cancellation handler gets interrupted by + * a SIGCANCEL and a second cancellation handler gets executed on top of the + * previous one. Right now this cannot happen, since we stay in signal handler + * context when canceling/exiting. In the future this might be done outside + * of a signal handler, in which case we shouldn't restart the cancellation process. + * + * tcbExitingBit is set when the thread starts the exit procedure. Currently + * this is just an exit, but in the future this will be a stack unwinding + * procedure, which shouldn't be reentered. Not currently set anywhere, + * may be done so in the future. + * + * TODO(geert): update this comment when we do unwinding in the exit procedure. + */ + +namespace { + // Set when the cancellation is enabled + constexpr unsigned int tcbCancelEnableBit = 1 << 0; + // 1 - cancellation is asynchronous, 0 - cancellation is deferred + constexpr unsigned int tcbCancelAsyncBit = 1 << 1; + // Set when the thread has been cancelled + constexpr unsigned int tcbCancelTriggerBit = 1 << 2; + // Set when the thread is in the process of being cancelled. + constexpr unsigned int tcbCancelingBit = 1 << 3; + // Set when the thread is exiting. + constexpr unsigned int tcbExitingBit = 1 << 4; +} + +namespace mlibc { + // Returns true when bitmask indicates thread has been asynchronously + // cancelled. + static constexpr bool tcb_async_cancelled(int value) { + return (value & (tcbCancelEnableBit | tcbCancelAsyncBit + | tcbCancelTriggerBit)) == (tcbCancelEnableBit + | tcbCancelAsyncBit | tcbCancelTriggerBit); + } + + // Returns true when bitmask indicates async cancellation is enabled. + static constexpr bool tcb_async_cancel(int value) { + return (value & (tcbCancelEnableBit | tcbCancelAsyncBit)) + == (tcbCancelEnableBit | tcbCancelAsyncBit); + } + + // Returns true when bitmask indicates cancellation is enabled. + static constexpr bool tcb_cancel_enabled(int value) { + return (value & tcbCancelEnableBit); + } + + // Returns true when bitmask indicates threas has been cancelled. + static constexpr bool tcb_cancelled(int value) { + return (value & (tcbCancelEnableBit | tcbCancelTriggerBit)) + == (tcbCancelEnableBit | tcbCancelTriggerBit); + } + +#if !MLIBC_STATIC_BUILD && !MLIBC_BUILDING_RTDL + // In non-static builds, libc.so always has a TCB available. + constexpr bool tcb_available_flag = true; +#else + // Otherwise this will be set to true after RTDL has initialized the TCB. + extern bool tcb_available_flag; +#endif +} + +enum class TcbThreadReturnValue { + Pointer, + Integer, +}; + +struct Tcb { + Tcb *selfPointer; + size_t dtvSize; + void **dtvPointers; + int tid; + int didExit; +#if defined(__x86_64__) + uint8_t padding[8]; +#endif + uintptr_t stackCanary; + int cancelBits; + + union { + void *voidPtr; + int intVal; + } returnValue; + TcbThreadReturnValue returnValueType; + + struct AtforkHandler { + void (*prepare)(void); + void (*parent)(void); + void (*child)(void); + + AtforkHandler *next; + AtforkHandler *prev; + }; + + AtforkHandler *atforkBegin; + AtforkHandler *atforkEnd; + + struct CleanupHandler { + void (*func)(void *); + void *arg; + + CleanupHandler *next; + CleanupHandler *prev; + }; + + CleanupHandler *cleanupBegin; + CleanupHandler *cleanupEnd; + int isJoinable; + + struct LocalKey { + void *value; + uint64_t generation; + }; + frg::array<LocalKey, PTHREAD_KEYS_MAX> *localKeys; + + size_t stackSize; + void *stackAddr; + size_t guardSize; + + inline void invokeThreadFunc(void *entry, void *user_arg) { + if(returnValueType == TcbThreadReturnValue::Pointer) { + auto func = reinterpret_cast<void *(*)(void *)>(entry); + returnValue.voidPtr = func(user_arg); + } else { + auto func = reinterpret_cast<int (*)(void *)>(entry); + returnValue.intVal = func(user_arg); + } + } +}; + +// There are a few places where we assume the layout of the TCB: +#if defined(__x86_64__) +// GCC expects the stack canary to be at fs:0x28. +static_assert(offsetof(Tcb, stackCanary) == 0x28); +// sysdeps/linux/x86_64/cp_syscall.S uses the offset of cancelBits. +static_assert(offsetof(Tcb, cancelBits) == 0x30); +#elif defined(__i386__) +// GCC expects the stack canary to be at gs:0x14. +// The offset differs from x86_64 due to the change in the pointer size +// and removed padding before the stack canary. +static_assert(offsetof(Tcb, stackCanary) == 0x14); +// sysdeps/linux/x86/cp_syscall.S uses the offset of cancelBits. +// It differs from x86_64 for the same reasons as the stack canary. +static_assert(offsetof(Tcb, cancelBits) == 0x18); +#elif defined(__aarch64__) +// The thread pointer on AArch64 points to 16 bytes before the end of the TCB. +// options/linker/aarch64/runtime.S uses the offset of dtvPointers. +static_assert(sizeof(Tcb) - offsetof(Tcb, dtvPointers) - TP_TCB_OFFSET == 104); +// sysdeps/linux/aarch64/cp_syscall.S uses the offset of cancelBits. +static_assert(sizeof(Tcb) - offsetof(Tcb, cancelBits) - TP_TCB_OFFSET == 80); +#elif defined(__riscv) && __riscv_xlen == 64 +// The thread pointer on RISC-V points to *after* the TCB, and since +// we need to access specific fields that means that the value in +// sysdeps/linux/riscv64/cp_syscall.S needs to be updated whenever +// the struct is expanded. +static_assert(sizeof(Tcb) - offsetof(Tcb, cancelBits) == 96); +#else +#error "Missing architecture specific code." +#endif diff --git a/lib/mlibc/options/internal/include/mlibc/threads.hpp b/lib/mlibc/options/internal/include/mlibc/threads.hpp new file mode 100644 index 0000000..989a8e5 --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/threads.hpp @@ -0,0 +1,27 @@ +#pragma once + +#include <bits/ansi/timespec.h> +#include <bits/threads.h> + +namespace mlibc { + +int thread_create(struct __mlibc_thread_data **__restrict thread, const struct __mlibc_threadattr *__restrict attrp, void *entry, void *__restrict user_arg, bool returns_int); +int thread_attr_init(struct __mlibc_threadattr *attr); +int thread_join(struct __mlibc_thread_data *thread, void *res); + +int thread_mutex_init(struct __mlibc_mutex *__restrict mutex, const struct __mlibc_mutexattr *__restrict attr); +int thread_mutex_destroy(struct __mlibc_mutex *mutex); +int thread_mutex_lock(struct __mlibc_mutex *mutex); +int thread_mutex_unlock(struct __mlibc_mutex *mutex); + +int thread_mutexattr_init(struct __mlibc_mutexattr *attr); +int thread_mutexattr_destroy(struct __mlibc_mutexattr *attr); +int thread_mutexattr_gettype(const struct __mlibc_mutexattr *__restrict attr, int *__restrict type); +int thread_mutexattr_settype(struct __mlibc_mutexattr *attr, int type); + +int thread_cond_init(struct __mlibc_cond *__restrict cond, const struct __mlibc_condattr *__restrict attr); +int thread_cond_destroy(struct __mlibc_cond *cond); +int thread_cond_broadcast(struct __mlibc_cond *cond); +int thread_cond_timedwait(struct __mlibc_cond *__restrict cond, __mlibc_mutex *__restrict mutex, const struct timespec *__restrict abstime); + +} diff --git a/lib/mlibc/options/internal/include/mlibc/tid.hpp b/lib/mlibc/options/internal/include/mlibc/tid.hpp new file mode 100644 index 0000000..e85c19f --- /dev/null +++ b/lib/mlibc/options/internal/include/mlibc/tid.hpp @@ -0,0 +1,18 @@ +#pragma once + +#include <mlibc/thread.hpp> +#include <mlibc/internal-sysdeps.hpp> + +namespace mlibc { + inline unsigned int this_tid() { + // During RTDL initialization, we don't have a TCB. + if (mlibc::tcb_available_flag) { + auto tcb = get_current_tcb(); + return tcb->tid; + } else if (mlibc::sys_futex_tid) { + return mlibc::sys_futex_tid(); + } else { + return 1; + } + } +} diff --git a/lib/mlibc/options/internal/include/stdint.h b/lib/mlibc/options/internal/include/stdint.h new file mode 100644 index 0000000..4d8df66 --- /dev/null +++ b/lib/mlibc/options/internal/include/stdint.h @@ -0,0 +1,150 @@ +#ifndef _MLIBC_STDINT_H +#define _MLIBC_STDINT_H + +#include <bits/types.h> +#include <bits/wchar.h> + +// ---------------------------------------------------------------------------- +// Type definitions. +// ---------------------------------------------------------------------------- + +// Fixed-width (signed). +typedef __mlibc_int8 int8_t; +typedef __mlibc_int16 int16_t; +typedef __mlibc_int32 int32_t; +typedef __mlibc_int64 int64_t; + +// Fixed-width (unsigned). +typedef __mlibc_uint8 uint8_t; +typedef __mlibc_uint16 uint16_t; +typedef __mlibc_uint32 uint32_t; +typedef __mlibc_uint64 uint64_t; + +// Least-width (signed). +typedef __mlibc_int8 int_least8_t; +typedef __mlibc_int16 int_least16_t; +typedef __mlibc_int32 int_least32_t; +typedef __mlibc_int64 int_least64_t; + +// Least-width (unsigned). +typedef __mlibc_uint8 uint_least8_t; +typedef __mlibc_uint16 uint_least16_t; +typedef __mlibc_uint32 uint_least32_t; +typedef __mlibc_uint64 uint_least64_t; + +// Fast-width (signed). +typedef __mlibc_int_fast8 int_fast8_t; +typedef __mlibc_int_fast16 int_fast16_t; +typedef __mlibc_int_fast32 int_fast32_t; +typedef __mlibc_int_fast64 int_fast64_t; + +// Fast-width (unsigned). +typedef __mlibc_uint_fast8 uint_fast8_t; +typedef __mlibc_uint_fast16 uint_fast16_t; +typedef __mlibc_uint_fast32 uint_fast32_t; +typedef __mlibc_uint_fast64 uint_fast64_t; + +// Miscellaneous (signed). +typedef __mlibc_intmax intmax_t; +typedef __mlibc_intptr intptr_t; + +// Miscellaneous (unsigned). +typedef __mlibc_uintmax uintmax_t; +typedef __mlibc_uintptr uintptr_t; + +// ---------------------------------------------------------------------------- +// Constants. +// ---------------------------------------------------------------------------- + +// Fixed-width (signed). +#define INT8_C(x) __MLIBC_INT8_C(x) +#define INT16_C(x) __MLIBC_INT16_C(x) +#define INT32_C(x) __MLIBC_INT32_C(x) +#define INT64_C(x) __MLIBC_INT64_C(x) +#define INTMAX_C(x) __MLIBC_INTMAX_C(x) + +// Fixed-width (unsigned). +#define UINT8_C(x) __MLIBC_UINT8_C(x) +#define UINT16_C(x) __MLIBC_UINT16_C(x) +#define UINT32_C(x) __MLIBC_UINT32_C(x) +#define UINT64_C(x) __MLIBC_UINT64_C(x) +#define UINTMAX_C(x) __MLIBC_UINTMAX_C(x) + +// ---------------------------------------------------------------------------- +// Limits. +// ---------------------------------------------------------------------------- + +// Fixed-width (signed). +#define INT8_MAX __MLIBC_INT8_MAX +#define INT16_MAX __MLIBC_INT16_MAX +#define INT32_MAX __MLIBC_INT32_MAX +#define INT64_MAX __MLIBC_INT64_MAX + +#define INT8_MIN __MLIBC_INT8_MIN +#define INT16_MIN __MLIBC_INT16_MIN +#define INT32_MIN __MLIBC_INT32_MIN +#define INT64_MIN __MLIBC_INT64_MIN + +// Fixed-width (unsigned). +#define UINT8_MAX __MLIBC_UINT8_MAX +#define UINT16_MAX __MLIBC_UINT16_MAX +#define UINT32_MAX __MLIBC_UINT32_MAX +#define UINT64_MAX __MLIBC_UINT64_MAX + +// Least-width (signed). +#define INT_LEAST8_MAX __MLIBC_INT8_MAX +#define INT_LEAST16_MAX __MLIBC_INT16_MAX +#define INT_LEAST32_MAX __MLIBC_INT32_MAX +#define INT_LEAST64_MAX __MLIBC_INT64_MAX + +#define INT_LEAST8_MIN __MLIBC_INT8_MIN +#define INT_LEAST16_MIN __MLIBC_INT16_MIN +#define INT_LEAST32_MIN __MLIBC_INT32_MIN +#define INT_LEAST64_MIN __MLIBC_INT64_MIN + +// Least-width (unsigned). +#define UINT_LEAST8_MAX __MLIBC_UINT8_MAX +#define UINT_LEAST16_MAX __MLIBC_UINT16_MAX +#define UINT_LEAST32_MAX __MLIBC_UINT32_MAX +#define UINT_LEAST64_MAX __MLIBC_UINT64_MAX + +// Fast-width (signed). +#define INT_FAST8_MAX __MLIBC_INT_FAST8_MAX +#define INT_FAST16_MAX __MLIBC_INT_FAST16_MAX +#define INT_FAST32_MAX __MLIBC_INT_FAST32_MAX +#define INT_FAST64_MAX __MLIBC_INT_FAST64_MAX + +#define INT_FAST8_MIN __MLIBC_INT_FAST8_MIN +#define INT_FAST16_MIN __MLIBC_INT_FAST16_MIN +#define INT_FAST32_MIN __MLIBC_INT_FAST32_MIN +#define INT_FAST64_MIN __MLIBC_INT_FAST64_MIN + +// Fast-width (unsigned). +#define UINT_FAST8_MAX __MLIBC_UINT_FAST8_MAX +#define UINT_FAST16_MAX __MLIBC_UINT_FAST16_MAX +#define UINT_FAST32_MAX __MLIBC_UINT_FAST32_MAX +#define UINT_FAST64_MAX __MLIBC_UINT_FAST64_MAX + +// Miscellaneous (signed). +#define INTMAX_MAX __MLIBC_INTMAX_MAX +#define INTPTR_MAX __MLIBC_INTPTR_MAX + +#define INTMAX_MIN __MLIBC_INTMAX_MIN +#define INTPTR_MIN __MLIBC_INTPTR_MIN + +// Miscellaneous (unsigned). +#define UINTMAX_MAX __MLIBC_UINTMAX_MAX +#define UINTPTR_MAX __MLIBC_UINTPTR_MAX + +// Other limits (signed). +#define PTRDIFF_MAX __MLIBC_PTRDIFF_MAX +#define PTRDIFF_MIN __MLIBC_PTRDIFF_MIN +#define SIG_ATOMIC_MAX __MLIBC_SIG_ATOMIC_MAX +#define SIG_ATOMIC_MIN __MLIBC_SIG_ATOMIC_MIN +#define WINT_MAX __MLIBC_WINT_MAX +#define WINT_MIN __MLIBC_WINT_MIN + +// Other limits (unsigned). +#define SIZE_MAX __MLIBC_SIZE_MAX + +#endif // _MLIBC_STDINT_H diff --git a/lib/mlibc/options/internal/riscv64-include/mlibc/arch-defs.hpp b/lib/mlibc/options/internal/riscv64-include/mlibc/arch-defs.hpp new file mode 100644 index 0000000..0a4789f --- /dev/null +++ b/lib/mlibc/options/internal/riscv64-include/mlibc/arch-defs.hpp @@ -0,0 +1,12 @@ +#ifndef MLIBC_ARCH_DEFS_HPP +#define MLIBC_ARCH_DEFS_HPP + +#include <stddef.h> + +namespace mlibc { + +inline constexpr size_t page_size = 0x1000; + +} // namespace mlibc + +#endif // MLIBC_ARCH_DEFS_HPP diff --git a/lib/mlibc/options/internal/riscv64-include/mlibc/thread.hpp b/lib/mlibc/options/internal/riscv64-include/mlibc/thread.hpp new file mode 100644 index 0000000..7428b75 --- /dev/null +++ b/lib/mlibc/options/internal/riscv64-include/mlibc/thread.hpp @@ -0,0 +1,23 @@ +#pragma once + +#include <stdint.h> +#include <mlibc/tcb.hpp> +#include <bits/ensure.h> + +namespace mlibc { + +inline Tcb *get_current_tcb() { + // On RISC-V, the TCB is below the thread pointer. + uintptr_t tp = (uintptr_t)__builtin_thread_pointer(); + auto tcb = reinterpret_cast<Tcb *>(tp - sizeof(Tcb)); + __ensure(tcb == tcb->selfPointer); + return tcb; +} + +inline uintptr_t get_sp() { + uintptr_t sp; + asm ("mv %0, sp" : "=r"(sp)); + return sp; +} + +} // namespace mlibc diff --git a/lib/mlibc/options/internal/riscv64/fenv.S b/lib/mlibc/options/internal/riscv64/fenv.S new file mode 100644 index 0000000..c62ea36 --- /dev/null +++ b/lib/mlibc/options/internal/riscv64/fenv.S @@ -0,0 +1,57 @@ + +#ifdef __riscv_flen + +.global feclearexcept +.type feclearexcept, %function +feclearexcept: + csrc fflags, a0 + li a0, 0 + ret + +.global feraiseexcept +.type feraiseexcept, %function +feraiseexcept: + csrs fflags, a0 + li a0, 0 + ret + +.global fetestexcept +.type fetestexcept, %function +fetestexcept: + frflags t0 + and a0, t0, a0 + ret + +.global fegetround +.type fegetround, %function +fegetround: + frrm a0 + ret + +.global __fesetround +.type __fesetround, %function +__fesetround: + fsrm t0, a0 + li a0, 0 + ret + +.global fegetenv +.type fegetenv, %function +fegetenv: + frcsr t0 + sw t0, 0(a0) + li a0, 0 + ret + +.global fesetenv +.type fesetenv, %function +fesetenv: + li t2, -1 + li t1, 0 + beq a0, t2, 1f + lw t1, 0(a0) +1: fscsr t1 + li a0, 0 + ret + +#endif
\ No newline at end of file diff --git a/lib/mlibc/options/internal/riscv64/mlibc_crtbegin.S b/lib/mlibc/options/internal/riscv64/mlibc_crtbegin.S new file mode 100644 index 0000000..b99748b --- /dev/null +++ b/lib/mlibc/options/internal/riscv64/mlibc_crtbegin.S @@ -0,0 +1,29 @@ + +.section .data +.hidden __dso_handle +.global __dso_handle +__dso_handle: + .quad __dso_handle + +.section .init +.hidden _init +.global _init +_init: + +.section .fini +.hidden _fini +.global _fini +_fini: + +.section .ctors +.hidden __CTOR_LIST__ +.global __CTOR_LIST__ +__CTOR_LIST__: + +.section .dtors +.hidden __DTOR_LIST__ +.global __DTOR_LIST__ +__DTOR_LIST__: + +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/internal/riscv64/mlibc_crtend.S b/lib/mlibc/options/internal/riscv64/mlibc_crtend.S new file mode 100644 index 0000000..bd0cebc --- /dev/null +++ b/lib/mlibc/options/internal/riscv64/mlibc_crtend.S @@ -0,0 +1,21 @@ +.hidden __mlibc_do_ctors +.hidden __mlibc_do_dtors + +.section .init + tail __mlibc_do_ctors + +.section .fini + tail __mlibc_do_dtors + +.section .ctors +.hidden __CTOR_END__ +.global __CTOR_END__ +__CTOR_END__: + +.section .dtors +.hidden __DTOR_END__ +.global __DTOR_END__ +__DTOR_END__: + +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/internal/riscv64/setjmp.S b/lib/mlibc/options/internal/riscv64/setjmp.S new file mode 100644 index 0000000..51568f7 --- /dev/null +++ b/lib/mlibc/options/internal/riscv64/setjmp.S @@ -0,0 +1,71 @@ +.global setjmp +.type setjmp, "function" +setjmp: + sd ra, 0(a0) + sd s0, 8(a0) + sd s1, 16(a0) + sd s2, 24(a0) + sd s3, 32(a0) + sd s4, 40(a0) + sd s5, 48(a0) + sd s6, 56(a0) + sd s7, 64(a0) + sd s8, 72(a0) + sd s9, 80(a0) + sd s10, 88(a0) + sd s11, 96(a0) + sd sp, 104(a0) + fsd fs0, 112(a0) + fsd fs1, 120(a0) + fsd fs2, 128(a0) + fsd fs3, 136(a0) + fsd fs4, 144(a0) + fsd fs5, 152(a0) + fsd fs6, 160(a0) + fsd fs7, 168(a0) + fsd fs8, 176(a0) + fsd fs9, 184(a0) + fsd fs10, 192(a0) + fsd fs11, 200(a0) + li a0, 0 + ret + +.global sigsetjmp +.type sigsetjmp, "function" +sigsetjmp: + unimp // TODO + +.global longjmp +.type longjmp, "function" +longjmp: + ld ra,0(a0) + ld s0,8(a0) + ld s1,16(a0) + ld s2,24(a0) + ld s3,32(a0) + ld s4,40(a0) + ld s5,48(a0) + ld s6,56(a0) + ld s7,64(a0) + ld s8,72(a0) + ld s9,80(a0) + ld s10,88(a0) + ld s11,96(a0) + ld sp,104(a0) + fld fs0,112(a0) + fld fs1,120(a0) + fld fs2,128(a0) + fld fs3,136(a0) + fld fs4,144(a0) + fld fs5,152(a0) + fld fs6,160(a0) + fld fs7,168(a0) + fld fs8,176(a0) + fld fs9,184(a0) + fld fs10,192(a0) + fld fs11,200(a0) + seqz a0,a1 + add a0,a0,a1 + ret +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/internal/x86-include/mlibc/arch-defs.hpp b/lib/mlibc/options/internal/x86-include/mlibc/arch-defs.hpp new file mode 100755 index 0000000..aa8fe38 --- /dev/null +++ b/lib/mlibc/options/internal/x86-include/mlibc/arch-defs.hpp @@ -0,0 +1,13 @@ +#ifndef MLIBC_ARCH_DEFS_HPP +#define MLIBC_ARCH_DEFS_HPP + +#include <stddef.h> + +namespace mlibc { + +inline constexpr size_t page_size = 0x1000; + +} // namespace mlibc + +#endif // MLIBC_ARCH_DEFS_HPP + diff --git a/lib/mlibc/options/internal/x86-include/mlibc/thread.hpp b/lib/mlibc/options/internal/x86-include/mlibc/thread.hpp new file mode 100755 index 0000000..3475fb4 --- /dev/null +++ b/lib/mlibc/options/internal/x86-include/mlibc/thread.hpp @@ -0,0 +1,21 @@ +#pragma once + +#include <stdint.h> +#include <mlibc/tcb.hpp> + +namespace mlibc { + +inline Tcb *get_current_tcb() { + uintptr_t ptr; + asm ("movl %%gs:0, %0" : "=r"(ptr)); + return reinterpret_cast<Tcb *>(ptr); +} + +inline uintptr_t get_sp() { + uintptr_t esp; + asm ("mov %%esp, %0" : "=r"(esp)); + return esp; +} + +} // namespace mlibc + diff --git a/lib/mlibc/options/internal/x86/fenv.S b/lib/mlibc/options/internal/x86/fenv.S new file mode 100644 index 0000000..a46b5fa --- /dev/null +++ b/lib/mlibc/options/internal/x86/fenv.S @@ -0,0 +1,168 @@ +# The functions below are taken from musl. + +.hidden __hwcap + +.global feclearexcept +.type feclearexcept,@function +feclearexcept: + mov 4(%esp),%ecx + and $0x3f,%ecx + fnstsw %ax + # consider sse fenv as well if the cpu has XMM capability + call 1f +1: addl $__hwcap-1b,(%esp) + pop %edx + testl $0x02000000,(%edx) + jz 2f + # maintain exceptions in the sse mxcsr, clear x87 exceptions + test %eax,%ecx + jz 1f + fnclex +1: push %edx + stmxcsr (%esp) + pop %edx + and $0x3f,%eax + or %eax,%edx + test %edx,%ecx + jz 1f + not %ecx + and %ecx,%edx + push %edx + ldmxcsr (%esp) + pop %edx +1: xor %eax,%eax + ret + # only do the expensive x87 fenv load/store when needed +2: test %eax,%ecx + jz 1b + not %ecx + and %ecx,%eax + test $0x3f,%eax + jz 1f + fnclex + jmp 1b +1: sub $32,%esp + fnstenv (%esp) + mov %al,4(%esp) + fldenv (%esp) + add $32,%esp + xor %eax,%eax + ret + +.global feraiseexcept +.type feraiseexcept,@function +feraiseexcept: + mov 4(%esp),%eax + and $0x3f,%eax + sub $32,%esp + fnstenv (%esp) + or %al,4(%esp) + fldenv (%esp) + add $32,%esp + xor %eax,%eax + ret + +.global __fesetround +.hidden __fesetround +.type __fesetround,@function +__fesetround: + mov 4(%esp),%ecx + push %eax + xor %eax,%eax + fnstcw (%esp) + andb $0xf3,1(%esp) + or %ch,1(%esp) + fldcw (%esp) + # consider sse fenv as well if the cpu has XMM capability + call 1f +1: addl $__hwcap-1b,(%esp) + pop %edx + testl $0x02000000,(%edx) + jz 1f + stmxcsr (%esp) + shl $3,%ch + andb $0x9f,1(%esp) + or %ch,1(%esp) + ldmxcsr (%esp) +1: pop %ecx + ret + +.global fegetround +.type fegetround,@function +fegetround: + push %eax + fnstcw (%esp) + pop %eax + and $0xc00,%eax + ret + +.global fegetenv +.type fegetenv,@function +fegetenv: + mov 4(%esp),%ecx + xor %eax,%eax + fnstenv (%ecx) + # consider sse fenv as well if the cpu has XMM capability + call 1f +1: addl $__hwcap-1b,(%esp) + pop %edx + testl $0x02000000,(%edx) + jz 1f + push %eax + stmxcsr (%esp) + pop %edx + and $0x3f,%edx + or %edx,4(%ecx) +1: ret + +.global fesetenv +.type fesetenv,@function +fesetenv: + mov 4(%esp),%ecx + xor %eax,%eax + inc %ecx + jz 1f + fldenv -1(%ecx) + movl -1(%ecx),%ecx + jmp 2f +1: push %eax + push %eax + push %eax + push %eax + pushl $0xffff + push %eax + pushl $0x37f + fldenv (%esp) + add $28,%esp + # consider sse fenv as well if the cpu has XMM capability +2: call 1f +1: addl $__hwcap-1b,(%esp) + pop %edx + testl $0x02000000,(%edx) + jz 1f + # mxcsr := same rounding mode, cleared exceptions, default mask + and $0xc00,%ecx + shl $3,%ecx + or $0x1f80,%ecx + mov %ecx,4(%esp) + ldmxcsr 4(%esp) +1: ret + +.global fetestexcept +.type fetestexcept,@function +fetestexcept: + mov 4(%esp),%ecx + and $0x3f,%ecx + fnstsw %ax + # consider sse fenv as well if the cpu has XMM capability + call 1f +1: addl $__hwcap-1b,(%esp) + pop %edx + testl $0x02000000,(%edx) + jz 1f + stmxcsr 4(%esp) + or 4(%esp),%eax +1: and %ecx,%eax + ret + +.section .note.GNU-stack,"",%progbits diff --git a/lib/mlibc/options/internal/x86/mlibc_crtbegin.S b/lib/mlibc/options/internal/x86/mlibc_crtbegin.S new file mode 100644 index 0000000..d317451 --- /dev/null +++ b/lib/mlibc/options/internal/x86/mlibc_crtbegin.S @@ -0,0 +1,29 @@ + +.section .data +.hidden __dso_handle +.global __dso_handle +__dso_handle: + .long __dso_handle + +.section .init +.hidden _init +.global _init +_init: + +.section .fini +.hidden _fini +.global _fini +_fini: + +.section .ctors +.hidden __CTOR_LIST__ +.global __CTOR_LIST__ +__CTOR_LIST__: + +.section .dtors +.hidden __DTOR_LIST__ +.global __DTOR_LIST__ +__DTOR_LIST__: + +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/internal/x86/mlibc_crtend.S b/lib/mlibc/options/internal/x86/mlibc_crtend.S new file mode 100644 index 0000000..e9d9136 --- /dev/null +++ b/lib/mlibc/options/internal/x86/mlibc_crtend.S @@ -0,0 +1,24 @@ + +.hidden __mlibc_do_ctors +.hidden __mlibc_do_dtors + +.section .init + call __mlibc_do_ctors + ret + +.section .fini + call __mlibc_do_dtors + ret + +.section .ctors +.hidden __CTOR_END__ +.global __CTOR_END__ +__CTOR_END__: + +.section .dtors +.hidden __DTOR_END__ +.global __DTOR_END__ +__DTOR_END__: + +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/internal/x86/setjmp.S b/lib/mlibc/options/internal/x86/setjmp.S new file mode 100644 index 0000000..fa6644c --- /dev/null +++ b/lib/mlibc/options/internal/x86/setjmp.S @@ -0,0 +1,53 @@ + +.type __setjmp, "function" +__setjmp: + mov 4(%esp), %eax # Save argument (buffer) in edi + mov %ebx, 0x00(%eax) + mov %ebp, 0x04(%eax) + mov %esi, 0x08(%eax) + mov %edi, 0x0c(%eax) + + lea 4(%esp), %ecx # esp before return eip is pushed + mov %ecx, 0x10(%eax) + mov (%esp), %ecx # Return eip + mov %ecx, 0x14(%eax) + + test %edx, %edx + jnz 1f + xor %eax, %eax + ret + +1: + jmp __sigsetjmp@PLT + +.global setjmp +.type setjmp, "function" +setjmp: + xor %edx, %edx + jmp __setjmp + +.global sigsetjmp +.type sigsetjmp, "function" +sigsetjmp: + mov $1, %edx + jmp __setjmp + +.global longjmp +.type longjmp, "function" +longjmp: + mov 4(%esp), %ecx + mov 0x00(%ecx), %ebx + mov 0x04(%ecx), %ebp + mov 0x08(%ecx), %esi + mov 0x0c(%ecx), %edi + + mov 8(%esp), %eax + test %eax, %eax + jnz 1f + inc %eax +1: + mov 0x10(%ecx), %esp + jmp *0x14(%ecx) + +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/internal/x86_64-include/mlibc/arch-defs.hpp b/lib/mlibc/options/internal/x86_64-include/mlibc/arch-defs.hpp new file mode 100644 index 0000000..0a4789f --- /dev/null +++ b/lib/mlibc/options/internal/x86_64-include/mlibc/arch-defs.hpp @@ -0,0 +1,12 @@ +#ifndef MLIBC_ARCH_DEFS_HPP +#define MLIBC_ARCH_DEFS_HPP + +#include <stddef.h> + +namespace mlibc { + +inline constexpr size_t page_size = 0x1000; + +} // namespace mlibc + +#endif // MLIBC_ARCH_DEFS_HPP diff --git a/lib/mlibc/options/internal/x86_64-include/mlibc/thread.hpp b/lib/mlibc/options/internal/x86_64-include/mlibc/thread.hpp new file mode 100644 index 0000000..ed02b67 --- /dev/null +++ b/lib/mlibc/options/internal/x86_64-include/mlibc/thread.hpp @@ -0,0 +1,20 @@ +#pragma once + +#include <stdint.h> +#include <mlibc/tcb.hpp> + +namespace mlibc { + +inline Tcb *get_current_tcb() { + uintptr_t ptr; + asm ("movq %%fs:0, %0" : "=r"(ptr)); + return reinterpret_cast<Tcb *>(ptr); +} + +inline uintptr_t get_sp() { + uintptr_t rsp; + asm ("mov %%rsp, %0" : "=r"(rsp)); + return rsp; +} + +} // namespace mlibc diff --git a/lib/mlibc/options/internal/x86_64/fenv.S b/lib/mlibc/options/internal/x86_64/fenv.S new file mode 100644 index 0000000..3748988 --- /dev/null +++ b/lib/mlibc/options/internal/x86_64/fenv.S @@ -0,0 +1,102 @@ +# The functions below are taken from musl. +.global feclearexcept +.type feclearexcept,@function +feclearexcept: + # maintain exceptions in the sse mxcsr, clear x87 exceptions + mov %edi,%ecx + and $0x3f,%ecx + fnstsw %ax + test %eax,%ecx + jz 1f + fnclex +1: stmxcsr -8(%rsp) + and $0x3f,%eax + or %eax,-8(%rsp) + test %ecx,-8(%rsp) + jz 1f + not %ecx + and %ecx,-8(%rsp) + ldmxcsr -8(%rsp) +1: xor %eax,%eax + ret + +.global feraiseexcept +.type feraiseexcept,@function +feraiseexcept: + and $0x3f,%edi + stmxcsr -8(%rsp) + or %edi,-8(%rsp) + ldmxcsr -8(%rsp) + xor %eax,%eax + ret + +.global __fesetround +.hidden __fesetround +.type __fesetround,@function +__fesetround: + push %rax + xor %eax,%eax + mov %edi,%ecx + fnstcw (%rsp) + andb $0xf3,1(%rsp) + or %ch,1(%rsp) + fldcw (%rsp) + stmxcsr (%rsp) + shl $3,%ch + andb $0x9f,1(%rsp) + or %ch,1(%rsp) + ldmxcsr (%rsp) + pop %rcx + ret + +.global fegetround +.type fegetround,@function +fegetround: + push %rax + stmxcsr (%rsp) + pop %rax + shr $3,%eax + and $0xc00,%eax + ret + +.global fegetenv +.type fegetenv,@function +fegetenv: + xor %eax,%eax + fnstenv (%rdi) + stmxcsr 28(%rdi) + ret + +.global fesetenv +.type fesetenv,@function +fesetenv: + xor %eax,%eax + inc %rdi + jz 1f + fldenv -1(%rdi) + ldmxcsr 27(%rdi) + ret +1: push %rax + push %rax + pushq $0xffff + pushq $0x37f + fldenv (%rsp) + pushq $0x1f80 + ldmxcsr (%rsp) + add $40,%rsp + ret + +.global fetestexcept +.type fetestexcept,@function +fetestexcept: + and $0x3f,%edi + push %rax + stmxcsr (%rsp) + pop %rsi + fnstsw %ax + or %esi,%eax + and %edi,%eax + ret + +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/internal/x86_64/mlibc_crtbegin.S b/lib/mlibc/options/internal/x86_64/mlibc_crtbegin.S new file mode 100644 index 0000000..b99748b --- /dev/null +++ b/lib/mlibc/options/internal/x86_64/mlibc_crtbegin.S @@ -0,0 +1,29 @@ + +.section .data +.hidden __dso_handle +.global __dso_handle +__dso_handle: + .quad __dso_handle + +.section .init +.hidden _init +.global _init +_init: + +.section .fini +.hidden _fini +.global _fini +_fini: + +.section .ctors +.hidden __CTOR_LIST__ +.global __CTOR_LIST__ +__CTOR_LIST__: + +.section .dtors +.hidden __DTOR_LIST__ +.global __DTOR_LIST__ +__DTOR_LIST__: + +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/internal/x86_64/mlibc_crtend.S b/lib/mlibc/options/internal/x86_64/mlibc_crtend.S new file mode 100644 index 0000000..e9d9136 --- /dev/null +++ b/lib/mlibc/options/internal/x86_64/mlibc_crtend.S @@ -0,0 +1,24 @@ + +.hidden __mlibc_do_ctors +.hidden __mlibc_do_dtors + +.section .init + call __mlibc_do_ctors + ret + +.section .fini + call __mlibc_do_dtors + ret + +.section .ctors +.hidden __CTOR_END__ +.global __CTOR_END__ +__CTOR_END__: + +.section .dtors +.hidden __DTOR_END__ +.global __DTOR_END__ +__DTOR_END__: + +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/internal/x86_64/setjmp.S b/lib/mlibc/options/internal/x86_64/setjmp.S new file mode 100644 index 0000000..aa8a134 --- /dev/null +++ b/lib/mlibc/options/internal/x86_64/setjmp.S @@ -0,0 +1,54 @@ + +.type __setjmp, "function" +__setjmp: + mov %rbx, 0x00(%rdi) + mov %rbp, 0x08(%rdi) + mov %r12, 0x10(%rdi) + mov %r13, 0x18(%rdi) + mov %r14, 0x20(%rdi) + mov %r15, 0x28(%rdi) + + lea 8(%rsp), %rax # rsp before return rip is pushed + mov %rax, 0x30(%rdi) + mov (%rsp), %rax # return rip + mov %rax, 0x38(%rdi) + + test %rdx, %rdx + jnz 1f + xor %rax, %rax + ret + +1: + jmp __sigsetjmp + +.global setjmp +.type setjmp, "function" +setjmp: + xor %rdx, %rdx + jmp __setjmp + +.global sigsetjmp +.type sigsetjmp, "function" +sigsetjmp: + mov $1, %rdx + jmp __setjmp + +.global longjmp +.type longjmp, "function" +longjmp: + mov 0x00(%rdi), %rbx + mov 0x08(%rdi), %rbp + mov 0x10(%rdi), %r12 + mov 0x18(%rdi), %r13 + mov 0x20(%rdi), %r14 + mov 0x28(%rdi), %r15 + + mov %rsi, %rax + test %rax, %rax + jnz 1f + inc %rax +1: + mov 0x30(%rdi), %rsp + jmp *0x38(%rdi) +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/intl/generic/libintl-stubs.cpp b/lib/mlibc/options/intl/generic/libintl-stubs.cpp new file mode 100644 index 0000000..8d4b28f --- /dev/null +++ b/lib/mlibc/options/intl/generic/libintl-stubs.cpp @@ -0,0 +1,73 @@ +#include <libintl.h> +#include <bits/ensure.h> + +char *gettext(const char *msgid) { + (void)msgid; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +char *dgettext(const char *domainname, const char *msgid) { + (void)domainname; + (void)msgid; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +char *dcgettext(const char *domainname, const char *msgid, + int category) { + (void)domainname; + (void)msgid; + (void)category; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +char *ngettext(const char *msgid, const char *msgid_plural, unsigned long int n) { + (void)msgid; + (void)msgid_plural; + (void)n; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +char *dngettext(const char *domainname, const char *msgid, + const char *msgid_plural, unsigned long int n) { + (void)domainname; + (void)msgid; + (void)msgid_plural; + (void)n; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +char *dcngettext(const char *domainname, const char *msgid, + const char *msgid_plural, unsigned long int n, int category) { + (void)domainname; + (void)msgid; + (void)msgid_plural; + (void)n; + (void)category; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +char *textdomain(const char *domainname) { + (void)domainname; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +char *bindtextdomain(const char *domainname, const char *dirname) { + (void)domainname; + (void)dirname; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +char *bind_textdomain_codeset(const char *domainname, const char *codeset) { + (void)domainname; + (void)codeset; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/intl/include/libintl.h b/lib/mlibc/options/intl/include/libintl.h new file mode 100644 index 0000000..a897dac --- /dev/null +++ b/lib/mlibc/options/intl/include/libintl.h @@ -0,0 +1,33 @@ + +#ifndef _LIBINTL_H +#define _LIBINTL_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +char *gettext(const char *msgid); +char *dgettext(const char *domainname, const char *msgid); +char *dcgettext(const char *domainname, const char *msgid, + int category); + +char *ngettext(const char *msgid, const char *msgid_plural, unsigned long int n); +char *dngettext(const char *domainname, const char *msgid, + const char *msgid_plural, unsigned long int n); +char *dcngettext(const char *domainname, const char *msgid, + const char *msgid_plural, unsigned long int n, int category); + +char *textdomain(const char *domainname); +char *bindtextdomain(const char *domainname, const char *dirname); +char *bind_textdomain_codeset(const char *domainname, const char *codeset); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _LIBINTL_H + diff --git a/lib/mlibc/options/intl/meson.build b/lib/mlibc/options/intl/meson.build new file mode 100644 index 0000000..94057f4 --- /dev/null +++ b/lib/mlibc/options/intl/meson.build @@ -0,0 +1,12 @@ +if disable_intl_option + subdir_done() +endif +libc_sources += files( + 'generic/libintl-stubs.cpp', +) + +if not no_headers + install_headers( + 'include/libintl.h', + ) +endif diff --git a/lib/mlibc/options/linux/generic/capabilities.cpp b/lib/mlibc/options/linux/generic/capabilities.cpp new file mode 100644 index 0000000..871822a --- /dev/null +++ b/lib/mlibc/options/linux/generic/capabilities.cpp @@ -0,0 +1,19 @@ +#include <mlibc/debug.hpp> + +#ifdef __cplusplus +extern "C" { +#endif + +int capset(void *, void *) { + mlibc::infoLogger() << "mlibc: capset is a no-op!" << frg::endlog; + return 0; +} + +int capget(void *, void *) { + mlibc::infoLogger() << "mlibc: capget is a no-op!" << frg::endlog; + return 0; +} + +#ifdef __cplusplus +} +#endif diff --git a/lib/mlibc/options/linux/generic/cpuset.cpp b/lib/mlibc/options/linux/generic/cpuset.cpp new file mode 100644 index 0000000..d0292b7 --- /dev/null +++ b/lib/mlibc/options/linux/generic/cpuset.cpp @@ -0,0 +1,71 @@ +#include <limits.h> +#include <sched.h> +#include <stdlib.h> +#include <string.h> + +cpu_set_t *__mlibc_cpu_alloc(int num_cpus) { + return reinterpret_cast<cpu_set_t *>(calloc(1, CPU_ALLOC_SIZE(num_cpus))); +} + +#define CPU_MASK_BITS (CHAR_BIT * sizeof(__cpu_mask)) + +size_t __mlibc_cpu_alloc_size(int num_cpus) { + /* calculate the (unaligned) remainder that doesn't neatly fit in one __cpu_mask; 0 or 1 */ + size_t remainder = ((num_cpus % CPU_MASK_BITS) + CPU_MASK_BITS - 1) / CPU_MASK_BITS; + return sizeof(__cpu_mask) * (num_cpus / CPU_MASK_BITS + remainder); +} + +void __mlibc_cpu_zero(const size_t setsize, cpu_set_t *set) { + memset(set, 0, CPU_ALLOC_SIZE(setsize)); +} + +void __mlibc_cpu_set(const int cpu, const size_t setsize, cpu_set_t *set) { + if(cpu >= static_cast<int>(setsize * CHAR_BIT)) { + return; + } + + unsigned char *ptr = reinterpret_cast<unsigned char *>(set); + size_t off = cpu / CHAR_BIT; + size_t mask = 1 << (cpu % CHAR_BIT); + + ptr[off] |= mask; +} + +void __mlibc_cpu_clear(const int cpu, const size_t setsize, cpu_set_t *set) { + if(cpu >= static_cast<int>(setsize * CHAR_BIT)) { + return; + } + + unsigned char *ptr = reinterpret_cast<unsigned char *>(set); + size_t off = cpu / CHAR_BIT; + size_t mask = 1 << (cpu % CHAR_BIT); + + ptr[off] &= ~mask; +} + + +int __mlibc_cpu_isset(const int cpu, const size_t setsize, const cpu_set_t *set) { + if(cpu >= static_cast<int>(setsize * CHAR_BIT)) { + return false; + } + + const unsigned char *ptr = reinterpret_cast<const unsigned char *>(set); + size_t off = cpu / CHAR_BIT; + size_t mask = 1 << (cpu % CHAR_BIT); + + return (ptr[off] & mask); +} + +int __mlibc_cpu_count(const size_t setsize, const cpu_set_t *set) { + size_t count = 0; + const unsigned char *ptr = reinterpret_cast<const unsigned char *>(set); + + for(size_t i = 0; i < setsize; i++) { + for(size_t bit = 0; bit < CHAR_BIT; bit++) { + if((1 << bit) & ptr[i]) + count++; + } + } + + return count; +} diff --git a/lib/mlibc/options/linux/generic/ifaddrs.cpp b/lib/mlibc/options/linux/generic/ifaddrs.cpp new file mode 100644 index 0000000..67dfbc6 --- /dev/null +++ b/lib/mlibc/options/linux/generic/ifaddrs.cpp @@ -0,0 +1,15 @@ +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <ifaddrs.h> +#include <errno.h> + +int getifaddrs(struct ifaddrs **) { + mlibc::infoLogger() << "mlibc: getifaddrs fails unconditionally!" << frg::endlog; + errno = ENOSYS; + return -1; +} + +void freeifaddrs(struct ifaddrs *) { + mlibc::infoLogger() << "mlibc: freeifaddrs is a stub!" << frg::endlog; + return; +} diff --git a/lib/mlibc/options/linux/generic/linux-unistd.cpp b/lib/mlibc/options/linux/generic/linux-unistd.cpp new file mode 100644 index 0000000..ec13f72 --- /dev/null +++ b/lib/mlibc/options/linux/generic/linux-unistd.cpp @@ -0,0 +1,33 @@ +#include <bits/linux/linux_unistd.h> +#include <bits/ensure.h> + +#include <errno.h> +#include <mlibc/posix-sysdeps.hpp> +#include <unistd.h> + +int dup3(int oldfd, int newfd, int flags) { + if(oldfd == newfd) { + errno = EINVAL; + return -1; + } + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_dup2, -1); + if(int e = mlibc::sys_dup2(oldfd, flags, newfd); e) { + errno = e; + return -1; + } + return newfd; +} + +int vhangup(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int getdtablesize(void){ + return sysconf(_SC_OPEN_MAX); +} + +int syncfs(int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/linux/generic/malloc.cpp b/lib/mlibc/options/linux/generic/malloc.cpp new file mode 100644 index 0000000..065de6c --- /dev/null +++ b/lib/mlibc/options/linux/generic/malloc.cpp @@ -0,0 +1,7 @@ +#include <bits/ensure.h> +#include <malloc.h> + +void *memalign(size_t, size_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/linux/generic/mntent-stubs.cpp b/lib/mlibc/options/linux/generic/mntent-stubs.cpp new file mode 100644 index 0000000..35c0e92 --- /dev/null +++ b/lib/mlibc/options/linux/generic/mntent-stubs.cpp @@ -0,0 +1,98 @@ + +#include <errno.h> +#include <mntent.h> +#include <stdio.h> +#include <limits.h> +#include <string.h> +#include <bits/ensure.h> + +namespace { + +char *internal_buf; +size_t internal_bufsize; + +} + +#define SENTINEL (char *)&internal_buf + +FILE *setmntent(const char *name, const char *mode) { + return fopen(name, mode); +} + +struct mntent *getmntent(FILE *f) { + static struct mntent mnt; + return getmntent_r(f, &mnt, SENTINEL, 0); +} + +int addmntent(FILE *f, const struct mntent *mnt) { + if(fseek(f, 0, SEEK_END)) { + return 1; + } + return fprintf(f, "%s\t%s\t%s\t%s\t%d\t%d\n", + mnt->mnt_fsname, mnt->mnt_dir, mnt->mnt_type, mnt->mnt_opts, + mnt->mnt_freq, mnt->mnt_passno) < 0; +} + +int endmntent(FILE *f) { + if(f) { + fclose(f); + } + return 1; +} + +char *hasmntopt(const struct mntent *mnt, const char *opt) { + return strstr(mnt->mnt_opts, opt); +} + +/* Adapted from musl */ +struct mntent *getmntent_r(FILE *f, struct mntent *mnt, char *linebuf, int buflen) { + int n[8]; + bool use_internal = (linebuf == SENTINEL); + int len; + size_t i; + + mnt->mnt_freq = 0; + mnt->mnt_passno = 0; + + do { + if(use_internal) { + getline(&internal_buf, &internal_bufsize, f); + linebuf = internal_buf; + } else { + fgets(linebuf, buflen, f); + } + if(feof(f) || ferror(f)) { + return 0; + } + if(!strchr(linebuf, '\n')) { + fscanf(f, "%*[^\n]%*[\n]"); + errno = ERANGE; + return 0; + } + + len = strlen(linebuf); + if(len > INT_MAX) { + continue; + } + + for(i = 0; i < sizeof n / sizeof *n; i++) { + n[i] = len; + } + + sscanf(linebuf, " %n%*s%n %n%*s%n %n%*s%n %n%*s%n %d %d", + n, n + 1, n + 2, n + 3, n + 4, n + 5, n + 6, n + 7, + &mnt->mnt_freq, &mnt->mnt_passno); + } while(linebuf[n[0]] == '#' || n[1] == len); + + linebuf[n[1]] = 0; + linebuf[n[3]] = 0; + linebuf[n[5]] = 0; + linebuf[n[7]] = 0; + + mnt->mnt_fsname = linebuf + n[0]; + mnt->mnt_dir = linebuf + n[2]; + mnt->mnt_type = linebuf + n[4]; + mnt->mnt_opts = linebuf + n[6]; + + return mnt; +} diff --git a/lib/mlibc/options/linux/generic/module.cpp b/lib/mlibc/options/linux/generic/module.cpp new file mode 100644 index 0000000..53b6dc8 --- /dev/null +++ b/lib/mlibc/options/linux/generic/module.cpp @@ -0,0 +1,24 @@ +#include <errno.h> +#include <module.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/linux-sysdeps.hpp> + +int init_module(void *module, unsigned long length, const char *args) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_init_module, -1); + if(int e = mlibc::sys_init_module(module, length, args); e) { + errno = e; + return -1; + } + return 0; +} + +int delete_module(const char *name, unsigned flags) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_delete_module, -1); + if(int e = mlibc::sys_delete_module(name, flags); e) { + errno = e; + return -1; + } + return 0; +} diff --git a/lib/mlibc/options/linux/generic/pty-stubs.cpp b/lib/mlibc/options/linux/generic/pty-stubs.cpp new file mode 100644 index 0000000..8d95027 --- /dev/null +++ b/lib/mlibc/options/linux/generic/pty-stubs.cpp @@ -0,0 +1,101 @@ + +#include <asm/ioctls.h> +#include <bits/ensure.h> +#include <errno.h> +#include <fcntl.h> +#include <pty.h> +#include <stdio.h> +#include <sys/ioctl.h> +#include <unistd.h> +#include <stdlib.h> + +#include <mlibc/debug.hpp> +#include <mlibc/linux-sysdeps.hpp> + +int openpty(int *mfd, int *sfd, char *name, const struct termios *ios, const struct winsize *win) { + int ptmx_fd; + if(int e = mlibc::sys_open("/dev/ptmx", O_RDWR | O_NOCTTY, 0, &ptmx_fd); e) { + errno = e; + goto fail; + } + + char spath[32]; + if(!name) + name = spath; + if(ptsname_r(ptmx_fd, name, 32)) + goto fail; + + int pts_fd; + unlockpt(ptmx_fd); + if(int e = mlibc::sys_open(name, O_RDWR | O_NOCTTY, 0, &pts_fd); e) { + errno = e; + goto fail; + } + + if(ios) + tcsetattr(ptmx_fd, TCSAFLUSH, ios); + + if(win) + ioctl(ptmx_fd, TIOCSWINSZ, (void*)win); + + *mfd = ptmx_fd; + *sfd = pts_fd; + return 0; + +fail: + mlibc::sys_close(ptmx_fd); + return -1; +} + +int login_tty(int fd) { + if(setsid() == -1) + return -1; + if(ioctl(fd, TIOCSCTTY, 0)) + return -1; + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_dup2, -1); + if(int e = mlibc::sys_dup2(fd, 0, STDIN_FILENO); e) { + errno = e; + return -1; + } + if(int e = mlibc::sys_dup2(fd, 0, STDOUT_FILENO); e) { + errno = e; + return -1; + } + if(int e = mlibc::sys_dup2(fd, 0, STDERR_FILENO); e) { + errno = e; + return -1; + } + + if(int e = mlibc::sys_close(fd); e) { + errno = e; + return -1; + } + return 0; +} + +int forkpty(int *mfd, char *name, const struct termios *ios, const struct winsize *win) { + int sfd; + if(openpty(mfd, &sfd, name, ios, win)) + return -1; + + pid_t child; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fork, -1); + if(int e = mlibc::sys_fork(&child); e) { + errno = e; + return -1; + } + + if(!child) { + if(login_tty(sfd)) + mlibc::panicLogger() << "mlibc: TTY login fail in forkpty() child" << frg::endlog; + }else{ + if(int e = mlibc::sys_close(sfd); e) { + errno = e; + return -1; + } + } + + return child; +} + diff --git a/lib/mlibc/options/linux/generic/sched.cpp b/lib/mlibc/options/linux/generic/sched.cpp new file mode 100644 index 0000000..760a9f5 --- /dev/null +++ b/lib/mlibc/options/linux/generic/sched.cpp @@ -0,0 +1,50 @@ +#include <bits/ensure.h> +#include <errno.h> +#include <sched.h> + +#include <mlibc/linux-sysdeps.hpp> +#include <mlibc/posix-sysdeps.hpp> + +int sched_getcpu(void) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getcpu, -1); + int cpu; + if(int e = mlibc::sys_getcpu(&cpu); e) { + errno = e; + return -1; + } + return cpu; +} + +int setns(int, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int sched_getscheduler(pid_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int sched_getaffinity(pid_t pid, size_t cpusetsize, cpu_set_t *mask) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getaffinity, -1); + if(int e = mlibc::sys_getaffinity(pid, cpusetsize, mask); e) { + errno = e; + return -1; + } + return 0; +} + +int unshare(int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int sched_setaffinity(pid_t, size_t, const cpu_set_t *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int clone(int (*)(void *), void *, int, void *, ...) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/linux/generic/sys-epoll.cpp b/lib/mlibc/options/linux/generic/sys-epoll.cpp new file mode 100644 index 0000000..799d1a9 --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-epoll.cpp @@ -0,0 +1,58 @@ + +#include <errno.h> +#include <sys/epoll.h> + +#include <bits/ensure.h> +#include <mlibc/linux-sysdeps.hpp> +#include <stddef.h> + +int epoll_create(int) { + int fd; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_epoll_create, -1); + if(int e = mlibc::sys_epoll_create(0, &fd); e) { + errno = e; + return -1; + } + return fd; +} + +int epoll_pwait(int epfd, struct epoll_event *evnts, int n, int timeout, + const sigset_t *sigmask) { + int raised; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_epoll_pwait, -1); + if(int e = mlibc::sys_epoll_pwait(epfd, evnts, n, timeout, sigmask, &raised)) { + errno = e; + return -1; + } + return raised; +} + +int epoll_create1(int flags) { + int fd; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_epoll_create, -1); + if(int e = mlibc::sys_epoll_create(flags, &fd); e) { + errno = e; + return -1; + } + return fd; +} + +int epoll_ctl(int epfd, int mode, int fd, struct epoll_event *ev) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_epoll_ctl, -1); + if(int e = mlibc::sys_epoll_ctl(epfd, mode, fd, ev); e) { + errno = e; + return -1; + } + return 0; +} + +int epoll_wait(int epfd, struct epoll_event *evnts, int n, int timeout) { + int raised; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_epoll_pwait, -1); + if(int e = mlibc::sys_epoll_pwait(epfd, evnts, n, timeout, NULL, &raised)) { + errno = e; + return -1; + } + return raised; +} + diff --git a/lib/mlibc/options/linux/generic/sys-eventfd.cpp b/lib/mlibc/options/linux/generic/sys-eventfd.cpp new file mode 100644 index 0000000..1d83d8c --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-eventfd.cpp @@ -0,0 +1,45 @@ +#include <sys/eventfd.h> +#include <errno.h> + +#include <bits/ensure.h> +#include <mlibc/linux-sysdeps.hpp> + +int eventfd(unsigned int initval, int flags) { + int fd = 0; + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_eventfd_create, -1); + if (int e = mlibc::sys_eventfd_create(initval, flags, &fd); e) { + errno = e; + return -1; + } + + return fd; +} + +int eventfd_read(int fd, eventfd_t *value) { + ssize_t bytes_read; + if (int e = mlibc::sys_read(fd, value, 8, &bytes_read); e) { + errno = e; + return -1; + } + + if (bytes_read != 8) { + return -1; + } + + return 0; +} + +int eventfd_write(int fd, eventfd_t value) { + ssize_t bytes_written; + if (int e = mlibc::sys_write(fd, &value, 8, &bytes_written); e) { + errno = e; + return -1; + } + + if (bytes_written != 8) { + return -1; + } + + return 0; +} diff --git a/lib/mlibc/options/linux/generic/sys-fsuid.cpp b/lib/mlibc/options/linux/generic/sys-fsuid.cpp new file mode 100644 index 0000000..653456c --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-fsuid.cpp @@ -0,0 +1,12 @@ +#include <bits/ensure.h> +#include <sys/fsuid.h> + +int setfsuid(uid_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int setfsgid(gid_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/linux/generic/sys-inotify-stubs.cpp b/lib/mlibc/options/linux/generic/sys-inotify-stubs.cpp new file mode 100644 index 0000000..0bc25c9 --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-inotify-stubs.cpp @@ -0,0 +1,47 @@ + +#include <errno.h> +#include <sys/inotify.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/linux-sysdeps.hpp> + +int inotify_init(void) { + int fd; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_inotify_create, -1); + if(int e = mlibc::sys_inotify_create(0, &fd); e) { + errno = e; + return -1; + } + return fd; +} + +int inotify_init1(int flags) { + int fd; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_inotify_create, -1); + if(int e = mlibc::sys_inotify_create(flags, &fd); e) { + errno = e; + return -1; + } + return fd; +} + +int inotify_add_watch(int ifd, const char *path, uint32_t mask) { + int wd; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_inotify_add_watch, -1); + if(int e = mlibc::sys_inotify_add_watch(ifd, path, mask, &wd); e) { + errno = e; + return -1; + } + return wd; +} + +int inotify_rm_watch(int ifd, int wd) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_inotify_rm_watch, -1); + if(int e = mlibc::sys_inotify_rm_watch(ifd, wd); e) { + errno = e; + return -1; + } + return 0; +} + diff --git a/lib/mlibc/options/linux/generic/sys-klog.cpp b/lib/mlibc/options/linux/generic/sys-klog.cpp new file mode 100644 index 0000000..059e292 --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-klog.cpp @@ -0,0 +1,16 @@ +#include <errno.h> +#include <sys/klog.h> + +#include <bits/ensure.h> + +#include <mlibc/linux-sysdeps.hpp> + +int klogctl(int type, char *bufp, int len) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_klogctl, -1); + int out; + if (int e = mlibc::sys_klogctl(type, bufp, len, &out); e) { + errno = e; + return -1; + } + return out; +} diff --git a/lib/mlibc/options/linux/generic/sys-mount.cpp b/lib/mlibc/options/linux/generic/sys-mount.cpp new file mode 100644 index 0000000..4783183 --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-mount.cpp @@ -0,0 +1,29 @@ + +#include <errno.h> +#include <sys/mount.h> + +#include <bits/ensure.h> +#include <mlibc/linux-sysdeps.hpp> + +int mount(const char *source, const char *target, + const char *fstype, unsigned long flags, const void *data) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_mount, -1); + if(int e = mlibc::sys_mount(source, target, fstype, flags, data); e) { + errno = e; + return -1; + } + return 0; +} + +int umount(const char *target) { + return umount2(target, 0); +} + +int umount2(const char *target, int flags) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_umount2, -1); + if(int e = mlibc::sys_umount2(target, flags); e) { + errno = e; + return -1; + } + return 0; +} diff --git a/lib/mlibc/options/linux/generic/sys-prctl-stubs.cpp b/lib/mlibc/options/linux/generic/sys-prctl-stubs.cpp new file mode 100644 index 0000000..5280332 --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-prctl-stubs.cpp @@ -0,0 +1,25 @@ + +#include <stdarg.h> +#include <errno.h> +#include <bits/ensure.h> +#include <sys/prctl.h> + +#include <mlibc/debug.hpp> + +#include "mlibc/linux-sysdeps.hpp" + +int prctl(int op, ...) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_prctl, -1); + + int val; + va_list ap; + va_start(ap, op); + if(int e = mlibc::sys_prctl(op, ap, &val); e) { + errno = e; + return -1; + } + va_end(ap); + + return val; +} + diff --git a/lib/mlibc/options/linux/generic/sys-ptrace-stubs.cpp b/lib/mlibc/options/linux/generic/sys-ptrace-stubs.cpp new file mode 100644 index 0000000..8c836c5 --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-ptrace-stubs.cpp @@ -0,0 +1,36 @@ + +#include <sys/ptrace.h> +#include <stdarg.h> +#include <errno.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/linux-sysdeps.hpp> + +long ptrace(int req, ...) { + va_list ap; + + va_start(ap, req); + auto pid = va_arg(ap, pid_t); + auto addr = va_arg(ap, void *); + auto data = va_arg(ap, void *); + va_end(ap); + + long ret; + if(req > 0 && req < 4) { + data = &ret; + } + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_ptrace, -1); + long out; + if(int e = mlibc::sys_ptrace(req, pid, addr, data, &out); e) { + errno = e; + return -1; + } else if(req > 0 && req < 4) { + errno = 0; + return ret; + } + + return out; +} + diff --git a/lib/mlibc/options/linux/generic/sys-quota.cpp b/lib/mlibc/options/linux/generic/sys-quota.cpp new file mode 100644 index 0000000..27c0e6d --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-quota.cpp @@ -0,0 +1,7 @@ +#include <bits/ensure.h> +#include <sys/quota.h> + +int quotactl(int, const char *, int, caddr_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/linux/generic/sys-random-stubs.cpp b/lib/mlibc/options/linux/generic/sys-random-stubs.cpp new file mode 100644 index 0000000..5e5057f --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-random-stubs.cpp @@ -0,0 +1,21 @@ + +#include <sys/random.h> +#include <bits/ensure.h> + +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> + +#include <errno.h> + +ssize_t getrandom(void *buffer, size_t max_size, unsigned int flags) { + if(flags & ~(GRND_RANDOM | GRND_NONBLOCK)) { + errno = EINVAL; + return -1; + } + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getentropy, -1); + if(int e = mlibc::sys_getentropy(buffer, max_size); e) { + errno = e; + return -1; + } + return max_size; +} diff --git a/lib/mlibc/options/linux/generic/sys-reboot.cpp b/lib/mlibc/options/linux/generic/sys-reboot.cpp new file mode 100644 index 0000000..c9b503f --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-reboot.cpp @@ -0,0 +1,13 @@ +#include <errno.h> +#include <sys/reboot.h> +#include <bits/ensure.h> +#include <mlibc/linux-sysdeps.hpp> + +int reboot(int what) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_reboot, -1); + if (int e = mlibc::sys_reboot(what); e) { + errno = e; + return -1; + } + return 0; +} diff --git a/lib/mlibc/options/linux/generic/sys-sendfile-stubs.cpp b/lib/mlibc/options/linux/generic/sys-sendfile-stubs.cpp new file mode 100644 index 0000000..25cd0a0 --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-sendfile-stubs.cpp @@ -0,0 +1,9 @@ + +#include <sys/sendfile.h> +#include <bits/ensure.h> + +ssize_t sendfile(int, int, off_t *, size_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + diff --git a/lib/mlibc/options/linux/generic/sys-signalfd.cpp b/lib/mlibc/options/linux/generic/sys-signalfd.cpp new file mode 100644 index 0000000..28cfea0 --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-signalfd.cpp @@ -0,0 +1,17 @@ + +#include <errno.h> +#include <sys/signalfd.h> + +#include <bits/ensure.h> +#include <mlibc/linux-sysdeps.hpp> + +int signalfd(int fd, const sigset_t *mask, int flags) { + __ensure(fd == -1); + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_signalfd_create, -1); + if(int e = mlibc::sys_signalfd_create(mask, flags, &fd); e) { + errno = e; + return -1; + } + return fd; +} + diff --git a/lib/mlibc/options/linux/generic/sys-statfs-stubs.cpp b/lib/mlibc/options/linux/generic/sys-statfs-stubs.cpp new file mode 100644 index 0000000..6152ef2 --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-statfs-stubs.cpp @@ -0,0 +1,26 @@ + +#include <errno.h> +#include <sys/statfs.h> +#include <bits/ensure.h> + +#include <mlibc/debug.hpp> +#include <mlibc/linux-sysdeps.hpp> + +int statfs(const char *path, struct statfs *buf) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_statfs, -1); + if(int e = mlibc::sys_statfs(path, buf); e) { + errno = e; + return -1; + } + return 0; +} + +int fstatfs(int fd, struct statfs *buf) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fstatfs, -1); + if (int e = mlibc::sys_fstatfs(fd, buf); e) { + errno = e; + return -1; + } + return 0; +} + diff --git a/lib/mlibc/options/linux/generic/sys-swap.cpp b/lib/mlibc/options/linux/generic/sys-swap.cpp new file mode 100644 index 0000000..44ddf98 --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-swap.cpp @@ -0,0 +1,24 @@ +#include <errno.h> +#include <sys/swap.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/linux-sysdeps.hpp> + +int swapon(const char *path, int flags) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_swapon, -1); + if(int e = mlibc::sys_swapon(path, flags); e) { + errno = e; + return -1; + } + return 0; +} + +int swapoff(const char *path) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_swapoff, -1); + if(int e = mlibc::sys_swapoff(path); e) { + errno = e; + return -1; + } + return 0; +} diff --git a/lib/mlibc/options/linux/generic/sys-sysinfo.cpp b/lib/mlibc/options/linux/generic/sys-sysinfo.cpp new file mode 100644 index 0000000..950c38a --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-sysinfo.cpp @@ -0,0 +1,15 @@ +#include <errno.h> +#include <sys/sysinfo.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/linux-sysdeps.hpp> + +int sysinfo(struct sysinfo *info) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_sysinfo, -1); + if(int e = mlibc::sys_sysinfo(info); e) { + errno = e; + return -1; + } + return 0; +} diff --git a/lib/mlibc/options/linux/generic/sys-timerfd.cpp b/lib/mlibc/options/linux/generic/sys-timerfd.cpp new file mode 100644 index 0000000..80bca1b --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-timerfd.cpp @@ -0,0 +1,33 @@ + +#include <errno.h> +#include <sys/timerfd.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/linux-sysdeps.hpp> + +int timerfd_create(int clockid, int flags) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_timerfd_create, -1); + int fd; + if(int e = mlibc::sys_timerfd_create(clockid, flags, &fd); e) { + errno = e; + return -1; + } + return fd; +} + +int timerfd_settime(int fd, int flags, const struct itimerspec *value, + struct itimerspec *oldvalue) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_timerfd_settime, -1); + if(int e = mlibc::sys_timerfd_settime(fd, flags, value, oldvalue); e) { + errno = e; + return -1; + } + return 0; +} + +int timerfd_gettime(int, struct itimerspec *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + diff --git a/lib/mlibc/options/linux/generic/sys-xattr.cpp b/lib/mlibc/options/linux/generic/sys-xattr.cpp new file mode 100644 index 0000000..c8d598f --- /dev/null +++ b/lib/mlibc/options/linux/generic/sys-xattr.cpp @@ -0,0 +1,122 @@ +#include <errno.h> +#include <sys/xattr.h> + +#include <mlibc/linux-sysdeps.hpp> +#include <bits/ensure.h> + +int setxattr(const char *path, const char *name, const void *val, size_t size, + int flags) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setxattr, -1); + + if (int e = sysdep(path, name, val, size, flags); e) { + errno = e; + return -1; + } + return 0; +} + +int lsetxattr(const char *path, const char *name, const void *val, size_t size, + int flags) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_lsetxattr, -1); + + if (int e = sysdep(path, name, val, size, flags); e) { + errno = e; + return -1; + } + return 0; +} + +int fsetxattr(int fd, const char *name, const void *val, size_t size, + int flags) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fsetxattr, -1); + + if (int e = sysdep(fd, name, val, size, flags); e) { + errno = e; + return -1; + } + return 0; +} + +ssize_t getxattr(const char *path, const char *name, void *val, size_t size) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getxattr, -1); + + ssize_t nread; + if (int e = sysdep(path, name, val, size, &nread); e) { + errno = e; + return -1; + } + + return nread; +} + +ssize_t lgetxattr(const char *path, const char *name, void *val, size_t size) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_lgetxattr, -1); + + ssize_t nread; + if (int e = sysdep(path, name, val, size, &nread); e) { + errno = e; + return -1; + } + + return nread; +} + +ssize_t fgetxattr(int fd, const char *name, void *val, size_t size) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fgetxattr, -1); + + ssize_t nread; + if (int e = sysdep(fd, name, val, size, &nread); e) { + errno = e; + return -1; + } + + return nread; +} + +int removexattr(const char *path, const char *name) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_removexattr, -1); + return sysdep(path, name); +} + +int lremovexattr(const char *path, const char *name) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_lremovexattr, -1); + return sysdep(path, name); +} + +int fremovexattr(int fd, const char *name) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fremovexattr, -1); + return sysdep(fd, name); +} + +ssize_t listxattr(const char *path, char *list, size_t size) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_listxattr, -1); + + ssize_t nread; + if (int e = sysdep(path, list, size, &nread); e) { + errno = e; + return -1; + } + return nread; +} + +ssize_t llistxattr(const char *path, char *list, size_t size) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_llistxattr, -1); + + ssize_t nread; + if (int e = sysdep(path, list, size, &nread); e) { + errno = e; + return -1; + } + return nread; +} + +ssize_t flistxattr(int fd, char *list, size_t size) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_flistxattr, -1); + + ssize_t nread; + if (int e = sysdep(fd, list, size, &nread); e) { + errno = e; + return -1; + } + return nread; +} diff --git a/lib/mlibc/options/linux/generic/utmp-stubs.cpp b/lib/mlibc/options/linux/generic/utmp-stubs.cpp new file mode 100644 index 0000000..658dfd3 --- /dev/null +++ b/lib/mlibc/options/linux/generic/utmp-stubs.cpp @@ -0,0 +1,116 @@ +#include <utmp.h> +#include <errno.h> +#include <fcntl.h> +#include <stdlib.h> +#include <unistd.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> + +/* + * The code in this file is largely based on glibc. + * This includes: + * - setutent + * - read_last_entry + * - getutent + * - getutent_r + * - endutent + */ +static int fd = -1; +static off_t offset; + +static struct utmp last_entry; + +void setutent(void) { + if(fd < 0) { + fd = open("/run/utmp", O_RDONLY | O_LARGEFILE | O_CLOEXEC); + if(fd == -1) { + return; + } + } + + lseek(fd, 0, SEEK_SET); + offset = 0; +} + +static ssize_t read_last_entry(void) { + struct utmp buf; + ssize_t bytes_read = pread(fd, &buf, sizeof(buf), offset); + + if(bytes_read < 0) { + return -1; + } else if(bytes_read != sizeof(buf)) { + // EOF + return 0; + } else { + last_entry = buf; + offset += sizeof(buf); + return 1; + } +} + +struct utmp *getutent(void) { + struct utmp *result; + static struct utmp *buf; + if(buf == NULL) { + buf = (struct utmp *)malloc(sizeof(struct utmp)); + if(buf == NULL) { + return NULL; + } + } + + if(getutent_r(buf, &result) < 0) { + return NULL; + } + return result; +} + +int getutent_r(struct utmp *buf, struct utmp **res) { + int saved_errno = errno; + + if(fd < 0) { + setutent(); + } + + ssize_t bytes_read = read_last_entry(); + + if(bytes_read <= 0) { + if(bytes_read == 0) { + errno = saved_errno; + *res = NULL; + return -1; + } + } + + memcpy(buf, &last_entry, sizeof(struct utmp)); + *res = buf; + + return 0; +} + +void endutent(void) { + if(fd >= 0) { + close(fd); + fd = -1; + } +} + +struct utmp *pututline(const struct utmp *) { + mlibc::infoLogger() << "\e[31mmlibc: pututline() is a stub!\e[39m" << frg::endlog; + return NULL; +} + +struct utmp *getutline(const struct utmp *) { + mlibc::infoLogger() << "\e[31mmlibc: getutline() is a stub!\e[39m" << frg::endlog; + return NULL; +} + +int utmpname(const char *) { + mlibc::infoLogger() << "\e[31mmlibc: utmpname() is a stub!\e[39m" << frg::endlog; + return -1; +} + +struct utmp *getutid(const struct utmp *) { + mlibc::infoLogger() << "\e[31mmlibc: getutid() is a stub!\e[39m" << frg::endlog; + return NULL; +} diff --git a/lib/mlibc/options/linux/generic/utmpx.cpp b/lib/mlibc/options/linux/generic/utmpx.cpp new file mode 100644 index 0000000..4742567 --- /dev/null +++ b/lib/mlibc/options/linux/generic/utmpx.cpp @@ -0,0 +1,45 @@ +#include <bits/ensure.h> +#include <stddef.h> +#include <errno.h> +#include <utmpx.h> +#include <mlibc/debug.hpp> + +void updwtmpx(const char *, const struct utmpx *) { + // Empty as musl does + mlibc::infoLogger() << "\e[31mmlibc: updwtmpx() is a stub\e[39m" << frg::endlog; +} + +void endutxent(void) { + // Empty as musl does + mlibc::infoLogger() << "\e[31mmlibc: endutxent() is a stub\e[39m" << frg::endlog; +} + +void setutxent(void) { + // Empty as musl does + mlibc::infoLogger() << "\e[31mmlibc: setutxent() is a stub\e[39m" << frg::endlog; +} + +struct utmpx *getutxent(void) { + // return NULL as musl does + mlibc::infoLogger() << "\e[31mmlibc: getutxent() is a stub\e[39m" << frg::endlog; + return NULL; +} + +struct utmpx *pututxline(const struct utmpx *) { + // return NULL as musl does + mlibc::infoLogger() << "\e[31mmlibc: pututxline() is a stub\e[39m" << frg::endlog; + return NULL; +} + +int utmpxname(const char *) { + // return -1 as musl does + mlibc::infoLogger() << "\e[31mmlibc: utmpxname() is a stub\e[39m" << frg::endlog; + errno = ENOSYS; + return -1; +} + +struct utmpx *getutxid(const struct utmpx *) { + // return NULL as musl does + mlibc::infoLogger() << "\e[31mmlibc: getutxid() is a stub\e[39m" << frg::endlog; + return NULL; +} diff --git a/lib/mlibc/options/linux/include/bits/linux/cpu_set.h b/lib/mlibc/options/linux/include/bits/linux/cpu_set.h new file mode 100644 index 0000000..f3c753e --- /dev/null +++ b/lib/mlibc/options/linux/include/bits/linux/cpu_set.h @@ -0,0 +1,49 @@ +#ifndef _LINUX_CPU_SET_H +#define _LINUX_CPU_SET_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/cpu_set.h> +#include <bits/size_t.h> +#include <limits.h> +#include <stdlib.h> + +#ifndef __MLIBC_ABI_ONLY + +cpu_set_t *__mlibc_cpu_alloc(int num_cpus); +size_t __mlibc_cpu_alloc_size(int num_cpus); + +void __mlibc_cpu_zero(const size_t setsize, cpu_set_t *set); +void __mlibc_cpu_set(const int cpu, const size_t setsize, cpu_set_t *set); +void __mlibc_cpu_clear(const int cpu, const size_t setsize, cpu_set_t *set); +int __mlibc_cpu_isset(const int cpu, const size_t setsize, const cpu_set_t *set); +int __mlibc_cpu_count(const size_t setsize, const cpu_set_t *set); + +#define CPU_ALLOC_SIZE(n) __mlibc_cpu_alloc_size((n)) +#define CPU_ALLOC(n) __mlibc_cpu_alloc((n)) +#define CPU_FREE(set) free((set)) + +#define CPU_ZERO_S(setsize, set) __mlibc_cpu_zero((setsize), (set)) +#define CPU_ZERO(set) CPU_ZERO_S(sizeof(cpu_set_t), set) + +#define CPU_SET_S(cpu, setsize, set) __mlibc_cpu_set((cpu), (setsize), (set)) +#define CPU_SET(cpu, set) CPU_SET_S(cpu, sizeof(cpu_set_t), set) + +#define CPU_CLR_S(cpu, setsize, set) __mlibc_cpu_clear((cpu), (setsize), (set)) +#define CPU_CLR(cpu, set) CPU_CLR_S(cpu, sizeof(cpu_set_t), set) + +#define CPU_ISSET_S(cpu, setsize, set) __mlibc_cpu_isset((cpu), (setsize), (set)) +#define CPU_ISSET(cpu, set) CPU_ISSET_S(cpu, sizeof(cpu_set_t), set) + +#define CPU_COUNT_S(setsize, set) __mlibc_cpu_count((setsize), (set)) +#define CPU_COUNT(set) CPU_COUNT_S(sizeof(cpu_set_t), set) + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* _LINUX_CPU_SET_H */ diff --git a/lib/mlibc/options/linux/include/bits/linux/linux_sched.h b/lib/mlibc/options/linux/include/bits/linux/linux_sched.h new file mode 100644 index 0000000..6a1209a --- /dev/null +++ b/lib/mlibc/options/linux/include/bits/linux/linux_sched.h @@ -0,0 +1,59 @@ + +#ifndef _LINUX_SCHED_H +#define _LINUX_SCHED_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <abi-bits/pid_t.h> +#include <bits/size_t.h> +#include <bits/linux/cpu_set.h> + +#define CLONE_VM 0x00000100 +#define CLONE_FS 0x00000200 +#define CLONE_FILES 0x00000400 +#define CLONE_SIGHAND 0x00000800 +#define CLONE_PTRACE 0x00002000 +#define CLONE_VFORK 0x00004000 +#define CLONE_PARENT 0x00008000 +#define CLONE_THREAD 0x00010000 +#define CLONE_NEWNS 0x00020000 +#define CLONE_SYSVSEM 0x00040000 +#define CLONE_SETTLS 0x00080000 +#define CLONE_PARENT_SETTID 0x00100000 +#define CLONE_CHILD_CLEARTID 0x00200000 +#define CLONE_DETACHED 0x00400000 +#define CLONE_UNTRACED 0x00800000 +#define CLONE_CHILD_SETTID 0x01000000 +#define CLONE_NEWCGROUP 0x02000000 +#define CLONE_NEWUTS 0x04000000 +#define CLONE_NEWIPC 0x08000000 +#define CLONE_NEWUSER 0x10000000 +#define CLONE_NEWPID 0x20000000 +#define CLONE_NEWNET 0x40000000 +#define CLONE_IO 0x80000000 + +#ifndef __MLIBC_ABI_ONLY + +int sched_getscheduler(pid_t pid); +int sched_setaffinity(pid_t pid, size_t cpusetsize, const cpu_set_t *mask); +int sched_getaffinity(pid_t pid, size_t cpusetsize, cpu_set_t *mask); + +int unshare(int flags); +int clone(int (*)(void *), void *, int, void *, ...); + +/* Glibc extension */ +int sched_getcpu(void); + +#if defined(_GNU_SOURCE) +int setns(int fd, int nstype); +#endif /* _GNU_SOURCE */ + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* _LINUX_SCHED_H */ diff --git a/lib/mlibc/options/linux/include/bits/linux/linux_unistd.h b/lib/mlibc/options/linux/include/bits/linux/linux_unistd.h new file mode 100644 index 0000000..77534ba --- /dev/null +++ b/lib/mlibc/options/linux/include/bits/linux/linux_unistd.h @@ -0,0 +1,21 @@ +#ifndef _LINUX_UNISTD_H +#define _LINUX_UNISTD_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int dup3(int fd, int newfd, int flags); +int vhangup(void); +int getdtablesize(void); +int syncfs(int fd); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _LINUX_UNISTD_H diff --git a/lib/mlibc/options/linux/include/ifaddrs.h b/lib/mlibc/options/linux/include/ifaddrs.h new file mode 100644 index 0000000..2604e3e --- /dev/null +++ b/lib/mlibc/options/linux/include/ifaddrs.h @@ -0,0 +1,35 @@ + +#ifndef _IFADDRS_H +#define _IFADDRS_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <netinet/in.h> +#include <sys/socket.h> + +// Struct definitions taken from musl +struct ifaddrs { + struct ifaddrs *ifa_next; + char *ifa_name; + unsigned ifa_flags; + struct sockaddr *ifa_addr; + struct sockaddr *ifa_netmask; + struct sockaddr *ifa_broadaddr; + struct sockaddr *ifa_dstaddr; + void *ifa_data; +}; + +#ifndef __MLIBC_ABI_ONLY + +int getifaddrs(struct ifaddrs **); +void freeifaddrs(struct ifaddrs *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _IFADDRS_H diff --git a/lib/mlibc/options/linux/include/lastlog.h b/lib/mlibc/options/linux/include/lastlog.h new file mode 100644 index 0000000..0930aaf --- /dev/null +++ b/lib/mlibc/options/linux/include/lastlog.h @@ -0,0 +1,2 @@ +// Maches glibc +#include <utmp.h>
\ No newline at end of file diff --git a/lib/mlibc/options/linux/include/linux/libc-compat.h b/lib/mlibc/options/linux/include/linux/libc-compat.h new file mode 100644 index 0000000..696f4af --- /dev/null +++ b/lib/mlibc/options/linux/include/linux/libc-compat.h @@ -0,0 +1,61 @@ +#ifndef _LINUX_LIBC_COMPAT_H +#define _LINUX_LIBC_COMPAT_H + +#if defined(_NET_IF_H) + +#define __UAPI_DEF_IF_IFCONF 0 +#define __UAPI_DEF_IF_IFMAP 0 +#define __UAPI_DEF_IF_IFNAMSIZ 0 +#define __UAPI_DEF_IF_IFREQ 0 +#define __UAPI_DEF_IF_NET_DEVICE_FLAGS 0 + +#else // _NET_IF_H + +#define __UAPI_DEF_IF_IFCONF 1 +#define __UAPI_DEF_IF_IFMAP 1 +#define __UAPI_DEF_IF_IFNAMSIZ 1 +#define __UAPI_DEF_IF_IFREQ 1 +#define __UAPI_DEF_IF_NET_DEVICE_FLAGS 1 +#define __UAPI_DEF_IF_NET_DEVICE_FLAGS_LOWER_UP_DORMANT_ECHO 1 + +#endif //_NET_IF_H + +#if defined(_NETINET_IN_H) + +#define __UAPI_DEF_IN_ADDR 0 +#define __UAPI_DEF_IN_CLASS 0 +#define __UAPI_DEF_IN_IPPROTO 0 +#define __UAPI_DEF_IN_PKTINFO 0 +#define __UAPI_DEF_IP_MREQ 0 +#define __UAPI_DEF_SOCKADDR_IN 0 + +#define __UAPI_DEF_IN6_ADDR 0 +#define __UAPI_DEF_IN6_ADDR_ALT 1 +#define __UAPI_DEF_IN6_PKTINFO 0 +#define __UAPI_DEF_IP6_MTUINFO 0 +#define __UAPI_DEF_IPPROTO_V6 0 +#define __UAPI_DEF_IPV6_MREQ 0 +#define __UAPI_DEF_IPV6_OPTIONS 0 +#define __UAPI_DEF_SOCKADDR_IN6 0 + +#else + +#define __UAPI_DEF_IN_ADDR 1 +#define __UAPI_DEF_IN_CLASS 1 +#define __UAPI_DEF_IN_IPPROTO 1 +#define __UAPI_DEF_IN_PKTINFO 1 +#define __UAPI_DEF_IP_MREQ 1 +#define __UAPI_DEF_SOCKADDR_IN 1 + +#define __UAPI_DEF_IN6_ADDR 1 +#define __UAPI_DEF_IN6_ADDR_ALT 1 +#define __UAPI_DEF_IN6_PKTINFO 1 +#define __UAPI_DEF_IP6_MTUINFO 1 +#define __UAPI_DEF_IPPROTO_V6 1 +#define __UAPI_DEF_IPV6_MREQ 1 +#define __UAPI_DEF_IPV6_OPTIONS 1 +#define __UAPI_DEF_SOCKADDR_IN6 1 + +#endif /* _NETINET_IN_H */ + +#endif // _LINUX_LIBC_COMPAT_H diff --git a/lib/mlibc/options/linux/include/malloc.h b/lib/mlibc/options/linux/include/malloc.h new file mode 100644 index 0000000..b03f9b4 --- /dev/null +++ b/lib/mlibc/options/linux/include/malloc.h @@ -0,0 +1,32 @@ + +#ifndef _MALLOC_H +#define _MALLOC_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/size_t.h> +#include <mlibc-config.h> + +#ifndef __MLIBC_ABI_ONLY + +// [7.22.3] Memory management functions +void *calloc(size_t count, size_t size); +void free(void *pointer); +void *malloc(size_t size); +void *realloc(void *pointer, size_t size); +void *memalign(size_t, size_t); + +#if __MLIBC_GLIBC_OPTION +#include <bits/glibc/glibc_malloc.h> +#endif + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _MALLOC_H + diff --git a/lib/mlibc/options/linux/include/memory.h b/lib/mlibc/options/linux/include/memory.h new file mode 100644 index 0000000..586822b --- /dev/null +++ b/lib/mlibc/options/linux/include/memory.h @@ -0,0 +1,9 @@ + +#ifndef _MEMORY_H +#define _MEMORY_H + +// This is a linux extension +#include <string.h> + +#endif // _MEMORY_H + diff --git a/lib/mlibc/options/linux/include/mlibc/linux-sysdeps.hpp b/lib/mlibc/options/linux/include/mlibc/linux-sysdeps.hpp new file mode 100644 index 0000000..b18544a --- /dev/null +++ b/lib/mlibc/options/linux/include/mlibc/linux-sysdeps.hpp @@ -0,0 +1,82 @@ +#ifndef MLIBC_LINUX_SYSDEPS +#define MLIBC_LINUX_SYSDEPS + +#include <sched.h> +#include <stdarg.h> +#include <sys/epoll.h> +#include <sys/sysinfo.h> +#include <sys/statfs.h> +#include <poll.h> +#include <abi-bits/pid_t.h> +#include <abi-bits/mode_t.h> +#include <bits/ssize_t.h> +#include <bits/size_t.h> + +namespace [[gnu::visibility("hidden")]] mlibc { + +int sys_open(const char *pathname, int flags, mode_t mode, int *fd); +int sys_close(int fd); +int sys_read(int fd, void *buf, size_t count, ssize_t *bytes_read); +int sys_write(int fd, const void *buf, size_t count, ssize_t *bytes_written); +int sys_ioctl(int fd, unsigned long request, void *arg, int *result); + +[[gnu::weak]] int sys_dup2(int fd, int flags, int newfd); +[[gnu::weak]] int sys_fork(pid_t *child); +[[gnu::weak]] int sys_inotify_create(int flags, int *fd); +[[gnu::weak]] int sys_inotify_add_watch(int ifd, const char *path, uint32_t mask, int *wd); +[[gnu::weak]] int sys_inotify_rm_watch(int ifd, int wd); +[[gnu::weak]] int sys_epoll_create(int flags, int *fd); +[[gnu::weak]] int sys_epoll_ctl(int epfd, int mode, int fd, struct epoll_event *ev); +[[gnu::weak]] int sys_epoll_pwait(int epfd, struct epoll_event *ev, int n, + int timeout, const sigset_t *sigmask, int *raised); +[[gnu::weak]] int sys_mount(const char *source, const char *target, + const char *fstype, unsigned long flags, const void *data); +[[gnu::weak]] int sys_umount2(const char *target, int flags); +[[gnu::weak]] int sys_eventfd_create(unsigned int initval, int flags, int *fd); +[[gnu::weak]] int sys_timerfd_create(int clockid, int flags, int *fd); +[[gnu::weak]] int sys_timerfd_settime(int fd, int flags, + const struct itimerspec *value, struct itimerspec *oldvalue); +[[gnu::weak]] int sys_signalfd_create(const sigset_t *, int flags, int *fd); +[[gnu::weak]] int sys_reboot(int cmd); +[[gnu::weak]] int sys_ptrace(long req, pid_t pid, void *addr, void *data, long *out); +[[gnu::weak]] int sys_prctl(int option, va_list va, int *out); +[[gnu::weak]] int sys_init_module(void *module, unsigned long length, const char *args); +[[gnu::weak]] int sys_delete_module(const char *name, unsigned flags); +[[gnu::weak]] int sys_klogctl(int type, char *bufp, int len, int *out); +[[gnu::weak]] int sys_getcpu(int *cpu); + +[[gnu::weak]] int sys_sysinfo(struct sysinfo *info); +[[gnu::weak]] int sys_swapon(const char *path, int flags); +[[gnu::weak]] int sys_swapoff(const char *path); + +[[gnu::weak]] int sys_setxattr(const char *path, const char *name, + const void *val, size_t size, int flags); +[[gnu::weak]] int sys_lsetxattr(const char *path, const char *name, + const void *val, size_t size, int flags); +[[gnu::weak]] int sys_fsetxattr(int fd, const char *name, const void *val, + size_t size, int flags); + +[[gnu::weak]] int sys_getxattr(const char *path, const char *name, + void *val, size_t size, ssize_t *nread); +[[gnu::weak]] int sys_lgetxattr(const char *path, const char *name, + void *val, size_t size, ssize_t *nread); +[[gnu::weak]] int sys_fgetxattr(int fd, const char *name, void *val, + size_t size, ssize_t *nread); + +[[gnu::weak]] int sys_listxattr(const char *path, char *list, size_t size, + ssize_t *nread); +[[gnu::weak]] int sys_llistxattr(const char *path, char *list, size_t size, + ssize_t *nread); +[[gnu::weak]] int sys_flistxattr(int fd, char *list, size_t size, + ssize_t *nread); + +[[gnu::weak]] int sys_removexattr(const char *path, const char *name); +[[gnu::weak]] int sys_lremovexattr(const char *path, const char *name); +[[gnu::weak]] int sys_fremovexattr(int fd, const char *name); + +[[gnu::weak]] int sys_statfs(const char *path, struct statfs *buf); +[[gnu::weak]] int sys_fstatfs(int fd, struct statfs *buf); + +} // namespace mlibc + +#endif // MLIBX_LINUX_SYSDEPS diff --git a/lib/mlibc/options/linux/include/mntent.h b/lib/mlibc/options/linux/include/mntent.h new file mode 100644 index 0000000..bafd289 --- /dev/null +++ b/lib/mlibc/options/linux/include/mntent.h @@ -0,0 +1,50 @@ +#ifndef _MNTENT_H +#define _MNTENT_H + +#include <stdio.h> + +// TODO: Refer to _PATH_MOUNTED +#define MOUNTED "/etc/mtab" + +/* Generic mount options */ +#define MNTOPT_DEFAULTS "defaults" /* Use all default options. */ +#define MNTOPT_RO "ro" /* Read only. */ +#define MNTOPT_RW "rw" /* Read/write. */ +#define MNTOPT_SUID "suid" /* Set uid allowed. */ +#define MNTOPT_NOSUID "nosuid" /* No set uid allowed. */ +#define MNTOPT_NOAUTO "noauto" /* Do not auto mount. */ + +#ifdef __cplusplus +extern "C" { +#endif + +struct mntent { + char *mnt_fsname; + char *mnt_dir; + char *mnt_type; + char *mnt_opts; + int mnt_freq; + int mnt_passno; +}; + +#ifndef __MLIBC_ABI_ONLY + +FILE *setmntent(const char *, const char *); + +struct mntent *getmntent(FILE *); + +int addmntent(FILE *, const struct mntent *); + +int endmntent(FILE *); + +char *hasmntopt(const struct mntent *, const char *); + +struct mntent *getmntent_r(FILE *, struct mntent *, char *, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _MNTENT_H diff --git a/lib/mlibc/options/linux/include/module.h b/lib/mlibc/options/linux/include/module.h new file mode 100644 index 0000000..ef715a4 --- /dev/null +++ b/lib/mlibc/options/linux/include/module.h @@ -0,0 +1,25 @@ +#ifndef _MODULE_H +#define _MODULE_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +/* + * Musl adds these, even though they aren't specified, but doesn't export them. + * See https://github.com/bminor/musl/commit/2169265ec6c902cd460bf96a1a0b5103657a4954 + * for more information and the rationale behind it. + * For our infrastructure, we expose them, and make it call into the sysdeps. + */ +int init_module(void *module, unsigned long len, const char *args); +int delete_module(const char *name, unsigned flags); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _MODULE_H diff --git a/lib/mlibc/options/linux/include/netpacket/packet.h b/lib/mlibc/options/linux/include/netpacket/packet.h new file mode 100644 index 0000000..1fa0917 --- /dev/null +++ b/lib/mlibc/options/linux/include/netpacket/packet.h @@ -0,0 +1,40 @@ +#ifndef _NETPACKET_PACKET_H +#define _NETPACKET_PACKET_H + +#include <abi-bits/packet.h> + +/* Packet types */ +#define PACKET_HOST 0 +#define PACKET_BROADCAST 1 +#define PACKET_MULTICAST 2 +#define PACKET_OTHERHOST 3 +#define PACKET_OUTGOING 4 +#define PACKET_LOOPBACK 5 +#define PACKET_FASTROUTE 6 + +struct sockaddr_ll { + unsigned short int sll_family; + unsigned short int sll_protocol; + int sll_ifindex; + unsigned short int sll_hatype; + unsigned char sll_pkttype; + unsigned char sll_halen; + unsigned char sll_addr[8]; +}; + +struct packet_mreq { + int mr_ifindex; + unsigned short int mr_type; + unsigned short int mr_alen; + unsigned char mr_address[8]; +}; + +#define PACKET_ADD_MEMBERSHIP 1 +#define PACKET_DROP_MEMBERSHIP 2 + +#define PACKET_MR_MULTICAST 0 +#define PACKET_MR_PROMISC 1 +#define PACKET_MR_ALLMULTI 2 +#define PACKET_MR_UNICAST 3 + +#endif // _NETPACKET_PACKET_H diff --git a/lib/mlibc/options/linux/include/pty.h b/lib/mlibc/options/linux/include/pty.h new file mode 100644 index 0000000..562fbb8 --- /dev/null +++ b/lib/mlibc/options/linux/include/pty.h @@ -0,0 +1,23 @@ + +#ifndef _PTY_H +#define _PTY_H + +#include <termios.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int openpty(int *, int *, char *, const struct termios *, const struct winsize *); +int forkpty(int *, char *, const struct termios *, const struct winsize *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _PTY_H + diff --git a/lib/mlibc/options/linux/include/scsi/scsi.h b/lib/mlibc/options/linux/include/scsi/scsi.h new file mode 100644 index 0000000..f7f92d8 --- /dev/null +++ b/lib/mlibc/options/linux/include/scsi/scsi.h @@ -0,0 +1,18 @@ + +#ifndef _LINUX_SCSI_SCSI_H +#define _LINUX_SCSI_SCSI_H + +#define RECOVERED_ERROR 0x01 +#define ILLEGAL_REQUEST 0x05 +#define UNIT_ATTENTION 0x06 +#define INQUIRY 0x12 +#define START_STOP 0x1b +#define ALLOW_MEDIUM_REMOVAL 0x1e + +#define SCSI_IOCTL_GET_IDLUN 0x5382 +#define SCSI_IOCTL_TAGGED_ENABLE 0x5383 +#define SCSI_IOCTL_TAGGED_DISABLE 0x5384 +#define SCSI_IOCTL_PROBE_HOST 0x5385 + +#endif // _LINUX_SCSI_SCSI_H + diff --git a/lib/mlibc/options/linux/include/scsi/scsi_ioctl.h b/lib/mlibc/options/linux/include/scsi/scsi_ioctl.h new file mode 100644 index 0000000..16c7cfa --- /dev/null +++ b/lib/mlibc/options/linux/include/scsi/scsi_ioctl.h @@ -0,0 +1,6 @@ + +#ifndef _LINUX_SCSI_SCSI_IOCTL_H +#define _LINUX_SCSI_SCSI_IOCTL_H + +#endif // _LINUX_SCSI_SCSI_IOCTL_H + diff --git a/lib/mlibc/options/linux/include/scsi/sg.h b/lib/mlibc/options/linux/include/scsi/sg.h new file mode 100644 index 0000000..a9dfc7a --- /dev/null +++ b/lib/mlibc/options/linux/include/scsi/sg.h @@ -0,0 +1,77 @@ + +#ifndef _LINUX_SCSI_SG_H +#define _LINUX_SCSI_SG_H + +#define SG_IO 0x2285 + +#define SG_GET_VERSION_NUM 0x2282 + +#define SG_FLAG_DIRECT_IO 1 +#define SG_FLAG_LUN_INHIBIT 2 + +#define SG_INFO_OK 0x0 +#define SG_INFO_OK_MASK 0x1 + +#define SG_DXFER_NONE (-1) +#define SG_DXFER_TO_DEV (-2) +#define SG_DXFER_FROM_DEV (-3) +#define SG_DXFER_TO_FROM_DEV (-4) + +#ifdef __cplusplus +extern "C" { +#endif + +typedef struct sg_io_hdr { + int interface_id; + int dxfer_direction; + unsigned char cmd_len; + unsigned char mx_sb_len; + unsigned short iovec_count; + unsigned int dxfer_len; + void *dxferp; + unsigned char *cmdp; + unsigned char *sbp; + unsigned int timeout; + unsigned int flags; + int pack_id; + void *usr_ptr; + unsigned char status; + unsigned char masked_status; + unsigned char msg_status; + unsigned char sb_len_wr; + unsigned short host_status; + unsigned short driver_status; + int resid; + unsigned int duration; + unsigned int info; +} sg_io_hdr_t; + +struct sg_scsi_id { + int host_no; + int channel; + int scsi_id; + int lun; + int scsi_type; + short int h_cmd_per_lun; + short int d_queue_depth; + int unused[2]; +}; + +typedef struct sg_req_info { + char req_state; + char orphan; + char sg_io_owned; + char problem; + int pack_id; + void *usr_ptr; + unsigned int duration; + + int unused; +} sg_req_info_t; + +#ifdef __cplusplus +} +#endif + +#endif // _LINUX_SCSI_SG_H + diff --git a/lib/mlibc/options/linux/include/sys/epoll.h b/lib/mlibc/options/linux/include/sys/epoll.h new file mode 100644 index 0000000..f84da7a --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/epoll.h @@ -0,0 +1,66 @@ +#ifndef _SYS_EPOLL_H +#define _SYS_EPOLL_H + +#include <stdint.h> +#include <abi-bits/signal.h> +#include <abi-bits/epoll.h> +#include <abi-bits/fcntl.h> + +#define EPOLL_NONBLOCK O_NONBLOCK + +// These constants match the Linux definitions. +#define EPOLLIN 0x001 +#define EPOLLPRI 0x002 +#define EPOLLOUT 0x004 +#define EPOLLRDNORM 0x040 +#define EPOLLRDBAND 0x080 +#define EPOLLWRNORM 0x100 +#define EPOLLWRBAND 0x200 +#define EPOLLMSG 0x400 +#define EPOLLERR 0x008 +#define EPOLLHUP 0x010 +#define EPOLLRDHUP 0x2000 +#define EPOLLEXCLUSIVE (1U << 28) +#define EPOLLWAKEUP (1U << 29) +#define EPOLLONESHOT (1U << 30) +#define EPOLLET (1U << 31) + +#define EPOLL_CTL_ADD 1 +#define EPOLL_CTL_DEL 2 +#define EPOLL_CTL_MOD 3 + +#ifdef __cplusplus +extern "C" { +#endif + +typedef union epoll_data { + void *ptr; + int fd; + uint32_t u32; + uint64_t u64; +} epoll_data_t; + +struct epoll_event { + uint32_t events; + epoll_data_t data; +} +#ifdef __x86_64__ +__attribute__((__packed__)) +#endif +; + +#ifndef __MLIBC_ABI_ONLY + +int epoll_create(int); +int epoll_create1(int); +int epoll_ctl(int, int, int, struct epoll_event *); +int epoll_wait(int, struct epoll_event *, int, int); +int epoll_pwait(int, struct epoll_event *, int, int, const sigset_t *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_EPOLL_H diff --git a/lib/mlibc/options/linux/include/sys/eventfd.h b/lib/mlibc/options/linux/include/sys/eventfd.h new file mode 100644 index 0000000..454a8c1 --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/eventfd.h @@ -0,0 +1,29 @@ +#ifndef _SYS_EVENTFD_H +#define _SYS_EVENTFD_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <stdint.h> +#include <fcntl.h> + +typedef uint64_t eventfd_t; + +#define EFD_SEMAPHORE 1 +#define EFD_CLOEXEC O_CLOEXEC +#define EFD_NONBLOCK O_NONBLOCK + +#ifndef __MLIBC_ABI_ONLY + +int eventfd(unsigned int, int); +int eventfd_read(int, eventfd_t *); +int eventfd_write(int, eventfd_t); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_EVENTFD_H diff --git a/lib/mlibc/options/linux/include/sys/fsuid.h b/lib/mlibc/options/linux/include/sys/fsuid.h new file mode 100644 index 0000000..9df9efc --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/fsuid.h @@ -0,0 +1,22 @@ +#ifndef _SYS_FSUID_H +#define _SYS_FSUID_H + +#include <abi-bits/uid_t.h> +#include <abi-bits/gid_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int setfsuid(uid_t uid); +int setfsgid(gid_t gid); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_FSUID_H diff --git a/lib/mlibc/options/linux/include/sys/inotify.h b/lib/mlibc/options/linux/include/sys/inotify.h new file mode 100644 index 0000000..3c48403 --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/inotify.h @@ -0,0 +1,63 @@ +#ifndef _SYS_INOTIFY_H +#define _SYS_INOTIFY_H + +#include <stdint.h> +#include <abi-bits/fcntl.h> +#include <abi-bits/inotify.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#define IN_ACCESS 0x1 +#define IN_ATTRIB 0x4 +#define IN_CLOSE_WRITE 0x8 +#define IN_CLOSE_NOWRITE 0x10 +#define IN_CREATE 0x100 +#define IN_DELETE 0x200 +#define IN_DELETE_SELF 0x400 +#define IN_MODIFY 0x2 +#define IN_MOVE_SELF 0x800 +#define IN_MOVED_FROM 0x40 +#define IN_MOVED_TO 0x80 +#define IN_OPEN 0x20 +#define IN_MOVE (IN_MOVED_FROM | IN_MOVED_TO) +#define IN_CLOSE (IN_CLOSE_WRITE | IN_CLOSE_NOWRITE) +#define IN_DONT_FOLLOW 0x2000000 +#define IN_EXCL_UNLINK 0x4000000 +#define IN_MASK_ADD 0x20000000 +#define IN_ONESHOT 0x80000000 +#define IN_ONLYDIR 0x1000000 +#define IN_IGNORED 0x8000 +#define IN_ISDIR 0x40000000 +#define IN_Q_OVERFLOW 0x4000 +#define IN_UNMOUNT 0x2000 + +#define IN_ALL_EVENTS (IN_ACCESS | IN_MODIFY | IN_ATTRIB | IN_CLOSE_WRITE | \ + IN_CLOSE_NOWRITE | IN_OPEN | IN_MOVED_FROM | \ + IN_MOVED_TO | IN_DELETE | IN_CREATE | IN_DELETE_SELF | \ + IN_MOVE_SELF) + +struct inotify_event { + int wd; + unsigned int mask; + unsigned int cookie; + unsigned int len; + char name[]; +}; + +#ifndef __MLIBC_ABI_ONLY + +int inotify_init(void); +int inotify_init1(int); +int inotify_add_watch(int, const char *, uint32_t); +int inotify_rm_watch(int, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif //_SYS_INOTIFY_H + diff --git a/lib/mlibc/options/linux/include/sys/klog.h b/lib/mlibc/options/linux/include/sys/klog.h new file mode 100644 index 0000000..520bdd1 --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/klog.h @@ -0,0 +1,18 @@ +#ifndef _SYS_KLOG_H +#define _SYS_KLOG_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int klogctl(int type, char *bufp, int len); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* _SYS_KLOG_H */ diff --git a/lib/mlibc/options/linux/include/sys/mount.h b/lib/mlibc/options/linux/include/sys/mount.h new file mode 100644 index 0000000..2486128 --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/mount.h @@ -0,0 +1,90 @@ +#ifndef _SYS_MOUNT_H +#define _SYS_MOUNT_H + +#include <asm/ioctl.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#define MS_RDONLY 1 +#define MS_NOSUID 2 +#define MS_NODEV 4 +#define MS_NOEXEC 8 +#define MS_SYNCHRONOUS 16 +#define MS_REMOUNT 32 +#define MS_MANDLOCK 64 +#define MS_DIRSYNC 128 +#define MS_NOSYMFOLLOW 256 +#define MS_NOATIME 1024 +#define MS_NODIRATIME 2048 +#define MS_BIND 4096 +#define MS_MOVE 8192 +#define MS_REC 16384 +#define MS_SILENT 32768 +#define MS_POSIXACL (1 << 16) +#define MS_UNBINDABLE (1 << 17) +#define MS_PRIVATE (1 << 18) +#define MS_SLAVE (1 << 19) +#define MS_SHARED (1 << 20) +#define MS_RELATIME (1 << 21) +#define MS_KERNMOUNT (1 << 22) +#define MS_I_VERSION (1 << 23) +#define MS_STRICTATIME (1 << 24) +#define MS_LAZYTIME (1 << 25) +#define MS_NOREMOTELOCK (1 << 27) +#define MS_NOSEC (1 << 28) +#define MS_BORN (1 << 29) +#define MS_ACTIVE (1 << 30) +#define MS_NOUSER (1 << 31) + +#define MNT_FORCE 1 +#define MNT_DETACH 2 +#define MNT_EXPIRE 4 +#define UMOUNT_NOFOLLOW 8 + +#undef BLKROSET +#define BLKROSET _IO(0x12, 93) +#undef BLKROGET +#define BLKROGET _IO(0x12, 94) +#undef BLKRRPART +#define BLKRRPART _IO(0x12, 95) +#undef BLKGETSIZE +#define BLKGETSIZE _IO(0x12, 96) +#undef BLKFLSBUF +#define BLKFLSBUF _IO(0x12, 97) +#undef BLKRASET +#define BLKRASET _IO(0x12, 98) +#undef BLKRAGET +#define BLKRAGET _IO(0x12, 99) +#undef BLKFRASET +#define BLKFRASET _IO(0x12, 100) +#undef BLKFRAGET +#define BLKFRAGET _IO(0x12, 101) +#undef BLKSECTSET +#define BLKSECTSET _IO(0x12, 102) +#undef BLKSECTGET +#define BLKSECTGET _IO(0x12, 103) +#undef BLKSSZGET +#define BLKSSZGET _IO(0x12, 104) +#undef BLKBSZGET +#define BLKBSZGET _IOR(0x12, 112, size_t) +#undef BLKBSZSET +#define BLKBSZSET _IOW(0x12, 113, size_t) +#undef BLKGETSIZE64 +#define BLKGETSIZE64 _IOR(0x12, 114, size_t) + +#ifndef __MLIBC_ABI_ONLY + +int mount(const char *source, const char *target, + const char *fstype, unsigned long flags, const void *data); +int umount(const char *target); +int umount2(const char *target, int flags); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_MOUNT_H diff --git a/lib/mlibc/options/linux/include/sys/prctl.h b/lib/mlibc/options/linux/include/sys/prctl.h new file mode 100644 index 0000000..de987c1 --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/prctl.h @@ -0,0 +1,128 @@ + +#ifndef _SYS_PRCTL_H +#define _SYS_PRCTL_H + +#include <stdint.h> + +#define PR_SET_PDEATHSIG 1 +#define PR_GET_PDEATHSIG 2 +#define PR_GET_DUMPABLE 3 +#define PR_SET_DUMPABLE 4 +#define PR_GET_UNALIGN 5 +#define PR_SET_UNALIGN 6 +#define PR_UNALIGN_NOPRINT 1 +#define PR_UNALIGN_SIGBUS 2 +#define PR_GET_KEEPCAPS 7 +#define PR_SET_KEEPCAPS 8 +#define PR_GET_FPEMU 9 +#define PR_SET_FPEMU 10 +#define PR_FPEMU_NOPRINT 1 +#define PR_FPEMU_SIGFPE 2 +#define PR_GET_FPEXC 11 +#define PR_SET_FPEXC 12 +#define PR_FP_EXC_SW_ENABLE 0x80 +#define PR_FP_EXC_DIV 0x010000 +#define PR_FP_EXC_OVF 0x020000 +#define PR_FP_EXC_UND 0x040000 +#define PR_FP_EXC_RES 0x080000 +#define PR_FP_EXC_INV 0x100000 +#define PR_FP_EXC_DISABLED 0 +#define PR_FP_EXC_NONRECOV 1 +#define PR_FP_EXC_ASYNC 2 +#define PR_FP_EXC_PRECISE 3 +#define PR_GET_TIMING 13 +#define PR_SET_TIMING 14 +#define PR_TIMING_STATISTICAL 0 +#define PR_TIMING_TIMESTAMP 1 +#define PR_SET_NAME 15 +#define PR_GET_NAME 16 +#define PR_GET_ENDIAN 19 +#define PR_SET_ENDIAN 20 +#define PR_ENDIAN_BIG 0 +#define PR_ENDIAN_LITTLE 1 +#define PR_ENDIAN_PPC_LITTLE 2 +#define PR_GET_SECCOMP 21 +#define PR_SET_SECCOMP 22 +#define PR_CAPBSET_READ 23 +#define PR_CAPBSET_DROP 24 +#define PR_GET_TSC 25 +#define PR_SET_TSC 26 +#define PR_TSC_ENABLE 1 +#define PR_TSC_SIGSEGV 2 +#define PR_GET_SECUREBITS 27 +#define PR_SET_SECUREBITS 28 +#define PR_SET_TIMERSLACK 29 +#define PR_GET_TIMERSLACK 30 + +#define PR_TASK_PERF_EVENTS_DISABLE 31 +#define PR_TASK_PERF_EVENTS_ENABLE 32 + +#define PR_MCE_KILL 33 +#define PR_MCE_KILL_CLEAR 0 +#define PR_MCE_KILL_SET 1 +#define PR_MCE_KILL_LATE 0 +#define PR_MCE_KILL_EARLY 1 +#define PR_MCE_KILL_DEFAULT 2 +#define PR_MCE_KILL_GET 34 + +#define PR_SET_MM 35 +#define PR_SET_MM_START_CODE 1 +#define PR_SET_MM_END_CODE 2 +#define PR_SET_MM_START_DATA 3 +#define PR_SET_MM_END_DATA 4 +#define PR_SET_MM_START_STACK 5 +#define PR_SET_MM_START_BRK 6 +#define PR_SET_MM_BRK 7 +#define PR_SET_MM_ARG_START 8 +#define PR_SET_MM_ARG_END 9 +#define PR_SET_MM_ENV_START 10 +#define PR_SET_MM_ENV_END 11 +#define PR_SET_MM_AUXV 12 +#define PR_SET_MM_EXE_FILE 13 +#define PR_SET_MM_MAP 14 +#define PR_SET_MM_MAP_SIZE 15 + +#define PR_SET_PTRACER 0x59616d61 +#define PR_SET_PTRACER_ANY (-1UL) + +#define PR_SET_CHILD_SUBREAPER 36 +#define PR_GET_CHILD_SUBREAPER 37 + +#define PR_SET_NO_NEW_PRIVS 38 +#define PR_GET_NO_NEW_PRIVS 39 + +#define PR_GET_TID_ADDRESS 40 + +#define PR_SET_THP_DISABLE 41 +#define PR_GET_THP_DISABLE 42 + +#define PR_MPX_ENABLE_MANAGEMENT 43 +#define PR_MPX_DISABLE_MANAGEMENT 44 + +#define PR_SET_FP_MODE 45 +#define PR_GET_FP_MODE 46 +#define PR_FP_MODE_FR (1 << 0) +#define PR_FP_MODE_FRE (1 << 1) + +#define PR_CAP_AMBIENT 47 +#define PR_CAP_AMBIENT_IS_SET 1 +#define PR_CAP_AMBIENT_RAISE 2 +#define PR_CAP_AMBIENT_LOWER 3 +#define PR_CAP_AMBIENT_CLEAR_ALL 4 + +#ifndef __MLIBC_ABI_ONLY + +#ifdef __cplusplus +extern "C" { +#endif + +int prctl (int, ...); + +#ifdef __cplusplus +} +#endif + +#endif /* !__MLIBC_ABI_ONLY */ + +#endif // _SYS_PRCTL_H + diff --git a/lib/mlibc/options/linux/include/sys/ptrace.h b/lib/mlibc/options/linux/include/sys/ptrace.h new file mode 100644 index 0000000..e98d38a --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/ptrace.h @@ -0,0 +1,55 @@ + +#ifndef _SYS_PTRACE_H +#define _SYS_PTRACE_H + +#include <abi-bits/ptrace.h> +#include <stdint.h> + +#define PTRACE_TRACEME 0 +#define PT_TRACE_ME PTRACE_TRACEME + +#define PT_READ_I PTRACE_PEEKTEXT +#define PT_READ_D PTRACE_PEEKDATA +#define PT_READ_U PTRACE_PEEKUSER +#define PT_WRITE_I PTRACE_POKETEXT +#define PT_WRITE_D PTRACE_POKEDATA +#define PT_WRITE_U PTRACE_POKEUSER +#define PT_CONTINUE PTRACE_CONT +#define PT_KILL PTRACE_KILL +#define PT_STEP PTRACE_SINGLESTEP +#define PT_GETREGS PTRACE_GETREGS +#define PT_SETREGS PTRACE_SETREGS +#define PT_GETFPREGS PTRACE_GETFPREGS +#define PT_SETFPREGS PTRACE_SETFPREGS +#define PT_ATTACH PTRACE_ATTACH +#define PT_DETACH PTRACE_DETACH +#define PT_GETFPXREGS PTRACE_GETFPXREGS +#define PT_SETFPXREGS PTRACE_SETFPXREGS +#define PT_SYSCALL PTRACE_SYSCALL +#define PT_SETOPTIONS PTRACE_SETOPTIONS +#define PT_GETEVENTMSG PTRACE_GETEVENTMSG +#define PT_GETSIGINFO PTRACE_GETSIGINFO +#define PT_SETSIGINFO PTRACE_SETSIGINFO + +#ifdef __cplusplus +extern "C" { +#endif + +struct ptrace_peeksiginfo_args { + uint64_t offset; + uint32_t flags; + int32_t nr; +}; + +#ifndef __MLIBC_ABI_ONLY + +long ptrace(int, ...); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_PTRACE_H + diff --git a/lib/mlibc/options/linux/include/sys/quota.h b/lib/mlibc/options/linux/include/sys/quota.h new file mode 100644 index 0000000..f668d9b --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/quota.h @@ -0,0 +1,24 @@ +#ifndef _SYS_QUOTA_H +#define _SYS_QUOTA_H + +#include <sys/types.h> + +#define SUBCMDMASK 0x00ff +#define SUBCMDSHIFT 8 +#define QCMD(cmd, type) (((cmd) << SUBCMDSHIFT) | ((type) & SUBCMDMASK)) + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int quotactl(int cmd, const char *special, int id, caddr_t addr); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_QUOTA_H diff --git a/lib/mlibc/options/linux/include/sys/random.h b/lib/mlibc/options/linux/include/sys/random.h new file mode 100644 index 0000000..0b24b74 --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/random.h @@ -0,0 +1,26 @@ + +#ifndef _SYS_RANDOM_H +#define _SYS_RANDOM_H + +#ifdef __cplusplus +extern "C" { +#endif + +#define GRND_RANDOM 1 +#define GRND_NONBLOCK 2 + +#include <bits/ssize_t.h> +#include <bits/size_t.h> + +#ifndef __MLIBC_ABI_ONLY + +ssize_t getrandom(void *, size_t, unsigned int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif //_SYS_RANDOM_H + diff --git a/lib/mlibc/options/linux/include/sys/reboot.h b/lib/mlibc/options/linux/include/sys/reboot.h new file mode 100644 index 0000000..6c4e495 --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/reboot.h @@ -0,0 +1,20 @@ +#ifndef MLIBC_SYS_REBOOT_H +#define MLIBC_SYS_REBOOT_H + +#include <abi-bits/reboot.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int reboot(int arg); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // MLIBC_SYS_REBOOT_H diff --git a/lib/mlibc/options/linux/include/sys/sendfile.h b/lib/mlibc/options/linux/include/sys/sendfile.h new file mode 100644 index 0000000..32b17ce --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/sendfile.h @@ -0,0 +1,22 @@ + +#ifndef _SYS_SENDFILE_H_ +#define _SYS_SENDFILE_H_ + +#ifdef __cplusplus +extern "C" { +#endif + +#include <unistd.h> + +#ifndef __MLIBC_ABI_ONLY + +ssize_t sendfile(int, int, off_t *, size_t); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_SENDFILE_H_ + diff --git a/lib/mlibc/options/linux/include/sys/signalfd.h b/lib/mlibc/options/linux/include/sys/signalfd.h new file mode 100644 index 0000000..adf7c1b --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/signalfd.h @@ -0,0 +1,48 @@ +#ifndef _SYS_SIGNALFD_H +#define _SYS_SIGNALFD_H + +// TODO: Define sigset separately and remove this include. +#include <signal.h> +// musl includes those. Restructure this so we do not need them? +#include <stdint.h> +#include <fcntl.h> + +#define SFD_CLOEXEC O_CLOEXEC +#define SFD_NONBLOCK O_NONBLOCK + +#ifdef __cplusplus +extern "C" { +#endif + +struct signalfd_siginfo { + uint32_t ssi_signo; + int32_t ssi_errno; + int32_t ssi_code; + uint32_t ssi_pid; + uint32_t ssi_uid; + int32_t ssi_fd; + uint32_t ssi_tid; + uint32_t ssi_band; + uint32_t ssi_overrun; + uint32_t ssi_trapno; + int32_t ssi_status; + int32_t ssi_int; + uint64_t ssi_ptr; + uint64_t ssi_utime; + uint64_t ssi_stime; + uint64_t ssi_addr; + uint16_t ssi_addr_lsb; + uint8_t pad[128-12*4-4*8-2]; +}; + +#ifndef __MLIBC_ABI_ONLY + +int signalfd(int, const sigset_t *, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_SIGNALFD_H diff --git a/lib/mlibc/options/linux/include/sys/statfs.h b/lib/mlibc/options/linux/include/sys/statfs.h new file mode 100644 index 0000000..07ae693 --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/statfs.h @@ -0,0 +1,22 @@ +#ifndef _SYS_STATFS_H +#define _SYS_STATFS_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <abi-bits/statfs.h> + +#ifndef __MLIBC_ABI_ONLY + +int statfs(const char *, struct statfs *); +int fstatfs(int, struct statfs *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_STATFS_H + diff --git a/lib/mlibc/options/linux/include/sys/swap.h b/lib/mlibc/options/linux/include/sys/swap.h new file mode 100644 index 0000000..79e89c6 --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/swap.h @@ -0,0 +1,24 @@ +#ifndef _SYS_SWAP_H +#define _SYS_SWAP_H + +#ifdef __cplusplus +extern "C" { +#endif + +#define SWAP_FLAG_PREFER 0x8000 +#define SWAP_FLAG_PRIO_MASK 0x7fff +#define SWAP_FLAG_PRIO_SHIFT 0 +#define SWAP_FLAG_DISCARD 0x10000 + +#ifndef __MLIBC_ABI_ONLY + +int swapon(const char *, int); +int swapoff(const char *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* _SYS_SWAP_H */ diff --git a/lib/mlibc/options/linux/include/sys/sysinfo.h b/lib/mlibc/options/linux/include/sys/sysinfo.h new file mode 100644 index 0000000..917f861 --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/sysinfo.h @@ -0,0 +1,34 @@ +#ifndef _SYS_SYSINFO_H +#define _SYS_SYSINFO_H + +#ifdef __cplusplus +extern "C" { +#endif + +struct sysinfo { + long uptime; + unsigned long loads[3]; + unsigned long totalram; + unsigned long freeram; + unsigned long sharedram; + unsigned long bufferram; + unsigned long totalswap; + unsigned long freeswap; + unsigned short procs; + unsigned long totalhigh; + unsigned long freehigh; + unsigned int mem_unit; + char _f[20 - 2 * sizeof(long) - sizeof(int)]; // Padding to 64 bytes according to my man page +}; + +#ifndef __MLIBC_ABI_ONLY + +int sysinfo(struct sysinfo *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_SYSINFO_H diff --git a/lib/mlibc/options/linux/include/sys/sysmacros.h b/lib/mlibc/options/linux/include/sys/sysmacros.h new file mode 100644 index 0000000..230858b --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/sysmacros.h @@ -0,0 +1,35 @@ +#ifndef _SYS_SYSMACROS_H +#define _SYS_SYSMACROS_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/inline-definition.h> + +__MLIBC_INLINE_DEFINITION unsigned int __mlibc_dev_major( + unsigned long long int __dev) { + return ((__dev >> 8) & 0xfff) | ((unsigned int)(__dev >> 32) & ~0xfff); +} + +__MLIBC_INLINE_DEFINITION unsigned int __mlibc_dev_minor( + unsigned long long int __dev) { + return (__dev & 0xff) | ((unsigned int)(__dev >> 12) & ~0xff); +} + +__MLIBC_INLINE_DEFINITION unsigned long long int __mlibc_dev_makedev( + unsigned int __major, unsigned int __minor) { + return ((__minor & 0xff) | ((__major & 0xfff) << 8) + | (((unsigned long long int)(__minor & ~0xff)) << 12) + | (((unsigned long long int)(__major & ~0xfff)) << 32)); +} + +#define major(dev) __mlibc_dev_major(dev) +#define minor(dev) __mlibc_dev_minor(dev) +#define makedev(major, minor) __mlibc_dev_makedev(major, minor) + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_SYSMACROS_H diff --git a/lib/mlibc/options/linux/include/sys/timerfd.h b/lib/mlibc/options/linux/include/sys/timerfd.h new file mode 100644 index 0000000..b8a2932 --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/timerfd.h @@ -0,0 +1,32 @@ +#ifndef _SYS_TIMERFD_H +#define _SYS_TIMERFD_H + +// musl includes those. Refactor and remove them? +#include <time.h> +#include <fcntl.h> + +#define TFD_NONBLOCK O_NONBLOCK +#define TFD_CLOEXEC O_CLOEXEC + +#define TFD_TIMER_ABSTIME 1 +#define TFD_TIMER_CANCEL_ON_SET (1 << 1) + +#ifdef __cplusplus +extern "C" { +#endif + +struct itimerspec; + +#ifndef __MLIBC_ABI_ONLY + +int timerfd_create(int, int); +int timerfd_settime(int, int, const struct itimerspec *, struct itimerspec *); +int timerfd_gettime(int, struct itimerspec *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_TIMERFD_H diff --git a/lib/mlibc/options/linux/include/sys/vfs.h b/lib/mlibc/options/linux/include/sys/vfs.h new file mode 100644 index 0000000..61a6aa3 --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/vfs.h @@ -0,0 +1,16 @@ + +#ifndef _SYS_VFS_H +#define _SYS_VFS_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <sys/statfs.h> + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_VFS_H + diff --git a/lib/mlibc/options/linux/include/sys/vt.h b/lib/mlibc/options/linux/include/sys/vt.h new file mode 100644 index 0000000..d9dfbd9 --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/vt.h @@ -0,0 +1,6 @@ +#ifndef _SYS_VT_H +#define _SYS_VT_H + +#include <abi-bits/vt.h> + +#endif // _SYS_VT_H diff --git a/lib/mlibc/options/linux/include/sys/xattr.h b/lib/mlibc/options/linux/include/sys/xattr.h new file mode 100644 index 0000000..e54c58c --- /dev/null +++ b/lib/mlibc/options/linux/include/sys/xattr.h @@ -0,0 +1,38 @@ +#ifndef _MLIBC_LINUX_SYS_XATTR_H +#define _MLIBC_LINUX_SYS_XATTR_H + +#include <sys/types.h> +#include <abi-bits/xattr.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int setxattr(const char *path, const char *name, const void *val, size_t size, + int flags); +int lsetxattr(const char *path, const char *name, const void *val, size_t size, + int flags); +int fsetxattr(int fd, const char *name, const void *val, size_t size, + int flags); + +ssize_t getxattr(const char *path, const char *name, void *val, size_t size); +ssize_t lgetxattr(const char *path, const char *name, void *val, size_t size); +ssize_t fgetxattr(int fd, const char *name, void *val, size_t size); + +ssize_t listxattr(const char *path, char *list, size_t size); +ssize_t llistxattr(const char *path, char *list, size_t size); +ssize_t flistxattr(int fd, char *list, size_t size); + +int removexattr(const char *path, const char *name); +int lremovexattr(const char *path, const char *name); +int fremovexattr(int fd, const char *name); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* _MLIBC_LINUX_SYS_XATTR_H */ diff --git a/lib/mlibc/options/linux/include/utmp.h b/lib/mlibc/options/linux/include/utmp.h new file mode 100644 index 0000000..e83d7a5 --- /dev/null +++ b/lib/mlibc/options/linux/include/utmp.h @@ -0,0 +1,84 @@ +#ifndef _UTMP_H +#define _UTMP_H + +#include <abi-bits/pid_t.h> +#include <bits/posix/timeval.h> +#include <bits/types.h> +#include <paths.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#define EMPTY 0 +#define RUN_LVL 1 +#define BOOT_TIME 2 +#define NEW_TIME 3 +#define OLD_TIME 4 +#define INIT_PROCESS 5 +#define LOGIN_PROCESS 6 +#define USER_PROCESS 7 +#define DEAD_PROCESS 8 +#define ACCOUNTING 9 + +#define UT_LINESIZE 32 +#define UT_NAMESIZE 32 +#define UT_HOSTSIZE 256 + +#define WTMP_FILE _PATH_WTMP +#define WTMP_FILENAME _PATH_WTMP + +#define UTMP_FILE _PATH_UTMP +#define UTMP_FILENAME _PATH_UTMP + +struct exit_status { + short int e_termination; + short int e_exit; +}; + +struct utmp { + short ut_type; + pid_t ut_pid; + char ut_line[UT_LINESIZE]; + char ut_id[4]; + char ut_user[UT_NAMESIZE]; + char ut_host[UT_HOSTSIZE]; + struct exit_status ut_exit; + long ut_session; + struct timeval ut_tv; + __mlibc_int32 ut_addr_v6[4]; + char __unused[20]; +}; + +struct lastlog { + time_t ll_time; + char ll_line[UT_LINESIZE]; + char ll_host[UT_HOSTSIZE]; +}; + +/* Hacks for compability reasons */ +#define ut_name ut_user +#ifndef _NO_UT_TIME +#define ut_time ut_tv.tv_sec +#endif +#define ut_xtime ut_tv.tv_sec +#define ut_addr ut_addr_v6[0] + +#ifndef __MLIBC_ABI_ONLY + +void setutent(void); +struct utmp *getutent(void); +int getutent_r(struct utmp *, struct utmp **); +void endutent(void); +struct utmp *pututline(const struct utmp *); +struct utmp *getutline(const struct utmp *); +struct utmp *getutid(const struct utmp *); +int utmpname(const char *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _UTMP_H diff --git a/lib/mlibc/options/linux/include/utmpx.h b/lib/mlibc/options/linux/include/utmpx.h new file mode 100644 index 0000000..32629dd --- /dev/null +++ b/lib/mlibc/options/linux/include/utmpx.h @@ -0,0 +1,68 @@ + +#ifndef _UTMPX_H +#define _UTMPX_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <abi-bits/pid_t.h> +#include <bits/posix/timeval.h> + +// Struct definition taken from musl +struct utmpx { + short ut_type; + short __ut_pad1; + pid_t ut_pid; + char ut_line[32]; + char ut_id[4]; + char ut_user[32]; + char ut_host[256]; + struct { + short __e_termination; + short __e_exit; + } ut_exit; + int ut_session, __ut_pad2; + struct timeval ut_tv; + unsigned ut_addr_v6[4]; + char __unused[20]; +}; + +#define e_exit __e_exit +#define e_termination __e_termination + +#ifndef __MLIBC_ABI_ONLY + +void updwtmpx(const char *, const struct utmpx *); +int utmpxname(const char *); +struct utmpx *pututxline(const struct utmpx *); +struct utmpx *getutxent(void); +struct utmpx *getutxid(const struct utmpx *id); +void setutxent(void); +void endutxent(void); + +#endif /* !__MLIBC_ABI_ONLY */ + +#define EMPTY 0 +#define RUN_LVL 1 +#define BOOT_TIME 2 +#define NEW_TIME 3 +#define OLD_TIME 4 +#define INIT_PROCESS 5 +#define LOGIN_PROCESS 6 +#define USER_PROCESS 7 +#define DEAD_PROCESS 8 + +#ifdef _GNU_SOURCE +#define ACCOUNTING 9 +#endif + +#define __UT_HOSTSIZE 256 +#define __UT_NAMESIZE 32 +#define __UT_LINESIZE 32 + +#ifdef __cplusplus +} +#endif + +#endif // _UTMPX_H diff --git a/lib/mlibc/options/linux/include/values.h b/lib/mlibc/options/linux/include/values.h new file mode 100644 index 0000000..55a50cd --- /dev/null +++ b/lib/mlibc/options/linux/include/values.h @@ -0,0 +1,39 @@ + +#ifndef _VALUES_H +#define _VALUES_H + +#include <limits.h> +#include <float.h> + +#define CHARBITS (sizeof(char) * 8) +#define SHORTBITS (sizeof(short) * 8) +#define INTBITS (sizeof(int) * 8) +#define LONGBITS (sizeof(long) * 8) +#define PTRBITS (sizeof(char *) * 8) +#define DOUBLEBITS (sizeof(double) * 8) +#define FLOATBITS (sizeof(float) * 8) + +#define MINSHORT SHRT_MIN +#define MININT INT_MIN +#define MINLONG LONG_MIN + +#define MAXSHORT SHRT_MAX +#define MAXINT INT_MAX +#define MAXLONG LONG_MAX + +#define HIBITS MINSHORT +#define HIBITL MINLONG + +#define MAXDOUBLE DBL_MAX +#define MAXFLOAT FLT_MAX +#define MINDOUBLE DBL_MIN +#define MINFLOAT FLT_MIN +#define DMINEXP DBL_MIN_EXP +#define FMINEXP FLT_MIN_EXP +#define DMAXEXP DBL_MAX_EXP +#define FMAXEXP FLT_MAX_EXP + +#define BITSPERBYTE CHAR_BIT + +#endif // _VALUES_H + diff --git a/lib/mlibc/options/linux/meson.build b/lib/mlibc/options/linux/meson.build new file mode 100644 index 0000000..eb8fefc --- /dev/null +++ b/lib/mlibc/options/linux/meson.build @@ -0,0 +1,96 @@ + +if disable_linux_option + subdir_done() +endif +libc_sources += files( + 'generic/mntent-stubs.cpp', + 'generic/pty-stubs.cpp', + 'generic/sys-epoll.cpp', + 'generic/sys-inotify-stubs.cpp', + 'generic/sys-mount.cpp', + 'generic/sys-prctl-stubs.cpp', + 'generic/sys-ptrace-stubs.cpp', + 'generic/sys-random-stubs.cpp', + 'generic/sys-sendfile-stubs.cpp', + 'generic/sys-signalfd.cpp', + 'generic/sys-timerfd.cpp', + 'generic/sys-eventfd.cpp', + 'generic/sys-reboot.cpp', + 'generic/sys-xattr.cpp', + 'generic/utmp-stubs.cpp', + 'generic/utmpx.cpp', + 'generic/linux-unistd.cpp', + 'generic/malloc.cpp', + 'generic/sys-fsuid.cpp', + 'generic/ifaddrs.cpp', + 'generic/sys-sysinfo.cpp', + 'generic/module.cpp', + 'generic/sys-klog.cpp', + 'generic/sched.cpp', + 'generic/sys-quota.cpp', + 'generic/capabilities.cpp', + 'generic/cpuset.cpp', + 'generic/sys-swap.cpp', + 'generic/sys-statfs-stubs.cpp', +) + +if not no_headers + install_headers( + 'include/ifaddrs.h', + 'include/malloc.h', + 'include/memory.h', + 'include/mntent.h', + 'include/pty.h', + 'include/utmp.h', + 'include/utmpx.h', + 'include/values.h', + 'include/lastlog.h', + 'include/module.h', + ) + install_headers( + 'include/bits/linux/linux_unistd.h', + 'include/bits/linux/linux_sched.h', + 'include/bits/linux/cpu_set.h', + subdir: 'bits/linux' + ) + install_headers( + 'include/netpacket/packet.h', + subdir: 'netpacket' + ) + # libc provides these, not the kernel, so the Linux option shall provide them too. + install_headers( + 'include/scsi/scsi.h', + 'include/scsi/scsi_ioctl.h', + 'include/scsi/sg.h', + subdir: 'scsi' + ) + install_headers( + 'include/sys/epoll.h', + 'include/sys/inotify.h', + 'include/sys/mount.h', + 'include/sys/prctl.h', + 'include/sys/ptrace.h', + 'include/sys/random.h', + 'include/sys/sendfile.h', + 'include/sys/signalfd.h', + 'include/sys/sysmacros.h', + 'include/sys/timerfd.h', + 'include/sys/eventfd.h', + 'include/sys/reboot.h', + 'include/sys/fsuid.h', + 'include/sys/vt.h', + 'include/sys/sysinfo.h', + 'include/sys/klog.h', + 'include/sys/xattr.h', + 'include/sys/quota.h', + 'include/sys/swap.h', + 'include/sys/statfs.h', + 'include/sys/vfs.h', + subdir: 'sys' + ) + install_headers( + 'include/linux/libc-compat.h', + subdir: 'linux' + ) +endif + diff --git a/lib/mlibc/options/lsb/generic/auxv.cpp b/lib/mlibc/options/lsb/generic/auxv.cpp new file mode 100644 index 0000000..a4d2c8f --- /dev/null +++ b/lib/mlibc/options/lsb/generic/auxv.cpp @@ -0,0 +1,59 @@ + +#include <errno.h> +#include <stdint.h> +#include <sys/auxv.h> + +#include <bits/ensure.h> + +extern "C" uintptr_t *__dlapi_entrystack(); + +int peekauxval(unsigned long type, unsigned long *out) { + // Find the auxiliary vector by skipping args and environment. + auto aux = __dlapi_entrystack(); + aux += *aux + 1; // Skip argc and all arguments + __ensure(!*aux); + aux++; + while(*aux) // Now, we skip the environment. + aux++; + aux++; + + // Parse the auxiliary vector. + while(true) { + auto value = aux + 1; + if(*aux == AT_NULL) { + errno = ENOENT; + return -1; + }else if(*aux == type) { + *out = *value; + return 0; + } + aux += 2; + } +} + +unsigned long getauxval(unsigned long type) { + unsigned long value = 0; + if(peekauxval(type, &value)) + return 0; + return value; +} + +// XXX(qookie): +// This is here because libgcc will call into __getauxval on glibc Linux +// (which is what it believes we are due to the aarch64-linux-gnu toolchain) +// in order to find AT_HWCAP to discover if LSE atomics are supported. +// +// This is not necessary on a custom Linux toolchain and is purely an artifact of +// using the host toolchain. + +// __gnu_linux__ is the define checked by libgcc +#if defined(__aarch64__) && defined(__gnu_linux__) + +extern "C" unsigned long __getauxval(unsigned long type) { + unsigned long value = 0; + if(peekauxval(type, &value)) + return 0; + return value; +} + +#endif diff --git a/lib/mlibc/options/lsb/generic/dso_exit.cpp b/lib/mlibc/options/lsb/generic/dso_exit.cpp new file mode 100644 index 0000000..b8b239d --- /dev/null +++ b/lib/mlibc/options/lsb/generic/dso_exit.cpp @@ -0,0 +1,42 @@ + +// for memcpy() +#include <string.h> + +#include <bits/ensure.h> +#include <mlibc/allocator.hpp> + +#include <frg/eternal.hpp> +#include <frg/vector.hpp> + +struct ExitHandler { + void (*function)(void *); + void *argument; + void *dsoHandle; +}; + +using ExitQueue = frg::vector<ExitHandler, MemoryAllocator>; + +ExitQueue &getExitQueue() { + // use frg::eternal to prevent the compiler from scheduling the destructor + // by generating a call to __cxa_atexit(). + static frg::eternal<ExitQueue> singleton(getAllocator()); + return singleton.get(); +} + +extern "C" int __cxa_atexit(void (*function)(void *), void *argument, void *handle) { + ExitHandler handler; + handler.function = function; + handler.argument = argument; + handler.dsoHandle = handle; + getExitQueue().push(handler); + return 0; +} + +void __mlibc_do_finalize() { + ExitQueue &eq = getExitQueue(); + for(size_t i = eq.size(); i > 0; i--) { + auto handler = &eq[i - 1]; + handler->function(handler->argument); + } +} + diff --git a/lib/mlibc/options/lsb/generic/tls.cpp b/lib/mlibc/options/lsb/generic/tls.cpp new file mode 100644 index 0000000..1d7cc30 --- /dev/null +++ b/lib/mlibc/options/lsb/generic/tls.cpp @@ -0,0 +1,23 @@ +#include <internal-config.h> +#include <mlibc/thread.hpp> +#include <mlibc/rtdl-abi.hpp> + +#if defined(__riscv) && defined(MLIBC_STATIC_BUILD) + // On RISC-V, linker optimisation is not guaranteed and so we may still get + // calls to this function in statically linked binaries. + // TODO: This will break dlopen calls from statically linked programs. + extern "C" void *__tls_get_addr(struct __abi_tls_entry *entry) { + Tcb *tcbPtr = mlibc::get_current_tcb(); + auto dtvPtr = reinterpret_cast<char *>(tcbPtr->dtvPointers[0]); + return reinterpret_cast<void *>(dtvPtr + entry->offset + TLS_DTV_OFFSET); + } +#elif defined(__i386__) + extern "C" __attribute__((regparm(1))) void *___tls_get_addr(struct __abi_tls_entry *entry) { + return __dlapi_get_tls(entry); + } +#else + extern "C" void *__tls_get_addr(struct __abi_tls_entry *entry) { + return __dlapi_get_tls(entry); + } +#endif + diff --git a/lib/mlibc/options/lsb/include/sys/auxv.h b/lib/mlibc/options/lsb/include/sys/auxv.h new file mode 100644 index 0000000..a3e028c --- /dev/null +++ b/lib/mlibc/options/lsb/include/sys/auxv.h @@ -0,0 +1,26 @@ +#ifndef _SYS_AUXV_H +#define _SYS_AUXV_H + +#define AT_NULL 0 +#include <abi-bits/auxv.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +// mlibc extension: Like getauxval but handles errors in a sane way. +// Success: Return 0. +// Failure: Return -1 and set errno. +int peekauxval(unsigned long type, unsigned long *value); + +unsigned long getauxval(unsigned long type); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} // extern "C" +#endif + +#endif diff --git a/lib/mlibc/options/lsb/meson.build b/lib/mlibc/options/lsb/meson.build new file mode 100644 index 0000000..322a912 --- /dev/null +++ b/lib/mlibc/options/lsb/meson.build @@ -0,0 +1,14 @@ + +lsb_sources = files( + 'generic/auxv.cpp', + 'generic/dso_exit.cpp', + 'generic/tls.cpp', +) + +if not no_headers + install_headers( + 'include/sys/auxv.h', + subdir: 'sys' + ) +endif + diff --git a/lib/mlibc/options/posix/generic/arpa-inet-stubs.cpp b/lib/mlibc/options/posix/generic/arpa-inet-stubs.cpp new file mode 100644 index 0000000..0bc9727 --- /dev/null +++ b/lib/mlibc/options/posix/generic/arpa-inet-stubs.cpp @@ -0,0 +1,220 @@ + +#include <arpa/inet.h> +#include <bits/ensure.h> +#include <stdlib.h> +#include <ctype.h> +#include <stdio.h> +#include <errno.h> +#include <string.h> +#include <mlibc/bitutil.hpp> +#include <mlibc/debug.hpp> + +const struct in6_addr in6addr_any = IN6ADDR_ANY_INIT; +const struct in6_addr in6addr_loopback = IN6ADDR_LOOPBACK_INIT; + +uint32_t htonl(uint32_t x) { +#if __BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__ + return mlibc::bit_util<uint32_t>::byteswap(x); +#else + return x; +#endif +} +uint16_t htons(uint16_t x) { +#if __BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__ + return mlibc::bit_util<uint16_t>::byteswap(x); +#else + return x; +#endif +} +uint32_t ntohl(uint32_t x) { +#if __BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__ + return mlibc::bit_util<uint32_t>::byteswap(x); +#else + return x; +#endif +} +uint16_t ntohs(uint16_t x) { +#if __BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__ + return mlibc::bit_util<uint16_t>::byteswap(x); +#else + return x; +#endif +} + +// ---------------------------------------------------------------------------- +// IPv4 address manipulation. +// ---------------------------------------------------------------------------- +in_addr_t inet_addr(const char *p) { + struct in_addr a; + if(!inet_aton(p, &a)) + return -1; + return a.s_addr; +} +char *inet_ntoa(struct in_addr addr) { + // string: xxx.yyy.zzz.aaa + // 4 * 3 + 3 + 1 = 12 + 4 = 16 + thread_local static char buffer[16]; + uint32_t proper = htonl(addr.s_addr); + snprintf(buffer, sizeof(buffer), "%d.%d.%d.%d", + (proper >> 24) & 0xff, ((proper >> 16) & 0xff), + (proper >> 8) & 0xff, proper & 0xff); + return buffer; +} +int inet_aton(const char *string, struct in_addr *dest) { + int array[4]; + int i = 0; + char *end; + + for (; i < 4; i++) { + array[i] = strtoul(string, &end, 0); + if (*end && *end != '.') + return 0; + if (!*end) + break; + string = end + 1; + } + + switch (i) { + case 0: + dest->s_addr = htonl(array[0]); + break; + case 1: + if (array[0] > 255 || array[1] > 0xffffff) + return 0; + dest->s_addr = htonl((array[0] << 24) | array[1]); + break; + case 2: + if (array[0] > 255 || array[1] > 255 || + array[2] > 0xffff) + return 0; + dest->s_addr = htonl((array[0] << 24) | (array[1] << 16) | + array[2]); + break; + case 3: + if (array[0] > 255 || array[1] > 255 || + array[2] > 255 || array[3] > 255) + return 0; + dest->s_addr = htonl((array[0] << 24) | (array[1] << 16) | + (array[2] << 8) | array[3]); + break; + } + + return 1; +} + +// ---------------------------------------------------------------------------- +// Generic IP address manipulation. +// ---------------------------------------------------------------------------- +const char *inet_ntop(int af, const void *__restrict src, char *__restrict dst, + socklen_t size) { + switch (af) { + case AF_INET: { + auto source = reinterpret_cast<const struct in_addr*>(src); + if (snprintf(dst, size, "%d.%d.%d.%d", + source->s_addr & 0xff, + (source->s_addr & 0xffff) >> 8, + (source->s_addr & 0xffffff) >> 16, + source->s_addr >> 24) < (int)size) + return dst; + break; + } + case AF_INET6: { + auto source = reinterpret_cast<const struct in6_addr*>(src); + size_t cur_zeroes_off = 0; + size_t cur_zeroes_len = 0; + size_t max_zeroes_off = 0; + size_t max_zeroes_len = 0; + + /* we look for the largest block of zeroed quartet(s) */ + for(size_t i = 0; i < 8; i++) { + auto ptr = source->s6_addr + (i * 2); + if(!ptr[0] && !ptr[1]) { + cur_zeroes_len++; + if(max_zeroes_len < cur_zeroes_len) { + max_zeroes_len = cur_zeroes_len; + max_zeroes_off = cur_zeroes_off; + } + } else { + /* advance the offset to the next quartet to check */ + cur_zeroes_len = 0; + cur_zeroes_off = i + 1; + } + } + + size_t off = 0; + for(size_t i = 0; i < 8; i++) { + auto ptr = source->s6_addr + (i * 2); + + /* if we are at the beginning of the largest block of zeroed quartets, place "::" */ + if(i == max_zeroes_off && max_zeroes_len >= 2) { + if(off < size) { + dst[off++] = ':'; + } + if(off < size) { + dst[off++] = ':'; + } + i += max_zeroes_len - 1; + + continue; + } + + /* place a colon if we're not at the beginning of the string and it is not already there */ + if(off && dst[off - 1] != ':') { + if(off < size) { + dst[off++] = ':'; + } + } + + off += snprintf(dst + off, size - off, "%x", ptr[0] << 8 | ptr[1]); + } + + dst[off] = 0; + + return dst; + } + default: + errno = EAFNOSUPPORT; + return NULL; + } + + errno = ENOSPC; + return NULL; +} +int inet_pton(int af, const char *__restrict src, void *__restrict dst) { + switch (af) { + case AF_INET: { + uint8_t array[4] = {}; + for (int i = 0; i < 4; i++) { + char *end; + long int value = strtol(src, &end, 10); + if (value > 255) + return 0; + if (*end != '\0' && *end != '.') + return 0; + src = end + 1; + array[i] = value; + } + auto addr = reinterpret_cast<struct in_addr*>(dst); + memcpy(&addr->s_addr, array, 4); + break; + } + case AF_INET6: + mlibc::infoLogger() << "inet_pton: ipv6 is not implemented!" << frg::endlog; + /* fallthrough */ + default: + errno = EAFNOSUPPORT; + return -1; + } + + return 1; +} + +struct in_addr inet_makeaddr(in_addr_t, in_addr_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +in_addr_t inet_netof(struct in_addr) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/posix/generic/dirent-stubs.cpp b/lib/mlibc/options/posix/generic/dirent-stubs.cpp new file mode 100644 index 0000000..1352585 --- /dev/null +++ b/lib/mlibc/options/posix/generic/dirent-stubs.cpp @@ -0,0 +1,180 @@ + +#include <errno.h> +#include <dirent.h> +#include <fcntl.h> +#include <unistd.h> +#include <sys/stat.h> +#include <stdlib.h> + +#include <bits/ensure.h> +#include <frg/allocation.hpp> +#include <mlibc/allocator.hpp> +#include <mlibc/posix-sysdeps.hpp> +#include <mlibc/debug.hpp> + +// Code taken from musl +int alphasort(const struct dirent **a, const struct dirent **b) { + return strcoll((*a)->d_name, (*b)->d_name); +} + +int closedir(DIR *dir) { + // TODO: Deallocate the dir structure. + close(dir->__handle); + return 0; +} +int dirfd(DIR *dir) { + return dir->__handle; +} +DIR *fdopendir(int fd) { + struct stat st; + + if(fstat(fd, &st) < 0) { + return nullptr; + } + // Musl implements this, but O_PATH is only declared on the linux abi + /*if(fcntl(fd, F_GETFL) & O_PATH) { + errno = EBADF; + return nullptr; + }*/ + if(!S_ISDIR(st.st_mode)) { + errno = ENOTDIR; + return nullptr; + } + auto dir = frg::construct<__mlibc_dir_struct>(getAllocator()); + __ensure(dir); + dir->__ent_next = 0; + dir->__ent_limit = 0; + int flags = fcntl(fd, F_GETFD); + fcntl(fd, F_SETFD, flags | FD_CLOEXEC); + dir->__handle = fd; + return dir; +} +DIR *opendir(const char *path) { + auto dir = frg::construct<__mlibc_dir_struct>(getAllocator()); + __ensure(dir); + dir->__ent_next = 0; + dir->__ent_limit = 0; + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_open_dir, nullptr); + if(int e = mlibc::sys_open_dir(path, &dir->__handle); e) { + errno = e; + frg::destruct(getAllocator(), dir); + return nullptr; + }else{ + return dir; + } +} +struct dirent *readdir(DIR *dir) { + __ensure(dir->__ent_next <= dir->__ent_limit); + if(dir->__ent_next == dir->__ent_limit) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_read_entries, nullptr); + if(int e = mlibc::sys_read_entries(dir->__handle, dir->__ent_buffer, 2048, &dir->__ent_limit); e) + __ensure(!"mlibc::sys_read_entries() failed"); + dir->__ent_next = 0; + if(!dir->__ent_limit) + return nullptr; + } + + auto entp = reinterpret_cast<struct dirent *>(dir->__ent_buffer + dir->__ent_next); + // We only copy as many bytes as we need to avoid buffer-overflows. + memcpy(&dir->__current, entp, offsetof(struct dirent, d_name) + strlen(entp->d_name) + 1); + dir->__ent_next += entp->d_reclen; + return &dir->__current; +} +int readdir_r(DIR *dir, struct dirent *entry, struct dirent **result) { + if(!mlibc::sys_read_entries) { + MLIBC_MISSING_SYSDEP(); + return ENOSYS; + } + + __ensure(dir->__ent_next <= dir->__ent_limit); + if(dir->__ent_next == dir->__ent_limit) { + if(int e = mlibc::sys_read_entries(dir->__handle, dir->__ent_buffer, 2048, &dir->__ent_limit); e) + __ensure(!"mlibc::sys_read_entries() failed"); + dir->__ent_next = 0; + if(!dir->__ent_limit) { + *result = NULL; + return 0; + } + } + + auto entp = reinterpret_cast<struct dirent *>(dir->__ent_buffer + dir->__ent_next); + // We only copy as many bytes as we need to avoid buffer-overflows. + memcpy(entry, entp, offsetof(struct dirent, d_name) + strlen(entp->d_name) + 1); + dir->__ent_next += entp->d_reclen; + *result = entry; + return 0; +} + +void rewinddir(DIR *dir) { + lseek(dir->__handle, 0, SEEK_SET); + dir->__ent_next = 0; +} + +int scandir(const char *path, struct dirent ***res, int (*select)(const struct dirent *), + int (*compare)(const struct dirent **, const struct dirent **)) { + DIR *dir = opendir(path); + if (!dir) + return -1; // errno will be set by opendir() + + // we should save the errno + int old_errno = errno; + errno = 0; + + struct dirent *dir_ent; + struct dirent **array = nullptr, **tmp = nullptr; + int length = 0; + int count = 0; + while((dir_ent = readdir(dir)) && !errno) { + if(select && !select(dir_ent)) + continue; + + if(count >= length) { + length = 2*length + 1; + tmp = static_cast<struct dirent**>(realloc(array, + length * sizeof(struct dirent*))); + // we need to check the call actually goes through + // before we overwrite array so that we can + // deallocate the already written entries should realloc() + // have failed + if(!tmp) + break; + array = tmp; + } + array[count] = static_cast<struct dirent*>(malloc(dir_ent->d_reclen)); + if(!array[count]) + break; + + memcpy(array[count], dir_ent, dir_ent->d_reclen); + count++; + } + + if(errno) { + if(array) + while(count-- > 0) + free(array[count]); + free(array); + return -1; + } + + // from here we can set the old errno back + errno = old_errno; + + if(compare) + qsort(array, count, sizeof(struct dirent*), + (int (*)(const void *, const void *)) compare); + *res = array; + return count; +} +void seekdir(DIR *, long) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long telldir(DIR *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int versionsort(const struct dirent **a, const struct dirent **b) { + return strverscmp((*a)->d_name, (*b)->d_name); +} diff --git a/lib/mlibc/options/posix/generic/dlfcn-stubs.cpp b/lib/mlibc/options/posix/generic/dlfcn-stubs.cpp new file mode 100644 index 0000000..fc9fd84 --- /dev/null +++ b/lib/mlibc/options/posix/generic/dlfcn-stubs.cpp @@ -0,0 +1,64 @@ + +#include <bits/ensure.h> +#include <dlfcn.h> + +#include <mlibc/debug.hpp> + +struct __dlapi_symbol { + const char *file; + void *base; + const char *symbol; + void *address; +}; + +extern "C" const char *__dlapi_error(); +extern "C" void *__dlapi_open(const char *, int, void *); +extern "C" void *__dlapi_resolve(void *, const char *, void *); +extern "C" int __dlapi_reverse(const void *, __dlapi_symbol *); +extern "C" int __dlapi_close(void *); + +int dlclose(void *handle) { + return __dlapi_close(handle); +} + +char *dlerror(void) { + return const_cast<char *>(__dlapi_error()); +} + +[[gnu::noinline]] +void *dlopen(const char *file, int flags) { + auto ra = __builtin_extract_return_addr(__builtin_return_address(0)); + return __dlapi_open(file, flags, ra); +} + +[[gnu::noinline]] +void *dlsym(void *__restrict handle, const char *__restrict string) { + auto ra = __builtin_extract_return_addr(__builtin_return_address(0)); + return __dlapi_resolve(handle, string, ra); +} + +[[gnu::noinline]] +void *dlvsym(void *__restrict handle, const char *__restrict string, const char *__restrict version) { + mlibc::infoLogger() << "mlibc: dlvsym ignores version " << version << frg::endlog; + auto ra = __builtin_extract_return_addr(__builtin_return_address(0)); + return __dlapi_resolve(handle, string, ra); +} + +//gnu extensions +int dladdr(const void *ptr, Dl_info *out) { + __dlapi_symbol info; + if(__dlapi_reverse(ptr, &info)) + return 0; + + out->dli_fname = info.file; + out->dli_fbase = info.base; + out->dli_sname = info.symbol; + out->dli_saddr = info.address; + return 1; +} + +int dlinfo(void *, int, void *) { + __ensure(!"dlinfo() not implemented"); + __builtin_unreachable(); +} + diff --git a/lib/mlibc/options/posix/generic/fcntl-stubs.cpp b/lib/mlibc/options/posix/generic/fcntl-stubs.cpp new file mode 100644 index 0000000..66e2d12 --- /dev/null +++ b/lib/mlibc/options/posix/generic/fcntl-stubs.cpp @@ -0,0 +1,108 @@ + +#include <errno.h> +#include <bits/ensure.h> +#include <fcntl.h> +#include <stdarg.h> + +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> + +int creat(const char *pathname, mode_t mode) { + return open(pathname, O_CREAT|O_WRONLY|O_TRUNC, mode); +} + +int fallocate(int, int, off_t, off_t) { + mlibc::infoLogger() << "mlibc: fallocate() is a no-op" << frg::endlog; + errno = ENOSYS; + return -1; +} + +int fcntl(int fd, int command, ...) { + va_list args; + va_start(args, command); + int result; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fcntl, -1); + if(int e = mlibc::sys_fcntl(fd, command, args, &result); e) { + errno = e; + return -1; + } + va_end(args); + return result; +} + +int openat(int dirfd, const char *pathname, int flags, ...) { + va_list args; + va_start(args, flags); + mode_t mode = 0; + int fd; + + if((flags & (O_CREAT | O_TMPFILE))) + mode = va_arg(args, mode_t); + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_openat, -1); + if(int e = mlibc::sys_openat(dirfd, pathname, flags, mode, &fd); e) { + errno = e; + return -1; + } + va_end(args); + return fd; +} + +int posix_fadvise(int fd, off_t offset, off_t length, int advice) { + if(!mlibc::sys_fadvise) { + mlibc::infoLogger() << "mlibc: fadvise() ignored due to missing sysdep" << frg::endlog; + return 0; + } + + // posix_fadvise() returns an error instead of setting errno. + return mlibc::sys_fadvise(fd, offset, length, advice); +} + +int posix_fallocate(int fd, off_t offset, off_t size) { + // posix_fallocate() returns an error instead of setting errno. + if(!mlibc::sys_fallocate) { + MLIBC_MISSING_SYSDEP(); + return ENOSYS; + } + return mlibc::sys_fallocate(fd, offset, size); +} + +// This is a linux extension +int name_to_handle_at(int, const char *, struct file_handle *, int *, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int open_by_handle_at(int, struct file_handle *, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +ssize_t splice(int, off_t *, int, off_t *, size_t, unsigned int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +ssize_t vmsplice(int, const struct iovec *, size_t, unsigned int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int open(const char *pathname, int flags, ...) { + mode_t mode = 0; + + if ((flags & O_CREAT) || (flags & O_TMPFILE)) { + va_list args; + va_start(args, flags); + mode = va_arg(args, mode_t); + va_end(args); + } + + int fd; + if(int e = mlibc::sys_open(pathname, flags, mode, &fd); e) { + errno = e; + return -1; + } + return fd; +} + diff --git a/lib/mlibc/options/posix/generic/ftw-stubs.cpp b/lib/mlibc/options/posix/generic/ftw-stubs.cpp new file mode 100644 index 0000000..2d93995 --- /dev/null +++ b/lib/mlibc/options/posix/generic/ftw-stubs.cpp @@ -0,0 +1,18 @@ + +#include <ftw.h> + +#include <bits/ensure.h> + +int ftw(const char *, int (*fn)(const char *, const struct stat *, int), int) { + (void)fn; + __ensure(!"ftw() not implemented"); + __builtin_unreachable(); +} + +int nftw(const char *, int (*fn)(const char *, const struct stat *, int, struct FTW *), + int, int) { + (void)fn; + __ensure(!"nftw() not implemented"); + __builtin_unreachable(); +} + diff --git a/lib/mlibc/options/posix/generic/grp-stubs.cpp b/lib/mlibc/options/posix/generic/grp-stubs.cpp new file mode 100644 index 0000000..f8b2813 --- /dev/null +++ b/lib/mlibc/options/posix/generic/grp-stubs.cpp @@ -0,0 +1,316 @@ + +#include <grp.h> +#include <errno.h> +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <bits/ensure.h> + +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> + +namespace { + FILE *global_file; + + bool open_global_file() { + if(!global_file) { + global_file = fopen("/etc/group", "r"); + if(!global_file) { + errno = EIO; + return false; + } + } + + return true; + } + + void close_global_file() { + if(global_file) { + fclose(global_file); + global_file = nullptr; + } + } + + template<typename F> + void walk_segments(frg::string_view line, char delimiter, F fn) { + size_t s = 0; + while(true) { + size_t d = line.find_first(delimiter, s); + if(d == size_t(-1)) + break; + auto chunk = line.sub_string(s, d - s); + fn(chunk); + s = d + 1; + } + if(line[s]) { + auto chunk = line.sub_string(s, line.size() - s); + + if (chunk.size() > 0) { + // Remove trailing newline + if (chunk[chunk.size() - 1] == '\n') + chunk = chunk.sub_string(0, chunk.size() - 1); + + fn(chunk); + } + } + } + + bool extract_entry(frg::string_view line, group *entry) { + frg::string_view segments[5]; + + // Parse the line into 3 or 4 segments (depending if the group has members or not) + int n = 0; + walk_segments(line, ':', [&] (frg::string_view s) { + __ensure(n < 4); + segments[n++] = s; + }); + + if(n < 3) // n can be 3 when there are no members in the group + return false; + + // TODO: Handle strndup() and malloc() failure. + auto name = strndup(segments[0].data(), segments[0].size()); + __ensure(name); + + auto passwd = strndup(segments[1].data(), segments[1].size()); + + auto gid = segments[2].to_number<int>(); + if(!gid) + return false; + + size_t n_members = 0; + walk_segments(segments[3], ',', [&] (frg::string_view) { + n_members++; + }); + + auto members = reinterpret_cast<char **>(malloc(sizeof(char *) * (n_members + 1))); + __ensure(members); + size_t k = 0; + walk_segments(segments[3], ',', [&] (frg::string_view m) { + members[k] = strndup(m.data(), m.size()); + __ensure(members[k]); + k++; + }); + members[k] = nullptr; + + entry->gr_name = name; + entry->gr_passwd = passwd; + entry->gr_gid = *gid; + entry->gr_mem = members; + return true; + } + + void clear_entry(group *entry) { + free(entry->gr_name); + if(entry->gr_mem) { + for(size_t i = 0; entry->gr_mem[i]; i++) + free(entry->gr_mem[i]); + free(entry->gr_mem); + } + entry->gr_name = nullptr; + entry->gr_mem = nullptr; + } + + template<typename C> + int walk_file(struct group *entry, C cond) { + auto file = fopen("/etc/group", "r"); + if(!file) { + return EIO; + } + + char line[512]; + while(fgets(line, 512, file)) { + if(!extract_entry(line, entry)) + continue; + if(cond(entry)) { + fclose(file); + return 0; + } + } + + int err = ESRCH; + if(ferror(file)) { + err = EIO; + } + + fclose(file); + return err; + } + + int copy_to_buffer(struct group *grp, char *buffer, size_t size) { + // Adjust to correct alignment so that we can put gr_mem first in buffer + uintptr_t mask = sizeof(char *) - 1; + size_t offset = (reinterpret_cast<uintptr_t>(buffer) % sizeof(char *) + mask) & ~mask; + if (size < offset) + return ERANGE; + + buffer += offset; + size -= offset; + + // Calculate the amount of space we need + size_t nmemb, required_size = 0; + for (nmemb = 0; grp->gr_mem[nmemb] != nullptr; nmemb++) { + // One for the string's null terminator and one for the pointer in gr_mem + required_size += strlen(grp->gr_mem[nmemb]) + 1 + sizeof(char *); + } + + // One for null terminator of gr_name, plus sizeof(char *) for nullptr terminator of gr_mem + required_size += strlen(grp->gr_name) + 1 + sizeof(char *); + if (size < required_size) + return ERANGE; + + // Put the gr_mem array first in the buffer as we are guaranteed + // that the pointer is aligned correctly + char *string_data = buffer + (nmemb + 1) * sizeof(char *); + + for (size_t i = 0; i < nmemb; i++) { + reinterpret_cast<char **>(buffer)[i] = string_data; + string_data = stpcpy(string_data, grp->gr_mem[i]) + 1; + free(grp->gr_mem[i]); + } + + reinterpret_cast<char **>(buffer)[nmemb] = nullptr; + free(grp->gr_mem); + grp->gr_mem = reinterpret_cast<char **>(buffer); + + char *gr_name = stpcpy(string_data, grp->gr_name) + 1; + free(grp->gr_name); + grp->gr_name = string_data; + + __ensure(gr_name <= buffer + size); + return 0; + } +} + +void endgrent(void) { + close_global_file(); +} + +struct group *getgrent(void) { + static group entry; + char line[512]; + + if(!open_global_file()) { + return nullptr; + } + + if(fgets(line, 512, global_file)) { + clear_entry(&entry); + if(!extract_entry(line, &entry)) { + errno = EINVAL; + return nullptr; + } + return &entry; + } + + if(ferror(global_file)) { + errno = EIO; + } + + return nullptr; +} + +struct group *getgrgid(gid_t gid) { + static group entry; + + int err = walk_file(&entry, [&] (group *entry) { + return entry->gr_gid == gid; + }); + + if (err) { + errno = err; + return nullptr; + } + + return &entry; +} + +int getgrgid_r(gid_t gid, struct group *grp, char *buffer, size_t size, struct group **result) { + *result = nullptr; + int err = walk_file(grp, [&] (group *entry) { + return entry->gr_gid == gid; + }); + + if (err) { + return err; + } + + err = copy_to_buffer(grp, buffer, size); + if (err) { + return err; + } + + *result = grp; + return 0; +} + +struct group *getgrnam(const char *name) { + static group entry; + + int err = walk_file(&entry, [&] (group *entry) { + return !strcmp(entry->gr_name, name); + }); + + if (err) { + errno = err; + return nullptr; + } + + return &entry; +} + +int getgrnam_r(const char *name, struct group *grp, char *buffer, size_t size, struct group **result) { + *result = nullptr; + + int err = walk_file(grp, [&] (group *entry) { + return !strcmp(entry->gr_name, name); + }); + + if (err) { + return err; + } + + err = copy_to_buffer(grp, buffer, size); + if (err) { + return err; + } + + *result = grp; + return 0; +} + +void setgrent(void) { + if(!open_global_file()) { + return; + } + rewind(global_file); +} + +int setgroups(size_t size, const gid_t *list) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setgroups, -1); + if(int e = mlibc::sys_setgroups(size, list); e) { + errno = e; + return -1; + } + return 0; +} + +int initgroups(const char *, gid_t) { + mlibc::infoLogger() << "mlibc: initgroups is a stub" << frg::endlog; + return 0; +} + +int putgrent(const struct group *, FILE *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +struct group *fgetgrent(FILE *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int getgrouplist(const char *, gid_t, gid_t *, int *) { + mlibc::infoLogger() << "mlibc: getgrouplist is a stub" << frg::endlog; + return 0; +} diff --git a/lib/mlibc/options/posix/generic/langinfo-stubs.cpp b/lib/mlibc/options/posix/generic/langinfo-stubs.cpp new file mode 100644 index 0000000..b239cbd --- /dev/null +++ b/lib/mlibc/options/posix/generic/langinfo-stubs.cpp @@ -0,0 +1,15 @@ + +#include <langinfo.h> +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/locale.hpp> + +char *nl_langinfo(nl_item item) { + return mlibc::nl_langinfo(item); +} + +char *nl_langinfo_l(nl_item, locale_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + diff --git a/lib/mlibc/options/posix/generic/libgen-stubs.cpp b/lib/mlibc/options/posix/generic/libgen-stubs.cpp new file mode 100644 index 0000000..ff80349 --- /dev/null +++ b/lib/mlibc/options/posix/generic/libgen-stubs.cpp @@ -0,0 +1,51 @@ + +#include <bits/ensure.h> +#include <libgen.h> +#include <string.h> + +#include <mlibc/debug.hpp> + +// Adopted from musl's code. +char *basename(char *s) { + // This empty string behavior is specified by POSIX. + if (!s || !*s) + return const_cast<char *>("."); + + // Delete trailing slashes. + // Note that we do not delete the slash at index zero. + auto i = strlen(s) - 1; + for(; i && s[i] == '/'; i--) + s[i] = 0; + + // Find the last non-trailing slash. + for(; i && s[i - 1] != '/'; i--) + ; + return s + i; +} + +char *dirname(char *s) { + if (!s || !(*s)) + return const_cast<char *>("."); + + auto i = strlen(s) - 1; + + // Skip trailing slashes. + for (; s[i] == '/'; i--) + if(!i) // Path only consists of slashes. + return const_cast<char *>("/"); + + // Skip the last non-slash path component. + for (; s[i] != '/'; i--) + if(!i) // Path only contains a single component. + return const_cast<char *>("."); + + // Skip slashes. + for (; s[i] == '/'; i--) + if(!i) // Path is entry in root directory. + return const_cast<char *>("/"); + + s[i+1] = 0; + + return s; +} + diff --git a/lib/mlibc/options/posix/generic/lookup.cpp b/lib/mlibc/options/posix/generic/lookup.cpp new file mode 100644 index 0000000..f877fe5 --- /dev/null +++ b/lib/mlibc/options/posix/generic/lookup.cpp @@ -0,0 +1,512 @@ +#include <mlibc/lookup.hpp> +#include <mlibc/resolv_conf.hpp> +#include <mlibc/debug.hpp> +#include <bits/ensure.h> + +#include <frg/string.hpp> +#include <mlibc/allocator.hpp> +#include <string.h> +#include <errno.h> +#include <arpa/inet.h> +#include <unistd.h> +#include <stdio.h> +#include <ctype.h> + +namespace mlibc { + +namespace { + constexpr unsigned int RECORD_A = 1; + constexpr unsigned int RECORD_CNAME = 5; + constexpr unsigned int RECORD_PTR = 12; +} + +static frg::string<MemoryAllocator> read_dns_name(char *buf, char *&it) { + frg::string<MemoryAllocator> res{getAllocator()}; + while (true) { + char code = *it++; + if ((code & 0xC0) == 0xC0) { + // pointer + uint8_t offset = ((code & 0x3F) << 8) | *it++; + auto offset_it = buf + offset; + return res + read_dns_name(buf, offset_it); + } else if (!(code & 0xC0)) { + if (!code) + break; + + for (int i = 0; i < code; i++) + res += (*it++); + + if (*it) + res += '.'; + } else { + break; + } + } + + return res; +} + +int lookup_name_dns(struct lookup_result &buf, const char *name, + frg::string<MemoryAllocator> &canon_name) { + frg::string<MemoryAllocator> request{getAllocator()}; + + int num_q = 1; + struct dns_header header; + header.identification = htons(123); + header.flags = htons(0x100); + header.no_q = htons(num_q); + header.no_ans = htons(0); + header.no_auths = htons(0); + header.no_additional = htons(0); + + request.resize(sizeof(header)); + memcpy(request.data(), &header, sizeof(header)); + + const char *end = name; + while (*end != '\0') { + end = strchrnul(name, '.'); + size_t length = end - name; + frg::string_view substring{name, length}; + name += length + 1; + request += char(length); + request += substring; + } + + request += char(0); + // set question type to fetch A records + request += 0; + request += 1; + // set CLASS to IN + request += 0; + request += 1; + + struct sockaddr_in sin = {}; + sin.sin_family = AF_INET; + // TODO(geert): we could probably make this use the service lookup + // for dns + sin.sin_port = htons(53); + + auto nameserver = get_nameserver(); + if (!inet_aton(nameserver ? nameserver->name.data() : "127.0.0.1", &sin.sin_addr)) { + mlibc::infoLogger() << "lookup_name_dns(): inet_aton() failed!" << frg::endlog; + return -EAI_SYSTEM; + } + + int fd = socket(AF_INET, SOCK_DGRAM, 0); + if (fd < 0) { + mlibc::infoLogger() << "lookup_name_dns(): socket() failed" << frg::endlog; + return -EAI_SYSTEM; + } + + size_t sent = sendto(fd, request.data(), request.size(), 0, + (struct sockaddr*)&sin, sizeof(sin)); + if (sent != request.size()) { + mlibc::infoLogger() << "lookup_name_dns(): sendto() failed to send everything" << frg::endlog; + return -EAI_SYSTEM; + } + + char response[256]; + ssize_t rlen; + int num_ans = 0; + while ((rlen = recvfrom(fd, response, 256, 0, NULL, NULL)) >= 0) { + if ((size_t)rlen < sizeof(struct dns_header)) + continue; + auto response_header = reinterpret_cast<struct dns_header*>(response); + if (response_header->identification != header.identification) + return -EAI_FAIL; + + auto it = response + sizeof(struct dns_header); + for (int i = 0; i < ntohs(response_header->no_q); i++) { + auto dns_name = read_dns_name(response, it); + (void) dns_name; + it += 4; + } + + for (int i = 0; i < ntohs(response_header->no_ans); i++) { + struct dns_addr_buf buffer; + auto dns_name = read_dns_name(response, it); + + uint16_t rr_type = (it[0] << 8) | it[1]; + uint16_t rr_class = (it[2] << 8) | it[3]; + uint16_t rr_length = (it[8] << 8) | it[9]; + it += 10; + (void)rr_class; + + switch (rr_type) { + case RECORD_A: + memcpy(buffer.addr, it, rr_length); + it += rr_length; + buffer.family = AF_INET; + buffer.name = std::move(dns_name); + buf.buf.push(std::move(buffer)); + break; + case RECORD_CNAME: + canon_name = read_dns_name(response, it); + buf.aliases.push(std::move(dns_name)); + break; + default: + mlibc::infoLogger() << "lookup_name_dns: unknown rr type " + << rr_type << frg::endlog; + break; + } + } + num_ans += ntohs(response_header->no_ans); + + if (num_ans >= num_q) + break; + } + + close(fd); + return buf.buf.size(); +} + +int lookup_addr_dns(frg::span<char> name, frg::array<uint8_t, 16> &addr, int family) { + frg::string<MemoryAllocator> request{getAllocator()}; + + int num_q = 1; + struct dns_header header; + header.identification = htons(123); + header.flags = htons(0x100); + header.no_q = htons(num_q); + header.no_ans = htons(0); + header.no_auths = htons(0); + header.no_additional = htons(0); + + request.resize(sizeof(header)); + memcpy(request.data(), &header, sizeof(header)); + + char addr_str[64]; + if(!inet_ntop(family, addr.data(), addr_str, sizeof(addr_str))) { + switch(errno) { + case EAFNOSUPPORT: + return -EAI_FAMILY; + case ENOSPC: + return -EAI_OVERFLOW; + default: + return -EAI_FAIL; + } + } + frg::string<MemoryAllocator> req_str{getAllocator(), addr_str}; + req_str += ".in-addr.arpa"; + + frg::string_view req_view{req_str.data(), req_str.size()}; + size_t ptr = 0; + do { + size_t next = req_view.find_first('.', ptr); + size_t length = next != (size_t)-1 ? next - ptr : req_view.size() - ptr; + frg::string_view substring = req_view.sub_string(ptr, length); + request += char(length); + request += substring; + ptr = next + 1; + } while(ptr != 0); + + request += char(0); + // set question type to fetch PTR records + request += 0; + request += 12; + // set CLASS to IN + request += 0; + request += 1; + + + struct sockaddr_in sin = {}; + sin.sin_family = AF_INET; + // TODO(geert): we could probably make this use the service lookup + // for dns + sin.sin_port = htons(53); + + auto nameserver = get_nameserver(); + if (!inet_aton(nameserver ? nameserver->name.data() : "127.0.0.1", &sin.sin_addr)) { + mlibc::infoLogger() << "lookup_name_dns(): inet_aton() failed!" << frg::endlog; + return -EAI_SYSTEM; + } + + int fd = socket(AF_INET, SOCK_DGRAM, 0); + if (fd < 0) { + mlibc::infoLogger() << "lookup_name_dns(): socket() failed" << frg::endlog; + return -EAI_SYSTEM; + } + + size_t sent = sendto(fd, request.data(), request.size(), 0, + (struct sockaddr*)&sin, sizeof(sin)); + if (sent != request.size()) { + mlibc::infoLogger() << "lookup_name_dns(): sendto() failed to send everything" << frg::endlog; + return -EAI_SYSTEM; + } + + char response[256]; + ssize_t rlen; + int num_ans = 0; + while ((rlen = recvfrom(fd, response, 256, 0, NULL, NULL)) >= 0) { + if ((size_t)rlen < sizeof(struct dns_header)) + continue; + auto response_header = reinterpret_cast<struct dns_header*>(response); + if (response_header->identification != header.identification) + return -EAI_FAIL; + + auto it = response + sizeof(struct dns_header); + for (int i = 0; i < ntohs(response_header->no_q); i++) { + auto dns_name = read_dns_name(response, it); + (void) dns_name; + it += 4; + } + + for (int i = 0; i < ntohs(response_header->no_ans); i++) { + struct dns_addr_buf buffer; + auto dns_name = read_dns_name(response, it); + + uint16_t rr_type = (it[0] << 8) | it[1]; + uint16_t rr_class = (it[2] << 8) | it[3]; + uint16_t rr_length = (it[8] << 8) | it[9]; + it += 10; + (void)rr_class; + (void)rr_length; + + (void)dns_name; + + switch (rr_type) { + case RECORD_PTR: { + auto ptr_name = read_dns_name(response, it); + if (ptr_name.size() >= name.size()) + return -EAI_OVERFLOW; + std::copy(ptr_name.begin(), ptr_name.end(), name.data()); + name.data()[ptr_name.size()] = '\0'; + return 1; + } + default: + mlibc::infoLogger() << "lookup_addr_dns: unknown rr type " + << rr_type << frg::endlog; + break; + } + num_ans += ntohs(response_header->no_ans); + + if (num_ans >= num_q) + break; + } + } + + close(fd); + return 0; +} + +int lookup_name_hosts(struct lookup_result &buf, const char *name, + frg::string<MemoryAllocator> &canon_name) { + auto file = fopen("/etc/hosts", "r"); + if (!file) { + switch (errno) { + case ENOENT: + case ENOTDIR: + case EACCES: + return -EAI_SERVICE; + default: + return -EAI_SYSTEM; + } + } + + char line[128]; + int name_length = strlen(name); + while (fgets(line, 128, file)) { + char *pos; + // same way to deal with comments as in services.cpp + if ((pos = strchr(line, '#'))) { + *pos++ = '\n'; + *pos = '\0'; + } + + for(pos = line + 1; (pos = strstr(pos, name)) && + (!isspace(pos[-1]) || !isspace(pos[name_length])); pos++); + if (!pos) + continue; + + for (pos = line; !isspace(*pos); pos++); + *pos = '\0'; + + // TODO(geert): we assume ipv4 for now + struct in_addr addr; + if (!inet_aton(line, &addr)) + continue; + + pos++; + for(; *pos && isspace(*pos); pos++); + char *end; + for(end = pos; *end && !isspace(*end); end++); + + struct dns_addr_buf buffer; + memcpy(buffer.addr, &addr, 4); + buffer.family = AF_INET; + buffer.name = frg::string<MemoryAllocator>{pos, + static_cast<size_t>(end - pos), getAllocator()}; + canon_name = buffer.name; + + buf.buf.push(std::move(buffer)); + + pos = end; + while (pos[1]) { + for (; *pos && isspace(*pos); pos++); + for (end = pos; *end && !isspace(*end); end++); + auto name = frg::string<MemoryAllocator>{pos, + static_cast<size_t>(end - pos), getAllocator()}; + buf.aliases.push(std::move(name)); + pos = end; + } + } + + fclose(file); + return buf.buf.size(); +} + +int lookup_addr_hosts(frg::span<char> name, frg::array<uint8_t, 16> &addr, int family) { + auto file = fopen("/etc/hosts", "r"); + if (!file) { + switch (errno) { + case ENOENT: + case ENOTDIR: + case EACCES: + return -EAI_SERVICE; + default: + return -EAI_SYSTEM; + } + } + + // Buffer to hold ASCII version of address + char addr_str[64]; + if(!inet_ntop(family, addr.data(), addr_str, sizeof(addr_str))) { + switch(errno) { + case EAFNOSUPPORT: + return -EAI_FAMILY; + case ENOSPC: + return -EAI_OVERFLOW; + default: + return -EAI_FAIL; + } + } + int addr_str_len = strlen(addr_str); + + char line[128]; + while (fgets(line, 128, file)) { + char *pos; + // same way to deal with comments as in services.cpp + if ((pos = strchr(line, '#'))) { + *pos++ = '\n'; + *pos = '\0'; + } + if (strncmp(line, addr_str, addr_str_len)) + continue; + + for (pos = line + addr_str_len + 1; isspace(*pos); pos++); + char *begin = pos; + for (; !isspace(*pos); pos++); + char *end = pos; + + size_t size = end - begin; + if (size >= name.size()) + return -EAI_OVERFLOW; + std::copy(begin, end, name.data()); + name.data()[size] = '\0'; + return 1; + } + return 0; +} + +int lookup_name_null(struct lookup_result &buf, int flags, int family) { + if (flags & AI_PASSIVE) { + if (family != AF_INET6) { + struct dns_addr_buf addr_buf; + addr_buf.family = AF_INET; + + in_addr_t addr = INADDR_ANY; + memcpy(&addr_buf.addr, &addr, 4); + + buf.buf.push_back(addr_buf); + } + if (family != AF_INET) { + struct dns_addr_buf addr_buf; + addr_buf.family = AF_INET6; + + struct in6_addr addr = IN6ADDR_ANY_INIT; + memcpy(&addr_buf.addr, &addr, 16); + + buf.buf.push_back(addr_buf); + } + } else { + if (family != AF_INET6) { + struct dns_addr_buf addr_buf; + addr_buf.family = AF_INET; + + in_addr_t addr = INADDR_LOOPBACK; + memcpy(&addr_buf.addr, &addr, 4); + + buf.buf.push_back(addr_buf); + } + if (family != AF_INET) { + struct dns_addr_buf addr_buf; + addr_buf.family = AF_INET6; + + struct in6_addr addr = IN6ADDR_LOOPBACK_INIT; + memcpy(&addr_buf.addr, &addr, 16); + + buf.buf.push_back(addr_buf); + } + } + return buf.buf.size(); +} + +int lookup_name_ip(struct lookup_result &buf, const char *name, int family) { + if (family == AF_INET) { + in_addr_t addr = 0; + int res = inet_pton(AF_INET, name, &addr); + + if (res <= 0) + return -EAI_NONAME; + + struct dns_addr_buf addr_buf; + addr_buf.family = AF_INET; + memcpy(&addr_buf.addr, &addr, 4); + + buf.buf.push_back(addr_buf); + return 1; + } + + if (family == AF_INET6) { + struct in6_addr addr{0}; + int res = inet_pton(AF_INET6, name, &addr); + + if (res <= 0) + return -EAI_NONAME; + + struct dns_addr_buf addr_buf; + addr_buf.family = AF_INET6; + memcpy(&addr_buf.addr, &addr, 16); + + buf.buf.push_back(addr_buf); + return 1; + } + + // If no family was specified we try ipv4 and then ipv6. + in_addr_t addr4 = 0; + int res = inet_pton(AF_INET, name, &addr4); + + if (res > 0) { + struct dns_addr_buf addr_buf; + addr_buf.family = AF_INET; + memcpy(&addr_buf.addr, &addr4, 4); + + buf.buf.push_back(addr_buf); + return 1; + } + + struct in6_addr addr6{0}; + res = inet_pton(AF_INET6, name, &addr6); + + if (res <= 0) + return -EAI_NONAME; + + struct dns_addr_buf addr_buf; + addr_buf.family = AF_INET6; + memcpy(&addr_buf.addr, &addr6, 16); + + buf.buf.push_back(addr_buf); + return 1; +} + +} // namespace mlibc diff --git a/lib/mlibc/options/posix/generic/mqueue.cpp b/lib/mlibc/options/posix/generic/mqueue.cpp new file mode 100644 index 0000000..d635419 --- /dev/null +++ b/lib/mlibc/options/posix/generic/mqueue.cpp @@ -0,0 +1,22 @@ +#include <mqueue.h> +#include <bits/ensure.h> + +int mq_getattr(mqd_t, struct mq_attr *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int mq_setattr(mqd_t, const struct mq_attr *__restrict__, struct mq_attr *__restrict__) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int mq_unlink(const char *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +mqd_t mq_open(const char *, int, ...) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/posix/generic/net-if-stubs.cpp b/lib/mlibc/options/posix/generic/net-if-stubs.cpp new file mode 100644 index 0000000..6a65a5c --- /dev/null +++ b/lib/mlibc/options/posix/generic/net-if-stubs.cpp @@ -0,0 +1,40 @@ +#include <errno.h> +#include <net/if.h> +#include <stdlib.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> + +void if_freenameindex(struct if_nameindex *) { + mlibc::infoLogger() << "mlibc: if_freenameindex is a no-op" << frg::endlog; +} + +char *if_indextoname(unsigned int index, char *name) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_if_indextoname, NULL); + + if(int e = sysdep(index, name); e) { + errno = e; + return NULL; + } + + return name; +} + +struct if_nameindex *if_nameindex(void) { + mlibc::infoLogger() << "mlibc: if_nameindex() is a no-op" << frg::endlog; + errno = ENOSYS; + return NULL; +} + +unsigned int if_nametoindex(const char *name) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_if_nametoindex, 0); + unsigned int ret = 0; + + if(int e = sysdep(name, &ret); e) { + errno = e; + return 0; + } + + return ret; +} diff --git a/lib/mlibc/options/posix/generic/netdb-stubs.cpp b/lib/mlibc/options/posix/generic/netdb-stubs.cpp new file mode 100644 index 0000000..455444b --- /dev/null +++ b/lib/mlibc/options/posix/generic/netdb-stubs.cpp @@ -0,0 +1,486 @@ +#include <netdb.h> +#include <bits/ensure.h> + +#include <mlibc/debug.hpp> +#include <mlibc/lookup.hpp> +#include <mlibc/allocator.hpp> +#include <mlibc/services.hpp> +#include <frg/vector.hpp> +#include <frg/array.hpp> +#include <frg/span.hpp> +#include <sys/socket.h> +#include <arpa/inet.h> +#include <stdlib.h> +#include <stdio.h> +#include <stddef.h> +#include <errno.h> + +__thread int __mlibc_h_errno; + +// This function is from musl +int *__h_errno_location(void) { + return &__mlibc_h_errno; +} + +void endhostent(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void endnetent(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void endprotoent(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void endservent(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void freeaddrinfo(struct addrinfo *ptr) { + if (ptr) { + auto buf = (struct mlibc::ai_buf*) ptr - offsetof(struct mlibc::ai_buf, ai); + // this string was allocated by a frg::string + getAllocator().free(ptr->ai_canonname); + free(buf); + } +} + +const char *gai_strerror(int code) { + static thread_local char buffer[128]; + snprintf(buffer, sizeof(buffer), "Unknown error (%d)", code); + return buffer; +} + +int getaddrinfo(const char *__restrict node, const char *__restrict service, + const struct addrinfo *__restrict hints, struct addrinfo **__restrict res) { + if (!node && !service) + return EAI_NONAME; + + int socktype = 0, protocol = 0, family = AF_UNSPEC, flags = AI_V4MAPPED | AI_ADDRCONFIG; + if (hints) { + socktype = hints->ai_socktype; + protocol = hints->ai_protocol; + family = hints->ai_family; + flags = hints->ai_flags; + + int mask = AI_V4MAPPED | AI_ADDRCONFIG | AI_NUMERICHOST | AI_PASSIVE | + AI_CANONNAME | AI_ALL | AI_NUMERICSERV; + if ((flags & mask) != flags) + return EAI_BADFLAGS; + + if (family != AF_INET && family != AF_INET6 && family != AF_UNSPEC) + return EAI_FAMILY; + } + + mlibc::service_result serv_buf{getAllocator()}; + int serv_count = mlibc::lookup_serv_by_name(serv_buf, service, protocol, socktype, flags); + if (serv_count < 0) + return -serv_count; + + struct mlibc::lookup_result addr_buf; + int addr_count = 1; + frg::string<MemoryAllocator> canon{getAllocator()}; + if (node) { + if ((addr_count = mlibc::lookup_name_ip(addr_buf, node, family)) <= 0) { + if (flags & AI_NUMERICHOST) + addr_count = -EAI_NONAME; + else if ((addr_count = mlibc::lookup_name_hosts(addr_buf, node, canon)) <= 0) + addr_count = mlibc::lookup_name_dns(addr_buf, node, canon); + else + addr_count = 1; + } + + if (addr_count < 0) + return -addr_count; + if (!addr_count) + return EAI_NONAME; + } else { + /* There is no node specified */ + if (flags & AI_NUMERICHOST) + return EAI_NONAME; + addr_count = lookup_name_null(addr_buf, flags, family); + } + + auto out = (struct mlibc::ai_buf *) calloc(serv_count * addr_count, + sizeof(struct mlibc::ai_buf)); + + if (node && !canon.size()) + canon = frg::string<MemoryAllocator>{node, getAllocator()}; + + for (int i = 0, k = 0; i < addr_count; i++) { + for (int j = 0; j < serv_count; j++, k++) { + out[i].ai.ai_family = addr_buf.buf[i].family; + out[i].ai.ai_socktype = serv_buf[j].socktype; + out[i].ai.ai_protocol = serv_buf[j].protocol; + out[i].ai.ai_flags = flags; + out[i].ai.ai_addr = (struct sockaddr *) &out[i].sa; + if (canon.size()) + out[i].ai.ai_canonname = canon.data(); + else + out[i].ai.ai_canonname = NULL; + out[i].ai.ai_next = NULL; + switch (addr_buf.buf[i].family) { + case AF_INET: + out[i].ai.ai_addrlen = sizeof(struct sockaddr_in); + out[i].sa.sin.sin_port = htons(serv_buf[j].port); + out[i].sa.sin.sin_family = AF_INET; + memcpy(&out[i].sa.sin.sin_addr, addr_buf.buf[i].addr, 4); + break; + case AF_INET6: + out[i].ai.ai_addrlen = sizeof(struct sockaddr_in6); + out[i].sa.sin6.sin6_family = htons(serv_buf[j].port); + out[i].sa.sin6.sin6_family = AF_INET6; + memcpy(&out[i].sa.sin6.sin6_addr, addr_buf.buf[i].addr, 16); + break; + } + } + } + if (canon.size()) + canon.detach(); + + *res = &out[0].ai; + return 0; +} + +struct hostent *gethostent(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int getnameinfo(const struct sockaddr *__restrict addr, socklen_t addr_len, + char *__restrict host, socklen_t host_len, char *__restrict serv, + socklen_t serv_len, int flags) { + frg::array<uint8_t, 16> addr_array; + int family = addr->sa_family; + + switch(family) { + case AF_INET: { + if (addr_len < sizeof(struct sockaddr_in)) + return EAI_FAMILY; + auto sockaddr = reinterpret_cast<const struct sockaddr_in*>(addr); + memcpy(addr_array.data(), reinterpret_cast<const char*>(&sockaddr->sin_addr), 4); + break; + } + case AF_INET6: { + mlibc::infoLogger() << "getnameinfo(): ipv6 is not fully supported in this function" << frg::endlog; + if (addr_len < sizeof(struct sockaddr_in6)) + return EAI_FAMILY; + auto sockaddr = reinterpret_cast<const struct sockaddr_in6*>(addr); + memcpy(addr_array.data(), reinterpret_cast<const char*>(&sockaddr->sin6_addr), 16); + break; + } + default: + return EAI_FAMILY; + } + + if (host && host_len) { + frg::span<char> host_span{host, host_len}; + int res = 0; + if (!(flags & NI_NUMERICHOST)) + res = mlibc::lookup_addr_hosts(host_span, addr_array, family); + if (!(flags & NI_NUMERICHOST) && !res) + res = mlibc::lookup_addr_dns(host_span, addr_array, family); + + if (!res) { + if (flags & NI_NAMEREQD) + return EAI_NONAME; + if(!inet_ntop(family, addr_array.data(), host, host_len)) { + switch(errno) { + case EAFNOSUPPORT: + return EAI_FAMILY; + case ENOSPC: + return EAI_OVERFLOW; + default: + return EAI_FAIL; + } + } + } + + if (res < 0) + return -res; + } + + if (serv && serv_len) { + __ensure("getnameinfo(): not implemented service resolution yet!"); + __builtin_unreachable(); + } + + return 0; +} + +struct netent *getnetbyaddr(uint32_t, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +struct netent *getnetbyname(const char *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +struct netent *getnetent(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +struct hostent *gethostbyname(const char *name) { + if (!name) { + h_errno = HOST_NOT_FOUND; + return NULL; + } + + struct mlibc::lookup_result buf; + frg::string<MemoryAllocator> canon{getAllocator()}; + int ret = 0; + if ((ret = mlibc::lookup_name_hosts(buf, name, canon)) <= 0) + ret = mlibc::lookup_name_dns(buf, name, canon); + if (ret <= 0) { + h_errno = HOST_NOT_FOUND; + return NULL; + } + + static struct hostent h; + if (h.h_name) { + getAllocator().free(h.h_name); + for (int i = 0; h.h_aliases[i] != NULL; i++) + getAllocator().free(h.h_aliases[i]); + free(h.h_aliases); + + if (h.h_addr_list) { + for (int i = 0; h.h_addr_list[i] != NULL; i++) + free(h.h_addr_list[i]); + free(h.h_addr_list); + } + } + h = {}; + + if (!canon.size()) + canon = frg::string<MemoryAllocator>{name, getAllocator()}; + + h.h_name = canon.data(); + + h.h_aliases = reinterpret_cast<char**>(malloc((buf.aliases.size() + 1) + * sizeof(char*))); + int alias_pos = 0; + for (auto &buf_name : buf.aliases) { + h.h_aliases[alias_pos] = buf_name.data(); + buf_name.detach(); + alias_pos++; + } + h.h_aliases[alias_pos] = NULL; + canon.detach(); + + // just pick the first family as the one for all addresses...?? + h.h_addrtype = buf.buf[0].family; + if (h.h_addrtype != AF_INET && h.h_addrtype != AF_INET6) { + // this is not allowed per spec + h_errno = NO_DATA; + return NULL; + } + + // can only be AF_INET or AF_INET6 + h.h_length = h.h_addrtype == AF_INET ? 4 : 16; + h.h_addr_list = reinterpret_cast<char**>(malloc((ret + 1) * sizeof(char*))); + int addr_pos = 0; + for (int i = 0; i < ret; i++) { + if (buf.buf[i].family != h.h_addrtype) + continue; + h.h_addr_list[addr_pos] = reinterpret_cast<char*>(malloc(h.h_length)); + memcpy(h.h_addr_list[addr_pos], buf.buf[i].addr, h.h_length); + addr_pos++; + } + h.h_addr_list[addr_pos] = NULL; + + return &h; +} + +struct hostent *gethostbyname2(const char *, int) { + __ensure(!"gethostbyname2() not implemented"); + __builtin_unreachable(); +} + +struct hostent *gethostbyaddr(const void *, socklen_t, int) { + __ensure(!"gethostbyaddr() not implemented"); + __builtin_unreachable(); +} + +int gethostbyaddr_r(const void *__restrict, socklen_t, int, struct hostent *__restrict, + char *__restrict, size_t, struct hostent **__restrict, int *__restrict) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int gethostbyname_r(const char *__restrict, struct hostent *__restrict, char *__restrict, size_t, + struct hostent **__restrict, int *__restrict) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +struct protoent *getprotobyname(const char *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +struct protoent *getprotobynumber(int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +struct protoent *getprotoent(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +struct servent *getservbyname(const char *name, const char *proto) { + int iproto = -1; + if (proto &&(!strncmp(proto, "tcp", 3) || !strncmp(proto, "TCP", 3))) + iproto = IPPROTO_TCP; + else if (proto && (!strncmp(proto, "udp", 3) || !strncmp(proto, "UDP", 3))) + iproto = IPPROTO_UDP; + + static struct servent ret; + if (ret.s_name) { + free(ret.s_name); + ret.s_name = nullptr; + + for (char **alias = ret.s_aliases; *alias != NULL; alias++) { + free(*alias); + *alias = nullptr; + } + + free(ret.s_proto); + ret.s_proto = nullptr; + } + + mlibc::service_result serv_buf{getAllocator()}; + int count = mlibc::lookup_serv_by_name(serv_buf, name, iproto, + 0, 0); + if (count <= 0) + return NULL; + + ret.s_name = serv_buf[0].name.data(); + serv_buf[0].name.detach(); + // Sanity check. + if (strncmp(name, serv_buf[0].name.data(), serv_buf[0].name.size())) + return NULL; + + ret.s_aliases = reinterpret_cast<char**>(malloc((serv_buf[0].aliases.size() + 1) * sizeof(char*))); + int alias_pos = 0; + for (auto &buf_name : serv_buf[0].aliases) { + ret.s_aliases[alias_pos] = buf_name.data(); + buf_name.detach(); + alias_pos++; + } + ret.s_aliases[alias_pos] = NULL; + + ret.s_port = htons(serv_buf[0].port); + + auto proto_string = frg::string<MemoryAllocator>(getAllocator()); + if (!proto) { + if (serv_buf[0].protocol == IPPROTO_TCP) + proto_string = frg::string<MemoryAllocator>("tcp", getAllocator()); + else if (serv_buf[0].protocol == IPPROTO_UDP) + proto_string = frg::string<MemoryAllocator>("udp", getAllocator()); + else + return NULL; + } else { + proto_string = frg::string<MemoryAllocator>(proto, getAllocator()); + } + ret.s_proto = proto_string.data(); + proto_string.detach(); + + return &ret; +} + +struct servent *getservbyport(int port, const char *proto) { + int iproto = -1; + if (proto && (!strncmp(proto, "tcp", 3) || !strncmp(proto, "TCP", 3))) + iproto = IPPROTO_TCP; + else if (proto && (!strncmp(proto, "udp", 3) || !strncmp(proto, "UDP", 3))) + iproto = IPPROTO_UDP; + + static struct servent ret; + if (ret.s_name) { + free(ret.s_name); + ret.s_name = nullptr; + + for (char **alias = ret.s_aliases; *alias != NULL; alias++) { + free(*alias); + *alias = nullptr; + } + + free(ret.s_proto); + ret.s_proto = nullptr; + } + + mlibc::service_result serv_buf{getAllocator()}; + int count = mlibc::lookup_serv_by_port(serv_buf, iproto, ntohs(port)); + if (count <= 0) + return NULL; + + ret.s_name = serv_buf[0].name.data(); + serv_buf[0].name.detach(); + + ret.s_aliases = reinterpret_cast<char**>(malloc((serv_buf[0].aliases.size() + 1) * sizeof(char*))); + int alias_pos = 0; + for (auto &buf_name : serv_buf[0].aliases) { + ret.s_aliases[alias_pos] = buf_name.data(); + buf_name.detach(); + alias_pos++; + } + ret.s_aliases[alias_pos] = NULL; + + ret.s_port = port; + + auto proto_string = frg::string<MemoryAllocator>(getAllocator()); + if (!proto) { + if (serv_buf[0].protocol == IPPROTO_TCP) + proto_string = frg::string<MemoryAllocator>("tcp", getAllocator()); + else if (serv_buf[0].protocol == IPPROTO_UDP) + proto_string = frg::string<MemoryAllocator>("udp", getAllocator()); + else + return NULL; + } else { + proto_string = frg::string<MemoryAllocator>(proto, getAllocator()); + } + ret.s_proto = proto_string.data(); + proto_string.detach(); + + return &ret; +} + +struct servent *getservent(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void sethostent(int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void setnetent(int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void setprotoent(int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void setservent(int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +const char *hstrerror(int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/posix/generic/poll.cpp b/lib/mlibc/options/posix/generic/poll.cpp new file mode 100644 index 0000000..c34e25e --- /dev/null +++ b/lib/mlibc/options/posix/generic/poll.cpp @@ -0,0 +1,31 @@ + +#include <errno.h> +#include <poll.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> + +int poll(struct pollfd *fds, nfds_t count, int timeout) { + int num_events; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_poll, -1); + if(int e = mlibc::sys_poll(fds, count, timeout, &num_events); e) { + errno = e; + return -1; + } + return num_events; +} + +#if __MLIBC_LINUX_OPTION +int ppoll(struct pollfd *fds, nfds_t nfds, const struct timespec *timeout_ts, const sigset_t *sigmask) { + sigset_t origmask; + int timeout = (timeout_ts == NULL) ? -1 : (timeout_ts->tv_sec * 1000 + timeout_ts->tv_nsec / 1000000); + + sigprocmask(SIG_SETMASK, sigmask, &origmask); + int ready = poll(fds, nfds, timeout); + sigprocmask(SIG_SETMASK, &origmask, NULL); + + return ready; +} +#endif // __MLIBC_LINUX_OPTION + diff --git a/lib/mlibc/options/posix/generic/posix-file-io.cpp b/lib/mlibc/options/posix/generic/posix-file-io.cpp new file mode 100644 index 0000000..1a4f38b --- /dev/null +++ b/lib/mlibc/options/posix/generic/posix-file-io.cpp @@ -0,0 +1,275 @@ +#include <mlibc/posix-file-io.hpp> +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> + +#include <errno.h> + +namespace mlibc { + +int mem_file::reopen(const char *, const char *) { + mlibc::panicLogger() << "mlibc: freopen() on a mem_file stream is unimplemented!" << frg::endlog; + return -1; +} + +int mem_file::determine_type(stream_type *type) { + *type = stream_type::file_like; + return 0; +} + +int mem_file::determine_bufmode(buffer_mode *mode) { + *mode = buffer_mode::no_buffer; + return 0; +} + +memstream_mem_file::memstream_mem_file(char **ptr, size_t *sizeloc, int flags, void (*do_dispose)(abstract_file *)) +: mem_file{flags, do_dispose}, _bufloc{ptr}, _sizeloc{sizeloc} { } + + +int memstream_mem_file::close() { + _update_ptrs(); + _buf.detach(); + + return 0; +} + +int memstream_mem_file::io_read(char *buffer, size_t max_size, size_t *actual_size) { + if ((_pos >= 0 && _pos >= _max_size) || !max_size) { + *actual_size = 0; + return 0; + } + + size_t bytes_read = std::min(size_t(_max_size - _pos), max_size); + memcpy(buffer, _buffer().data() + _pos, bytes_read); + _pos += bytes_read; + *actual_size = bytes_read; + return 0; +} + +int memstream_mem_file::io_write(const char *buffer, size_t max_size, size_t *actual_size) { + if (_pos + max_size >= _buffer_size()) { + _buf.resize(_pos + max_size + 1, '\0'); + _update_ptrs(); + } + + size_t bytes_write = std::min(static_cast<size_t>(_buffer_size() - _pos), max_size); + memcpy(_buffer().data() + _pos, buffer, bytes_write); + _pos += max_size; + *actual_size = max_size; + + return 0; +} + +int memstream_mem_file::io_seek(off_t offset, int whence, off_t *new_offset) { + switch (whence) { + case SEEK_SET: + _pos = offset; + if (_pos >= 0 && size_t(_pos) >= _buffer_size()) { + _buf.resize(_pos + 1, '\0'); + _update_ptrs(); + } + *new_offset = _pos; + break; + case SEEK_CUR: + _pos += offset; + if (_pos >= 0 && size_t(_pos) >= _buffer_size()) { + _buf.resize(_pos + 1, '\0'); + _update_ptrs(); + } + *new_offset = _pos; + break; + case SEEK_END: + _pos = _buffer_size() ? _buffer_size() - 1 + offset : _buffer_size() + offset; + _buf.resize(_pos + 1, '\0'); + _update_ptrs(); + *new_offset = _pos; + break; + default: + return EINVAL; + } + return 0; +} + +void memstream_mem_file::_update_ptrs() { + *_bufloc = _buf.data(); + *_sizeloc = _buf.size() - 1; +} + +fmemopen_mem_file::fmemopen_mem_file(void *in_buf, size_t size, int flags, void (*do_dispose)(abstract_file *)) +: mem_file{flags, do_dispose}, _inBuffer{in_buf}, _inBufferSize{size} { + if(!_inBuffer) { + _inBuffer = getAllocator().allocate(size); + _needsDeallocation = true; + } + + if(_flags & O_APPEND) { + // the initial seek-size for append is zero if buf was NULL, or the first '\0' found, or the size + _max_size = (_needsDeallocation) ? 0 : strnlen(reinterpret_cast<char *>(_inBuffer), _inBufferSize); + _pos = _max_size; + } else if((_flags & O_WRONLY || _flags & O_RDWR) && _flags & O_CREAT && _flags & O_TRUNC) { + // modes: "w", "w+" + _max_size = 0; + } else { + _max_size = size; + } +} + +int fmemopen_mem_file::close() { + if(_needsDeallocation) { + getAllocator().free(_inBuffer); + } + + return 0; +} + +int fmemopen_mem_file::io_read(char *buffer, size_t max_size, size_t *actual_size) { + if ((_pos >= 0 && _pos >= _max_size) || !max_size) { + *actual_size = 0; + return 0; + } + + size_t bytes_read = std::min(size_t(_max_size - _pos), max_size); + memcpy(buffer, _buffer().data() + _pos, bytes_read); + _pos += bytes_read; + *actual_size = bytes_read; + return 0; +} + +int fmemopen_mem_file::io_write(const char *buffer, size_t max_size, size_t *actual_size) { + off_t bytes_write = std::min(static_cast<size_t>(_buffer_size() - _pos), max_size); + memcpy(_buffer().data() + _pos, buffer, bytes_write); + _pos += bytes_write; + *actual_size = bytes_write; + + if(_pos > _max_size) { + _max_size = _pos; + } + + // upon flushing, we need to put a null byte at the current position or at the end of the buffer + size_t null = _pos; + // a special case is if the mode is set to updating ('+'), then it always goes at the end + if(null >= _buffer_size() || _flags & O_RDWR) { + null = _buffer_size() - 1; + } + + if(_buffer_size()) { + _buffer()[null] = '\0'; + } + + return 0; +} + +int fmemopen_mem_file::io_seek(off_t offset, int whence, off_t *new_offset) { + switch (whence) { + case SEEK_SET: + if(offset < 0 || size_t(offset) > _buffer_size()) { + return EINVAL; + } + _pos = offset; + *new_offset = _pos; + break; + case SEEK_CUR: + // seeking to negative positions or positions larger than the buffer is disallowed in fmemopen(3) + if((_pos + offset) < 0 || size_t(_pos + offset) > _buffer_size()) { + return EINVAL; + } + _pos += offset; + *new_offset = _pos; + break; + case SEEK_END: + if((_max_size + offset) < 0 || size_t(_max_size + offset) > _buffer_size()) { + return EINVAL; + } + _pos = _max_size + offset; + *new_offset = _pos; + break; + default: + return EINVAL; + } + return 0; +} + +int cookie_file::close() { + if(!_funcs.close) { + return 0; + } + + return _funcs.close(_cookie); +} + +int cookie_file::reopen(const char *, const char *) { + mlibc::panicLogger() << "mlibc: freopen() on a cookie_file stream is unimplemented!" << frg::endlog; + return -1; +} + +int cookie_file::determine_type(stream_type *type) { + *type = stream_type::file_like; + return 0; +} + +int cookie_file::determine_bufmode(buffer_mode *mode) { + *mode = buffer_mode::no_buffer; + return 0; +} + +int cookie_file::io_read(char *buffer, size_t max_size, size_t *actual_size) { + if(!_funcs.read) { + return EOF; + } + + *actual_size = _funcs.read(_cookie, buffer, max_size); + + return 0; +} + +int cookie_file::io_write(const char *buffer, size_t max_size, size_t *actual_size) { + if(!_funcs.write) { + return 0; + } + + *actual_size = _funcs.write(_cookie, buffer, max_size); + + return 0; +} + +int cookie_file::io_seek(off_t offset, int whence, off_t *new_offset) { + if(!_funcs.seek) { + return ENOTSUP; + } + + *new_offset = offset; + + return _funcs.seek(_cookie, new_offset, whence); +} + +} // namespace mlibc + +FILE *fdopen(int fd, const char *mode) { + int flags = mlibc::fd_file::parse_modestring(mode); + + flags &= ~O_TRUNC; // 'w' should not truncate the file + + if (flags & O_APPEND) { + int cur_flags = fcntl(fd, F_GETFL, 0); + if (cur_flags < 0) { + errno = EINVAL; + return nullptr; + } else if (!(cur_flags & O_APPEND)) { + if (fcntl(fd, F_SETFL, cur_flags | O_APPEND)) { + errno = EINVAL; + return nullptr; + } + } + } + + if (flags & O_CLOEXEC) { + if (fcntl(fd, F_SETFD, FD_CLOEXEC)) { + errno = EINVAL; + return nullptr; + } + } + + // TODO: We may need to activate line buffered mode for terminals. + + return frg::construct<mlibc::fd_file>(getAllocator(), fd, + mlibc::file_dispose_cb<mlibc::fd_file>); +} diff --git a/lib/mlibc/options/posix/generic/posix_ctype.cpp b/lib/mlibc/options/posix/generic/posix_ctype.cpp new file mode 100644 index 0000000..19f129f --- /dev/null +++ b/lib/mlibc/options/posix/generic/posix_ctype.cpp @@ -0,0 +1,136 @@ +#include <ctype.h> +#include <wctype.h> + +#include <bits/ensure.h> + +int isalnum_l(int c, locale_t) { + return isalnum(c); +} + +int isalpha_l(int c, locale_t) { + return isalpha(c); +} + +int isblank_l(int c, locale_t) { + return isblank(c); +} + +int iscntrl_l(int c, locale_t) { + return iscntrl(c); +} + +int isdigit_l(int c, locale_t) { + return isdigit(c); +} + +int isgraph_l(int c, locale_t) { + return isgraph(c); +} + +int islower_l(int c, locale_t) { + return islower(c); +} + +int isprint_l(int c, locale_t) { + return isprint(c); +} + +int ispunct_l(int c, locale_t) { + return ispunct(c); +} + +int isspace_l(int c, locale_t) { + return isspace(c); +} + +int isupper_l(int c, locale_t) { + return isupper(c); +} + +int isxdigit_l(int c, locale_t) { + return isxdigit(c); +} + +int isascii_l(int c, locale_t) { + return isascii(c); +} + +int tolower_l(int c, locale_t) { + return tolower(c); +} + +int toupper_l(int c, locale_t) { + return toupper(c); +} + +int iswalnum_l(wint_t c, locale_t) { + return iswalnum(c); +} + +int iswblank_l(wint_t c, locale_t) { + return iswblank(c); +} + +int iswcntrl_l(wint_t c, locale_t) { + return iswcntrl(c); +} + +int iswdigit_l(wint_t c, locale_t) { + return iswdigit(c); +} + +int iswgraph_l(wint_t c, locale_t) { + return iswgraph(c); +} + +int iswlower_l(wint_t c, locale_t) { + return iswlower(c); +} + +int iswprint_l(wint_t c, locale_t) { + return iswprint(c); +} + +int iswpunct_l(wint_t c, locale_t) { + return iswpunct(c); +} + +int iswspace_l(wint_t c, locale_t) { + return iswspace(c); +} + +int iswupper_l(wint_t c, locale_t) { + return iswupper(c); +} + +int iswxdigit_l(wint_t c, locale_t) { + return iswxdigit(c); +} + +int iswalpha_l(wint_t c, locale_t) { + return iswalpha(c); +} + +wctype_t wctype_l(const char* p, locale_t) { + return wctype(p); +} + +int iswctype_l(wint_t w, wctype_t t, locale_t) { + return iswctype(w, t); +} + +wint_t towlower_l(wint_t c, locale_t) { + return towlower(c); +} + +wint_t towupper_l(wint_t c, locale_t) { + return towupper(c); +} + +wctrans_t wctrans_l(const char* c, locale_t) { + return wctrans(c); +} + +wint_t towctrans_l(wint_t c, wctrans_t desc, locale_t) { + return towctrans(c, desc); +} diff --git a/lib/mlibc/options/posix/generic/posix_locale.cpp b/lib/mlibc/options/posix/generic/posix_locale.cpp new file mode 100644 index 0000000..bd8710a --- /dev/null +++ b/lib/mlibc/options/posix/generic/posix_locale.cpp @@ -0,0 +1,37 @@ +#include <bits/posix/posix_locale.h> +#include <bits/ensure.h> +#include <mlibc/debug.hpp> + +namespace { + +bool newlocale_seen = false; +bool uselocale_seen = false; + +} + +locale_t newlocale(int, const char *, locale_t) { + // Due to all of the locale functions being stubs, the locale will not be used + if(!newlocale_seen) { + mlibc::infoLogger() << "mlibc: newlocale() is a no-op" << frg::endlog; + newlocale_seen = true; + } + return nullptr; +} + +void freelocale(locale_t) { + mlibc::infoLogger() << "mlibc: freelocale() is a no-op" << frg::endlog; + return; +} + +locale_t uselocale(locale_t) { + if(!uselocale_seen) { + mlibc::infoLogger() << "mlibc: uselocale() is a no-op" << frg::endlog; + uselocale_seen = true; + } + return nullptr; +} + +locale_t duplocale(locale_t) { + mlibc::infoLogger() << "mlibc: duplocale() is a no-op" << frg::endlog; + return nullptr; +} diff --git a/lib/mlibc/options/posix/generic/posix_signal.cpp b/lib/mlibc/options/posix/generic/posix_signal.cpp new file mode 100644 index 0000000..eef3ef3 --- /dev/null +++ b/lib/mlibc/options/posix/generic/posix_signal.cpp @@ -0,0 +1,151 @@ + +#include <errno.h> +#include <signal.h> +#include <unistd.h> +#include <bits/ensure.h> + +#include <mlibc/posix-sysdeps.hpp> +#include <mlibc/tcb.hpp> + +int sigsuspend(const sigset_t *sigmask) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_sigsuspend, -1); + + // This is guaranteed to return an error (EINTR most probably) + errno = mlibc::sys_sigsuspend(sigmask); + return -1; +} + +int pthread_sigmask(int how, const sigset_t *__restrict set, sigset_t *__restrict retrieve) { + if(!mlibc::sys_sigprocmask) { + MLIBC_MISSING_SYSDEP(); + return ENOSYS; + } + if(int e = mlibc::sys_sigprocmask(how, set, retrieve); e) { + return e; + } + return 0; +} + +int pthread_kill(pthread_t thread, int sig) { + auto tcb = reinterpret_cast<Tcb *>(thread); + auto pid = getpid(); + + if(!mlibc::sys_tgkill) { + MLIBC_MISSING_SYSDEP(); + return ENOSYS; + } + + if(int e = mlibc::sys_tgkill(pid, tcb->tid, sig); e) { + return e; + } + + return 0; +} + +int sigaction(int signum, const struct sigaction *__restrict act, struct sigaction *__restrict oldact) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_sigaction, -1); + if(int e = mlibc::sys_sigaction(signum, act, oldact); e) { + errno = e; + return -1; + } + return 0; +} + +int siginterrupt(int sig, int flag) { + int ret; + struct sigaction act; + + sigaction(sig, NULL, &act); + if (flag) + act.sa_flags &= ~SA_RESTART; + else + act.sa_flags |= SA_RESTART; + + ret = sigaction(sig, &act, NULL); + return ret; +} + +int kill(pid_t pid, int number) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_kill, -1); + if(int e = mlibc::sys_kill(pid, number); e) { + errno = e; + return -1; + } + return 0; +} + +int killpg(pid_t pgrp, int sig) { + if(pgrp > 1) { + return kill(-pgrp, sig); + } + + errno = EINVAL; + return -1; +} + +int sigtimedwait(const sigset_t *__restrict set, siginfo_t *__restrict info, const struct timespec *__restrict timeout) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_sigtimedwait, -1); + + int signo; + + if (int e = sysdep(set, info, timeout, &signo)) { + errno = e; + return -1; + } + + return signo; +} + +int sigwaitinfo(const sigset_t *__restrict set, siginfo_t *__restrict info) { + // NOTE: This assumes the sysdep behavior noted in mlibc/posix-sysdeps.hpp + return sigtimedwait(set, info, nullptr); +} + +int sigwait(const sigset_t *__restrict set, int *__restrict sig) { + if (int e = sigwaitinfo(set, nullptr); e < 0) { + return e; + } else { + if (sig) + *sig = e; + + return 0; + } +} + +int sigpending(sigset_t *set) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_sigpending, -1); + + if(int e = sysdep(set)) { + errno = e; + return -1; + } + + return 0; +} + +int sigaltstack(const stack_t *__restrict ss, stack_t *__restrict oss) { + if (ss && ss->ss_size < MINSIGSTKSZ && !(ss->ss_flags & SS_DISABLE)) { + errno = ENOMEM; + return -1; + } + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_sigaltstack, -1); + if (int e = mlibc::sys_sigaltstack(ss, oss); e) { + errno = e; + return -1; + } + + return 0; +} + +#if __MLIBC_GLIBC_OPTION +int sigisemptyset(const sigset_t *set) { + return !(*set); +} +#endif // __MLIBC_GLIBC_OPTION + +int sigqueue(pid_t, int, const union sigval) { + __ensure(!"sigqueue() not implemented"); + __builtin_unreachable(); +} + diff --git a/lib/mlibc/options/posix/generic/posix_stdio.cpp b/lib/mlibc/options/posix/generic/posix_stdio.cpp new file mode 100644 index 0000000..fc77a54 --- /dev/null +++ b/lib/mlibc/options/posix/generic/posix_stdio.cpp @@ -0,0 +1,209 @@ +#ifndef _GNU_SOURCE +#define _GNU_SOURCE +#endif + +#include <errno.h> +#include <stdio.h> +#include <stdlib.h> +#include <unistd.h> +#include <fcntl.h> + +#include <bits/ensure.h> +#include <mlibc/ansi-sysdeps.hpp> +#include <mlibc/debug.hpp> +#include <mlibc/file-io.hpp> +#include <mlibc/posix-file-io.hpp> +#include <mlibc/posix-sysdeps.hpp> + +struct popen_file : mlibc::fd_file { + popen_file(int fd, void (*do_dispose)(abstract_file *) = nullptr) + : fd_file(fd, do_dispose) {} + + pid_t get_popen_pid() { + return _popen_pid; + } + + void set_popen_pid(pid_t new_pid) { + _popen_pid = new_pid; + } + +private: + // Underlying PID in case of popen() + pid_t _popen_pid; +}; + +FILE *fmemopen(void *buf, size_t size, const char *__restrict mode) { + int flags = mlibc::fd_file::parse_modestring(mode); + + return frg::construct<mlibc::fmemopen_mem_file>(getAllocator(), buf, size, flags, + mlibc::file_dispose_cb<mlibc::mem_file>); +} + +int pclose(FILE *stream) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_waitpid, -1); + + auto file = static_cast<popen_file *>(stream); + + int status; + pid_t pid = file->get_popen_pid(); + + fclose(file); + + if (mlibc::sys_waitpid(pid, &status, 0, NULL, &pid) != 0) { + errno = ECHILD; + return -1; + } + + return status; +} + +FILE *popen(const char *command, const char *typestr) { + bool is_write; + pid_t child; + FILE *ret = nullptr; + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fork && mlibc::sys_dup2 && mlibc::sys_execve && + mlibc::sys_sigprocmask && mlibc::sys_sigaction && mlibc::sys_pipe, nullptr); + + if (typestr == NULL) { + errno = EINVAL; + return nullptr; + } + + if (strstr(typestr, "w") != NULL) { + is_write = true; + } else if (strstr(typestr, "r") != NULL) { + is_write = false; + } else { + errno = EINVAL; + return nullptr; + } + + bool cloexec = false; + if (strstr(typestr, "e") != NULL) { + // Set FD_CLOEXEC on the new file descriptor + cloexec = true; + } + + int fds[2]; + if (int e = mlibc::sys_pipe(fds, 0)) { + errno = e; + return nullptr; + } + + struct sigaction new_sa, old_int, old_quit; + sigset_t new_mask, old_mask; + + new_sa.sa_handler = SIG_IGN; + new_sa.sa_flags = 0; + sigemptyset(&new_sa.sa_mask); + mlibc::sys_sigaction(SIGINT, &new_sa, &old_int); + mlibc::sys_sigaction(SIGQUIT, &new_sa, &old_quit); + + sigemptyset(&new_mask); + sigaddset(&new_mask, SIGCHLD); + mlibc::sys_sigprocmask(SIG_BLOCK, &new_mask, &old_mask); + + int parent_end = is_write ? 1 : 0; + int child_end = is_write ? 0 : 1; + + if (int e = mlibc::sys_fork(&child)) { + errno = e; + mlibc::sys_close(fds[0]); + mlibc::sys_close(fds[1]); + } else if (!child) { + // For the child + mlibc::sys_sigaction(SIGINT, &old_int, nullptr); + mlibc::sys_sigaction(SIGQUIT, &old_quit, nullptr); + mlibc::sys_sigprocmask(SIG_SETMASK, &old_mask, nullptr); + + mlibc::sys_close(fds[parent_end]); + + if (mlibc::sys_dup2(fds[child_end], 0, is_write ? 0 : 1)) { + __ensure(!"sys_dup2() failed in popen()"); + } + mlibc::sys_close(fds[child_end]); + + const char *args[] = { + "sh", "-c", command, nullptr + }; + + mlibc::sys_execve("/bin/sh", const_cast<char **>(args), environ); + _Exit(127); + } else { + // For the parent + mlibc::sys_close(fds[child_end]); + + ret = frg::construct<popen_file>( + getAllocator(), + fds[parent_end], + mlibc::file_dispose_cb<popen_file> + ); + __ensure(ret); + + auto file = static_cast<popen_file *>(ret); + + file->set_popen_pid(child); + + if (cloexec == true) { + fcntl(file->fd(), F_SETFD, O_CLOEXEC); + } + } + + mlibc::sys_sigaction(SIGINT, &old_int, nullptr); + mlibc::sys_sigaction(SIGQUIT, &old_quit, nullptr); + mlibc::sys_sigprocmask(SIG_SETMASK, &old_mask, nullptr); + + return ret; +} + +FILE *open_memstream(char **buf, size_t *sizeloc) { + return frg::construct<mlibc::memstream_mem_file>(getAllocator(), buf, sizeloc, O_RDWR, + mlibc::file_dispose_cb<mlibc::mem_file>); +} + +int fseeko(FILE *file_base, off_t offset, int whence) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + if(int e = file->seek(offset, whence); e) { + errno = e; + return -1; + } + return 0; +} + +off_t ftello(FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + off_t current_offset; + if(int e = file->tell(¤t_offset); e) { + errno = e; + return -1; + } + return current_offset; +} + +int dprintf(int fd, const char *format, ...) { + va_list args; + va_start(args, format); + int result = vdprintf(fd, format, args); + va_end(args); + return result; +} + +int vdprintf(int fd, const char *format, __builtin_va_list args) { + mlibc::fd_file file{fd}; + int ret = vfprintf(&file, format, args); + file.flush(); + return ret; +} + +char *fgetln(FILE *, size_t *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +FILE *fopencookie(void *cookie, const char *__restrict mode, cookie_io_functions_t funcs) { + int flags = mlibc::fd_file::parse_modestring(mode); + + return frg::construct<mlibc::cookie_file>(getAllocator(), cookie, flags, funcs, + mlibc::file_dispose_cb<mlibc::cookie_file>); +} diff --git a/lib/mlibc/options/posix/generic/posix_stdlib.cpp b/lib/mlibc/options/posix/generic/posix_stdlib.cpp new file mode 100644 index 0000000..4010998 --- /dev/null +++ b/lib/mlibc/options/posix/generic/posix_stdlib.cpp @@ -0,0 +1,513 @@ + +#include <abi-bits/fcntl.h> +#include <bits/ensure.h> +#include <errno.h> +#include <fcntl.h> +#include <limits.h> +#include <stdlib.h> +#include <stdio.h> +#include <string.h> +#include <unistd.h> +#include <sys/ioctl.h> +#include <sys/stat.h> + +#include <frg/small_vector.hpp> +#include <mlibc/allocator.hpp> +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> +#include <mlibc/rtdl-config.hpp> + +namespace { + constexpr bool debugPathResolution = false; +} + +// Borrowed from musl +static uint32_t init[] = { +0x00000000,0x5851f42d,0xc0b18ccf,0xcbb5f646, +0xc7033129,0x30705b04,0x20fd5db4,0x9a8b7f78, +0x502959d8,0xab894868,0x6c0356a7,0x88cdb7ff, +0xb477d43f,0x70a3a52b,0xa8e4baf1,0xfd8341fc, +0x8ae16fd9,0x742d2f7a,0x0d1f0796,0x76035e09, +0x40f7702c,0x6fa72ca5,0xaaa84157,0x58a0df74, +0xc74a0364,0xae533cc4,0x04185faf,0x6de3b115, +0x0cab8628,0xf043bfa4,0x398150e9,0x37521657}; + +static int n = 31; +static int i = 3; +static int j = 0; +static uint32_t *x = init + 1; + + +static uint32_t lcg31(uint32_t x) { + return (1103515245 * x + 12345) & 0x7fffffff; +} + +static uint64_t lcg64(uint64_t x) { + return 6364136223846793005ull * x + 1; +} + +static void *savestate(void) { + x[-1] = (n << 16) | (i << 8) | j; + return x - 1; +} + +static void loadstate(uint32_t *state) { + x = state + 1; + n = x[-1] >> 16; + i = (x[-1] >> 8) & 0xff; + j = x[-1] & 0xff; +} + +long random(void) { + long k; + + if(n == 0) { + k = x[0] = lcg31(x[0]); + return k; + } + x[i] += x[j]; + k = x[i] >> 1; + if(++i == n) + i = 0; + if(++j == n) + j = 0; + + return k; +} + +double drand48(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void srand48(long int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +// Borrowed from musl +void srandom(unsigned int seed) { + int k; + uint64_t s = seed; + + if(n == 0) { + x[0] = s; + return; + } + i = n == 31 || n == 7 ? 3 : 1; + j = 0; + for(k = 0; k < n; k++) { + s = lcg64(s); + x[k] = s >> 32; + } + // Make sure x contains at least one odd number + x[0] |= 1; +} + +char *initstate(unsigned int seed, char *state, size_t size) { + void *old; + + if(size < 8) + return 0; + old = savestate(); + if(size < 32) + n = 0; + else if(size < 64) + n = 7; + else if(size < 128) + n = 15; + else if(size < 256) + n = 31; + else + n = 63; + x = (uint32_t *)state + 1; + srandom(seed); + savestate(); + return (char *)old; +} + +char *setstate(char *state) { + void *old; + + old = savestate(); + loadstate((uint32_t *)state); + return (char *)old; +} + +// ---------------------------------------------------------------------------- +// Path handling. +// ---------------------------------------------------------------------------- + + +int mkostemps(char *pattern, int suffixlen, int flags) { + auto n = strlen(pattern); + if(n < (6 + static_cast<size_t>(suffixlen))) { + errno = EINVAL; + return -1; + } + + flags &= ~O_WRONLY; + + for(size_t i = 0; i < 6; i++) { + if(pattern[n - (6 + suffixlen) + i] == 'X') + continue; + errno = EINVAL; + return -1; + } + + // TODO: Do an exponential search. + for(size_t i = 0; i < 999999; i++) { + char sfx = pattern[n - suffixlen]; + __ensure(sprintf(pattern + (n - (6 + suffixlen)), "%06zu", i) == 6); + pattern[n - suffixlen] = sfx; + + int fd; + if(int e = mlibc::sys_open(pattern, O_RDWR | O_CREAT | O_EXCL | flags, S_IRUSR | S_IWUSR, &fd); !e) { + return fd; + }else if(e != EEXIST) { + errno = e; + return -1; + } + } + + errno = EEXIST; + return -1; +} + +int mkostemp(char *pattern, int flags) { + return mkostemps(pattern, flags, 0); +} + +int mkstemp(char *path) { + return mkostemp(path, 0); +} + +int mkstemps(char *pattern, int suffixlen) { + return mkostemps(pattern, suffixlen, 0); +} + +char *mkdtemp(char *pattern) { + mlibc::infoLogger() << "mlibc mkdtemp(" << pattern << ") called" << frg::endlog; + auto n = strlen(pattern); + __ensure(n >= 6); + if(n < 6) { + errno = EINVAL; + return NULL; + } + for(size_t i = 0; i < 6; i++) { + if(pattern[n - 6 + i] == 'X') + continue; + errno = EINVAL; + return NULL; + } + + // TODO: Do an exponential search. + for(size_t i = 0; i < 999999; i++) { + __ensure(sprintf(pattern + (n - 6), "%06zu", i) == 6); + if(int e = mlibc::sys_mkdir(pattern, S_IRWXU); !e) { + return pattern; + }else if(e != EEXIST) { + errno = e; + return NULL; + } + } + + errno = EEXIST; + return NULL; +} + +char *realpath(const char *path, char *out) { + if(debugPathResolution) + mlibc::infoLogger() << "mlibc realpath(): Called on '" << path << "'" << frg::endlog; + frg::string_view path_view{path}; + + // In case of the root, the string only contains the null-terminator. + frg::small_vector<char, PATH_MAX, MemoryAllocator> resolv{getAllocator()}; + size_t ps; + + // If the path is relative, we have to preprend the working directory. + if(path[0] == '/') { + resolv.push_back(0); + ps = 1; + }else{ + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getcwd, nullptr); + + // Try to getcwd() until the buffer is large enough. + resolv.resize(128); + while(true) { + int e = mlibc::sys_getcwd(resolv.data(), resolv.size()); + if(e == ERANGE) { + resolv.resize(2 * resolv.size()); + }else if(!e) { + break; + }else{ + errno = e; + return nullptr; + } + } + frg::string_view cwd_view{resolv.data()}; + if(cwd_view == "/") { + // Restore our invariant that we only store the null-terminator for the root. + resolv.resize(1); + resolv[0] = 0; + }else{ + resolv.resize(cwd_view.size() + 1); + } + ps = 0; + } + + // Contains unresolved links as a relative path compared to resolv. + frg::small_vector<char, PATH_MAX, MemoryAllocator> lnk{getAllocator()}; + size_t ls = 0; + + auto process_segment = [&] (frg::string_view s_view) -> int { + if(debugPathResolution) + mlibc::infoLogger() << "mlibc realpath(): resolv is '" << resolv.data() << "'" + << ", segment is " << s_view.data() + << ", size: " << s_view.size() << frg::endlog; + + if(!s_view.size() || s_view == ".") { + // Keep resolv invariant. + return 0; + }else if(s_view == "..") { + // Remove a single segment from resolv. + if(resolv.size() > 1) { + auto slash = strrchr(resolv.data(), '/'); + __ensure(slash); // We never remove the leading sla. + resolv.resize((slash - resolv.data()) + 1); + *slash = 0; // Replace the slash by a null-terminator. + } + return 0; + } + + // Append the segment to resolv. + auto rsz = resolv.size(); + resolv[rsz - 1] = '/'; // Replace null-terminator by a slash. + resolv.resize(rsz + s_view.size() + 1); + memcpy(resolv.data() + rsz, s_view.data(), s_view.size()); + resolv[rsz + s_view.size()] = 0; + + // stat() the path to (1) see if it exists and (2) see if it is a link. + if(!mlibc::sys_stat) { + MLIBC_MISSING_SYSDEP(); + return ENOSYS; + } + if(debugPathResolution) + mlibc::infoLogger() << "mlibc realpath(): stat()ing '" + << resolv.data() << "'" << frg::endlog; + struct stat st; + if(int e = mlibc::sys_stat(mlibc::fsfd_target::path, + -1, resolv.data(), AT_SYMLINK_NOFOLLOW, &st); e) + return e; + + if(S_ISLNK(st.st_mode)) { + if(debugPathResolution) { + mlibc::infoLogger() << "mlibc realpath(): Encountered symlink '" + << resolv.data() << "'" << frg::endlog; + } + + if(!mlibc::sys_readlink) { + MLIBC_MISSING_SYSDEP(); + return ENOSYS; + } + + ssize_t sz = 0; + char path[512]; + + if (int e = mlibc::sys_readlink(resolv.data(), path, 512, &sz); e) + return e; + + if(debugPathResolution) { + mlibc::infoLogger() << "mlibc realpath(): Symlink resolves to '" + << frg::string_view{path, static_cast<size_t>(sz)} << "'" << frg::endlog; + } + + if (path[0] == '/') { + // Absolute path, replace resolv + resolv.resize(sz); + strncpy(resolv.data(), path, sz - 1); + resolv.data()[sz - 1] = 0; + + if(debugPathResolution) { + mlibc::infoLogger() << "mlibc realpath(): Symlink is absolute, resolv: '" + << resolv.data() << "'" << frg::endlog; + } + } else { + // Relative path, revert changes to resolv, prepend to lnk + resolv.resize(rsz); + resolv[rsz - 1] = 0; + + auto lsz = lnk.size(); + lnk.resize((lsz - ls) + sz + 1); + memmove(lnk.data() + sz, lnk.data() + ls, lsz - ls); + memcpy(lnk.data(), path, sz); + lnk[(lsz - ls) + sz] = 0; + + ls = 0; + + if(debugPathResolution) { + mlibc::infoLogger() << "mlibc realpath(): Symlink is relative, resolv: '" + << resolv.data() << "' lnk: '" + << frg::string_view{lnk.data(), lnk.size()} << "'" << frg::endlog; + } + } + } + + return 0; + }; + + // Each iteration of this outer loop consumes segment of the input path. + // This design avoids copying the input path into lnk; + // the latter could often involve additional allocations. + while(ps < path_view.size()) { + frg::string_view ps_view; + if(auto slash = strchr(path + ps, '/'); slash) { + ps_view = frg::string_view{path + ps, static_cast<size_t>(slash - (path + ps))}; + }else{ + ps_view = frg::string_view{path + ps, strlen(path) - ps}; + } + ps += ps_view.size() + 1; + + // Handle one segment from the input path. + if(int e = process_segment(ps_view); e) { + errno = e; + return nullptr; + } + + // This inner loop consumes segments of lnk. + while(ls < lnk.size()) { + frg::string_view ls_view; + if(auto slash = strchr(lnk.data() + ls, '/'); slash) { + ls_view = frg::string_view{lnk.data() + ls, static_cast<size_t>(slash - (lnk.data() + ls))}; + }else{ + ls_view = frg::string_view{lnk.data() + ls, strlen(lnk.data()) - ls}; + } + ls += ls_view.size() + 1; + + // Handle one segment from the link + if(int e = process_segment(ls_view); e) { + errno = e; + return nullptr; + } + } + + // All of lnk was consumed, reset it + lnk.resize(0); + ls = 0; + } + + if(resolv.size() == 1) { + resolv.resize(0); + resolv.push_back('/'); + resolv.push_back(0); + } + + if(debugPathResolution) + mlibc::infoLogger() << "mlibc realpath(): Returns '" << resolv.data() << "'" << frg::endlog; + + if(resolv.size() > PATH_MAX) { + errno = ENAMETOOLONG; + return nullptr; + } + + if(!out) + out = reinterpret_cast<char *>(getAllocator().allocate(resolv.size())); + strcpy(out, resolv.data()); + return out; +} + +// ---------------------------------------------------------------------------- +// Pseudoterminals +// ---------------------------------------------------------------------------- + +int ptsname_r(int fd, char *buffer, size_t length) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_ptsname, ENOSYS); + + if(int e = sysdep(fd, buffer, length); e) + return e; + + return 0; +} + +char *ptsname(int fd) { + static char buffer[128]; + + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_ptsname, NULL); + + if(int e = sysdep(fd, buffer, 128); e) { + errno = e; + return NULL; + } + + return buffer; +} + +int posix_openpt(int flags) { + int fd; + if(int e = mlibc::sys_open("/dev/ptmx", flags, 0, &fd); e) { + errno = e; + return -1; + } + + return fd; +} + +int unlockpt(int fd) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_unlockpt, -1); + + if(int e = sysdep(fd); e) { + errno = e; + return -1; + } + + return 0; +} + +int grantpt(int) { + return 0; +} + +double strtod_l(const char *__restrict__ nptr, char ** __restrict__ endptr, locale_t) { + mlibc::infoLogger() << "mlibc: strtod_l ignores locale!" << frg::endlog; + return strtod(nptr, endptr); +} + +long double strtold_l(const char *__restrict__, char ** __restrict__, locale_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +float strtof_l(const char *__restrict__ nptr, char **__restrict__ endptr, locale_t) { + mlibc::infoLogger() << "mlibc: strtof_l ignores locales" << frg::endlog; + return strtof(nptr, endptr); +} + +int strcoll_l(const char *, const char *, locale_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int getloadavg(double *, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +char *secure_getenv(const char *name) { + if (mlibc::rtdlConfig().secureRequired) + return NULL; + else + return getenv(name); +} + +void *reallocarray(void *ptr, size_t m, size_t n) { + if(n && m > -1 / n) { + errno = ENOMEM; + return 0; + } + + return realloc(ptr, m * n); +} + +char *canonicalize_file_name(const char *name) { + return realpath(name, NULL); +} diff --git a/lib/mlibc/options/posix/generic/posix_string.cpp b/lib/mlibc/options/posix/generic/posix_string.cpp new file mode 100644 index 0000000..d0bc7b5 --- /dev/null +++ b/lib/mlibc/options/posix/generic/posix_string.cpp @@ -0,0 +1,174 @@ +#ifndef _GNU_SOURCE +#define _GNU_SOURCE +#endif + +#include <bits/ensure.h> +#include <stdlib.h> +#include <string.h> +#include <strings.h> +#include <signal.h> + +#include <mlibc/debug.hpp> + +char *strdup(const char *string) { + auto num_bytes = strlen(string); + + char *new_string = (char *)malloc(num_bytes + 1); + if(!new_string) // TODO: set errno + return nullptr; + + memcpy(new_string, string, num_bytes); + new_string[num_bytes] = 0; + return new_string; +} + +char *strndup(const char *string, size_t max_size) { + auto num_bytes = strnlen(string, max_size); + char *new_string = (char *)malloc(num_bytes + 1); + if(!new_string) // TODO: set errno + return nullptr; + + memcpy(new_string, string, num_bytes); + new_string[num_bytes] = 0; + return new_string; +} + +char *stpcpy(char *__restrict dest, const char *__restrict src) { + auto n = strlen(src); + memcpy(dest, src, n + 1); + return dest + n; +} + +char *stpncpy(char *__restrict dest, const char *__restrict src, size_t n) { + size_t nulls, copied, srcLen = strlen(src); + if (n >= srcLen) { + nulls = n - srcLen; + copied = srcLen; + } else { + nulls = 0; + copied = n; + } + + memcpy(dest, src, copied); + memset(dest + srcLen, 0, nulls); + return dest + n - nulls; +} + +size_t strnlen(const char *s, size_t n) { + size_t len = 0; + while(len < n && s[len]) + ++len; + return len; +} + +char *strsep(char **m, const char *del) { + __ensure(m); + + auto tok = *m; + if(!tok) + return nullptr; + + // Replace the following delimiter by a null-terminator. + // After this loop: *p is null iff we reached the end of the string. + auto p = tok; + while(*p && !strchr(del, *p)) + p++; + + if(*p) { + *p = 0; + *m = p + 1; + }else{ + *m = nullptr; + } + return tok; +} + +char *strsignal(int sig) { + #define CASE_FOR(sigconst) case sigconst: s = #sigconst; break; + const char *s; + switch(sig) { + CASE_FOR(SIGABRT) + CASE_FOR(SIGFPE) + CASE_FOR(SIGILL) + CASE_FOR(SIGINT) + CASE_FOR(SIGSEGV) + CASE_FOR(SIGTERM) + CASE_FOR(SIGPROF) + CASE_FOR(SIGIO) + CASE_FOR(SIGPWR) + CASE_FOR(SIGALRM) + CASE_FOR(SIGBUS) + CASE_FOR(SIGCHLD) + CASE_FOR(SIGCONT) + CASE_FOR(SIGHUP) + CASE_FOR(SIGKILL) + CASE_FOR(SIGPIPE) + CASE_FOR(SIGQUIT) + CASE_FOR(SIGSTOP) + CASE_FOR(SIGTSTP) + CASE_FOR(SIGTTIN) + CASE_FOR(SIGTTOU) + CASE_FOR(SIGUSR1) + CASE_FOR(SIGUSR2) + CASE_FOR(SIGSYS) + CASE_FOR(SIGTRAP) + CASE_FOR(SIGURG) + CASE_FOR(SIGVTALRM) + CASE_FOR(SIGXCPU) + CASE_FOR(SIGXFSZ) + CASE_FOR(SIGWINCH) + default: + mlibc::infoLogger() << "mlibc: Unknown signal number " << sig << frg::endlog; + s = "Unknown signal number"; + } + return const_cast<char *>(s); +} + +char *strcasestr(const char *s, const char *pattern) { + size_t plen = strlen(pattern); + const char *p = s; + while(*p) { + // Need strncasecmp() to avoid checking past the end of a successful match. + if(!strncasecmp(p, pattern, plen)) + return const_cast<char *>(p); + ++p; + } + return nullptr; +} + +void *memccpy(void *__restrict, const void *__restrict, int, size_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +// This implementation was taken from musl +void *memrchr(const void *m, int c, size_t n) { + const unsigned char *s = (const unsigned char *)m; + c = (unsigned char)c; + while(n--) { + if(s[n] == c) + return (void *)(s + n); + } + return 0; +} + +// BSD extensions. +// Taken from musl +size_t strlcpy(char *d, const char *s, size_t n) { + char *d0 = d; + + if(!n--) + goto finish; + for(; n && (*d=*s); n--, s++, d++); + *d = 0; +finish: + return d-d0 + strlen(s); +} + +size_t strlcat(char *d, const char *s, size_t n) { + size_t l = strnlen(d, n); + if(l == n) { + return l + strlen(s); + } + return l + strlcpy(d + l, s, n - l); +} diff --git a/lib/mlibc/options/posix/generic/posix_time.cpp b/lib/mlibc/options/posix/generic/posix_time.cpp new file mode 100644 index 0000000..d93ebbc --- /dev/null +++ b/lib/mlibc/options/posix/generic/posix_time.cpp @@ -0,0 +1,32 @@ +#include <bits/posix/posix_time.h> +#include <bits/ensure.h> +#include <mlibc/posix-sysdeps.hpp> +#include <errno.h> + +int utimes(const char *filename, const struct timeval times[2]) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_utimensat, -1); + struct timespec time[2]; + if(times == nullptr) { + time[0].tv_sec = UTIME_NOW; + time[0].tv_nsec = UTIME_NOW; + time[1].tv_sec = UTIME_NOW; + time[1].tv_nsec = UTIME_NOW; + } else { + time[0].tv_sec = times[0].tv_sec; + time[0].tv_nsec = times[0].tv_usec * 1000; + time[1].tv_sec = times[1].tv_sec; + time[1].tv_nsec = times[1].tv_usec * 1000; + } + + if (int e = mlibc::sys_utimensat(AT_FDCWD, filename, time, 0); e) { + errno = e; + return -1; + } + + return 0; +} + +int futimes(int, const struct timeval[2]) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/posix/generic/pthread-stubs.cpp b/lib/mlibc/options/posix/generic/pthread-stubs.cpp new file mode 100644 index 0000000..9720bc2 --- /dev/null +++ b/lib/mlibc/options/posix/generic/pthread-stubs.cpp @@ -0,0 +1,1426 @@ + +#include <stddef.h> +#include <stdint.h> +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <pthread.h> +#include <unistd.h> +#include <errno.h> +#include <inttypes.h> + +#include <bits/ensure.h> +#include <frg/allocation.hpp> +#include <frg/array.hpp> +#include <mlibc/allocator.hpp> +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> +#include <mlibc/thread.hpp> +#include <mlibc/tcb.hpp> +#include <mlibc/tid.hpp> +#include <mlibc/threads.hpp> + +static bool enableTrace = false; + +struct ScopeTrace { + ScopeTrace(const char *file, int line, const char *function) + : _file(file), _line(line), _function(function) { + if(!enableTrace) + return; + mlibc::infoLogger() << "trace: Enter scope " + << _file << ":" << _line << " (in function " + << _function << ")" << frg::endlog; + } + + ~ScopeTrace() { + if(!enableTrace) + return; + mlibc::infoLogger() << "trace: Exit scope" << frg::endlog; + } + +private: + const char *_file; + int _line; + const char *_function; +}; + +#define SCOPE_TRACE() ScopeTrace(__FILE__, __LINE__, __FUNCTION__) + +static constexpr unsigned int mutexRecursive = 1; +static constexpr unsigned int mutexErrorCheck = 2; + +// TODO: either use uint32_t or determine the bit based on sizeof(int). +static constexpr unsigned int mutex_owner_mask = (static_cast<uint32_t>(1) << 30) - 1; +static constexpr unsigned int mutex_waiters_bit = static_cast<uint32_t>(1) << 31; + +// Only valid for the internal __mlibc_m mutex of wrlocks. +static constexpr unsigned int mutex_excl_bit = static_cast<uint32_t>(1) << 30; + +static constexpr unsigned int rc_count_mask = (static_cast<uint32_t>(1) << 31) - 1; +static constexpr unsigned int rc_waiters_bit = static_cast<uint32_t>(1) << 31; + +static constexpr size_t default_stacksize = 0x200000; +static constexpr size_t default_guardsize = 4096; + +// ---------------------------------------------------------------------------- +// pthread_attr and pthread functions. +// ---------------------------------------------------------------------------- + +// pthread_attr functions. +int pthread_attr_init(pthread_attr_t *attr) { + *attr = pthread_attr_t{}; + attr->__mlibc_stacksize = default_stacksize; + attr->__mlibc_guardsize = default_guardsize; + attr->__mlibc_detachstate = PTHREAD_CREATE_JOINABLE; + return 0; +} + +int pthread_attr_destroy(pthread_attr_t *) { + return 0; +} + +int pthread_attr_getdetachstate(const pthread_attr_t *attr, int *detachstate) { + *detachstate = attr->__mlibc_detachstate; + return 0; +} +int pthread_attr_setdetachstate(pthread_attr_t *attr, int detachstate) { + if (detachstate != PTHREAD_CREATE_DETACHED && + detachstate != PTHREAD_CREATE_JOINABLE) + return EINVAL; + + attr->__mlibc_detachstate = detachstate; + return 0; +} + +int pthread_attr_getstacksize(const pthread_attr_t *__restrict attr, size_t *__restrict stacksize) { + *stacksize = attr->__mlibc_stacksize; + return 0; +} + +int pthread_attr_setstacksize(pthread_attr_t *attr, size_t stacksize) { + if (stacksize < PTHREAD_STACK_MIN) + return EINVAL; + attr->__mlibc_stacksize = stacksize; + return 0; +} + +int pthread_attr_getstackaddr(const pthread_attr_t *attr, void **stackaddr) { + *stackaddr = attr->__mlibc_stackaddr; + return 0; +} +int pthread_attr_setstackaddr(pthread_attr_t *attr, void *stackaddr) { + attr->__mlibc_stackaddr = stackaddr; + return 0; +} + +int pthread_attr_getstack(const pthread_attr_t *attr, void **stackaddr, size_t *stacksize) { + *stackaddr = attr->__mlibc_stackaddr; + *stacksize = attr->__mlibc_stacksize; + return 0; +} +int pthread_attr_setstack(pthread_attr_t *attr, void *stackaddr, size_t stacksize) { + if (stacksize < PTHREAD_STACK_MIN) + return EINVAL; + attr->__mlibc_stacksize = stacksize; + attr->__mlibc_stackaddr = stackaddr; + return 0; +} + +int pthread_attr_getguardsize(const pthread_attr_t *__restrict attr, size_t *__restrict guardsize) { + *guardsize = attr->__mlibc_guardsize; + return 0; +} +int pthread_attr_setguardsize(pthread_attr_t *attr, size_t guardsize) { + attr->__mlibc_guardsize = guardsize; + return 0; +} + +int pthread_attr_getscope(const pthread_attr_t *attr, int *scope) { + *scope = attr->__mlibc_scope; + return 0; +} +int pthread_attr_setscope(pthread_attr_t *attr, int scope) { + if (scope != PTHREAD_SCOPE_SYSTEM && + scope != PTHREAD_SCOPE_PROCESS) + return EINVAL; + if (scope == PTHREAD_SCOPE_PROCESS) + return ENOTSUP; + attr->__mlibc_scope = scope; + return 0; +} + +int pthread_attr_getinheritsched(const pthread_attr_t *attr, int *inheritsched) { + *inheritsched = attr->__mlibc_inheritsched; + return 0; +} +int pthread_attr_setinheritsched(pthread_attr_t *attr, int inheritsched) { + if (inheritsched != PTHREAD_INHERIT_SCHED && + inheritsched != PTHREAD_EXPLICIT_SCHED) + return EINVAL; + attr->__mlibc_inheritsched = inheritsched; + return 0; +} + +int pthread_attr_getschedparam(const pthread_attr_t *__restrict attr, struct sched_param *__restrict schedparam) { + *schedparam = attr->__mlibc_schedparam; + return 0; +} +int pthread_attr_setschedparam(pthread_attr_t *__restrict attr, const struct sched_param *__restrict schedparam) { + // TODO: this is supposed to return EINVAL for when the schedparam doesn't make sense + // for the given schedpolicy. + attr->__mlibc_schedparam = *schedparam; + return 0; +} + +int pthread_attr_getschedpolicy(const pthread_attr_t *__restrict attr, int *__restrict policy) { + *policy = attr->__mlibc_schedpolicy; + return 0; +} +int pthread_attr_setschedpolicy(pthread_attr_t *__restrict attr, int policy) { + if (policy != SCHED_FIFO && policy != SCHED_RR && + policy != SCHED_OTHER) + return EINVAL; + attr->__mlibc_schedpolicy = policy; + return 0; +} + +#if __MLIBC_LINUX_OPTION +int pthread_attr_getaffinity_np(const pthread_attr_t *__restrict attr, + size_t cpusetsize, cpu_set_t *__restrict cpusetp) { + if (!attr) + return EINVAL; + + if (!attr->__mlibc_cpuset) { + memset(cpusetp, -1, cpusetsize); + return 0; + } + + for (size_t cnt = cpusetsize; cnt < attr->__mlibc_cpusetsize; cnt++) + if (reinterpret_cast<char*>(attr->__mlibc_cpuset)[cnt] != '\0') + return ERANGE; + + auto p = memcpy(cpusetp, attr->__mlibc_cpuset, + std::min(cpusetsize, attr->__mlibc_cpusetsize)); + if (cpusetsize > attr->__mlibc_cpusetsize) + memset(p, '\0', cpusetsize - attr->__mlibc_cpusetsize); + + return 0; +} + +int pthread_attr_setaffinity_np(pthread_attr_t *__restrict attr, + size_t cpusetsize, const cpu_set_t *__restrict cpusetp) { + if (!attr) + return EINVAL; + + if (!cpusetp || !cpusetsize) { + attr->__mlibc_cpuset = NULL; + attr->__mlibc_cpusetsize = 0; + return 0; + } + + if (attr->__mlibc_cpusetsize != cpusetsize) { + auto newp = realloc(attr->__mlibc_cpuset, cpusetsize); + if (!newp) + return ENOMEM; + + attr->__mlibc_cpuset = static_cast<cpu_set_t*>(newp); + attr->__mlibc_cpusetsize = cpusetsize; + } + + memcpy(attr->__mlibc_cpuset, cpusetp, cpusetsize); + return 0; +} + +int pthread_attr_getsigmask_np(const pthread_attr_t *__restrict attr, + sigset_t *__restrict sigmask) { + if (!attr) + return EINVAL; + + if (!attr->__mlibc_sigmaskset) { + sigemptyset(sigmask); + return PTHREAD_ATTR_NO_SIGMASK_NP; + } + + *sigmask = attr->__mlibc_sigmask; + + return 0; +} +int pthread_attr_setsigmask_np(pthread_attr_t *__restrict attr, + const sigset_t *__restrict sigmask) { + if (!attr) + return EINVAL; + + if (!sigmask) { + attr->__mlibc_sigmaskset = 0; + return 0; + } + + attr->__mlibc_sigmask = *sigmask; + attr->__mlibc_sigmaskset = 1; + + // Filter out internally used signals. + sigdelset(&attr->__mlibc_sigmask, SIGCANCEL); + + return 0; +} + +namespace { + void get_own_stackinfo(void **stack_addr, size_t *stack_size) { + auto fp = fopen("/proc/self/maps", "r"); + if (!fp) { + mlibc::infoLogger() << "mlibc pthreads: /proc/self/maps does not exist! Producing incorrect" + " stack results!" << frg::endlog; + return; + } + + char line[256]; + auto sp = mlibc::get_sp(); + while (fgets(line, 256, fp)) { + uintptr_t from, to; + if(sscanf(line, "%" SCNxPTR "-%" SCNxPTR, &from, &to) != 2) + continue; + if (sp < to && sp > from) { + // We need to return the lowest byte of the stack. + *stack_addr = reinterpret_cast<void*>(from); + *stack_size = to - from; + fclose(fp); + return; + } + } + + fclose(fp); + } +} + +int pthread_getattr_np(pthread_t thread, pthread_attr_t *attr) { + auto tcb = reinterpret_cast<Tcb*>(thread); + *attr = pthread_attr_t{}; + + if (!tcb->stackAddr || !tcb->stackSize) { + get_own_stackinfo(&attr->__mlibc_stackaddr, &attr->__mlibc_stacksize); + } else { + attr->__mlibc_stacksize = tcb->stackSize; + attr->__mlibc_stackaddr = tcb->stackAddr; + } + + attr->__mlibc_guardsize = tcb->guardSize; + attr->__mlibc_detachstate = tcb->isJoinable ? PTHREAD_CREATE_JOINABLE : PTHREAD_CREATE_DETACHED; + mlibc::infoLogger() << "pthread_getattr_np(): Implementation is incomplete!" << frg::endlog; + return 0; +} + +int pthread_getaffinity_np(pthread_t thread, size_t cpusetsize, cpu_set_t *mask) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getthreadaffinity, ENOSYS); + return mlibc::sys_getthreadaffinity(reinterpret_cast<Tcb*>(thread)->tid, cpusetsize, mask); +} + +int pthread_setaffinity_np(pthread_t thread, size_t cpusetsize, const cpu_set_t *mask) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setthreadaffinity, ENOSYS); + return mlibc::sys_setthreadaffinity(reinterpret_cast<Tcb*>(thread)->tid, cpusetsize, mask); +} +#endif // __MLIBC_LINUX_OPTION + +extern "C" Tcb *__rtdl_allocateTcb(); + +// pthread functions. +int pthread_create(pthread_t *__restrict thread, const pthread_attr_t *__restrict attrp, + void *(*entry) (void *), void *__restrict user_arg) { + return mlibc::thread_create(thread, attrp, reinterpret_cast<void *>(entry), user_arg, false); +} + +pthread_t pthread_self(void) { + return reinterpret_cast<pthread_t>(mlibc::get_current_tcb()); +} + +int pthread_equal(pthread_t t1, pthread_t t2) { + if(t1 == t2) + return 1; + return 0; +} + +namespace { + struct key_global_info { + bool in_use; + + void (*dtor)(void *); + uint64_t generation; + }; + + constinit frg::array< + key_global_info, + PTHREAD_KEYS_MAX + > key_globals_{}; + + FutexLock key_mutex_; +} + +namespace mlibc { + __attribute__ ((__noreturn__)) void do_exit() { + sys_thread_exit(); + __builtin_unreachable(); + } +} + +__attribute__ ((__noreturn__)) void pthread_exit(void *ret_val) { + auto self = mlibc::get_current_tcb(); + + if (__atomic_load_n(&self->cancelBits, __ATOMIC_RELAXED) & tcbExitingBit) + mlibc::do_exit(); + + __atomic_fetch_or(&self->cancelBits, tcbExitingBit, __ATOMIC_RELAXED); + + auto hand = self->cleanupEnd; + while (hand) { + auto old = hand; + hand->func(hand->arg); + hand = hand->prev; + frg::destruct(getAllocator(), old); + } + + for (size_t j = 0; j < PTHREAD_DESTRUCTOR_ITERATIONS; j++) { + for (size_t i = 0; i < PTHREAD_KEYS_MAX; i++) { + if (auto v = pthread_getspecific(i)) { + key_mutex_.lock(); + auto dtor = key_globals_[i].dtor; + key_mutex_.unlock(); + + if (dtor) { + dtor(v); + (*self->localKeys)[i].value = nullptr; + } + } + } + } + + self->returnValue.voidPtr = ret_val; + __atomic_store_n(&self->didExit, 1, __ATOMIC_RELEASE); + mlibc::sys_futex_wake(&self->didExit); + + // TODO: clean up thread resources when we are detached. + + // TODO: do exit(0) when we're the only thread instead + mlibc::do_exit(); +} + +int pthread_join(pthread_t thread, void **ret) { + return mlibc::thread_join(thread, ret); +} + +int pthread_detach(pthread_t thread) { + auto tcb = reinterpret_cast<Tcb*>(thread); + if (!__atomic_load_n(&tcb->isJoinable, __ATOMIC_RELAXED)) + return EINVAL; + + int expected = 1; + if(!__atomic_compare_exchange_n(&tcb->isJoinable, &expected, 0, false, __ATOMIC_RELEASE, + __ATOMIC_RELAXED)) + return EINVAL; + + return 0; +} + +void pthread_cleanup_push(void (*func) (void *), void *arg) { + auto self = mlibc::get_current_tcb(); + + auto hand = frg::construct<Tcb::CleanupHandler>(getAllocator()); + hand->func = func; + hand->arg = arg; + hand->next = nullptr; + hand->prev = self->cleanupEnd; + + if (self->cleanupEnd) + self->cleanupEnd->next = hand; + + self->cleanupEnd = hand; + + if (!self->cleanupBegin) + self->cleanupBegin = self->cleanupEnd; +} + +void pthread_cleanup_pop(int execute) { + auto self = mlibc::get_current_tcb(); + + auto hand = self->cleanupEnd; + + if (self->cleanupEnd) + self->cleanupEnd = self->cleanupEnd->prev; + if (self->cleanupEnd) + self->cleanupEnd->next = nullptr; + + if (execute) + hand->func(hand->arg); + + frg::destruct(getAllocator(), hand); +} + +int pthread_setname_np(pthread_t thread, const char *name) { + auto tcb = reinterpret_cast<Tcb*>(thread); + + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_thread_setname, ENOSYS); + if(int e = sysdep(tcb, name); e) { + return e; + } + + return 0; +} + +int pthread_getname_np(pthread_t thread, char *name, size_t size) { + auto tcb = reinterpret_cast<Tcb*>(thread); + + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_thread_getname, ENOSYS); + if(int e = sysdep(tcb, name, size); e) { + return e; + } + + return 0; +} + +int pthread_setschedparam(pthread_t thread, int policy, const struct sched_param *param) { + auto tcb = reinterpret_cast<Tcb*>(thread); + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setschedparam, ENOSYS); + if(int e = mlibc::sys_setschedparam(tcb, policy, param); e) { + return e; + } + + return 0; +} + +int pthread_getschedparam(pthread_t thread, int *policy, struct sched_param *param) { + auto tcb = reinterpret_cast<Tcb*>(thread); + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getschedparam, ENOSYS); + if(int e = mlibc::sys_getschedparam(tcb, policy, param); e) { + return e; + } + + return 0; +} + +//pthread cancel functions + +extern "C" void __mlibc_do_cancel() { + //TODO(geert): for now the same as pthread_exit() + pthread_exit(PTHREAD_CANCELED); +} + +namespace { + + void sigcancel_handler(int signal, siginfo_t *info, void *ucontext) { + ucontext_t *uctx = static_cast<ucontext_t*>(ucontext); + // The function could be called from other signals, or from another + // process, in which case we should do nothing. + if (signal != SIGCANCEL || info->si_pid != getpid() || + info->si_code != SI_TKILL) + return; + + auto tcb = reinterpret_cast<Tcb*>(mlibc::get_current_tcb()); + int old_value = tcb->cancelBits; + + /* + * When a thread is marked with deferred cancellation and performs a blocking syscall, + * the spec mandates that the syscall can get interrupted before it has caused any side + * effects (e.g. before a read() has read any bytes from disk). If the syscall has + * already caused side effects it should return its partial work, and set the program + * counter just after the syscall. If the syscall hasn't caused any side effects, it + * should fail with EINTR and set the program counter to the syscall instruction. + * + * cancellable_syscall: + * test whether_a_cancel_is_queued + * je cancel + * syscall + * end_cancellable_syscall + * + * The mlibc::sys_before_cancellable_syscall sysdep should return 1 when the + * program counter is between the 'canellable_syscall' and 'end_cancellable_syscall' label. + */ + if (!(old_value & tcbCancelAsyncBit) && + mlibc::sys_before_cancellable_syscall && !mlibc::sys_before_cancellable_syscall(uctx)) + return; + + int bitmask = tcbCancelTriggerBit | tcbCancelingBit; + while (1) { + int new_value = old_value | bitmask; + + // Check if we are already cancelled or exiting + if (old_value == new_value || old_value & tcbExitingBit) + return; + + int current_value = old_value; + if (__atomic_compare_exchange_n(&tcb->cancelBits, ¤t_value, + new_value, true,__ATOMIC_RELAXED, __ATOMIC_RELAXED)) { + tcb->returnValue.voidPtr = PTHREAD_CANCELED; + + // Perform cancellation + __mlibc_do_cancel(); + + break; + } + + old_value = current_value; + } + } +} + +namespace mlibc { +namespace { + +struct PthreadSignalInstaller { + PthreadSignalInstaller() { + struct sigaction sa; + sa.sa_sigaction = sigcancel_handler; + sa.sa_flags = SA_SIGINFO; + auto e = ENOSYS; + if(sys_sigaction) + e = sys_sigaction(SIGCANCEL, &sa, NULL); + // Opt-out of cancellation support. + if(e == ENOSYS) + return; + __ensure(!e); + } +}; + +PthreadSignalInstaller pthread_signal_installer; + +} // anonymous namespace +} // namespace mlibc + +int pthread_setcanceltype(int type, int *oldtype) { + if (type != PTHREAD_CANCEL_DEFERRED && type != PTHREAD_CANCEL_ASYNCHRONOUS) + return EINVAL; + + auto self = reinterpret_cast<Tcb *>(mlibc::get_current_tcb()); + int old_value = self->cancelBits; + while (1) { + int new_value = old_value & ~tcbCancelAsyncBit; + if (type == PTHREAD_CANCEL_ASYNCHRONOUS) + new_value |= tcbCancelAsyncBit; + + if (oldtype) + *oldtype = ((old_value & tcbCancelAsyncBit) + ? PTHREAD_CANCEL_ASYNCHRONOUS + : PTHREAD_CANCEL_DEFERRED); + + // Avoid unecessary atomic op. + if (old_value == new_value) + break; + + int current_value = old_value; + if (__atomic_compare_exchange_n(&self->cancelBits, ¤t_value, + new_value, true, __ATOMIC_RELAXED, __ATOMIC_RELAXED)) { + + if (mlibc::tcb_async_cancelled(new_value)) + __mlibc_do_cancel(); + + break; + } + + old_value = current_value; + } + + return 0; +} +int pthread_setcancelstate(int state, int *oldstate) { + if (state != PTHREAD_CANCEL_ENABLE && state != PTHREAD_CANCEL_DISABLE) + return EINVAL; + + auto self = reinterpret_cast<Tcb *>(mlibc::get_current_tcb()); + int old_value = self->cancelBits; + while (1) { + int new_value = old_value & ~tcbCancelEnableBit; + if (state == PTHREAD_CANCEL_ENABLE) + new_value |= tcbCancelEnableBit; + + if (oldstate) + *oldstate = ((old_value & tcbCancelEnableBit) + ? PTHREAD_CANCEL_ENABLE + : PTHREAD_CANCEL_DISABLE); + + // Avoid unecessary atomic op. + if (old_value == new_value) + break; + + int current_value = old_value; + if (__atomic_compare_exchange_n(&self->cancelBits, ¤t_value, + new_value, true, __ATOMIC_RELAXED, __ATOMIC_RELAXED)) { + + if (mlibc::tcb_async_cancelled(new_value)) + __mlibc_do_cancel(); + + sigset_t set = {}; + sigaddset(&set, SIGCANCEL); + if (new_value & PTHREAD_CANCEL_ENABLE) + sigprocmask(SIG_UNBLOCK, &set, NULL); + else + sigprocmask(SIG_BLOCK, &set, NULL); + break; + } + + old_value = current_value; + } + + return 0; +} +void pthread_testcancel(void) { + auto self = reinterpret_cast<Tcb *>(mlibc::get_current_tcb()); + int value = self->cancelBits; + if ((value & tcbCancelEnableBit) && (value & tcbCancelTriggerBit)) { + __mlibc_do_cancel(); + __builtin_unreachable(); + } +} +int pthread_cancel(pthread_t thread) { + if (!mlibc::sys_tgkill) { + MLIBC_MISSING_SYSDEP(); + return ENOSYS; + } + + auto tcb = reinterpret_cast<Tcb *>(thread); + // Check if the TCB is valid, somewhat.. + if (tcb->selfPointer != tcb) + return ESRCH; + + int old_value = __atomic_load_n(&tcb->cancelBits, __ATOMIC_RELAXED); + while (1) { + int bitmask = tcbCancelTriggerBit; + + int new_value = old_value | bitmask; + if (old_value == new_value) + break; + + int current_value = old_value; + if (__atomic_compare_exchange_n(&tcb->cancelBits, ¤t_value, + new_value, true, __ATOMIC_RELAXED, __ATOMIC_RELAXED)) { + if (mlibc::tcb_cancel_enabled(new_value)) { + pid_t pid = getpid(); + + int res = mlibc::sys_tgkill(pid, tcb->tid, SIGCANCEL); + + current_value = __atomic_load_n(&tcb->cancelBits, __ATOMIC_RELAXED); + + // If we can't find the thread anymore, it's possible that it exited between + // us setting the cancel trigger bit, and us sending the signal. Check the + // cancelBits for tcbExitingBit to confirm that. + // XXX(qookie): This will be an use-after-free once we start freeing TCBs on + // exit. Perhaps the TCB should be refcounted. + if (!(res == ESRCH && (current_value & tcbExitingBit))) + return res; + } + + break; + } + + old_value = current_value; + } + + return 0; +} + +int pthread_atfork(void (*prepare) (void), void (*parent) (void), void (*child) (void)) { + auto self = mlibc::get_current_tcb(); + + auto hand = frg::construct<Tcb::AtforkHandler>(getAllocator()); + if (!hand) + return -1; + + hand->prepare = prepare; + hand->parent = parent; + hand->child = child; + hand->next = nullptr; + hand->prev = self->atforkEnd; + + if (self->atforkEnd) + self->atforkEnd->next = hand; + + self->atforkEnd = hand; + + if (!self->atforkBegin) + self->atforkBegin = self->atforkEnd; + + return 0; +} + +// ---------------------------------------------------------------------------- +// pthread_key functions. +// ---------------------------------------------------------------------------- + +int pthread_key_create(pthread_key_t *out, void (*destructor)(void *)) { + SCOPE_TRACE(); + + auto g = frg::guard(&key_mutex_); + + pthread_key_t key = PTHREAD_KEYS_MAX; + for (size_t i = 0; i < PTHREAD_KEYS_MAX; i++) { + if (!key_globals_[i].in_use) { + key = i; + break; + } + } + + if (key == PTHREAD_KEYS_MAX) + return EAGAIN; + + key_globals_[key].in_use = true; + key_globals_[key].dtor = destructor; + + *out = key; + + return 0; +} + +int pthread_key_delete(pthread_key_t key) { + SCOPE_TRACE(); + + auto g = frg::guard(&key_mutex_); + + if (key >= PTHREAD_KEYS_MAX || !key_globals_[key].in_use) + return EINVAL; + + key_globals_[key].in_use = false; + key_globals_[key].dtor = nullptr; + key_globals_[key].generation++; + + return 0; +} + +void *pthread_getspecific(pthread_key_t key) { + SCOPE_TRACE(); + + auto self = mlibc::get_current_tcb(); + auto g = frg::guard(&key_mutex_); + + if (key >= PTHREAD_KEYS_MAX || !key_globals_[key].in_use) + return nullptr; + + if (key_globals_[key].generation > (*self->localKeys)[key].generation) { + (*self->localKeys)[key].value = nullptr; + (*self->localKeys)[key].generation = key_globals_[key].generation; + } + + return (*self->localKeys)[key].value; +} + +int pthread_setspecific(pthread_key_t key, const void *value) { + SCOPE_TRACE(); + + auto self = mlibc::get_current_tcb(); + auto g = frg::guard(&key_mutex_); + + if (key >= PTHREAD_KEYS_MAX || !key_globals_[key].in_use) + return EINVAL; + + (*self->localKeys)[key].value = const_cast<void *>(value); + (*self->localKeys)[key].generation = key_globals_[key].generation; + + return 0; +} + +// ---------------------------------------------------------------------------- +// pthread_once functions. +// ---------------------------------------------------------------------------- + +static constexpr unsigned int onceComplete = 1; +static constexpr unsigned int onceLocked = 2; + +int pthread_once(pthread_once_t *once, void (*function) (void)) { + SCOPE_TRACE(); + + auto expected = __atomic_load_n(&once->__mlibc_done, __ATOMIC_ACQUIRE); + + // fast path: the function was already run. + while(!(expected & onceComplete)) { + if(!expected) { + // try to acquire the mutex. + if(!__atomic_compare_exchange_n(&once->__mlibc_done, + &expected, onceLocked, false, __ATOMIC_ACQUIRE, __ATOMIC_ACQUIRE)) + continue; + + function(); + + // unlock the mutex. + __atomic_exchange_n(&once->__mlibc_done, onceComplete, __ATOMIC_RELEASE); + if(int e = mlibc::sys_futex_wake((int *)&once->__mlibc_done); e) + __ensure(!"sys_futex_wake() failed"); + return 0; + }else{ + // a different thread is currently running the initializer. + __ensure(expected == onceLocked); + if(int e = mlibc::sys_futex_wait((int *)&once->__mlibc_done, onceLocked, nullptr); e) + __ensure(!"sys_futex_wait() failed"); + expected = __atomic_load_n(&once->__mlibc_done, __ATOMIC_ACQUIRE); + } + } + + return 0; +} + +// ---------------------------------------------------------------------------- +// pthread_mutexattr and pthread_mutex functions. +// ---------------------------------------------------------------------------- + +// pthread_mutexattr functions +int pthread_mutexattr_init(pthread_mutexattr_t *attr) { + SCOPE_TRACE(); + return mlibc::thread_mutexattr_init(attr); +} + +int pthread_mutexattr_destroy(pthread_mutexattr_t *attr) { + SCOPE_TRACE(); + return mlibc::thread_mutexattr_destroy(attr); +} + +int pthread_mutexattr_gettype(const pthread_mutexattr_t *__restrict attr, int *__restrict type) { + return mlibc::thread_mutexattr_gettype(attr, type); +} + +int pthread_mutexattr_settype(pthread_mutexattr_t *attr, int type) { + return mlibc::thread_mutexattr_settype(attr, type); +} + +int pthread_mutexattr_getrobust(const pthread_mutexattr_t *__restrict attr, + int *__restrict robust) { + *robust = attr->__mlibc_robust; + return 0; +} +int pthread_mutexattr_setrobust(pthread_mutexattr_t *attr, int robust) { + if (robust != PTHREAD_MUTEX_STALLED && robust != PTHREAD_MUTEX_ROBUST) + return EINVAL; + + attr->__mlibc_robust = robust; + return 0; +} + +int pthread_mutexattr_getpshared(const pthread_mutexattr_t *attr, int *pshared) { + *pshared = attr->__mlibc_pshared; + return 0; +} +int pthread_mutexattr_setpshared(pthread_mutexattr_t *attr, int pshared) { + if (pshared != PTHREAD_PROCESS_PRIVATE && pshared != PTHREAD_PROCESS_SHARED) + return EINVAL; + + attr->__mlibc_pshared = pshared; + return 0; +} + +int pthread_mutexattr_getprotocol(const pthread_mutexattr_t *__restrict attr, + int *__restrict protocol) { + *protocol = attr->__mlibc_protocol; + return 0; +} + +int pthread_mutexattr_setprotocol(pthread_mutexattr_t *attr, int protocol) { + if (protocol != PTHREAD_PRIO_NONE && protocol != PTHREAD_PRIO_INHERIT + && protocol != PTHREAD_PRIO_PROTECT) + return EINVAL; + + attr->__mlibc_protocol = protocol; + return 0; +} + +int pthread_mutexattr_getprioceiling(const pthread_mutexattr_t *__restrict attr, + int *__restrict prioceiling) { + (void)attr; + (void)prioceiling; + return EINVAL; +} + +int pthread_mutexattr_setprioceiling(pthread_mutexattr_t *attr, int prioceiling) { + (void)attr; + (void)prioceiling; + return EINVAL; +} + +// pthread_mutex functions +int pthread_mutex_init(pthread_mutex_t *__restrict mutex, + const pthread_mutexattr_t *__restrict attr) { + SCOPE_TRACE(); + + return mlibc::thread_mutex_init(mutex, attr); +} + +int pthread_mutex_destroy(pthread_mutex_t *mutex) { + return mlibc::thread_mutex_destroy(mutex); +} + +int pthread_mutex_lock(pthread_mutex_t *mutex) { + SCOPE_TRACE(); + + return mlibc::thread_mutex_lock(mutex); +} + +int pthread_mutex_trylock(pthread_mutex_t *mutex) { + SCOPE_TRACE(); + + unsigned int this_tid = mlibc::this_tid(); + unsigned int expected = __atomic_load_n(&mutex->__mlibc_state, __ATOMIC_RELAXED); + if(!expected) { + // Try to take the mutex here. + if(__atomic_compare_exchange_n(&mutex->__mlibc_state, + &expected, this_tid, false, __ATOMIC_ACQUIRE, __ATOMIC_ACQUIRE)) { + __ensure(!mutex->__mlibc_recursion); + mutex->__mlibc_recursion = 1; + return 0; + } + } else { + // If this (recursive) mutex is already owned by us, increment the recursion level. + if((expected & mutex_owner_mask) == this_tid) { + if(!(mutex->__mlibc_flags & mutexRecursive)) { + return EBUSY; + } + ++mutex->__mlibc_recursion; + return 0; + } + } + + return EBUSY; +} + +int pthread_mutex_timedlock(pthread_mutex_t *__restrict, + const struct timespec *__restrict) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int pthread_mutex_unlock(pthread_mutex_t *mutex) { + SCOPE_TRACE(); + + return mlibc::thread_mutex_unlock(mutex); +} + +int pthread_mutex_consistent(pthread_mutex_t *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +// ---------------------------------------------------------------------------- +// pthread_condattr and pthread_cond functions. +// ---------------------------------------------------------------------------- + +int pthread_condattr_init(pthread_condattr_t *attr) { + attr->__mlibc_pshared = PTHREAD_PROCESS_PRIVATE; + attr->__mlibc_clock = CLOCK_REALTIME; + return 0; +} + +int pthread_condattr_destroy(pthread_condattr_t *attr) { + memset(attr, 0, sizeof(*attr)); + return 0; +} + +int pthread_condattr_getclock(const pthread_condattr_t *__restrict attr, + clockid_t *__restrict clock) { + *clock = attr->__mlibc_clock; + return 0; +} + +int pthread_condattr_setclock(pthread_condattr_t *attr, clockid_t clock) { + if (clock != CLOCK_REALTIME && clock != CLOCK_MONOTONIC + && clock != CLOCK_MONOTONIC_RAW && clock != CLOCK_REALTIME_COARSE + && clock != CLOCK_MONOTONIC_COARSE && clock != CLOCK_BOOTTIME) + return EINVAL; + + attr->__mlibc_clock = clock; + return 0; +} + +int pthread_condattr_getpshared(const pthread_condattr_t *__restrict attr, + int *__restrict pshared) { + *pshared = attr->__mlibc_pshared; + return 0; +} + +int pthread_condattr_setpshared(pthread_condattr_t *attr, int pshared) { + if (pshared != PTHREAD_PROCESS_PRIVATE && pshared != PTHREAD_PROCESS_SHARED) + return EINVAL; + + attr->__mlibc_pshared = pshared; + return 0; +} + +int pthread_cond_init(pthread_cond_t *__restrict cond, const pthread_condattr_t *__restrict attr) { + SCOPE_TRACE(); + + return mlibc::thread_cond_init(cond, attr); +} + +int pthread_cond_destroy(pthread_cond_t *cond) { + SCOPE_TRACE(); + + return mlibc::thread_cond_destroy(cond); +} + +int pthread_cond_wait(pthread_cond_t *__restrict cond, pthread_mutex_t *__restrict mutex) { + return pthread_cond_timedwait(cond, mutex, nullptr); +} + +int pthread_cond_timedwait(pthread_cond_t *__restrict cond, pthread_mutex_t *__restrict mutex, + const struct timespec *__restrict abstime) { + return mlibc::thread_cond_timedwait(cond, mutex, abstime); +} + +int pthread_cond_signal(pthread_cond_t *cond) { + SCOPE_TRACE(); + + return pthread_cond_broadcast(cond); +} + +int pthread_cond_broadcast(pthread_cond_t *cond) { + SCOPE_TRACE(); + + return mlibc::thread_cond_broadcast(cond); +} + +// ---------------------------------------------------------------------------- +// pthread_barrierattr and pthread_barrier functions. +// ---------------------------------------------------------------------------- + +int pthread_barrierattr_init(pthread_barrierattr_t *attr) { + attr->__mlibc_pshared = PTHREAD_PROCESS_PRIVATE; + return 0; +} + +int pthread_barrierattr_getpshared(const pthread_barrierattr_t *__restrict attr, + int *__restrict pshared) { + *pshared = attr->__mlibc_pshared; + return 0; +} + +int pthread_barrierattr_setpshared(pthread_barrierattr_t *attr, int pshared) { + if (pshared != PTHREAD_PROCESS_SHARED && pshared != PTHREAD_PROCESS_PRIVATE) + return EINVAL; + + attr->__mlibc_pshared = pshared; + return 0; +} + +int pthread_barrierattr_destroy(pthread_barrierattr_t *) { + return 0; +} + +int pthread_barrier_init(pthread_barrier_t *__restrict barrier, + const pthread_barrierattr_t *__restrict attr, unsigned count) { + if (count == 0) + return EINVAL; + + barrier->__mlibc_waiting = 0; + barrier->__mlibc_inside = 0; + barrier->__mlibc_seq = 0; + barrier->__mlibc_count = count; + + // Since we don't implement these yet, set a flag to error later. + auto pshared = attr ? attr->__mlibc_pshared : PTHREAD_PROCESS_PRIVATE; + barrier->__mlibc_flags = pshared; + + return 0; +} + +int pthread_barrier_destroy(pthread_barrier_t *barrier) { + // Wait until there are no threads still using the barrier. + unsigned inside = 0; + do { + unsigned expected = __atomic_load_n(&barrier->__mlibc_inside, __ATOMIC_RELAXED); + if (expected == 0) + break; + + int e = mlibc::sys_futex_wait((int *)&barrier->__mlibc_inside, expected, nullptr); + if (e != 0 && e != EAGAIN && e != EINTR) + mlibc::panicLogger() << "mlibc: sys_futex_wait() returned error " << e << frg::endlog; + } while (inside > 0); + + memset(barrier, 0, sizeof *barrier); + return 0; +} + +int pthread_barrier_wait(pthread_barrier_t *barrier) { + if (barrier->__mlibc_flags != 0) { + mlibc::panicLogger() << "mlibc: pthread_barrier_t flags were non-zero" + << frg::endlog; + } + + // inside is incremented on entry and decremented on exit. + // This is used to synchronise with pthread_barrier_destroy, to ensure that a thread doesn't pass + // the barrier and immediately destroy its state while other threads still rely on it. + + __atomic_fetch_add(&barrier->__mlibc_inside, 1, __ATOMIC_ACQUIRE); + + auto leave = [&](){ + unsigned inside = __atomic_sub_fetch(&barrier->__mlibc_inside, 1, __ATOMIC_RELEASE); + if (inside == 0) + mlibc::sys_futex_wake((int *)&barrier->__mlibc_inside); + }; + + unsigned seq = __atomic_load_n(&barrier->__mlibc_seq, __ATOMIC_ACQUIRE); + + while (true) { + unsigned expected = __atomic_load_n(&barrier->__mlibc_waiting, __ATOMIC_RELAXED); + bool swapped = __atomic_compare_exchange_n(&barrier->__mlibc_waiting, &expected, expected + 1, false, __ATOMIC_ACQUIRE, __ATOMIC_ACQUIRE); + + if (swapped) { + if (expected + 1 == barrier->__mlibc_count) { + // We were the last thread to hit the barrier. Reset waiters and wake the others. + __atomic_fetch_add(&barrier->__mlibc_seq, 1, __ATOMIC_ACQUIRE); + __atomic_store_n(&barrier->__mlibc_waiting, 0, __ATOMIC_RELEASE); + + mlibc::sys_futex_wake((int *)&barrier->__mlibc_seq); + + leave(); + return PTHREAD_BARRIER_SERIAL_THREAD; + } + + while (true) { + int e = mlibc::sys_futex_wait((int *)&barrier->__mlibc_seq, seq, nullptr); + if (e != 0 && e != EAGAIN && e != EINTR) + mlibc::panicLogger() << "mlibc: sys_futex_wait() returned error " << e << frg::endlog; + + unsigned newSeq = __atomic_load_n(&barrier->__mlibc_seq, __ATOMIC_ACQUIRE); + if (newSeq > seq) { + leave(); + return 0; + } + } + } + } +} + +// ---------------------------------------------------------------------------- +// pthread_rwlock functions. +// ---------------------------------------------------------------------------- + +namespace { + void rwlock_m_lock(pthread_rwlock_t *rw, bool excl) { + unsigned int m_expected = __atomic_load_n(&rw->__mlibc_m, __ATOMIC_RELAXED); + while(true) { + if(m_expected) { + __ensure(m_expected & mutex_owner_mask); + + // Try to set the waiters bit. + if(!(m_expected & mutex_waiters_bit)) { + unsigned int desired = m_expected | mutex_waiters_bit; + if(!__atomic_compare_exchange_n(&rw->__mlibc_m, + &m_expected, desired, false, __ATOMIC_RELAXED, __ATOMIC_RELAXED)) + continue; + } + + // Wait on the futex. + mlibc::sys_futex_wait((int *)&rw->__mlibc_m, m_expected | mutex_waiters_bit, nullptr); + + // Opportunistically try to take the lock after we wake up. + m_expected = 0; + }else{ + // Try to lock the mutex. + unsigned int desired = 1; + if(excl) + desired |= mutex_excl_bit; + if(__atomic_compare_exchange_n(&rw->__mlibc_m, + &m_expected, desired, false, __ATOMIC_ACQUIRE, __ATOMIC_RELAXED)) + break; + } + } + } + + int rwlock_m_trylock(pthread_rwlock_t *rw, bool excl) { + unsigned int m_expected = __atomic_load_n(&rw->__mlibc_m, __ATOMIC_RELAXED); + if(!m_expected) { + // Try to lock the mutex. + unsigned int desired = 1; + if(excl) + desired |= mutex_excl_bit; + if(__atomic_compare_exchange_n(&rw->__mlibc_m, + &m_expected, desired, false, __ATOMIC_ACQUIRE, __ATOMIC_RELAXED)) + return 0; + } + + __ensure(m_expected & mutex_owner_mask); + + // POSIX says that this function should never block but also that + // readers should not be blocked by readers. We implement this by returning EAGAIN + // (and not EBUSY) if a reader would block a reader. + if(!excl && !(m_expected & mutex_excl_bit)) + return EAGAIN; + + return EBUSY; + } + + void rwlock_m_unlock(pthread_rwlock_t *rw) { + auto m = __atomic_exchange_n(&rw->__mlibc_m, 0, __ATOMIC_RELEASE); + if(m & mutex_waiters_bit) + mlibc::sys_futex_wake((int *)&rw->__mlibc_m); + } +} + +int pthread_rwlockattr_init(pthread_rwlockattr_t *attr) { + attr->__mlibc_pshared = PTHREAD_PROCESS_PRIVATE; + return 0; +} + +int pthread_rwlockattr_getpshared(const pthread_rwlockattr_t *__restrict attr, + int *__restrict pshared) { + *pshared = attr->__mlibc_pshared; + return 0; +} + +int pthread_rwlockattr_setpshared(pthread_rwlockattr_t *attr, int pshared) { + if (pshared != PTHREAD_PROCESS_SHARED && pshared != PTHREAD_PROCESS_PRIVATE) + return EINVAL; + + attr->__mlibc_pshared = pshared; + return 0; +} + +int pthread_rwlockattr_destroy(pthread_rwlockattr_t *) { + return 0; +} + +int pthread_rwlock_init(pthread_rwlock_t *__restrict rw, const pthread_rwlockattr_t *__restrict attr) { + SCOPE_TRACE(); + rw->__mlibc_m = 0; + rw->__mlibc_rc = 0; + + // Since we don't implement this yet, set a flag to error later. + auto pshared = attr ? attr->__mlibc_pshared : PTHREAD_PROCESS_PRIVATE; + rw->__mlibc_flags = pshared; + return 0; +} + +int pthread_rwlock_destroy(pthread_rwlock_t *rw) { + __ensure(!rw->__mlibc_m); + __ensure(!rw->__mlibc_rc); + return 0; +} + +int pthread_rwlock_trywrlock(pthread_rwlock_t *rw) { + SCOPE_TRACE(); + + if (rw->__mlibc_flags != 0) { + mlibc::panicLogger() << "mlibc: pthread_rwlock_t flags were non-zero" + << frg::endlog; + } + + // Take the __mlibc_m mutex. + // Will be released in pthread_rwlock_unlock(). + if(int e = rwlock_m_trylock(rw, true)) + return e; + + // Check that there are no readers. + unsigned int rc_expected = __atomic_load_n(&rw->__mlibc_rc, __ATOMIC_ACQUIRE); + if(rc_expected) { + rwlock_m_unlock(rw); + return EBUSY; + } + + return 0; +} + +int pthread_rwlock_wrlock(pthread_rwlock_t *rw) { + SCOPE_TRACE(); + + if (rw->__mlibc_flags != 0) { + mlibc::panicLogger() << "mlibc: pthread_rwlock_t flags were non-zero" + << frg::endlog; + } + + // Take the __mlibc_m mutex. + // Will be released in pthread_rwlock_unlock(). + rwlock_m_lock(rw, true); + + // Now wait until there are no more readers. + unsigned int rc_expected = __atomic_load_n(&rw->__mlibc_rc, __ATOMIC_ACQUIRE); + while(true) { + if(!rc_expected) + break; + + __ensure(rc_expected & rc_count_mask); + + // Try to set the waiters bit. + if(!(rc_expected & rc_waiters_bit)) { + unsigned int desired = rc_expected | rc_count_mask; + if(!__atomic_compare_exchange_n(&rw->__mlibc_rc, + &rc_expected, desired, false, __ATOMIC_ACQUIRE, __ATOMIC_ACQUIRE)) + continue; + } + + // Wait on the futex. + mlibc::sys_futex_wait((int *)&rw->__mlibc_rc, rc_expected | rc_waiters_bit, nullptr); + + // Re-check the reader counter. + rc_expected = __atomic_load_n(&rw->__mlibc_rc, __ATOMIC_ACQUIRE); + } + + return 0; +} + +int pthread_rwlock_tryrdlock(pthread_rwlock_t *rw) { + SCOPE_TRACE(); + + if (rw->__mlibc_flags != 0) { + mlibc::panicLogger() << "mlibc: pthread_rwlock_t flags were non-zero" + << frg::endlog; + } + + // Increment the reader count while holding the __mlibc_m mutex. + if(int e = rwlock_m_trylock(rw, false); e) + return e; + __atomic_fetch_add(&rw->__mlibc_rc, 1, __ATOMIC_ACQUIRE); + rwlock_m_unlock(rw); + + return 0; +} + +int pthread_rwlock_rdlock(pthread_rwlock_t *rw) { + SCOPE_TRACE(); + + if (rw->__mlibc_flags != 0) { + mlibc::panicLogger() << "mlibc: pthread_rwlock_t flags were non-zero" + << frg::endlog; + } + + // Increment the reader count while holding the __mlibc_m mutex. + rwlock_m_lock(rw, false); + __atomic_fetch_add(&rw->__mlibc_rc, 1, __ATOMIC_ACQUIRE); + rwlock_m_unlock(rw); + + return 0; +} + +int pthread_rwlock_unlock(pthread_rwlock_t *rw) { + SCOPE_TRACE(); + + unsigned int rc_expected = __atomic_load_n(&rw->__mlibc_rc, __ATOMIC_RELAXED); + if(!rc_expected) { + // We are doing a write-unlock. + rwlock_m_unlock(rw); + return 0; + }else{ + // We are doing a read-unlock. + while(true) { + unsigned int count = rc_expected & rc_count_mask; + __ensure(count); + + // Try to decrement the count. + if(count == 1 && (rc_expected & rc_waiters_bit)) { + unsigned int desired = 0; + if(!__atomic_compare_exchange_n(&rw->__mlibc_rc, + &rc_expected, desired, false, __ATOMIC_RELEASE, __ATOMIC_RELAXED)) + continue; + + // Wake the futex. + mlibc::sys_futex_wake((int *)&rw->__mlibc_rc); + break; + }else{ + unsigned int desired = (rc_expected & ~rc_count_mask) | (count - 1); + if(!__atomic_compare_exchange_n(&rw->__mlibc_rc, + &rc_expected, desired, false, __ATOMIC_RELEASE, __ATOMIC_RELAXED)) + continue; + break; + } + } + + return 0; + } +} + +int pthread_getcpuclockid(pthread_t, clockid_t *) { + mlibc::infoLogger() << "mlibc: pthread_getcpuclockid() always returns ENOENT" + << frg::endlog; + return ENOENT; +} diff --git a/lib/mlibc/options/posix/generic/pwd-stubs.cpp b/lib/mlibc/options/posix/generic/pwd-stubs.cpp new file mode 100644 index 0000000..5d8f618 --- /dev/null +++ b/lib/mlibc/options/posix/generic/pwd-stubs.cpp @@ -0,0 +1,284 @@ + +#include <errno.h> +#include <pwd.h> +#include <stdio.h> +#include <stdlib.h> +#include <bits/ensure.h> + +#include <mlibc/debug.hpp> + +namespace { + FILE *global_file; // Used by setpwent/getpwent/endpwent. + + bool open_global_file() { + if(!global_file) { + global_file = fopen("/etc/passwd", "r"); + if(!global_file) { + errno = EIO; + return false; + } + } + + return true; + } + + void close_global_file() { + if(global_file) { + fclose(global_file); + global_file = nullptr; + } + } + + bool extract_entry(frg::string_view line, passwd *entry) { + frg::string_view segments[8]; + + // Parse the line into 7 or 8 segments. + size_t s = 0; + int n; + for(n = 0; n < 7; n++) { + size_t d = line.find_first(':', s); + if(d == size_t(-1)) + break; + segments[n] = line.sub_string(s, d - s); + s = d + 1; + } + if(line.find_first(':', s) != size_t(-1)) + return false; + segments[n] = line.sub_string(s, line.size() - s); + n++; + + if(n < 7) + return false; + + // TODO: Handle strndup() failure. + auto name = strndup(segments[0].data(), segments[0].size()); + __ensure(name); + + auto passwd = strndup(segments[1].data(), segments[1].size()); + __ensure(passwd); + + auto uid = segments[2].to_number<int>(); + if(!uid) + return false; + auto gid = segments[3].to_number<int>(); + if(!gid) + return false; + + auto real_name = strndup(segments[4].data(), segments[4].size()); + __ensure(real_name); + auto dir = strndup(segments[5].data(), segments[5].size()); + __ensure(dir); + auto shell = strndup(segments[6].data(), segments[6].size()); + __ensure(shell); + + // Chop the newline off the end of shell + __ensure(strlen(shell) > 0); + shell[strlen(shell) - 1] = '\0'; + + entry->pw_name = name; + entry->pw_passwd = passwd; + entry->pw_uid = *uid; + entry->pw_gid = *gid; + entry->pw_dir = dir; + entry->pw_shell = shell; + entry->pw_gecos = real_name; + return true; + } + + void copy_to_buffer(passwd *pwd, char *buffer, size_t size) { + char *pw_dir = stpcpy(buffer, pwd->pw_name) + 1; + free(pwd->pw_name); + pwd->pw_name = buffer; + + char *pw_shell = stpcpy(pw_dir, pwd->pw_dir) + 1; + free(pwd->pw_dir); + pwd->pw_dir = pw_dir; + + char *pw_passwd = stpcpy(pw_shell, pwd->pw_shell) + 1; + free(pwd->pw_shell); + pwd->pw_shell = pw_shell; + + char *end = stpcpy(pw_passwd, pwd->pw_passwd); + __ensure(end <= buffer + size); + free(pwd->pw_passwd); + pwd->pw_passwd = pw_passwd; + } + + void clear_entry(passwd *entry) { + free(entry->pw_name); + free(entry->pw_dir); + free(entry->pw_passwd); + free(entry->pw_shell); + entry->pw_name = nullptr; + entry->pw_dir = nullptr; + entry->pw_passwd = nullptr; + entry->pw_shell = nullptr; + } +} + +struct passwd *getpwent(void) { + static passwd entry; + char line[NSS_BUFLEN_PASSWD]; + + if(!open_global_file()) { + return nullptr; + } + + if (fgets(line, NSS_BUFLEN_PASSWD, global_file)) { + clear_entry(&entry); + if(!extract_entry(line, &entry)) { + errno = EINVAL; // I suppose this can be a valid errno? + return nullptr; + } + return &entry; + } + + if(ferror(global_file)) { + errno = EIO; + } + + return nullptr; +} + +struct passwd *getpwnam(const char *name) { + static passwd entry; + auto file = fopen("/etc/passwd", "r"); + if(!file) + return nullptr; + + char line[NSS_BUFLEN_PASSWD]; + while(fgets(line, NSS_BUFLEN_PASSWD, file)) { + clear_entry(&entry); + if(!extract_entry(line, &entry)) + continue; + if(!strcmp(entry.pw_name, name)) { + fclose(file); + return &entry; + } + } + + int err = errno; + if(ferror(file)) { + err = EIO; + } + + fclose(file); + errno = err; + return nullptr; +} + +int getpwnam_r(const char *name, struct passwd *pwd, char *buffer, size_t size, struct passwd **result) { + *result = nullptr; + auto file = fopen("/etc/passwd", "r"); + if(!file) { + return EIO; + } + + char line[NSS_BUFLEN_PASSWD]; + while(fgets(line, NSS_BUFLEN_PASSWD, file)) { + if(!extract_entry(line, pwd)) + continue; + if(!strcmp(pwd->pw_name, name)) { + fclose(file); + + size_t required_size = strlen(pwd->pw_name) + strlen(pwd->pw_dir) + + strlen(pwd->pw_shell) + strlen(pwd->pw_passwd) + 4; + if (size < required_size) + return ERANGE; + + copy_to_buffer(pwd, buffer, size); + *result = pwd; + return 0; + } + } + + int ret = 0; + if(ferror(file)) { + ret = EIO; + } + + fclose(file); + return ret; +} + +struct passwd *getpwuid(uid_t uid) { + static passwd entry; + auto file = fopen("/etc/passwd", "r"); + if(!file) + return nullptr; + + char line[NSS_BUFLEN_PASSWD]; + while(fgets(line, NSS_BUFLEN_PASSWD, file)) { + clear_entry(&entry); + if(!extract_entry(line, &entry)) + continue; + if(entry.pw_uid == uid) { + fclose(file); + return &entry; + } + } + + int err = ESRCH; + if(ferror(file)) { + err = EIO; + } + + fclose(file); + errno = err; + return nullptr; +} + +int getpwuid_r(uid_t uid, struct passwd *pwd, char *buffer, size_t size, struct passwd **result) { + *result = nullptr; + auto file = fopen("/etc/passwd", "r"); + if(!file) { + return EIO; + } + + char line[NSS_BUFLEN_PASSWD]; + while(fgets(line, NSS_BUFLEN_PASSWD, file)) { + if(!extract_entry(line, pwd)) + continue; + if(pwd->pw_uid == uid) { + fclose(file); + + size_t required_size = strlen(pwd->pw_name) + strlen(pwd->pw_dir) + + strlen(pwd->pw_shell) + + strlen(pwd->pw_passwd) + 4; + if (size < required_size) + return ERANGE; + + copy_to_buffer(pwd, buffer, size); + *result = pwd; + return 0; + } + } + + int ret = 0; + if(ferror(file)) { + ret = EIO; + } + + fclose(file); + return ret; +} + +void setpwent(void) { + if(!open_global_file()) { + return; + } + rewind(global_file); +} + +void endpwent(void) { + close_global_file(); +} + +int putpwent(const struct passwd *, FILE *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +struct passwd *fgetpwent(FILE *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/posix/generic/resolv_conf.cpp b/lib/mlibc/options/posix/generic/resolv_conf.cpp new file mode 100644 index 0000000..a5c3aa7 --- /dev/null +++ b/lib/mlibc/options/posix/generic/resolv_conf.cpp @@ -0,0 +1,42 @@ +#include <mlibc/resolv_conf.hpp> +#include <mlibc/allocator.hpp> +#include <stdio.h> +#include <ctype.h> + +namespace mlibc { + +frg::optional<struct nameserver_data> get_nameserver() { + auto file = fopen("/etc/resolv.conf", "r"); + if (!file) + return frg::null_opt; + + char line[128]; + struct nameserver_data ret; + while (fgets(line, 128, file)) { + char *pos; + if (!strchr(line, '\n') && !feof(file)) { + // skip truncated lines + for (int c = getc(file); c != '\n' && c != EOF; c = getc(file)); + continue; + } + + // TODO(geert): resolv.conf can actually have multiple nameservers + // but we just pick the first one for now + if (!strncmp(line, "nameserver", 10) && isspace(line[10])) { + char *end; + for (pos = line + 11; isspace(*pos); pos++); + for (end = pos; *end && !isspace(*end); end++); + *end = '\0'; + ret.name = frg::string<MemoryAllocator>( + pos, end - pos, getAllocator()); + break; + } + } + + fclose(file); + if(ret.name.empty()) + return frg::null_opt; + return ret; +} + +} // namespace mlibc diff --git a/lib/mlibc/options/posix/generic/sched-stubs.cpp b/lib/mlibc/options/posix/generic/sched-stubs.cpp new file mode 100644 index 0000000..9d75d50 --- /dev/null +++ b/lib/mlibc/options/posix/generic/sched-stubs.cpp @@ -0,0 +1,50 @@ + +#include <bits/ensure.h> +#include <errno.h> +#include <limits.h> +#include <sched.h> + +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> + +int sched_yield(void) { + if(mlibc::sys_yield) { + mlibc::sys_yield(); + }else{ + // Missing sched_yield() is not an error. + MLIBC_MISSING_SYSDEP(); + } + return 0; +} + +int sched_get_priority_max(int policy) { + int res = 0; + + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_get_max_priority, -1); + if(int e = sysdep(policy, &res); e) { + errno = e; + return -1; + } + return res; +} + +int sched_get_priority_min(int policy) { + int res = 0; + + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_get_min_priority, -1); + if(int e = sysdep(policy, &res); e) { + errno = e; + return -1; + } + return res; +} + +int sched_setscheduler(pid_t, int, const struct sched_param *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int sched_getparam(pid_t, struct sched_param *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/posix/generic/search.cpp b/lib/mlibc/options/posix/generic/search.cpp new file mode 100644 index 0000000..e6f8c1d --- /dev/null +++ b/lib/mlibc/options/posix/generic/search.cpp @@ -0,0 +1,151 @@ + +#include <bits/ensure.h> +#include <search.h> +#include <stddef.h> +#include <new> +#include <mlibc/allocator.hpp> +#include <frg/stack.hpp> +#include <stdlib.h> + +struct node { + const void *key; + void *a[2]; + int h; +}; + +namespace { + int height(struct node *node) { + return node ? node->h : 0; + } + + int rotate(struct node **nodep, int side) { + struct node *node = *nodep; + struct node *x = static_cast<struct node *>(node->a[side]); + struct node *y = static_cast<struct node *>(x->a[!side]); + struct node *z = static_cast<struct node *>(x->a[side]); + + int height_node = node->h; + int height_y = height(y); + if (height_y > height(z)) { + // Perform double rotation + node->a[side] = y->a[!side]; + x->a[!side] = y->a[side]; + y->a[!side] = node; + y->a[side] = x; + node->h = height_y; + x->h = height_y; + y->h = height_y + 1; + } else { + // Perform single rotation + node->a[side] = y; + x->a[!side] = node; + node->h = height_y + 1; + x->h = height_y + 2; + y = x; + + } + *nodep = y; + return y->h - height_node; + } + + int balance_tree(struct node **nodep) { + struct node *node = *nodep; + int height_a = height(static_cast<struct node *>(node->a[0])); + int height_b = height(static_cast<struct node *>(node->a[1])); + if (height_a - height_b < 2) { + int old = node->h; + node->h = height_a < height_b ? height_b + 1 : height_a + 1; + return node->h - old; + } + + return rotate(nodep, height_a < height_b); + } +} + +void *tsearch(const void *key, void **rootp, int(*compar)(const void *, const void *)) { + if (!rootp) + return NULL; + + struct node *n = static_cast<struct node *>(*rootp); + frg::stack<struct node **, MemoryAllocator> nodes(getAllocator()); + nodes.push(reinterpret_cast<struct node **>(rootp)); + int c = 0; + for (;;) { + if (!n) + break; + c = compar(key, n->key); + if (!c) + return n; + nodes.push(reinterpret_cast<struct node **>(&n->a[c > 0])); + n = static_cast<struct node *>(n->a[c > 0]); + } + + struct node *insert = static_cast<struct node*>(malloc(sizeof(struct node))); + if (!insert) + return NULL; + insert->key = key; + insert->a[0] = insert->a[1] = NULL; + insert->h = 1; + + (*nodes.top()) = insert; + nodes.pop(); + while(nodes.size() && balance_tree(nodes.top())) nodes.pop(); + return insert; +} + +// This implementation is taken from musl +void *tfind(const void *key, void *const *rootp, int (*compar)(const void *, const void *)) { + if(!rootp) + return 0; + + struct node *n = (struct node *)*rootp; + for(;;) { + if(!n) + break; + int c = compar(key, n->key); + if(!c) + break; + n = (struct node *)n->a[c > 0]; + } + return n; +} + +void *tdelete(const void *, void **, int(*compar)(const void *, const void *)) { + (void)compar; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void twalk(const void *, void (*action)(const void *, VISIT, int)) { + (void)action; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void tdestroy(void *, void (*free_node)(void *)) { + (void)free_node; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void *lsearch(const void *key, void *base, size_t *nelp, size_t width, + int (*compar)(const void *, const void *)) { + (void)key; + (void)base; + (void)nelp; + (void)width; + (void)compar; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void *lfind(const void *key, const void *base, size_t *nelp, + size_t width, int (*compar)(const void *, const void *)) { + (void)key; + (void)base; + (void)nelp; + (void)width; + (void)compar; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/posix/generic/semaphore-stubs.cpp b/lib/mlibc/options/posix/generic/semaphore-stubs.cpp new file mode 100644 index 0000000..d41eccb --- /dev/null +++ b/lib/mlibc/options/posix/generic/semaphore-stubs.cpp @@ -0,0 +1,114 @@ +#include <semaphore.h> +#include <errno.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/ansi-sysdeps.hpp> +#include <mlibc/posix-sysdeps.hpp> + +static constexpr unsigned int semaphoreHasWaiters = static_cast<uint32_t>(1 << 31); +static constexpr unsigned int semaphoreCountMask = static_cast<uint32_t>(1 << 31) - 1; + +int sem_init(sem_t *sem, int pshared, unsigned int initial_count) { + if (pshared) { + mlibc::infoLogger() << "mlibc: shared semaphores are unsuppored" << frg::endlog; + errno = ENOSYS; + return -1; + } + + if (initial_count > SEM_VALUE_MAX) { + errno = EINVAL; + return -1; + } + + sem->__mlibc_count = initial_count; + + return 0; +} + +int sem_destroy(sem_t *) { + return 0; +} + +int sem_wait(sem_t *sem) { + unsigned int state = 0; + + while (1) { + if (!(state & semaphoreCountMask)) { + if (__atomic_compare_exchange_n(&sem->__mlibc_count, &state, semaphoreHasWaiters, + false, __ATOMIC_ACQUIRE, __ATOMIC_ACQUIRE)) { + int e = mlibc::sys_futex_wait((int *)&sem->__mlibc_count, state, nullptr); + if (e == 0 || e == EAGAIN) { + continue; + } else if (e == EINTR) { + errno = EINTR; + return -1; + } else { + mlibc::panicLogger() << "sys_futex_wait() failed with error code " << e << frg::endlog; + } + } + } else { + unsigned int desired = (state - 1); + if (__atomic_compare_exchange_n(&sem->__mlibc_count, &state, desired, false, + __ATOMIC_RELAXED, __ATOMIC_RELAXED)) + return 0; + } + } +} + +int sem_timedwait(sem_t *sem, const struct timespec *) { + mlibc::infoLogger() << "\e[31mmlibc: sem_timedwait is implemented as sem_wait\e[0m" << frg::endlog; + return sem_wait(sem); +} + +int sem_post(sem_t *sem) { + auto old_count = __atomic_load_n(&sem->__mlibc_count, __ATOMIC_RELAXED) & semaphoreCountMask; + + if (old_count + 1 > SEM_VALUE_MAX) { + errno = EOVERFLOW; + return -1; + } + + auto state = __atomic_exchange_n(&sem->__mlibc_count, old_count + 1, __ATOMIC_RELEASE); + + if (state & semaphoreHasWaiters) + if (int e = mlibc::sys_futex_wake((int *)&sem->__mlibc_count); e) + __ensure(!"sys_futex_wake() failed"); + + return 0; +} + +sem_t *sem_open(const char *, int, ...) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int sem_close(sem_t *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int sem_getvalue(sem_t *, int *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int sem_unlink(const char *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int sem_trywait(sem_t *sem) { + while (true) { + auto state = __atomic_load_n(&sem->__mlibc_count, __ATOMIC_ACQUIRE); + + if (state & semaphoreHasWaiters) { + return EAGAIN; + } + + auto desired = state - 1; + if (__atomic_compare_exchange_n(&sem->__mlibc_count, &state, desired, false, __ATOMIC_RELEASE, __ATOMIC_RELAXED)) { + return 0; + } + } +} diff --git a/lib/mlibc/options/posix/generic/services.cpp b/lib/mlibc/options/posix/generic/services.cpp new file mode 100644 index 0000000..8ae0656 --- /dev/null +++ b/lib/mlibc/options/posix/generic/services.cpp @@ -0,0 +1,222 @@ +#include <mlibc/services.hpp> +#include <netdb.h> +#include <stdio.h> +#include <errno.h> +#include <string.h> +#include <stdlib.h> +#include <ctype.h> +#include <sys/socket.h> +#include <netinet/in.h> +#include <mlibc/debug.hpp> + +namespace mlibc { + +static int parse_rest(service_buf &buf, char *end, int proto) { + if (!strncmp(end, "/udp", 4)) { + if (proto == IPPROTO_TCP && proto != -1) + return 0; + buf.protocol = IPPROTO_UDP; + buf.socktype = SOCK_DGRAM; + } else if (!strncmp(end, "/tcp", 4)) { + if (proto == IPPROTO_UDP && proto != -1) + return 0; + buf.protocol = IPPROTO_TCP; + buf.socktype = SOCK_STREAM; + } else { + return 0; + } + + //TODO(geert): also parse aliases. + + return 1; +} + +static int lookup_serv_file_port(service_result &buf, int proto, int port) { + auto file = fopen(_PATH_SERVICES, "r"); + if (!file) { + switch (errno) { + case ENOENT: + case ENOTDIR: + case EACCES: + return -EAI_SERVICE; + default: + return -EAI_SYSTEM; + } + } + + char line_buf[129] = {0}; + char *line = line_buf + 1; + while(fgets(line, 128, file)) { + int name_length = 0; + char *pos; + // easy way to handle comments, just move the end of the line + // to the beginning of the comment + if ((pos = strchr(line, '#'))) { + *pos++ = '\n'; + *pos = '\0'; + } + + char *end = NULL; + for (pos = line; *pos; pos++) { + for (; isalpha(*pos); pos++); + int rport = strtoul(pos, &end, 10); + if (rport != port || rport > 65535) { + pos = end; + continue; + } + + // We have found the port, time to rewind to the start + // of the line. + for (; pos[-1]; pos--) + if(!isspace(pos[-1])) + name_length++; + break; + } + + if (!pos) + continue; + + if (!name_length) + continue; + + auto name = frg::string<MemoryAllocator>(pos, name_length, + getAllocator()); + + struct service_buf sbuf = {}; + sbuf.port = port; + sbuf.name = std::move(name); + if (!parse_rest(sbuf, end, proto)) + continue; + buf.push_back(std::move(sbuf)); + } + + fclose(file); + return buf.size(); +} + +static int lookup_serv_file_name(service_result &buf, const char *name, + int proto) { + auto file = fopen(_PATH_SERVICES, "r"); + if (!file) { + switch (errno) { + case ENOENT: + case ENOTDIR: + case EACCES: + return -EAI_SERVICE; + default: + return -EAI_SYSTEM; + } + } + + char line[128]; + int name_length = strlen(name); + while(fgets(line, 128, file)) { + char *pos; + // easy way to handle comments, just move the end of the line + // to the beginning of the comment + if ((pos = strchr(line, '#'))) { + *pos++ = '\n'; + *pos = '\0'; + } + + for (pos = line; (pos = strstr(pos, name)); pos++) { + // the name must start and end with a space + if (pos > line && !isspace(pos[-1])) + continue; + if (pos[name_length] && !isspace(pos[name_length])) + continue; + break; + } + if (!pos) + continue; + + // Skip the name at the beginning of the line. + for(pos = line; *pos && !isspace(*pos); pos++) + ; + + char *end = NULL; + int port = strtoul(pos, &end, 10); + if (port > 65535 || end == pos) + continue; + + struct service_buf sbuf; + sbuf.port = port; + sbuf.name = frg::string<MemoryAllocator>(name, getAllocator()); + if (!parse_rest(sbuf, end, proto)) + continue; + + buf.push_back(sbuf); + + } + + fclose(file); + return buf.size(); +} + + +// This function returns a negative error code, since a positive +// return code means success. +int lookup_serv_by_name(service_result &buf, const char *name, int proto, + int socktype, int flags) { + switch(socktype) { + case SOCK_STREAM: + if (!proto) + proto = IPPROTO_TCP; + else if (proto != IPPROTO_TCP) + return -EAI_SERVICE; + break; + case SOCK_DGRAM: + if (!proto) + proto = IPPROTO_UDP; + else if (proto != IPPROTO_UDP) + return -EAI_SERVICE; + break; + case 0: + break; + default: + if (name) + return -EAI_SERVICE; + buf[0].port = 0; + buf[0].socktype = socktype; + buf[0].protocol = proto; + return 1; + } + + char *end = nullptr; + unsigned int port = 0; + int count = 0; + + if (name) { + if (!*name) + return -EAI_SERVICE; + port = strtoul(name, &end, 10); + } + // The end pointer is a null pointer so the name was a port + // or the name was not specified. + if (!end || !*end) { + if (proto != IPPROTO_UDP) { + buf[count].port = port; + buf[count].protocol = IPPROTO_TCP; + buf[count].socktype = SOCK_STREAM; + count++; + } + if (proto != IPPROTO_TCP) { + buf[count].port = port; + buf[count].protocol = IPPROTO_UDP; + buf[count].socktype = SOCK_DGRAM; + count++; + } + return count; + } + + if (flags & AI_NUMERICSERV) + return -EAI_NONAME; + + return lookup_serv_file_name(buf, name, proto); +} + +int lookup_serv_by_port(service_result &buf, int proto, int port) { + return lookup_serv_file_port(buf, proto, port); +} + +} // namespace mlibc diff --git a/lib/mlibc/options/posix/generic/spawn-stubs.cpp b/lib/mlibc/options/posix/generic/spawn-stubs.cpp new file mode 100644 index 0000000..cf7edfc --- /dev/null +++ b/lib/mlibc/options/posix/generic/spawn-stubs.cpp @@ -0,0 +1,376 @@ + +#include <spawn.h> +#include <errno.h> +#include <pthread.h> +#include <fcntl.h> +#include <unistd.h> +#include <limits.h> +#include <sched.h> +#include <stdlib.h> +#include <signal.h> +#include <sys/wait.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> + +/* + * Musl places this in a seperate header called fdop.h + * This header isn't present in glibc, or on my host, so I + * include it's contents here + */ + +#define FDOP_CLOSE 1 +#define FDOP_DUP2 2 +#define FDOP_OPEN 3 +#define FDOP_CHDIR 4 +#define FDOP_FCHDIR 5 + +struct fdop { + struct fdop *next, *prev; + int cmd, fd, srcfd, oflag; + mode_t mode; + char path[]; +}; + +/* + * This posix_spawn implementation is taken from musl + */ + +static unsigned long handler_set[NSIG / (8 * sizeof(long))]; + +static void __get_handler_set(sigset_t *set) { + memcpy(set, handler_set, sizeof handler_set); +} + +struct args { + int p[2]; + sigset_t oldmask; + const char *path; + const posix_spawn_file_actions_t *fa; + const posix_spawnattr_t *__restrict attr; + char *const *argv, *const *envp; +}; + +static int child(void *args_vp) { + int i, ret; + struct sigaction sa = {}; + struct args *args = (struct args *)args_vp; + int p = args->p[1]; + const posix_spawn_file_actions_t *fa = args->fa; + const posix_spawnattr_t *__restrict attr = args->attr; + sigset_t hset; + bool use_execvpe = false; + + if(attr->__fn) + use_execvpe = true; + + close(args->p[0]); + + /* All signal dispositions must be either SIG_DFL or SIG_IGN + * before signals are unblocked. Otherwise a signal handler + * from the parent might get run in the child while sharing + * memory, with unpredictable and dangerous results. To + * reduce overhead, sigaction has tracked for us which signals + * potentially have a signal handler. */ + __get_handler_set(&hset); + for(i = 1; i < NSIG; i++) { + if((attr->__flags & POSIX_SPAWN_SETSIGDEF) && sigismember(&attr->__def, i)) { + sa.sa_handler = SIG_DFL; + } else if(sigismember(&hset, i)) { + if (i - 32 < 3) { + sa.sa_handler = SIG_IGN; + } else {; + sigaction(i, 0, &sa); + if(sa.sa_handler == SIG_IGN) + continue; + sa.sa_handler = SIG_DFL; + } + } else { + continue; + } + sigaction(i, &sa, 0); + } + + if(attr->__flags & POSIX_SPAWN_SETSID) { + if((ret = setsid()) < 0) + goto fail; + } + + if(attr->__flags & POSIX_SPAWN_SETPGROUP) { + mlibc::infoLogger() << "mlibc: posix_spawn: ignoring SETPGROUP" << frg::endlog; + //if((ret = setpgid(0, attr->__pgrp))) + // goto fail; + } + + if(attr->__flags & POSIX_SPAWN_RESETIDS) { + if((ret = setgid(getgid())) || (ret = setuid(getuid())) ) + goto fail; + } + + if(fa && fa->__actions) { + struct fdop *op; + int fd; + for(op = (struct fdop *)fa->__actions; op->next; op = op->next); + for(; op; op = op->prev) { + /* It's possible that a file operation would clobber + * the pipe fd used for synchronizing with the + * parent. To avoid that, we dup the pipe onto + * an unoccupied fd. */ + if(op->fd == p) { + ret = dup(p); + if(ret < 0) + goto fail; + close(p); + p = ret; + } + switch(op->cmd) { + case FDOP_CLOSE: + close(op->fd); + break; + case FDOP_DUP2: + fd = op->srcfd; + if(fd == p) { + ret = -EBADF; + goto fail; + } + if(fd != op->fd) { + if((ret = dup2(fd, op->fd)) < 0) + goto fail; + } else { + ret = fcntl(fd, F_GETFD); + ret = fcntl(fd, F_SETFD, ret & ~FD_CLOEXEC); + if(ret < 0) + goto fail; + } + break; + case FDOP_OPEN: + fd = open(op->path, op->oflag, op->mode); + if((ret = fd) < 0) + goto fail; + if(fd != op->fd) { + if((ret = dup2(fd, op->fd)) < 0) + goto fail; + close(fd); + } + break; + case FDOP_CHDIR: + ret = chdir(op->path); + if(ret < 0) + goto fail; + break; + case FDOP_FCHDIR: + ret = fchdir(op->fd); + if(ret < 0) + goto fail; + break; + } + } + } + + /* Close-on-exec flag may have been lost if we moved the pipe + * to a different fd. */ + fcntl(p, F_SETFD, FD_CLOEXEC); + + pthread_sigmask(SIG_SETMASK, (attr->__flags & POSIX_SPAWN_SETSIGMASK) + ? &attr->__mask : &args->oldmask, 0); + + if(use_execvpe) + execvpe(args->path, args->argv, args->envp); + else + execve(args->path, args->argv, args->envp); + ret = -errno; + +fail: + /* Since sizeof errno < PIPE_BUF, the write is atomic. */ + ret = -ret; + if(ret) + while(write(p, &ret, sizeof ret) < 0); + _exit(127); +} + +int posix_spawn(pid_t *__restrict res, const char *__restrict path, + const posix_spawn_file_actions_t *file_actions, + const posix_spawnattr_t *__restrict attrs, + char *const argv[], char *const envp[]) { + pid_t pid; + int ec = 0, cs; + struct args args; + const posix_spawnattr_t empty_attr = {}; + sigset_t full_sigset; + sigfillset(&full_sigset); + + pthread_setcancelstate(PTHREAD_CANCEL_DISABLE, &cs); + + args.path = path; + args.fa = file_actions; + args.attr = attrs ? attrs : &empty_attr; + args.argv = argv; + args.envp = envp; + pthread_sigmask(SIG_BLOCK, &full_sigset, &args.oldmask); + + /* The lock guards both against seeing a SIGABRT disposition change + * by abort and against leaking the pipe fd to fork-without-exec. */ + //LOCK(__abort_lock); + + if(pipe2(args.p, O_CLOEXEC)) { + //UNLOCK(__abort_lock); + ec = errno; + goto fail; + } + + /* Mlibc change: We use fork + execve, as clone is not implemented. + * This yields the same result in the end. */ + //pid = clone(child, stack + sizeof stack, CLONE_VM | CLONE_VFORK | SIGCHLD, &args); + pid = fork(); + if(!pid) { + child(&args); + } + close(args.p[1]); + //UNLOCK(__abort_lock); + + if(pid > 0) { + if(read(args.p[0], &ec, sizeof ec) != sizeof ec) + ec = 0; + else + waitpid(pid, 0, 0); + } else { + ec = -pid; + } + + close(args.p[0]); + + if(!ec && res) + *res = pid; + +fail: + pthread_sigmask(SIG_SETMASK, &args.oldmask, 0); + pthread_setcancelstate(cs, 0); + + return ec; +} + +int posix_spawnattr_init(posix_spawnattr_t *attr) { + *attr = (posix_spawnattr_t){}; + return 0; +} + +int posix_spawnattr_destroy(posix_spawnattr_t *) { + return 0; +} + +int posix_spawnattr_setflags(posix_spawnattr_t *attr, short flags) { + const unsigned all_flags = + POSIX_SPAWN_RESETIDS | + POSIX_SPAWN_SETPGROUP | + POSIX_SPAWN_SETSIGDEF | + POSIX_SPAWN_SETSIGMASK | + POSIX_SPAWN_SETSCHEDPARAM | + POSIX_SPAWN_SETSCHEDULER | + POSIX_SPAWN_USEVFORK | + POSIX_SPAWN_SETSID; + if(flags & ~all_flags) + return EINVAL; + attr->__flags = flags; + return 0; +} + +int posix_spawnattr_setsigdefault(posix_spawnattr_t *__restrict attr, + const sigset_t *__restrict sigdefault) { + attr->__def = *sigdefault; + return 0; +} + +int posix_spawnattr_setschedparam(posix_spawnattr_t *__restrict, + const struct sched_param *__restrict) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int posix_spawnattr_setschedpolicy(posix_spawnattr_t *, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int posix_spawnattr_setsigmask(posix_spawnattr_t *__restrict attr, + const sigset_t *__restrict sigmask) { + attr->__mask = *sigmask; + return 0; +} + +int posix_spawnattr_setpgroup(posix_spawnattr_t *attr, pid_t pgroup) { + attr->__pgrp = pgroup; + return 0; +} + +int posix_spawn_file_actions_init(posix_spawn_file_actions_t *file_actions) { + file_actions->__actions = 0; + return 0; +} + +int posix_spawn_file_actions_destroy(posix_spawn_file_actions_t *file_actions) { + struct fdop *op = (struct fdop *)file_actions->__actions, *next; + while(op) { + next = op->next; + free(op); + op = next; + } + return 0; +} + +int posix_spawn_file_actions_adddup2(posix_spawn_file_actions_t *file_actions, + int fildes, int newfildes) { + struct fdop *op = (struct fdop *)malloc(sizeof *op); + if(!op) + return ENOMEM; + op->cmd = FDOP_DUP2; + op->srcfd = fildes; + op->fd = newfildes; + if((op->next = (struct fdop *)file_actions->__actions)) + op->next->prev = op; + op->prev = 0; + file_actions->__actions = op; + return 0; +} + +int posix_spawn_file_actions_addclose(posix_spawn_file_actions_t *file_actions, + int fildes) { + struct fdop *op = (struct fdop *)malloc(sizeof *op); + if(!op) + return ENOMEM; + op->cmd = FDOP_CLOSE; + op->fd = fildes; + if((op->next = (struct fdop *)file_actions->__actions)) + op->next->prev = op; + op->prev = 0; + file_actions->__actions = op; + return 0; +} + +int posix_spawn_file_actions_addopen(posix_spawn_file_actions_t *__restrict file_actions, + int fildes, const char *__restrict path, int oflag, mode_t mode) { + struct fdop *op = (struct fdop *)malloc(sizeof *op + strlen(path) + 1); + if(!op) + return ENOMEM; + op->cmd = FDOP_OPEN; + op->fd = fildes; + op->oflag = oflag; + op->mode = mode; + strcpy(op->path, path); + if((op->next = (struct fdop *)file_actions->__actions)) + op->next->prev = op; + op->prev = 0; + file_actions->__actions = op; + return 0; +} + +int posix_spawnp(pid_t *__restrict pid, const char *__restrict file, + const posix_spawn_file_actions_t *file_actions, + const posix_spawnattr_t *__restrict attrp, + char *const argv[], char *const envp[]) { + posix_spawnattr_t spawnp_attr = {}; + if(attrp) + spawnp_attr = *attrp; + spawnp_attr.__fn = (void *)execvpe; + return posix_spawn(pid, file, file_actions, &spawnp_attr, argv, envp); +} + diff --git a/lib/mlibc/options/posix/generic/strings-stubs.cpp b/lib/mlibc/options/posix/generic/strings-stubs.cpp new file mode 100644 index 0000000..524c424 --- /dev/null +++ b/lib/mlibc/options/posix/generic/strings-stubs.cpp @@ -0,0 +1,107 @@ + +#include <strings.h> +#include <string.h> + +#include <ctype.h> +#include <bits/ensure.h> +#include <mlibc/strings.hpp> + +char *index (const char *s, int c) { + return strchr(s, c); +} + +char *rindex(const char *s, int c) { + return strrchr(s, c); +} + +namespace { + + template<typename T> + int ffs_generic(T i) { + //Non-portably assume a byte has 8 bits; fine in all plausible cases. + for(size_t b = 0; b < sizeof(T) * 8;) + if(i & (static_cast<T>(0x1) << b++)) + return b; + + return 0; + } + +} + +// On RISC-V, __builtin_ffs just calls into ffs, so we can't use it here. +#if defined(__has_builtin) && !defined(__riscv) +# if __has_builtin(__builtin_ffs) +# define __mlibc_ffs __builtin_ffs +# endif +# if __has_builtin(__builtin_ffsl) +# define __mlibc_ffsl __builtin_ffsl +# endif +# if __has_builtin(__builtin_ffsll) +# define __mlibc_ffsll __builtin_ffsll +# endif +#endif + +int ffs(int i) { +#ifdef __mlibc_ffs + return __mlibc_ffs(i); +#else + return ffs_generic<int>(i); +#endif +} + +/* + Both ffsl() and ffsll() are glibc extensions + defined in string.h. They are however implemented + here because of similarity in logic and + shared code. +*/ + +int ffsl(long i) { +#ifdef __mlibc_ffsl + return __mlibc_ffsl(i); +#else + return ffs_generic<long>(i); +#endif +} + +int ffsll(long long i) { +#ifdef __mlibc_ffsll + return __mlibc_ffsll(i); +#else + return ffs_generic<long long>(i); +#endif +} + +int strcasecmp(const char *a, const char *b) { + size_t i = 0; + while(true) { + unsigned char a_byte = tolower(a[i]); + unsigned char b_byte = tolower(b[i]); + if(!a_byte && !b_byte) + return 0; + // If only one char is null, one of the following cases applies. + if(a_byte < b_byte) + return -1; + if(a_byte > b_byte) + return 1; + i++; + } +} + +int strncasecmp(const char *a, const char *b, size_t size) { + return mlibc::strncasecmp(a, b, size); +} + +// Marked as obsolete in posix 2008 but used by at least tracker +int bcmp(const void *s1, const void *s2, size_t n) { + return memcmp(s1, s2, n); +} + +void bcopy(const void *s1, void *s2, size_t n) { + memmove(s2, s1, n); +} + +void bzero(void *s, size_t n) { + memset(s, 0, n); +} + diff --git a/lib/mlibc/options/posix/generic/sys-file-stubs.cpp b/lib/mlibc/options/posix/generic/sys-file-stubs.cpp new file mode 100644 index 0000000..e1cc9ab --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-file-stubs.cpp @@ -0,0 +1,16 @@ + +#include <sys/file.h> +#include <mlibc/posix-sysdeps.hpp> +#include <errno.h> + +#include <bits/ensure.h> + +int flock(int fd, int opt) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_flock, -1); + if(int e = mlibc::sys_flock(fd, opt); e) { + errno = e; + return -1; + } + return 0; +} + diff --git a/lib/mlibc/options/posix/generic/sys-ipc.cpp b/lib/mlibc/options/posix/generic/sys-ipc.cpp new file mode 100644 index 0000000..b9e0d3d --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-ipc.cpp @@ -0,0 +1,8 @@ +#include <sys/ipc.h> + +#include <bits/ensure.h> + +key_t ftok(const char *, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/posix/generic/sys-mman-stubs.cpp b/lib/mlibc/options/posix/generic/sys-mman-stubs.cpp new file mode 100644 index 0000000..9383976 --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-mman-stubs.cpp @@ -0,0 +1,177 @@ + +#include <errno.h> +#include <limits.h> +#include <pthread.h> +#include <unistd.h> +#include <sys/mman.h> +#include <bits/ensure.h> + +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> + +int mprotect(void *pointer, size_t size, int prot) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_vm_protect, -1); + if(int e = mlibc::sys_vm_protect(pointer, size, prot); e) { + errno = e; + return -1; + } + return 0; +} + +int mlock(const void *addr, size_t len) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_mlock, -1); + if(int e = mlibc::sys_mlock(addr, len); e) { + errno = e; + return -1; + } + return 0; +} + +int mlockall(int flags) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_mlockall, -1); + if(int e = mlibc::sys_mlockall(flags); e) { + errno = e; + return -1; + } + return 0; +} + +int munlock(const void *addr, size_t len) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_munlock, -1); + if(int e = mlibc::sys_munlock(addr, len); e) { + errno = e; + return -1; + } + return 0; +} + +int munlockall(void) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_munlockall, -1); + if(int e = mlibc::sys_munlockall(); e) { + errno = e; + return -1; + } + return 0; +} + + +int posix_madvise(void *, size_t, int) { + mlibc::infoLogger() << "\e[31m" "mlibc: posix_madvise() fails unconditionally" "\e[39m" + << frg::endlog; + return ENOSYS; +} + +int msync(void *addr, size_t length, int flags) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_msync, -1); + if(int e = mlibc::sys_msync(addr, length, flags); e) { + errno = e; + return -1; + } + return 0; +} + +void *mremap(void *pointer, size_t size, size_t new_size, int flags, ...) { + __ensure(flags == MREMAP_MAYMOVE); + + void *window; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_vm_remap, (void *)-1); + if(int e = mlibc::sys_vm_remap(pointer, size, new_size, &window); e) { + errno = e; + return (void *)-1; + } + return window; +} + +int remap_file_pages(void *, size_t, int, size_t, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void *mmap(void *hint, size_t size, int prot, int flags, int fd, off_t offset) { + void *window; + if(int e = mlibc::sys_vm_map(hint, size, prot, flags, fd, offset, &window); e) { + errno = e; + return (void *)-1; + } + return window; +} + +int munmap(void *pointer, size_t size) { + if(int e = mlibc::sys_vm_unmap(pointer, size); e) { + errno = e; + return -1; + } + return 0; +} + +// The implementation of shm_open and shm_unlink is taken from musl. +namespace { + char *shm_mapname(const char *name, char *buf) { + char *p; + while(*name == '/') + name++; + if(*(p = strchrnul(name, '/')) || p == name || + (p - name <= 2 && name[0] == '.' && p[-1] == '.')) { + errno = EINVAL; + return 0; + } + if(p - name > NAME_MAX) { + errno = ENAMETOOLONG; + return 0; + } + memcpy(buf, "/dev/shm/", 9); + memcpy(buf + 9, name, p - name + 1); + return buf; + } +} + +int shm_open(const char *name, int flags, mode_t mode) { + int cs; + char buf[NAME_MAX + 10]; + if(!(name = shm_mapname(name, buf))) + return -1; + pthread_setcancelstate(PTHREAD_CANCEL_DISABLE, &cs); + int fd = open(name, flags | O_NOFOLLOW | O_CLOEXEC | O_NONBLOCK, mode); + pthread_setcancelstate(cs, 0); + return fd; +} + +int shm_unlink(const char *name) { + char buf[NAME_MAX + 10]; + if(!(name = shm_mapname(name, buf))) + return -1; + return unlink(name); +} + +#if __MLIBC_LINUX_OPTION +int memfd_create(const char *name, unsigned int flags) { + int ret = -1; + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_memfd_create, -1); + if(int e = mlibc::sys_memfd_create(name, flags, &ret)) { + errno = e; + return -1; + } + + return ret; +} + +int madvise(void *addr, size_t length, int advice) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_madvise, -1); + if(int e = mlibc::sys_madvise(addr, length, advice)) { + errno = e; + return -1; + } + + return 0; +} + +int mincore(void *addr, size_t length, unsigned char *vec) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_munlockall, -1); + if(int e = mlibc::sys_mincore(addr, length, vec); e) { + errno = e; + return -1; + } + return 0; +} +#endif /* __MLIBC_LINUX_OPTION */ diff --git a/lib/mlibc/options/posix/generic/sys-msg.cpp b/lib/mlibc/options/posix/generic/sys-msg.cpp new file mode 100644 index 0000000..95f067e --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-msg.cpp @@ -0,0 +1,23 @@ + +#include <bits/ensure.h> +#include <sys/msg.h> + +int msgget(key_t, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int msgctl(int, int, struct msqid_ds *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +ssize_t msgrcv(int, void *, size_t, long, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int msgsnd(int, const void *, size_t, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/posix/generic/sys-resource-stubs.cpp b/lib/mlibc/options/posix/generic/sys-resource-stubs.cpp new file mode 100644 index 0000000..597de4d --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-resource-stubs.cpp @@ -0,0 +1,57 @@ + +#include <errno.h> +#include <sys/resource.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> + +int getpriority(int which, id_t who) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getpriority, -1); + int value = 0; + if(int e = mlibc::sys_getpriority(which, who, &value); e) { + errno = e; + } + return value; +} + +int setpriority(int which, id_t who, int prio) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setpriority, -1); + if(int e = mlibc::sys_setpriority(which, who, prio); e) { + errno = e; + return -1; + } + return 0; +} + +int getrusage(int scope, struct rusage *usage) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getrusage, -1); + if(int e = mlibc::sys_getrusage(scope, usage); e) { + errno = e; + return -1; + } + return 0; +} + +int getrlimit(int resource, struct rlimit *limit) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getrlimit, -1); + if(int e = mlibc::sys_getrlimit(resource, limit); e) { + errno = e; + return -1; + } + return 0; +} + +int setrlimit(int resource, const struct rlimit *limit) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setrlimit, -1); + if(int e = mlibc::sys_setrlimit(resource, limit); e) { + errno = e; + return -1; + } + return 0; +} + +int prlimit(pid_t, int, const struct rlimit *, struct rlimit *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/posix/generic/sys-select-stubs.cpp b/lib/mlibc/options/posix/generic/sys-select-stubs.cpp new file mode 100644 index 0000000..e8ff927 --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-select-stubs.cpp @@ -0,0 +1,58 @@ + +#include <string.h> +#include <sys/select.h> +#include <unistd.h> +#include <errno.h> + +#include <bits/ensure.h> +#include <mlibc-config.h> + +#include <mlibc/posix-sysdeps.hpp> + +void __FD_CLR(int fd, fd_set *set) { + __ensure(fd < FD_SETSIZE); + set->__mlibc_elems[fd / 8] &= ~(1 << (fd % 8)); +} +int __FD_ISSET(int fd, fd_set *set) { + __ensure(fd < FD_SETSIZE); + return set->__mlibc_elems[fd / 8] & (1 << (fd % 8)); +} +void __FD_SET(int fd, fd_set *set) { + __ensure(fd < FD_SETSIZE); + set->__mlibc_elems[fd / 8] |= 1 << (fd % 8); +} +void __FD_ZERO(fd_set *set) { + memset(set->__mlibc_elems, 0, sizeof(fd_set)); +} + +int select(int num_fds, fd_set *__restrict read_set, fd_set *__restrict write_set, + fd_set *__restrict except_set, struct timeval *__restrict timeout) { + int num_events = 0; + struct timespec timeouts = {}; + struct timespec *timeout_ptr = NULL; + if (timeout) { + timeouts.tv_sec = timeout->tv_sec; + timeouts.tv_nsec = timeout->tv_usec * 1000; + timeout_ptr = &timeouts; + } + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_pselect, -1); + if(int e = mlibc::sys_pselect(num_fds, read_set, write_set, except_set, + timeout_ptr, NULL, &num_events); e) { + errno = e; + return -1; + } + return num_events; +} + +int pselect(int num_fds, fd_set *read_set, fd_set *write_set, fd_set *except_set, + const struct timespec *timeout, const sigset_t *sigmask) { + int num_events = 0; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_pselect, -1); + if(int e = mlibc::sys_pselect(num_fds, read_set, write_set, except_set, + timeout, sigmask, &num_events); e) { + errno = e; + return -1; + } + return num_events; +} diff --git a/lib/mlibc/options/posix/generic/sys-sem.cpp b/lib/mlibc/options/posix/generic/sys-sem.cpp new file mode 100644 index 0000000..ac3df69 --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-sem.cpp @@ -0,0 +1,51 @@ + +#include <bits/ensure.h> +#include <errno.h> +#include <limits.h> +#include <sys/sem.h> + +#include <mlibc/posix-sysdeps.hpp> + +int semget(key_t key, int n, int fl) { + if(n > USHRT_MAX) { + errno = EINVAL; + return -1; + } + + int id = 0; + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_semget, -1); + if(int e = sysdep(key, n, fl, &id); e) { + errno = e; + return -1; + } + return id; +} + +int semop(int, struct sembuf *, size_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +union semun { + int val; + struct semid_ds *buf; + unsigned short *array; +}; + +int semctl(int id, int num, int cmd, ...) { + union semun semun; + int ret = 0; + + va_list ap; + va_start(ap, cmd); + semun = va_arg(ap, union semun); + va_end(ap); + + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_semctl, -1); + if(int e = sysdep(id, num, cmd, semun.buf, &ret); e) { + errno = e; + return -1; + } + + return ret; +} diff --git a/lib/mlibc/options/posix/generic/sys-shm.cpp b/lib/mlibc/options/posix/generic/sys-shm.cpp new file mode 100644 index 0000000..3af7e90 --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-shm.cpp @@ -0,0 +1,24 @@ +#include <sys/shm.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> + +void *shmat(int, const void *, int) { + __ensure(!"Function is not implemented"); + __builtin_unreachable(); +} + +int shmctl(int, int, struct shmid_ds *) { + __ensure(!"Function is not implemented"); + __builtin_unreachable(); +} + +int shmdt(const void *) { + __ensure(!"Function is not implemented"); + __builtin_unreachable(); +} + +int shmget(key_t, size_t, int) { + mlibc::infoLogger() << "mlibc: shmget() is a no-op!" << frg::endlog; + return -1; +} diff --git a/lib/mlibc/options/posix/generic/sys-socket-stubs.cpp b/lib/mlibc/options/posix/generic/sys-socket-stubs.cpp new file mode 100644 index 0000000..037a994 --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-socket-stubs.cpp @@ -0,0 +1,225 @@ + +#include <errno.h> +#include <fcntl.h> +#include <limits.h> +#include <sys/socket.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> + +int accept(int fd, struct sockaddr *__restrict addr_ptr, socklen_t *__restrict addr_length) { + int newfd; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_accept, -1); + if(int e = mlibc::sys_accept(fd, &newfd, addr_ptr, addr_length, 0); e) { + errno = e; + return -1; + } + return newfd; +} + +int accept4(int fd, struct sockaddr *__restrict addr_ptr, socklen_t *__restrict addr_length, int flags) { + int newfd; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_accept, -1); + if(int e = mlibc::sys_accept(fd, &newfd, addr_ptr, addr_length, flags); e) { + errno = e; + return -1; + } + + return newfd; +} + +int bind(int fd, const struct sockaddr *addr_ptr, socklen_t addr_len) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_bind, -1); + if(int e = mlibc::sys_bind(fd, addr_ptr, addr_len); e) { + errno = e; + return -1; + } + return 0; +} + +int connect(int fd, const struct sockaddr *addr_ptr, socklen_t addr_len) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_connect, -1); + if(int e = mlibc::sys_connect(fd, addr_ptr, addr_len); e) { + errno = e; + return -1; + } + return 0; +} + +int getpeername(int fd, struct sockaddr *addr_ptr, socklen_t *__restrict addr_length) { + socklen_t actual_length; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_peername, -1); + if(int e = mlibc::sys_peername(fd, addr_ptr, *addr_length, &actual_length); e) { + errno = e; + return -1; + } + *addr_length = actual_length; + return 0; +} + +int getsockname(int fd, struct sockaddr *__restrict addr_ptr, socklen_t *__restrict addr_length) { + socklen_t actual_length; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_sockname, -1); + if(int e = mlibc::sys_sockname(fd, addr_ptr, *addr_length, &actual_length); e) { + errno = e; + return -1; + } + *addr_length = actual_length; + return 0; +} + +int getsockopt(int fd, int layer, int number, + void *__restrict buffer, socklen_t *__restrict size) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getsockopt, -1); + return mlibc::sys_getsockopt(fd, layer, number, buffer, size); +} + +int listen(int fd, int backlog) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_listen, -1); + if(int e = mlibc::sys_listen(fd, backlog); e) { + errno = e; + return -1; + } + return 0; +} + +ssize_t recv(int sockfd, void *__restrict buf, size_t len, int flags) { + return recvfrom(sockfd, buf, len, flags, NULL, NULL); +} + +ssize_t recvfrom(int sockfd, void *__restrict buf, size_t len, int flags, + struct sockaddr *__restrict src_addr, socklen_t *__restrict addrlen) { + if(mlibc::sys_recvfrom) { + ssize_t length; + if(int e = mlibc::sys_recvfrom(sockfd, buf, len, flags, src_addr, addrlen, &length); e) { + errno = e; + return -1; + } + return length; + } + + struct iovec iov = {}; + iov.iov_base = buf; + iov.iov_len = len; + + struct msghdr hdr = {}; + hdr.msg_name = src_addr; + if (addrlen) { + hdr.msg_namelen = *addrlen; + } + hdr.msg_iov = &iov; + hdr.msg_iovlen = 1; + + int ret = recvmsg(sockfd, &hdr, flags); + if (ret < 0) + return ret; + + if(addrlen) + *addrlen = hdr.msg_namelen; + return ret; +} + +ssize_t recvmsg(int fd, struct msghdr *hdr, int flags) { + ssize_t length; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_msg_recv, -1); + if(int e = mlibc::sys_msg_recv(fd, hdr, flags, &length); e) { + errno = e; + return -1; + } + return length; +} + +int recvmmsg(int, struct mmsghdr *, unsigned int, int, struct timespec *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +ssize_t send(int fd, const void *buffer, size_t size, int flags) { + return sendto(fd, buffer, size, flags, nullptr, 0); +} + +ssize_t sendto(int fd, const void *buffer, size_t size, int flags, + const struct sockaddr *sock_addr, socklen_t addr_length) { + if(mlibc::sys_sendto) { + ssize_t length; + if(int e = mlibc::sys_sendto(fd, buffer, size, flags, sock_addr, addr_length, &length); e) { + errno = e; + return -1; + } + return length; + } + + struct iovec iov = {}; + iov.iov_base = const_cast<void *>(buffer); + iov.iov_len = size; + + struct msghdr hdr = {}; + hdr.msg_name = const_cast<struct sockaddr *>(sock_addr); + hdr.msg_namelen = addr_length; + hdr.msg_iov = &iov; + hdr.msg_iovlen = 1; + + return sendmsg(fd, &hdr, flags); +} + +ssize_t sendmsg(int fd, const struct msghdr *hdr, int flags) { + if(hdr->msg_iovlen > IOV_MAX) + return EMSGSIZE; + + ssize_t length; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_msg_send, -1); + if(int e = mlibc::sys_msg_send(fd, hdr, flags, &length); e) { + errno = e; + return -1; + } + return length; +} + +int sendmmsg(int, struct mmsghdr *, unsigned int, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int setsockopt(int fd, int layer, int number, + const void *buffer, socklen_t size) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setsockopt, -1); + return mlibc::sys_setsockopt(fd, layer, number, buffer, size); +} + +int shutdown(int sockfd, int how) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_shutdown, -1); + if(int e = sysdep(sockfd, how); e) { + errno = e; + return -1; + } + + return 0; +} + +int sockatmark(int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int socket(int family, int type, int protocol) { + int fd; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_socket, -1); + if(int e = mlibc::sys_socket(family, type, protocol, &fd); e) { + errno = e; + return -1; + } + return fd; +} + +int socketpair(int domain, int type, int protocol, int sv[2]) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_socketpair, -1); + if(int e = mlibc::sys_socketpair(domain, type, protocol, sv); e) { + errno = e; + return -1; + } + return 0; +} + +// connectpair() is provided by the platform + diff --git a/lib/mlibc/options/posix/generic/sys-stat-stubs.cpp b/lib/mlibc/options/posix/generic/sys-stat-stubs.cpp new file mode 100644 index 0000000..2eca445 --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-stat-stubs.cpp @@ -0,0 +1,155 @@ + +#include <errno.h> +#include <bits/ensure.h> +#include <sys/stat.h> + +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> + +int chmod(const char *pathname, mode_t mode) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_chmod, -1); + if(int e = mlibc::sys_chmod(pathname, mode); e) { + errno = e; + return -1; + } + return 0; +} + +int fchmod(int fd, mode_t mode) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fchmod, -1); + if(int e = mlibc::sys_fchmod(fd, mode); e) { + errno = e; + return -1; + } + return 0; +} + +int fchmodat(int dirfd, const char *pathname, mode_t mode, int flags) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fchmodat, -1); + if(int e = mlibc::sys_fchmodat(dirfd, pathname, mode, flags); e) { + errno = e; + return -1; + } + return 0; +} + +int fstatat(int dirfd, const char *path, struct stat *result, int flags) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_stat, -1); + if(int e = mlibc::sys_stat(mlibc::fsfd_target::fd_path, dirfd, path, flags, result); e) { + errno = e; + return -1; + } + return 0; +} + +int futimens(int fd, const struct timespec times[2]) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_utimensat, -1); + + if (int e = mlibc::sys_utimensat(fd, nullptr, times, 0); e) { + errno = e; + return -1; + } + + return 0; +} + +int mkdir(const char *path, mode_t mode) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_mkdir, -1); + if(int e = mlibc::sys_mkdir(path, mode); e) { + errno = e; + return -1; + } + return 0; +} + +int mkdirat(int dirfd, const char *path, mode_t mode) { + mlibc::infoLogger() << "\e[31mmlibc: mkdirat() ignores its mode\e[39m" << frg::endlog; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_mkdirat, -1); + if(int e = mlibc::sys_mkdirat(dirfd, path, mode); e) { + errno = e; + return -1; + } + return 0; +} + +int mkfifo(const char *path, mode_t mode) { + return mkfifoat(AT_FDCWD, path, mode); +} + +int mkfifoat(int dirfd, const char *path, mode_t mode) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_mkfifoat, -1); + if (int e = mlibc::sys_mkfifoat(dirfd, path, mode); e) { + errno = e; + return -1; + } + + return 0; +} + +int mknod(const char *path, mode_t mode, dev_t dev) { + return mknodat(AT_FDCWD, path, mode, dev); +} + +int mknodat(int dirfd, const char *path, mode_t mode, dev_t dev) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_mknodat, -1); + if (int e = mlibc::sys_mknodat(dirfd, path, mode, dev); e) { + errno = e; + return -1; + } + + return 0; +} + +mode_t umask(mode_t mode) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_umask, -1); + mode_t old; + if (int e = mlibc::sys_umask(mode, &old); e) { + errno = e; + return -1; + } + return old; +} + +int utimensat(int dirfd, const char *pathname, const struct timespec times[2], int flags) { + if(pathname == nullptr) { + errno = EINVAL; + return -1; + } + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_utimensat, -1); + if (int e = mlibc::sys_utimensat(dirfd, pathname, times, flags); e) { + errno = e; + return -1; + } + + return 0; +} + +int stat(const char *path, struct stat *result) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_stat, -1); + if(int e = mlibc::sys_stat(mlibc::fsfd_target::path, -1, path, 0, result); e) { + errno = e; + return -1; + } + return 0; +} + +int lstat(const char *path, struct stat *result) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_stat, -1); + if(int e = mlibc::sys_stat(mlibc::fsfd_target::path, + -1, path, AT_SYMLINK_NOFOLLOW, result); e) { + errno = e; + return -1; + } + return 0; +} + +int fstat(int fd, struct stat *result) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_stat, -1); + if(int e = mlibc::sys_stat(mlibc::fsfd_target::fd, fd, "", 0, result); e) { + errno = e; + return -1; + } + return 0; +} + diff --git a/lib/mlibc/options/posix/generic/sys-statvfs-stubs.cpp b/lib/mlibc/options/posix/generic/sys-statvfs-stubs.cpp new file mode 100644 index 0000000..c02cc39 --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-statvfs-stubs.cpp @@ -0,0 +1,24 @@ +#include <errno.h> +#include <sys/statvfs.h> + +#include <bits/ensure.h> +#include <mlibc/posix-sysdeps.hpp> + +int statvfs(const char *path, struct statvfs *out) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_statvfs, -1); + if(int e = mlibc::sys_statvfs(path, out); e) { + errno = e; + return -1; + } + return 0; +} + +int fstatvfs(int fd, struct statvfs *out) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fstatvfs, -1); + if(int e = mlibc::sys_fstatvfs(fd, out); e) { + errno = e; + return -1; + } + return 0; +} + diff --git a/lib/mlibc/options/posix/generic/sys-time-stubs.cpp b/lib/mlibc/options/posix/generic/sys-time-stubs.cpp new file mode 100644 index 0000000..5cc0fe5 --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-time-stubs.cpp @@ -0,0 +1,107 @@ + +#include <errno.h> +#include <sys/time.h> +#include <time.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> + +int gettimeofday(struct timeval *__restrict result, void *__restrict unused) { + (void)unused; // Linux just ignores gettimeofday(). + + if(result) { + long nanos; + if(int e = mlibc::sys_clock_get(CLOCK_REALTIME, &result->tv_sec, &nanos); e) { + errno = e; + return -1; + } + result->tv_usec = nanos / 1000; + } + return 0; +} + +int settimeofday(const struct timeval *, const struct timezone *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void timeradd(const struct timeval *a, const struct timeval *b, struct timeval *res) { + res->tv_sec = a->tv_sec + b->tv_sec; + res->tv_usec = a->tv_usec + b->tv_usec; + while(res->tv_usec > 999999) { + res->tv_usec -= 1000000; + res->tv_sec += 1; + } +} + +void timersub(const struct timeval *a, const struct timeval *b, struct timeval *res) { + res->tv_sec = a->tv_sec - b->tv_sec; + res->tv_usec = a->tv_usec - b->tv_usec; + while(res->tv_usec < 0) { + res->tv_usec += 1000000; + res->tv_sec -= 1; + } +} + +void timerclear(struct timeval *tvp) { + tvp->tv_sec = 0; + tvp->tv_usec = 0; +} + +int timerisset(struct timeval *tvp) { + if(tvp->tv_sec != 0 || tvp->tv_usec != 0) { + return 1; + } + return 0; +} + +int getitimer(int which, struct itimerval *curr_value) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getitimer, -1); + if(int e = mlibc::sys_getitimer(which, curr_value); e) { + errno = e; + return -1; + } + return 0; +} + +int setitimer(int which, const struct itimerval *new_value, struct itimerval *old_value) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setitimer, -1); + if(int e = mlibc::sys_setitimer(which, new_value, old_value); e) { + errno = e; + return -1; + } + return 0; +} + +int timer_create(clockid_t clk, struct sigevent *__restrict evp, timer_t *__restrict res) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_timer_create, -1); + if(int e = mlibc::sys_timer_create(clk, evp, res); e) { + errno = e; + return -1; + } + return 0; +} + +int timer_settime(timer_t t, int flags, const struct itimerspec *__restrict val, struct itimerspec *__restrict old) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_timer_settime, -1); + if(int e = mlibc::sys_timer_settime(t, flags, val, old); e) { + errno = e; + return -1; + } + return 0; +} + +int timer_gettime(timer_t, struct itimerspec *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int timer_delete(timer_t t) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_timer_delete, -1); + if(int e = mlibc::sys_timer_delete(t); e) { + errno = e; + return -1; + } + return 0; +} diff --git a/lib/mlibc/options/posix/generic/sys-times.cpp b/lib/mlibc/options/posix/generic/sys-times.cpp new file mode 100644 index 0000000..61b6e25 --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-times.cpp @@ -0,0 +1,19 @@ + +#include <errno.h> +#include <sys/times.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <internal-config.h> +#include <mlibc/posix-sysdeps.hpp> + +clock_t times(struct tms *tms) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_times, -1); + clock_t ret; + if(int e = mlibc::sys_times(tms, &ret); e) { + errno = e; + return -1; + } + return ret; +} + diff --git a/lib/mlibc/options/posix/generic/sys-uio.cpp b/lib/mlibc/options/posix/generic/sys-uio.cpp new file mode 100644 index 0000000..0f14bc0 --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-uio.cpp @@ -0,0 +1,67 @@ + +#include <sys/uio.h> +#include <unistd.h> +#include <errno.h> +#include <stdlib.h> +#include <string.h> +#include <limits.h> + +#include <frg/vector.hpp> +#include <mlibc/allocator.hpp> +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> +#include <bits/ensure.h> + +ssize_t readv(int fd, const struct iovec *iovs, int iovc) { + ssize_t read_bytes = 0; + + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_readv, -1); + + if (int e = sysdep(fd, iovs, iovc, &read_bytes); e) { + errno = e; + return -1; + } + + return read_bytes; +} + +ssize_t writev(int fd, const struct iovec *iovs, int iovc) { + __ensure(iovc); + + ssize_t written = 0; + size_t bytes = 0; + for(int i = 0; i < iovc; i++) { + if(SSIZE_MAX - bytes < iovs[i].iov_len) { + errno = EINVAL; + return -1; + } + bytes += iovs[i].iov_len; + } + frg::vector<char, MemoryAllocator> buffer{getAllocator()}; + buffer.resize(bytes); + + size_t to_copy = bytes; + char *bp = buffer.data(); + for(int i = 0; i < iovc; i++) { + size_t copy = frg::min(iovs[i].iov_len, to_copy); + + bp = (char *)mempcpy((void *)bp, (void *)iovs[i].iov_base, copy); + + to_copy -= copy; + if(to_copy == 0) + break; + } + + written = write(fd, buffer.data(), bytes); + return written; +} + +ssize_t preadv(int, const struct iovec *, int, off_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +ssize_t pwritev(int, const struct iovec *, int, off_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/posix/generic/sys-utsname.cpp b/lib/mlibc/options/posix/generic/sys-utsname.cpp new file mode 100644 index 0000000..3176574 --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-utsname.cpp @@ -0,0 +1,24 @@ + +#include <string.h> +#include <sys/utsname.h> +#include <errno.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <internal-config.h> +#include <mlibc/posix-sysdeps.hpp> + +int uname(struct utsname *p) { + if (p == NULL) { + errno = EFAULT; + return -1; + } + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_uname, -1); + if(int e = mlibc::sys_uname(p); e) { + errno = e; + return -1; + } + return 0; +} + diff --git a/lib/mlibc/options/posix/generic/sys-wait-stubs.cpp b/lib/mlibc/options/posix/generic/sys-wait-stubs.cpp new file mode 100644 index 0000000..6e7cc78 --- /dev/null +++ b/lib/mlibc/options/posix/generic/sys-wait-stubs.cpp @@ -0,0 +1,52 @@ + +#include <errno.h> +#include <sys/wait.h> +#include <bits/ensure.h> + +#include <mlibc/ansi-sysdeps.hpp> +#include <mlibc/posix-sysdeps.hpp> +#include <mlibc/debug.hpp> + +int waitid(idtype_t idtype, id_t id, siginfo_t *info, int options) { + auto sysdep = MLIBC_CHECK_OR_ENOSYS(mlibc::sys_waitid, -1); + if(int e = sysdep(idtype, id, info, options); e) { + errno = e; + return -1; + } + return 0; +} + +pid_t waitpid(pid_t pid, int *status, int flags) { + pid_t ret; + int tmp_status = 0; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_waitpid, -1); + if(int e = mlibc::sys_waitpid(pid, &tmp_status, flags, NULL, &ret); e) { + errno = e; + return -1; + } + if(status) { + *status = tmp_status; + } + return ret; +} + +pid_t wait(int *status) { + return waitpid(-1, status, 0); +} + +pid_t wait3(int *status, int options, struct rusage *rusage) { + (void) rusage; + mlibc::infoLogger() << "\e[31mmlibc: wait3() is not implemented correctly\e[39m" + << frg::endlog; + return waitpid(-1, status, options); +} + +pid_t wait4(pid_t pid, int *status, int options, struct rusage *ru) { + pid_t ret; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_waitpid, -1); + if(int e = mlibc::sys_waitpid(pid, status, options, ru, &ret); e) { + errno = e; + return -1; + } + return ret; +} diff --git a/lib/mlibc/options/posix/generic/syslog-stubs.cpp b/lib/mlibc/options/posix/generic/syslog-stubs.cpp new file mode 100644 index 0000000..6a80ff9 --- /dev/null +++ b/lib/mlibc/options/posix/generic/syslog-stubs.cpp @@ -0,0 +1,152 @@ + +#include <syslog.h> +#include <string.h> +#include <unistd.h> +#include <stdio.h> +#include <errno.h> +#include <time.h> +#include <fcntl.h> +#include <pthread.h> +#include <sys/socket.h> +#include <sys/un.h> +#include <bits/ensure.h> + +#include <frg/mutex.hpp> +#include <mlibc/lock.hpp> +#include <mlibc/debug.hpp> + +// This syslog implementation is largely taken from musl + +static char log_ident[32]; +static int log_options; +static int log_facility = LOG_USER; +static int log_fd = -1; +static int log_opt; +static int log_mask = 0xff; + +static int use_mlibc_logger = 0; +static FutexLock __syslog_lock; + +static const struct sockaddr_un log_addr {AF_UNIX, "/dev/log"}; + +void closelog(void) { + frg::unique_lock<FutexLock> holder { __syslog_lock }; + close(log_fd); + log_fd = -1; +} + +static void __openlog() { + log_fd = socket(AF_UNIX, SOCK_DGRAM | SOCK_CLOEXEC, 0); + if(log_fd >= 0) { + int ret = connect(log_fd, (const sockaddr *)&log_addr, sizeof log_addr); + if(ret) { + mlibc::infoLogger() << "\e[31mmlibc: syslog: connect returned an error, falling back to infoLogger\e[39m" << frg::endlog; + use_mlibc_logger = 1; + } + } +} + +void openlog(const char *ident, int options, int facility) { + frg::unique_lock<FutexLock> holder { __syslog_lock }; + if(ident) { + size_t n = strnlen(ident, sizeof log_ident - 1); + memcpy(log_ident, ident, n); + log_ident[n] = 0; + } else { + log_ident[0] = 0; + } + log_options = options; + log_facility = facility; + + if((options & LOG_NDELAY) && log_fd < 0) + __openlog(); +} + +int setlogmask(int mask) { + int old_mask = log_mask; + + log_mask = mask; + + return old_mask; +} + +static void _vsyslog(int priority, const char *message, va_list ap) { + auto is_lost_conn = [] (int e) { + return e == ECONNREFUSED || e == ECONNRESET || e == ENOTCONN || e == EPIPE; + }; + + if(!(priority & log_mask)) { + return; + } + + char timebuf[16]; + time_t now; + struct tm tm; + char buf[1024]; + int errno_save = errno; + int pid; + int l, l2; + int hlen; + int fd; + + if(log_fd < 0) + __openlog(); + + if(use_mlibc_logger) { + vsnprintf(buf, sizeof buf, message, ap); + mlibc::infoLogger() << "mlibc: syslog: " << buf << frg::endlog; + return; + } + + if(!(priority & LOG_FACMASK)) + priority |= log_facility; + + now = time(NULL); + gmtime_r(&now, &tm); + strftime(timebuf, sizeof timebuf, "%b %e %T", &tm); + + pid = (log_opt & LOG_PID) ? getpid() : 0; + l = snprintf(buf, sizeof buf, "<%d>%s %n%s%s%.0d%s: ", + priority, timebuf, &hlen, log_ident, "[" + !pid, pid, "]" + !pid); + errno = errno_save; + l2 = vsnprintf(buf + l, sizeof buf - l, message, ap); + if(l2 >= 0) { + if(l2 >= (long int)(sizeof buf - l)) + l = sizeof buf - 1; + else + l += l2; + if(buf[l - 1] != '\n') + buf[l++] = '\n'; + if(send(log_fd, buf, l, 0) < 0 && (!is_lost_conn(errno) + || connect(log_fd, (const sockaddr *)&log_addr, sizeof log_addr) < 0 + || send(log_fd, buf, l, 0) < 0) + && (log_opt & LOG_CONS)) { + fd = open("/dev/console", O_WRONLY|O_NOCTTY|O_CLOEXEC); + if(fd >= 0) { + dprintf(fd, "%.*s", l - hlen, buf + hlen); + close(fd); + } + } + if(log_opt & LOG_PERROR) + dprintf(STDERR_FILENO, "%.*s", l - hlen, buf + hlen); + } +} + +void syslog(int priority, const char *format, ...) { + va_list ap; + va_start(ap, format); + vsyslog(priority, format, ap); + va_end(ap); +} + +void vsyslog(int priority, const char *message, va_list ap) { + int cs; + if(!(log_mask & LOG_MASK(priority & 7)) || (priority & ~0x3ff)) { + mlibc::infoLogger() << "\e[31mmlibc: syslog: log_mask or priority out of range, not printing anything\e[39m" << frg::endlog; + return; + } + pthread_setcancelstate(PTHREAD_CANCEL_DISABLE, &cs); + frg::unique_lock<FutexLock> lock(__syslog_lock); + _vsyslog(priority, message, ap); + pthread_setcancelstate(cs, 0); +} diff --git a/lib/mlibc/options/posix/generic/termios-stubs.cpp b/lib/mlibc/options/posix/generic/termios-stubs.cpp new file mode 100644 index 0000000..631456a --- /dev/null +++ b/lib/mlibc/options/posix/generic/termios-stubs.cpp @@ -0,0 +1,103 @@ +#ifndef _GNU_SOURCE +# define _GNU_SOURCE +#endif + +#include <errno.h> +#include <termios.h> +#include <sys/ioctl.h> + +#include <bits/ensure.h> +#include <mlibc/posix-sysdeps.hpp> + +speed_t cfgetispeed(const struct termios *tios) { + return tios->c_cflag & CBAUD; +} + +speed_t cfgetospeed(const struct termios *tios) { + return tios->c_cflag & CBAUD; +} + +int cfsetispeed(struct termios *termios, speed_t speed) { + return speed ? cfsetospeed(termios, speed) : 0; +} + +int cfsetospeed(struct termios *termios, speed_t speed) { + if(speed & ~CBAUD) { + errno = EINVAL; + return -1; + } + + termios->c_cflag &= ~CBAUD; + termios->c_cflag |= speed; + + return 0; +} + +void cfmakeraw(struct termios *t) { + t->c_iflag &= ~(IGNBRK | BRKINT | PARMRK | ISTRIP | INLCR | IGNCR | ICRNL | IXON); + t->c_oflag &= ~OPOST; + t->c_lflag &= ~(ECHO | ECHONL | ICANON | ISIG | IEXTEN); + t->c_cflag &= ~(CSIZE | PARENB); + t->c_cflag |= CS8; + t->c_cc[VMIN] = 1; + t->c_cc[VTIME] = 0; +} + +int tcdrain(int fd) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_tcdrain, -1); + if(int e = mlibc::sys_tcdrain(fd); e) { + errno = e; + return -1; + } + return 0; +} + +int tcflow(int fd, int action) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_tcflow, -1); + if(int e = mlibc::sys_tcflow(fd, action); e) { + errno = e; + return -1; + } + return 0; +} + +int tcflush(int fd, int queue_selector) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_tcflush, -1); + if(int e = mlibc::sys_tcflush(fd, queue_selector); e) { + errno = e; + return -1; + } + return 0; +} + +int tcgetattr(int fd, struct termios *attr) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_tcgetattr, -1); + if(int e = mlibc::sys_tcgetattr(fd, attr); e) { + errno = e; + return -1; + } + return 0; +} + +pid_t tcgetsid(int fd) { + int sid; + if(ioctl(fd, TIOCGSID, &sid) < 0) { + return -1; + } + return sid; +} + +int tcsendbreak(int, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int tcsetattr(int fd, int opts, const struct termios *attr) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_tcsetattr, -1); + if(int e = mlibc::sys_tcsetattr(fd, opts, attr); e) { + errno = e; + return -1; + } + return 0; +} + diff --git a/lib/mlibc/options/posix/generic/time.cpp b/lib/mlibc/options/posix/generic/time.cpp new file mode 100644 index 0000000..14193af --- /dev/null +++ b/lib/mlibc/options/posix/generic/time.cpp @@ -0,0 +1,505 @@ +#include <ctype.h> +#include <langinfo.h> +#include <stdio.h> +#include <string.h> +#include <time.h> + +#include <bits/ensure.h> +#include <mlibc/strings.hpp> + +namespace { + +int month_to_day(int month) { + switch(month){ + case 0: return 0; + case 1: return 31; + case 2: return 59; + case 3: return 90; + case 4: return 120; + case 5: return 151; + case 6: return 181; + case 7: return 212; + case 8: return 243; + case 9: return 273; + case 10: return 304; + case 11: return 334; + } + return -1; +} + +int is_leapyear(int year) { + return year % 4 == 0 && (year % 100 != 0 || year % 400 == 0); +} + +int month_and_year_to_day_in_year(int month, int year){ + int day = month_to_day(month); + if(is_leapyear(year) && month < 2) + return day + 1; + + return day; +} + +int target_determination(int month) { + switch(month){ + case 0: return 3; + case 1: return 14; + case 2: return 14; + case 3: return 4; + case 4: return 9; + case 5: return 6; + case 6: return 11; + case 7: return 8; + case 8: return 5; + case 9: return 10; + case 10: return 7; + case 11: return 12; + } + + return -1; +} + +int doom_determination(int full_year) { + int century = full_year / 100; + int anchor = 2 + 5 * (century % 4) % 7; + + int year = full_year % 100; + + if(year % 2) + year += 11; + + year /= 2; + + if(year % 2) + year += 11; + + return 7 - (year % 7) + anchor; +} + +//Determine day of week through the doomsday algorithm. +int day_determination(int day, int month, int year) { + int doom = doom_determination(year); + bool leap = is_leapyear(year); + + int target = target_determination(month); + if(leap && month < 2) + target++; + + int doom_dif = (day - target) % 7; + return (doom + doom_dif) % 7; +} + +struct strptime_internal_state { + bool has_century; + bool has_year; + bool has_month; + bool has_day_of_month; + bool has_day_of_year; + bool has_day_of_week; + + bool full_year_given; + + int century; + + size_t format_index; + size_t input_index; +}; + +char *strptime_internal(const char *__restrict input, const char *__restrict format, + struct tm *__restrict tm, struct strptime_internal_state *__restrict state) { + auto matchLanginfoItem = [&] (int start, size_t num, int &dest, bool &flag) -> bool { + for(size_t i = start; i < (start + num); i++) { + const char *mon = nl_langinfo(i); + size_t len = strlen(mon); + if(mlibc::strncasecmp(&input[state->input_index], mon, len)) + continue; + state->input_index += len; + dest = i - start; + flag = true; + return true; + } + return false; + }; + + auto matchNumericRange = [&] (int start, int end, int &dest, bool *flag) -> bool { + int product = 0, n = 0; + sscanf(&input[state->input_index], "%d%n", &product, &n); + if(n == 0 || 2 < n) + return false; + if(product < start || product > end) + return false; + state->input_index += n; + dest = product; + if(flag) *flag = true; + return true; + }; + + while(isspace(input[state->input_index])) + state->input_index++; + + if(input[state->input_index] == '\0') + return NULL; + + while(format[state->format_index] != '\0'){ + if(format[state->format_index] != '%'){ + if(isspace(format[state->format_index])){ + while(isspace(input[state->input_index++])); + state->input_index--; + } + else { + if(format[state->format_index] != input[state->input_index++]) + return NULL; + } + state->format_index++; + continue; + } + state->format_index++; + switch(format[state->format_index]){ + case '%': + if(input[state->input_index++] != '%') + return NULL; + break; + case 'a': + case 'A': { + if (!matchLanginfoItem(DAY_1, 7, tm->tm_wday, state->has_day_of_week) && \ + !matchLanginfoItem(ABDAY_1, 7, tm->tm_wday, state->has_day_of_week)) + return NULL; + break; + } + case 'b': + case 'B': + case 'h': { + if (!matchLanginfoItem(MON_1, 12, tm->tm_mon, state->has_month) && \ + !matchLanginfoItem(ABMON_1, 12, tm->tm_mon, state->has_month)) + return NULL; + break; + } + case 'c': + __ensure(!"strptime() %c directive unimplemented."); + __builtin_unreachable(); + break; + case 'C': { + int product = 0, n = 0; + sscanf(&input[state->input_index], "%d%n", &product, &n); + if(n == 0 || 2 < n) + return NULL; + state->input_index += n; + state->century = product; + state->has_century = true; + break; + } + case 'd': //`%d` and `%e` are equivalent + case 'e': { + if(!matchNumericRange(1, 31, tm->tm_mday, &state->has_day_of_month)) + return NULL; + break; + } + case 'D': { //equivalent to `%m/%d/%y` + size_t pre_fi = state->format_index; + state->format_index = 0; + + char *result = strptime_internal(input, "%m/%d/%y", tm, state); + if(result == NULL) + return NULL; + + state->format_index = pre_fi; + break; + } + case 'H': { + if(!matchNumericRange(0, 23, tm->tm_hour, nullptr)) + return NULL; + break; + } + case 'I': { + if(!matchNumericRange(1, 12, tm->tm_hour, nullptr)) + return NULL; + break; + } + case 'j': { + if(!matchNumericRange(1, 366, tm->tm_yday, &state->has_day_of_year)) + return NULL; + tm->tm_yday--; + break; + } + case 'm': { + if(!matchNumericRange(1, 12, tm->tm_mon, &state->has_month)) + return NULL; + tm->tm_mon--; + break; + } + case 'M': { + if(!matchNumericRange(0, 59, tm->tm_min, nullptr)) + return NULL; + break; + } + case 'n': + case 't': { + size_t n = 0; + while(isspace(input[state->input_index++])) + n++; + if(n == 0) + return NULL; + state->input_index--; + break; + } + case 'p': { + const char *meridian_str = nl_langinfo(AM_STR); + size_t len = strlen(meridian_str); + if (!mlibc::strncasecmp(&input[state->input_index], meridian_str, len)) { + tm->tm_hour %= 12; + state->input_index += len; + break; + } + meridian_str = nl_langinfo(PM_STR); + len = strlen(meridian_str); + if (!mlibc::strncasecmp(&input[state->input_index], meridian_str, len)) { + tm->tm_hour %= 12; + tm->tm_hour += 12; + state->input_index += len; + break; + } + break; + } + case 'r': { //equivalent to `%I:%M:%S %p` + size_t pre_fi = state->format_index; + state->format_index = 0; + + char *result = strptime_internal(input, "%I:%M:%S %p", tm, state); + if(result == NULL) + return NULL; + + state->format_index = pre_fi; + break; + } + case 'R': { //equivalent to `%H:%M` + size_t pre_fi = state->format_index; + state->format_index = 0; + + char *result = strptime_internal(input, "%H:%M", tm, state); + if(result == NULL) + return NULL; + + state->format_index = pre_fi; + break; + } + case 'S': { + if(!matchNumericRange(0, 60, tm->tm_sec, nullptr)) + return NULL; + break; + } + case 'T': { //equivalent to `%H:%M:%S` + size_t pre_fi = state->format_index; + state->format_index = 0; + + char *result = strptime_internal(input, "%H:%M:%S", tm, state); + if(result == NULL) + return NULL; + + state->format_index = pre_fi; + break; + } + case 'U': + __ensure(!"strptime() %U directive unimplemented."); + __builtin_unreachable(); + break; + case 'w': { + int product = 0, n = 0; + sscanf(&input[state->input_index], "%d%n", &product, &n); + if(n == 0 || 1 < n) + return NULL; + state->input_index += n; + tm->tm_wday = product; + state->has_day_of_week = true; + break; + } + case 'W': + __ensure(!"strptime() %W directive unimplemented."); + __builtin_unreachable(); + break; + case 'x': + __ensure(!"strptime() %x directive unimplemented."); + __builtin_unreachable(); + break; + case 'X': + __ensure(!"strptime() %X directive unimplemented."); + __builtin_unreachable(); + break; + case 'y': { + int product = 0, n = 0; + sscanf(&input[state->input_index], "%d%n", &product, &n); + if(n == 0 || 2 < n) + return NULL; + if(product < 69) + product += 100; + state->input_index += n; + tm->tm_year = product; + state->has_year = true; + break; + } + case 'Y': { + int product = 0, n = 0; + sscanf(&input[state->input_index], "%d%n", &product, &n); + if(n == 0 || 4 < n) + return NULL; + state->input_index += n; + tm->tm_year = product - 1900; + state->has_year = true; + state->has_century = true; + state->full_year_given = true; + state->century = product / 100; + break; + } + case 'F': { //GNU extensions + //equivalent to `%Y-%m-%d` + size_t pre_fi = state->format_index; + state->format_index = 0; + + char *result = strptime_internal(input, "%Y-%m-%d", tm, state); + if(result == NULL) + return NULL; + + state->format_index = pre_fi; + break; + } + case 'g': + __ensure(!"strptime() %g directive unimplemented."); + __builtin_unreachable(); + break; + case 'G': + __ensure(!"strptime() %G directive unimplemented."); + __builtin_unreachable(); + break; + case 'u': { + if(!matchNumericRange(1, 7, tm->tm_wday, nullptr)) + return NULL; + tm->tm_wday--; + break; + } + case 'V': + __ensure(!"strptime() %V directive unimplemented."); + __builtin_unreachable(); + break; + case 'z': + __ensure(!"strptime() %z directive unimplemented."); + __builtin_unreachable(); + break; + case 'Z': + __ensure(!"strptime() %Z directive unimplemented."); + __builtin_unreachable(); + break; + case 's': //end of GNU extensions + __ensure(!"strptime() %s directive unimplemented."); + __builtin_unreachable(); + break; + case 'E': { //locale-dependent date & time representation + __ensure(!"strptime() %E* directives unimplemented."); + __builtin_unreachable(); + /* + state->format_index++; + switch(format[state->format_index]){ + case 'c': + break; + case 'C': + break; + case 'x': + break; + case 'X': + break; + case 'y': + break; + case 'Y': + break; + default: + return NULL; + } + */ + } + case 'O': { //locale-dependent numeric symbols + __ensure(!"strptime() %O* directives unimplemented."); + __builtin_unreachable(); + /* + state->format_index++; + switch(format[state->format_index]){ + case 'd': + case 'e': + break; + case 'H': + break; + case 'I': + break; + case 'm': + break; + case 'M': + break; + case 'S': + break; + case 'U': + break; + case 'w': + break; + case 'W': + break; + case 'y': + break; + default: + return NULL; + } + */ + } + default: + return NULL; + } + state->format_index++; + } + + return (char*)input + state->input_index; +} + +} //anonymous namespace + +char *strptime(const char *__restrict s, const char *__restrict format, struct tm *__restrict tm){ + struct strptime_internal_state state = {}; + + char *result = strptime_internal(s, format, tm, &state); + + if(result == NULL) + return NULL; + + if(state.has_century && !state.full_year_given){ + int full_year = state.century * 100; + + if(state.has_year){ + //Compensate for default century-adjustment of `%j` operand + if(tm->tm_year >= 100) + full_year += tm->tm_year - 100; + else + full_year += tm->tm_year; + } + + tm->tm_year = full_year - 1900; + + state.has_year = true; + } + + if(state.has_month && !state.has_day_of_year){ + int day = 0; + if(state.has_year) + day = month_and_year_to_day_in_year(tm->tm_mon, tm->tm_year); + else + day = month_to_day(tm->tm_mon); + + tm->tm_yday = day + tm->tm_mday - 1; + state.has_day_of_year = true; + } + + if(state.has_year && !state.has_day_of_week){ + if(!state.has_month && !state.has_day_of_month){ + tm->tm_wday = day_determination(0, 0, tm->tm_year + 1900); + } + else if(state.has_month && state.has_day_of_month){ + tm->tm_wday = day_determination(tm->tm_mday, tm->tm_mon, tm->tm_year + 1900); + } + state.has_day_of_week = true; + } + + return result; +} diff --git a/lib/mlibc/options/posix/generic/ucontext-stubs.cpp b/lib/mlibc/options/posix/generic/ucontext-stubs.cpp new file mode 100644 index 0000000..9413a78 --- /dev/null +++ b/lib/mlibc/options/posix/generic/ucontext-stubs.cpp @@ -0,0 +1,19 @@ +#include <ucontext.h> +#include <bits/ensure.h> + +int getcontext(ucontext_t *) { + __ensure(!"Not implemented!"); + __builtin_unreachable(); +} +int setcontext(const ucontext_t *) { + __ensure(!"Not implemented!"); + __builtin_unreachable(); +} +void makecontext(ucontext_t *, void (*)(), int, ...) { + __ensure(!"Not implemented!"); + __builtin_unreachable(); +} +int swapcontext(ucontext_t *, const ucontext_t *) { + __ensure(!"Not implemented!"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/posix/generic/unistd-stubs.cpp b/lib/mlibc/options/posix/generic/unistd-stubs.cpp new file mode 100644 index 0000000..39cf76a --- /dev/null +++ b/lib/mlibc/options/posix/generic/unistd-stubs.cpp @@ -0,0 +1,1227 @@ +#include <stdio.h> +#include <errno.h> +#include <stdarg.h> +#include <stdlib.h> +#include <string.h> +#include <sys/resource.h> +#include <unistd.h> +#include <limits.h> +#include <termios.h> +#include <pwd.h> +#include <sys/ioctl.h> + +#include <bits/ensure.h> +#include <mlibc/allocator.hpp> +#include <mlibc/arch-defs.hpp> +#include <mlibc/debug.hpp> +#include <mlibc/posix-sysdeps.hpp> +#include <mlibc/bsd-sysdeps.hpp> +#include <mlibc/thread.hpp> + +namespace { + +constexpr bool logExecvpeTries = false; + +} + +unsigned int alarm(unsigned int seconds) { + struct itimerval it = {}, old = {}; + it.it_value.tv_sec = seconds; + setitimer(ITIMER_REAL, &it, &old); + return old.it_value.tv_sec + !! old.it_value.tv_usec; +} + +int chdir(const char *path) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_chdir, -1); + if(int e = mlibc::sys_chdir(path); e) { + errno = e; + return -1; + } + return 0; +} + +int fchdir(int fd) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fchdir, -1); + if(int e = mlibc::sys_fchdir(fd); e) { + errno = e; + return -1; + } + return 0; +} + +int chown(const char *path, uid_t uid, gid_t gid) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fchownat, -1); + if(int e = mlibc::sys_fchownat(AT_FDCWD, path, uid, gid, 0); e) { + errno = e; + return -1; + } + return 0; +} + +ssize_t confstr(int name, char *buf, size_t len) { + const char *str = ""; + if (name == _CS_PATH) { + str = "/bin:/usr/bin"; + } else if(name == _CS_GNU_LIBPTHREAD_VERSION) { + // We are not glibc, so we can return 0 here. + return 0; + } else if(name == _CS_GNU_LIBC_VERSION) { + // We are not glibc, so we can return 0 here. + return 0; + } else { + mlibc::infoLogger() << "\e[31mmlibc: confstr() request " << name << " is unimplemented\e[39m" + << frg::endlog; + __ensure(!"Not implemented"); + } + + return snprintf(buf, len, "%s", str) + 1; +} + +void _exit(int status) { + mlibc::sys_exit(status); +} + +int execl(const char *path, const char *arg0, ...) { + // TODO: It's a stupid idea to limit the number of arguments here. + char *argv[16]; + argv[0] = const_cast<char *>(arg0); + + va_list args; + int n = 1; + va_start(args, arg0); + while(true) { + __ensure(n < 15); + auto argn = va_arg(args, const char *); + argv[n++] = const_cast<char *>(argn); + if(!argn) + break; + } + va_end(args); + argv[n] = nullptr; + + return execve(path, argv, environ); +} + +// This function is taken from musl. +int execle(const char *path, const char *arg0, ...) { + int argc; + va_list ap; + va_start(ap, arg0); + for(argc = 1; va_arg(ap, const char *); argc++); + va_end(ap); + + int i; + char *argv[argc + 1]; + char **envp; + va_start(ap, arg0); + argv[0] = (char *)argv; + for(i = 1; i <= argc; i++) + argv[i] = va_arg(ap, char *); + envp = va_arg(ap, char **); + va_end(ap); + return execve(path, argv, envp); +} + +// This function is taken from musl +int execlp(const char *file, const char *argv0, ...) { + int argc; + va_list ap; + va_start(ap, argv0); + for(argc = 1; va_arg(ap, const char *); argc++); + va_end(ap); + { + int i; + char *argv[argc + 1]; + va_start(ap, argv0); + argv[0] = (char *)argv0; + for(i = 1; i < argc; i++) + argv[i] = va_arg(ap, char *); + argv[i] = NULL; + va_end(ap); + return execvp(file, argv); + } +} + +int execv(const char *path, char *const argv[]) { + return execve(path, argv, environ); +} + +int execvp(const char *file, char *const argv[]) { + return execvpe(file, argv, environ); +} + +int execvpe(const char *file, char *const argv[], char *const envp[]) { + char *null_list[] = { + nullptr + }; + + if(!argv) + argv = null_list; + if(!envp) + envp = null_list; + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_execve, -1); + + if(strchr(file, '/')) { + int e = mlibc::sys_execve(file, argv, envp); + __ensure(e && "sys_execve() is supposed to never return with success"); + errno = e; + return -1; + } + + frg::string_view dirs; + if(const char *pv = getenv("PATH"); pv) { + dirs = pv; + }else{ + dirs = "/bin:/usr/bin"; + } + + size_t p = 0; + int res = ENOENT; + while(p < dirs.size()) { + size_t s; // Offset of next colon or end of string. + if(size_t cs = dirs.find_first(':', p); cs != size_t(-1)) { + s = cs; + }else{ + s = dirs.size(); + } + + frg::string<MemoryAllocator> path{getAllocator()}; + path += dirs.sub_string(p, s - p); + path += "/"; + path += file; + + if(logExecvpeTries) + mlibc::infoLogger() << "mlibc: execvpe() tries '" << path.data() << "'" << frg::endlog; + + int e = mlibc::sys_execve(path.data(), argv, envp); + __ensure(e && "sys_execve() is supposed to never return with success"); + switch(e) { + case ENOENT: + case ENOTDIR: + break; + case EACCES: + res = EACCES; + break; + default: + errno = e; + return -1; + } + + p = s + 1; + } + + errno = res; + return -1; +} + +int faccessat(int dirfd, const char *pathname, int mode, int flags) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_faccessat, -1); + if(int e = mlibc::sys_faccessat(dirfd, pathname, mode, flags); e) { + errno = e; + return -1; + } + return 0; +} + +int fchown(int fd, uid_t uid, gid_t gid) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fchownat, -1); + if(int e = mlibc::sys_fchownat(fd, "", uid, gid, AT_EMPTY_PATH); e) { + errno = e; + return -1; + } + return 0; +} + +int fchownat(int fd, const char *path, uid_t uid, gid_t gid, int flags) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fchownat, -1); + if(int e = mlibc::sys_fchownat(fd, path, uid, gid, flags); e) { + errno = e; + return -1; + } + return 0; +} + +int fdatasync(int fd) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fdatasync, -1); + if(int e = mlibc::sys_fdatasync(fd); e) { + errno = e; + return -1; + } + return 0; +} + +int fexecve(int, char *const [], char *const []) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +long fpathconf(int, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int fsync(int fd) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fsync, -1); + if(auto e = mlibc::sys_fsync(fd); e) { + errno = e; + return -1; + } + return 0; +} + +int ftruncate(int fd, off_t size) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_ftruncate, -1); + if(int e = mlibc::sys_ftruncate(fd, size); e) { + errno = e; + return -1; + } + return 0; +} + +char *getcwd(char *buffer, size_t size) { + if (buffer) { + if (size == 0) { + errno = EINVAL; + return NULL; + } + } else if (!buffer) { + if (size == 0) + size = PATH_MAX; + + buffer = (char *)malloc(size); + } + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getcwd, nullptr); + if(int e = mlibc::sys_getcwd(buffer, size); e) { + errno = e; + return NULL; + } + + return buffer; +} + +int getgroups(int size, gid_t list[]) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getgroups, -1); + int ret; + if(int e = mlibc::sys_getgroups(size, list, &ret); e) { + errno = e; + return -1; + } + return ret; +} + +long gethostid(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int gethostname(char *buffer, size_t bufsize) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_gethostname, -1); + if(auto e = mlibc::sys_gethostname(buffer, bufsize); e) { + errno = e; + return -1; + } + return 0; +} + +int sethostname(const char *buffer, size_t bufsize) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_sethostname, -1); + if(auto e = mlibc::sys_sethostname(buffer, bufsize); e) { + errno = e; + return -1; + } + return 0; +} + +// Code taken from musl +char *getlogin(void) { + return getenv("LOGNAME"); +} + +int getlogin_r(char *, size_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +// optarg and optind are provided to us by the GLIBC part of the mlibc. + +static char *scan = NULL; /* Private scan pointer. */ + +int getopt(int argc, char *const argv[], const char *optstring) { + char c; + char *place; + + optarg = NULL; + + if (!scan || *scan == '\0') { + if (optind == 0) + optind++; + + if (optind >= argc || argv[optind][0] != '-' || argv[optind][1] == '\0') + return EOF; + if (argv[optind][1] == '-' && argv[optind][2] == '\0') { + optind++; + return EOF; + } + + scan = argv[optind]+1; + optind++; + } + + c = *scan++; + place = strchr(optstring, c); + + if (!place || c == ':') { + fprintf(stderr, "%s: unknown option -%c\n", argv[0], c); + return '?'; + } + + place++; + if (*place == ':') { + if (*scan != '\0') { + optarg = scan; + scan = NULL; + } else if( optind < argc ) { + optarg = argv[optind]; + optind++; + } else { + fprintf(stderr, "%s: option requires argument -%c\n", argv[0], c); + return ':'; + } + } + + return c; +} + +pid_t getpgid(pid_t pid) { + pid_t pgid; + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getpgid, -1); + if(int e = mlibc::sys_getpgid(pid, &pgid); e) { + errno = e; + return -1; + } + return pgid; +} + +pid_t getpgrp(void) { + return getpgid(0); +} + +pid_t getsid(pid_t pid) { + if(!mlibc::sys_getsid) { + MLIBC_MISSING_SYSDEP(); + return -1; + } + pid_t sid; + if(int e = mlibc::sys_getsid(pid, &sid); e) { + errno = e; + return -1; + } + return sid; +} + +int lchown(const char *path, uid_t uid, gid_t gid) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fchownat, -1); + if(int e = mlibc::sys_fchownat(AT_FDCWD, path, uid, gid, AT_SYMLINK_NOFOLLOW); e) { + errno = e; + return -1; + } + return 0; +} + +int link(const char *old_path, const char *new_path) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_link, -1); + if(int e = mlibc::sys_link(old_path, new_path); e) { + errno = e; + return -1; + } + return 0; +} + +int linkat(int olddirfd, const char *old_path, int newdirfd, const char *new_path, int flags) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_linkat, -1); + if(int e = mlibc::sys_linkat(olddirfd, old_path, newdirfd, new_path, flags); e) { + errno = e; + return -1; + } + return 0; +} + +// Code take from musl +int lockf(int fd, int op, off_t size) { + struct flock l = { + .l_type = F_WRLCK, + .l_whence = SEEK_CUR, + .l_start = 0, + .l_len = size, + .l_pid = 0, + }; + + switch(op) { + case F_TEST: + l.l_type = F_RDLCK; + if(fcntl(fd, F_GETLK, &l) < 0) + return -1; + if(l.l_type == F_UNLCK || l.l_pid == getpid()) + return 0; + errno = EACCES; + return -1; + case F_ULOCK: + l.l_type = F_UNLCK; + [[fallthrough]]; + case F_TLOCK: + return fcntl(fd, F_SETLK, &l); + case F_LOCK: + return fcntl(fd, F_SETLKW, &l); + } + + errno = EINVAL; + return -1; +} + +int nice(int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +long pathconf(const char *, int name) { + switch (name) { + case _PC_NAME_MAX: + return NAME_MAX; + default: + mlibc::infoLogger() << "missing pathconf() entry " << name << frg::endlog; + errno = EINVAL; + return -1; + } +} + +int pause(void) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_pause, -1); + if(int e = mlibc::sys_pause(); e) { + errno = e; + return -1; + } + __ensure(!"There is no successful completion return value for pause"); + __builtin_unreachable(); +} + +int pipe(int *fds) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_pipe, -1); + if(int e = mlibc::sys_pipe(fds, 0); e) { + errno = e; + return -1; + } + return 0; +} + +int pipe2(int *fds, int flags) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_pipe, -1); + if(int e = mlibc::sys_pipe(fds, flags); e) { + errno = e; + return -1; + } + return 0; +} + +ssize_t pread(int fd, void *buf, size_t n, off_t off) { + ssize_t num_read; + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_pread, -1); + if(int e = mlibc::sys_pread(fd, buf, n, off, &num_read); e) { + errno = e; + return -1; + } + return num_read; +} + +ssize_t pwrite(int fd, const void *buf, size_t n, off_t off) { + ssize_t num_written; + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_pwrite, -1); + if(int e = mlibc::sys_pwrite(fd, buf, n, off, &num_written); e) { + errno = e; + return -1; + } + return num_written; +} + +ssize_t readlink(const char *__restrict path, char *__restrict buffer, size_t max_size) { + ssize_t length; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_readlink, -1); + if(int e = mlibc::sys_readlink(path, buffer, max_size, &length); e) { + errno = e; + return -1; + } + return length; +} + +ssize_t readlinkat(int, const char *__restrict, char *__restrict, size_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int rmdir(const char *path) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_rmdir, -1); + if(int e = mlibc::sys_rmdir(path); e) { + errno = e; + return -1; + } + return 0; +} + +int setegid(gid_t egid) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setegid, 0); + if(int e = mlibc::sys_setegid(egid); e) { + errno = e; + return -1; + } + return 0; +} + +int seteuid(uid_t euid) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_seteuid, 0); + if(int e = mlibc::sys_seteuid(euid); e) { + errno = e; + return -1; + } + return 0; +} + +int setgid(gid_t gid) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setgid, 0); + if(int e = mlibc::sys_setgid(gid); e) { + errno = e; + return -1; + } + return 0; +} + +int setpgid(pid_t pid, pid_t pgid) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setpgid, -1); + if(int e = mlibc::sys_setpgid(pid, pgid); e) { + errno = e; + return -1; + } + return 0; +} + +pid_t setpgrp(void) { + return setpgid(0, 0); +} + +int setregid(gid_t rgid, gid_t egid) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setregid, -1); + if(int e = mlibc::sys_setregid(rgid, egid); e) { + errno = e; + return -1; + } + return 0; +} + +int setreuid(uid_t ruid, uid_t euid) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setreuid, -1); + if(int e = mlibc::sys_setreuid(ruid, euid); e) { + errno = e; + return -1; + } + return 0; +} + +pid_t setsid(void) { + if(!mlibc::sys_setsid) { + MLIBC_MISSING_SYSDEP(); + return -1; + } + pid_t sid; + if(int e = mlibc::sys_setsid(&sid); e) { + errno = e; + return -1; + } + return sid; +} + +int setuid(uid_t uid) { + if(!mlibc::sys_setuid) { + MLIBC_MISSING_SYSDEP(); + mlibc::infoLogger() << "mlibc: missing sysdep sys_setuid(). Returning 0" << frg::endlog; + return 0; + } + if(int e = mlibc::sys_setuid(uid); e) { + errno = e; + return -1; + } + return 0; +} + +void swab(const void *__restrict, void *__restrict, ssize_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int symlink(const char *target_path, const char *link_path) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_symlink, -1); + if(int e = mlibc::sys_symlink(target_path, link_path); e) { + errno = e; + return -1; + } + return 0; +} + +int symlinkat(const char *target_path, int dirfd, const char *link_path) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_symlinkat, -1); + if(int e = mlibc::sys_symlinkat(target_path, dirfd, link_path); e) { + errno = e; + return -1; + } + return 0; +} + +void sync(void) { + if(!mlibc::sys_sync) { + MLIBC_MISSING_SYSDEP(); + } else { + mlibc::sys_sync(); + } +} + +long sysconf(int number) { + if(mlibc::sys_sysconf) { + long ret = 0; + + int e = mlibc::sys_sysconf(number, &ret); + + if(e && e != EINVAL) { + errno = e; + return -1; + } + + if(e != EINVAL) { + return ret; + } + } + + /* default return values, if not overriden by sysdep */ + switch(number) { + case _SC_ARG_MAX: + // On linux, it is defined to 2097152 in most cases, so define it to be 2097152 + return 2097152; + case _SC_PAGE_SIZE: + return mlibc::page_size; + case _SC_OPEN_MAX: + mlibc::infoLogger() << "\e[31mmlibc: sysconf(_SC_OPEN_MAX) returns fallback value 256\e[39m" << frg::endlog; + return 256; + case _SC_PHYS_PAGES: + mlibc::infoLogger() << "\e[31mmlibc: sysconf(_SC_PHYS_PAGES) returns fallback value 1024\e[39m" << frg::endlog; + return 1024; + case _SC_NPROCESSORS_ONLN: + mlibc::infoLogger() << "\e[31mmlibc: sysconf(_SC_NPROCESSORS_ONLN) returns fallback value 1\e[39m" << frg::endlog; + return 1; + case _SC_GETPW_R_SIZE_MAX: + return NSS_BUFLEN_PASSWD; + case _SC_GETGR_R_SIZE_MAX: + mlibc::infoLogger() << "\e[31mmlibc: sysconf(_SC_GETGR_R_SIZE_MAX) returns fallback value 1024\e[39m" << frg::endlog; + return 1024; + case _SC_CHILD_MAX: + mlibc::infoLogger() << "\e[31mmlibc: sysconf(_SC_CHILD_MAX) returns fallback value 25\e[39m" << frg::endlog; + // On linux, it is defined to 25 in most cases, so define it to be 25 + return 25; + case _SC_JOB_CONTROL: + mlibc::infoLogger() << "\e[31mmlibc: sysconf(_SC_JOB_CONTROL) returns fallback value 1\e[39m" << frg::endlog; + // If 1, job control is supported + return 1; + case _SC_CLK_TCK: + // TODO: This should be obsolete? + mlibc::infoLogger() << "\e[31mmlibc: sysconf(_SC_CLK_TCK) is obsolete and returns arbitrary value 1000000\e[39m" << frg::endlog; + return 1000000; + case _SC_NGROUPS_MAX: + mlibc::infoLogger() << "\e[31mmlibc: sysconf(_SC_NGROUPS_MAX) returns fallback value 65536\e[39m" << frg::endlog; + // On linux, it is defined to 65536 in most cases, so define it to be 65536 + return 65536; + case _SC_RE_DUP_MAX: + mlibc::infoLogger() << "\e[31mmlibc: sysconf(_SC_RE_DUP_MAX) returns fallback value RE_DUP_MAX\e[39m" << frg::endlog; + return RE_DUP_MAX; + case _SC_LINE_MAX: + mlibc::infoLogger() << "\e[31mmlibc: sysconf(_SC_LINE_MAX) returns fallback value 2048\e[39m" << frg::endlog; + // Linux defines it as 2048. + return 2048; + case _SC_XOPEN_CRYPT: +#if __MLIBC_CRYPT_OPTION + return _XOPEN_CRYPT; +#else + return -1; +#endif /* __MLIBC_CRYPT_OPTION */ + case _SC_NPROCESSORS_CONF: + // TODO: actually return a proper value for _SC_NPROCESSORS_CONF + mlibc::infoLogger() << "\e[31mmlibc: sysconf(_SC_NPROCESSORS_CONF) unconditionally returns fallback value 1\e[39m" << frg::endlog; + return 1; + case _SC_HOST_NAME_MAX: + mlibc::infoLogger() << "\e[31mmlibc: sysconf(_SC_HOST_NAME_MAX) unconditionally returns fallback value 256\e[39m" << frg::endlog; + return 256; + default: + mlibc::infoLogger() << "\e[31mmlibc: sysconf() call is not implemented, number: " << number << "\e[39m" << frg::endlog; + errno = EINVAL; + return -1; + } +} + +pid_t tcgetpgrp(int fd) { + int pgrp; + if(ioctl(fd, TIOCGPGRP, &pgrp) < 0) { + return -1; + } + return pgrp; +} + +int tcsetpgrp(int fd, pid_t pgrp) { + return ioctl(fd, TIOCSPGRP, &pgrp); +} + +int truncate(const char *, off_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +char *ttyname(int fd) { + const size_t size = 128; + static thread_local char buf[size]; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_ttyname, nullptr); + if(int e = mlibc::sys_ttyname(fd, buf, size); e) { + errno = e; + return nullptr; + } + return buf; +} + +int ttyname_r(int fd, char *buf, size_t size) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_ttyname, -1); + if(int e = mlibc::sys_ttyname(fd, buf, size); e) { + return e; + } + return 0; +} + +int unlink(const char *path) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_unlinkat, -1); + if(int e = mlibc::sys_unlinkat(AT_FDCWD, path, 0); e) { + errno = e; + return -1; + } + return 0; +} + +int unlinkat(int fd, const char *path, int flags) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_unlinkat, -1); + if(int e = mlibc::sys_unlinkat(fd, path, flags); e) { + errno = e; + return -1; + } + return 0; +} + +int getpagesize() { + return mlibc::page_size; +} + +// Code taken from musl +// GLIBC extension for stdin/stdout +char *getpass(const char *prompt) { + int fdin, fdout; + struct termios s, t; + ssize_t l; + static char password[128]; + + if((fdin = open("/dev/tty", O_RDWR|O_NOCTTY|O_CLOEXEC)) < 0) { + fdin = STDIN_FILENO; + fdout = STDOUT_FILENO; + } else { + fdout = fdin; + } + + tcgetattr(fdin, &t); + s = t; + t.c_lflag &= ~(ECHO | ISIG); + t.c_lflag |= ICANON; + t.c_iflag &= ~(INLCR | IGNCR); + t.c_iflag |= ICRNL; + tcsetattr(fdin, TCSAFLUSH, &t); + tcdrain(fdin); + + dprintf(fdout, "%s", prompt); + + l = read(fdin, password, sizeof password); + if(l >= 0) { + if((l > 0 && password[l - 1] == '\n') || l == sizeof password) + l--; + password[l] = 0; + } + + tcsetattr(fdin, TCSAFLUSH, &s); + + dprintf(fdout, "\n"); + if(fdin != STDIN_FILENO) { + close(fdin); + } + + return l < 0 ? 0 : password; +} + +char *get_current_dir_name(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +// This is a Linux extension +pid_t gettid(void) { + if(!mlibc::sys_gettid) { + MLIBC_MISSING_SYSDEP(); + __ensure(!"Cannot continue without sys_gettid()"); + } + return mlibc::sys_gettid(); +} + +int getentropy(void *buffer, size_t length) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getentropy, -1); + if(length > 256) { + errno = EIO; + return -1; + } + if(int e = mlibc::sys_getentropy(buffer, length); e) { + errno = e; + return -1; + } + return 0; +} + +ssize_t write(int fd, const void *buf, size_t count) { + ssize_t bytes_written; + if(int e = mlibc::sys_write(fd, buf, count, &bytes_written); e) { + errno = e; + return (ssize_t)-1; + } + return bytes_written; +} + +ssize_t read(int fd, void *buf, size_t count) { + ssize_t bytes_read; + if(int e = mlibc::sys_read(fd, buf, count, &bytes_read); e) { + errno = e; + return (ssize_t)-1; + } + return bytes_read; +} + +off_t lseek(int fd, off_t offset, int whence) { + off_t new_offset; + if(int e = mlibc::sys_seek(fd, offset, whence, &new_offset); e) { + errno = e; + return (off_t)-1; + } + return new_offset; +} + +off64_t lseek64(int fd, off64_t offset, int whence) { + off64_t new_offset; + if(int e = mlibc::sys_seek(fd, offset, whence, &new_offset); e) { + errno = e; + return (off64_t)-1; + } + return new_offset; +} + +int close(int fd) { + return mlibc::sys_close(fd); +} + +unsigned int sleep(unsigned int secs) { + time_t seconds = secs; + long nanos = 0; + if(!mlibc::sys_sleep) { + MLIBC_MISSING_SYSDEP(); + __ensure(!"Cannot continue without sys_sleep()"); + } + mlibc::sys_sleep(&seconds, &nanos); + return seconds; +} + +// In contrast to sleep() this functions returns 0/-1 on success/failure. +int usleep(useconds_t usecs) { + time_t seconds = 0; + long nanos = usecs * 1000; + if(!mlibc::sys_sleep) { + MLIBC_MISSING_SYSDEP(); + __ensure(!"Cannot continue without sys_sleep()"); + } + return mlibc::sys_sleep(&seconds, &nanos); +} + +int dup(int fd) { + int newfd; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_dup, -1); + if(int e = mlibc::sys_dup(fd, 0, &newfd); e) { + errno = e; + return -1; + } + return newfd; +} + +int dup2(int fd, int newfd) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_dup2, -1); + if(int e = mlibc::sys_dup2(fd, 0, newfd); e) { + errno = e; + return -1; + } + return newfd; +} + +pid_t fork(void) { + auto self = mlibc::get_current_tcb(); + pid_t child; + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fork, -1); + + auto hand = self->atforkEnd; + while (hand) { + if (hand->prepare) + hand->prepare(); + + hand = hand->prev; + } + + if(int e = mlibc::sys_fork(&child); e) { + errno = e; + return -1; + } + + hand = self->atforkBegin; + while (hand) { + if (!child) { + if (hand->child) + hand->child(); + } else { + if (hand->parent) + hand->parent(); + } + hand = hand->next; + } + + return child; +} + +pid_t vfork(void) { + pid_t child; + /* + * Fork handlers established using pthread_atfork(3) are not + * called when a multithreaded program employing the NPTL + * threading library calls vfork(). Fork handlers are called + * in this case in a program using the LinuxThreads threading + * library. (See pthreads(7) for a description of Linux + * threading libraries.) + * - vfork(2), release 5.13 of the Linux man-pages project + * + * as a result, we call sys_fork instead of running atforks + */ + + /* deferring to fork as implementing vfork correctly requires assembly + * to handle not mucking up the stack + */ + if(!mlibc::sys_fork) { + MLIBC_MISSING_SYSDEP(); + errno = ENOSYS; + return -1; + } + + if(int e = mlibc::sys_fork(&child); e) { + errno = e; + return -1; + } + + return child; +} + +int execve(const char *path, char *const argv[], char *const envp[]) { + char *null_list[] = { + nullptr + }; + + if(!argv) + argv = null_list; + if(!envp) + envp = null_list; + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_execve, -1); + int e = mlibc::sys_execve(path, argv, envp); + __ensure(e && "sys_execve() is expected to fail if it returns"); + errno = e; + return -1; +} + +gid_t getgid(void) { + if(!mlibc::sys_getgid) { + MLIBC_MISSING_SYSDEP(); + __ensure(!"Cannot continue without sys_getgid()"); + } + return mlibc::sys_getgid(); +} + +gid_t getegid(void) { + if(!mlibc::sys_getegid) { + MLIBC_MISSING_SYSDEP(); + __ensure(!"Cannot continue without sys_getegid()"); + } + return mlibc::sys_getegid(); +} + +uid_t getuid(void) { + if(!mlibc::sys_getuid) { + MLIBC_MISSING_SYSDEP(); + __ensure(!"Cannot continue without sys_getuid()"); + } + return mlibc::sys_getuid(); +} + +uid_t geteuid(void) { + if(!mlibc::sys_geteuid) { + MLIBC_MISSING_SYSDEP(); + __ensure(!"Cannot continue without sys_geteuid()"); + } + return mlibc::sys_geteuid(); +} + +pid_t getpid(void) { + if(!mlibc::sys_getpid) { + MLIBC_MISSING_SYSDEP(); + __ensure(!"Cannot continue without sys_getpid()"); + } + return mlibc::sys_getpid(); +} + +pid_t getppid(void) { + if(!mlibc::sys_getppid) { + MLIBC_MISSING_SYSDEP(); + __ensure(!"Cannot continue without sys_getppid()"); + } + return mlibc::sys_getppid(); +} + +int access(const char *path, int mode) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_access, -1); + if(int e = mlibc::sys_access(path, mode); e) { + errno = e; + return -1; + } + return 0; +} + +char *getusershell(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void setusershell(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void endusershell(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int isatty(int fd) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_isatty, 0); + if(int e = mlibc::sys_isatty(fd); e) { + errno = e; + return 0; + } + return 1; +} + +int chroot(const char *ptr) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_chroot, -1); + if(int e = mlibc::sys_chroot(ptr); e) { + errno = e; + return -1; + } + return 0; +} + +int daemon(int, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +char *ctermid(char *s) { + return s ? strcpy(s, "/dev/tty") : const_cast<char *>("/dev/tty"); +} + +int setresuid(uid_t ruid, uid_t euid, uid_t suid) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setresuid, -1); + if(int e = mlibc::sys_setresuid(ruid, euid, suid); e) { + errno = e; + return -1; + } + return 0; +} + +int setresgid(gid_t rgid, gid_t egid, gid_t sgid) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_setresgid, -1); + if(int e = mlibc::sys_setresgid(rgid, egid, sgid); e) { + errno = e; + return -1; + } + return 0; +} + +int getdomainname(char *, size_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int setdomainname(const char *, size_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int getresuid(uid_t *ruid, uid_t *euid, uid_t *suid) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getresuid, -1); + if(int e = mlibc::sys_getresuid(ruid, euid, suid); e) { + errno = e; + return -1; + } + return 0; +} + +int getresgid(gid_t *rgid, gid_t *egid, gid_t *sgid) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getresgid, -1); + if(int e = mlibc::sys_getresgid(rgid, egid, sgid); e) { + errno = e; + return -1; + } + return 0; +} + +#if __MLIBC_CRYPT_OPTION +void encrypt(char[64], int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +#endif + +#if __MLIBC_BSD_OPTION +void *sbrk(intptr_t increment) { + if(increment) { + errno = ENOMEM; + return (void *)-1; + } + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_brk, (void *)-1); + void *out; + if(int e = mlibc::sys_brk(&out); e) { + errno = e; + return (void *)-1; + } + return out; +} +#endif diff --git a/lib/mlibc/options/posix/generic/utime-stubs.cpp b/lib/mlibc/options/posix/generic/utime-stubs.cpp new file mode 100644 index 0000000..f78729f --- /dev/null +++ b/lib/mlibc/options/posix/generic/utime-stubs.cpp @@ -0,0 +1,31 @@ + +#include <utime.h> +#include <fcntl.h> +#include <errno.h> + +#include <bits/ensure.h> +#include <mlibc/posix-sysdeps.hpp> + +int utime(const char *filename, const struct utimbuf *times) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_utimensat, -1); + struct timespec time[2]; + if(times) { + time[0].tv_sec = times->actime; + time[0].tv_nsec = 0; + time[1].tv_sec = times->modtime; + time[1].tv_nsec = 0; + } else { + time[0].tv_sec = UTIME_NOW; + time[0].tv_nsec = UTIME_NOW; + time[1].tv_sec = UTIME_NOW; + time[1].tv_nsec = UTIME_NOW; + } + + if (int e = mlibc::sys_utimensat(AT_FDCWD, filename, time, 0); e) { + errno = e; + return -1; + } + + return 0; +} + diff --git a/lib/mlibc/options/posix/generic/wordexp-stubs.cpp b/lib/mlibc/options/posix/generic/wordexp-stubs.cpp new file mode 100644 index 0000000..8443527 --- /dev/null +++ b/lib/mlibc/options/posix/generic/wordexp-stubs.cpp @@ -0,0 +1,342 @@ +/* + * SPDX-License-Identifier: BSD-2-Clause-FreeBSD + * + * code taken from OPNSense, with modifications + * + * Copyright (c) 2002 Tim J. Robbins. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#include <wordexp.h> +#include <fcntl.h> +#include <sys/wait.h> +#include <unistd.h> +#include <errno.h> +#include <string.h> +#include <stdlib.h> +#include <signal.h> +#include <stdint.h> + +#define SHELL_PATH "/bin/sh" +#define SHELL_NAME "sh" + +static size_t we_read_fully(int fd, char *buffer, size_t len) { + size_t done = 0; + + do { + ssize_t nread = read(fd, buffer + done, len - done); + if(nread == -1 && errno == EINTR) + continue; + if(nread <= 0) + break; + done += nread; + } while (done != len); + + return done; +} + +static int we_askshell(const char *words, wordexp_t *we, int flags) { + int pdes[2]; /* pipe to child */ + char bbuf[9]; /* buffer for byte count */ + char wbuf[9]; /* buffer for word count */ + size_t nwords = 0; /* number of words from child */ + size_t nbytes = 0; /* number of bytes from child */ + size_t sofs = 0; /* offset into we->we_strings */ + size_t vofs = 0; /* offset into we->we_wordv */ + pid_t pid; /* PID of child */ + pid_t wpid; /* waitpid return value */ + int status; /* child exit status */ + int error; /* our return value */ + int serrno; /* errno to return */ + char *np, *p; /* handy pointers */ + char *nstrings; /* temporary for realloc() */ + char **new_wordv; /* temporary for realloc() */ + sigset_t newsigblock; + sigset_t oldsigblock; + const char *ifs = getenv("IFS"); + + serrno = errno; + + if(pipe2(pdes, O_CLOEXEC) < 0) + return WRDE_NOSPACE; + + (void)sigemptyset(&newsigblock); + (void)sigaddset(&newsigblock, SIGCHLD); + (void)sigprocmask(SIG_BLOCK, &newsigblock, &oldsigblock); + + if((pid = fork()) < 0) { + serrno = errno; + close(pdes[0]); + close(pdes[1]); + (void)sigprocmask(SIG_SETMASK, &oldsigblock, NULL); + errno = serrno; + return WRDE_NOSPACE; + } else if(pid == 0) { + /* + * We are the child; make /bin/sh expand `words'. + */ + (void)sigprocmask(SIG_SETMASK, &oldsigblock, NULL); + if((pdes[1] != STDOUT_FILENO ? dup2(pdes[1], STDOUT_FILENO) : fcntl(pdes[1], F_SETFD, 0)) < 0) + _exit(1); + + execl(SHELL_PATH, SHELL_NAME, flags & WRDE_UNDEF ? "-u" : "+u", + "-c", "IFS=$1;eval \"$2\";eval \"set -- $3\";IFS=;a=\"$*\";" + "printf '%08x' \"$#\" \"${#a}\";printf '%s\\0' \"$@\"", "", + ifs != NULL ? ifs : " \t\n", + flags & WRDE_SHOWERR ? "" : "exec 2>/dev/null", + words, + (char *)NULL); + _exit(1); + } + + /* + * We are the parent; read the output of the shell wordexp function, + * which is a 32-bit hexadecimal word count, a 32-bit hexadecimal + * byte count (not including terminating null bytes), followed by + * the expanded words separated by nulls. + */ + close(pdes[1]); + if(we_read_fully(pdes[0], wbuf, 8) != 8 || we_read_fully(pdes[0], bbuf, 8) != 8) { + error = flags & WRDE_UNDEF ? WRDE_BADVAL : WRDE_SYNTAX; + serrno = errno; + goto cleanup; + } + wbuf[8] = bbuf[8] = '\0'; + nwords = strtol(wbuf, NULL, 16); + nbytes = strtol(bbuf, NULL, 16) + nwords; + + /* + * Allocate or reallocate (when flags & WRDE_APPEND) the word vector + * and string storage buffers for the expanded words we're about to + * read from the child. + */ + sofs = we->we_nbytes; + vofs = we->we_wordc; + if((flags & (WRDE_DOOFFS|WRDE_APPEND)) == (WRDE_DOOFFS | WRDE_APPEND)) + vofs += we->we_offs; + we->we_wordc += nwords; + we->we_nbytes += nbytes; + + if((new_wordv = (char **) realloc(we->we_wordv, (we->we_wordc + 1 + (flags & WRDE_DOOFFS ? we->we_offs : 0)) * sizeof(char *))) == NULL) { + error = WRDE_NOSPACE; + goto cleanup; + } + + we->we_wordv = new_wordv; + + if((nstrings = (char *) realloc(we->we_strings, we->we_nbytes)) == NULL) { + error = WRDE_NOSPACE; + goto cleanup; + } + + for(size_t i = 0; i < vofs; i++) { + if(we->we_wordv[i] != NULL) + we->we_wordv[i] += nstrings - we->we_strings; + } + we->we_strings = nstrings; + + if(we_read_fully(pdes[0], we->we_strings + sofs, nbytes) != nbytes) { + error = flags & WRDE_UNDEF ? WRDE_BADVAL : WRDE_SYNTAX; + serrno = errno; + goto cleanup; + } + + error = 0; +cleanup: + close(pdes[0]); + + do { + wpid = waitpid(pid, &status, 0); + } while(wpid < 0 && errno == EINTR); + + (void)sigprocmask(SIG_SETMASK, &oldsigblock, NULL); + + if(error != 0) { + errno = serrno; + return error; + } + + if(wpid < 0 || !WIFEXITED(status) || WEXITSTATUS(status) != 0) + return flags & WRDE_UNDEF ? WRDE_BADVAL : WRDE_SYNTAX; + + /* + * Break the null-terminated expanded word strings out into + * the vector. + */ + if(vofs == 0 && flags & WRDE_DOOFFS) { + while (vofs < we->we_offs) + we->we_wordv[vofs++] = NULL; + } + + p = we->we_strings + sofs; + while (nwords-- != 0) { + we->we_wordv[vofs++] = p; + if((np = (char *) memchr(p, '\0', nbytes)) == NULL) + return WRDE_NOSPACE; + + nbytes -= np - p + 1; + p = np + 1; + } + + we->we_wordv[vofs] = NULL; + return 0; +} + +/* + * we_check -- + * Check that the string contains none of the following unquoted + * special characters: <newline> |&;<>(){} + * or command substitutions when WRDE_NOCMD is set in flags. + */ +static int we_check(const char *words, int flags) +{ + char c; + int dquote, level, quote, squote; + + quote = squote = dquote = 0; + while ((c = *words++) != '\0') { + switch (c) { + case '\\': { + if(squote == 0) + quote ^= 1; + continue; + } + case '\'': { + if(quote + dquote == 0) + squote ^= 1; + break; + } + case '"': { + if(quote + squote == 0) + dquote ^= 1; + break; + } + case '`': { + if(quote + squote == 0 && flags & WRDE_NOCMD) + return WRDE_CMDSUB; + while ((c = *words++) != '\0' && c != '`') + if(c == '\\' && (c = *words++) == '\0') + break; + if(c == '\0') + return WRDE_SYNTAX; + break; + } + case '|': + case '&': + case ';': + case '<': + case '>': + case '{': + case '}': + case '(': + case ')': + case '\n': { + if(quote + squote + dquote == 0) + return WRDE_BADCHAR; + break; + } + case '$': { + if((c = *words++) == '\0') + break; + else if(quote + squote == 0 && c == '(') { + if(flags & WRDE_NOCMD && *words != '(') + return WRDE_CMDSUB; + level = 1; + while ((c = *words++) != '\0') { + if(c == '\\') { + if((c = *words++) == '\0') + break; + } else if(c == '(') + level++; + else if(c == ')' && --level == 0) + break; + } + if(c == '\0' || level != 0) + return WRDE_SYNTAX; + } else if(quote + squote == 0 && c == '{') { + level = 1; + while ((c = *words++) != '\0') { + if(c == '\\') { + if((c = *words++) == '\0') + break; + } else if(c == '{') + level++; + else if(c == '}' && --level == 0) + break; + } + if(c == '\0' || level != 0) + return WRDE_SYNTAX; + } else + --words; + break; + } + default: { + break; + } + } + quote = 0; + } + + if(quote + squote + dquote != 0) + return WRDE_SYNTAX; + + return 0; +} + +int wordexp(const char * __restrict words, wordexp_t * __restrict we, int flags) { + int error; + + if(flags & WRDE_REUSE) + wordfree(we); + + if((flags & WRDE_APPEND) == 0) { + we->we_wordc = 0; + we->we_wordv = NULL; + we->we_strings = NULL; + we->we_nbytes = 0; + } + + if((error = we_check(words, flags)) != 0) { + wordfree(we); + return error; + } + + if((error = we_askshell(words, we, flags)) != 0) { + wordfree(we); + return error; + } + + return 0; +} + +void wordfree(wordexp_t *we) { + if (we == NULL) + return; + free(we->we_wordv); + free(we->we_strings); + we->we_wordv = NULL; + we->we_strings = NULL; + we->we_nbytes = 0; + we->we_wordc = 0; +} diff --git a/lib/mlibc/options/posix/include/arpa/inet.h b/lib/mlibc/options/posix/include/arpa/inet.h new file mode 100644 index 0000000..599987e --- /dev/null +++ b/lib/mlibc/options/posix/include/arpa/inet.h @@ -0,0 +1,46 @@ +#ifndef _ARPA_INET_H +#define _ARPA_INET_H + +#include <netinet/in.h> +#include <stdint.h> +#include <sys/socket.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +uint32_t htonl(uint32_t); +uint16_t htons(uint16_t); +uint32_t ntohl(uint32_t); +uint16_t ntohs(uint16_t); + +// ---------------------------------------------------------------------------- +// IPv4 address manipulation. +// ---------------------------------------------------------------------------- + +in_addr_t inet_addr(const char *); +char *inet_ntoa(struct in_addr); + +// GLIBC replacement for inet_addr(). +int inet_aton(const char *, struct in_addr *); + +// ---------------------------------------------------------------------------- +// Generic IP address manipulation. +// ---------------------------------------------------------------------------- +const char *inet_ntop(int, const void *__restrict, char *__restrict, + socklen_t) __attribute__((__nonnull__(3))); +int inet_pton(int, const char *__restrict, void *__restrict); + +struct in_addr inet_makeaddr(in_addr_t net, in_addr_t host); +in_addr_t inet_netof(struct in_addr in); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _ARPA_INET_H + diff --git a/lib/mlibc/options/posix/include/bits/posix/fd_set.h b/lib/mlibc/options/posix/include/bits/posix/fd_set.h new file mode 100644 index 0000000..554738e --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/fd_set.h @@ -0,0 +1,14 @@ +#ifndef MLIBC_FD_SET_H +#define MLIBC_FD_SET_H + +#include <bits/types.h> + +typedef struct { + union { + __mlibc_uint8 __mlibc_elems[128]; + // Some programs require the fds_bits field to be present + __mlibc_uint8 fds_bits[128]; + }; +} fd_set; + +#endif // MLIBC_FD_SET_H diff --git a/lib/mlibc/options/posix/include/bits/posix/id_t.h b/lib/mlibc/options/posix/include/bits/posix/id_t.h new file mode 100644 index 0000000..f222bc1 --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/id_t.h @@ -0,0 +1,6 @@ +#ifndef _MLIBC_ID_T_H +#define _MLIBC_ID_T_H + +typedef unsigned int id_t; + +#endif // _MLIBC_ID_T_H diff --git a/lib/mlibc/options/posix/include/bits/posix/in_addr_t.h b/lib/mlibc/options/posix/include/bits/posix/in_addr_t.h new file mode 100644 index 0000000..bac9ff2 --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/in_addr_t.h @@ -0,0 +1,8 @@ +#ifndef MLIBC_IN_ADDR_H +#define MLIBC_IN_ADDR_H + +#include <stdint.h> + +typedef uint32_t in_addr_t; + +#endif // MLIBC_IN_ADDR_H diff --git a/lib/mlibc/options/posix/include/bits/posix/in_port_t.h b/lib/mlibc/options/posix/include/bits/posix/in_port_t.h new file mode 100644 index 0000000..0368159 --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/in_port_t.h @@ -0,0 +1,8 @@ +#ifndef MLIBC_IN_PORT_H +#define MLIBC_IN_PORT_H + +#include <stdint.h> + +typedef uint16_t in_port_t; + +#endif // MLIBC_IN_PORT_H diff --git a/lib/mlibc/options/posix/include/bits/posix/iovec.h b/lib/mlibc/options/posix/include/bits/posix/iovec.h new file mode 100644 index 0000000..c004f1c --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/iovec.h @@ -0,0 +1,11 @@ +#ifndef MLIBC_IOVEC_H +#define MLIBC_IOVEC_H + +#include <bits/types.h> + +struct iovec { + void *iov_base; + __mlibc_size iov_len; +}; + +#endif // MLIBC_IOVEC_H diff --git a/lib/mlibc/options/posix/include/bits/posix/locale_t.h b/lib/mlibc/options/posix/include/bits/posix/locale_t.h new file mode 100644 index 0000000..c128d58 --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/locale_t.h @@ -0,0 +1,14 @@ +#ifndef _LOCALE_T_H +#define _LOCALE_T_H + +#ifdef __cplusplus +extern "C" { +#endif + +typedef void *locale_t; + +#ifdef __cplusplus +} +#endif + +#endif // _LOCALE_T_H diff --git a/lib/mlibc/options/posix/include/bits/posix/posix_ctype.h b/lib/mlibc/options/posix/include/bits/posix/posix_ctype.h new file mode 100644 index 0000000..2b11057 --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/posix_ctype.h @@ -0,0 +1,36 @@ +#ifndef _POSIX_CTYPE_H +#define _POSIX_CTYPE_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/posix/locale_t.h> + +#ifndef __MLIBC_ABI_ONLY + +int isalnum_l(int c, locale_t loc); +int isalpha_l(int c, locale_t loc); +int isblank_l(int c, locale_t loc); +int iscntrl_l(int c, locale_t loc); +int isdigit_l(int c, locale_t loc); +int isgraph_l(int c, locale_t loc); +int islower_l(int c, locale_t loc); +int isprint_l(int c, locale_t loc); +int ispunct_l(int c, locale_t loc); +int isspace_l(int c, locale_t loc); +int isupper_l(int c, locale_t loc); +int isxdigit_l(int c, locale_t loc); + +int isascii_l(int c, locale_t loc); + +int tolower_l(int c, locale_t loc); +int toupper_l(int c, locale_t loc); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _POSIX_CTYPE_H diff --git a/lib/mlibc/options/posix/include/bits/posix/posix_locale.h b/lib/mlibc/options/posix/include/bits/posix/posix_locale.h new file mode 100644 index 0000000..7554bc5 --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/posix_locale.h @@ -0,0 +1,23 @@ +#ifndef MLIBC_POSIX_LOCALE_H +#define MLIBC_POSIX_LOCALE_H + +#include <bits/posix/locale_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +locale_t newlocale(int category_mask, const char *locale, locale_t base); +void freelocale(locale_t locobj); +locale_t uselocale(locale_t locobj); +locale_t duplocale(locale_t locobj); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // MLIBC_POSIX_LOCALE_H diff --git a/lib/mlibc/options/posix/include/bits/posix/posix_signal.h b/lib/mlibc/options/posix/include/bits/posix/posix_signal.h new file mode 100644 index 0000000..20f030f --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/posix_signal.h @@ -0,0 +1,111 @@ + +#ifndef MLIBC_POSIX_SIGNAL_H +#define MLIBC_POSIX_SIGNAL_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/ansi/time_t.h> +#include <bits/ansi/timespec.h> +#include <bits/posix/pthread_t.h> +#include <bits/sigset_t.h> +#include <stddef.h> +#include <stdint.h> +#include <mlibc-config.h> + +#define FPE_INTDIV 1 /* integer divide by zero */ +#define FPE_INTOVF 2 /* integer overflow */ +#define FPE_FLTDIV 3 /* floating point divide by zero */ +#define FPE_FLTOVF 4 /* floating point overflow */ +#define FPE_FLTUND 5 /* floating point underflow */ +#define FPE_FLTRES 6 /* floating point inexact result */ +#define FPE_FLTINV 7 /* floating point invalid operation */ +#define FPE_FLTSUB 8 /* subscript out of range */ + +#define TRAP_BRKPT 1 /* process breakpoint */ +#define TRAP_TRACE 2 /* process trace trap */ + +// Start Glibc stuff + +struct _libc_fpxreg { + unsigned short int significand[4]; + unsigned short int exponent; + unsigned short int __glibc_reserved1[3]; +}; + +struct _libc_xmmreg { + uint32_t element[4]; +}; + +struct _libc_fpstate { + uint16_t cwd; + int16_t swd; + uint16_t ftw; + uint16_t fop; + uint64_t rip; + uint64_t dp; + uint32_t mxcsr; + uint32_t mxcr_mask; + struct _libc_fpxreg _st[8]; + struct _libc_xmmreg _xmm[16]; + uint32_t __glibc_reserved1[24]; +}; + +typedef struct _libc_fpstate *fpregset_t; +// End Glibc stuff + +typedef unsigned long int greg_t; + +#define FPE_INTDIV 1 /* integer divide by zero */ +#define FPE_INTOVF 2 /* integer overflow */ +#define FPE_FLTDIV 3 /* floating point divide by zero */ +#define FPE_FLTOVF 4 /* floating point overflow */ +#define FPE_FLTUND 5 /* floating point underflow */ +#define FPE_FLTRES 6 /* floating point inexact result */ +#define FPE_FLTINV 7 /* floating point invalid operation */ +#define FPE_FLTSUB 8 /* subscript out of range */ + +#define TRAP_BRKPT 1 /* process breakpoint */ +#define TRAP_TRACE 2 /* process trace trap */ + +#ifndef __MLIBC_ABI_ONLY + +// functions to block / wait for signals +int sigsuspend(const sigset_t *); +int sigprocmask(int, const sigset_t *__restrict, sigset_t *__restrict); + +int pthread_sigmask(int, const sigset_t *__restrict, sigset_t *__restrict); +int pthread_kill(pthread_t, int); + +// functions to handle signals +int sigaction(int, const struct sigaction *__restrict, struct sigaction *__restrict); +int sigpending(sigset_t *); + +int siginterrupt(int sig, int flag); + +int sigaltstack(const stack_t *__restrict ss, stack_t *__restrict oss); + +// functions to raise signals +int kill(pid_t, int); +int killpg(int, int); + +int sigtimedwait(const sigset_t *__restrict set, siginfo_t *__restrict info, const struct timespec *__restrict timeout); +int sigwait(const sigset_t *__restrict set, int *__restrict sig); +int sigwaitinfo(const sigset_t *__restrict set, siginfo_t *__restrict info); + +// Glibc extension +#if __MLIBC_GLIBC_OPTION +int sigisemptyset(const sigset_t *set); +#endif // __MLIBC_GLIBC_OPTION + +int sigqueue(pid_t pid, int sig, const union sigval value); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // MLIBC_POSIX_SIGNAL_H + diff --git a/lib/mlibc/options/posix/include/bits/posix/posix_stdio.h b/lib/mlibc/options/posix/include/bits/posix/posix_stdio.h new file mode 100644 index 0000000..4572a04 --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/posix_stdio.h @@ -0,0 +1,72 @@ + +#ifndef MLIBC_POSIX_STDIO_H +#define MLIBC_POSIX_STDIO_H + +#include <bits/off_t.h> +#include <bits/size_t.h> +#include <bits/ssize_t.h> + +// MISSING: var_list + +#ifdef __cplusplus +extern "C" { +#endif + +#define P_tmpdir "/tmp" + +#ifndef __MLIBC_ABI_ONLY + +typedef struct __mlibc_file_base FILE; + +int fileno(FILE *file); +FILE *fdopen(int fd, const char *mode); + +FILE *fmemopen(void *__restrict, size_t, const char *__restrict); +int pclose(FILE *); +FILE *popen(const char*, const char *); +FILE *open_memstream(char **, size_t *); + +int fseeko(FILE *stream, off_t offset, int whence); +off_t ftello(FILE *stream); + +int dprintf(int fd, const char *format, ...); +int vdprintf(int fd, const char *format, __builtin_va_list args); + +char *fgetln(FILE *, size_t *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#define RENAME_EXCHANGE (1 << 1) + +// GNU extensions +typedef ssize_t (cookie_read_function_t)(void *, char *, size_t); +typedef ssize_t (cookie_write_function_t)(void *, const char *, size_t); +typedef int (cookie_seek_function_t)(void *, off_t *, int); +typedef int (cookie_close_function_t)(void *); + +typedef struct _IO_cookie_io_functions_t { + cookie_read_function_t *read; + cookie_write_function_t *write; + cookie_seek_function_t *seek; + cookie_close_function_t *close; +} cookie_io_functions_t; + +#ifndef __MLIBC_ABI_ONLY + +#if defined(_GNU_SOURCE) + +FILE *fopencookie(void *__restrict cookie, const char *__restrict mode, cookie_io_functions_t io_funcs); + +#endif // defined(_GNU_SOURCE) + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +// MISSING: various functions and macros + +#endif /* MLIBC_POSIX_STDIO_H */ + + diff --git a/lib/mlibc/options/posix/include/bits/posix/posix_stdlib.h b/lib/mlibc/options/posix/include/bits/posix/posix_stdlib.h new file mode 100644 index 0000000..5248fca --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/posix_stdlib.h @@ -0,0 +1,73 @@ + +#ifndef MLIBC_POSIX_STDLIB_H +#define MLIBC_POSIX_STDLIB_H + +#include <bits/posix/locale_t.h> +#include <bits/size_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +long random(void); +double drand48(void); +void srand48(long int); +char *initstate(unsigned int, char *, size_t); +char *setstate(char *); +void srandom(unsigned int); + +// ---------------------------------------------------------------------------- +// Environment. +// ---------------------------------------------------------------------------- + +int putenv(char *); +int setenv(const char *, const char *, int); +int unsetenv(const char *); + +// ---------------------------------------------------------------------------- +// Path handling. +// ---------------------------------------------------------------------------- + +int mkstemp(char *); +int mkstemps(char *pattern, int suffixlen); +int mkostemp(char *, int flags); +int mkostemps(char *pattern, int suffixlen, int flags); +char *mkdtemp(char *path); + +char *realpath(const char *__restrict, char *__restrict); + +// ---------------------------------------------------------------------------- +// Pseudoterminals +// ---------------------------------------------------------------------------- + +int posix_openpt(int flags); +int grantpt(int fd); +int unlockpt(int fd); +char *ptsname(int fd); +int ptsname_r(int fd, char *buf, size_t len); + +double strtod_l(const char *__restrict__ nptr, char ** __restrict__ endptr, locale_t loc); +long double strtold_l(const char *__restrict__ nptr, char ** __restrict__ endptr, locale_t loc); +float strtof_l(const char *__restrict string, char **__restrict end, locale_t loc); + +int getloadavg(double *, int); + +// GNU extension +char *secure_getenv(const char *); +char *canonicalize_file_name(const char *); + +// BSD extension +void *reallocarray(void *, size_t, size_t); + +int clearenv(void); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // MLIBC_POSIX_STDLIB_H + diff --git a/lib/mlibc/options/posix/include/bits/posix/posix_string.h b/lib/mlibc/options/posix/include/bits/posix/posix_string.h new file mode 100644 index 0000000..1f61942 --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/posix_string.h @@ -0,0 +1,57 @@ + +#ifndef MLIBC_POSIX_STRING_H +#define MLIBC_POSIX_STRING_H + +#include <alloca.h> +#include <bits/posix/locale_t.h> +#include <bits/size_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +char *strdup(const char *string); +char *strndup(const char *, size_t); +size_t strnlen(const char *, size_t); +char *strtok_r(char *__restrict, const char *__restrict, char **__restrict); +char *strsep(char **stringp, const char *delim); +char *strsignal(int sig); +char *stpcpy(char *__restrict, const char *__restrict); +char *stpncpy(char *__restrict, const char *__restrict, size_t n); +void *memccpy(void *__restrict dest, const void *__restrict src, int c, size_t n); + +int strcoll_l(const char *s1, const char *s2, locale_t locale); + +// GNU extensions. +#if defined(_GNU_SOURCE) +char *strcasestr(const char *, const char *); +#define strdupa(x) ({ \ + const char *str = (x); \ + size_t len = strlen(str) + 1; \ + char *buf = alloca(len); \ + (char *) memcpy(buf, str, len); \ +}) +#define strndupa(x, y) ({ \ + const char *str = (x); \ + size_t len = strnlen(str, (y)) + 1; \ + char *buf = alloca(len); \ + buf[len - 1] = '\0'; \ + (char *) memcpy(buf, str, len - 1); \ +}) +void *memrchr(const void *, int, size_t); +#endif /* defined(_GNU_SOURCE) */ + +// BSD extensions +size_t strlcpy(char *d, const char *s, size_t n); +size_t strlcat(char *d, const char *s, size_t n); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // MLIBC_POSIX_STRING_H + diff --git a/lib/mlibc/options/posix/include/bits/posix/posix_time.h b/lib/mlibc/options/posix/include/bits/posix/posix_time.h new file mode 100644 index 0000000..d3e8e1d --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/posix_time.h @@ -0,0 +1,25 @@ +#ifndef MLIBC_POSIX_TIME_H +#define MLIBC_POSIX_TIME_H + +#include <bits/posix/timeval.h> + +#define TIMER_ABSTIME 1 + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int utimes(const char *, const struct timeval[2]); + +// Not standardized, Linux and BSDs have it +int futimes(int, const struct timeval[2]); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // MLIBC_POSIX_TIME_H diff --git a/lib/mlibc/options/posix/include/bits/posix/posix_wctype.h b/lib/mlibc/options/posix/include/bits/posix/posix_wctype.h new file mode 100644 index 0000000..4d2887c --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/posix_wctype.h @@ -0,0 +1,44 @@ +#ifndef _POSIX_WCTYPE_H +#define _POSIX_WCTYPE_H + +#include <bits/posix/locale_t.h> +#include <bits/wint_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +typedef unsigned long wctype_t; +typedef unsigned long wctrans_t; + +int iswalnum_l(wint_t, locale_t); +int iswblank_l(wint_t, locale_t); +int iswcntrl_l(wint_t, locale_t); +int iswdigit_l(wint_t, locale_t); +int iswgraph_l(wint_t, locale_t); +int iswlower_l(wint_t, locale_t); +int iswprint_l(wint_t, locale_t); +int iswpunct_l(wint_t, locale_t); +int iswspace_l(wint_t, locale_t); +int iswupper_l(wint_t, locale_t); +int iswxdigit_l(wint_t, locale_t); +int iswalpha_l(wint_t, locale_t); + +wctype_t wctype_l(const char *); +int iswctype_l(wint_t, wctype_t); + +wint_t towlower_l(wint_t, locale_t); +wint_t towupper_l(wint_t, locale_t); + +wctrans_t wctrans_l(const char *, locale_t); +wint_t towctrans_l(wint_t, wctrans_t, locale_t); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _POSIX_WCTYPE_H diff --git a/lib/mlibc/options/posix/include/bits/posix/pthread_t.h b/lib/mlibc/options/posix/include/bits/posix/pthread_t.h new file mode 100644 index 0000000..1310c40 --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/pthread_t.h @@ -0,0 +1,8 @@ +#ifndef _MLIBC_BITS_PTHREAD_T_HPP +#define _MLIBC_BITS_PTHREAD_T_HPP + +#include <bits/threads.h> + +typedef struct __mlibc_thread_data *pthread_t; + +#endif // _MLIBC_BITS_PTHREAD_T_HPP diff --git a/lib/mlibc/options/posix/include/bits/posix/stat.h b/lib/mlibc/options/posix/include/bits/posix/stat.h new file mode 100644 index 0000000..4dd081d --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/stat.h @@ -0,0 +1,24 @@ +#ifndef MLIBC_STAT_H +#define MLIBC_STAT_H + +#include <abi-bits/stat.h> + +// Used by utimensat and friends +#define UTIME_NOW ((1l << 30) - 1l) +#define UTIME_OMIT ((1l << 30) - 2l) + +#define S_ISBLK(m) (((m) & S_IFMT) == S_IFBLK) +#define S_ISCHR(m) (((m) & S_IFMT) == S_IFCHR) +#define S_ISFIFO(m) (((m) & S_IFMT) == S_IFIFO) +#define S_ISREG(m) (((m) & S_IFMT) == S_IFREG) +#define S_ISDIR(m) (((m) & S_IFMT) == S_IFDIR) +#define S_ISLNK(m) (((m) & S_IFMT) == S_IFLNK) +#define S_ISSOCK(m) (((m) & S_IFMT) == S_IFSOCK) + +// POSIX compatibility macros +#define st_atime st_atim.tv_sec +#define st_mtime st_mtim.tv_sec +#define st_ctime st_ctim.tv_sec + +#endif // MLIBC_STAT_H + diff --git a/lib/mlibc/options/posix/include/bits/posix/timer_t.h b/lib/mlibc/options/posix/include/bits/posix/timer_t.h new file mode 100644 index 0000000..b230501 --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/timer_t.h @@ -0,0 +1,6 @@ +#ifndef _MLIBC_TIMER_T_H +#define _MLIBC_TIMER_T_H + +typedef void * timer_t; + +#endif // _MLIBC_TIMER_T_H diff --git a/lib/mlibc/options/posix/include/bits/posix/timeval.h b/lib/mlibc/options/posix/include/bits/posix/timeval.h new file mode 100644 index 0000000..445ee7f --- /dev/null +++ b/lib/mlibc/options/posix/include/bits/posix/timeval.h @@ -0,0 +1,12 @@ +#ifndef MLIBC_TIMEVAL_H +#define MLIBC_TIMEVAL_H + +#include <bits/ansi/time_t.h> +#include <abi-bits/suseconds_t.h> + +struct timeval { + time_t tv_sec; + suseconds_t tv_usec; +}; + +#endif // MLIBC_TIMEVAL_H diff --git a/lib/mlibc/options/posix/include/byteswap.h b/lib/mlibc/options/posix/include/byteswap.h new file mode 100644 index 0000000..74b9fe2 --- /dev/null +++ b/lib/mlibc/options/posix/include/byteswap.h @@ -0,0 +1,23 @@ + +#ifndef _BYTESWAP_H +#define _BYTESWAP_H + +#ifdef __cplusplus +extern "C" { +#endif + +#define bswap_16(x) __builtin_bswap16(x) +#define bswap_32(x) __builtin_bswap32(x) +#define bswap_64(x) __builtin_bswap64(x) + +// Some programs like eudev call these functions instead +#define __bswap_16(x) __builtin_bswap16(x) +#define __bswap_32(x) __builtin_bswap32(x) +#define __bswap_64(x) __builtin_bswap64(x) + +#ifdef __cplusplus +} +#endif + +#endif // _BYTESWAP_H + diff --git a/lib/mlibc/options/posix/include/dirent.h b/lib/mlibc/options/posix/include/dirent.h new file mode 100644 index 0000000..b50566d --- /dev/null +++ b/lib/mlibc/options/posix/include/dirent.h @@ -0,0 +1,76 @@ + +#ifndef _DIRENT_H +#define _DIRENT_H + +#include <abi-bits/ino_t.h> +#include <bits/off_t.h> +#include <bits/types.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#define DT_UNKNOWN 0 +#define DT_FIFO 1 +#define DT_CHR 2 +#define DT_DIR 4 +#define DT_BLK 6 +#define DT_REG 8 +#define DT_LNK 10 +#define DT_SOCK 12 +#define DT_WHT 14 + +#define __MLIBC_DIRENT_BODY ino_t d_ino; \ + off_t d_off; \ + unsigned short d_reclen; \ + unsigned char d_type; \ + char d_name[1024]; + +struct dirent { + __MLIBC_DIRENT_BODY +}; + +struct dirent64 { + __MLIBC_DIRENT_BODY +}; + +#define d_fileno d_ino + +#undef __MLIBC_DIRENT_BODY + +#define IFTODT(mode) (((mode) & 0170000) >> 12) + +struct __mlibc_dir_struct { + int __handle; + __mlibc_size __ent_next; + __mlibc_size __ent_limit; + char __ent_buffer[2048]; + struct dirent __current; +}; + +typedef struct __mlibc_dir_struct DIR; + +#ifndef __MLIBC_ABI_ONLY + +int alphasort(const struct dirent **, const struct dirent **); +int closedir(DIR *); +int dirfd(DIR *); +DIR *fdopendir(int); +DIR *opendir(const char *); +struct dirent *readdir(DIR *); +int readdir_r(DIR *__restrict, struct dirent *__restrict, struct dirent **__restrict); +void rewinddir(DIR *); +int scandir(const char *, struct dirent ***, int (*)(const struct dirent *), + int (*)(const struct dirent **, const struct dirent **)); +void seekdir(DIR *, long); +long telldir(DIR *); +int versionsort(const struct dirent **, const struct dirent **); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _DIRENT_H + diff --git a/lib/mlibc/options/posix/include/dlfcn.h b/lib/mlibc/options/posix/include/dlfcn.h new file mode 100644 index 0000000..3bb8a02 --- /dev/null +++ b/lib/mlibc/options/posix/include/dlfcn.h @@ -0,0 +1,52 @@ + +#ifndef _DLFCN_H +#define _DLFCN_H + +#define RTLD_LOCAL 0 +#define RTLD_NOW 1 +#define RTLD_GLOBAL 2 +#define RTLD_NOLOAD 4 +#define RTLD_NODELETE 8 +#define RTLD_DEEPBIND 16 +#define RTLD_LAZY 32 + +#define RTLD_NEXT ((void *)-1) +#define RTLD_DEFAULT ((void *)0) + +#define RTLD_DI_LINKMAP 2 + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int dlclose(void *); +char *dlerror(void); +void *dlopen(const char *, int); +void *dlsym(void *__restrict, const char *__restrict); +void *dlvsym(void *__restrict, const char *__restrict, const char *__restrict); + +#endif /* !__MLIBC_ABI_ONLY */ + +//gnu extension +typedef struct { + const char *dli_fname; + void *dli_fbase; + const char *dli_sname; + void *dli_saddr; +} Dl_info; + +#ifndef __MLIBC_ABI_ONLY + +int dladdr(const void *, Dl_info *); +int dlinfo(void *, int, void *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _DLFCN_H + diff --git a/lib/mlibc/options/posix/include/fcntl.h b/lib/mlibc/options/posix/include/fcntl.h new file mode 100644 index 0000000..9983219 --- /dev/null +++ b/lib/mlibc/options/posix/include/fcntl.h @@ -0,0 +1,76 @@ + +#ifndef _FCNTL_H +#define _FCNTL_H + +#include <abi-bits/fcntl.h> +#include <abi-bits/seek-whence.h> +#include <abi-bits/mode_t.h> +#include <abi-bits/pid_t.h> +#include <bits/posix/iovec.h> +#include <bits/off_t.h> +#include <bits/ssize_t.h> +#include <bits/size_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#define O_NDELAY O_NONBLOCK + +struct flock { + short l_type; + short l_whence; + off_t l_start; + off_t l_len; + pid_t l_pid; +}; + +#ifndef __MLIBC_ABI_ONLY + +int creat(const char *, mode_t); +int fallocate(int fd, int mode, off_t offset, off_t len); +int fcntl(int fd, int command, ...); +int open(const char *path, int flags, ...); +int openat(int, const char *, int, ...); +int posix_fadvise(int, off_t, off_t, int); +int posix_fallocate(int, off_t, off_t); + +#endif /* !__MLIBC_ABI_ONLY */ + +// This is a linux extension + +struct file_handle { + unsigned int handle_bytes; + int handle_type; + unsigned char f_handle[0]; +}; + +#ifndef __MLIBC_ABI_ONLY + +int name_to_handle_at(int, const char *, struct file_handle *, int *, int); +int open_by_handle_at(int, struct file_handle *, int); + +ssize_t splice(int fd_in, off_t *off_in, int fd_out, off_t *off_out, size_t len, unsigned int flags); +ssize_t vmsplice(int fd, const struct iovec *iov, size_t nr_segs, unsigned int flags); + +#endif /* !__MLIBC_ABI_ONLY */ + +#define SPLICE_F_MOVE 1 +#define SPLICE_F_NONBLOCK 2 +#define SPLICE_F_MORE 4 +#define SPLICE_F_GIFT 8 + +#define AT_NO_AUTOMOUNT 0x800 + +#define F_SETPIPE_SZ 1031 +#define F_GETPIPE_SZ 1032 + +#define FALLOC_FL_KEEP_SIZE 1 +#define FALLOC_FL_PUNCH_HOLE 2 + +#ifdef __cplusplus +} +#endif + +#endif // _FCNTL_H + diff --git a/lib/mlibc/options/posix/include/fnmatch.h b/lib/mlibc/options/posix/include/fnmatch.h new file mode 100644 index 0000000..3eccbd0 --- /dev/null +++ b/lib/mlibc/options/posix/include/fnmatch.h @@ -0,0 +1,33 @@ + +#ifndef _FNMATCH_H +#define _FNMATCH_H + +#ifdef __cplusplus +extern "C" { +#endif + +// POSIX-defined fnmatch() flags. +#define FNM_PATHNAME 0x1 +#define FNM_NOESCAPE 0x2 +#define FNM_PERIOD 0x4 + +// GNU extensions for fnmatch() flags. +#define FNM_LEADING_DIR 0x8 +#define FNM_CASEFOLD 0x10 +#define FNM_EXTMATCH 0x20 + +// fnmatch() return values. +#define FNM_NOMATCH 1 + +#ifndef __MLIBC_ABI_ONLY + +int fnmatch(const char *, const char *, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _FNMATCH_H + diff --git a/lib/mlibc/options/posix/include/ftw.h b/lib/mlibc/options/posix/include/ftw.h new file mode 100644 index 0000000..bde283d --- /dev/null +++ b/lib/mlibc/options/posix/include/ftw.h @@ -0,0 +1,43 @@ + +#ifndef _FTW_H +#define _FTW_H + +#include <bits/posix/stat.h> + +#define FTW_F 1 +#define FTW_D 2 +#define FTW_DNR 3 +#define FTW_DP 4 +#define FTW_NS 5 +#define FTW_SL 6 +#define FTW_SLN 7 + +#define FTW_PHYS 1 +#define FTW_MOUNT 2 +#define FTW_DEPTH 4 +#define FTW_CHDIR 8 + +#define FTW_CONTINUE 0 + +#ifdef __cplusplus +extern "C" { +#endif + +struct FTW { + int base; + int level; +}; + +#ifndef __MLIBC_ABI_ONLY + +int ftw(const char *, int (*)(const char *, const struct stat *, int), int); +int nftw(const char *, int (*)(const char *, const struct stat *, int, struct FTW *), int, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _FTW_H + diff --git a/lib/mlibc/options/posix/include/glob.h b/lib/mlibc/options/posix/include/glob.h new file mode 100644 index 0000000..2bf9e48 --- /dev/null +++ b/lib/mlibc/options/posix/include/glob.h @@ -0,0 +1,58 @@ + +#ifndef _GLOB_H +#define _GLOB_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/size_t.h> + +#define GLOB_APPEND 0x01 +#define GLOB_DOOFFS 0x02 +#define GLOB_ERR 0x04 +#define GLOB_MARK 0x08 +#define GLOB_NOCHECK 0x10 +#define GLOB_NOESCAPE 0x20 +#define GLOB_NOSORT 0x40 +#define GLOB_PERIOD 0x80 +#define GLOB_TILDE 0x100 +#define GLOB_TILDE_CHECK 0x200 +#define GLOB_BRACE 0x400 +#define GLOB_NOMAGIC 0x800 +#define GLOB_ALTDIRFUNC 0x1000 +#define GLOB_ONLYDIR 0x2000 +#define GLOB_MAGCHAR 0x4000 + +#define GLOB_ABORTED 1 +#define GLOB_NOMATCH 2 +#define GLOB_NOSPACE 3 +#define GLOB_NOSYS 4 + +struct stat; +typedef struct glob_t { + size_t gl_pathc; + char **gl_pathv; + size_t gl_offs; + int gl_flags; + void (*gl_closedir) (void *); + struct dirent *(*gl_readdir) (void *); + void *(*gl_opendir) (const char *); + int (*gl_lstat) (const char *__restrict, struct stat *__restrict); + int (*gl_stat) (const char *__restrict, struct stat *__restrict); +} glob_t; + +#ifndef __MLIBC_ABI_ONLY + +int glob(const char *__restirct, int, int(*)(const char *, int), struct glob_t *__restrict); +void globfree(struct glob_t *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _GLOB_H + + diff --git a/lib/mlibc/options/posix/include/grp.h b/lib/mlibc/options/posix/include/grp.h new file mode 100644 index 0000000..a50396e --- /dev/null +++ b/lib/mlibc/options/posix/include/grp.h @@ -0,0 +1,43 @@ +#ifndef _GRP_H +#define _GRP_H + +#include <stddef.h> +#include <stdio.h> +#include <abi-bits/gid_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +struct group { + char *gr_name; + char *gr_passwd; + gid_t gr_gid; + char **gr_mem; +}; + +#ifndef __MLIBC_ABI_ONLY + +void endgrent(void); +struct group *getgrent(void); +struct group *getgrgid(gid_t); +int getgrgid_r(gid_t, struct group *, char *, size_t, struct group **); +struct group *getgrnam(const char *); +int getgrnam_r(const char *, struct group *, char *, size_t, struct group **); +void setgrent(void); +int putgrent(const struct group *, FILE *); +struct group *fgetgrent(FILE *); + +int setgroups(size_t size, const gid_t *list); +int initgroups(const char *user, gid_t group); + +// Non standard extension +int getgrouplist(const char *, gid_t, gid_t *, int *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _GRP_H diff --git a/lib/mlibc/options/posix/include/langinfo.h b/lib/mlibc/options/posix/include/langinfo.h new file mode 100644 index 0000000..5436a54 --- /dev/null +++ b/lib/mlibc/options/posix/include/langinfo.h @@ -0,0 +1,24 @@ + +#ifndef _LANGINFO_H +#define _LANGINFO_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/posix/locale_t.h> +#include <bits/nl_item.h> + +#ifndef __MLIBC_ABI_ONLY + +char *nl_langinfo(nl_item); +char *nl_langinfo_l(nl_item, locale_t); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _LANGINFO_H + diff --git a/lib/mlibc/options/posix/include/libgen.h b/lib/mlibc/options/posix/include/libgen.h new file mode 100644 index 0000000..fa53fc5 --- /dev/null +++ b/lib/mlibc/options/posix/include/libgen.h @@ -0,0 +1,28 @@ + +#ifndef _LIBGEN_H +#define _LIBGEN_H + +#ifdef __cplusplus +extern "C" { +#endif + +#if defined(basename) && defined(_GNU_SOURCE) +/* see: ./options/ansi/include/string.h, search for __mlibc_gnu_basename */ +# undef basename +#endif + +#ifndef __MLIBC_ABI_ONLY + +char *basename(char *); +#define basename basename +char *dirname(char *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _LIBGEN_H + + diff --git a/lib/mlibc/options/posix/include/mlibc/lookup.hpp b/lib/mlibc/options/posix/include/mlibc/lookup.hpp new file mode 100644 index 0000000..71f84e7 --- /dev/null +++ b/lib/mlibc/options/posix/include/mlibc/lookup.hpp @@ -0,0 +1,58 @@ +#ifndef _MLIBC_LOOKUP +#define _MLIBC_LOOKUP + +#include <stdint.h> +#include <netinet/in.h> +#include <netdb.h> +#include <frg/string.hpp> +#include <frg/vector.hpp> +#include <frg/span.hpp> +#include <frg/array.hpp> +#include <mlibc/allocator.hpp> + +namespace mlibc { + +struct dns_addr_buf { + dns_addr_buf() + : name(getAllocator()) {} + frg::string<MemoryAllocator> name; + int family; + uint8_t addr[16]; +}; + +struct lookup_result { + lookup_result() + : buf(getAllocator()), aliases(getAllocator()) {} + frg::vector<struct dns_addr_buf, MemoryAllocator> buf; + frg::vector<frg::string<MemoryAllocator>, MemoryAllocator> aliases; +}; + +struct dns_header { + uint16_t identification; + uint16_t flags; + uint16_t no_q; + uint16_t no_ans; + uint16_t no_auths; + uint16_t no_additional; +}; + +struct ai_buf { + struct addrinfo ai; + union sa { + struct sockaddr_in sin; + struct sockaddr_in6 sin6; + } sa; +}; + +int lookup_name_dns(struct lookup_result &buf, const char *name, + frg::string<MemoryAllocator> &canon_name); +int lookup_addr_dns(frg::span<char> name, frg::array<uint8_t, 16> &addr, int family); +int lookup_name_hosts(struct lookup_result &buf, const char *name, + frg::string<MemoryAllocator> &canon_name); +int lookup_addr_hosts(frg::span<char> name, frg::array<uint8_t, 16> &addr, int family); +int lookup_name_null(struct lookup_result &buf, int flags, int family); +int lookup_name_ip(struct lookup_result &buf, const char *name, int family); + +} // namespace mlibc + +#endif // _MLIBC_LOOKUP diff --git a/lib/mlibc/options/posix/include/mlibc/posix-file-io.hpp b/lib/mlibc/options/posix/include/mlibc/posix-file-io.hpp new file mode 100644 index 0000000..ac316ac --- /dev/null +++ b/lib/mlibc/options/posix/include/mlibc/posix-file-io.hpp @@ -0,0 +1,102 @@ +#ifndef MLIBC_POSIX_FILE_IO_HPP +#define MLIBC_POSIX_FILE_IO_HPP + +#include <frg/span.hpp> +#include <frg/vector.hpp> +#include <mlibc/file-io.hpp> +#include <mlibc/allocator.hpp> + +namespace mlibc { + +struct mem_file : abstract_file { + mem_file(int flags, void (*do_dispose)(abstract_file *) = nullptr) : abstract_file{do_dispose}, _flags{flags} { }; + + int reopen(const char *path, const char *mode) override; +protected: + int determine_type(stream_type *type) override; + int determine_bufmode(buffer_mode *mode) override; + + virtual frg::span<char> _buffer() = 0; + virtual size_t _buffer_size() const = 0; + + off_t _pos = 0; + int _flags = 0; + // maintains the size of buffer contents as required by POSIX + off_t _max_size = 0; +}; + +struct memstream_mem_file final : public mem_file { + memstream_mem_file(char **ptr, size_t *sizeloc, int flags, void (*do_dispose)(abstract_file *) = nullptr); + + int close() override; + + int io_read(char *buffer, size_t max_size, size_t *actual_size) override; + int io_write(const char *buffer, size_t max_size, size_t *actual_size) override; + int io_seek(off_t offset, int whence, off_t *new_offset) override; + + frg::span<char> _buffer() override { + return {_buf.data(), _buffer_size()}; + } + + size_t _buffer_size() const override { + return _buf.size(); + } + +private: + void _update_ptrs(); + + // Where to write back buffer and size on flush and close. + char **_bufloc; + size_t *_sizeloc; + + frg::vector<char, MemoryAllocator> _buf = {getAllocator()}; +}; + +struct fmemopen_mem_file final : public mem_file { + fmemopen_mem_file(void *in_buf, size_t size, int flags, void (*do_dispose)(abstract_file *) = nullptr); + + int close() override; + + int io_read(char *buffer, size_t max_size, size_t *actual_size) override; + int io_write(const char *buffer, size_t max_size, size_t *actual_size) override; + int io_seek(off_t offset, int whence, off_t *new_offset) override; + + frg::span<char> _buffer() override { + return {reinterpret_cast<char *>(_inBuffer), _buffer_size()}; + } + + size_t _buffer_size() const override { + return _inBufferSize; + } + +private: + void *_inBuffer; + size_t _inBufferSize; + + bool _needsDeallocation = false; +}; + +struct cookie_file : abstract_file { + cookie_file(void *cookie, int flags, cookie_io_functions_t funcs, void (*do_dispose)(abstract_file *) = nullptr) + : abstract_file{do_dispose}, _cookie{cookie}, _flags{flags}, _funcs{funcs} { } + + int close() override; + int reopen(const char *path, const char *mode) override; +protected: + int determine_type(stream_type *type) override; + int determine_bufmode(buffer_mode *mode) override; + + int io_read(char *buffer, size_t max_size, size_t *actual_size) override; + int io_write(const char *buffer, size_t max_size, size_t *actual_size) override; + int io_seek(off_t offset, int whence, off_t *new_offset) override; + +private: + void *_cookie; + + int _flags; + cookie_io_functions_t _funcs; +}; + +} // namespace mlibc + +#endif // MLIBC_POSIX_FILE_IO_HPP diff --git a/lib/mlibc/options/posix/include/mlibc/posix-sysdeps.hpp b/lib/mlibc/options/posix/include/mlibc/posix-sysdeps.hpp new file mode 100644 index 0000000..ba77b32 --- /dev/null +++ b/lib/mlibc/options/posix/include/mlibc/posix-sysdeps.hpp @@ -0,0 +1,240 @@ +#ifndef MLIBC_POSIX_SYSDEPS +#define MLIBC_POSIX_SYSDEPS + +#include <stddef.h> + +#include <abi-bits/seek-whence.h> +#include <abi-bits/vm-flags.h> +#include <bits/off_t.h> +#include <bits/ssize_t.h> +#include <mlibc/fsfd_target.hpp> + +#include <fcntl.h> +#include <time.h> +#include <abi-bits/pid_t.h> +#include <abi-bits/socklen_t.h> +#include <bits/posix/stat.h> +#include <poll.h> +#include <stdarg.h> +#include <sys/socket.h> +#include <sys/resource.h> +#include <sys/utsname.h> +#include <sys/select.h> +#include <sys/sem.h> +#include <sys/statvfs.h> +#include <sys/time.h> +#include <sys/times.h> +#include <sys/wait.h> +#include <sched.h> +#include <termios.h> +#include <time.h> +#include <ucontext.h> + +namespace [[gnu::visibility("hidden")]] mlibc { + +void sys_libc_log(const char *message); +[[noreturn]] void sys_libc_panic(); + +[[noreturn]] void sys_exit(int status); +[[noreturn, gnu::weak]] void sys_thread_exit(); +int sys_clock_get(int clock, time_t *secs, long *nanos); + +int sys_open(const char *pathname, int flags, mode_t mode, int *fd); +[[gnu::weak]] int sys_flock(int fd, int options); + +[[gnu::weak]] int sys_open_dir(const char *path, int *handle); +[[gnu::weak]] int sys_read_entries(int handle, void *buffer, size_t max_size, + size_t *bytes_read); + +int sys_read(int fd, void *buf, size_t count, ssize_t *bytes_read); +[[gnu::weak]] int sys_readv(int fd, const struct iovec *iovs, int iovc, ssize_t *bytes_read); + +int sys_write(int fd, const void *buf, size_t count, ssize_t *bytes_written); +[[gnu::weak]] int sys_pread(int fd, void *buf, size_t n, off_t off, ssize_t *bytes_read); +[[gnu::weak]] int sys_pwrite(int fd, const void *buf, size_t n, off_t off, ssize_t *bytes_read); + +int sys_seek(int fd, off_t offset, int whence, off_t *new_offset); +int sys_close(int fd); + +[[gnu::weak]] int sys_access(const char *path, int mode); +[[gnu::weak]] int sys_faccessat(int dirfd, const char *pathname, int mode, int flags); +[[gnu::weak]] int sys_dup(int fd, int flags, int *newfd); +[[gnu::weak]] int sys_dup2(int fd, int flags, int newfd); +// In contrast to the isatty() library function, the sysdep function uses return value +// zero (and not one) to indicate that the file is a terminal. +[[gnu::weak]] int sys_isatty(int fd); +[[gnu::weak]] int sys_stat(fsfd_target fsfdt, int fd, const char *path, int flags, + struct stat *statbuf); +[[gnu::weak]] int sys_statvfs(const char *path, struct statvfs *out); +[[gnu::weak]] int sys_fstatvfs(int fd, struct statvfs *out); +[[gnu::weak]] int sys_readlink(const char *path, void *buffer, size_t max_size, ssize_t *length); +[[gnu::weak]] int sys_rmdir(const char *path); +[[gnu::weak]] int sys_ftruncate(int fd, size_t size); +[[gnu::weak]] int sys_fallocate(int fd, off_t offset, size_t size); +[[gnu::weak]] int sys_unlinkat(int fd, const char *path, int flags); +[[gnu::weak]] int sys_openat(int dirfd, const char *path, int flags, mode_t mode, int *fd); +[[gnu::weak]] int sys_socket(int family, int type, int protocol, int *fd); +[[gnu::weak]] int sys_msg_send(int fd, const struct msghdr *hdr, int flags, ssize_t *length); +[[gnu::weak]] ssize_t sys_sendto(int fd, const void *buffer, size_t size, int flags, const struct sockaddr *sock_addr, socklen_t addr_length, ssize_t *length); +[[gnu::weak]] int sys_msg_recv(int fd, struct msghdr *hdr, int flags, ssize_t *length); +[[gnu::weak]] ssize_t sys_recvfrom(int fd, void *buffer, size_t size, int flags, struct sockaddr *sock_addr, socklen_t *addr_length, ssize_t *length); +[[gnu::weak]] int sys_listen(int fd, int backlog); +[[gnu::weak]] gid_t sys_getgid(); +[[gnu::weak]] gid_t sys_getegid(); +[[gnu::weak]] uid_t sys_getuid(); +[[gnu::weak]] uid_t sys_geteuid(); +[[gnu::weak]] pid_t sys_getpid(); +[[gnu::weak]] pid_t sys_gettid(); +[[gnu::weak]] pid_t sys_getppid(); +[[gnu::weak]] int sys_getpgid(pid_t pid, pid_t *pgid); +[[gnu::weak]] int sys_getsid(pid_t pid, pid_t *sid); +[[gnu::weak]] int sys_setpgid(pid_t pid, pid_t pgid); +[[gnu::weak]] int sys_setuid(uid_t uid); +[[gnu::weak]] int sys_seteuid(uid_t euid); +[[gnu::weak]] int sys_setgid(gid_t gid); +[[gnu::weak]] int sys_setegid(gid_t egid); +[[gnu::weak]] int sys_getgroups(size_t size, const gid_t *list, int *ret); +[[gnu::weak]] void sys_yield(); +[[gnu::weak]] int sys_sleep(time_t *secs, long *nanos); +[[gnu::weak]] int sys_fork(pid_t *child); +[[gnu::weak]] int sys_execve(const char *path, char *const argv[], char *const envp[]); +[[gnu::weak]] int sys_pselect(int num_fds, fd_set *read_set, fd_set *write_set, + fd_set *except_set, const struct timespec *timeout, const sigset_t *sigmask, int *num_events); +[[gnu::weak]] int sys_getrusage(int scope, struct rusage *usage); +[[gnu::weak]] int sys_getrlimit(int resource, struct rlimit *limit); +[[gnu::weak]] int sys_setrlimit(int resource, const struct rlimit *limit); +[[gnu::weak]] int sys_getpriority(int which, id_t who, int *value); +[[gnu::weak]] int sys_setpriority(int which, id_t who, int prio); +[[gnu::weak]] int sys_getschedparam(void *tcb, int *policy, struct sched_param *param); +[[gnu::weak]] int sys_setschedparam(void *tcb, int policy, const struct sched_param *param); +[[gnu::weak]] int sys_get_max_priority(int policy, int *out); +[[gnu::weak]] int sys_get_min_priority(int policy, int *out); +[[gnu::weak]] int sys_getcwd(char *buffer, size_t size); +[[gnu::weak]] int sys_chdir(const char *path); +[[gnu::weak]] int sys_fchdir(int fd); +[[gnu::weak]] int sys_chroot(const char *path); +[[gnu::weak]] int sys_mkdir(const char *path, mode_t mode); +[[gnu::weak]] int sys_mkdirat(int dirfd, const char *path, mode_t mode); +[[gnu::weak]] int sys_link(const char *old_path, const char *new_path); +[[gnu::weak]] int sys_linkat(int olddirfd, const char *old_path, int newdirfd, const char *new_path, int flags); +[[gnu::weak]] int sys_symlink(const char *target_path, const char *link_path); +[[gnu::weak]] int sys_symlinkat(const char *target_path, int dirfd, const char *link_path); +[[gnu::weak]] int sys_rename(const char *path, const char *new_path); +[[gnu::weak]] int sys_renameat(int olddirfd, const char *old_path, int newdirfd, const char *new_path); +[[gnu::weak]] int sys_fcntl(int fd, int request, va_list args, int *result); +[[gnu::weak]] int sys_ttyname(int fd, char *buf, size_t size); +[[gnu::weak]] int sys_fadvise(int fd, off_t offset, off_t length, int advice); +[[gnu::weak]] void sys_sync(); +[[gnu::weak]] int sys_fsync(int fd); +[[gnu::weak]] int sys_fdatasync(int fd); +[[gnu::weak]] int sys_chmod(const char *pathname, mode_t mode); +[[gnu::weak]] int sys_fchmod(int fd, mode_t mode); +[[gnu::weak]] int sys_fchmodat(int fd, const char *pathname, mode_t mode, int flags); +[[gnu::weak]] int sys_utimensat(int dirfd, const char *pathname, const struct timespec times[2], int flags); +[[gnu::weak]] int sys_mlock(const void *addr, size_t length); +[[gnu::weak]] int sys_munlock(const void *addr, size_t length); +[[gnu::weak]] int sys_mlockall(int flags); +[[gnu::weak]] int sys_mlock(const void *addr, size_t len); +[[gnu::weak]] int sys_munlockall(void); +[[gnu::weak]] int sys_mincore(void *addr, size_t length, unsigned char *vec); + +// mlibc assumes that anonymous memory returned by sys_vm_map() is zeroed by the kernel / whatever is behind the sysdeps +int sys_vm_map(void *hint, size_t size, int prot, int flags, int fd, off_t offset, void **window); + +[[gnu::weak]] int sys_vm_remap(void *pointer, size_t size, size_t new_size, void **window); +[[gnu::weak]] int sys_vm_protect(void *pointer, size_t size, int prot); + +int sys_vm_unmap(void *pointer, size_t size); + +[[gnu::weak]] int sys_setsid(pid_t *sid); +[[gnu::weak]] int sys_tcgetattr(int fd, struct termios *attr); +[[gnu::weak]] int sys_tcsetattr(int, int, const struct termios *attr); +[[gnu::weak]] int sys_tcflow(int, int); +[[gnu::weak]] int sys_tcflush(int fd, int queue); +[[gnu::weak]] int sys_tcdrain(int); +[[gnu::weak]] int sys_pipe(int *fds, int flags); +[[gnu::weak]] int sys_socketpair(int domain, int type_and_flags, int proto, int *fds); +[[gnu::weak]] int sys_poll(struct pollfd *fds, nfds_t count, int timeout, int *num_events); +[[gnu::weak]] int sys_ioctl(int fd, unsigned long request, void *arg, int *result); +[[gnu::weak]] int sys_getsockopt(int fd, int layer, int number, + void *__restrict buffer, socklen_t *__restrict size); +[[gnu::weak]] int sys_setsockopt(int fd, int layer, int number, + const void *buffer, socklen_t size); +[[gnu::weak]] int sys_shutdown(int sockfd, int how); +[[gnu::weak]] int sys_sigprocmask(int how, const sigset_t *__restrict set, + sigset_t *__restrict retrieve); +[[gnu::weak]] int sys_sigaction(int, const struct sigaction *__restrict, + struct sigaction *__restrict); +// NOTE: POSIX says that behavior of timeout = nullptr is unspecified. We treat this case +// as an infinite timeout, making sigtimedwait(..., nullptr) equivalent to sigwaitinfo(...) +[[gnu::weak]] int sys_sigtimedwait(const sigset_t *__restrict set, siginfo_t *__restrict info, const struct timespec *__restrict timeout, int *out_signal); +[[gnu::weak]] int sys_kill(int, int); +[[gnu::weak]] int sys_accept(int fd, int *newfd, struct sockaddr *addr_ptr, socklen_t *addr_length, int flags); +[[gnu::weak]] int sys_bind(int fd, const struct sockaddr *addr_ptr, socklen_t addr_length); +[[gnu::weak]] int sys_connect(int fd, const struct sockaddr *addr_ptr, socklen_t addr_length); +[[gnu::weak]] int sys_sockname(int fd, struct sockaddr *addr_ptr, socklen_t max_addr_length, + socklen_t *actual_length); +[[gnu::weak]] int sys_peername(int fd, struct sockaddr *addr_ptr, socklen_t max_addr_length, + socklen_t *actual_length); +[[gnu::weak]] int sys_gethostname(char *buffer, size_t bufsize); +[[gnu::weak]] int sys_sethostname(const char *buffer, size_t bufsize); +[[gnu::weak]] int sys_mkfifoat(int dirfd, const char *path, int mode); +[[gnu::weak]] int sys_getentropy(void *buffer, size_t length); +[[gnu::weak]] int sys_mknodat(int dirfd, const char *path, int mode, int dev); +[[gnu::weak]] int sys_umask(mode_t mode, mode_t *old); + +[[gnu::weak]] int sys_before_cancellable_syscall(ucontext_t *uctx); +[[gnu::weak]] int sys_tgkill(int tgid, int tid, int sig); + +[[gnu::weak]] int sys_fchownat(int dirfd, const char *pathname, uid_t owner, gid_t group, int flags); +[[gnu::weak]] int sys_sigaltstack(const stack_t *ss, stack_t *oss); +[[gnu::weak]] int sys_sigsuspend(const sigset_t *set); +[[gnu::weak]] int sys_sigpending(sigset_t *set); +[[gnu::weak]] int sys_setgroups(size_t size, const gid_t *list); +[[gnu::weak]] int sys_memfd_create(const char *name, int flags, int *fd); +[[gnu::weak]] int sys_madvise(void *addr, size_t length, int advice); +[[gnu::weak]] int sys_msync(void *addr, size_t length, int flags); + +[[gnu::weak]] int sys_getitimer(int which, struct itimerval *curr_value); +[[gnu::weak]] int sys_setitimer(int which, const struct itimerval *new_value, struct itimerval *old_value); +[[gnu::weak]] int sys_timer_create(clockid_t clk, struct sigevent *__restrict evp, timer_t *__restrict res); +[[gnu::weak]] int sys_timer_settime(timer_t t, int flags, const struct itimerspec *__restrict val, struct itimerspec *__restrict old); +[[gnu::weak]] int sys_timer_delete(timer_t t); +[[gnu::weak]] int sys_times(struct tms *tms, clock_t *out); +[[gnu::weak]] int sys_uname(struct utsname *buf); +[[gnu::weak]] int sys_pause(); + +[[gnu::weak]] int sys_setresuid(uid_t ruid, uid_t euid, uid_t suid); +[[gnu::weak]] int sys_setresgid(gid_t rgid, gid_t egid, gid_t sgid); +[[gnu::weak]] int sys_getresuid(uid_t *ruid, uid_t *euid, uid_t *suid); +[[gnu::weak]] int sys_getresgid(gid_t *rgid, gid_t *egid, gid_t *sgid); +[[gnu::weak]] int sys_setreuid(uid_t ruid, uid_t euid); +[[gnu::weak]] int sys_setregid(gid_t rgid, gid_t egid); + +[[gnu::weak]] int sys_poll(struct pollfd *fds, nfds_t count, int timeout, int *num_events); + +[[gnu::weak]] int sys_if_indextoname(unsigned int index, char *name); +[[gnu::weak]] int sys_if_nametoindex(const char *name, unsigned int *ret); + +[[gnu::weak]] int sys_ptsname(int fd, char *buffer, size_t length); +[[gnu::weak]] int sys_unlockpt(int fd); + +[[gnu::weak]] int sys_thread_setname(void *tcb, const char *name); +[[gnu::weak]] int sys_thread_getname(void *tcb, char *name, size_t size); + +[[gnu::weak]] int sys_sysconf(int num, long *ret); + +[[gnu::weak]] int sys_semget(key_t key, int n, int fl, int *id); +[[gnu::weak]] int sys_semctl(int semid, int semnum, int cmd, void *semun, int *ret); + +[[gnu::weak]] int sys_getaffinity(pid_t pid, size_t cpusetsize, cpu_set_t *mask); +[[gnu::weak]] int sys_getthreadaffinity(pid_t tid, size_t cpusetsize, cpu_set_t *mask); + +[[gnu::weak]] int sys_setaffinity(pid_t pid, size_t cpusetsize, const cpu_set_t *mask); +[[gnu::weak]] int sys_setthreadaffinity(pid_t tid, size_t cpusetsize, const cpu_set_t *mask); + +[[gnu::weak]] int sys_waitid(idtype_t idtype, id_t id, siginfo_t *info, int options); + +} //namespace mlibc + +#endif // MLIBC_POSIX_SYSDEPS diff --git a/lib/mlibc/options/posix/include/mlibc/resolv_conf.hpp b/lib/mlibc/options/posix/include/mlibc/resolv_conf.hpp new file mode 100644 index 0000000..2a349c7 --- /dev/null +++ b/lib/mlibc/options/posix/include/mlibc/resolv_conf.hpp @@ -0,0 +1,21 @@ +#ifndef _MLIBC_RESOLV_CONF +#define _MLIBC_RESOLV_CONF + +#include <frg/string.hpp> +#include <frg/optional.hpp> +#include <mlibc/allocator.hpp> + +namespace mlibc { + +struct nameserver_data { + nameserver_data() + : name(getAllocator()) {} + frg::string<MemoryAllocator> name; + // for in the future we can also store options here +}; + +frg::optional<struct nameserver_data> get_nameserver(); + +} // namespace mlibc + +#endif // _MLIBC_RESOLV_CONF diff --git a/lib/mlibc/options/posix/include/mlibc/services.hpp b/lib/mlibc/options/posix/include/mlibc/services.hpp new file mode 100644 index 0000000..10dec47 --- /dev/null +++ b/lib/mlibc/options/posix/include/mlibc/services.hpp @@ -0,0 +1,33 @@ +#ifndef _MLIBC_SERVICES +#define _MLIBC_SERVICES + +#include <frg/small_vector.hpp> +#include <frg/vector.hpp> +#include <frg/string.hpp> +#include <mlibc/allocator.hpp> + +namespace mlibc { + +// Only two services for tcp and udp +#define SERV_MAX 2 + +struct service_buf { + service_buf() + : name(getAllocator()), aliases(getAllocator()) + { } + int port, protocol, socktype; + frg::string<MemoryAllocator> name; + frg::vector<frg::string<MemoryAllocator>, MemoryAllocator> aliases; +}; + +using service_result = frg::small_vector<service_buf, SERV_MAX, MemoryAllocator>; + +int lookup_serv_by_name(service_result &buf, const char *name, int proto, + int socktype, int flags); + +int lookup_serv_by_port(service_result &buf, int proto, int port); + + +} // namespace mlibc + +#endif // _MLIBC_SERVICES diff --git a/lib/mlibc/options/posix/include/mqueue.h b/lib/mlibc/options/posix/include/mqueue.h new file mode 100644 index 0000000..34ac990 --- /dev/null +++ b/lib/mlibc/options/posix/include/mqueue.h @@ -0,0 +1,26 @@ +#ifndef _MQUEUE_H +#define _MQUEUE_H + +#include <abi-bits/mqueue.h> + +#ifdef __cplusplus +extern "C" { +#endif + +typedef int mqd_t; + +#ifndef __MLIBC_ABI_ONLY + +int mq_getattr(mqd_t mqdes, struct mq_attr *attr); +int mq_setattr(mqd_t mqdes, const struct mq_attr *__restrict__ newattr, struct mq_attr *__restrict__ oldattr); +int mq_unlink(const char *name); +mqd_t mq_open(const char *name, int flags, ...); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* _MQUEUE_H */ + diff --git a/lib/mlibc/options/posix/include/net/if.h b/lib/mlibc/options/posix/include/net/if.h new file mode 100644 index 0000000..10016fd --- /dev/null +++ b/lib/mlibc/options/posix/include/net/if.h @@ -0,0 +1,118 @@ + +#ifndef _NET_IF_H +#define _NET_IF_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <sys/socket.h> + +#define IF_NAMESIZE 16 +#define IFNAMSIZ IF_NAMESIZE +#define ALTIFNAMSIZ 128 +#define IFALIASZ 256 + +struct if_nameindex { + unsigned int if_index; + char *if_name; +}; + +struct ifmap { + unsigned long mem_start; + unsigned long mem_end; + unsigned short base_addr; + unsigned char irq; + unsigned char dma; + unsigned char port; +}; + +struct ifreq { + union { + char ifrn_name[IFNAMSIZ]; + } ifr_ifrn; + + union { + struct sockaddr ifru_addr; + struct sockaddr ifru_dstaddr; + struct sockaddr ifru_broadaddr; + struct sockaddr ifru_netmask; + struct sockaddr ifru_hwaddr; + short int ifru_flags; + int ifru_ivalue; + int ifru_mtu; + struct ifmap ifru_map; + char ifru_slave[IFNAMSIZ]; + char ifru_newname[IFNAMSIZ]; + char *ifru_data; + } ifr_ifru; +}; + +#define ifr_name ifr_ifrn.ifrn_name +#define ifr_hwaddr ifr_ifru.ifru_hwaddr +#define ifr_addr ifr_ifru.ifru_addr +#define ifr_dstaddr ifr_ifru.ifru_dstaddr +#define ifr_broadaddr ifr_ifru.ifru_broadaddr +#define ifr_netmask ifr_ifru.ifru_netmask +#define ifr_flags ifr_ifru.ifru_flags +#define ifr_metric ifr_ifru.ifru_ivalue +#define ifr_mtu ifr_ifru.ifru_mtu +#define ifr_map ifr_ifru.ifru_map +#define ifr_slave ifr_ifru.ifru_slave +#define ifr_data ifr_ifru.ifru_data +#define ifr_ifindex ifr_ifru.ifru_ivalue +#define ifr_bandwidth ifr_ifru.ifru_ivalue +#define ifr_qlen ifr_ifru.ifru_ivalue +#define ifr_newname ifr_ifru.ifru_newname + +struct ifconf { + int ifc_len; + union { + char *ifcu_buf; + struct ifreq *ifcu_req; + } ifc_ifcu; +}; + +#define ifc_buf ifc_ifcu.ifcu_buf +#define ifc_req ifc_ifcu.ifcu_req + +#ifndef __MLIBC_ABI_ONLY + +void if_freenameindex(struct if_nameindex *); +char *if_indextoname(unsigned int, char *); +struct if_nameindex *if_nameindex(void); +unsigned int if_nametoindex(const char *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#define IFHWADDRLEN 6 + +#define IFF_UP 0x1 +#define IFF_BROADCAST 0x2 +#define IFF_DEBUG 0x4 +#define IFF_LOOPBACK 0x8 +#define IFF_POINTOPOINT 0x10 +#define IFF_NOTRAILERS 0x20 +#define IFF_RUNNING 0x40 +#define IFF_NOARP 0x80 +#define IFF_PROMISC 0x100 +#define IFF_ALLMULTI 0x200 +#define IFF_MASTER 0x400 +#define IFF_SLAVE 0x800 +#define IFF_MULTICAST 0x1000 +#define IFF_PORTSEL 0x2000 +#define IFF_AUTOMEDIA 0x4000 +#define IFF_DYNAMIC 0x8000 +#define IFF_LOWER_UP 0x10000 +#define IFF_DORMANT 0x20000 +#define IFF_ECHO 0x40000 +#define IFF_VOLATILE (IFF_LOOPBACK|IFF_POINTOPOINT|IFF_BROADCAST| \ + IFF_ECHO|IFF_MASTER|IFF_SLAVE|IFF_RUNNING|IFF_LOWER_UP|IFF_DORMANT) + +#ifdef __cplusplus +} +#endif + +#endif // _NET_IF_H + + diff --git a/lib/mlibc/options/posix/include/net/if_arp.h b/lib/mlibc/options/posix/include/net/if_arp.h new file mode 100644 index 0000000..de8a0c2 --- /dev/null +++ b/lib/mlibc/options/posix/include/net/if_arp.h @@ -0,0 +1,103 @@ +#ifndef _NET_IF_ARP_H +#define _NET_IF_ARP_H + +#include <sys/types.h> +#include <sys/socket.h> +#include <stdint.h> + +#define ARPOP_REQUEST 1 +#define ARPOP_REPLY 2 +#define ARPOP_RREQUEST 3 +#define ARPOP_RREPLY 4 +#define ARPOP_InREQUEST 8 +#define ARPOP_InREPLY 9 +#define ARPOP_NAK 10 + +#define ARPHRD_NETROM 0 +#define ARPHRD_ETHER 1 +#define ARPHRD_EETHER 2 +#define ARPHRD_AX25 3 +#define ARPHRD_PRONET 4 +#define ARPHRD_CHAOS 5 +#define ARPHRD_IEEE802 6 +#define ARPHRD_ARCNET 7 +#define ARPHRD_APPLETLK 8 +#define ARPHRD_DLCI 15 +#define ARPHRD_ATM 19 +#define ARPHRD_METRICOM 23 +#define ARPHRD_IEEE1394 24 +#define ARPHRD_EUI64 27 +#define ARPHRD_INFINIBAND 32 +#define ARPHRD_SLIP 256 +#define ARPHRD_CSLIP 257 +#define ARPHRD_SLIP6 258 +#define ARPHRD_CSLIP6 259 +#define ARPHRD_RSRVD 260 +#define ARPHRD_ADAPT 264 +#define ARPHRD_ROSE 270 +#define ARPHRD_X25 271 +#define ARPHRD_HWX25 272 +#define ARPHRD_CAN 280 +#define ARPHRD_PPP 512 +#define ARPHRD_CISCO 513 +#define ARPHRD_HDLC ARPHRD_CISCO +#define ARPHRD_LAPB 516 +#define ARPHRD_DDCMP 517 +#define ARPHRD_RAWHDLC 518 +#define ARPHRD_RAWIP 519 + +#define ARPHRD_TUNNEL 768 +#define ARPHRD_TUNNEL6 769 +#define ARPHRD_FRAD 770 +#define ARPHRD_SKIP 771 +#define ARPHRD_LOOPBACK 772 +#define ARPHRD_LOCALTLK 773 +#define ARPHRD_FDDI 774 +#define ARPHRD_BIF 775 +#define ARPHRD_SIT 776 +#define ARPHRD_IPDDP 777 +#define ARPHRD_IPGRE 778 +#define ARPHRD_PIMREG 779 +#define ARPHRD_HIPPI 780 +#define ARPHRD_ASH 781 +#define ARPHRD_ECONET 782 +#define ARPHRD_IRDA 783 +#define ARPHRD_FCPP 784 +#define ARPHRD_FCAL 785 +#define ARPHRD_FCPL 786 +#define ARPHRD_FCFABRIC 787 +#define ARPHRD_IEEE802_TR 800 +#define ARPHRD_IEEE80211 801 +#define ARPHRD_IEEE80211_PRISM 802 +#define ARPHRD_IEEE80211_RADIOTAP 803 +#define ARPHRD_IEEE802154 804 +#define ARPHRD_IEEE802154_MONITOR 805 +#define ARPHRD_PHONET 820 +#define ARPHRD_PHONET_PIPE 821 +#define ARPHRD_CAIF 822 +#define ARPHRD_IP6GRE 823 +#define ARPHRD_NETLINK 824 +#define ARPHRD_6LOWPAN 825 +#define ARPHRD_VSOCKMON 826 + +#define ARPHRD_VOID 0xFFFF +#define ARPHRD_NONE 0xFFFE + +struct arphdr { + uint16_t ar_hrd; + uint16_t ar_pro; + uint8_t ar_hln; + uint8_t ar_pln; + uint16_t ar_op; +}; + +struct arpreq { + struct sockaddr arp_pa; + struct sockaddr arp_ha; + int arp_flags; + struct sockaddr arp_netmask; + char arp_dev[16]; +}; + +#endif // _NET_IF_ARP_H + diff --git a/lib/mlibc/options/posix/include/netdb.h b/lib/mlibc/options/posix/include/netdb.h new file mode 100644 index 0000000..368c74f --- /dev/null +++ b/lib/mlibc/options/posix/include/netdb.h @@ -0,0 +1,148 @@ +#ifndef _NETDB_H +#define _NETDB_H + +#include <stdint.h> +#include <bits/size_t.h> +#include <bits/posix/in_port_t.h> +#include <bits/posix/in_addr_t.h> +#include <abi-bits/socklen_t.h> + +#define AI_PASSIVE 0x01 +#define AI_CANONNAME 0x02 +#define AI_NUMERICHOST 0x04 +#define AI_V4MAPPED 0x08 +#define AI_ALL 0x10 +#define AI_ADDRCONFIG 0x20 +#define AI_NUMERICSERV 0x40 + +#define NI_NOFQDN 0x01 +#define NI_NUMERICHOST 0x02 +#define NI_NAMEREQD 0x04 +#define NI_NUMERICSCOPE 0x08 +#define NI_DGRAM 0x10 + +#define NI_NUMERICSERV 2 +#define NI_MAXSERV 32 +#define NI_IDN 32 + +#define NI_MAXHOST 1025 + +#define EAI_AGAIN 1 +#define EAI_BADFLAGS 2 +#define EAI_FAIL 3 +#define EAI_FAMILY 4 +#define EAI_MEMORY 5 +#define EAI_NONAME 6 +#define EAI_SERVICE 7 +#define EAI_SOCKTYPE 8 +#define EAI_SYSTEM 9 +#define EAI_OVERFLOW 10 +#define EAI_NODATA 11 +#define EAI_ADDRFAMILY 12 + +#define HOST_NOT_FOUND 1 +#define TRY_AGAIN 2 +#define NO_RECOVERY 3 +#define NO_DATA 4 +#define NO_ADDRESS NO_DATA + +#define IPPORT_RESERVED 1024 + +#define _PATH_SERVICES "/etc/services" + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int *__h_errno_location(void); +#define h_errno (*__h_errno_location()) + +#endif /* !__MLIBC_ABI_ONLY */ + +struct hostent { + char *h_name; + char **h_aliases; + int h_addrtype; + int h_length; + char **h_addr_list; +}; + +#define h_addr h_addr_list[0] // Required by some programs + +struct netent { + char *n_name; + char **n_aliases; + int n_addrtype; + uint32_t n_net; +}; + +struct protoent { + char *p_name; + char **p_aliases; + int p_proto; +}; + +struct servent { + char *s_name; + char **s_aliases; + int s_port; + char *s_proto; +}; + +struct addrinfo { + int ai_flags; + int ai_family; + int ai_socktype; + int ai_protocol; + socklen_t ai_addrlen; + struct sockaddr *ai_addr; + char *ai_canonname; + struct addrinfo *ai_next; +}; + +#ifndef __MLIBC_ABI_ONLY + +void endhostent(void); +void endnetent(void); +void endprotoent(void); +void endservent(void); +void freeaddrinfo(struct addrinfo *); +const char *gai_strerror(int); +int getaddrinfo(const char *__restrict, const char *__restrict, + const struct addrinfo *__restrict, struct addrinfo **__restrict); +struct hostent *gethostent(void); +struct hostent *gethostbyname(const char *); +struct hostent *gethostbyname2(const char *, int); +struct hostent *gethostbyaddr(const void *, socklen_t, int); +int gethostbyaddr_r(const void *__restrict, socklen_t, int, struct hostent *__restrict, + char *__restrict, size_t, struct hostent **__restrict, int *__restrict); +int gethostbyname_r(const char *__restrict, struct hostent *__restrict, char *__restrict, size_t, + struct hostent **__restrict, int *__restrict); +int getnameinfo(const struct sockaddr *__restrict, socklen_t, + char *__restrict, socklen_t, char *__restrict, socklen_t, int); +struct netent *getnetbyaddr(uint32_t, int); +struct netent *getnetbyname(const char *); +struct netent *getnetent(void); +struct protoent *getprotobyname(const char *); +struct protoent *getprotobynumber(int); +struct protoent *getprotoent(void); +struct servent *getservbyname(const char *, const char *); +struct servent *getservbyport(int, const char *); +struct servent *getservent(void); +void sethostent(int); +void setnetent(int); +void setprotoent(int); +void setservent(int); + +// Deprecated GNU extension +const char *hstrerror(int err); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _NETDB_H diff --git a/lib/mlibc/options/posix/include/netinet/icmp6.h b/lib/mlibc/options/posix/include/netinet/icmp6.h new file mode 100644 index 0000000..7dfe237 --- /dev/null +++ b/lib/mlibc/options/posix/include/netinet/icmp6.h @@ -0,0 +1,139 @@ +#ifndef _NETINET_ICMP6_H +#define _NETINET_ICMP6_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <stdint.h> +#include <abi-bits/in.h> +#include <mlibc-config.h> + +#if __MLIBC_GLIBC_OPTION +#include <bits/glibc/glibc_icmp6.h> +#endif // __MLIBC_GLIBC_OPTION + +#define ICMP6_FILTER 1 + +#define ICMP6_FILTER_BLOCK 1 +#define ICMP6_FILTER_PASS 2 +#define ICMP6_FILTER_BLOCKOTHERS 3 +#define ICMP6_FILTER_PASSONLY 4 +#define ICMP6_ECHO_REQUEST 128 + +struct icmp6_filter { + uint32_t icmp6_filt[8]; +}; + +struct icmp6_hdr { + uint8_t icmp6_type; + uint8_t icmp6_code; + uint16_t icmp6_cksum; + union { + uint32_t icmp6_un_data32[1]; + uint16_t icmp6_un_data16[2]; + uint8_t icmp6_un_data8[4]; + } icmp6_dataun; +}; + +#define icmp6_data32 icmp6_dataun.icmp6_un_data32 +#define icmp6_data16 icmp6_dataun.icmp6_un_data16 +#define icmp6_data8 icmp6_dataun.icmp6_un_data8 + +#define icmp6_pptr icmp6_data32[0] +#define icmp6_mtu icmp6_data32[0] +#define icmp6_id icmp6_data16[0] +#define icmp6_seq icmp6_data16[1] +#define icmp6_maxdelay icmp6_data16[0] + +#define ICMP6_FILTER_WILLPASS(type, filterp) \ + ((((filterp)->icmp6_filt[(type) >> 5]) & (1U << ((type) & 31))) == 0) + +#define ICMP6_FILTER_WILLBLOCK(type, filterp) \ + ((((filterp)->icmp6_filt[(type) >> 5]) & (1U << ((type) & 31))) != 0) + +#define ICMP6_FILTER_SETPASS(type, filterp) \ + ((((filterp)->icmp6_filt[(type) >> 5]) &= ~(1U << ((type) & 31)))) + +#define ICMP6_FILTER_SETBLOCK(type, filterp) \ + ((((filterp)->icmp6_filt[(type) >> 5]) |= (1U << ((type) & 31)))) + +#define ICMP6_FILTER_SETPASSALL(filterp) \ + memset (filterp, 0, sizeof (struct icmp6_filter)); + +#define ICMP6_FILTER_SETBLOCKALL(filterp) \ + memset (filterp, 0xFF, sizeof (struct icmp6_filter)); + +#define ND_ROUTER_SOLICIT 133 +#define ND_ROUTER_ADVERT 134 +#define ND_NEIGHBOR_SOLICIT 135 +#define ND_NEIGHBOR_ADVERT 136 +#define ND_REDIRECT 137 + +struct nd_router_solicit { + struct icmp6_hdr nd_rs_hdr; +}; + +#define nd_rs_type nd_rs_hdr.icmp6_type +#define nd_rs_code nd_rs_hdr.icmp6_code +#define nd_rs_cksum nd_rs_hdr.icmp6_cksum +#define nd_rs_reserved nd_rs_hdr.icmp6_data32[0] + +struct nd_router_advert { + struct icmp6_hdr nd_ra_hdr; + uint32_t nd_ra_reachable; + uint32_t nd_ra_retransmit; +}; + +struct nd_opt_hdr { + uint8_t nd_opt_type; + uint8_t nd_opt_len; +}; + +#define ND_OPT_SOURCE_LINKADDR 1 +#define ND_OPT_TARGET_LINKADDR 2 +#define ND_OPT_PREFIX_INFORMATION 3 +#define ND_OPT_REDIRECTED_HEADER 4 +#define ND_OPT_MTU 5 +#define ND_OPT_RTR_ADV_INTERVAL 7 +#define ND_OPT_HOME_AGENT_INFO 8 + +struct nd_opt_prefix_info { + uint8_t nd_opt_pi_type; + uint8_t nd_opt_pi_len; + uint8_t nd_opt_pi_prefix_len; + uint8_t nd_opt_pi_flags_reserved; + uint32_t nd_opt_pi_valid_time; + uint32_t nd_opt_pi_preferred_time; + uint32_t nd_opt_pi_reserved2; + struct in6_addr nd_opt_pi_prefix; +}; + +#define ND_OPT_PI_FLAG_RADDR 0x20 +#define ND_OPT_PI_FLAG_AUTO 0x40 +#define ND_OPT_PI_FLAG_ONLINK 0x80 + +#define nd_ra_type nd_ra_hdr.icmp6_type +#define nd_ra_code nd_ra_hdr.icmp6_code +#define nd_ra_cksum nd_ra_hdr.icmp6_cksum +#define nd_ra_curhoplimit nd_ra_hdr.icmp6_data8[0] +#define nd_ra_flags_reserved nd_ra_hdr.icmp6_data8[1] +#define nd_ra_router_lifetime nd_ra_hdr.icmp6_data16[1] + +#define ND_RA_FLAG_HOME_AGENT 0x20 +#define ND_RA_FLAG_OTHER 0x40 +#define ND_RA_FLAG_MANAGED 0x80 + +struct nd_opt_mtu { + uint8_t nd_opt_mtu_type; + uint8_t nd_opt_mtu_len; + uint16_t nd_opt_mtu_reserved; + uint32_t nd_opt_mtu_mtu; +}; + +#ifdef __cplusplus +} +#endif + +#endif // _NETINET_ICMP6_H + diff --git a/lib/mlibc/options/posix/include/netinet/if_ether.h b/lib/mlibc/options/posix/include/netinet/if_ether.h new file mode 100644 index 0000000..c4ce173 --- /dev/null +++ b/lib/mlibc/options/posix/include/netinet/if_ether.h @@ -0,0 +1,105 @@ +#ifndef _NETINET_IF_ETHER_H +#define _NETINET_IF_ETHER_H + +#include <net/if_arp.h> + +#define ETH_ALEN 6 +#define ETH_HLEN 14 +#define ETH_ZLEN 60 +#define ETH_FRAME_LEN 1514 +#define ETH_FCS_LEN 4 + +#define ETH_P_LOOP 0x0060 +#define ETH_P_PUP 0x0200 +#define ETH_P_PUPAT 0x0201 +#define ETH_P_IP 0x0800 +#define ETH_P_X25 0x0805 +#define ETH_P_ARP 0x0806 +#define ETH_P_BPQ 0x08FF +#define ETH_P_IEEEPUP 0x0a00 +#define ETH_P_IEEEPUPAT 0x0a01 +#define ETH_P_BATMAN 0x4305 +#define ETH_P_DEC 0x6000 +#define ETH_P_DNA_DL 0x6001 +#define ETH_P_DNA_RC 0x6002 +#define ETH_P_DNA_RT 0x6003 +#define ETH_P_LAT 0x6004 +#define ETH_P_DIAG 0x6005 +#define ETH_P_CUST 0x6006 +#define ETH_P_SCA 0x6007 +#define ETH_P_TEB 0x6558 +#define ETH_P_RARP 0x8035 +#define ETH_P_ATALK 0x809B +#define ETH_P_AARP 0x80F3 +#define ETH_P_8021Q 0x8100 +#define ETH_P_IPX 0x8137 +#define ETH_P_IPV6 0x86DD +#define ETH_P_PAUSE 0x8808 +#define ETH_P_SLOW 0x8809 +#define ETH_P_WCCP 0x883E +#define ETH_P_MPLS_UC 0x8847 +#define ETH_P_MPLS_MC 0x8848 +#define ETH_P_ATMMPOA 0x884c +#define ETH_P_PPP_DISC 0x8863 +#define ETH_P_PPP_SES 0x8864 +#define ETH_P_LINK_CTL 0x886c +#define ETH_P_ATMFATE 0x8884 +#define ETH_P_PAE 0x888E +#define ETH_P_AOE 0x88A2 +#define ETH_P_8021AD 0x88A8 +#define ETH_P_802_EX1 0x88B5 +#define ETH_P_TIPC 0x88CA +#define ETH_P_8021AH 0x88E7 +#define ETH_P_MVRP 0x88F5 +#define ETH_P_1588 0x88F7 +#define ETH_P_PRP 0x88FB +#define ETH_P_FCOE 0x8906 +#define ETH_P_TDLS 0x890D +#define ETH_P_FIP 0x8914 +#define ETH_P_80221 0x8917 +#define ETH_P_LOOPBACK 0x9000 +#define ETH_P_QINQ1 0x9100 +#define ETH_P_QINQ2 0x9200 +#define ETH_P_QINQ3 0x9300 +#define ETH_P_EDSA 0xDADA +#define ETH_P_AF_IUCV 0xFBFB + +#define ETH_P_802_3_MIN 0x0600 + +#define ETH_P_802_3 0x0001 +#define ETH_P_AX25 0x0002 +#define ETH_P_ALL 0x0003 +#define ETH_P_802_2 0x0004 +#define ETH_P_SNAP 0x0005 +#define ETH_P_DDCMP 0x0006 +#define ETH_P_WAN_PPP 0x0007 +#define ETH_P_PPP_MP 0x0008 +#define ETH_P_LOCALTALK 0x0009 +#define ETH_P_CAN 0x000C +#define ETH_P_CANFD 0x000D +#define ETH_P_PPPTALK 0x0010 +#define ETH_P_TR_802_2 0x0011 +#define ETH_P_MOBITEX 0x0015 +#define ETH_P_CONTROL 0x0016 +#define ETH_P_IRDA 0x0017 +#define ETH_P_ECONET 0x0018 +#define ETH_P_HDLC 0x0019 +#define ETH_P_ARCNET 0x001A +#define ETH_P_DSA 0x001B +#define ETH_P_TRAILER 0x001C +#define ETH_P_PHONET 0x00F5 +#define ETH_P_IEEE802154 0x00F6 +#define ETH_P_CAIF 0x00F7 + +#include <net/ethernet.h> +#include <net/if_arp.h> + +struct ether_arp { + struct arphdr ea_hdr; + uint8_t arp_sha[ETH_ALEN]; + uint8_t arp_spa[4]; + uint8_t arp_tha[ETH_ALEN]; + uint8_t arp_tpa[4]; +}; + +#endif //_NETINET_IF_ETHER_H diff --git a/lib/mlibc/options/posix/include/netinet/in.h b/lib/mlibc/options/posix/include/netinet/in.h new file mode 100644 index 0000000..9a42c47 --- /dev/null +++ b/lib/mlibc/options/posix/include/netinet/in.h @@ -0,0 +1,118 @@ + +#ifndef _NETINET_IN_H +#define _NETINET_IN_H + +#include <stdint.h> +#include <endian.h> +#include <sys/socket.h> // struct sockaddr +#include <abi-bits/socket.h> +#include <abi-bits/in.h> +#include <arpa/inet.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +extern const struct in6_addr in6addr_any; +extern const struct in6_addr in6addr_loopback; + +uint32_t htonl(uint32_t); +uint16_t htons(uint16_t); +uint32_t ntohl(uint32_t); +uint16_t ntohs(uint16_t); + +#endif /* !__MLIBC_ABI_ONLY */ + +#define IN6_IS_ADDR_UNSPECIFIED(a) ({ \ + uint32_t *_a = (uint32_t *)(((struct in6_addr *) a)->s6_addr); \ + !_a[0] && \ + !_a[1] && \ + !_a[2] && \ + !_a[3]; \ +}) +#define IN6_IS_ADDR_LOOPBACK(a) ({ \ + uint32_t *_a = (uint32_t *)(((struct in6_addr *) a)->s6_addr); \ + !_a[0] && \ + !_a[1] && \ + !_a[2] && \ + _a[3] == htonl(0x0001); \ +}) +#define IN6_IS_ADDR_MULTICAST(a) (((const uint8_t *) (a))[0] == 0xff) +#define IN6_IS_ADDR_LINKLOCAL(a) ({ \ + uint32_t *_a = (uint32_t *)(((struct in6_addr *) a)->s6_addr); \ + _a[0] & htonl(0xffc00000) == htonl(0xfe800000); \ +}) +#define IN6_IS_ADDR_SITELOCAL(a) ({ \ + uint32_t *_a = (uint32_t *)(((struct in6_addr *) a)->s6_addr); \ + _a[0] & htonl(0xffc00000) == htonl(0xfec00000); \ +}) +#define IN6_IS_ADDR_V4MAPPED(a) ({ \ + uint32_t *_a = (uint32_t *)(((struct in6_addr *) a)->s6_addr); \ + !_a[0] && \ + !_a[1] && \ + _a[2] == htonl(0xffff); \ +}) +#define __ARE_4_BYTE_EQUAL(a, b) \ + ((a)[0] == (b)[0] && (a)[1] == (b)[1] && (a)[2] == (b)[2] && \ + (a)[3] == (b)[3] && (a)[4] == (b)[4]) +#define IN6_ARE_ADDR_EQUAL(a, b) \ + __ARE_4_BYTE_EQUAL((const uint32_t *)(a), (const uint32_t *)(b)) + +#define IN6_IS_ADDR_V4COMPAT(a) ({ \ + uint32_t *_a = (uint32_t *)(((struct in6_addr *) a)->s6_addr); \ + uint8_t *_a8 = (uint8_t *)(((struct in6_addr *) a)->s6_addr); \ + !_a[0] && !_a[1] && !_a[2] && (_a8[15] > 1); \ +}) +#define IN6_IS_ADDR_MC_NODELOCAL(a) ({ \ + (IN6_IS_ADDR_MULTICAST(a) && \ + ((((const uint8_t *)(a))[1] & 0xf) == 0x1)); \ +}) +#define IN6_IS_ADDR_MC_LINKLOCAL(a) ({ \ + (IN6_IS_ADDR_MULTICAST(a) && \ + ((((const uint8_t *)(a))[1] & 0xf) == 0x2)); \ +}) +#define IN6_IS_ADDR_MC_SITELOCAL(a) ({ \ + (IN6_IS_ADDR_MULTICAST(a) && \ + ((((const uint8_t *)(a))[1] & 0xf) == 0x5)); \ +}) +#define IN6_IS_ADDR_MC_ORGLOCAL(a) ({ \ + (IN6_IS_ADDR_MULTICAST(a) && \ + ((((const uint8_t *)(a))[1] & 0xf) == 0x8)); \ +}) +#define IN6_IS_ADDR_MC_GLOBAL(a) ({ \ + (IN6_IS_ADDR_MULTICAST(a) && \ + ((((const uint8_t *)(a))[1] & 0xf) == 0xe)); \ +}) + +#define IN_CLASSA(a) ((((in_addr_t)(a)) & 0x80000000) == 0) +#define IN_CLASSA_NET 0xff000000 +#define IN_CLASSA_NSHIFT 24 +#define IN_CLASSA_HOST (0xffffffff & ~IN_CLASSA_NET) +#define IN_CLASSA_MAX 128 +#define IN_CLASSB(a) ((((in_addr_t)(a)) & 0xc0000000) == 0x80000000) +#define IN_CLASSB_NET 0xffff0000 +#define IN_CLASSB_NSHIFT 16 +#define IN_CLASSB_HOST (0xffffffff & ~IN_CLASSB_NET) +#define IN_CLASSB_MAX 65536 +#define IN_CLASSC(a) ((((in_addr_t)(a)) & 0xe0000000) == 0xc0000000) +#define IN_CLASSC_NET 0xffffff00 +#define IN_CLASSC_NSHIFT 8 +#define IN_CLASSC_HOST (0xffffffff & ~IN_CLASSC_NET) +#define IN_CLASSD(a) ((((in_addr_t)(a)) & 0xf0000000) == 0xe0000000) +#define IN_MULTICAST(a) IN_CLASSD(a) +#define IN_EXPERIMENTAL(a) ((((in_addr_t)(a)) & 0xe0000000) == 0xe0000000) +#define IN_BADCLASS(a) ((((in_addr_t)(a)) & 0xf0000000) == 0xf0000000) + +#define IN_LOOPBACKNET 127 + +#define MCAST_EXCLUDE 0 +#define MCAST_INCLUDE 1 + +#ifdef __cplusplus +} +#endif + +#endif // _NETINET_IN_H + diff --git a/lib/mlibc/options/posix/include/netinet/ip.h b/lib/mlibc/options/posix/include/netinet/ip.h new file mode 100644 index 0000000..161aa18 --- /dev/null +++ b/lib/mlibc/options/posix/include/netinet/ip.h @@ -0,0 +1,75 @@ + +#ifndef _NETINET_IP_H +#define _NETINET_IP_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <sys/types.h> +#include <netinet/in.h> + +#define IPTOS_TOS_MASK 0x1E +#define IPTOS_TOS(tos) ((tos) & IPTOS_TOS_MASK) +#define IPTOS_LOWDELAY 0x10 +#define IPTOS_THROUGHPUT 0x08 +#define IPTOS_RELIABILITY 0x04 +#define IPTOS_LOWCOST 0x02 +#define IPTOS_MINCOST IPTOS_LOWCOST +#define IPTOS_CLASS_CS4 0x80 +#define IPTOS_CLASS_CS6 0xC0 + +#define IPDEFTTL 64 + +struct ip { +#if __BYTE_ORDER == __LITTLE_ENDIAN + unsigned int ip_hl:4; + unsigned int ip_v:4; +#endif +#if __BYTE_ORDER == __BIG_ENDIAN + unsigned int ip_v:4; + unsigned int ip_hl:4; +#endif + uint8_t ip_tos; + unsigned short ip_len; + unsigned short ip_id; + unsigned short ip_off; +#define IP_RF 0x8000 +#define IP_DF 0x4000 +#define IP_MF 0x2000 +#define IP_OFFMASK 0x1fff + uint8_t ip_ttl; + uint8_t ip_p; + unsigned short ip_sum; + struct in_addr ip_src, ip_dst; +}; + +#define IPVERSION 4 + +struct iphdr { +#if __BYTE_ORDER == __LITTLE_ENDIAN + unsigned int ihl:4; + unsigned int version:4; +#elif __BYTE_ORDER == __BIG_ENDIAN + unsigned int version:4; + unsigned int ihl:4; +#else +# error "Please fix <endian.h>" +#endif + uint8_t tos; + uint16_t tot_len; + uint16_t id; + uint16_t frag_off; + uint8_t ttl; + uint8_t protocol; + uint16_t check; + uint32_t saddr; + uint32_t daddr; +}; + +#ifdef __cplusplus +} +#endif + +#endif // _NETINET_IP_H + diff --git a/lib/mlibc/options/posix/include/netinet/ip6.h b/lib/mlibc/options/posix/include/netinet/ip6.h new file mode 100644 index 0000000..88f0cb6 --- /dev/null +++ b/lib/mlibc/options/posix/include/netinet/ip6.h @@ -0,0 +1,28 @@ +#ifndef _NETINET_IP6_H +#define _NETINET_IP6_H + +#include <netinet/in.h> + +#ifdef __cplusplus +extern "C" { +#endif + +struct ip6_hdr { + union { + struct ip6_hdrctl { + uint32_t ip6_un1_flow; + uint16_t ip6_un1_plen; + uint8_t ip6_un1_nxt; + uint8_t ip6_un1_hlim; + } ip6_un1; + uint8_t ip6_un2_vfc; + } ip6_ctlun; + struct in6_addr ip6_src; + struct in6_addr ip6_dst; +}; + +#ifdef __cplusplus +} +#endif + +#endif // _NETINET_IP6_H diff --git a/lib/mlibc/options/posix/include/netinet/ip_icmp.h b/lib/mlibc/options/posix/include/netinet/ip_icmp.h new file mode 100644 index 0000000..56615e4 --- /dev/null +++ b/lib/mlibc/options/posix/include/netinet/ip_icmp.h @@ -0,0 +1,84 @@ +#ifndef _NETINET_ICMP_H +#define _NETINET_ICMP_H + +#include <stdint.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#include <netinet/in.h> +#include <netinet/ip.h> + +#define ICMP_ECHOREPLY 0 +#define ICMP_ECHO 8 +#define ICMP_ADVLENMIN (8 + sizeof(struct ip) + 8) + +struct icmp_ra_addr { + uint32_t ira_addr; + uint32_t ira_preference; +}; + +struct icmp { + uint8_t icmp_type; + uint8_t icmp_code; + uint16_t icmp_cksum; + union { + unsigned char ih_pptr; + struct in_addr ih_gwaddr; + struct ih_idseq { + uint16_t icd_id; + uint16_t icd_seq; + } ih_idseq; + uint32_t ih_void; + + struct ih_pmtu { + uint16_t ipm_void; + uint16_t ipm_nextmtu; + } ih_pmtu; + + struct ih_rtradv { + uint8_t irt_num_addrs; + uint8_t irt_wpa; + uint16_t irt_lifetime; + } ih_rtradv; + } icmp_hun; + union { + struct { + uint32_t its_otime; + uint32_t its_rtime; + uint32_t its_ttime; + } id_ts; + struct { + struct ip idi_ip; + } id_ip; + struct icmp_ra_addr id_radv; + uint32_t id_mask; + uint8_t id_data[1]; + } icmp_dun; +}; + +#define icmp_pptr icmp_hun.ih_pptr +#define icmp_gwaddr icmp_hun.ih_gwaddr +#define icmp_id icmp_hun.ih_idseq.icd_id +#define icmp_seq icmp_hun.ih_idseq.icd_seq +#define icmp_void icmp_hun.ih_void +#define icmp_pmvoid icmp_hun.ih_pmtu.ipm_void +#define icmp_nextmtu icmp_hun.ih_pmtu.ipm_nextmtu +#define icmp_num_addrs icmp_hun.ih_rtradv.irt_num_addrs +#define icmp_wpa icmp_hun.ih_rtradv.irt_wpa +#define icmp_lifetime icmp_hun.ih_rtradv.irt_lifetime + +#define icmp_otime icmp_dun.id_ts.its_otime +#define icmp_rtime icmp_dun.id_ts.its_rtime +#define icmp_ttime icmp_dun.id_ts.its_ttime +#define icmp_ip icmp_dun.id_ip.idi_ip +#define icmp_radv icmp_dun.id_radv +#define icmp_mask icmp_dun.id_mask +#define icmp_data icmp_dun.id_data + +#ifdef __cplusplus +} +#endif + +#endif // _NETINET_ICMP_H diff --git a/lib/mlibc/options/posix/include/netinet/tcp.h b/lib/mlibc/options/posix/include/netinet/tcp.h new file mode 100644 index 0000000..9d64d7a --- /dev/null +++ b/lib/mlibc/options/posix/include/netinet/tcp.h @@ -0,0 +1,37 @@ +#ifndef _NETINET_TCP_H +#define _NETINET_TCP_H + +#ifdef __cplusplus +extern "C" { +#endif + +// Define some macros using same ABI as Linux +#define TCP_NODELAY 1 +#define TCP_MAXSEG 2 +#define TCP_KEEPIDLE 4 +#define TCP_KEEPINTVL 5 +#define TCP_KEEPCNT 6 +#define TCP_DEFER_ACCEPT 9 +#define TCP_CONGESTION 13 +#define TCP_FASTOPEN 23 + +#define TCP_ESTABLISHED 1 +#define TCP_SYN_SENT 2 +#define TCP_SYN_RECV 3 +#define TCP_FIN_WAIT1 4 +#define TCP_FIN_WAIT2 5 +#define TCP_TIME_WAIT 6 +#define TCP_CLOSE 7 +#define TCP_CLOSE_WAIT 8 +#define TCP_LAST_ACK 9 +#define TCP_LISTEN 10 +#define TCP_CLOSING 11 +#define TCP_QUICKACK 12 + +#define SOL_TCP 6 + +#ifdef __cplusplus +} +#endif + +#endif // _NETINET_TCP_H diff --git a/lib/mlibc/options/posix/include/netinet/udp.h b/lib/mlibc/options/posix/include/netinet/udp.h new file mode 100644 index 0000000..5cc887d --- /dev/null +++ b/lib/mlibc/options/posix/include/netinet/udp.h @@ -0,0 +1,31 @@ +#ifndef _NETINET_UDP_H +#define _NETINET_UDP_H + +#include <stdint.h> + +#ifdef __cplusplus +extern "C" { +#endif + +struct udphdr { + union { + struct { + uint16_t uh_sport; + uint16_t uh_dport; + uint16_t uh_ulen; + uint16_t uh_sum; + }; + struct { + uint16_t source; + uint16_t dest; + uint16_t len; + uint16_t check; + }; + }; +}; + +#ifdef __cplusplus +} +#endif + +#endif // _NETINET_UDP_H diff --git a/lib/mlibc/options/posix/include/nl_types.h b/lib/mlibc/options/posix/include/nl_types.h new file mode 100644 index 0000000..f0099ba --- /dev/null +++ b/lib/mlibc/options/posix/include/nl_types.h @@ -0,0 +1,6 @@ +#ifndef NL_TYPES_H +#define NL_TYPES_H + + + +#endif // NL_TYPES_H
\ No newline at end of file diff --git a/lib/mlibc/options/posix/include/poll.h b/lib/mlibc/options/posix/include/poll.h new file mode 100644 index 0000000..7550015 --- /dev/null +++ b/lib/mlibc/options/posix/include/poll.h @@ -0,0 +1,6 @@ +#ifndef _POLL_H +#define _POLL_H + +#include <sys/poll.h> + +#endif // _POLL_H diff --git a/lib/mlibc/options/posix/include/pthread.h b/lib/mlibc/options/posix/include/pthread.h new file mode 100644 index 0000000..739f607 --- /dev/null +++ b/lib/mlibc/options/posix/include/pthread.h @@ -0,0 +1,325 @@ + +#ifndef _PTHREAD_H +#define _PTHREAD_H + +#include <abi-bits/clockid_t.h> +#include <bits/cpu_set.h> +// TODO: pthread is not required to define size_t. +#include <bits/size_t.h> +#include <bits/posix/pthread_t.h> +#include <bits/threads.h> +#include <mlibc-config.h> + +#include <signal.h> +#include <stdint.h> + +// pthread.h is required to include sched.h and time.h +#include <sched.h> +#include <time.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#define PTHREAD_CREATE_JOINABLE __MLIBC_THREAD_CREATE_JOINABLE +#define PTHREAD_CREATE_DETACHED __MLIBC_THREAD_CREATE_DETACHED + +// Values for pthread_attr_{get,set}scope +#define PTHREAD_SCOPE_SYSTEM 0 +#define PTHREAD_SCOPE_PROCESS 1 + +// Values for pthread_attr_{get,set}inheritsched +#define PTHREAD_INHERIT_SCHED 0 +#define PTHREAD_EXPLICIT_SCHED 1 + +// values for pthread_{get,set}canceltype(). +#define PTHREAD_CANCEL_DEFERRED 0 +#define PTHREAD_CANCEL_ASYNCHRONOUS 1 + +// values for pthread_{get,set}cancelstate(). +#define PTHREAD_CANCEL_ENABLE 0 +#define PTHREAD_CANCEL_DISABLE 1 + +// values for pthread_mutexattr_{get,set}type(). +#define PTHREAD_MUTEX_DEFAULT __MLIBC_THREAD_MUTEX_DEFAULT +#define PTHREAD_MUTEX_NORMAL __MLIBC_THREAD_MUTEX_NORMAL +#define PTHREAD_MUTEX_ERRORCHECK __MLIBC_THREAD_MUTEX_ERRORCHECK +#define PTHREAD_MUTEX_RECURSIVE __MLIBC_THREAD_MUTEX_RECURSIVE + +// values for pthread_mutexattr_{get,set}robust(). +#define PTHREAD_MUTEX_STALLED __MLIBC_THREAD_MUTEX_STALLED +#define PTHREAD_MUTEX_ROBUST __MLIBC_THREAD_MUTEX_ROBUST + +// values for pthread_mutexattr_{get,set}pshared(). +#define PTHREAD_PROCESS_PRIVATE __MLIBC_THREAD_PROCESS_PRIVATE +#define PTHREAD_PROCESS_SHARED __MLIBC_THREAD_PROCESS_SHARED + +// Values for pthread_mutexattr_{get,set}protocol() +#define PTHREAD_PRIO_NONE __MLIBC_THREAD_PRIO_NONE +#define PTHREAD_PRIO_INHERIT __MLIBC_THREAD_PRIO_INHERIT +#define PTHREAD_PRIO_PROTECT __MLIBC_THREAD_PRIO_PROTECT + +#define PTHREAD_ONCE_INIT {0} +#define PTHREAD_COND_INITIALIZER {0} +#define PTHREAD_MUTEX_INITIALIZER {0, 0, 0, 0} +#define PTHREAD_RWLOCK_INITIALIZER {0, 0, 0} + +#define PTHREAD_CANCELED ((void*) -1) + +#define PTHREAD_BARRIER_SERIAL_THREAD -1 + +// values for pthread_key +#define PTHREAD_DESTRUCTOR_ITERATIONS 8 + +#define PTHREAD_INHERIT_SCHED 0 +#define PTHREAD_EXPLICIT_SCHED 1 + +#define PTHREAD_STACK_MIN 16384 + +#define PTHREAD_ATTR_NO_SIGMASK_NP (-1) + +// TODO: move to own file and include in sys/types.h +typedef struct __mlibc_threadattr pthread_attr_t; + +typedef uintptr_t pthread_key_t; + +struct __mlibc_once { + unsigned int __mlibc_done; +}; +typedef struct __mlibc_once pthread_once_t; + +typedef struct __mlibc_mutexattr pthread_mutexattr_t; + +typedef struct __mlibc_mutex pthread_mutex_t; + +typedef struct __mlibc_condattr pthread_condattr_t; + +typedef struct __mlibc_cond pthread_cond_t; + +struct __mlibc_barrierattr_struct { + int __mlibc_pshared; +}; +typedef struct __mlibc_barrierattr_struct pthread_barrierattr_t; + +struct __mlibc_barrier { + unsigned int __mlibc_waiting; + unsigned int __mlibc_inside; + unsigned int __mlibc_count; + unsigned int __mlibc_seq; + unsigned int __mlibc_flags; +}; +typedef struct __mlibc_barrier pthread_barrier_t; + +struct __mlibc_fair_rwlock { + unsigned int __mlibc_m; // Mutex. + unsigned int __mlibc_rc; // Reader count (not reference count). + unsigned int __mlibc_flags; +}; +typedef struct __mlibc_fair_rwlock pthread_rwlock_t; + +struct __mlibc_rwlockattr { + int __mlibc_pshared; +}; +typedef struct __mlibc_rwlockattr pthread_rwlockattr_t; + +#ifndef __MLIBC_ABI_ONLY + +// ---------------------------------------------------------------------------- +// pthread_attr and pthread functions. +// ---------------------------------------------------------------------------- + +// pthread_attr functions. +int pthread_attr_init(pthread_attr_t *); +int pthread_attr_destroy(pthread_attr_t *); + +int pthread_attr_getdetachstate(const pthread_attr_t *, int *); +int pthread_attr_setdetachstate(pthread_attr_t *, int); + +int pthread_attr_getstacksize(const pthread_attr_t *__restrict, size_t *__restrict); +int pthread_attr_setstacksize(pthread_attr_t *, size_t); + +int pthread_attr_getstackaddr(const pthread_attr_t *, void **); +int pthread_attr_setstackaddr(pthread_attr_t *, void *); + +int pthread_attr_getstack(const pthread_attr_t *, void **, size_t*); +int pthread_attr_setstack(pthread_attr_t *, void *, size_t); + +int pthread_attr_getguardsize(const pthread_attr_t *__restrict, size_t *__restrict); +int pthread_attr_setguardsize(pthread_attr_t *, size_t); + +int pthread_attr_getscope(const pthread_attr_t *, int*); +int pthread_attr_setscope(pthread_attr_t *, int); + +int pthread_attr_getschedparam(const pthread_attr_t *__restrict, struct sched_param *__restrict); +int pthread_attr_setschedparam(pthread_attr_t *__restrict, const struct sched_param *__restrict); + +int pthread_attr_getschedpolicy(const pthread_attr_t *__restrict, int *__restrict); +int pthread_attr_setschedpolicy(pthread_attr_t *__restrict, int); + +int pthread_attr_getinheritsched(const pthread_attr_t *__restrict, int *__restrict); +int pthread_attr_setinheritsched(pthread_attr_t *__restrict, int); + +int pthread_attr_getschedparam(const pthread_attr_t *__restrict, struct sched_param *__restrict); +int pthread_attr_setschedparam(pthread_attr_t *__restrict, const struct sched_param *__restrict); + +#if __MLIBC_LINUX_OPTION +int pthread_attr_getaffinity_np(const pthread_attr_t *__restrict, size_t, cpu_set_t *__restrict); +int pthread_attr_setaffinity_np(pthread_attr_t *__restrict, size_t, const cpu_set_t *__restrict); + +int pthread_attr_getsigmask_np(const pthread_attr_t *__restrict, sigset_t *__restrict); +int pthread_attr_setsigmask_np(pthread_attr_t *__restrict, const sigset_t *__restrict); + +int pthread_getattr_np(pthread_t, pthread_attr_t *); + +int pthread_getaffinity_np(pthread_t thread, size_t cpusetsize, cpu_set_t *cpuset); +int pthread_setaffinity_np(pthread_t thread, size_t cpusetsize, const cpu_set_t *cpuset); +#endif /* __MLIBC_LINUX_OPTION */ + +// pthread functions. +int pthread_create(pthread_t *__restrict, const pthread_attr_t *__restrict, + void *(*) (void *), void *__restrict); +pthread_t pthread_self(void); +int pthread_equal(pthread_t, pthread_t); +__attribute__ ((__noreturn__)) void pthread_exit(void *); + +int pthread_join(pthread_t, void **); +int pthread_detach(pthread_t); + +void pthread_cleanup_push(void (*) (void *), void *); +void pthread_cleanup_pop(int); + +int pthread_setname_np(pthread_t, const char *); +int pthread_getname_np(pthread_t, char *, size_t); + +int pthread_attr_setstack(pthread_attr_t *, void *, size_t); +int pthread_attr_getstack(const pthread_attr_t *, void **, size_t *); + +int pthread_getattr_np(pthread_t, pthread_attr_t *); + +int pthread_setschedparam(pthread_t, int, const struct sched_param *); +int pthread_getschedparam(pthread_t, int *, struct sched_param *); + +int pthread_setcanceltype(int, int *); +int pthread_setcancelstate(int, int *); +void pthread_testcancel(void); +int pthread_cancel(pthread_t); + +int pthread_atfork(void (*) (void), void (*) (void), void (*) (void)); + +// ---------------------------------------------------------------------------- +// pthread_key functions. +// ---------------------------------------------------------------------------- + +int pthread_key_create(pthread_key_t *, void (*) (void *)); +int pthread_key_delete(pthread_key_t); + +void *pthread_getspecific(pthread_key_t); +int pthread_setspecific(pthread_key_t, const void *); + +// ---------------------------------------------------------------------------- +// pthread_once functions. +// ---------------------------------------------------------------------------- + +int pthread_once(pthread_once_t *, void (*) (void)); + +// ---------------------------------------------------------------------------- +// pthread_mutexattr and pthread_mutex functions. +// ---------------------------------------------------------------------------- + +// pthread_mutexattr functions +int pthread_mutexattr_init(pthread_mutexattr_t *); +int pthread_mutexattr_destroy(pthread_mutexattr_t *); + +int pthread_mutexattr_gettype(const pthread_mutexattr_t *__restrict, int *__restrict); +int pthread_mutexattr_settype(pthread_mutexattr_t *, int); + +int pthread_mutexattr_getrobust(const pthread_mutexattr_t *__restrict, int *__restrict); +int pthread_mutexattr_setrobust(pthread_mutexattr_t *, int); + +int pthread_mutexattr_getpshared(const pthread_mutexattr_t *, int *); +int pthread_mutexattr_setpshared(pthread_mutexattr_t *, int); + +int pthread_mutexattr_getprotocol(const pthread_mutexattr_t *__restrict, int *__restrict); +int pthread_mutexattr_setprotocol(pthread_mutexattr_t *, int); + +int pthread_mutexattr_getprioceiling(const pthread_mutexattr_t *, int *); +int pthread_mutexattr_setprioceiling(pthread_mutexattr_t *, int); + +// pthread_mutex functions +int pthread_mutex_init(pthread_mutex_t *__restrict, const pthread_mutexattr_t *__restrict); +int pthread_mutex_destroy(pthread_mutex_t *); + +int pthread_mutex_lock(pthread_mutex_t *); +int pthread_mutex_trylock(pthread_mutex_t *); +int pthread_mutex_timedlock(pthread_mutex_t *__restrict, + const struct timespec *__restrict); +int pthread_mutex_unlock(pthread_mutex_t *); + +int pthread_mutex_consistent(pthread_mutex_t *); + +// ---------------------------------------------------------------------------- +// pthread_condattr and pthread_cond functions. +// ---------------------------------------------------------------------------- + +int pthread_condattr_init(pthread_condattr_t *); +int pthread_condattr_destroy(pthread_condattr_t *); + +int pthread_condattr_getclock(const pthread_condattr_t *__restrict, clockid_t *__restrict); +int pthread_condattr_setclock(pthread_condattr_t *, clockid_t); + +int pthread_condattr_getpshared(const pthread_condattr_t *__restrict, int *__restrict); +int pthread_condattr_setpshared(pthread_condattr_t *, int); + +int pthread_cond_init(pthread_cond_t *__restrict, const pthread_condattr_t *__restrict); +int pthread_cond_destroy(pthread_cond_t *); + +int pthread_cond_wait(pthread_cond_t *__restrict, pthread_mutex_t *__restrict); +int pthread_cond_timedwait(pthread_cond_t *__restrict, pthread_mutex_t *__restrict, + const struct timespec *__restrict); +int pthread_cond_signal(pthread_cond_t *); +int pthread_cond_broadcast(pthread_cond_t *); + +// ---------------------------------------------------------------------------- +// pthread_barrierattr and pthread_barrier functions. +// ---------------------------------------------------------------------------- + +int pthread_barrierattr_init(pthread_barrierattr_t *); +int pthread_barrierattr_destroy(pthread_barrierattr_t *); +int pthread_barrierattr_setpshared(pthread_barrierattr_t *, int); +int pthread_barrierattr_getpshared(const pthread_barrierattr_t *__restrict, + int *__restrict); + +int pthread_barrier_init(pthread_barrier_t *__restrict, const pthread_barrierattr_t *__restrict, + unsigned int); +int pthread_barrier_destroy(pthread_barrier_t *); + +int pthread_barrier_wait(pthread_barrier_t *); + +// ---------------------------------------------------------------------------- +// pthread_wrlockattr and pthread_rwlock functions. +// ---------------------------------------------------------------------------- + +int pthread_rwlockattr_init(pthread_rwlockattr_t *); +int pthread_rwlockattr_destroy(pthread_rwlockattr_t *); +int pthread_rwlockattr_setpshared(pthread_rwlockattr_t *, int); +int pthread_rwlockattr_getpshared(const pthread_rwlockattr_t *__restrict, + int *__restrict); + +int pthread_rwlock_init(pthread_rwlock_t *__restrict, const pthread_rwlockattr_t *__restrict); +int pthread_rwlock_destroy(pthread_rwlock_t *); +int pthread_rwlock_trywrlock(pthread_rwlock_t *); +int pthread_rwlock_wrlock(pthread_rwlock_t *); +int pthread_rwlock_tryrdlock(pthread_rwlock_t *); +int pthread_rwlock_rdlock(pthread_rwlock_t *); +int pthread_rwlock_unlock(pthread_rwlock_t *); + +int pthread_getcpuclockid(pthread_t, clockid_t *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _PTHREAD_H + diff --git a/lib/mlibc/options/posix/include/pwd.h b/lib/mlibc/options/posix/include/pwd.h new file mode 100644 index 0000000..b885f57 --- /dev/null +++ b/lib/mlibc/options/posix/include/pwd.h @@ -0,0 +1,45 @@ + +#ifndef _PWD_H +#define _PWD_H + +#include <abi-bits/uid_t.h> +#include <abi-bits/gid_t.h> +#include <bits/size_t.h> +#include <stdio.h> + +#ifdef __cplusplus +extern "C" { +#endif + +struct passwd { + char *pw_name; + char *pw_passwd; + uid_t pw_uid; + gid_t pw_gid; + char *pw_gecos; + char *pw_dir; + char *pw_shell; +}; + +#define NSS_BUFLEN_PASSWD 512 + +#ifndef __MLIBC_ABI_ONLY + +void endpwent(void); +struct passwd *getpwent(void); +struct passwd *getpwnam(const char *); +int getpwnam_r(const char *, struct passwd *, char *, size_t, struct passwd **); +struct passwd *getpwuid(uid_t); +int getpwuid_r(uid_t, struct passwd *, char *, size_t, struct passwd **); +void setpwent(void); +int putpwent(const struct passwd *, FILE *); +struct passwd *fgetpwent(FILE *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _PWD_H + diff --git a/lib/mlibc/options/posix/include/regex.h b/lib/mlibc/options/posix/include/regex.h new file mode 100644 index 0000000..b7f0a46 --- /dev/null +++ b/lib/mlibc/options/posix/include/regex.h @@ -0,0 +1,66 @@ +#ifndef _REGEX_H +#define _REGEX_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <stddef.h> + +typedef ptrdiff_t regoff_t; + +typedef struct re_pattern_buffer { + size_t re_nsub; + void *__opaque, *__padding[4]; + size_t __nsub2; + char __padding2; +} regex_t; + +typedef struct { + regoff_t rm_so; + regoff_t rm_eo; +} regmatch_t; + +// Flags for regcomp(). +#define REG_EXTENDED 1 +#define REG_ICASE 2 +#define REG_NEWLINE 4 +#define REG_NOSUB 8 + +// Flags for regexec(). +#define REG_NOTBOL 1 +#define REG_NOTEOL 2 + +// Errors for regcomp() and regexec(). +#define REG_OK 0 +#define REG_NOMATCH 1 +#define REG_BADPAT 2 +#define REG_ECOLLATE 3 +#define REG_ECTYPE 4 +#define REG_EESCAPE 5 +#define REG_ESUBREG 6 +#define REG_EBRACK 7 +#define REG_EPAREN 8 +#define REG_EBRACE 9 +#define REG_BADBR 10 +#define REG_ERANGE 11 +#define REG_ESPACE 12 +#define REG_BADRPT 13 + +// Obsolete in POSIX. +#define REG_ENOSYS -1 + +#ifndef __MLIBC_ABI_ONLY + +int regcomp(regex_t *__restrict, const char *__restrict, int); +int regexec(const regex_t *__restrict, const char *__restrict, size_t, regmatch_t *__restrict, int); +size_t regerror(int, const regex_t *__restrict, char *__restrict, size_t); +void regfree(regex_t *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/lib/mlibc/options/posix/include/sched.h b/lib/mlibc/options/posix/include/sched.h new file mode 100644 index 0000000..739d91e --- /dev/null +++ b/lib/mlibc/options/posix/include/sched.h @@ -0,0 +1,49 @@ + +#ifndef _SCHED_H +#define _SCHED_H + +#include <abi-bits/pid_t.h> +#include <bits/threads.h> +#include <bits/size_t.h> +#include <mlibc-config.h> + +// MISSING: time_t, struct timespec + +// MISSING: POSIX [PS], [SS] and [TSP] options + +#ifdef __cplusplus +extern "C" { +#endif + +#if __MLIBC_LINUX_OPTION +#include <bits/linux/linux_sched.h> +#include <bits/linux/cpu_set.h> +#endif + +#define SCHED_OTHER 0 +#define SCHED_FIFO 1 +#define SCHED_RR 2 +#define SCHED_BATCH 3 +#define SCHED_IDLE 5 +#define SCHED_DEADLINE 6 +#define SCHED_RESET_ON_FORK 0x40000000 + +#ifndef __MLIBC_ABI_ONLY + +int sched_yield(void); + +int sched_get_priority_max(int policy); +int sched_get_priority_min(int policy); + +int sched_setscheduler(pid_t pid, int policy, const struct sched_param *param); + +int sched_getparam(pid_t pid, struct sched_param *param); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SCHED_H + diff --git a/lib/mlibc/options/posix/include/search.h b/lib/mlibc/options/posix/include/search.h new file mode 100644 index 0000000..02e1913 --- /dev/null +++ b/lib/mlibc/options/posix/include/search.h @@ -0,0 +1,37 @@ + +#ifndef _SEARCH_H +#define _SEARCH_H + +#include <stddef.h> + +#ifdef __cplusplus +extern "C" { +#endif + +typedef enum { + preorder, + postorder, + endorder, + leaf +} VISIT; + +#ifndef __MLIBC_ABI_ONLY + +void *tsearch(const void *, void **, int(*compar)(const void *, const void *)); +void *tfind(const void *, void *const *, int (*compar)(const void *, const void *)); +void *tdelete(const void *, void **, int(*compar)(const void *, const void *)); +void twalk(const void *, void (*action)(const void *, VISIT, int)); +void tdestroy(void *, void (*free_node)(void *)); + +void *lsearch(const void *key, void *base, size_t *nelp, size_t width, + int (*compar)(const void *, const void *)); +void *lfind(const void *key, const void *base, size_t *nelp, + size_t width, int (*compar)(const void *, const void *)); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SEARCH_H diff --git a/lib/mlibc/options/posix/include/semaphore.h b/lib/mlibc/options/posix/include/semaphore.h new file mode 100644 index 0000000..877527f --- /dev/null +++ b/lib/mlibc/options/posix/include/semaphore.h @@ -0,0 +1,37 @@ +#ifndef _SEMAPHORE_H +#define _SEMAPHORE_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/ansi/time_t.h> +#include <bits/ansi/timespec.h> + +#define SEM_VALUE_MAX 0x7FFFFFFF +#define SEM_FAILED ((sem_t *) 0) + +typedef struct sem_ { + unsigned int __mlibc_count; +} sem_t; + +#ifndef __MLIBC_ABI_ONLY + +int sem_init(sem_t *sem, int pshared, unsigned int initial_count); +sem_t *sem_open(const char *, int, ...); +int sem_close(sem_t *sem); +int sem_unlink(const char *); +int sem_destroy(sem_t *sem); +int sem_wait(sem_t *sem); +int sem_trywait(sem_t *sem); +int sem_timedwait(sem_t *sem, const struct timespec *abstime); +int sem_post(sem_t *sem); +int sem_getvalue(sem_t *sem, int *sval); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif //_SEMAPHORE_H diff --git a/lib/mlibc/options/posix/include/spawn.h b/lib/mlibc/options/posix/include/spawn.h new file mode 100644 index 0000000..3ab2004 --- /dev/null +++ b/lib/mlibc/options/posix/include/spawn.h @@ -0,0 +1,82 @@ + +#ifndef _SPAWN_H +#define _SPAWN_H + +#include <abi-bits/signal.h> +#include <abi-bits/mode_t.h> +#include <abi-bits/pid_t.h> +#include <sched.h> + +#ifdef __cplusplus +extern "C" { +#endif + +typedef struct { + int __flags; + pid_t __pgrp; + sigset_t __def, __mask; + int __prio, __pol; + void *__fn; + char __pad[64 - sizeof(void *)]; +} posix_spawnattr_t; + +typedef struct { + int __pad0[2]; + void *__actions; + int __pad[16]; +} posix_spawn_file_actions_t; + +// MISSIG: sigset_t + +struct sched_param; + +#define POSIX_SPAWN_RESETIDS 1 +#define POSIX_SPAWN_SETPGROUP 2 +#define POSIX_SPAWN_SETSIGDEF 4 +#define POSIX_SPAWN_SETSIGMASK 8 +#define POSIX_SPAWN_SETSCHEDPARAM 16 +#define POSIX_SPAWN_SETSCHEDULER 32 +#define POSIX_SPAWN_USEVFORK 64 +#define POSIX_SPAWN_SETSID 128 + +#ifndef __MLIBC_ABI_ONLY + +int posix_spawn(pid_t *__restrict pid, const char *__restrict path, + const posix_spawn_file_actions_t *file_actions, + const posix_spawnattr_t *__restrict attrs, + char *const argv[], char *const envp[]); + +int posix_spawnattr_init(posix_spawnattr_t *attr); +int posix_spawnattr_destroy(posix_spawnattr_t *attr); +int posix_spawnattr_setflags(posix_spawnattr_t *attr, short flags); +int posix_spawnattr_setsigdefault(posix_spawnattr_t *__restrict attr, + const sigset_t *__restrict sigdefault); +int posix_spawnattr_setschedparam(posix_spawnattr_t *__restrict attr, + const struct sched_param *__restrict schedparam); +int posix_spawnattr_setschedpolicy(posix_spawnattr_t *attr, int schedpolicy); +int posix_spawnattr_setsigmask(posix_spawnattr_t *__restrict attr, + const sigset_t *__restrict sigmask); +int posix_spawnattr_setpgroup(posix_spawnattr_t *attr, pid_t pgroup); +int posix_spawn_file_actions_init(posix_spawn_file_actions_t *file_actions); +int posix_spawn_file_actions_destroy(posix_spawn_file_actions_t *file_actions); +int posix_spawn_file_actions_adddup2(posix_spawn_file_actions_t *file_actions, + int fildes, int newfildes); +int posix_spawn_file_actions_addclose(posix_spawn_file_actions_t *file_actions, + int fildes); +int posix_spawn_file_actions_addopen(posix_spawn_file_actions_t *__restrict file_actions, + int fildes, const char *__restrict path, int oflag, mode_t mode); +int posix_spawnp(pid_t *__restrict pid, const char *__restrict file, + const posix_spawn_file_actions_t *file_actions, + const posix_spawnattr_t *__restrict attrp, + char *const argv[], char *const envp[]); + +// MISSING: all other functions + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // SPAWN_H + diff --git a/lib/mlibc/options/posix/include/strings.h b/lib/mlibc/options/posix/include/strings.h new file mode 100644 index 0000000..a21c3d7 --- /dev/null +++ b/lib/mlibc/options/posix/include/strings.h @@ -0,0 +1,32 @@ + +#ifndef _STRINGS_H +#define _STRINGS_H + +#include <bits/size_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +char *index (const char *s, int c); +char *rindex(const char *s, int c); + +int ffs(int word); +int strcasecmp(const char *a, const char *b); +int strncasecmp(const char *a, const char *b, size_t size); + +/* Marked as obsolete in posix 2008 but used by at least tracker */ +int bcmp(const void *s1, const void *s2, size_t n); +void bcopy(const void *s1, void *s2, size_t n); +void bzero(void *s, size_t n); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _STRINGS_H + diff --git a/lib/mlibc/options/posix/include/sys/file.h b/lib/mlibc/options/posix/include/sys/file.h new file mode 100644 index 0000000..add43d3 --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/file.h @@ -0,0 +1,25 @@ + +#ifndef _SYS_FILE_H +#define _SYS_FILE_H + +#define LOCK_SH 1 +#define LOCK_EX 2 +#define LOCK_NB 4 +#define LOCK_UN 8 + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int flock(int, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_FILE_H + diff --git a/lib/mlibc/options/posix/include/sys/ipc.h b/lib/mlibc/options/posix/include/sys/ipc.h new file mode 100644 index 0000000..8318dde --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/ipc.h @@ -0,0 +1,53 @@ +#ifndef _SYS_IPC_H +#define _SYS_IPC_H + +#include <abi-bits/uid_t.h> +#include <abi-bits/gid_t.h> +#include <abi-bits/mode_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#define IPC_CREAT 01000 +#define IPC_EXCL 02000 +#define IPC_NOWAIT 04000 + +#define IPC_RMID 0 +#define IPC_SET 1 +#define IPC_STAT 2 +#define IPC_INFO 3 + +#define IPC_PRIVATE ((key_t) 0) + +#if defined(__aarch64__) || defined(__i386__) +#define IPC_64 0x100 +#elif defined(__x86_64__) || (defined(__riscv) && __riscv_xlen == 64) +#define IPC_64 0 +#else +#error "Unsupported arch!" +#endif + +typedef int key_t; + +struct ipc_perm { + key_t __ipc_perm_key; + uid_t uid; + gid_t gid; + uid_t cuid; + gid_t cgid; + mode_t mode; + int __ipc_perm_seq; +}; + +#ifndef __MLIBC_ABI_ONLY + +key_t ftok(const char *, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/lib/mlibc/options/posix/include/sys/mman.h b/lib/mlibc/options/posix/include/sys/mman.h new file mode 100644 index 0000000..784878e --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/mman.h @@ -0,0 +1,47 @@ +#ifndef _SYS_MMAN_H +#define _SYS_MMAN_H + +#include <mlibc-config.h> +#include <abi-bits/mode_t.h> +#include <abi-bits/vm-flags.h> +#include <bits/off_t.h> +#include <bits/size_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +void *mmap(void *, size_t, int, int, int, off_t); +int mprotect(void *, size_t, int); +int munmap(void *, size_t); + +int mlock(const void *, size_t); +int mlockall(int); +int munlock(const void *, size_t); +int munlockall(void); + +int posix_madvise(void *, size_t, int); +int msync(void *, size_t, int); + +int shm_open(const char *, int, mode_t); +int shm_unlink(const char *); + +// Linux extension: +void *mremap(void *, size_t, size_t, int, ...); +int remap_file_pages(void *, size_t, int, size_t, int); + +#if __MLIBC_LINUX_OPTION +int memfd_create(const char *, unsigned int); +int madvise(void *, size_t, int); +int mincore(void *, size_t, unsigned char *); +#endif /* __MLIBC_LINUX_OPTION */ + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_MMAN_H diff --git a/lib/mlibc/options/posix/include/sys/msg.h b/lib/mlibc/options/posix/include/sys/msg.h new file mode 100644 index 0000000..d602f76 --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/msg.h @@ -0,0 +1,27 @@ +#ifndef _SYS_MSG_H +#define _SYS_MSG_H + +#include <abi-bits/msg.h> +#include <bits/size_t.h> +#include <bits/ssize_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int msgget(key_t, int); + +int msgctl(int msqid, int cmd, struct msqid_ds *buf); + +ssize_t msgrcv(int, void *, size_t, long, int); +int msgsnd(int, const void *, size_t, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_MSG_H diff --git a/lib/mlibc/options/posix/include/sys/param.h b/lib/mlibc/options/posix/include/sys/param.h new file mode 100644 index 0000000..9bb4552 --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/param.h @@ -0,0 +1,36 @@ + +#ifndef _SYS_PARAM_H +#define _SYS_PARAM_H + +#include <endian.h> +#include <limits.h> + +#define NBBY CHAR_BIT +#define NGROUPS NGROUPS_MAX + +// Report the same value as Linux here. +#define MAXNAMLEN 255 +#define MAXPATHLEN 4096 +#define HOST_NAME_MAX 64 +#define MAXSYMLINKS 20 +#define MAXHOSTNAMELEN HOST_NAME_MAX + +#ifdef __cplusplus +extern "C" { +#endif + +#undef MIN +#define MIN(a,b) (((a) < (b)) ? (a) : (b)) +#undef MAX +#define MAX(a,b) (((a) > (b)) ? (a) : (b)) + +#define howmany(x, y) (((x) + ((y) - 1)) / (y)) + +#define roundup(x, y) ((((x) + ((y) - 1)) / (y)) * (y)) + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_PARAM_H + diff --git a/lib/mlibc/options/posix/include/sys/poll.h b/lib/mlibc/options/posix/include/sys/poll.h new file mode 100644 index 0000000..3edecab --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/poll.h @@ -0,0 +1,37 @@ +#ifndef _SYS_POLL_H +#define _SYS_POLL_H + +#include <bits/types.h> +#include <bits/sigset_t.h> +#include <bits/ansi/timespec.h> +#include <abi-bits/poll.h> +#include <abi-bits/signal.h> +#include <mlibc-config.h> + +typedef __mlibc_size nfds_t; + +#ifdef __cplusplus +extern "C" { +#endif + +struct pollfd { + int fd; + short events; + short revents; +}; + +#ifndef __MLIBC_ABI_ONLY + +int poll(struct pollfd *, nfds_t, int); + +#if __MLIBC_LINUX_OPTION +int ppoll(struct pollfd *fds, nfds_t nfds, const struct timespec *timeout_ts, const sigset_t *sigmask); +#endif // __MLIBC_LINUX_OPTION + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_POLL_H diff --git a/lib/mlibc/options/posix/include/sys/resource.h b/lib/mlibc/options/posix/include/sys/resource.h new file mode 100644 index 0000000..c5453e2 --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/resource.h @@ -0,0 +1,52 @@ +#ifndef _SYS_RESOURCE_H +#define _SYS_RESOURCE_H + +#include <abi-bits/pid_t.h> +#include <abi-bits/resource.h> +#include <bits/posix/id_t.h> +#include <abi-bits/suseconds_t.h> +#include <bits/ansi/time_t.h> +#include <bits/posix/timeval.h> + +#define PRIO_PROCESS 1 +#define PRIO_PGRP 2 +#define PRIO_USER 3 + +#define PRIO_MIN (-20) +#define PRIO_MAX 20 + +#define RLIM_INFINITY ((rlim_t)-1) +#define RLIM_SAVED_MAX ((rlim_t)-1) +#define RLIM_SAVED_CUR ((rlim_t)-1) + +#define RLIM_NLIMITS RLIMIT_NLIMITS + +#ifdef __cplusplus +extern "C" { +#endif + +typedef unsigned long rlim_t; + +struct rlimit { + rlim_t rlim_cur; + rlim_t rlim_max; +}; + +#ifndef __MLIBC_ABI_ONLY + +int getpriority(int, id_t); +int setpriority(int, id_t, int); + +int getrusage(int, struct rusage *); +int getrlimit(int, struct rlimit *); +int setrlimit(int, const struct rlimit *); + +int prlimit(pid_t pid, int resource, const struct rlimit *new_limits, struct rlimit *old_limits); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_RESOURCE_H diff --git a/lib/mlibc/options/posix/include/sys/select.h b/lib/mlibc/options/posix/include/sys/select.h new file mode 100644 index 0000000..85a15b0 --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/select.h @@ -0,0 +1,49 @@ + +#ifndef _SYS_SELECT_H +#define _SYS_SELECT_H + +#include <abi-bits/signal.h> + +#include <bits/ansi/time_t.h> +#include <bits/ansi/timespec.h> +#include <abi-bits/suseconds_t.h> +#include <bits/posix/timeval.h> +#include <bits/posix/fd_set.h> + +#define FD_SETSIZE 1024 + +#ifdef __cplusplus +extern "C" { +#endif + +typedef long int __fd_mask; +#define __NFDBITS (8 * (int) sizeof (__fd_mask)) + +typedef __fd_mask fd_mask; +#define NFDBITS __NFDBITS + +#ifndef __MLIBC_ABI_ONLY + +void __FD_CLR(int fd, fd_set *); +int __FD_ISSET(int fd, fd_set *); +void __FD_SET(int fd, fd_set *); +void __FD_ZERO(fd_set *); + +#define FD_CLR(fd, set) __FD_CLR(fd, set) +#define FD_ISSET(fd, set) __FD_ISSET(fd, set) +#define FD_SET(fd, set) __FD_SET(fd, set) +#define FD_ZERO(set) __FD_ZERO(set) + +int select(int, fd_set *__restrict, fd_set *__restrict, fd_set *__restrict, + struct timeval *__restrict); +int pselect(int, fd_set *, fd_set *, fd_set *, const struct timespec *, + const sigset_t *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_SELECT_H + diff --git a/lib/mlibc/options/posix/include/sys/sem.h b/lib/mlibc/options/posix/include/sys/sem.h new file mode 100644 index 0000000..cb3516a --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/sem.h @@ -0,0 +1,44 @@ +#ifndef _SYS_SEM_H +#define _SYS_SEM_H + +#include <bits/ansi/time_t.h> +#include <sys/ipc.h> +#include <stddef.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#define GETALL 13 +#define SETVAL 16 +#define SETALL 17 + +#define SEM_UNDO 0x1000 + +struct sembuf { + unsigned short int sem_num; + short int sem_op; + short int sem_flg; +}; + +struct semid_ds { + struct ipc_perm sem_perm; + time_t sem_otime; + time_t sem_ctime; + + unsigned long sem_nsems; +}; + +#ifndef __MLIBC_ABI_ONLY + +int semget(key_t, int, int); +int semop(int, struct sembuf *, size_t); +int semctl(int, int, int, ...); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_SEM_H diff --git a/lib/mlibc/options/posix/include/sys/shm.h b/lib/mlibc/options/posix/include/sys/shm.h new file mode 100644 index 0000000..3767ced --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/shm.h @@ -0,0 +1,83 @@ +#ifndef _SYS_SHM_H +#define _SYS_SHM_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <abi-bits/pid_t.h> +#include <abi-bits/shm.h> +#include <bits/size_t.h> +#include <time.h> + +#include <sys/ipc.h> + +#define SHM_R 0400 +#define SHM_W 0200 + +#define SHM_RDONLY 010000 +#define SHM_RND 020000 +#define SHM_REMAP 040000 +#define SHM_EXEC 0100000 + +#define SHM_LOCK 11 +#define SHM_UNLOCK 12 +#define SHM_STAT 13 +#define SHM_INFO 14 +#define SHM_STAT_ANY 15 +#define SHM_DEST 01000 +#define SHM_LOCKED 02000 +#define SHM_HUGETLB 04000 +#define SHM_NORESERVE 010000 + +#define SHM_HUGE_SHIFT 26 +#define SHM_HUGE_MASK 0x3f +#define SHM_HUGE_64KB (16 << 26) +#define SHM_HUGE_512KB (19 << 26) +#define SHM_HUGE_1MB (20 << 26) +#define SHM_HUGE_2MB (21 << 26) +#define SHM_HUGE_8MB (23 << 26) +#define SHM_HUGE_16MB (24 << 26) +#define SHM_HUGE_32MB (25 << 26) +#define SHM_HUGE_256MB (28 << 26) +#define SHM_HUGE_512MB (29 << 26) +#define SHM_HUGE_1GB (30 << 26) +#define SHM_HUGE_2GB (31 << 26) +#define SHM_HUGE_16GB (34U << 26) + +typedef unsigned long shmatt_t; + +struct shmid_ds { + struct ipc_perm shm_perm; + size_t shm_segsz; + time_t shm_atime; + time_t shm_dtime; + time_t shm_ctime; + pid_t shm_cpid; + pid_t shm_lpid; + unsigned long shm_nattch; +}; + +struct shminfo { + unsigned long shmmax; + unsigned long shmmin; + unsigned long shmmni; + unsigned long shmseg; + unsigned long shmall; + unsigned long __unused[4]; +}; + +#ifndef __MLIBC_ABI_ONLY + +void *shmat(int, const void *, int); +int shmctl(int, int, struct shmid_ds *); +int shmdt(const void *); +int shmget(key_t, size_t, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_SHM_H diff --git a/lib/mlibc/options/posix/include/sys/socket.h b/lib/mlibc/options/posix/include/sys/socket.h new file mode 100644 index 0000000..9552f93 --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/socket.h @@ -0,0 +1,105 @@ + +#ifndef _SOCKET_H +#define _SOCKET_H + +#include <abi-bits/gid_t.h> +#include <abi-bits/pid_t.h> +#include <bits/size_t.h> +#include <abi-bits/socklen_t.h> +#include <bits/ssize_t.h> +#include <abi-bits/uid_t.h> +#include <bits/posix/iovec.h> +#include <abi-bits/socket.h> +#include <bits/ansi/time_t.h> +#include <bits/ansi/timespec.h> + +#include <stddef.h> + +#ifdef __cplusplus +extern "C" { +#endif + +struct sockaddr { + sa_family_t sa_family; + char sa_data[14]; +}; + +// Control message format: +// The offsets marked with ^ are aligned to alignof(size_t). +// +// |---HEADER---|---DATA---|---PADDING---|---HEADER---|... +// ^ ^ ^ +// |---------CMSG_LEN------| +// |---------------CMSG_SPACE------------| + +// Auxiliary macro. While there is basically no reason for applications +// to use this, it is exported by glibc. +#define CMSG_ALIGN(s) (((s) + __alignof__(size_t) - 1) & \ + ~(__alignof__(size_t) - 1)) + +// Basic macros to return content and padding size of a control message. +#define CMSG_LEN(s) (CMSG_ALIGN(sizeof(struct cmsghdr)) + (s)) +#define CMSG_SPACE(s) (CMSG_ALIGN(sizeof(struct cmsghdr)) + CMSG_ALIGN(s)) + +// Provides access to the data of a control message. +#define CMSG_DATA(c) ((char *)(c) + CMSG_ALIGN(sizeof(struct cmsghdr))) + +#define __MLIBC_CMSG_NEXT(c) ((char *)(c) + CMSG_ALIGN((c)->cmsg_len)) +#define __MLIBC_MHDR_LIMIT(m) ((char *)(m)->msg_control + (m)->msg_controllen) + +// For parsing control messages only. +// Returns a pointer to the first header or nullptr if there is none. +#define CMSG_FIRSTHDR(m) ((size_t)(m)->msg_controllen <= sizeof(struct cmsghdr) \ + ? (struct cmsghdr *)0 : (struct cmsghdr *) (m)->msg_control) + +// For parsing control messages only. +// Returns a pointer to the next header or nullptr if there is none. +#define CMSG_NXTHDR(m, c) \ + ((c)->cmsg_len < sizeof(struct cmsghdr) || \ + (ptrdiff_t)(sizeof(struct cmsghdr) + CMSG_ALIGN((c)->cmsg_len)) \ + >= __MLIBC_MHDR_LIMIT(m) - (char *)(c) \ + ? (struct cmsghdr *)0 : (struct cmsghdr *)__MLIBC_CMSG_NEXT(c)) + +struct linger{ + int l_onoff; + int l_linger; +}; + +struct ucred { + pid_t pid; + uid_t uid; + gid_t gid; +}; + +#ifndef __MLIBC_ABI_ONLY + +int accept(int, struct sockaddr *__restrict, socklen_t *__restrict); +int accept4(int, struct sockaddr *__restrict, socklen_t *__restrict, int); +int bind(int, const struct sockaddr *, socklen_t); +int connect(int, const struct sockaddr *, socklen_t); +int getpeername(int, struct sockaddr *__restrict, socklen_t *__restrict); +int getsockname(int, struct sockaddr *__restrict, socklen_t *__restrict); +int getsockopt(int, int, int, void *__restrict, socklen_t *__restrict); +int listen(int, int); +ssize_t recv(int, void *, size_t, int); +ssize_t recvfrom(int, void *__restrict, size_t, int, struct sockaddr *__restrict, socklen_t *__restrict); +ssize_t recvmsg(int, struct msghdr *, int); +ssize_t send(int, const void *, size_t, int); +ssize_t sendmsg(int, const struct msghdr *, int); +ssize_t sendto(int, const void *, size_t, int, const struct sockaddr *, socklen_t); +int recvmmsg(int sockfd, struct mmsghdr *msgvec, unsigned int vlen, int flags, struct timespec *timeout); +int sendmmsg(int sockfd, struct mmsghdr *msgvec, unsigned int vlen, int flags); +int setsockopt(int, int, int, const void *, socklen_t); +int shutdown(int, int); +int sockatmark(int); +int socket(int, int, int); +int socketpair(int, int, int, int [2]); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _UNISTD_H + diff --git a/lib/mlibc/options/posix/include/sys/stat.h b/lib/mlibc/options/posix/include/sys/stat.h new file mode 100644 index 0000000..7159a77 --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/stat.h @@ -0,0 +1,37 @@ + +#ifndef _SYS_STAT_H +#define _SYS_STAT_H + +#include <bits/posix/stat.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int chmod(const char *, mode_t); +int fchmod(int, mode_t); +int fchmodat(int, const char *, mode_t, int); +int fstat(int fd, struct stat *result); +int fstatat(int, const char *__restrict, struct stat *__restrict, int); +int futimens(int fd, const struct timespec times[2]); +int lstat(const char *__restrict, struct stat *__restrict); +int mkdir(const char *, mode_t); +int mkdirat(int, const char *, mode_t); +int mkfifo(const char *, mode_t); +int mkfifoat(int, const char *, mode_t); +int mknod(const char *, mode_t, dev_t); +int mknodat(int, const char *, mode_t, dev_t); +int stat(const char *__restrict, struct stat *__restrict); +mode_t umask(mode_t); +int utimensat(int, const char *, const struct timespec times[2], int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_STAT_H + diff --git a/lib/mlibc/options/posix/include/sys/statvfs.h b/lib/mlibc/options/posix/include/sys/statvfs.h new file mode 100644 index 0000000..0e4c308 --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/statvfs.h @@ -0,0 +1,22 @@ +#ifndef _SYS_STATVFS_H +#define _SYS_STATVFS_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <abi-bits/statvfs.h> + +#ifndef __MLIBC_ABI_ONLY + +int statvfs(const char *__restrict, struct statvfs *__restrict); +int fstatvfs(int, struct statvfs *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_STATVFS_H + diff --git a/lib/mlibc/options/posix/include/sys/syslog.h b/lib/mlibc/options/posix/include/sys/syslog.h new file mode 100644 index 0000000..7761ece --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/syslog.h @@ -0,0 +1 @@ +#include <syslog.h> diff --git a/lib/mlibc/options/posix/include/sys/termios.h b/lib/mlibc/options/posix/include/sys/termios.h new file mode 100644 index 0000000..b23f171 --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/termios.h @@ -0,0 +1,6 @@ + +#ifndef _SYS_TERMIOS_H +#define _SYS_TERMIOS_H +#include <termios.h> +#endif // _SYS_TERMIOS_H + diff --git a/lib/mlibc/options/posix/include/sys/time.h b/lib/mlibc/options/posix/include/sys/time.h new file mode 100644 index 0000000..838d7cc --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/time.h @@ -0,0 +1,68 @@ +#ifndef _SYS_TIME_H +#define _SYS_TIME_H + +#include <abi-bits/time.h> +#include <abi-bits/signal.h> +#include <abi-bits/clockid_t.h> +#include <bits/ansi/time_t.h> +#include <abi-bits/suseconds_t.h> +#include <bits/posix/timer_t.h> +#include <bits/posix/timeval.h> + +#include <sys/select.h> + +#ifdef __cplusplus +extern "C" { +#endif + +struct timezone { + int tz_minuteswest; + int tz_dsttime; +}; + +#ifndef __MLIBC_ABI_ONLY + +// TODO: this function is [OB]. disable it by default and add a macro to enable it +int gettimeofday(struct timeval *__restrict result, void *__restrict unused); +int settimeofday(const struct timeval *result, const struct timezone *zone); + +void timeradd(const struct timeval *a, const struct timeval *b, struct timeval *res); +void timersub(const struct timeval *a, const struct timeval *b, struct timeval *res); +void timerclear(struct timeval *tvp); +int timerisset(struct timeval *tvp); + +#endif /* !__MLIBC_ABI_ONLY */ + +// timercmp taken from musl +#define timercmp(s,t,op) ((s)->tv_sec == (t)->tv_sec ? \ + (s)->tv_usec op (t)->tv_usec : (s)->tv_sec op (t)->tv_sec) + +#ifndef __MLIBC_ABI_ONLY + +int getitimer(int which, struct itimerval *curr_value); +int setitimer(int which, const struct itimerval *new_value, + struct itimerval *old_value); + +int timer_create(clockid_t clockid, struct sigevent *__restrict sevp, timer_t *__restrict timerid); +int timer_settime(timer_t timerid, int flags, const struct itimerspec *__restrict new_value, + struct itimerspec *__restrict old_value); +int timer_gettime(timer_t timerid, struct itimerspec *curr_value); +int timer_delete(timer_t timerid); + +#endif /* !__MLIBC_ABI_ONLY */ + +// The following 2 macros are taken from musl +#define TIMEVAL_TO_TIMESPEC(tv, ts) ( \ + (ts)->tv_sec = (tv)->tv_sec, \ + (ts)->tv_nsec = (tv)->tv_usec * 1000, \ + (void)0 ) +#define TIMESPEC_TO_TIMEVAL(tv, ts) ( \ + (tv)->tv_sec = (ts)->tv_sec, \ + (tv)->tv_usec = (ts)->tv_nsec / 1000, \ + (void)0 ) + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_TIME_H diff --git a/lib/mlibc/options/posix/include/sys/times.h b/lib/mlibc/options/posix/include/sys/times.h new file mode 100644 index 0000000..2dd2889 --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/times.h @@ -0,0 +1,28 @@ +#ifndef _SYS_TIMES_H +#define _SYS_TIMES_H + +// TODO: Only define the clock_t type. +#include <time.h> + +#ifdef __cplusplus +extern "C" { +#endif + +struct tms { + clock_t tms_utime; + clock_t tms_stime; + clock_t tms_cutime; + clock_t tms_cstime; +}; + +#ifndef __MLIBC_ABI_ONLY + +clock_t times(struct tms *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_TIMES_H diff --git a/lib/mlibc/options/posix/include/sys/ttydefaults.h b/lib/mlibc/options/posix/include/sys/ttydefaults.h new file mode 100644 index 0000000..c6d04f6 --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/ttydefaults.h @@ -0,0 +1,39 @@ + +#ifndef _SYS_TTYDEFAULTS_H +#define _SYS_TTYDEFAULTS_H + +// Values taken from musl + +#define TTYDEF_IFLAG (BRKINT | ISTRIP | ICRNL | IMAXBEL | IXON | IXANY) +#define TTYDEF_OFLAG (OPOST | ONLCR | XTABS) +#define TTYDEF_LFLAG (ECHO | ICANON | ISIG | IEXTEN | ECHOE|ECHOKE|ECHOCTL) +#define TTYDEF_CFLAG (CREAD | CS7 | PARENB | HUPCL) +#define TTYDEF_SPEED (B9600) + +#define CTRL(x) ((x) & 037) +#define CEOF CTRL('d') + +#define CEOL '\0' +#define CEOL2 '\0' +#define CSTATUS '\0' + +#define CERASE 0177 +#define CINTR CTRL('c') +#define CKILL CTRL('u') +#define CMIN 1 +#define CQUIT 034 +#define CSUSP CTRL('z') +#define CTIME 0 +#define CDSUSP CTRL('y') +#define CSTART CTRL('q') +#define CSTOP CTRL('s') +#define CLNEXT CTRL('v') +#define CDISCARD CTRL('o') +#define CWERASE CTRL('w') +#define CREPRINT CTRL('r') +#define CEOT CEOF +#define CBRK CEOL +#define CRPRNT CREPRINT +#define CFLUSH CDISCARD + +#endif // _SYS_TTYDEFAULTS_H diff --git a/lib/mlibc/options/posix/include/sys/types.h b/lib/mlibc/options/posix/include/sys/types.h new file mode 100644 index 0000000..ad837fc --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/types.h @@ -0,0 +1,53 @@ + +#ifndef _SYS_TYPES_H +#define _SYS_TYPES_H + +#include <bits/size_t.h> +#include <bits/ssize_t.h> +#include <bits/off_t.h> + +#include <bits/posix/id_t.h> +#include <abi-bits/uid_t.h> +#include <abi-bits/gid_t.h> +#include <abi-bits/pid_t.h> + +#include <abi-bits/mode_t.h> +#include <abi-bits/dev_t.h> +#include <abi-bits/ino_t.h> +#include <abi-bits/blksize_t.h> +#include <abi-bits/blkcnt_t.h> +#include <abi-bits/nlink_t.h> + +#include <bits/ansi/time_t.h> +#include <abi-bits/suseconds_t.h> + +#include <abi-bits/fsblkcnt_t.h> +#include <abi-bits/fsfilcnt_t.h> +#include <bits/posix/fd_set.h> + +#include <stdint.h> + +#include <sys/select.h> + +typedef unsigned int u_int; +typedef unsigned char u_char; +typedef unsigned short u_short; +typedef unsigned long int u_long; +typedef char *caddr_t; +typedef off64_t loff_t; + +typedef unsigned long int ulong; +typedef unsigned short int ushort; +typedef unsigned int uint; + +typedef uint8_t u_int8_t; +typedef uint16_t u_int16_t; +typedef uint32_t u_int32_t; +typedef uint64_t u_int64_t; + +// BSD extensions +typedef int64_t quad_t; +typedef uint64_t u_quad_t; + +#endif // _SYS_TYPES_H + diff --git a/lib/mlibc/options/posix/include/sys/uio.h b/lib/mlibc/options/posix/include/sys/uio.h new file mode 100644 index 0000000..04679a6 --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/uio.h @@ -0,0 +1,31 @@ +#ifndef _SYS_UIO_H +#define _SYS_UIO_H + +#include <bits/posix/iovec.h> +#include <bits/ssize_t.h> +#include <bits/off_t.h> +#include <bits/size_t.h> +#include <limits.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#define UIO_MAXIOV IOV_MAX + +#ifndef __MLIBC_ABI_ONLY + +ssize_t readv(int fd, const struct iovec *iov, int iovcnt); +ssize_t writev(int fd, const struct iovec *iov, int iovcnt); + +// Non standard extensions, also found on modern BSD's +ssize_t preadv(int fd, const struct iovec *iov, int iovcnt, off_t offset); +ssize_t pwritev(int fd, const struct iovec *iov, int iovcnt, off_t offset); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_UIO_H diff --git a/lib/mlibc/options/posix/include/sys/un.h b/lib/mlibc/options/posix/include/sys/un.h new file mode 100644 index 0000000..bb9b5ad --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/un.h @@ -0,0 +1,24 @@ + +#ifndef _SYS_UN_H +#define _SYS_UN_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <abi-bits/socket.h> + +struct sockaddr_un { + sa_family_t sun_family; + char sun_path[108]; +}; + +// Evaluate to actual length of the `sockaddr_un' structure. +#define SUN_LEN(ptr) ((size_t) offsetof(struct sockaddr_un, sun_path) + strlen((ptr)->sun_path)) + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_UN_H + diff --git a/lib/mlibc/options/posix/include/sys/utsname.h b/lib/mlibc/options/posix/include/sys/utsname.h new file mode 100644 index 0000000..bd7b174 --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/utsname.h @@ -0,0 +1,22 @@ + +#ifndef _SYS_UTSNAME_H +#define _SYS_UTSNAME_H + +#include <abi-bits/utsname.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +int uname(struct utsname *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_UTSNAME_H + diff --git a/lib/mlibc/options/posix/include/sys/wait.h b/lib/mlibc/options/posix/include/sys/wait.h new file mode 100644 index 0000000..5081041 --- /dev/null +++ b/lib/mlibc/options/posix/include/sys/wait.h @@ -0,0 +1,40 @@ + +#ifndef _SYS_WAIT_H +#define _SYS_WAIT_H + +#include <bits/posix/id_t.h> +#include <abi-bits/pid_t.h> +// for siginfo_t +#include <abi-bits/signal.h> +#include <abi-bits/wait.h> + +#ifdef __cplusplus +extern "C" { +#endif + +// According to POSIX, <sys/wait.h> does not make rusage available. +struct rusage; + +// TODO: move to own file and include in sys/types.h +typedef enum { + P_ALL, P_PID, P_PGID +} idtype_t; + +#ifndef __MLIBC_ABI_ONLY + +pid_t wait(int *status); +int waitid(idtype_t idtype, id_t id, siginfo_t *siginfo, int flags); +pid_t waitpid(pid_t pid, int *status, int flags); + +// GNU extensions. +pid_t wait3(int *, int, struct rusage *); +pid_t wait4(pid_t pid, int *status, int options, struct rusage *ru); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYS_WAIT_H + diff --git a/lib/mlibc/options/posix/include/syslog.h b/lib/mlibc/options/posix/include/syslog.h new file mode 100644 index 0000000..6c258cf --- /dev/null +++ b/lib/mlibc/options/posix/include/syslog.h @@ -0,0 +1,75 @@ + +#ifndef _SYSLOG_H +#define _SYSLOG_H + +#include <stdarg.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#define LOG_PID 0x01 +#define LOG_CONS 0x02 +#define LOG_NDELAY 0x08 +#define LOG_ODELAY 0x04 +#define LOG_NOWAIT 0x10 +#define LOG_PERROR 0x20 + +#define LOG_KERN (0<<3) +#define LOG_USER (1<<3) +#define LOG_MAIL (2<<3) +#define LOG_DAEMON (3<<3) +#define LOG_AUTH (4<<3) +#define LOG_SYSLOG (5<<3) +#define LOG_LPR (6<<3) +#define LOG_NEWS (7<<3) +#define LOG_UUCP (8<<3) +#define LOG_CRON (9<<3) +#define LOG_AUTHPRIV (10<<3) +#define LOG_FTP (11<<3) + +#define LOG_LOCAL0 (16<<3) +#define LOG_LOCAL1 (17<<3) +#define LOG_LOCAL2 (18<<3) +#define LOG_LOCAL3 (19<<3) +#define LOG_LOCAL4 (20<<3) +#define LOG_LOCAL5 (21<<3) +#define LOG_LOCAL6 (22<<3) +#define LOG_LOCAL7 (23<<3) + +#define LOG_PRIMASK 7 +#define LOG_PRI(p) ((p)&LOG_PRIMASK) +#define LOG_MAKEPRI(f, p) (((f)<<3) | (p)) +#define LOG_MASK(p) (1<<(p)) +#define LOG_UPTO(p) ((1<<((p)+1))-1) +#define LOG_NFACILITIES 24 +#define LOG_FACMASK (0x7F<<3) +#define LOG_FAC(p) (((p)&LOG_FACMASK)>>3) + +#define LOG_EMERG 0 +#define LOG_ALERT 1 +#define LOG_CRIT 2 +#define LOG_ERR 3 +#define LOG_WARNING 4 +#define LOG_NOTICE 5 +#define LOG_INFO 6 +#define LOG_DEBUG 7 + +#ifndef __MLIBC_ABI_ONLY + +void closelog(void); +void openlog(const char *, int, int); +int setlogmask(int); +void syslog(int, const char *, ...); + +// This is a linux extension +void vsyslog(int, const char *, va_list); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SYSLOG_H + diff --git a/lib/mlibc/options/posix/include/termios.h b/lib/mlibc/options/posix/include/termios.h new file mode 100644 index 0000000..a5a6a2f --- /dev/null +++ b/lib/mlibc/options/posix/include/termios.h @@ -0,0 +1,100 @@ + +#ifndef _TERMIOS_H +#define _TERMIOS_H + +#include <abi-bits/pid_t.h> +#include <abi-bits/termios.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/winsize.h> + +#if defined(_GNU_SOURCE) || defined(_BSD_SOURCE) +#include <sys/ttydefaults.h> +#endif + +// baud rate constants for speed_t +#define B0 0 +#define B50 1 +#define B75 2 +#define B110 3 +#define B134 4 +#define B150 5 +#define B200 6 +#define B300 7 +#define B600 8 +#define B1200 9 +#define B1800 10 +#define B2400 11 +#define B4800 12 +#define B9600 13 +#define B19200 14 +#define B38400 15 +#define B57600 0010001 +#define B115200 0010002 +#define B230400 0010003 +#define B460800 0010004 +#define B500000 0010005 +#define B576000 0010006 +#define B921600 0010007 +#define B1000000 0010010 +#define B1152000 0010011 +#define B1500000 0010012 +#define B2000000 0010013 +#define B2500000 0010014 +#define B3000000 0010015 +#define B3500000 0010016 +#define B4000000 0010017 + +// constants for tcsetattr() +#define TCSANOW 0 +#define TCSADRAIN 1 +#define TCSAFLUSH 2 + +// constants for tcflush() +#define TCIFLUSH 0 +#define TCOFLUSH 1 +#define TCIOFLUSH 2 + +// constants for tcflow() +#define TCOOFF 0 +#define TCOON 1 +#define TCIOFF 2 +#define TCION 3 + +#define TIOCM_DTR 0x002 +#define TIOCM_RTS 0x004 + +#ifndef __MLIBC_ABI_ONLY + +speed_t cfgetispeed(const struct termios *); +speed_t cfgetospeed(const struct termios *); +int cfsetispeed(struct termios *, speed_t); +int cfsetospeed(struct termios *, speed_t); +void cfmakeraw(struct termios *); +int tcdrain(int); +int tcflow(int, int); +int tcflush(int, int); +int tcgetattr(int fd, struct termios *attr); +pid_t tcgetsid(int); +int tcsendbreak(int, int); +int tcsetattr(int, int, const struct termios *); + +#endif /* !__MLIBC_ABI_ONLY */ + +// This is a linux extension + +#define TIOCGPGRP 0x540F +#define TIOCSPGRP 0x5410 +#define TIOCGWINSZ 0x5413 +#define TIOCSWINSZ 0x5414 +#define TIOCGSID 0x5429 + +#ifdef __cplusplus +} +#endif + +#endif // _TERMIOS_H + diff --git a/lib/mlibc/options/posix/include/ucontext.h b/lib/mlibc/options/posix/include/ucontext.h new file mode 100644 index 0000000..c50b0b1 --- /dev/null +++ b/lib/mlibc/options/posix/include/ucontext.h @@ -0,0 +1,23 @@ +#ifndef _UCONTEXT_H +#define _UCONTEXT_H + +#include <signal.h> + +#ifdef __cplusplus +extern "C" { +#endif // __cplusplus + +#ifndef __MLIBC_ABI_ONLY + +int getcontext(ucontext_t *); +int setcontext(const ucontext_t *); +void makecontext(ucontext_t *, void (*)(void), int, ...); +int swapcontext(ucontext_t *, const ucontext_t *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif // __cplusplus + +#endif // _UCONTEXT_H diff --git a/lib/mlibc/options/posix/include/unistd.h b/lib/mlibc/options/posix/include/unistd.h new file mode 100644 index 0000000..d29257d --- /dev/null +++ b/lib/mlibc/options/posix/include/unistd.h @@ -0,0 +1,360 @@ + +#ifndef _UNISTD_H +#define _UNISTD_H + +#include <mlibc-config.h> +#include <bits/types.h> +#include <bits/size_t.h> +#include <bits/ssize_t.h> +#include <bits/off_t.h> +#include <bits/types.h> +#include <abi-bits/access.h> +#include <abi-bits/uid_t.h> +#include <abi-bits/gid_t.h> +#include <abi-bits/pid_t.h> +#include <abi-bits/seek-whence.h> + +#if __MLIBC_SYSDEP_HAS_BITS_SYSCALL_H && __MLIBC_LINUX_OPTION +#include <bits/syscall.h> +#endif /* __MLIBC_SYSDEP_HAS_BITS_SYSCALL_H && __MLIBC_LINUX_OPTION */ + +#ifdef __cplusplus +extern "C" { +#endif + +#define _POSIX_VERSION 200809L +#define _POSIX2_VERSION _POSIX_VERSION +#define _XOPEN_VERSION 700 + +#define _POSIX_FSYNC _POSIX_VERSION +#define _POSIX_IPV6 _POSIX_VERSION +#define _POSIX_JOB_CONTROL 1 +#define _POSIX_SAVED_IDS 1 +#define _POSIX_SHELL 1 +#define _POSIX_SPAWN _POSIX_VERSION +#define _POSIX_THREADS _POSIX_VERSION +#define _POSIX_THREAD_SAFE_FUNCTIONS _POSIX_VERSION +#define _POSIX_MONOTONIC_CLOCK 0 + +#if __MLIBC_CRYPT_OPTION +#define _XOPEN_CRYPT 1 +#endif + +// MISSING: additional _POSIX and _XOPEN feature macros +// MISSING: _POSIX_TIMESTAMP_RESOLUTION and _POSIX2_SYMLINKS + +#define _CS_PATH 0 +#define _CS_POSIX_V6_WIDTH_RESTRICTED_ENVS 1 +#define _CS_GNU_LIBC_VERSION 2 +#define _CS_GNU_LIBPTHREAD_VERSION 3 +#define _CS_POSIX_V5_WIDTH_RESTRICTED_ENVS 4 +#define _CS_POSIX_V7_WIDTH_RESTRICTED_ENVS 5 + +#define _CS_POSIX_V6_ILP32_OFF32_CFLAGS 1116 +#define _CS_POSIX_V6_ILP32_OFF32_LDFLAGS 1117 +#define _CS_POSIX_V6_ILP32_OFF32_LIBS 1118 +#define _CS_POSIX_V6_ILP32_OFF32_LINTFLAGS 1119 +#define _CS_POSIX_V6_ILP32_OFFBIG_CFLAGS 1120 +#define _CS_POSIX_V6_ILP32_OFFBIG_LDFLAGS 1121 +#define _CS_POSIX_V6_ILP32_OFFBIG_LIBS 1122 +#define _CS_POSIX_V6_ILP32_OFFBIG_LINTFLAGS 1123 +#define _CS_POSIX_V6_LP64_OFF64_CFLAGS 1124 +#define _CS_POSIX_V6_LP64_OFF64_LDFLAGS 1125 +#define _CS_POSIX_V6_LP64_OFF64_LIBS 1126 +#define _CS_POSIX_V6_LP64_OFF64_LINTFLAGS 1127 +#define _CS_POSIX_V6_LPBIG_OFFBIG_CFLAGS 1128 +#define _CS_POSIX_V6_LPBIG_OFFBIG_LDFLAGS 1129 +#define _CS_POSIX_V6_LPBIG_OFFBIG_LIBS 1130 +#define _CS_POSIX_V6_LPBIG_OFFBIG_LINTFLAGS 1131 +#define _CS_POSIX_V7_ILP32_OFF32_CFLAGS 1132 +#define _CS_POSIX_V7_ILP32_OFF32_LDFLAGS 1133 +#define _CS_POSIX_V7_ILP32_OFF32_LIBS 1134 +#define _CS_POSIX_V7_ILP32_OFF32_LINTFLAGS 1135 +#define _CS_POSIX_V7_ILP32_OFFBIG_CFLAGS 1136 +#define _CS_POSIX_V7_ILP32_OFFBIG_LDFLAGS 1137 +#define _CS_POSIX_V7_ILP32_OFFBIG_LIBS 1138 +#define _CS_POSIX_V7_ILP32_OFFBIG_LINTFLAGS 1139 +#define _CS_POSIX_V7_LP64_OFF64_CFLAGS 1140 +#define _CS_POSIX_V7_LP64_OFF64_LDFLAGS 1141 +#define _CS_POSIX_V7_LP64_OFF64_LIBS 1142 +#define _CS_POSIX_V7_LP64_OFF64_LINTFLAGS 1143 +#define _CS_POSIX_V7_LPBIG_OFFBIG_CFLAGS 1144 +#define _CS_POSIX_V7_LPBIG_OFFBIG_LDFLAGS 1145 +#define _CS_POSIX_V7_LPBIG_OFFBIG_LIBS 1146 +#define _CS_POSIX_V7_LPBIG_OFFBIG_LINTFLAGS 1147 +#define _CS_V6_ENV 1148 +#define _CS_V7_ENV 1149 + +// MISSING: SEEK macros from stdio.h + +#define F_LOCK 1 +#define F_TEST 2 +#define F_TLOCK 3 +#define F_ULOCK 4 + +// MISSING: _PC macros +// For now, use the Linux ABI for _PC constants. +#define _PC_LINK_MAX 0 +#define _PC_MAX_CANON 1 +#define _PC_MAX_INPUT 2 +#define _PC_NAME_MAX 3 +#define _PC_PATH_MAX 4 +#define _PC_PIPE_BUF 5 +#define _PC_CHOWN_RESTRICTED 6 +#define _PC_NO_TRUNC 7 +#define _PC_VDISABLE 8 + +#define _PC_FILESIZEBITS 9 +#define _PC_SYMLINK_MAX 10 + +// MISSING: remaining _SC_macros +#define _SC_ARG_MAX 0 +#define _SC_GETPW_R_SIZE_MAX 1 +#define _SC_PHYS_PAGES 2 +#define _SC_PAGE_SIZE 3 +#define _SC_PAGESIZE _SC_PAGE_SIZE +#define _SC_OPEN_MAX 5 +#define _SC_NPROCESSORS_ONLN 6 +#define _SC_GETGR_R_SIZE_MAX 7 + +#define _SC_CHILD_MAX 8 +#define _SC_CLK_TCK 9 +#define _SC_NGROUPS_MAX 10 +#define _SC_VERSION 11 +#define _SC_SAVED_IDS 12 +#define _SC_JOB_CONTROL 13 +#define _SC_HOST_NAME_MAX 14 +#define _SC_LINE_MAX 15 +#define _SC_XOPEN_CRYPT 16 +#define _SC_NPROCESSORS_CONF 17 +#define _SC_SYMLOOP_MAX 18 +#define _SC_TTY_NAME_MAX 19 +#define _SC_RE_DUP_MAX 20 + +#define _SC_ATEXIT_MAX 21 +#define _SC_LOGIN_NAME_MAX 22 +#define _SC_THREAD_DESTRUCTOR_ITERATIONS 23 +#define _SC_THREAD_KEYS_MAX 24 +#define _SC_THREAD_STACK_MIN 25 +#define _SC_THREAD_THREADS_MAX 26 +#define _SC_TZNAME_MAX 27 +#define _SC_ASYNCHRONOUS_IO 28 +#define _SC_FSYNC 29 +#define _SC_MAPPED_FILES 30 +#define _SC_MEMLOCK 31 +#define _SC_MEMLOCK_RANGE 32 +#define _SC_MEMORY_PROTECTION 33 +#define _SC_MESSAGE_PASSING 34 +#define _SC_PRIORITY_SCHEDULING 35 +#define _SC_REALTIME_SIGNALS 36 +#define _SC_SEMAPHORES 37 +#define _SC_SHARED_MEMORY_OBJECTS 38 +#define _SC_SYNCHRONIZED_IO 39 +#define _SC_THREADS 40 +#define _SC_THREAD_ATTR_STACKADDR 41 +#define _SC_THREAD_ATTR_STACKSIZE 42 +#define _SC_THREAD_PRIORITY_SCHEDULING 43 +#define _SC_THREAD_PRIO_INHERIT 44 +#define _SC_THREAD_PRIO_PROTECT 45 +#define _SC_THREAD_PROCESS_SHARED 46 +#define _SC_THREAD_SAFE_FUNCTIONS 47 +#define _SC_TIMERS 48 +#define _SC_TIMER_MAX 49 +#define _SC_2_CHAR_TERM 50 +#define _SC_2_C_BIND 51 +#define _SC_2_C_DEV 52 +#define _SC_2_FORT_DEV 53 +#define _SC_2_FORT_RUN 54 +#define _SC_2_LOCALEDEF 55 +#define _SC_2_SW_DEV 56 +#define _SC_2_UPE 57 +#define _SC_2_VERSION 58 +#define _SC_CLOCK_SELECTION 59 +#define _SC_CPUTIME 60 +#define _SC_THREAD_CPUTIME 61 +#define _SC_MONOTONIC_CLOCK 62 +#define _SC_READER_WRITER_LOCKS 63 +#define _SC_SPIN_LOCKS 64 +#define _SC_REGEXP 65 +#define _SC_SHELL 66 +#define _SC_SPAWN 67 +#define _SC_2_PBS 68 +#define _SC_2_PBS_ACCOUNTING 69 +#define _SC_2_PBS_LOCATE 70 +#define _SC_2_PBS_TRACK 71 +#define _SC_2_PBS_MESSAGE 72 +#define _SC_STREAM_MAX 73 +#define _SC_AIO_LISTIO_MAX 74 +#define _SC_AIO_MAX 75 +#define _SC_DELAYTIMER_MAX 76 +#define _SC_MQ_OPEN_MAX 77 +#define _SC_MQ_PRIO_MAX 78 +#define _SC_RTSIG_MAX 79 +#define _SC_SIGQUEUE_MAX 80 +#define _SC_IOV_MAX 81 + +#define STDERR_FILENO 2 +#define STDIN_FILENO 0 +#define STDOUT_FILENO 1 + +#define _POSIX_VDISABLE '\0' + +#define L_ctermid 20 + +#ifndef intptr_t +typedef __mlibc_intptr intptr_t; +#endif + +#ifndef __MLIBC_ABI_ONLY + +int access(const char *path, int mode); +unsigned int alarm(unsigned int seconds); +int chdir(const char *path); +int chown(const char *path, uid_t uid, gid_t gid); +int close(int fd); +ssize_t confstr(int, char *, size_t); +char *ctermid(char *s); +int dup(int fd); +int dup2(int src_fd, int dest_fd); +__attribute__((__noreturn__)) void _exit(int status); +void endusershell(void); +int execl(const char *, const char *, ...); +int execle(const char *, const char *, ...); +int execlp(const char *, const char *, ...); +int execv(const char *, char *const []); +int execve(const char *path, char *const argv[], char *const envp[]); +int execvp(const char *, char *const[]); +int execvpe(const char *path, char *const argv[], char *const envp[]); +int faccessat(int, const char *, int, int); +int fchdir(int fd); +int fchown(int fd, uid_t uid, gid_t gid); +int fchownat(int fd, const char *path, uid_t uid, gid_t gid, int flags); +int fdatasync(int); +int fexecve(int, char *const [], char *const []); +pid_t fork(void); +pid_t vfork(void); +long fpathconf(int, int); +int fsync(int); +int ftruncate(int, off_t); +char *getcwd(char *, size_t); +gid_t getegid(void); +uid_t geteuid(void); +gid_t getgid(void); +int getgroups(int, gid_t []); +long gethostid(void); +int gethostname(char *buffer, size_t max_length); +int sethostname(const char *buffer, size_t max_length); +char *getlogin(void); +int getlogin_r(char *, size_t); +int getopt(int, char *const [], const char *); +char *getpass(const char *); +pid_t getpgid(pid_t); +pid_t getpgrp(void); +pid_t getpid(void); +pid_t getppid(void); +pid_t getsid(pid_t); +uid_t getuid(void); +char *getusershell(void); +int isatty(int fd); +int lchown(const char *path, uid_t uid, gid_t gid); +int link(const char *, const char *); +int linkat(int, const char *, int, const char *, int); +int lockf(int, int, off_t); +off_t lseek(int fd, off_t offset, int whence); +off64_t lseek64(int fd, off64_t offset, int whence); +int nice(int); +long pathconf(const char *, int); +int pause(void); +int pipe(int [2]); +ssize_t pread(int, void *, size_t, off_t); +ssize_t pwrite(int, const void *, size_t, off_t); +ssize_t read(int fd, void *buffer, size_t size); +ssize_t readlink(const char *__restrict, char *__restrict, size_t); +ssize_t readlinkat(int, const char *__restrict, char *__restrict, size_t); +int rmdir(const char *); +int setegid(gid_t); +int seteuid(uid_t); +int setgid(gid_t); +int setpgid(pid_t, pid_t); +pid_t setpgrp(void); +int setregid(gid_t, gid_t); +int setreuid(uid_t, uid_t); +pid_t setsid(void); +int setuid(uid_t); +void setusershell(void); +unsigned int sleep(unsigned int); +void swab(const void *__restrict, void *__restrict, ssize_t); +int symlink(const char *, const char *); +int symlinkat(const char *, int, const char *); +void sync(void); +long sysconf(int); +pid_t tcgetpgrp(int); +int tcsetpgrp(int, pid_t); +int truncate(const char *, off_t); +char *ttyname(int); +int ttyname_r(int, char *, size_t); +int unlink(const char *); +int unlinkat(int, const char *, int); +ssize_t write(int fd, const void *buffer, size_t size); + +extern char **environ; +extern char *optarg; +extern int optind; +extern int opterr; +extern int optopt; + +#endif /* !__MLIBC_ABI_ONLY */ + +// Non-POSIX functions supported by Linux. +#if UINTPTR_MAX == UINT64_MAX +typedef __mlibc_uint64 useconds_t; +#else +typedef __mlibc_uint32 useconds_t; +#endif + +#ifndef __MLIBC_ABI_ONLY + +int getpagesize(void); +char *get_current_dir_name(void); +int usleep(useconds_t); +int chroot(const char *); +int daemon(int, int); + +// This is a Linux extension +pid_t gettid(void); +int getentropy(void *, size_t); + +int pipe2(int *pipefd, int flags); + +int setresuid(uid_t ruid, uid_t euid, uid_t suid); +int setresgid(gid_t rgid, gid_t egid, gid_t sgid); + +/* Glibc extensions. */ +int getdomainname(char *name, size_t len); +int setdomainname(const char *name, size_t len); + +int getresuid(uid_t *ruid, uid_t *euid, uid_t *suid); +int getresgid(gid_t *rgid, gid_t *egid, gid_t *sgid); + +// Glibc doesn't provide them by default anymore, lock behind an option +#if __MLIBC_CRYPT_OPTION +char *crypt(const char *, const char *); +void encrypt(char block[64], int flags); +#endif + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#if __MLIBC_LINUX_OPTION +# include <bits/linux/linux_unistd.h> +#endif + +#if __MLIBC_BSD_OPTION +# include <bits/bsd/bsd_unistd.h> +#endif + +#endif // _UNISTD_H + diff --git a/lib/mlibc/options/posix/include/utime.h b/lib/mlibc/options/posix/include/utime.h new file mode 100644 index 0000000..dcf053d --- /dev/null +++ b/lib/mlibc/options/posix/include/utime.h @@ -0,0 +1,25 @@ +#ifndef _UTIME_H +#define _UTIME_H + +#include <bits/ansi/time_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +struct utimbuf { + time_t actime; + time_t modtime; +}; + +#ifndef __MLIBC_ABI_ONLY + +int utime(const char *, const struct utimbuf *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _UTIME_H diff --git a/lib/mlibc/options/posix/include/wordexp.h b/lib/mlibc/options/posix/include/wordexp.h new file mode 100644 index 0000000..e5d69ce --- /dev/null +++ b/lib/mlibc/options/posix/include/wordexp.h @@ -0,0 +1,43 @@ +#ifndef _WORDEXP_H +#define _WORDEXP_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/size_t.h> + +#define WRDE_APPEND 1 +#define WRDE_DOOFFS 2 +#define WRDE_NOCMD 4 +#define WRDE_REUSE 8 +#define WRDE_SHOWERR 16 +#define WRDE_UNDEF 32 + +#define WRDE_SUCCESS 1 +#define WRDE_BADCHAR 1 +#define WRDE_BADVAL 2 +#define WRDE_CMDSUB 3 +#define WRDE_NOSPACE 4 +#define WRDE_SYNTAX 5 + +typedef struct { + size_t we_wordc; + char **we_wordv; + size_t we_offs; + char *we_strings; + size_t we_nbytes; +} wordexp_t; + +#ifndef __MLIBC_ABI_ONLY + +int wordexp(const char *s, wordexp_t *p, int flags); +void wordfree(wordexp_t *p); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/lib/mlibc/options/posix/meson.build b/lib/mlibc/options/posix/meson.build new file mode 100644 index 0000000..038dd2c --- /dev/null +++ b/lib/mlibc/options/posix/meson.build @@ -0,0 +1,175 @@ + +if disable_posix_option + subdir_done() +endif +libc_sources += files( + 'generic/arpa-inet-stubs.cpp', + 'generic/dirent-stubs.cpp', + 'generic/dlfcn-stubs.cpp', + 'generic/fcntl-stubs.cpp', + 'generic/ftw-stubs.cpp', + 'generic/grp-stubs.cpp', + 'generic/langinfo-stubs.cpp', + 'generic/libgen-stubs.cpp', + 'generic/lookup.cpp', + 'generic/netdb-stubs.cpp', + 'generic/net-if-stubs.cpp', + 'generic/poll.cpp', + 'generic/posix_ctype.cpp', + 'generic/posix-file-io.cpp', + 'generic/posix_locale.cpp', + 'generic/posix_signal.cpp', + 'generic/posix_stdio.cpp', + 'generic/posix_stdlib.cpp', + 'generic/posix_string.cpp', + 'generic/posix_time.cpp', + 'generic/pthread-stubs.cpp', + 'generic/pwd-stubs.cpp', + 'generic/resolv_conf.cpp', + 'generic/sched-stubs.cpp', + 'generic/spawn-stubs.cpp', + 'generic/strings-stubs.cpp', + 'generic/services.cpp', + 'generic/sys-file-stubs.cpp', + 'generic/syslog-stubs.cpp', + 'generic/sys-mman-stubs.cpp', + 'generic/sys-resource-stubs.cpp', + 'generic/sys-select-stubs.cpp', + 'generic/sys-shm.cpp', + 'generic/sys-socket-stubs.cpp', + 'generic/sys-stat-stubs.cpp', + 'generic/sys-statvfs-stubs.cpp', + 'generic/sys-times.cpp', + 'generic/sys-time-stubs.cpp', + 'generic/sys-uio.cpp', + 'generic/sys-utsname.cpp', + 'generic/sys-wait-stubs.cpp', + 'generic/termios-stubs.cpp', + 'generic/unistd-stubs.cpp', + 'generic/utime-stubs.cpp', + 'generic/ucontext-stubs.cpp', + 'generic/semaphore-stubs.cpp', + 'generic/search.cpp', + 'generic/sys-msg.cpp', + 'generic/sys-sem.cpp', + 'generic/sys-ipc.cpp', + 'generic/time.cpp', + 'generic/wordexp-stubs.cpp', + 'generic/mqueue.cpp' +) + +if not headers_only + libc_sublibs += static_library('musl-generic-regex', + 'musl-generic-regex/fnmatch.c', + 'musl-generic-regex/glob.c', + 'musl-generic-regex/regcomp.c', + 'musl-generic-regex/regerror.c', + 'musl-generic-regex/regexec.c', + 'musl-generic-regex/tre-mem.c', + pic: true, + include_directories: libc_include_dirs, + dependencies: libc_deps, + c_args: ['-Wno-unused', '-Wno-implicit', '-Wno-parentheses', '-Wno-sign-compare', '-Wno-attributes', '-Wno-unknown-pragmas', '-Wno-implicit-fallthrough'] + ) +endif + +if not no_headers + install_headers( + 'include/byteswap.h', + 'include/dirent.h', + 'include/dlfcn.h', + 'include/fcntl.h', + 'include/fnmatch.h', + 'include/ftw.h', + 'include/glob.h', + 'include/grp.h', + 'include/langinfo.h', + 'include/libgen.h', + 'include/netdb.h', + 'include/nl_types.h', + 'include/pthread.h', + 'include/pwd.h', + 'include/poll.h', + 'include/regex.h', + 'include/sched.h', + 'include/search.h', + 'include/spawn.h', + 'include/strings.h', + 'include/syslog.h', + 'include/termios.h', + 'include/unistd.h', + 'include/utime.h', + 'include/ucontext.h', + 'include/wordexp.h', + 'include/semaphore.h', + 'include/mqueue.h', + ) + install_headers( + 'include/arpa/inet.h', + subdir: 'arpa' + ) + install_headers( + 'include/net/if.h', + 'include/net/if_arp.h', + subdir: 'net' + ) + install_headers( + 'include/netinet/in.h', + 'include/netinet/ip.h', + 'include/netinet/tcp.h', + 'include/netinet/icmp6.h', + 'include/netinet/if_ether.h', + 'include/netinet/udp.h', + 'include/netinet/ip6.h', + 'include/netinet/ip_icmp.h', + subdir: 'netinet' + ) + install_headers( + 'include/sys/file.h', + 'include/sys/ipc.h', + 'include/sys/mman.h', + 'include/sys/msg.h', + 'include/sys/param.h', + 'include/sys/poll.h', + 'include/sys/resource.h', + 'include/sys/select.h', + 'include/sys/sem.h', + 'include/sys/shm.h', + 'include/sys/socket.h', + 'include/sys/stat.h', + 'include/sys/statvfs.h', + 'include/sys/termios.h', + 'include/sys/time.h', + 'include/sys/times.h', + 'include/sys/ttydefaults.h', + 'include/sys/types.h', + 'include/sys/uio.h', + 'include/sys/un.h', + 'include/sys/utsname.h', + 'include/sys/wait.h', + 'include/sys/syslog.h', + subdir: 'sys' + ) + install_headers( + 'include/bits/posix/id_t.h', + 'include/bits/posix/in_addr_t.h', + 'include/bits/posix/in_port_t.h', + 'include/bits/posix/iovec.h', + 'include/bits/posix/locale_t.h', + 'include/bits/posix/posix_ctype.h', + 'include/bits/posix/posix_locale.h', + 'include/bits/posix/posix_signal.h', + 'include/bits/posix/posix_stdio.h', + 'include/bits/posix/posix_stdlib.h', + 'include/bits/posix/posix_string.h', + 'include/bits/posix/posix_time.h', + 'include/bits/posix/posix_wctype.h', + 'include/bits/posix/stat.h', + 'include/bits/posix/timeval.h', + 'include/bits/posix/fd_set.h', + 'include/bits/posix/pthread_t.h', + 'include/bits/posix/timer_t.h', + subdir: 'bits/posix' + ) +endif + diff --git a/lib/mlibc/options/posix/musl-generic-regex/fnmatch.c b/lib/mlibc/options/posix/musl-generic-regex/fnmatch.c new file mode 100644 index 0000000..0e6de47 --- /dev/null +++ b/lib/mlibc/options/posix/musl-generic-regex/fnmatch.c @@ -0,0 +1,321 @@ +/* + * An implementation of what I call the "Sea of Stars" algorithm for + * POSIX fnmatch(). The basic idea is that we factor the pattern into + * a head component (which we match first and can reject without ever + * measuring the length of the string), an optional tail component + * (which only exists if the pattern contains at least one star), and + * an optional "sea of stars", a set of star-separated components + * between the head and tail. After the head and tail matches have + * been removed from the input string, the components in the "sea of + * stars" are matched sequentially by searching for their first + * occurrence past the end of the previous match. + * + * - Rich Felker, April 2012 + */ + +#include <string.h> +#include <fnmatch.h> +#include <stdlib.h> +#include <wchar.h> +#include <wctype.h> +// #include "locale_impl.h" + +#define END 0 +#define UNMATCHABLE -2 +#define BRACKET -3 +#define QUESTION -4 +#define STAR -5 + +static int str_next(const char *str, size_t n, size_t *step) +{ + if (!n) { + *step = 0; + return 0; + } + if (str[0] >= 128U) { + wchar_t wc; + int k = mbtowc(&wc, str, n); + if (k<0) { + *step = 1; + return -1; + } + *step = k; + return wc; + } + *step = 1; + return str[0]; +} + +static int pat_next(const char *pat, size_t m, size_t *step, int flags) +{ + int esc = 0; + if (!m || !*pat) { + *step = 0; + return END; + } + *step = 1; + if (pat[0]=='\\' && pat[1] && !(flags & FNM_NOESCAPE)) { + *step = 2; + pat++; + esc = 1; + goto escaped; + } + if (pat[0]=='[') { + size_t k = 1; + if (k<m) if (pat[k] == '^' || pat[k] == '!') k++; + if (k<m) if (pat[k] == ']') k++; + for (; k<m && pat[k] && pat[k]!=']'; k++) { + if (k+1<m && pat[k+1] && pat[k]=='[' && (pat[k+1]==':' || pat[k+1]=='.' || pat[k+1]=='=')) { + int z = pat[k+1]; + k+=2; + if (k<m && pat[k]) k++; + while (k<m && pat[k] && (pat[k-1]!=z || pat[k]!=']')) k++; + if (k==m || !pat[k]) break; + } + } + if (k==m || !pat[k]) { + *step = 1; + return '['; + } + *step = k+1; + return BRACKET; + } + if (pat[0] == '*') + return STAR; + if (pat[0] == '?') + return QUESTION; +escaped: + if (pat[0] >= 128U) { + wchar_t wc; + int k = mbtowc(&wc, pat, m); + if (k<0) { + *step = 0; + return UNMATCHABLE; + } + *step = k + esc; + return wc; + } + return pat[0]; +} + +static int casefold(int k) +{ + int c = towupper(k); + return c == k ? towlower(k) : c; +} + +static int match_bracket(const char *p, int k, int kfold) +{ + wchar_t wc; + int inv = 0; + p++; + if (*p=='^' || *p=='!') { + inv = 1; + p++; + } + if (*p==']') { + if (k==']') return !inv; + p++; + } else if (*p=='-') { + if (k=='-') return !inv; + p++; + } + wc = p[-1]; + for (; *p != ']'; p++) { + if (p[0]=='-' && p[1]!=']') { + wchar_t wc2; + int l = mbtowc(&wc2, p+1, 4); + if (l < 0) return 0; + if (wc <= wc2) + if ((unsigned)k-wc <= wc2-wc || + (unsigned)kfold-wc <= wc2-wc) + return !inv; + p += l-1; + continue; + } + if (p[0]=='[' && (p[1]==':' || p[1]=='.' || p[1]=='=')) { + const char *p0 = p+2; + int z = p[1]; + p+=3; + while (p[-1]!=z || p[0]!=']') p++; + if (z == ':' && p-1-p0 < 16) { + char buf[16]; + memcpy(buf, p0, p-1-p0); + buf[p-1-p0] = 0; + if (iswctype(k, wctype(buf)) || + iswctype(kfold, wctype(buf))) + return !inv; + } + continue; + } + if (*p < 128U) { + wc = (unsigned char)*p; + } else { + int l = mbtowc(&wc, p, 4); + if (l < 0) return 0; + p += l-1; + } + if (wc==(wchar_t)k || wc==(wchar_t)kfold) return !inv; + } + return inv; +} + +static int fnmatch_internal(const char *pat, size_t m, const char *str, size_t n, int flags) +{ + const char *p, *ptail, *endpat; + const char *s, *stail, *endstr; + size_t pinc, sinc, tailcnt=0; + int c, k, kfold; + + if (flags & FNM_PERIOD) { + if (*str == '.' && *pat != '.') + return FNM_NOMATCH; + } + for (;;) { + switch ((c = pat_next(pat, m, &pinc, flags))) { + case UNMATCHABLE: + return FNM_NOMATCH; + case STAR: + pat++; + m--; + break; + default: + k = str_next(str, n, &sinc); + if (k <= 0) + return (c==END) ? 0 : FNM_NOMATCH; + str += sinc; + n -= sinc; + kfold = flags & FNM_CASEFOLD ? casefold(k) : k; + if (c == BRACKET) { + if (!match_bracket(pat, k, kfold)) + return FNM_NOMATCH; + } else if (c != QUESTION && k != c && kfold != c) { + return FNM_NOMATCH; + } + pat+=pinc; + m-=pinc; + continue; + } + break; + } + + /* Compute real pat length if it was initially unknown/-1 */ + m = strnlen(pat, m); + endpat = pat + m; + + /* Find the last * in pat and count chars needed after it */ + for (p=ptail=pat; p<endpat; p+=pinc) { + switch (pat_next(p, endpat-p, &pinc, flags)) { + case UNMATCHABLE: + return FNM_NOMATCH; + case STAR: + tailcnt=0; + ptail = p+1; + break; + default: + tailcnt++; + break; + } + } + + /* Past this point we need not check for UNMATCHABLE in pat, + * because all of pat has already been parsed once. */ + + /* Compute real str length if it was initially unknown/-1 */ + n = strnlen(str, n); + endstr = str + n; + if (n < tailcnt) return FNM_NOMATCH; + + /* Find the final tailcnt chars of str, accounting for UTF-8. + * On illegal sequences we may get it wrong, but in that case + * we necessarily have a matching failure anyway. */ + for (s=endstr; s>str && tailcnt; tailcnt--) { + if (s[-1] < 128U || MB_CUR_MAX==1) s--; + else while ((unsigned char)*--s-0x80U<0x40 && s>str); + } + if (tailcnt) return FNM_NOMATCH; + stail = s; + + /* Check that the pat and str tails match */ + p = ptail; + for (;;) { + c = pat_next(p, endpat-p, &pinc, flags); + p += pinc; + if ((k = str_next(s, endstr-s, &sinc)) <= 0) { + if (c != END) return FNM_NOMATCH; + break; + } + s += sinc; + kfold = flags & FNM_CASEFOLD ? casefold(k) : k; + if (c == BRACKET) { + if (!match_bracket(p-pinc, k, kfold)) + return FNM_NOMATCH; + } else if (c != QUESTION && k != c && kfold != c) { + return FNM_NOMATCH; + } + } + + /* We're all done with the tails now, so throw them out */ + endstr = stail; + endpat = ptail; + + /* Match pattern components until there are none left */ + while (pat<endpat) { + p = pat; + s = str; + for (;;) { + c = pat_next(p, endpat-p, &pinc, flags); + p += pinc; + /* Encountering * completes/commits a component */ + if (c == STAR) { + pat = p; + str = s; + break; + } + k = str_next(s, endstr-s, &sinc); + if (!k) + return FNM_NOMATCH; + kfold = flags & FNM_CASEFOLD ? casefold(k) : k; + if (c == BRACKET) { + if (!match_bracket(p-pinc, k, kfold)) + break; + } else if (c != QUESTION && k != c && kfold != c) { + break; + } + s += sinc; + } + if (c == STAR) continue; + /* If we failed, advance str, by 1 char if it's a valid + * char, or past all invalid bytes otherwise. */ + k = str_next(str, endstr-str, &sinc); + if (k > 0) str += sinc; + else for (str++; str_next(str, endstr-str, &sinc)<0; str++); + } + + return 0; +} + +int fnmatch(const char *pat, const char *str, int flags) +{ + const char *s, *p; + size_t inc; + int c; + if (flags & FNM_PATHNAME) for (;;) { + for (s=str; *s && *s!='/'; s++); + for (p=pat; (c=pat_next(p, -1, &inc, flags))!=END && c!='/'; p+=inc); + if (c!=*s && (!*s || !(flags & FNM_LEADING_DIR))) + return FNM_NOMATCH; + if (fnmatch_internal(pat, p-pat, str, s-str, flags)) + return FNM_NOMATCH; + if (!c) return 0; + str = s+1; + pat = p+inc; + } else if (flags & FNM_LEADING_DIR) { + for (s=str; *s; s++) { + if (*s != '/') continue; + if (!fnmatch_internal(pat, -1, str, s-str, flags)) + return 0; + } + } + return fnmatch_internal(pat, -1, str, -1, flags); +} diff --git a/lib/mlibc/options/posix/musl-generic-regex/glob.c b/lib/mlibc/options/posix/musl-generic-regex/glob.c new file mode 100644 index 0000000..b57f2f3 --- /dev/null +++ b/lib/mlibc/options/posix/musl-generic-regex/glob.c @@ -0,0 +1,311 @@ +#define _BSD_SOURCE +#include <glob.h> +#include <fnmatch.h> +#include <sys/stat.h> +#include <dirent.h> +#include <limits.h> +#include <string.h> +#include <stdlib.h> +#include <errno.h> +#include <stddef.h> +#include <unistd.h> +#include <pwd.h> + +struct match +{ + struct match *next; + char name[]; +}; + +static int append(struct match **tail, const char *name, size_t len, int mark) +{ + struct match *new = malloc(sizeof(struct match) + len + 2); + if (!new) return -1; + (*tail)->next = new; + new->next = NULL; + memcpy(new->name, name, len+1); + if (mark && len && name[len-1]!='/') { + new->name[len] = '/'; + new->name[len+1] = 0; + } + *tail = new; + return 0; +} + +static int do_glob(char *buf, size_t pos, int type, char *pat, int flags, int (*errfunc)(const char *path, int err), struct match **tail) +{ + /* If GLOB_MARK is unused, we don't care about type. */ + if (!type && !(flags & GLOB_MARK)) type = DT_REG; + + /* Special-case the remaining pattern being all slashes, in + * which case we can use caller-passed type if it's a dir. */ + if (*pat && type!=DT_DIR) type = 0; + while (pos+1 < PATH_MAX && *pat=='/') buf[pos++] = *pat++; + + /* Consume maximal [escaped-]literal prefix of pattern, copying + * and un-escaping it to the running buffer as we go. */ + ptrdiff_t i=0, j=0; + int in_bracket = 0, overflow = 0; + for (; pat[i]!='*' && pat[i]!='?' && (!in_bracket || pat[i]!=']'); i++) { + if (!pat[i]) { + if (overflow) return 0; + pat += i; + pos += j; + i = j = 0; + break; + } else if (pat[i] == '[') { + in_bracket = 1; + } else if (pat[i] == '\\' && !(flags & GLOB_NOESCAPE)) { + /* Backslashes inside a bracket are (at least by + * our interpretation) non-special, so if next + * char is ']' we have a complete expression. */ + if (in_bracket && pat[i+1]==']') break; + /* Unpaired final backslash never matches. */ + if (!pat[i+1]) return 0; + i++; + } + if (pat[i] == '/') { + if (overflow) return 0; + in_bracket = 0; + pat += i+1; + i = -1; + pos += j+1; + j = -1; + } + /* Only store a character if it fits in the buffer, but if + * a potential bracket expression is open, the overflow + * must be remembered and handled later only if the bracket + * is unterminated (and thereby a literal), so as not to + * disallow long bracket expressions with short matches. */ + if (pos+(j+1) < PATH_MAX) { + buf[pos+j++] = pat[i]; + } else if (in_bracket) { + overflow = 1; + } else { + return 0; + } + /* If we consume any new components, the caller-passed type + * or dummy type from above is no longer valid. */ + type = 0; + } + buf[pos] = 0; + if (!*pat) { + /* If we consumed any components above, or if GLOB_MARK is + * requested and we don't yet know if the match is a dir, + * we must confirm the file exists and/or determine its type. + * + * If marking dirs, symlink type is inconclusive; we need the + * type for the symlink target, and therefore must try stat + * first unless type is known not to be a symlink. Otherwise, + * or if that fails, use lstat for determining existence to + * avoid false negatives in the case of broken symlinks. */ + struct stat st; + if ((flags & GLOB_MARK) && (!type||type==DT_LNK) && !stat(buf, &st)) { + if (S_ISDIR(st.st_mode)) type = DT_DIR; + else type = DT_REG; + } + if (!type && lstat(buf, &st)) { + if (errno!=ENOENT && (errfunc(buf, errno) || (flags & GLOB_ERR))) + return GLOB_ABORTED; + return 0; + } + if (append(tail, buf, pos, (flags & GLOB_MARK) && type==DT_DIR)) + return GLOB_NOSPACE; + return 0; + } + char *p2 = strchr(pat, '/'), saved_sep = '/'; + /* Check if the '/' was escaped and, if so, remove the escape char + * so that it will not be unpaired when passed to fnmatch. */ + if (p2 && !(flags & GLOB_NOESCAPE)) { + char *p; + for (p=p2; p>pat && p[-1]=='\\'; p--); + if ((p2-p)%2) { + p2--; + saved_sep = '\\'; + } + } + DIR *dir = opendir(pos ? buf : "."); + if (!dir) { + if (errfunc(buf, errno) || (flags & GLOB_ERR)) + return GLOB_ABORTED; + return 0; + } + int old_errno = errno; + struct dirent *de; + while (errno=0, de=readdir(dir)) { + /* Quickly skip non-directories when there's pattern left. */ + if (p2 && de->d_type && de->d_type!=DT_DIR && de->d_type!=DT_LNK) + continue; + + size_t l = strlen(de->d_name); + if (l >= PATH_MAX-pos) continue; + + if (p2) *p2 = 0; + + int fnm_flags= ((flags & GLOB_NOESCAPE) ? FNM_NOESCAPE : 0) + | ((!(flags & GLOB_PERIOD)) ? FNM_PERIOD : 0); + + if (fnmatch(pat, de->d_name, fnm_flags)) + continue; + + /* With GLOB_PERIOD, don't allow matching . or .. unless + * fnmatch would match them with FNM_PERIOD rules in effect. */ + if (p2 && (flags & GLOB_PERIOD) && de->d_name[0]=='.' + && (!de->d_name[1] || de->d_name[1]=='.' && !de->d_name[2]) + && fnmatch(pat, de->d_name, fnm_flags | FNM_PERIOD)) + continue; + + memcpy(buf+pos, de->d_name, l+1); + if (p2) *p2 = saved_sep; + int r = do_glob(buf, pos+l, de->d_type, p2 ? p2 : "", flags, errfunc, tail); + if (r) { + closedir(dir); + return r; + } + } + int readerr = errno; + if (p2) *p2 = saved_sep; + closedir(dir); + if (readerr && (errfunc(buf, errno) || (flags & GLOB_ERR))) + return GLOB_ABORTED; + errno = old_errno; + return 0; +} + +static int ignore_err(const char *path, int err) +{ + return 0; +} + +static void freelist(struct match *head) +{ + struct match *match, *next; + for (match=head->next; match; match=next) { + next = match->next; + free(match); + } +} + +static int sort(const void *a, const void *b) +{ + return strcmp(*(const char **)a, *(const char **)b); +} + +static int expand_tilde(char **pat, char *buf, size_t *pos) +{ + char *p = *pat + 1; + size_t i = 0; + + char delim, *name_end = strchrnul(p, '/'); + if ((delim = *name_end)) *name_end++ = 0; + *pat = name_end; + + char *home = *p ? NULL : getenv("HOME"); + if (!home) { + struct passwd pw, *res; + switch (*p ? getpwnam_r(p, &pw, buf, PATH_MAX, &res) + : getpwuid_r(getuid(), &pw, buf, PATH_MAX, &res)) { + case ENOMEM: + return GLOB_NOSPACE; + case 0: + if (!res) + default: + return GLOB_NOMATCH; + } + home = pw.pw_dir; + } + while (i < PATH_MAX - 2 && *home) + buf[i++] = *home++; + if (*home) + return GLOB_NOMATCH; + if ((buf[i] = delim)) + buf[++i] = 0; + *pos = i; + return 0; +} + +int glob(const char *restrict pat, int flags, int (*errfunc)(const char *path, int err), glob_t *restrict g) +{ + struct match head = { .next = NULL }, *tail = &head; + size_t cnt, i; + size_t offs = (flags & GLOB_DOOFFS) ? g->gl_offs : 0; + int error = 0; + char buf[PATH_MAX]; + + if (!errfunc) errfunc = ignore_err; + + if (!(flags & GLOB_APPEND)) { + g->gl_offs = offs; + g->gl_pathc = 0; + g->gl_pathv = NULL; + } + + if (*pat) { + char *p = strdup(pat); + if (!p) return GLOB_NOSPACE; + buf[0] = 0; + size_t pos = 0; + char *s = p; + if ((flags & (GLOB_TILDE | GLOB_TILDE_CHECK)) && *p == '~') + error = expand_tilde(&s, buf, &pos); + if (!error) + error = do_glob(buf, pos, 0, s, flags, errfunc, &tail); + free(p); + } + + if (error == GLOB_NOSPACE) { + freelist(&head); + return error; + } + + for (cnt=0, tail=head.next; tail; tail=tail->next, cnt++); + if (!cnt) { + if (flags & GLOB_NOCHECK) { + tail = &head; + if (append(&tail, pat, strlen(pat), 0)) + return GLOB_NOSPACE; + cnt++; + } else + return GLOB_NOMATCH; + } + + if (flags & GLOB_APPEND) { + char **pathv = realloc(g->gl_pathv, (offs + g->gl_pathc + cnt + 1) * sizeof(char *)); + if (!pathv) { + freelist(&head); + return GLOB_NOSPACE; + } + g->gl_pathv = pathv; + offs += g->gl_pathc; + } else { + g->gl_pathv = malloc((offs + cnt + 1) * sizeof(char *)); + if (!g->gl_pathv) { + freelist(&head); + return GLOB_NOSPACE; + } + for (i=0; i<offs; i++) + g->gl_pathv[i] = NULL; + } + for (i=0, tail=head.next; i<cnt; tail=tail->next, i++) + g->gl_pathv[offs + i] = tail->name; + g->gl_pathv[offs + i] = NULL; + g->gl_pathc += cnt; + + if (!(flags & GLOB_NOSORT)) + qsort(g->gl_pathv+offs, cnt, sizeof(char *), sort); + + return error; +} + +void globfree(glob_t *g) +{ + size_t i; + for (i=0; i<g->gl_pathc; i++) + free(g->gl_pathv[g->gl_offs + i] - offsetof(struct match, name)); + free(g->gl_pathv); + g->gl_pathc = 0; + g->gl_pathv = NULL; +} + +// weak_alias(glob, glob64); +// weak_alias(globfree, globfree64); diff --git a/lib/mlibc/options/posix/musl-generic-regex/regcomp.c b/lib/mlibc/options/posix/musl-generic-regex/regcomp.c new file mode 100644 index 0000000..ab03984 --- /dev/null +++ b/lib/mlibc/options/posix/musl-generic-regex/regcomp.c @@ -0,0 +1,2953 @@ +/* + regcomp.c - TRE POSIX compatible regex compilation functions. + + Copyright (c) 2001-2009 Ville Laurikari <vl@iki.fi> + All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDER AND CONTRIBUTORS + ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT + HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT + LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +*/ + +#include <string.h> +#include <stdlib.h> +#include <regex.h> +#include <limits.h> +#include <stdint.h> +#include <ctype.h> + +#include "tre.h" + +#include <assert.h> + +/*********************************************************************** + from tre-compile.h +***********************************************************************/ + +typedef struct { + int position; + int code_min; + int code_max; + int *tags; + int assertions; + tre_ctype_t class; + tre_ctype_t *neg_classes; + int backref; +} tre_pos_and_tags_t; + + +/*********************************************************************** + from tre-ast.c and tre-ast.h +***********************************************************************/ + +/* The different AST node types. */ +typedef enum { + LITERAL, + CATENATION, + ITERATION, + UNION +} tre_ast_type_t; + +/* Special subtypes of TRE_LITERAL. */ +#define EMPTY -1 /* Empty leaf (denotes empty string). */ +#define ASSERTION -2 /* Assertion leaf. */ +#define TAG -3 /* Tag leaf. */ +#define BACKREF -4 /* Back reference leaf. */ + +#define IS_SPECIAL(x) ((x)->code_min < 0) +#define IS_EMPTY(x) ((x)->code_min == EMPTY) +#define IS_ASSERTION(x) ((x)->code_min == ASSERTION) +#define IS_TAG(x) ((x)->code_min == TAG) +#define IS_BACKREF(x) ((x)->code_min == BACKREF) + + +/* A generic AST node. All AST nodes consist of this node on the top + level with `obj' pointing to the actual content. */ +typedef struct { + tre_ast_type_t type; /* Type of the node. */ + void *obj; /* Pointer to actual node. */ + int nullable; + int submatch_id; + int num_submatches; + int num_tags; + tre_pos_and_tags_t *firstpos; + tre_pos_and_tags_t *lastpos; +} tre_ast_node_t; + + +/* A "literal" node. These are created for assertions, back references, + tags, matching parameter settings, and all expressions that match one + character. */ +typedef struct { + long code_min; + long code_max; + int position; + tre_ctype_t class; + tre_ctype_t *neg_classes; +} tre_literal_t; + +/* A "catenation" node. These are created when two regexps are concatenated. + If there are more than one subexpressions in sequence, the `left' part + holds all but the last, and `right' part holds the last subexpression + (catenation is left associative). */ +typedef struct { + tre_ast_node_t *left; + tre_ast_node_t *right; +} tre_catenation_t; + +/* An "iteration" node. These are created for the "*", "+", "?", and "{m,n}" + operators. */ +typedef struct { + /* Subexpression to match. */ + tre_ast_node_t *arg; + /* Minimum number of consecutive matches. */ + int min; + /* Maximum number of consecutive matches. */ + int max; + /* If 0, match as many characters as possible, if 1 match as few as + possible. Note that this does not always mean the same thing as + matching as many/few repetitions as possible. */ + unsigned int minimal:1; +} tre_iteration_t; + +/* An "union" node. These are created for the "|" operator. */ +typedef struct { + tre_ast_node_t *left; + tre_ast_node_t *right; +} tre_union_t; + + +static tre_ast_node_t * +tre_ast_new_node(tre_mem_t mem, int type, void *obj) +{ + tre_ast_node_t *node = tre_mem_calloc(mem, sizeof *node); + if (!node || !obj) + return 0; + node->obj = obj; + node->type = type; + node->nullable = -1; + node->submatch_id = -1; + return node; +} + +static tre_ast_node_t * +tre_ast_new_literal(tre_mem_t mem, int code_min, int code_max, int position) +{ + tre_ast_node_t *node; + tre_literal_t *lit; + + lit = tre_mem_calloc(mem, sizeof *lit); + node = tre_ast_new_node(mem, LITERAL, lit); + if (!node) + return 0; + lit->code_min = code_min; + lit->code_max = code_max; + lit->position = position; + return node; +} + +static tre_ast_node_t * +tre_ast_new_iter(tre_mem_t mem, tre_ast_node_t *arg, int min, int max, int minimal) +{ + tre_ast_node_t *node; + tre_iteration_t *iter; + + iter = tre_mem_calloc(mem, sizeof *iter); + node = tre_ast_new_node(mem, ITERATION, iter); + if (!node) + return 0; + iter->arg = arg; + iter->min = min; + iter->max = max; + iter->minimal = minimal; + node->num_submatches = arg->num_submatches; + return node; +} + +static tre_ast_node_t * +tre_ast_new_union(tre_mem_t mem, tre_ast_node_t *left, tre_ast_node_t *right) +{ + tre_ast_node_t *node; + tre_union_t *un; + + if (!left) + return right; + un = tre_mem_calloc(mem, sizeof *un); + node = tre_ast_new_node(mem, UNION, un); + if (!node || !right) + return 0; + un->left = left; + un->right = right; + node->num_submatches = left->num_submatches + right->num_submatches; + return node; +} + +static tre_ast_node_t * +tre_ast_new_catenation(tre_mem_t mem, tre_ast_node_t *left, tre_ast_node_t *right) +{ + tre_ast_node_t *node; + tre_catenation_t *cat; + + if (!left) + return right; + cat = tre_mem_calloc(mem, sizeof *cat); + node = tre_ast_new_node(mem, CATENATION, cat); + if (!node) + return 0; + cat->left = left; + cat->right = right; + node->num_submatches = left->num_submatches + right->num_submatches; + return node; +} + + +/*********************************************************************** + from tre-stack.c and tre-stack.h +***********************************************************************/ + +typedef struct tre_stack_rec tre_stack_t; + +/* Creates a new stack object. `size' is initial size in bytes, `max_size' + is maximum size, and `increment' specifies how much more space will be + allocated with realloc() if all space gets used up. Returns the stack + object or NULL if out of memory. */ +static tre_stack_t * +tre_stack_new(int size, int max_size, int increment); + +/* Frees the stack object. */ +static void +tre_stack_destroy(tre_stack_t *s); + +/* Returns the current number of objects in the stack. */ +static int +tre_stack_num_objects(tre_stack_t *s); + +/* Each tre_stack_push_*(tre_stack_t *s, <type> value) function pushes + `value' on top of stack `s'. Returns REG_ESPACE if out of memory. + This tries to realloc() more space before failing if maximum size + has not yet been reached. Returns REG_OK if successful. */ +#define declare_pushf(typetag, type) \ + static reg_errcode_t tre_stack_push_ ## typetag(tre_stack_t *s, type value) + +declare_pushf(voidptr, void *); +declare_pushf(int, int); + +/* Each tre_stack_pop_*(tre_stack_t *s) function pops the topmost + element off of stack `s' and returns it. The stack must not be + empty. */ +#define declare_popf(typetag, type) \ + static type tre_stack_pop_ ## typetag(tre_stack_t *s) + +declare_popf(voidptr, void *); +declare_popf(int, int); + +/* Just to save some typing. */ +#define STACK_PUSH(s, typetag, value) \ + do \ + { \ + status = tre_stack_push_ ## typetag(s, value); \ + } \ + while (/*CONSTCOND*/0) + +#define STACK_PUSHX(s, typetag, value) \ + { \ + status = tre_stack_push_ ## typetag(s, value); \ + if (status != REG_OK) \ + break; \ + } + +#define STACK_PUSHR(s, typetag, value) \ + { \ + reg_errcode_t _status; \ + _status = tre_stack_push_ ## typetag(s, value); \ + if (_status != REG_OK) \ + return _status; \ + } + +union tre_stack_item { + void *voidptr_value; + int int_value; +}; + +struct tre_stack_rec { + int size; + int max_size; + int increment; + int ptr; + union tre_stack_item *stack; +}; + + +static tre_stack_t * +tre_stack_new(int size, int max_size, int increment) +{ + tre_stack_t *s; + + s = xmalloc(sizeof(*s)); + if (s != NULL) + { + s->stack = xmalloc(sizeof(*s->stack) * size); + if (s->stack == NULL) + { + xfree(s); + return NULL; + } + s->size = size; + s->max_size = max_size; + s->increment = increment; + s->ptr = 0; + } + return s; +} + +static void +tre_stack_destroy(tre_stack_t *s) +{ + xfree(s->stack); + xfree(s); +} + +static int +tre_stack_num_objects(tre_stack_t *s) +{ + return s->ptr; +} + +static reg_errcode_t +tre_stack_push(tre_stack_t *s, union tre_stack_item value) +{ + if (s->ptr < s->size) + { + s->stack[s->ptr] = value; + s->ptr++; + } + else + { + if (s->size >= s->max_size) + { + return REG_ESPACE; + } + else + { + union tre_stack_item *new_buffer; + int new_size; + new_size = s->size + s->increment; + if (new_size > s->max_size) + new_size = s->max_size; + new_buffer = xrealloc(s->stack, sizeof(*new_buffer) * new_size); + if (new_buffer == NULL) + { + return REG_ESPACE; + } + assert(new_size > s->size); + s->size = new_size; + s->stack = new_buffer; + tre_stack_push(s, value); + } + } + return REG_OK; +} + +#define define_pushf(typetag, type) \ + declare_pushf(typetag, type) { \ + union tre_stack_item item; \ + item.typetag ## _value = value; \ + return tre_stack_push(s, item); \ +} + +define_pushf(int, int) +define_pushf(voidptr, void *) + +#define define_popf(typetag, type) \ + declare_popf(typetag, type) { \ + return s->stack[--s->ptr].typetag ## _value; \ + } + +define_popf(int, int) +define_popf(voidptr, void *) + + +/*********************************************************************** + from tre-parse.c and tre-parse.h +***********************************************************************/ + +/* Parse context. */ +typedef struct { + /* Memory allocator. The AST is allocated using this. */ + tre_mem_t mem; + /* Stack used for keeping track of regexp syntax. */ + tre_stack_t *stack; + /* The parsed node after a parse function returns. */ + tre_ast_node_t *n; + /* Position in the regexp pattern after a parse function returns. */ + const char *s; + /* The first character of the last subexpression parsed. */ + const char *start; + /* Current submatch ID. */ + int submatch_id; + /* Current position (number of literal). */ + int position; + /* The highest back reference or -1 if none seen so far. */ + int max_backref; + /* Compilation flags. */ + int cflags; +} tre_parse_ctx_t; + +/* Some macros for expanding \w, \s, etc. */ +static const struct { + char c; + const char *expansion; +} tre_macros[] = { + {'t', "\t"}, {'n', "\n"}, {'r', "\r"}, + {'f', "\f"}, {'a', "\a"}, {'e', "\033"}, + {'w', "[[:alnum:]_]"}, {'W', "[^[:alnum:]_]"}, {'s', "[[:space:]]"}, + {'S', "[^[:space:]]"}, {'d', "[[:digit:]]"}, {'D', "[^[:digit:]]"}, + { 0, 0 } +}; + +/* Expands a macro delimited by `regex' and `regex_end' to `buf', which + must have at least `len' items. Sets buf[0] to zero if the there + is no match in `tre_macros'. */ +static const char *tre_expand_macro(const char *s) +{ + int i; + for (i = 0; tre_macros[i].c && tre_macros[i].c != *s; i++); + return tre_macros[i].expansion; +} + +static int +tre_compare_lit(const void *a, const void *b) +{ + const tre_literal_t *const *la = a; + const tre_literal_t *const *lb = b; + /* assumes the range of valid code_min is < INT_MAX */ + return la[0]->code_min - lb[0]->code_min; +} + +struct literals { + tre_mem_t mem; + tre_literal_t **a; + int len; + int cap; +}; + +static tre_literal_t *tre_new_lit(struct literals *p) +{ + tre_literal_t **a; + if (p->len >= p->cap) { + if (p->cap >= 1<<15) + return 0; + p->cap *= 2; + a = xrealloc(p->a, p->cap * sizeof *p->a); + if (!a) + return 0; + p->a = a; + } + a = p->a + p->len++; + *a = tre_mem_calloc(p->mem, sizeof **a); + return *a; +} + +static int add_icase_literals(struct literals *ls, int min, int max) +{ + tre_literal_t *lit; + int b, e, c; + for (c=min; c<=max; ) { + /* assumes islower(c) and isupper(c) are exclusive + and toupper(c)!=c if islower(c). + multiple opposite case characters are not supported */ + if (tre_islower(c)) { + b = e = tre_toupper(c); + for (c++, e++; c<=max; c++, e++) + if (tre_toupper(c) != e) break; + } else if (tre_isupper(c)) { + b = e = tre_tolower(c); + for (c++, e++; c<=max; c++, e++) + if (tre_tolower(c) != e) break; + } else { + c++; + continue; + } + lit = tre_new_lit(ls); + if (!lit) + return -1; + lit->code_min = b; + lit->code_max = e-1; + lit->position = -1; + } + return 0; +} + + +/* Maximum number of character classes in a negated bracket expression. */ +#define MAX_NEG_CLASSES 64 + +struct neg { + int negate; + int len; + tre_ctype_t a[MAX_NEG_CLASSES]; +}; + +// TODO: parse bracket into a set of non-overlapping [lo,hi] ranges + +/* +bracket grammar: +Bracket = '[' List ']' | '[^' List ']' +List = Term | List Term +Term = Char | Range | Chclass | Eqclass +Range = Char '-' Char | Char '-' '-' +Char = Coll | coll_single +Meta = ']' | '-' +Coll = '[.' coll_single '.]' | '[.' coll_multi '.]' | '[.' Meta '.]' +Eqclass = '[=' coll_single '=]' | '[=' coll_multi '=]' +Chclass = '[:' class ':]' + +coll_single is a single char collating element but it can be + '-' only at the beginning or end of a List and + ']' only at the beginning of a List and + '^' anywhere except after the openning '[' +*/ + +static reg_errcode_t parse_bracket_terms(tre_parse_ctx_t *ctx, const char *s, struct literals *ls, struct neg *neg) +{ + const char *start = s; + tre_ctype_t class; + int min, max; + wchar_t wc; + int len; + + for (;;) { + class = 0; + len = mbtowc(&wc, s, -1); + if (len <= 0) + return *s ? REG_BADPAT : REG_EBRACK; + if (*s == ']' && s != start) { + ctx->s = s+1; + return REG_OK; + } + if (*s == '-' && s != start && s[1] != ']' && + /* extension: [a-z--@] is accepted as [a-z]|[--@] */ + (s[1] != '-' || s[2] == ']')) + return REG_ERANGE; + if (*s == '[' && (s[1] == '.' || s[1] == '=')) + /* collating symbols and equivalence classes are not supported */ + return REG_ECOLLATE; + if (*s == '[' && s[1] == ':') { + char tmp[CHARCLASS_NAME_MAX+1]; + s += 2; + for (len=0; len < CHARCLASS_NAME_MAX && s[len]; len++) { + if (s[len] == ':') { + memcpy(tmp, s, len); + tmp[len] = 0; + class = tre_ctype(tmp); + break; + } + } + if (!class || s[len+1] != ']') + return REG_ECTYPE; + min = 0; + max = TRE_CHAR_MAX; + s += len+2; + } else { + min = max = wc; + s += len; + if (*s == '-' && s[1] != ']') { + s++; + len = mbtowc(&wc, s, -1); + max = wc; + /* XXX - Should use collation order instead of + encoding values in character ranges. */ + if (len <= 0 || min > max) + return REG_ERANGE; + s += len; + } + } + + if (class && neg->negate) { + if (neg->len >= MAX_NEG_CLASSES) + return REG_ESPACE; + neg->a[neg->len++] = class; + } else { + tre_literal_t *lit = tre_new_lit(ls); + if (!lit) + return REG_ESPACE; + lit->code_min = min; + lit->code_max = max; + lit->class = class; + lit->position = -1; + + /* Add opposite-case codepoints if REG_ICASE is present. + It seems that POSIX requires that bracket negation + should happen before case-folding, but most practical + implementations do it the other way around. Changing + the order would need efficient representation of + case-fold ranges and bracket range sets even with + simple patterns so this is ok for now. */ + if (ctx->cflags & REG_ICASE && !class) + if (add_icase_literals(ls, min, max)) + return REG_ESPACE; + } + } +} + +static reg_errcode_t parse_bracket(tre_parse_ctx_t *ctx, const char *s) +{ + int i, max, min, negmax, negmin; + tre_ast_node_t *node = 0, *n; + tre_ctype_t *nc = 0; + tre_literal_t *lit; + struct literals ls; + struct neg neg; + reg_errcode_t err; + + ls.mem = ctx->mem; + ls.len = 0; + ls.cap = 32; + ls.a = xmalloc(ls.cap * sizeof *ls.a); + if (!ls.a) + return REG_ESPACE; + neg.len = 0; + neg.negate = *s == '^'; + if (neg.negate) + s++; + + err = parse_bracket_terms(ctx, s, &ls, &neg); + if (err != REG_OK) + goto parse_bracket_done; + + if (neg.negate) { + /* + * With REG_NEWLINE, POSIX requires that newlines are not matched by + * any form of a non-matching list. + */ + if (ctx->cflags & REG_NEWLINE) { + lit = tre_new_lit(&ls); + if (!lit) { + err = REG_ESPACE; + goto parse_bracket_done; + } + lit->code_min = '\n'; + lit->code_max = '\n'; + lit->position = -1; + } + /* Sort the array if we need to negate it. */ + qsort(ls.a, ls.len, sizeof *ls.a, tre_compare_lit); + /* extra lit for the last negated range */ + lit = tre_new_lit(&ls); + if (!lit) { + err = REG_ESPACE; + goto parse_bracket_done; + } + lit->code_min = TRE_CHAR_MAX+1; + lit->code_max = TRE_CHAR_MAX+1; + lit->position = -1; + /* negated classes */ + if (neg.len) { + nc = tre_mem_alloc(ctx->mem, (neg.len+1)*sizeof *neg.a); + if (!nc) { + err = REG_ESPACE; + goto parse_bracket_done; + } + memcpy(nc, neg.a, neg.len*sizeof *neg.a); + nc[neg.len] = 0; + } + } + + /* Build a union of the items in the array, negated if necessary. */ + negmax = negmin = 0; + for (i = 0; i < ls.len; i++) { + lit = ls.a[i]; + min = lit->code_min; + max = lit->code_max; + if (neg.negate) { + if (min <= negmin) { + /* Overlap. */ + negmin = MAX(max + 1, negmin); + continue; + } + negmax = min - 1; + lit->code_min = negmin; + lit->code_max = negmax; + negmin = max + 1; + } + lit->position = ctx->position; + lit->neg_classes = nc; + n = tre_ast_new_node(ctx->mem, LITERAL, lit); + node = tre_ast_new_union(ctx->mem, node, n); + if (!node) { + err = REG_ESPACE; + break; + } + } + +parse_bracket_done: + xfree(ls.a); + ctx->position++; + ctx->n = node; + return err; +} + +static const char *parse_dup_count(const char *s, int *n) +{ + *n = -1; + if (!isdigit(*s)) + return s; + *n = 0; + for (;;) { + *n = 10 * *n + (*s - '0'); + s++; + if (!isdigit(*s) || *n > RE_DUP_MAX) + break; + } + return s; +} + +static const char *parse_dup(const char *s, int ere, int *pmin, int *pmax) +{ + int min, max; + + s = parse_dup_count(s, &min); + if (*s == ',') + s = parse_dup_count(s+1, &max); + else + max = min; + + if ( + (max < min && max >= 0) || + max > RE_DUP_MAX || + min > RE_DUP_MAX || + min < 0 || + (!ere && *s++ != '\\') || + *s++ != '}' + ) + return 0; + *pmin = min; + *pmax = max; + return s; +} + +static int hexval(unsigned c) +{ + if (c-'0'<10) return c-'0'; + c |= 32; + if (c-'a'<6) return c-'a'+10; + return -1; +} + +static reg_errcode_t marksub(tre_parse_ctx_t *ctx, tre_ast_node_t *node, int subid) +{ + if (node->submatch_id >= 0) { + tre_ast_node_t *n = tre_ast_new_literal(ctx->mem, EMPTY, -1, -1); + if (!n) + return REG_ESPACE; + n = tre_ast_new_catenation(ctx->mem, n, node); + if (!n) + return REG_ESPACE; + n->num_submatches = node->num_submatches; + node = n; + } + node->submatch_id = subid; + node->num_submatches++; + ctx->n = node; + return REG_OK; +} + +/* +BRE grammar: +Regex = Branch | '^' | '$' | '^$' | '^' Branch | Branch '$' | '^' Branch '$' +Branch = Atom | Branch Atom +Atom = char | quoted_char | '.' | Bracket | Atom Dup | '\(' Branch '\)' | back_ref +Dup = '*' | '\{' Count '\}' | '\{' Count ',\}' | '\{' Count ',' Count '\}' + +(leading ^ and trailing $ in a sub expr may be an anchor or literal as well) + +ERE grammar: +Regex = Branch | Regex '|' Branch +Branch = Atom | Branch Atom +Atom = char | quoted_char | '.' | Bracket | Atom Dup | '(' Regex ')' | '^' | '$' +Dup = '*' | '+' | '?' | '{' Count '}' | '{' Count ',}' | '{' Count ',' Count '}' + +(a*+?, ^*, $+, \X, {, (|a) are unspecified) +*/ + +static reg_errcode_t parse_atom(tre_parse_ctx_t *ctx, const char *s) +{ + int len, ere = ctx->cflags & REG_EXTENDED; + const char *p; + tre_ast_node_t *node; + wchar_t wc; + switch (*s) { + case '[': + return parse_bracket(ctx, s+1); + case '\\': + p = tre_expand_macro(s+1); + if (p) { + /* assume \X expansion is a single atom */ + reg_errcode_t err = parse_atom(ctx, p); + ctx->s = s+2; + return err; + } + /* extensions: \b, \B, \<, \>, \xHH \x{HHHH} */ + switch (*++s) { + case 0: + return REG_EESCAPE; + case 'b': + node = tre_ast_new_literal(ctx->mem, ASSERTION, ASSERT_AT_WB, -1); + break; + case 'B': + node = tre_ast_new_literal(ctx->mem, ASSERTION, ASSERT_AT_WB_NEG, -1); + break; + case '<': + node = tre_ast_new_literal(ctx->mem, ASSERTION, ASSERT_AT_BOW, -1); + break; + case '>': + node = tre_ast_new_literal(ctx->mem, ASSERTION, ASSERT_AT_EOW, -1); + break; + case 'x': + s++; + int i, v = 0, c; + len = 2; + if (*s == '{') { + len = 8; + s++; + } + for (i=0; i<len && v<0x110000; i++) { + c = hexval(s[i]); + if (c < 0) break; + v = 16*v + c; + } + s += i; + if (len == 8) { + if (*s != '}') + return REG_EBRACE; + s++; + } + node = tre_ast_new_literal(ctx->mem, v, v, ctx->position++); + s--; + break; + case '{': + case '+': + case '?': + /* extension: treat \+, \? as repetitions in BRE */ + /* reject repetitions after empty expression in BRE */ + if (!ere) + return REG_BADRPT; + case '|': + /* extension: treat \| as alternation in BRE */ + if (!ere) { + node = tre_ast_new_literal(ctx->mem, EMPTY, -1, -1); + s--; + goto end; + } + /* fallthrough */ + default: + if (!ere && (unsigned)*s-'1' < 9) { + /* back reference */ + int val = *s - '0'; + node = tre_ast_new_literal(ctx->mem, BACKREF, val, ctx->position++); + ctx->max_backref = MAX(val, ctx->max_backref); + } else { + /* extension: accept unknown escaped char + as a literal */ + goto parse_literal; + } + } + s++; + break; + case '.': + if (ctx->cflags & REG_NEWLINE) { + tre_ast_node_t *tmp1, *tmp2; + tmp1 = tre_ast_new_literal(ctx->mem, 0, '\n'-1, ctx->position++); + tmp2 = tre_ast_new_literal(ctx->mem, '\n'+1, TRE_CHAR_MAX, ctx->position++); + if (tmp1 && tmp2) + node = tre_ast_new_union(ctx->mem, tmp1, tmp2); + else + node = 0; + } else { + node = tre_ast_new_literal(ctx->mem, 0, TRE_CHAR_MAX, ctx->position++); + } + s++; + break; + case '^': + /* '^' has a special meaning everywhere in EREs, and at beginning of BRE. */ + if (!ere && s != ctx->start) + goto parse_literal; + node = tre_ast_new_literal(ctx->mem, ASSERTION, ASSERT_AT_BOL, -1); + s++; + break; + case '$': + /* '$' is special everywhere in EREs, and at the end of a BRE subexpression. */ + if (!ere && s[1] && (s[1]!='\\'|| (s[2]!=')' && s[2]!='|'))) + goto parse_literal; + node = tre_ast_new_literal(ctx->mem, ASSERTION, ASSERT_AT_EOL, -1); + s++; + break; + case '*': + case '{': + case '+': + case '?': + /* reject repetitions after empty expression in ERE */ + if (ere) + return REG_BADRPT; + case '|': + if (!ere) + goto parse_literal; + case 0: + node = tre_ast_new_literal(ctx->mem, EMPTY, -1, -1); + break; + default: +parse_literal: + len = mbtowc(&wc, s, -1); + if (len < 0) + return REG_BADPAT; + if (ctx->cflags & REG_ICASE && (tre_isupper(wc) || tre_islower(wc))) { + tre_ast_node_t *tmp1, *tmp2; + /* multiple opposite case characters are not supported */ + tmp1 = tre_ast_new_literal(ctx->mem, tre_toupper(wc), tre_toupper(wc), ctx->position); + tmp2 = tre_ast_new_literal(ctx->mem, tre_tolower(wc), tre_tolower(wc), ctx->position); + if (tmp1 && tmp2) + node = tre_ast_new_union(ctx->mem, tmp1, tmp2); + else + node = 0; + } else { + node = tre_ast_new_literal(ctx->mem, wc, wc, ctx->position); + } + ctx->position++; + s += len; + break; + } +end: + if (!node) + return REG_ESPACE; + ctx->n = node; + ctx->s = s; + return REG_OK; +} + +#define PUSHPTR(err, s, v) do { \ + if ((err = tre_stack_push_voidptr(s, v)) != REG_OK) \ + return err; \ +} while(0) + +#define PUSHINT(err, s, v) do { \ + if ((err = tre_stack_push_int(s, v)) != REG_OK) \ + return err; \ +} while(0) + +static reg_errcode_t tre_parse(tre_parse_ctx_t *ctx) +{ + tre_ast_node_t *nbranch=0, *nunion=0; + int ere = ctx->cflags & REG_EXTENDED; + const char *s = ctx->start; + int subid = 0; + int depth = 0; + reg_errcode_t err; + tre_stack_t *stack = ctx->stack; + + PUSHINT(err, stack, subid++); + for (;;) { + if ((!ere && *s == '\\' && s[1] == '(') || + (ere && *s == '(')) { + PUSHPTR(err, stack, nunion); + PUSHPTR(err, stack, nbranch); + PUSHINT(err, stack, subid++); + s++; + if (!ere) + s++; + depth++; + nbranch = nunion = 0; + ctx->start = s; + continue; + } + if ((!ere && *s == '\\' && s[1] == ')') || + (ere && *s == ')' && depth)) { + ctx->n = tre_ast_new_literal(ctx->mem, EMPTY, -1, -1); + if (!ctx->n) + return REG_ESPACE; + } else { + err = parse_atom(ctx, s); + if (err != REG_OK) + return err; + s = ctx->s; + } + + parse_iter: + for (;;) { + int min, max; + + if (*s!='\\' && *s!='*') { + if (!ere) + break; + if (*s!='+' && *s!='?' && *s!='{') + break; + } + if (*s=='\\' && ere) + break; + /* extension: treat \+, \? as repetitions in BRE */ + if (*s=='\\' && s[1]!='+' && s[1]!='?' && s[1]!='{') + break; + if (*s=='\\') + s++; + + /* handle ^* at the start of a BRE. */ + if (!ere && s==ctx->start+1 && s[-1]=='^') + break; + + /* extension: multiple consecutive *+?{,} is unspecified, + but (a+)+ has to be supported so accepting a++ makes + sense, note however that the RE_DUP_MAX limit can be + circumvented: (a{255}){255} uses a lot of memory.. */ + if (*s=='{') { + s = parse_dup(s+1, ere, &min, &max); + if (!s) + return REG_BADBR; + } else { + min=0; + max=-1; + if (*s == '+') + min = 1; + if (*s == '?') + max = 1; + s++; + } + if (max == 0) + ctx->n = tre_ast_new_literal(ctx->mem, EMPTY, -1, -1); + else + ctx->n = tre_ast_new_iter(ctx->mem, ctx->n, min, max, 0); + if (!ctx->n) + return REG_ESPACE; + } + + nbranch = tre_ast_new_catenation(ctx->mem, nbranch, ctx->n); + if ((ere && *s == '|') || + (ere && *s == ')' && depth) || + (!ere && *s == '\\' && s[1] == ')') || + /* extension: treat \| as alternation in BRE */ + (!ere && *s == '\\' && s[1] == '|') || + !*s) { + /* extension: empty branch is unspecified (), (|a), (a|) + here they are not rejected but match on empty string */ + int c = *s; + nunion = tre_ast_new_union(ctx->mem, nunion, nbranch); + nbranch = 0; + + if (c == '\\' && s[1] == '|') { + s+=2; + ctx->start = s; + } else if (c == '|') { + s++; + ctx->start = s; + } else { + if (c == '\\') { + if (!depth) return REG_EPAREN; + s+=2; + } else if (c == ')') + s++; + depth--; + err = marksub(ctx, nunion, tre_stack_pop_int(stack)); + if (err != REG_OK) + return err; + if (!c && depth<0) { + ctx->submatch_id = subid; + return REG_OK; + } + if (!c || depth<0) + return REG_EPAREN; + nbranch = tre_stack_pop_voidptr(stack); + nunion = tre_stack_pop_voidptr(stack); + goto parse_iter; + } + } + } +} + + +/*********************************************************************** + from tre-compile.c +***********************************************************************/ + + +/* + TODO: + - Fix tre_ast_to_tnfa() to recurse using a stack instead of recursive + function calls. +*/ + +/* + Algorithms to setup tags so that submatch addressing can be done. +*/ + + +/* Inserts a catenation node to the root of the tree given in `node'. + As the left child a new tag with number `tag_id' to `node' is added, + and the right child is the old root. */ +static reg_errcode_t +tre_add_tag_left(tre_mem_t mem, tre_ast_node_t *node, int tag_id) +{ + tre_catenation_t *c; + + c = tre_mem_alloc(mem, sizeof(*c)); + if (c == NULL) + return REG_ESPACE; + c->left = tre_ast_new_literal(mem, TAG, tag_id, -1); + if (c->left == NULL) + return REG_ESPACE; + c->right = tre_mem_alloc(mem, sizeof(tre_ast_node_t)); + if (c->right == NULL) + return REG_ESPACE; + + c->right->obj = node->obj; + c->right->type = node->type; + c->right->nullable = -1; + c->right->submatch_id = -1; + c->right->firstpos = NULL; + c->right->lastpos = NULL; + c->right->num_tags = 0; + c->right->num_submatches = 0; + node->obj = c; + node->type = CATENATION; + return REG_OK; +} + +/* Inserts a catenation node to the root of the tree given in `node'. + As the right child a new tag with number `tag_id' to `node' is added, + and the left child is the old root. */ +static reg_errcode_t +tre_add_tag_right(tre_mem_t mem, tre_ast_node_t *node, int tag_id) +{ + tre_catenation_t *c; + + c = tre_mem_alloc(mem, sizeof(*c)); + if (c == NULL) + return REG_ESPACE; + c->right = tre_ast_new_literal(mem, TAG, tag_id, -1); + if (c->right == NULL) + return REG_ESPACE; + c->left = tre_mem_alloc(mem, sizeof(tre_ast_node_t)); + if (c->left == NULL) + return REG_ESPACE; + + c->left->obj = node->obj; + c->left->type = node->type; + c->left->nullable = -1; + c->left->submatch_id = -1; + c->left->firstpos = NULL; + c->left->lastpos = NULL; + c->left->num_tags = 0; + c->left->num_submatches = 0; + node->obj = c; + node->type = CATENATION; + return REG_OK; +} + +typedef enum { + ADDTAGS_RECURSE, + ADDTAGS_AFTER_ITERATION, + ADDTAGS_AFTER_UNION_LEFT, + ADDTAGS_AFTER_UNION_RIGHT, + ADDTAGS_AFTER_CAT_LEFT, + ADDTAGS_AFTER_CAT_RIGHT, + ADDTAGS_SET_SUBMATCH_END +} tre_addtags_symbol_t; + + +typedef struct { + int tag; + int next_tag; +} tre_tag_states_t; + + +/* Go through `regset' and set submatch data for submatches that are + using this tag. */ +static void +tre_purge_regset(int *regset, tre_tnfa_t *tnfa, int tag) +{ + int i; + + for (i = 0; regset[i] >= 0; i++) + { + int id = regset[i] / 2; + int start = !(regset[i] % 2); + if (start) + tnfa->submatch_data[id].so_tag = tag; + else + tnfa->submatch_data[id].eo_tag = tag; + } + regset[0] = -1; +} + + +/* Adds tags to appropriate locations in the parse tree in `tree', so that + subexpressions marked for submatch addressing can be traced. */ +static reg_errcode_t +tre_add_tags(tre_mem_t mem, tre_stack_t *stack, tre_ast_node_t *tree, + tre_tnfa_t *tnfa) +{ + reg_errcode_t status = REG_OK; + tre_addtags_symbol_t symbol; + tre_ast_node_t *node = tree; /* Tree node we are currently looking at. */ + int bottom = tre_stack_num_objects(stack); + /* True for first pass (counting number of needed tags) */ + int first_pass = (mem == NULL || tnfa == NULL); + int *regset, *orig_regset; + int num_tags = 0; /* Total number of tags. */ + int num_minimals = 0; /* Number of special minimal tags. */ + int tag = 0; /* The tag that is to be added next. */ + int next_tag = 1; /* Next tag to use after this one. */ + int *parents; /* Stack of submatches the current submatch is + contained in. */ + int minimal_tag = -1; /* Tag that marks the beginning of a minimal match. */ + tre_tag_states_t *saved_states; + + tre_tag_direction_t direction = TRE_TAG_MINIMIZE; + if (!first_pass) + { + tnfa->end_tag = 0; + tnfa->minimal_tags[0] = -1; + } + + regset = xmalloc(sizeof(*regset) * ((tnfa->num_submatches + 1) * 2)); + if (regset == NULL) + return REG_ESPACE; + regset[0] = -1; + orig_regset = regset; + + parents = xmalloc(sizeof(*parents) * (tnfa->num_submatches + 1)); + if (parents == NULL) + { + xfree(regset); + return REG_ESPACE; + } + parents[0] = -1; + + saved_states = xmalloc(sizeof(*saved_states) * (tnfa->num_submatches + 1)); + if (saved_states == NULL) + { + xfree(regset); + xfree(parents); + return REG_ESPACE; + } + else + { + unsigned int i; + for (i = 0; i <= tnfa->num_submatches; i++) + saved_states[i].tag = -1; + } + + STACK_PUSH(stack, voidptr, node); + STACK_PUSH(stack, int, ADDTAGS_RECURSE); + + while (tre_stack_num_objects(stack) > bottom) + { + if (status != REG_OK) + break; + + symbol = (tre_addtags_symbol_t)tre_stack_pop_int(stack); + switch (symbol) + { + + case ADDTAGS_SET_SUBMATCH_END: + { + int id = tre_stack_pop_int(stack); + int i; + + /* Add end of this submatch to regset. */ + for (i = 0; regset[i] >= 0; i++); + regset[i] = id * 2 + 1; + regset[i + 1] = -1; + + /* Pop this submatch from the parents stack. */ + for (i = 0; parents[i] >= 0; i++); + parents[i - 1] = -1; + break; + } + + case ADDTAGS_RECURSE: + node = tre_stack_pop_voidptr(stack); + + if (node->submatch_id >= 0) + { + int id = node->submatch_id; + int i; + + + /* Add start of this submatch to regset. */ + for (i = 0; regset[i] >= 0; i++); + regset[i] = id * 2; + regset[i + 1] = -1; + + if (!first_pass) + { + for (i = 0; parents[i] >= 0; i++); + tnfa->submatch_data[id].parents = NULL; + if (i > 0) + { + int *p = xmalloc(sizeof(*p) * (i + 1)); + if (p == NULL) + { + status = REG_ESPACE; + break; + } + assert(tnfa->submatch_data[id].parents == NULL); + tnfa->submatch_data[id].parents = p; + for (i = 0; parents[i] >= 0; i++) + p[i] = parents[i]; + p[i] = -1; + } + } + + /* Add end of this submatch to regset after processing this + node. */ + STACK_PUSHX(stack, int, node->submatch_id); + STACK_PUSHX(stack, int, ADDTAGS_SET_SUBMATCH_END); + } + + switch (node->type) + { + case LITERAL: + { + tre_literal_t *lit = node->obj; + + if (!IS_SPECIAL(lit) || IS_BACKREF(lit)) + { + int i; + if (regset[0] >= 0) + { + /* Regset is not empty, so add a tag before the + literal or backref. */ + if (!first_pass) + { + status = tre_add_tag_left(mem, node, tag); + tnfa->tag_directions[tag] = direction; + if (minimal_tag >= 0) + { + for (i = 0; tnfa->minimal_tags[i] >= 0; i++); + tnfa->minimal_tags[i] = tag; + tnfa->minimal_tags[i + 1] = minimal_tag; + tnfa->minimal_tags[i + 2] = -1; + minimal_tag = -1; + num_minimals++; + } + tre_purge_regset(regset, tnfa, tag); + } + else + { + node->num_tags = 1; + } + + regset[0] = -1; + tag = next_tag; + num_tags++; + next_tag++; + } + } + else + { + assert(!IS_TAG(lit)); + } + break; + } + case CATENATION: + { + tre_catenation_t *cat = node->obj; + tre_ast_node_t *left = cat->left; + tre_ast_node_t *right = cat->right; + int reserved_tag = -1; + + + /* After processing right child. */ + STACK_PUSHX(stack, voidptr, node); + STACK_PUSHX(stack, int, ADDTAGS_AFTER_CAT_RIGHT); + + /* Process right child. */ + STACK_PUSHX(stack, voidptr, right); + STACK_PUSHX(stack, int, ADDTAGS_RECURSE); + + /* After processing left child. */ + STACK_PUSHX(stack, int, next_tag + left->num_tags); + if (left->num_tags > 0 && right->num_tags > 0) + { + /* Reserve the next tag to the right child. */ + reserved_tag = next_tag; + next_tag++; + } + STACK_PUSHX(stack, int, reserved_tag); + STACK_PUSHX(stack, int, ADDTAGS_AFTER_CAT_LEFT); + + /* Process left child. */ + STACK_PUSHX(stack, voidptr, left); + STACK_PUSHX(stack, int, ADDTAGS_RECURSE); + + } + break; + case ITERATION: + { + tre_iteration_t *iter = node->obj; + + if (first_pass) + { + STACK_PUSHX(stack, int, regset[0] >= 0 || iter->minimal); + } + else + { + STACK_PUSHX(stack, int, tag); + STACK_PUSHX(stack, int, iter->minimal); + } + STACK_PUSHX(stack, voidptr, node); + STACK_PUSHX(stack, int, ADDTAGS_AFTER_ITERATION); + + STACK_PUSHX(stack, voidptr, iter->arg); + STACK_PUSHX(stack, int, ADDTAGS_RECURSE); + + /* Regset is not empty, so add a tag here. */ + if (regset[0] >= 0 || iter->minimal) + { + if (!first_pass) + { + int i; + status = tre_add_tag_left(mem, node, tag); + if (iter->minimal) + tnfa->tag_directions[tag] = TRE_TAG_MAXIMIZE; + else + tnfa->tag_directions[tag] = direction; + if (minimal_tag >= 0) + { + for (i = 0; tnfa->minimal_tags[i] >= 0; i++); + tnfa->minimal_tags[i] = tag; + tnfa->minimal_tags[i + 1] = minimal_tag; + tnfa->minimal_tags[i + 2] = -1; + minimal_tag = -1; + num_minimals++; + } + tre_purge_regset(regset, tnfa, tag); + } + + regset[0] = -1; + tag = next_tag; + num_tags++; + next_tag++; + } + direction = TRE_TAG_MINIMIZE; + } + break; + case UNION: + { + tre_union_t *uni = node->obj; + tre_ast_node_t *left = uni->left; + tre_ast_node_t *right = uni->right; + int left_tag; + int right_tag; + + if (regset[0] >= 0) + { + left_tag = next_tag; + right_tag = next_tag + 1; + } + else + { + left_tag = tag; + right_tag = next_tag; + } + + /* After processing right child. */ + STACK_PUSHX(stack, int, right_tag); + STACK_PUSHX(stack, int, left_tag); + STACK_PUSHX(stack, voidptr, regset); + STACK_PUSHX(stack, int, regset[0] >= 0); + STACK_PUSHX(stack, voidptr, node); + STACK_PUSHX(stack, voidptr, right); + STACK_PUSHX(stack, voidptr, left); + STACK_PUSHX(stack, int, ADDTAGS_AFTER_UNION_RIGHT); + + /* Process right child. */ + STACK_PUSHX(stack, voidptr, right); + STACK_PUSHX(stack, int, ADDTAGS_RECURSE); + + /* After processing left child. */ + STACK_PUSHX(stack, int, ADDTAGS_AFTER_UNION_LEFT); + + /* Process left child. */ + STACK_PUSHX(stack, voidptr, left); + STACK_PUSHX(stack, int, ADDTAGS_RECURSE); + + /* Regset is not empty, so add a tag here. */ + if (regset[0] >= 0) + { + if (!first_pass) + { + int i; + status = tre_add_tag_left(mem, node, tag); + tnfa->tag_directions[tag] = direction; + if (minimal_tag >= 0) + { + for (i = 0; tnfa->minimal_tags[i] >= 0; i++); + tnfa->minimal_tags[i] = tag; + tnfa->minimal_tags[i + 1] = minimal_tag; + tnfa->minimal_tags[i + 2] = -1; + minimal_tag = -1; + num_minimals++; + } + tre_purge_regset(regset, tnfa, tag); + } + + regset[0] = -1; + tag = next_tag; + num_tags++; + next_tag++; + } + + if (node->num_submatches > 0) + { + /* The next two tags are reserved for markers. */ + next_tag++; + tag = next_tag; + next_tag++; + } + + break; + } + } + + if (node->submatch_id >= 0) + { + int i; + /* Push this submatch on the parents stack. */ + for (i = 0; parents[i] >= 0; i++); + parents[i] = node->submatch_id; + parents[i + 1] = -1; + } + + break; /* end case: ADDTAGS_RECURSE */ + + case ADDTAGS_AFTER_ITERATION: + { + int minimal = 0; + int enter_tag; + node = tre_stack_pop_voidptr(stack); + if (first_pass) + { + node->num_tags = ((tre_iteration_t *)node->obj)->arg->num_tags + + tre_stack_pop_int(stack); + minimal_tag = -1; + } + else + { + minimal = tre_stack_pop_int(stack); + enter_tag = tre_stack_pop_int(stack); + if (minimal) + minimal_tag = enter_tag; + } + + if (!first_pass) + { + if (minimal) + direction = TRE_TAG_MINIMIZE; + else + direction = TRE_TAG_MAXIMIZE; + } + break; + } + + case ADDTAGS_AFTER_CAT_LEFT: + { + int new_tag = tre_stack_pop_int(stack); + next_tag = tre_stack_pop_int(stack); + if (new_tag >= 0) + { + tag = new_tag; + } + break; + } + + case ADDTAGS_AFTER_CAT_RIGHT: + node = tre_stack_pop_voidptr(stack); + if (first_pass) + node->num_tags = ((tre_catenation_t *)node->obj)->left->num_tags + + ((tre_catenation_t *)node->obj)->right->num_tags; + break; + + case ADDTAGS_AFTER_UNION_LEFT: + /* Lift the bottom of the `regset' array so that when processing + the right operand the items currently in the array are + invisible. The original bottom was saved at ADDTAGS_UNION and + will be restored at ADDTAGS_AFTER_UNION_RIGHT below. */ + while (*regset >= 0) + regset++; + break; + + case ADDTAGS_AFTER_UNION_RIGHT: + { + int added_tags, tag_left, tag_right; + tre_ast_node_t *left = tre_stack_pop_voidptr(stack); + tre_ast_node_t *right = tre_stack_pop_voidptr(stack); + node = tre_stack_pop_voidptr(stack); + added_tags = tre_stack_pop_int(stack); + if (first_pass) + { + node->num_tags = ((tre_union_t *)node->obj)->left->num_tags + + ((tre_union_t *)node->obj)->right->num_tags + added_tags + + ((node->num_submatches > 0) ? 2 : 0); + } + regset = tre_stack_pop_voidptr(stack); + tag_left = tre_stack_pop_int(stack); + tag_right = tre_stack_pop_int(stack); + + /* Add tags after both children, the left child gets a smaller + tag than the right child. This guarantees that we prefer + the left child over the right child. */ + /* XXX - This is not always necessary (if the children have + tags which must be seen for every match of that child). */ + /* XXX - Check if this is the only place where tre_add_tag_right + is used. If so, use tre_add_tag_left (putting the tag before + the child as opposed after the child) and throw away + tre_add_tag_right. */ + if (node->num_submatches > 0) + { + if (!first_pass) + { + status = tre_add_tag_right(mem, left, tag_left); + tnfa->tag_directions[tag_left] = TRE_TAG_MAXIMIZE; + if (status == REG_OK) + status = tre_add_tag_right(mem, right, tag_right); + tnfa->tag_directions[tag_right] = TRE_TAG_MAXIMIZE; + } + num_tags += 2; + } + direction = TRE_TAG_MAXIMIZE; + break; + } + + default: + assert(0); + break; + + } /* end switch(symbol) */ + } /* end while(tre_stack_num_objects(stack) > bottom) */ + + if (!first_pass) + tre_purge_regset(regset, tnfa, tag); + + if (!first_pass && minimal_tag >= 0) + { + int i; + for (i = 0; tnfa->minimal_tags[i] >= 0; i++); + tnfa->minimal_tags[i] = tag; + tnfa->minimal_tags[i + 1] = minimal_tag; + tnfa->minimal_tags[i + 2] = -1; + minimal_tag = -1; + num_minimals++; + } + + assert(tree->num_tags == num_tags); + tnfa->end_tag = num_tags; + tnfa->num_tags = num_tags; + tnfa->num_minimals = num_minimals; + xfree(orig_regset); + xfree(parents); + xfree(saved_states); + return status; +} + + + +/* + AST to TNFA compilation routines. +*/ + +typedef enum { + COPY_RECURSE, + COPY_SET_RESULT_PTR +} tre_copyast_symbol_t; + +/* Flags for tre_copy_ast(). */ +#define COPY_REMOVE_TAGS 1 +#define COPY_MAXIMIZE_FIRST_TAG 2 + +static reg_errcode_t +tre_copy_ast(tre_mem_t mem, tre_stack_t *stack, tre_ast_node_t *ast, + int flags, int *pos_add, tre_tag_direction_t *tag_directions, + tre_ast_node_t **copy, int *max_pos) +{ + reg_errcode_t status = REG_OK; + int bottom = tre_stack_num_objects(stack); + int num_copied = 0; + int first_tag = 1; + tre_ast_node_t **result = copy; + tre_copyast_symbol_t symbol; + + STACK_PUSH(stack, voidptr, ast); + STACK_PUSH(stack, int, COPY_RECURSE); + + while (status == REG_OK && tre_stack_num_objects(stack) > bottom) + { + tre_ast_node_t *node; + if (status != REG_OK) + break; + + symbol = (tre_copyast_symbol_t)tre_stack_pop_int(stack); + switch (symbol) + { + case COPY_SET_RESULT_PTR: + result = tre_stack_pop_voidptr(stack); + break; + case COPY_RECURSE: + node = tre_stack_pop_voidptr(stack); + switch (node->type) + { + case LITERAL: + { + tre_literal_t *lit = node->obj; + int pos = lit->position; + int min = lit->code_min; + int max = lit->code_max; + if (!IS_SPECIAL(lit) || IS_BACKREF(lit)) + { + /* XXX - e.g. [ab] has only one position but two + nodes, so we are creating holes in the state space + here. Not fatal, just wastes memory. */ + pos += *pos_add; + num_copied++; + } + else if (IS_TAG(lit) && (flags & COPY_REMOVE_TAGS)) + { + /* Change this tag to empty. */ + min = EMPTY; + max = pos = -1; + } + else if (IS_TAG(lit) && (flags & COPY_MAXIMIZE_FIRST_TAG) + && first_tag) + { + /* Maximize the first tag. */ + tag_directions[max] = TRE_TAG_MAXIMIZE; + first_tag = 0; + } + *result = tre_ast_new_literal(mem, min, max, pos); + if (*result == NULL) + status = REG_ESPACE; + else { + tre_literal_t *p = (*result)->obj; + p->class = lit->class; + p->neg_classes = lit->neg_classes; + } + + if (pos > *max_pos) + *max_pos = pos; + break; + } + case UNION: + { + tre_union_t *uni = node->obj; + tre_union_t *tmp; + *result = tre_ast_new_union(mem, uni->left, uni->right); + if (*result == NULL) + { + status = REG_ESPACE; + break; + } + tmp = (*result)->obj; + result = &tmp->left; + STACK_PUSHX(stack, voidptr, uni->right); + STACK_PUSHX(stack, int, COPY_RECURSE); + STACK_PUSHX(stack, voidptr, &tmp->right); + STACK_PUSHX(stack, int, COPY_SET_RESULT_PTR); + STACK_PUSHX(stack, voidptr, uni->left); + STACK_PUSHX(stack, int, COPY_RECURSE); + break; + } + case CATENATION: + { + tre_catenation_t *cat = node->obj; + tre_catenation_t *tmp; + *result = tre_ast_new_catenation(mem, cat->left, cat->right); + if (*result == NULL) + { + status = REG_ESPACE; + break; + } + tmp = (*result)->obj; + tmp->left = NULL; + tmp->right = NULL; + result = &tmp->left; + + STACK_PUSHX(stack, voidptr, cat->right); + STACK_PUSHX(stack, int, COPY_RECURSE); + STACK_PUSHX(stack, voidptr, &tmp->right); + STACK_PUSHX(stack, int, COPY_SET_RESULT_PTR); + STACK_PUSHX(stack, voidptr, cat->left); + STACK_PUSHX(stack, int, COPY_RECURSE); + break; + } + case ITERATION: + { + tre_iteration_t *iter = node->obj; + STACK_PUSHX(stack, voidptr, iter->arg); + STACK_PUSHX(stack, int, COPY_RECURSE); + *result = tre_ast_new_iter(mem, iter->arg, iter->min, + iter->max, iter->minimal); + if (*result == NULL) + { + status = REG_ESPACE; + break; + } + iter = (*result)->obj; + result = &iter->arg; + break; + } + default: + assert(0); + break; + } + break; + } + } + *pos_add += num_copied; + return status; +} + +typedef enum { + EXPAND_RECURSE, + EXPAND_AFTER_ITER +} tre_expand_ast_symbol_t; + +/* Expands each iteration node that has a finite nonzero minimum or maximum + iteration count to a catenated sequence of copies of the node. */ +static reg_errcode_t +tre_expand_ast(tre_mem_t mem, tre_stack_t *stack, tre_ast_node_t *ast, + int *position, tre_tag_direction_t *tag_directions) +{ + reg_errcode_t status = REG_OK; + int bottom = tre_stack_num_objects(stack); + int pos_add = 0; + int pos_add_total = 0; + int max_pos = 0; + int iter_depth = 0; + + STACK_PUSHR(stack, voidptr, ast); + STACK_PUSHR(stack, int, EXPAND_RECURSE); + while (status == REG_OK && tre_stack_num_objects(stack) > bottom) + { + tre_ast_node_t *node; + tre_expand_ast_symbol_t symbol; + + if (status != REG_OK) + break; + + symbol = (tre_expand_ast_symbol_t)tre_stack_pop_int(stack); + node = tre_stack_pop_voidptr(stack); + switch (symbol) + { + case EXPAND_RECURSE: + switch (node->type) + { + case LITERAL: + { + tre_literal_t *lit= node->obj; + if (!IS_SPECIAL(lit) || IS_BACKREF(lit)) + { + lit->position += pos_add; + if (lit->position > max_pos) + max_pos = lit->position; + } + break; + } + case UNION: + { + tre_union_t *uni = node->obj; + STACK_PUSHX(stack, voidptr, uni->right); + STACK_PUSHX(stack, int, EXPAND_RECURSE); + STACK_PUSHX(stack, voidptr, uni->left); + STACK_PUSHX(stack, int, EXPAND_RECURSE); + break; + } + case CATENATION: + { + tre_catenation_t *cat = node->obj; + STACK_PUSHX(stack, voidptr, cat->right); + STACK_PUSHX(stack, int, EXPAND_RECURSE); + STACK_PUSHX(stack, voidptr, cat->left); + STACK_PUSHX(stack, int, EXPAND_RECURSE); + break; + } + case ITERATION: + { + tre_iteration_t *iter = node->obj; + STACK_PUSHX(stack, int, pos_add); + STACK_PUSHX(stack, voidptr, node); + STACK_PUSHX(stack, int, EXPAND_AFTER_ITER); + STACK_PUSHX(stack, voidptr, iter->arg); + STACK_PUSHX(stack, int, EXPAND_RECURSE); + /* If we are going to expand this node at EXPAND_AFTER_ITER + then don't increase the `pos' fields of the nodes now, it + will get done when expanding. */ + if (iter->min > 1 || iter->max > 1) + pos_add = 0; + iter_depth++; + break; + } + default: + assert(0); + break; + } + break; + case EXPAND_AFTER_ITER: + { + tre_iteration_t *iter = node->obj; + int pos_add_last; + pos_add = tre_stack_pop_int(stack); + pos_add_last = pos_add; + if (iter->min > 1 || iter->max > 1) + { + tre_ast_node_t *seq1 = NULL, *seq2 = NULL; + int j; + int pos_add_save = pos_add; + + /* Create a catenated sequence of copies of the node. */ + for (j = 0; j < iter->min; j++) + { + tre_ast_node_t *copy; + /* Remove tags from all but the last copy. */ + int flags = ((j + 1 < iter->min) + ? COPY_REMOVE_TAGS + : COPY_MAXIMIZE_FIRST_TAG); + pos_add_save = pos_add; + status = tre_copy_ast(mem, stack, iter->arg, flags, + &pos_add, tag_directions, ©, + &max_pos); + if (status != REG_OK) + return status; + if (seq1 != NULL) + seq1 = tre_ast_new_catenation(mem, seq1, copy); + else + seq1 = copy; + if (seq1 == NULL) + return REG_ESPACE; + } + + if (iter->max == -1) + { + /* No upper limit. */ + pos_add_save = pos_add; + status = tre_copy_ast(mem, stack, iter->arg, 0, + &pos_add, NULL, &seq2, &max_pos); + if (status != REG_OK) + return status; + seq2 = tre_ast_new_iter(mem, seq2, 0, -1, 0); + if (seq2 == NULL) + return REG_ESPACE; + } + else + { + for (j = iter->min; j < iter->max; j++) + { + tre_ast_node_t *tmp, *copy; + pos_add_save = pos_add; + status = tre_copy_ast(mem, stack, iter->arg, 0, + &pos_add, NULL, ©, &max_pos); + if (status != REG_OK) + return status; + if (seq2 != NULL) + seq2 = tre_ast_new_catenation(mem, copy, seq2); + else + seq2 = copy; + if (seq2 == NULL) + return REG_ESPACE; + tmp = tre_ast_new_literal(mem, EMPTY, -1, -1); + if (tmp == NULL) + return REG_ESPACE; + seq2 = tre_ast_new_union(mem, tmp, seq2); + if (seq2 == NULL) + return REG_ESPACE; + } + } + + pos_add = pos_add_save; + if (seq1 == NULL) + seq1 = seq2; + else if (seq2 != NULL) + seq1 = tre_ast_new_catenation(mem, seq1, seq2); + if (seq1 == NULL) + return REG_ESPACE; + node->obj = seq1->obj; + node->type = seq1->type; + } + + iter_depth--; + pos_add_total += pos_add - pos_add_last; + if (iter_depth == 0) + pos_add = pos_add_total; + + break; + } + default: + assert(0); + break; + } + } + + *position += pos_add_total; + + /* `max_pos' should never be larger than `*position' if the above + code works, but just an extra safeguard let's make sure + `*position' is set large enough so enough memory will be + allocated for the transition table. */ + if (max_pos > *position) + *position = max_pos; + + return status; +} + +static tre_pos_and_tags_t * +tre_set_empty(tre_mem_t mem) +{ + tre_pos_and_tags_t *new_set; + + new_set = tre_mem_calloc(mem, sizeof(*new_set)); + if (new_set == NULL) + return NULL; + + new_set[0].position = -1; + new_set[0].code_min = -1; + new_set[0].code_max = -1; + + return new_set; +} + +static tre_pos_and_tags_t * +tre_set_one(tre_mem_t mem, int position, int code_min, int code_max, + tre_ctype_t class, tre_ctype_t *neg_classes, int backref) +{ + tre_pos_and_tags_t *new_set; + + new_set = tre_mem_calloc(mem, sizeof(*new_set) * 2); + if (new_set == NULL) + return NULL; + + new_set[0].position = position; + new_set[0].code_min = code_min; + new_set[0].code_max = code_max; + new_set[0].class = class; + new_set[0].neg_classes = neg_classes; + new_set[0].backref = backref; + new_set[1].position = -1; + new_set[1].code_min = -1; + new_set[1].code_max = -1; + + return new_set; +} + +static tre_pos_and_tags_t * +tre_set_union(tre_mem_t mem, tre_pos_and_tags_t *set1, tre_pos_and_tags_t *set2, + int *tags, int assertions) +{ + int s1, s2, i, j; + tre_pos_and_tags_t *new_set; + int *new_tags; + int num_tags; + + for (num_tags = 0; tags != NULL && tags[num_tags] >= 0; num_tags++); + for (s1 = 0; set1[s1].position >= 0; s1++); + for (s2 = 0; set2[s2].position >= 0; s2++); + new_set = tre_mem_calloc(mem, sizeof(*new_set) * (s1 + s2 + 1)); + if (!new_set ) + return NULL; + + for (s1 = 0; set1[s1].position >= 0; s1++) + { + new_set[s1].position = set1[s1].position; + new_set[s1].code_min = set1[s1].code_min; + new_set[s1].code_max = set1[s1].code_max; + new_set[s1].assertions = set1[s1].assertions | assertions; + new_set[s1].class = set1[s1].class; + new_set[s1].neg_classes = set1[s1].neg_classes; + new_set[s1].backref = set1[s1].backref; + if (set1[s1].tags == NULL && tags == NULL) + new_set[s1].tags = NULL; + else + { + for (i = 0; set1[s1].tags != NULL && set1[s1].tags[i] >= 0; i++); + new_tags = tre_mem_alloc(mem, (sizeof(*new_tags) + * (i + num_tags + 1))); + if (new_tags == NULL) + return NULL; + for (j = 0; j < i; j++) + new_tags[j] = set1[s1].tags[j]; + for (i = 0; i < num_tags; i++) + new_tags[j + i] = tags[i]; + new_tags[j + i] = -1; + new_set[s1].tags = new_tags; + } + } + + for (s2 = 0; set2[s2].position >= 0; s2++) + { + new_set[s1 + s2].position = set2[s2].position; + new_set[s1 + s2].code_min = set2[s2].code_min; + new_set[s1 + s2].code_max = set2[s2].code_max; + /* XXX - why not | assertions here as well? */ + new_set[s1 + s2].assertions = set2[s2].assertions; + new_set[s1 + s2].class = set2[s2].class; + new_set[s1 + s2].neg_classes = set2[s2].neg_classes; + new_set[s1 + s2].backref = set2[s2].backref; + if (set2[s2].tags == NULL) + new_set[s1 + s2].tags = NULL; + else + { + for (i = 0; set2[s2].tags[i] >= 0; i++); + new_tags = tre_mem_alloc(mem, sizeof(*new_tags) * (i + 1)); + if (new_tags == NULL) + return NULL; + for (j = 0; j < i; j++) + new_tags[j] = set2[s2].tags[j]; + new_tags[j] = -1; + new_set[s1 + s2].tags = new_tags; + } + } + new_set[s1 + s2].position = -1; + return new_set; +} + +/* Finds the empty path through `node' which is the one that should be + taken according to POSIX.2 rules, and adds the tags on that path to + `tags'. `tags' may be NULL. If `num_tags_seen' is not NULL, it is + set to the number of tags seen on the path. */ +static reg_errcode_t +tre_match_empty(tre_stack_t *stack, tre_ast_node_t *node, int *tags, + int *assertions, int *num_tags_seen) +{ + tre_literal_t *lit; + tre_union_t *uni; + tre_catenation_t *cat; + tre_iteration_t *iter; + int i; + int bottom = tre_stack_num_objects(stack); + reg_errcode_t status = REG_OK; + if (num_tags_seen) + *num_tags_seen = 0; + + status = tre_stack_push_voidptr(stack, node); + + /* Walk through the tree recursively. */ + while (status == REG_OK && tre_stack_num_objects(stack) > bottom) + { + node = tre_stack_pop_voidptr(stack); + + switch (node->type) + { + case LITERAL: + lit = (tre_literal_t *)node->obj; + switch (lit->code_min) + { + case TAG: + if (lit->code_max >= 0) + { + if (tags != NULL) + { + /* Add the tag to `tags'. */ + for (i = 0; tags[i] >= 0; i++) + if (tags[i] == lit->code_max) + break; + if (tags[i] < 0) + { + tags[i] = lit->code_max; + tags[i + 1] = -1; + } + } + if (num_tags_seen) + (*num_tags_seen)++; + } + break; + case ASSERTION: + assert(lit->code_max >= 1 + || lit->code_max <= ASSERT_LAST); + if (assertions != NULL) + *assertions |= lit->code_max; + break; + case EMPTY: + break; + default: + assert(0); + break; + } + break; + + case UNION: + /* Subexpressions starting earlier take priority over ones + starting later, so we prefer the left subexpression over the + right subexpression. */ + uni = (tre_union_t *)node->obj; + if (uni->left->nullable) + STACK_PUSHX(stack, voidptr, uni->left) + else if (uni->right->nullable) + STACK_PUSHX(stack, voidptr, uni->right) + else + assert(0); + break; + + case CATENATION: + /* The path must go through both children. */ + cat = (tre_catenation_t *)node->obj; + assert(cat->left->nullable); + assert(cat->right->nullable); + STACK_PUSHX(stack, voidptr, cat->left); + STACK_PUSHX(stack, voidptr, cat->right); + break; + + case ITERATION: + /* A match with an empty string is preferred over no match at + all, so we go through the argument if possible. */ + iter = (tre_iteration_t *)node->obj; + if (iter->arg->nullable) + STACK_PUSHX(stack, voidptr, iter->arg); + break; + + default: + assert(0); + break; + } + } + + return status; +} + + +typedef enum { + NFL_RECURSE, + NFL_POST_UNION, + NFL_POST_CATENATION, + NFL_POST_ITERATION +} tre_nfl_stack_symbol_t; + + +/* Computes and fills in the fields `nullable', `firstpos', and `lastpos' for + the nodes of the AST `tree'. */ +static reg_errcode_t +tre_compute_nfl(tre_mem_t mem, tre_stack_t *stack, tre_ast_node_t *tree) +{ + int bottom = tre_stack_num_objects(stack); + + STACK_PUSHR(stack, voidptr, tree); + STACK_PUSHR(stack, int, NFL_RECURSE); + + while (tre_stack_num_objects(stack) > bottom) + { + tre_nfl_stack_symbol_t symbol; + tre_ast_node_t *node; + + symbol = (tre_nfl_stack_symbol_t)tre_stack_pop_int(stack); + node = tre_stack_pop_voidptr(stack); + switch (symbol) + { + case NFL_RECURSE: + switch (node->type) + { + case LITERAL: + { + tre_literal_t *lit = (tre_literal_t *)node->obj; + if (IS_BACKREF(lit)) + { + /* Back references: nullable = false, firstpos = {i}, + lastpos = {i}. */ + node->nullable = 0; + node->firstpos = tre_set_one(mem, lit->position, 0, + TRE_CHAR_MAX, 0, NULL, -1); + if (!node->firstpos) + return REG_ESPACE; + node->lastpos = tre_set_one(mem, lit->position, 0, + TRE_CHAR_MAX, 0, NULL, + (int)lit->code_max); + if (!node->lastpos) + return REG_ESPACE; + } + else if (lit->code_min < 0) + { + /* Tags, empty strings, params, and zero width assertions: + nullable = true, firstpos = {}, and lastpos = {}. */ + node->nullable = 1; + node->firstpos = tre_set_empty(mem); + if (!node->firstpos) + return REG_ESPACE; + node->lastpos = tre_set_empty(mem); + if (!node->lastpos) + return REG_ESPACE; + } + else + { + /* Literal at position i: nullable = false, firstpos = {i}, + lastpos = {i}. */ + node->nullable = 0; + node->firstpos = + tre_set_one(mem, lit->position, (int)lit->code_min, + (int)lit->code_max, 0, NULL, -1); + if (!node->firstpos) + return REG_ESPACE; + node->lastpos = tre_set_one(mem, lit->position, + (int)lit->code_min, + (int)lit->code_max, + lit->class, lit->neg_classes, + -1); + if (!node->lastpos) + return REG_ESPACE; + } + break; + } + + case UNION: + /* Compute the attributes for the two subtrees, and after that + for this node. */ + STACK_PUSHR(stack, voidptr, node); + STACK_PUSHR(stack, int, NFL_POST_UNION); + STACK_PUSHR(stack, voidptr, ((tre_union_t *)node->obj)->right); + STACK_PUSHR(stack, int, NFL_RECURSE); + STACK_PUSHR(stack, voidptr, ((tre_union_t *)node->obj)->left); + STACK_PUSHR(stack, int, NFL_RECURSE); + break; + + case CATENATION: + /* Compute the attributes for the two subtrees, and after that + for this node. */ + STACK_PUSHR(stack, voidptr, node); + STACK_PUSHR(stack, int, NFL_POST_CATENATION); + STACK_PUSHR(stack, voidptr, ((tre_catenation_t *)node->obj)->right); + STACK_PUSHR(stack, int, NFL_RECURSE); + STACK_PUSHR(stack, voidptr, ((tre_catenation_t *)node->obj)->left); + STACK_PUSHR(stack, int, NFL_RECURSE); + break; + + case ITERATION: + /* Compute the attributes for the subtree, and after that for + this node. */ + STACK_PUSHR(stack, voidptr, node); + STACK_PUSHR(stack, int, NFL_POST_ITERATION); + STACK_PUSHR(stack, voidptr, ((tre_iteration_t *)node->obj)->arg); + STACK_PUSHR(stack, int, NFL_RECURSE); + break; + } + break; /* end case: NFL_RECURSE */ + + case NFL_POST_UNION: + { + tre_union_t *uni = (tre_union_t *)node->obj; + node->nullable = uni->left->nullable || uni->right->nullable; + node->firstpos = tre_set_union(mem, uni->left->firstpos, + uni->right->firstpos, NULL, 0); + if (!node->firstpos) + return REG_ESPACE; + node->lastpos = tre_set_union(mem, uni->left->lastpos, + uni->right->lastpos, NULL, 0); + if (!node->lastpos) + return REG_ESPACE; + break; + } + + case NFL_POST_ITERATION: + { + tre_iteration_t *iter = (tre_iteration_t *)node->obj; + + if (iter->min == 0 || iter->arg->nullable) + node->nullable = 1; + else + node->nullable = 0; + node->firstpos = iter->arg->firstpos; + node->lastpos = iter->arg->lastpos; + break; + } + + case NFL_POST_CATENATION: + { + int num_tags, *tags, assertions; + reg_errcode_t status; + tre_catenation_t *cat = node->obj; + node->nullable = cat->left->nullable && cat->right->nullable; + + /* Compute firstpos. */ + if (cat->left->nullable) + { + /* The left side matches the empty string. Make a first pass + with tre_match_empty() to get the number of tags and + parameters. */ + status = tre_match_empty(stack, cat->left, + NULL, NULL, &num_tags); + if (status != REG_OK) + return status; + /* Allocate arrays for the tags and parameters. */ + tags = xmalloc(sizeof(*tags) * (num_tags + 1)); + if (!tags) + return REG_ESPACE; + tags[0] = -1; + assertions = 0; + /* Second pass with tre_mach_empty() to get the list of + tags and parameters. */ + status = tre_match_empty(stack, cat->left, tags, + &assertions, NULL); + if (status != REG_OK) + { + xfree(tags); + return status; + } + node->firstpos = + tre_set_union(mem, cat->right->firstpos, cat->left->firstpos, + tags, assertions); + xfree(tags); + if (!node->firstpos) + return REG_ESPACE; + } + else + { + node->firstpos = cat->left->firstpos; + } + + /* Compute lastpos. */ + if (cat->right->nullable) + { + /* The right side matches the empty string. Make a first pass + with tre_match_empty() to get the number of tags and + parameters. */ + status = tre_match_empty(stack, cat->right, + NULL, NULL, &num_tags); + if (status != REG_OK) + return status; + /* Allocate arrays for the tags and parameters. */ + tags = xmalloc(sizeof(int) * (num_tags + 1)); + if (!tags) + return REG_ESPACE; + tags[0] = -1; + assertions = 0; + /* Second pass with tre_mach_empty() to get the list of + tags and parameters. */ + status = tre_match_empty(stack, cat->right, tags, + &assertions, NULL); + if (status != REG_OK) + { + xfree(tags); + return status; + } + node->lastpos = + tre_set_union(mem, cat->left->lastpos, cat->right->lastpos, + tags, assertions); + xfree(tags); + if (!node->lastpos) + return REG_ESPACE; + } + else + { + node->lastpos = cat->right->lastpos; + } + break; + } + + default: + assert(0); + break; + } + } + + return REG_OK; +} + + +/* Adds a transition from each position in `p1' to each position in `p2'. */ +static reg_errcode_t +tre_make_trans(tre_pos_and_tags_t *p1, tre_pos_and_tags_t *p2, + tre_tnfa_transition_t *transitions, + int *counts, int *offs) +{ + tre_pos_and_tags_t *orig_p2 = p2; + tre_tnfa_transition_t *trans; + int i, j, k, l, dup, prev_p2_pos; + + if (transitions != NULL) + while (p1->position >= 0) + { + p2 = orig_p2; + prev_p2_pos = -1; + while (p2->position >= 0) + { + /* Optimization: if this position was already handled, skip it. */ + if (p2->position == prev_p2_pos) + { + p2++; + continue; + } + prev_p2_pos = p2->position; + /* Set `trans' to point to the next unused transition from + position `p1->position'. */ + trans = transitions + offs[p1->position]; + while (trans->state != NULL) + { +#if 0 + /* If we find a previous transition from `p1->position' to + `p2->position', it is overwritten. This can happen only + if there are nested loops in the regexp, like in "((a)*)*". + In POSIX.2 repetition using the outer loop is always + preferred over using the inner loop. Therefore the + transition for the inner loop is useless and can be thrown + away. */ + /* XXX - The same position is used for all nodes in a bracket + expression, so this optimization cannot be used (it will + break bracket expressions) unless I figure out a way to + detect it here. */ + if (trans->state_id == p2->position) + { + break; + } +#endif + trans++; + } + + if (trans->state == NULL) + (trans + 1)->state = NULL; + /* Use the character ranges, assertions, etc. from `p1' for + the transition from `p1' to `p2'. */ + trans->code_min = p1->code_min; + trans->code_max = p1->code_max; + trans->state = transitions + offs[p2->position]; + trans->state_id = p2->position; + trans->assertions = p1->assertions | p2->assertions + | (p1->class ? ASSERT_CHAR_CLASS : 0) + | (p1->neg_classes != NULL ? ASSERT_CHAR_CLASS_NEG : 0); + if (p1->backref >= 0) + { + assert((trans->assertions & ASSERT_CHAR_CLASS) == 0); + assert(p2->backref < 0); + trans->u.backref = p1->backref; + trans->assertions |= ASSERT_BACKREF; + } + else + trans->u.class = p1->class; + if (p1->neg_classes != NULL) + { + for (i = 0; p1->neg_classes[i] != (tre_ctype_t)0; i++); + trans->neg_classes = + xmalloc(sizeof(*trans->neg_classes) * (i + 1)); + if (trans->neg_classes == NULL) + return REG_ESPACE; + for (i = 0; p1->neg_classes[i] != (tre_ctype_t)0; i++) + trans->neg_classes[i] = p1->neg_classes[i]; + trans->neg_classes[i] = (tre_ctype_t)0; + } + else + trans->neg_classes = NULL; + + /* Find out how many tags this transition has. */ + i = 0; + if (p1->tags != NULL) + while(p1->tags[i] >= 0) + i++; + j = 0; + if (p2->tags != NULL) + while(p2->tags[j] >= 0) + j++; + + /* If we are overwriting a transition, free the old tag array. */ + if (trans->tags != NULL) + xfree(trans->tags); + trans->tags = NULL; + + /* If there were any tags, allocate an array and fill it. */ + if (i + j > 0) + { + trans->tags = xmalloc(sizeof(*trans->tags) * (i + j + 1)); + if (!trans->tags) + return REG_ESPACE; + i = 0; + if (p1->tags != NULL) + while(p1->tags[i] >= 0) + { + trans->tags[i] = p1->tags[i]; + i++; + } + l = i; + j = 0; + if (p2->tags != NULL) + while (p2->tags[j] >= 0) + { + /* Don't add duplicates. */ + dup = 0; + for (k = 0; k < i; k++) + if (trans->tags[k] == p2->tags[j]) + { + dup = 1; + break; + } + if (!dup) + trans->tags[l++] = p2->tags[j]; + j++; + } + trans->tags[l] = -1; + } + + p2++; + } + p1++; + } + else + /* Compute a maximum limit for the number of transitions leaving + from each state. */ + while (p1->position >= 0) + { + p2 = orig_p2; + while (p2->position >= 0) + { + counts[p1->position]++; + p2++; + } + p1++; + } + return REG_OK; +} + +/* Converts the syntax tree to a TNFA. All the transitions in the TNFA are + labelled with one character range (there are no transitions on empty + strings). The TNFA takes O(n^2) space in the worst case, `n' is size of + the regexp. */ +static reg_errcode_t +tre_ast_to_tnfa(tre_ast_node_t *node, tre_tnfa_transition_t *transitions, + int *counts, int *offs) +{ + tre_union_t *uni; + tre_catenation_t *cat; + tre_iteration_t *iter; + reg_errcode_t errcode = REG_OK; + + /* XXX - recurse using a stack!. */ + switch (node->type) + { + case LITERAL: + break; + case UNION: + uni = (tre_union_t *)node->obj; + errcode = tre_ast_to_tnfa(uni->left, transitions, counts, offs); + if (errcode != REG_OK) + return errcode; + errcode = tre_ast_to_tnfa(uni->right, transitions, counts, offs); + break; + + case CATENATION: + cat = (tre_catenation_t *)node->obj; + /* Add a transition from each position in cat->left->lastpos + to each position in cat->right->firstpos. */ + errcode = tre_make_trans(cat->left->lastpos, cat->right->firstpos, + transitions, counts, offs); + if (errcode != REG_OK) + return errcode; + errcode = tre_ast_to_tnfa(cat->left, transitions, counts, offs); + if (errcode != REG_OK) + return errcode; + errcode = tre_ast_to_tnfa(cat->right, transitions, counts, offs); + break; + + case ITERATION: + iter = (tre_iteration_t *)node->obj; + assert(iter->max == -1 || iter->max == 1); + + if (iter->max == -1) + { + assert(iter->min == 0 || iter->min == 1); + /* Add a transition from each last position in the iterated + expression to each first position. */ + errcode = tre_make_trans(iter->arg->lastpos, iter->arg->firstpos, + transitions, counts, offs); + if (errcode != REG_OK) + return errcode; + } + errcode = tre_ast_to_tnfa(iter->arg, transitions, counts, offs); + break; + } + return errcode; +} + + +#define ERROR_EXIT(err) \ + do \ + { \ + errcode = err; \ + if (/*CONSTCOND*/1) \ + goto error_exit; \ + } \ + while (/*CONSTCOND*/0) + + +int +regcomp(regex_t *restrict preg, const char *restrict regex, int cflags) +{ + tre_stack_t *stack; + tre_ast_node_t *tree, *tmp_ast_l, *tmp_ast_r; + tre_pos_and_tags_t *p; + int *counts = NULL, *offs = NULL; + int i, add = 0; + tre_tnfa_transition_t *transitions, *initial; + tre_tnfa_t *tnfa = NULL; + tre_submatch_data_t *submatch_data; + tre_tag_direction_t *tag_directions = NULL; + reg_errcode_t errcode; + tre_mem_t mem; + + /* Parse context. */ + tre_parse_ctx_t parse_ctx; + + /* Allocate a stack used throughout the compilation process for various + purposes. */ + stack = tre_stack_new(512, 1024000, 128); + if (!stack) + return REG_ESPACE; + /* Allocate a fast memory allocator. */ + mem = tre_mem_new(); + if (!mem) + { + tre_stack_destroy(stack); + return REG_ESPACE; + } + + /* Parse the regexp. */ + memset(&parse_ctx, 0, sizeof(parse_ctx)); + parse_ctx.mem = mem; + parse_ctx.stack = stack; + parse_ctx.start = regex; + parse_ctx.cflags = cflags; + parse_ctx.max_backref = -1; + errcode = tre_parse(&parse_ctx); + if (errcode != REG_OK) + ERROR_EXIT(errcode); + preg->re_nsub = parse_ctx.submatch_id - 1; + tree = parse_ctx.n; + +#ifdef TRE_DEBUG + tre_ast_print(tree); +#endif /* TRE_DEBUG */ + + /* Referring to nonexistent subexpressions is illegal. */ + if (parse_ctx.max_backref > (int)preg->re_nsub) + ERROR_EXIT(REG_ESUBREG); + + /* Allocate the TNFA struct. */ + tnfa = xcalloc(1, sizeof(tre_tnfa_t)); + if (tnfa == NULL) + ERROR_EXIT(REG_ESPACE); + tnfa->have_backrefs = parse_ctx.max_backref >= 0; + tnfa->have_approx = 0; + tnfa->num_submatches = parse_ctx.submatch_id; + + /* Set up tags for submatch addressing. If REG_NOSUB is set and the + regexp does not have back references, this can be skipped. */ + if (tnfa->have_backrefs || !(cflags & REG_NOSUB)) + { + + /* Figure out how many tags we will need. */ + errcode = tre_add_tags(NULL, stack, tree, tnfa); + if (errcode != REG_OK) + ERROR_EXIT(errcode); + + if (tnfa->num_tags > 0) + { + tag_directions = xmalloc(sizeof(*tag_directions) + * (tnfa->num_tags + 1)); + if (tag_directions == NULL) + ERROR_EXIT(REG_ESPACE); + tnfa->tag_directions = tag_directions; + memset(tag_directions, -1, + sizeof(*tag_directions) * (tnfa->num_tags + 1)); + } + tnfa->minimal_tags = xcalloc((unsigned)tnfa->num_tags * 2 + 1, + sizeof(*tnfa->minimal_tags)); + if (tnfa->minimal_tags == NULL) + ERROR_EXIT(REG_ESPACE); + + submatch_data = xcalloc((unsigned)parse_ctx.submatch_id, + sizeof(*submatch_data)); + if (submatch_data == NULL) + ERROR_EXIT(REG_ESPACE); + tnfa->submatch_data = submatch_data; + + errcode = tre_add_tags(mem, stack, tree, tnfa); + if (errcode != REG_OK) + ERROR_EXIT(errcode); + + } + + /* Expand iteration nodes. */ + errcode = tre_expand_ast(mem, stack, tree, &parse_ctx.position, + tag_directions); + if (errcode != REG_OK) + ERROR_EXIT(errcode); + + /* Add a dummy node for the final state. + XXX - For certain patterns this dummy node can be optimized away, + for example "a*" or "ab*". Figure out a simple way to detect + this possibility. */ + tmp_ast_l = tree; + tmp_ast_r = tre_ast_new_literal(mem, 0, 0, parse_ctx.position++); + if (tmp_ast_r == NULL) + ERROR_EXIT(REG_ESPACE); + + tree = tre_ast_new_catenation(mem, tmp_ast_l, tmp_ast_r); + if (tree == NULL) + ERROR_EXIT(REG_ESPACE); + + errcode = tre_compute_nfl(mem, stack, tree); + if (errcode != REG_OK) + ERROR_EXIT(errcode); + + counts = xmalloc(sizeof(int) * parse_ctx.position); + if (counts == NULL) + ERROR_EXIT(REG_ESPACE); + + offs = xmalloc(sizeof(int) * parse_ctx.position); + if (offs == NULL) + ERROR_EXIT(REG_ESPACE); + + for (i = 0; i < parse_ctx.position; i++) + counts[i] = 0; + tre_ast_to_tnfa(tree, NULL, counts, NULL); + + add = 0; + for (i = 0; i < parse_ctx.position; i++) + { + offs[i] = add; + add += counts[i] + 1; + counts[i] = 0; + } + transitions = xcalloc((unsigned)add + 1, sizeof(*transitions)); + if (transitions == NULL) + ERROR_EXIT(REG_ESPACE); + tnfa->transitions = transitions; + tnfa->num_transitions = add; + + errcode = tre_ast_to_tnfa(tree, transitions, counts, offs); + if (errcode != REG_OK) + ERROR_EXIT(errcode); + + tnfa->firstpos_chars = NULL; + + p = tree->firstpos; + i = 0; + while (p->position >= 0) + { + i++; + p++; + } + + initial = xcalloc((unsigned)i + 1, sizeof(tre_tnfa_transition_t)); + if (initial == NULL) + ERROR_EXIT(REG_ESPACE); + tnfa->initial = initial; + + i = 0; + for (p = tree->firstpos; p->position >= 0; p++) + { + initial[i].state = transitions + offs[p->position]; + initial[i].state_id = p->position; + initial[i].tags = NULL; + /* Copy the arrays p->tags, and p->params, they are allocated + from a tre_mem object. */ + if (p->tags) + { + int j; + for (j = 0; p->tags[j] >= 0; j++); + initial[i].tags = xmalloc(sizeof(*p->tags) * (j + 1)); + if (!initial[i].tags) + ERROR_EXIT(REG_ESPACE); + memcpy(initial[i].tags, p->tags, sizeof(*p->tags) * (j + 1)); + } + initial[i].assertions = p->assertions; + i++; + } + initial[i].state = NULL; + + tnfa->num_transitions = add; + tnfa->final = transitions + offs[tree->lastpos[0].position]; + tnfa->num_states = parse_ctx.position; + tnfa->cflags = cflags; + + tre_mem_destroy(mem); + tre_stack_destroy(stack); + xfree(counts); + xfree(offs); + + preg->TRE_REGEX_T_FIELD = (void *)tnfa; + return REG_OK; + + error_exit: + /* Free everything that was allocated and return the error code. */ + tre_mem_destroy(mem); + if (stack != NULL) + tre_stack_destroy(stack); + if (counts != NULL) + xfree(counts); + if (offs != NULL) + xfree(offs); + preg->TRE_REGEX_T_FIELD = (void *)tnfa; + regfree(preg); + return errcode; +} + + + + +void +regfree(regex_t *preg) +{ + tre_tnfa_t *tnfa; + unsigned int i; + tre_tnfa_transition_t *trans; + + tnfa = (void *)preg->TRE_REGEX_T_FIELD; + if (!tnfa) + return; + + for (i = 0; i < tnfa->num_transitions; i++) + if (tnfa->transitions[i].state) + { + if (tnfa->transitions[i].tags) + xfree(tnfa->transitions[i].tags); + if (tnfa->transitions[i].neg_classes) + xfree(tnfa->transitions[i].neg_classes); + } + if (tnfa->transitions) + xfree(tnfa->transitions); + + if (tnfa->initial) + { + for (trans = tnfa->initial; trans->state; trans++) + { + if (trans->tags) + xfree(trans->tags); + } + xfree(tnfa->initial); + } + + if (tnfa->submatch_data) + { + for (i = 0; i < tnfa->num_submatches; i++) + if (tnfa->submatch_data[i].parents) + xfree(tnfa->submatch_data[i].parents); + xfree(tnfa->submatch_data); + } + + if (tnfa->tag_directions) + xfree(tnfa->tag_directions); + if (tnfa->firstpos_chars) + xfree(tnfa->firstpos_chars); + if (tnfa->minimal_tags) + xfree(tnfa->minimal_tags); + xfree(tnfa); +}
\ No newline at end of file diff --git a/lib/mlibc/options/posix/musl-generic-regex/regerror.c b/lib/mlibc/options/posix/musl-generic-regex/regerror.c new file mode 100644 index 0000000..41e9a36 --- /dev/null +++ b/lib/mlibc/options/posix/musl-generic-regex/regerror.c @@ -0,0 +1,37 @@ +#include <string.h> +#include <regex.h> +#include <stdio.h> +// #include "locale_impl.h" + +/* Error message strings for error codes listed in `regex.h'. This list + needs to be in sync with the codes listed there, naturally. */ + +/* Converted to single string by Rich Felker to remove the need for + * data relocations at runtime, 27 Feb 2006. */ + +static const char messages[] = { + "No error\0" + "No match\0" + "Invalid regexp\0" + "Unknown collating element\0" + "Unknown character class name\0" + "Trailing backslash\0" + "Invalid back reference\0" + "Missing ']'\0" + "Missing ')'\0" + "Missing '}'\0" + "Invalid contents of {}\0" + "Invalid character range\0" + "Out of memory\0" + "Repetition not preceded by valid expression\0" + "\0Unknown error" +}; + +size_t regerror(int e, const regex_t *restrict preg, char *restrict buf, size_t size) +{ + const char *s; + for (s=messages; e && *s; e--, s+=strlen(s)+1); + if (!*s) s++; + // s = LCTRANS_CUR(s); + return 1+snprintf(buf, size, "%s", s); +} diff --git a/lib/mlibc/options/posix/musl-generic-regex/regexec.c b/lib/mlibc/options/posix/musl-generic-regex/regexec.c new file mode 100644 index 0000000..1a169ab --- /dev/null +++ b/lib/mlibc/options/posix/musl-generic-regex/regexec.c @@ -0,0 +1,1028 @@ +/* + regexec.c - TRE POSIX compatible matching functions (and more). + + Copyright (c) 2001-2009 Ville Laurikari <vl@iki.fi> + All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDER AND CONTRIBUTORS + ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT + HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT + LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +*/ + +#include <stdlib.h> +#include <string.h> +#include <wchar.h> +#include <wctype.h> +#include <limits.h> +#include <stdint.h> + +#include <regex.h> + +#include "tre.h" + +#include <assert.h> + +static void +tre_fill_pmatch(size_t nmatch, regmatch_t pmatch[], int cflags, + const tre_tnfa_t *tnfa, regoff_t *tags, regoff_t match_eo); + +/*********************************************************************** + from tre-match-utils.h +***********************************************************************/ + +#define GET_NEXT_WCHAR() do { \ + prev_c = next_c; pos += pos_add_next; \ + if ((pos_add_next = mbtowc(&next_c, str_byte, MB_LEN_MAX)) <= 0) { \ + if (pos_add_next < 0) { ret = REG_NOMATCH; goto error_exit; } \ + else pos_add_next++; \ + } \ + str_byte += pos_add_next; \ + } while (0) + +#define IS_WORD_CHAR(c) ((c) == L'_' || tre_isalnum(c)) + +#define CHECK_ASSERTIONS(assertions) \ + (((assertions & ASSERT_AT_BOL) \ + && (pos > 0 || reg_notbol) \ + && (prev_c != L'\n' || !reg_newline)) \ + || ((assertions & ASSERT_AT_EOL) \ + && (next_c != L'\0' || reg_noteol) \ + && (next_c != L'\n' || !reg_newline)) \ + || ((assertions & ASSERT_AT_BOW) \ + && (IS_WORD_CHAR(prev_c) || !IS_WORD_CHAR(next_c))) \ + || ((assertions & ASSERT_AT_EOW) \ + && (!IS_WORD_CHAR(prev_c) || IS_WORD_CHAR(next_c))) \ + || ((assertions & ASSERT_AT_WB) \ + && (pos != 0 && next_c != L'\0' \ + && IS_WORD_CHAR(prev_c) == IS_WORD_CHAR(next_c))) \ + || ((assertions & ASSERT_AT_WB_NEG) \ + && (pos == 0 || next_c == L'\0' \ + || IS_WORD_CHAR(prev_c) != IS_WORD_CHAR(next_c)))) + +#define CHECK_CHAR_CLASSES(trans_i, tnfa, eflags) \ + (((trans_i->assertions & ASSERT_CHAR_CLASS) \ + && !(tnfa->cflags & REG_ICASE) \ + && !tre_isctype((tre_cint_t)prev_c, trans_i->u.class)) \ + || ((trans_i->assertions & ASSERT_CHAR_CLASS) \ + && (tnfa->cflags & REG_ICASE) \ + && !tre_isctype(tre_tolower((tre_cint_t)prev_c),trans_i->u.class) \ + && !tre_isctype(tre_toupper((tre_cint_t)prev_c),trans_i->u.class)) \ + || ((trans_i->assertions & ASSERT_CHAR_CLASS_NEG) \ + && tre_neg_char_classes_match(trans_i->neg_classes,(tre_cint_t)prev_c,\ + tnfa->cflags & REG_ICASE))) + + + + +/* Returns 1 if `t1' wins `t2', 0 otherwise. */ +static int +tre_tag_order(int num_tags, tre_tag_direction_t *tag_directions, + regoff_t *t1, regoff_t *t2) +{ + int i; + for (i = 0; i < num_tags; i++) + { + if (tag_directions[i] == TRE_TAG_MINIMIZE) + { + if (t1[i] < t2[i]) + return 1; + if (t1[i] > t2[i]) + return 0; + } + else + { + if (t1[i] > t2[i]) + return 1; + if (t1[i] < t2[i]) + return 0; + } + } + /* assert(0);*/ + return 0; +} + +static int +tre_neg_char_classes_match(tre_ctype_t *classes, tre_cint_t wc, int icase) +{ + while (*classes != (tre_ctype_t)0) + if ((!icase && tre_isctype(wc, *classes)) + || (icase && (tre_isctype(tre_toupper(wc), *classes) + || tre_isctype(tre_tolower(wc), *classes)))) + return 1; /* Match. */ + else + classes++; + return 0; /* No match. */ +} + + +/*********************************************************************** + from tre-match-parallel.c +***********************************************************************/ + +/* + This algorithm searches for matches basically by reading characters + in the searched string one by one, starting at the beginning. All + matching paths in the TNFA are traversed in parallel. When two or + more paths reach the same state, exactly one is chosen according to + tag ordering rules; if returning submatches is not required it does + not matter which path is chosen. + + The worst case time required for finding the leftmost and longest + match, or determining that there is no match, is always linearly + dependent on the length of the text being searched. + + This algorithm cannot handle TNFAs with back referencing nodes. + See `tre-match-backtrack.c'. +*/ + +typedef struct { + tre_tnfa_transition_t *state; + regoff_t *tags; +} tre_tnfa_reach_t; + +typedef struct { + regoff_t pos; + regoff_t **tags; +} tre_reach_pos_t; + + +static reg_errcode_t +tre_tnfa_run_parallel(const tre_tnfa_t *tnfa, const void *string, + regoff_t *match_tags, int eflags, + regoff_t *match_end_ofs) +{ + /* State variables required by GET_NEXT_WCHAR. */ + tre_char_t prev_c = 0, next_c = 0; + const char *str_byte = string; + regoff_t pos = -1; + regoff_t pos_add_next = 1; +#ifdef TRE_MBSTATE + mbstate_t mbstate; +#endif /* TRE_MBSTATE */ + int reg_notbol = eflags & REG_NOTBOL; + int reg_noteol = eflags & REG_NOTEOL; + int reg_newline = tnfa->cflags & REG_NEWLINE; + reg_errcode_t ret; + + char *buf; + tre_tnfa_transition_t *trans_i; + tre_tnfa_reach_t *reach, *reach_next, *reach_i, *reach_next_i; + tre_reach_pos_t *reach_pos; + int *tag_i; + int num_tags, i; + + regoff_t match_eo = -1; /* end offset of match (-1 if no match found yet) */ + int new_match = 0; + regoff_t *tmp_tags = NULL; + regoff_t *tmp_iptr; + +#ifdef TRE_MBSTATE + memset(&mbstate, '\0', sizeof(mbstate)); +#endif /* TRE_MBSTATE */ + + if (!match_tags) + num_tags = 0; + else + num_tags = tnfa->num_tags; + + /* Allocate memory for temporary data required for matching. This needs to + be done for every matching operation to be thread safe. This allocates + everything in a single large block with calloc(). */ + { + size_t tbytes, rbytes, pbytes, xbytes, total_bytes; + char *tmp_buf; + + /* Ensure that tbytes and xbytes*num_states cannot overflow, and that + * they don't contribute more than 1/8 of SIZE_MAX to total_bytes. */ + if (num_tags > SIZE_MAX/(8 * sizeof(regoff_t) * tnfa->num_states)) + return REG_ESPACE; + + /* Likewise check rbytes. */ + if (tnfa->num_states+1 > SIZE_MAX/(8 * sizeof(*reach_next))) + return REG_ESPACE; + + /* Likewise check pbytes. */ + if (tnfa->num_states > SIZE_MAX/(8 * sizeof(*reach_pos))) + return REG_ESPACE; + + /* Compute the length of the block we need. */ + tbytes = sizeof(*tmp_tags) * num_tags; + rbytes = sizeof(*reach_next) * (tnfa->num_states + 1); + pbytes = sizeof(*reach_pos) * tnfa->num_states; + xbytes = sizeof(regoff_t) * num_tags; + total_bytes = + (sizeof(long) - 1) * 4 /* for alignment paddings */ + + (rbytes + xbytes * tnfa->num_states) * 2 + tbytes + pbytes; + + /* Allocate the memory. */ + buf = calloc(total_bytes, 1); + if (buf == NULL) + return REG_ESPACE; + + /* Get the various pointers within tmp_buf (properly aligned). */ + tmp_tags = (void *)buf; + tmp_buf = buf + tbytes; + tmp_buf += ALIGN(tmp_buf, long); + reach_next = (void *)tmp_buf; + tmp_buf += rbytes; + tmp_buf += ALIGN(tmp_buf, long); + reach = (void *)tmp_buf; + tmp_buf += rbytes; + tmp_buf += ALIGN(tmp_buf, long); + reach_pos = (void *)tmp_buf; + tmp_buf += pbytes; + tmp_buf += ALIGN(tmp_buf, long); + for (i = 0; i < tnfa->num_states; i++) + { + reach[i].tags = (void *)tmp_buf; + tmp_buf += xbytes; + reach_next[i].tags = (void *)tmp_buf; + tmp_buf += xbytes; + } + } + + for (i = 0; i < tnfa->num_states; i++) + reach_pos[i].pos = -1; + + GET_NEXT_WCHAR(); + pos = 0; + + reach_next_i = reach_next; + while (1) + { + /* If no match found yet, add the initial states to `reach_next'. */ + if (match_eo < 0) + { + trans_i = tnfa->initial; + while (trans_i->state != NULL) + { + if (reach_pos[trans_i->state_id].pos < pos) + { + if (trans_i->assertions + && CHECK_ASSERTIONS(trans_i->assertions)) + { + trans_i++; + continue; + } + + reach_next_i->state = trans_i->state; + for (i = 0; i < num_tags; i++) + reach_next_i->tags[i] = -1; + tag_i = trans_i->tags; + if (tag_i) + while (*tag_i >= 0) + { + if (*tag_i < num_tags) + reach_next_i->tags[*tag_i] = pos; + tag_i++; + } + if (reach_next_i->state == tnfa->final) + { + match_eo = pos; + new_match = 1; + for (i = 0; i < num_tags; i++) + match_tags[i] = reach_next_i->tags[i]; + } + reach_pos[trans_i->state_id].pos = pos; + reach_pos[trans_i->state_id].tags = &reach_next_i->tags; + reach_next_i++; + } + trans_i++; + } + reach_next_i->state = NULL; + } + else + { + if (num_tags == 0 || reach_next_i == reach_next) + /* We have found a match. */ + break; + } + + /* Check for end of string. */ + if (!next_c) break; + + GET_NEXT_WCHAR(); + + /* Swap `reach' and `reach_next'. */ + reach_i = reach; + reach = reach_next; + reach_next = reach_i; + + /* For each state in `reach', weed out states that don't fulfill the + minimal matching conditions. */ + if (tnfa->num_minimals && new_match) + { + new_match = 0; + reach_next_i = reach_next; + for (reach_i = reach; reach_i->state; reach_i++) + { + int skip = 0; + for (i = 0; tnfa->minimal_tags[i] >= 0; i += 2) + { + int end = tnfa->minimal_tags[i]; + int start = tnfa->minimal_tags[i + 1]; + if (end >= num_tags) + { + skip = 1; + break; + } + else if (reach_i->tags[start] == match_tags[start] + && reach_i->tags[end] < match_tags[end]) + { + skip = 1; + break; + } + } + if (!skip) + { + reach_next_i->state = reach_i->state; + tmp_iptr = reach_next_i->tags; + reach_next_i->tags = reach_i->tags; + reach_i->tags = tmp_iptr; + reach_next_i++; + } + } + reach_next_i->state = NULL; + + /* Swap `reach' and `reach_next'. */ + reach_i = reach; + reach = reach_next; + reach_next = reach_i; + } + + /* For each state in `reach' see if there is a transition leaving with + the current input symbol to a state not yet in `reach_next', and + add the destination states to `reach_next'. */ + reach_next_i = reach_next; + for (reach_i = reach; reach_i->state; reach_i++) + { + for (trans_i = reach_i->state; trans_i->state; trans_i++) + { + /* Does this transition match the input symbol? */ + if (trans_i->code_min <= (tre_cint_t)prev_c && + trans_i->code_max >= (tre_cint_t)prev_c) + { + if (trans_i->assertions + && (CHECK_ASSERTIONS(trans_i->assertions) + || CHECK_CHAR_CLASSES(trans_i, tnfa, eflags))) + { + continue; + } + + /* Compute the tags after this transition. */ + for (i = 0; i < num_tags; i++) + tmp_tags[i] = reach_i->tags[i]; + tag_i = trans_i->tags; + if (tag_i != NULL) + while (*tag_i >= 0) + { + if (*tag_i < num_tags) + tmp_tags[*tag_i] = pos; + tag_i++; + } + + if (reach_pos[trans_i->state_id].pos < pos) + { + /* Found an unvisited node. */ + reach_next_i->state = trans_i->state; + tmp_iptr = reach_next_i->tags; + reach_next_i->tags = tmp_tags; + tmp_tags = tmp_iptr; + reach_pos[trans_i->state_id].pos = pos; + reach_pos[trans_i->state_id].tags = &reach_next_i->tags; + + if (reach_next_i->state == tnfa->final + && (match_eo == -1 + || (num_tags > 0 + && reach_next_i->tags[0] <= match_tags[0]))) + { + match_eo = pos; + new_match = 1; + for (i = 0; i < num_tags; i++) + match_tags[i] = reach_next_i->tags[i]; + } + reach_next_i++; + + } + else + { + assert(reach_pos[trans_i->state_id].pos == pos); + /* Another path has also reached this state. We choose + the winner by examining the tag values for both + paths. */ + if (tre_tag_order(num_tags, tnfa->tag_directions, + tmp_tags, + *reach_pos[trans_i->state_id].tags)) + { + /* The new path wins. */ + tmp_iptr = *reach_pos[trans_i->state_id].tags; + *reach_pos[trans_i->state_id].tags = tmp_tags; + if (trans_i->state == tnfa->final) + { + match_eo = pos; + new_match = 1; + for (i = 0; i < num_tags; i++) + match_tags[i] = tmp_tags[i]; + } + tmp_tags = tmp_iptr; + } + } + } + } + } + reach_next_i->state = NULL; + } + + *match_end_ofs = match_eo; + ret = match_eo >= 0 ? REG_OK : REG_NOMATCH; +error_exit: + xfree(buf); + return ret; +} + + + +/*********************************************************************** + from tre-match-backtrack.c +***********************************************************************/ + +/* + This matcher is for regexps that use back referencing. Regexp matching + with back referencing is an NP-complete problem on the number of back + references. The easiest way to match them is to use a backtracking + routine which basically goes through all possible paths in the TNFA + and chooses the one which results in the best (leftmost and longest) + match. This can be spectacularly expensive and may run out of stack + space, but there really is no better known generic algorithm. Quoting + Henry Spencer from comp.compilers: + <URL: http://compilers.iecc.com/comparch/article/93-03-102> + + POSIX.2 REs require longest match, which is really exciting to + implement since the obsolete ("basic") variant also includes + \<digit>. I haven't found a better way of tackling this than doing + a preliminary match using a DFA (or simulation) on a modified RE + that just replicates subREs for \<digit>, and then doing a + backtracking match to determine whether the subRE matches were + right. This can be rather slow, but I console myself with the + thought that people who use \<digit> deserve very slow execution. + (Pun unintentional but very appropriate.) + +*/ + +typedef struct { + regoff_t pos; + const char *str_byte; + tre_tnfa_transition_t *state; + int state_id; + int next_c; + regoff_t *tags; +#ifdef TRE_MBSTATE + mbstate_t mbstate; +#endif /* TRE_MBSTATE */ +} tre_backtrack_item_t; + +typedef struct tre_backtrack_struct { + tre_backtrack_item_t item; + struct tre_backtrack_struct *prev; + struct tre_backtrack_struct *next; +} *tre_backtrack_t; + +#ifdef TRE_MBSTATE +#define BT_STACK_MBSTATE_IN stack->item.mbstate = (mbstate) +#define BT_STACK_MBSTATE_OUT (mbstate) = stack->item.mbstate +#else /* !TRE_MBSTATE */ +#define BT_STACK_MBSTATE_IN +#define BT_STACK_MBSTATE_OUT +#endif /* !TRE_MBSTATE */ + +#define tre_bt_mem_new tre_mem_new +#define tre_bt_mem_alloc tre_mem_alloc +#define tre_bt_mem_destroy tre_mem_destroy + + +#define BT_STACK_PUSH(_pos, _str_byte, _str_wide, _state, _state_id, _next_c, _tags, _mbstate) \ + do \ + { \ + int i; \ + if (!stack->next) \ + { \ + tre_backtrack_t s; \ + s = tre_bt_mem_alloc(mem, sizeof(*s)); \ + if (!s) \ + { \ + tre_bt_mem_destroy(mem); \ + if (tags) \ + xfree(tags); \ + if (pmatch) \ + xfree(pmatch); \ + if (states_seen) \ + xfree(states_seen); \ + return REG_ESPACE; \ + } \ + s->prev = stack; \ + s->next = NULL; \ + s->item.tags = tre_bt_mem_alloc(mem, \ + sizeof(*tags) * tnfa->num_tags); \ + if (!s->item.tags) \ + { \ + tre_bt_mem_destroy(mem); \ + if (tags) \ + xfree(tags); \ + if (pmatch) \ + xfree(pmatch); \ + if (states_seen) \ + xfree(states_seen); \ + return REG_ESPACE; \ + } \ + stack->next = s; \ + stack = s; \ + } \ + else \ + stack = stack->next; \ + stack->item.pos = (_pos); \ + stack->item.str_byte = (_str_byte); \ + stack->item.state = (_state); \ + stack->item.state_id = (_state_id); \ + stack->item.next_c = (_next_c); \ + for (i = 0; i < tnfa->num_tags; i++) \ + stack->item.tags[i] = (_tags)[i]; \ + BT_STACK_MBSTATE_IN; \ + } \ + while (0) + +#define BT_STACK_POP() \ + do \ + { \ + int i; \ + assert(stack->prev); \ + pos = stack->item.pos; \ + str_byte = stack->item.str_byte; \ + state = stack->item.state; \ + next_c = stack->item.next_c; \ + for (i = 0; i < tnfa->num_tags; i++) \ + tags[i] = stack->item.tags[i]; \ + BT_STACK_MBSTATE_OUT; \ + stack = stack->prev; \ + } \ + while (0) + +#undef MIN +#define MIN(a, b) ((a) <= (b) ? (a) : (b)) + +static reg_errcode_t +tre_tnfa_run_backtrack(const tre_tnfa_t *tnfa, const void *string, + regoff_t *match_tags, int eflags, regoff_t *match_end_ofs) +{ + /* State variables required by GET_NEXT_WCHAR. */ + tre_char_t prev_c = 0, next_c = 0; + const char *str_byte = string; + regoff_t pos = 0; + regoff_t pos_add_next = 1; +#ifdef TRE_MBSTATE + mbstate_t mbstate; +#endif /* TRE_MBSTATE */ + int reg_notbol = eflags & REG_NOTBOL; + int reg_noteol = eflags & REG_NOTEOL; + int reg_newline = tnfa->cflags & REG_NEWLINE; + + /* These are used to remember the necessary values of the above + variables to return to the position where the current search + started from. */ + int next_c_start; + const char *str_byte_start; + regoff_t pos_start = -1; +#ifdef TRE_MBSTATE + mbstate_t mbstate_start; +#endif /* TRE_MBSTATE */ + + /* End offset of best match so far, or -1 if no match found yet. */ + regoff_t match_eo = -1; + /* Tag arrays. */ + int *next_tags; + regoff_t *tags = NULL; + /* Current TNFA state. */ + tre_tnfa_transition_t *state; + int *states_seen = NULL; + + /* Memory allocator to for allocating the backtracking stack. */ + tre_mem_t mem = tre_bt_mem_new(); + + /* The backtracking stack. */ + tre_backtrack_t stack; + + tre_tnfa_transition_t *trans_i; + regmatch_t *pmatch = NULL; + int ret; + +#ifdef TRE_MBSTATE + memset(&mbstate, '\0', sizeof(mbstate)); +#endif /* TRE_MBSTATE */ + + if (!mem) + return REG_ESPACE; + stack = tre_bt_mem_alloc(mem, sizeof(*stack)); + if (!stack) + { + ret = REG_ESPACE; + goto error_exit; + } + stack->prev = NULL; + stack->next = NULL; + + if (tnfa->num_tags) + { + tags = xmalloc(sizeof(*tags) * tnfa->num_tags); + if (!tags) + { + ret = REG_ESPACE; + goto error_exit; + } + } + if (tnfa->num_submatches) + { + pmatch = xmalloc(sizeof(*pmatch) * tnfa->num_submatches); + if (!pmatch) + { + ret = REG_ESPACE; + goto error_exit; + } + } + if (tnfa->num_states) + { + states_seen = xmalloc(sizeof(*states_seen) * tnfa->num_states); + if (!states_seen) + { + ret = REG_ESPACE; + goto error_exit; + } + } + + retry: + { + int i; + for (i = 0; i < tnfa->num_tags; i++) + { + tags[i] = -1; + if (match_tags) + match_tags[i] = -1; + } + for (i = 0; i < tnfa->num_states; i++) + states_seen[i] = 0; + } + + state = NULL; + pos = pos_start; + GET_NEXT_WCHAR(); + pos_start = pos; + next_c_start = next_c; + str_byte_start = str_byte; +#ifdef TRE_MBSTATE + mbstate_start = mbstate; +#endif /* TRE_MBSTATE */ + + /* Handle initial states. */ + next_tags = NULL; + for (trans_i = tnfa->initial; trans_i->state; trans_i++) + { + if (trans_i->assertions && CHECK_ASSERTIONS(trans_i->assertions)) + { + continue; + } + if (state == NULL) + { + /* Start from this state. */ + state = trans_i->state; + next_tags = trans_i->tags; + } + else + { + /* Backtrack to this state. */ + BT_STACK_PUSH(pos, str_byte, 0, trans_i->state, + trans_i->state_id, next_c, tags, mbstate); + { + int *tmp = trans_i->tags; + if (tmp) + while (*tmp >= 0) + stack->item.tags[*tmp++] = pos; + } + } + } + + if (next_tags) + for (; *next_tags >= 0; next_tags++) + tags[*next_tags] = pos; + + + if (state == NULL) + goto backtrack; + + while (1) + { + tre_tnfa_transition_t *next_state; + int empty_br_match; + + if (state == tnfa->final) + { + if (match_eo < pos + || (match_eo == pos + && match_tags + && tre_tag_order(tnfa->num_tags, tnfa->tag_directions, + tags, match_tags))) + { + int i; + /* This match wins the previous match. */ + match_eo = pos; + if (match_tags) + for (i = 0; i < tnfa->num_tags; i++) + match_tags[i] = tags[i]; + } + /* Our TNFAs never have transitions leaving from the final state, + so we jump right to backtracking. */ + goto backtrack; + } + + /* Go to the next character in the input string. */ + empty_br_match = 0; + trans_i = state; + if (trans_i->state && trans_i->assertions & ASSERT_BACKREF) + { + /* This is a back reference state. All transitions leaving from + this state have the same back reference "assertion". Instead + of reading the next character, we match the back reference. */ + regoff_t so, eo; + int bt = trans_i->u.backref; + regoff_t bt_len; + int result; + + /* Get the substring we need to match against. Remember to + turn off REG_NOSUB temporarily. */ + tre_fill_pmatch(bt + 1, pmatch, tnfa->cflags & ~REG_NOSUB, + tnfa, tags, pos); + so = pmatch[bt].rm_so; + eo = pmatch[bt].rm_eo; + bt_len = eo - so; + + result = strncmp((const char*)string + so, str_byte - 1, + (size_t)bt_len); + + if (result == 0) + { + /* Back reference matched. Check for infinite loop. */ + if (bt_len == 0) + empty_br_match = 1; + if (empty_br_match && states_seen[trans_i->state_id]) + { + goto backtrack; + } + + states_seen[trans_i->state_id] = empty_br_match; + + /* Advance in input string and resync `prev_c', `next_c' + and pos. */ + str_byte += bt_len - 1; + pos += bt_len - 1; + GET_NEXT_WCHAR(); + } + else + { + goto backtrack; + } + } + else + { + /* Check for end of string. */ + if (next_c == L'\0') + goto backtrack; + + /* Read the next character. */ + GET_NEXT_WCHAR(); + } + + next_state = NULL; + for (trans_i = state; trans_i->state; trans_i++) + { + if (trans_i->code_min <= (tre_cint_t)prev_c + && trans_i->code_max >= (tre_cint_t)prev_c) + { + if (trans_i->assertions + && (CHECK_ASSERTIONS(trans_i->assertions) + || CHECK_CHAR_CLASSES(trans_i, tnfa, eflags))) + { + continue; + } + + if (next_state == NULL) + { + /* First matching transition. */ + next_state = trans_i->state; + next_tags = trans_i->tags; + } + else + { + /* Second matching transition. We may need to backtrack here + to take this transition instead of the first one, so we + push this transition in the backtracking stack so we can + jump back here if needed. */ + BT_STACK_PUSH(pos, str_byte, 0, trans_i->state, + trans_i->state_id, next_c, tags, mbstate); + { + int *tmp; + for (tmp = trans_i->tags; tmp && *tmp >= 0; tmp++) + stack->item.tags[*tmp] = pos; + } +#if 0 /* XXX - it's important not to look at all transitions here to keep + the stack small! */ + break; +#endif + } + } + } + + if (next_state != NULL) + { + /* Matching transitions were found. Take the first one. */ + state = next_state; + + /* Update the tag values. */ + if (next_tags) + while (*next_tags >= 0) + tags[*next_tags++] = pos; + } + else + { + backtrack: + /* A matching transition was not found. Try to backtrack. */ + if (stack->prev) + { + if (stack->item.state->assertions & ASSERT_BACKREF) + { + states_seen[stack->item.state_id] = 0; + } + + BT_STACK_POP(); + } + else if (match_eo < 0) + { + /* Try starting from a later position in the input string. */ + /* Check for end of string. */ + if (next_c == L'\0') + { + break; + } + next_c = next_c_start; +#ifdef TRE_MBSTATE + mbstate = mbstate_start; +#endif /* TRE_MBSTATE */ + str_byte = str_byte_start; + goto retry; + } + else + { + break; + } + } + } + + ret = match_eo >= 0 ? REG_OK : REG_NOMATCH; + *match_end_ofs = match_eo; + + error_exit: + tre_bt_mem_destroy(mem); +#ifndef TRE_USE_ALLOCA + if (tags) + xfree(tags); + if (pmatch) + xfree(pmatch); + if (states_seen) + xfree(states_seen); +#endif /* !TRE_USE_ALLOCA */ + + return ret; +} + +/*********************************************************************** + from regexec.c +***********************************************************************/ + +/* Fills the POSIX.2 regmatch_t array according to the TNFA tag and match + endpoint values. */ +static void +tre_fill_pmatch(size_t nmatch, regmatch_t pmatch[], int cflags, + const tre_tnfa_t *tnfa, regoff_t *tags, regoff_t match_eo) +{ + tre_submatch_data_t *submatch_data; + unsigned int i, j; + int *parents; + + i = 0; + if (match_eo >= 0 && !(cflags & REG_NOSUB)) + { + /* Construct submatch offsets from the tags. */ + submatch_data = tnfa->submatch_data; + while (i < tnfa->num_submatches && i < nmatch) + { + if (submatch_data[i].so_tag == tnfa->end_tag) + pmatch[i].rm_so = match_eo; + else + pmatch[i].rm_so = tags[submatch_data[i].so_tag]; + + if (submatch_data[i].eo_tag == tnfa->end_tag) + pmatch[i].rm_eo = match_eo; + else + pmatch[i].rm_eo = tags[submatch_data[i].eo_tag]; + + /* If either of the endpoints were not used, this submatch + was not part of the match. */ + if (pmatch[i].rm_so == -1 || pmatch[i].rm_eo == -1) + pmatch[i].rm_so = pmatch[i].rm_eo = -1; + + i++; + } + /* Reset all submatches that are not within all of their parent + submatches. */ + i = 0; + while (i < tnfa->num_submatches && i < nmatch) + { + if (pmatch[i].rm_eo == -1) + assert(pmatch[i].rm_so == -1); + assert(pmatch[i].rm_so <= pmatch[i].rm_eo); + + parents = submatch_data[i].parents; + if (parents != NULL) + for (j = 0; parents[j] >= 0; j++) + { + if (pmatch[i].rm_so < pmatch[parents[j]].rm_so + || pmatch[i].rm_eo > pmatch[parents[j]].rm_eo) + pmatch[i].rm_so = pmatch[i].rm_eo = -1; + } + i++; + } + } + + while (i < nmatch) + { + pmatch[i].rm_so = -1; + pmatch[i].rm_eo = -1; + i++; + } +} + + +/* + Wrapper functions for POSIX compatible regexp matching. +*/ + +int +regexec(const regex_t *restrict preg, const char *restrict string, + size_t nmatch, regmatch_t pmatch[restrict], int eflags) +{ + tre_tnfa_t *tnfa = (void *)preg->TRE_REGEX_T_FIELD; + reg_errcode_t status; + regoff_t *tags = NULL, eo; + if (tnfa->cflags & REG_NOSUB) nmatch = 0; + if (tnfa->num_tags > 0 && nmatch > 0) + { + tags = xmalloc(sizeof(*tags) * tnfa->num_tags); + if (tags == NULL) + return REG_ESPACE; + } + + /* Dispatch to the appropriate matcher. */ + if (tnfa->have_backrefs) + { + /* The regex has back references, use the backtracking matcher. */ + status = tre_tnfa_run_backtrack(tnfa, string, tags, eflags, &eo); + } + else + { + /* Exact matching, no back references, use the parallel matcher. */ + status = tre_tnfa_run_parallel(tnfa, string, tags, eflags, &eo); + } + + if (status == REG_OK) + /* A match was found, so fill the submatch registers. */ + tre_fill_pmatch(nmatch, pmatch, tnfa->cflags, tnfa, tags, eo); + if (tags) + xfree(tags); + return status; +}
\ No newline at end of file diff --git a/lib/mlibc/options/posix/musl-generic-regex/tre-mem.c b/lib/mlibc/options/posix/musl-generic-regex/tre-mem.c new file mode 100644 index 0000000..a3df685 --- /dev/null +++ b/lib/mlibc/options/posix/musl-generic-regex/tre-mem.c @@ -0,0 +1,158 @@ +/* + tre-mem.c - TRE memory allocator + + Copyright (c) 2001-2009 Ville Laurikari <vl@iki.fi> + All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDER AND CONTRIBUTORS + ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT + HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT + LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +*/ + +/* + This memory allocator is for allocating small memory blocks efficiently + in terms of memory overhead and execution speed. The allocated blocks + cannot be freed individually, only all at once. There can be multiple + allocators, though. +*/ + +#include <stdlib.h> +#include <string.h> + +#include "tre.h" + +/* + This memory allocator is for allocating small memory blocks efficiently + in terms of memory overhead and execution speed. The allocated blocks + cannot be freed individually, only all at once. There can be multiple + allocators, though. +*/ + +/* Returns a new memory allocator or NULL if out of memory. */ +tre_mem_t +tre_mem_new_impl(int provided, void *provided_block) +{ + tre_mem_t mem; + if (provided) + { + mem = provided_block; + memset(mem, 0, sizeof(*mem)); + } + else + mem = xcalloc(1, sizeof(*mem)); + if (mem == NULL) + return NULL; + return mem; +} + + +/* Frees the memory allocator and all memory allocated with it. */ +void +tre_mem_destroy(tre_mem_t mem) +{ + tre_list_t *tmp, *l = mem->blocks; + + while (l != NULL) + { + xfree(l->data); + tmp = l->next; + xfree(l); + l = tmp; + } + xfree(mem); +} + + +/* Allocates a block of `size' bytes from `mem'. Returns a pointer to the + allocated block or NULL if an underlying malloc() failed. */ +void * +tre_mem_alloc_impl(tre_mem_t mem, int provided, void *provided_block, + int zero, size_t size) +{ + void *ptr; + + if (mem->failed) + { + return NULL; + } + + if (mem->n < size) + { + /* We need more memory than is available in the current block. + Allocate a new block. */ + tre_list_t *l; + if (provided) + { + if (provided_block == NULL) + { + mem->failed = 1; + return NULL; + } + mem->ptr = provided_block; + mem->n = TRE_MEM_BLOCK_SIZE; + } + else + { + int block_size; + if (size * 8 > TRE_MEM_BLOCK_SIZE) + block_size = size * 8; + else + block_size = TRE_MEM_BLOCK_SIZE; + l = xmalloc(sizeof(*l)); + if (l == NULL) + { + mem->failed = 1; + return NULL; + } + l->data = xmalloc(block_size); + if (l->data == NULL) + { + xfree(l); + mem->failed = 1; + return NULL; + } + l->next = NULL; + if (mem->current != NULL) + mem->current->next = l; + if (mem->blocks == NULL) + mem->blocks = l; + mem->current = l; + mem->ptr = l->data; + mem->n = block_size; + } + } + + /* Make sure the next pointer will be aligned. */ + size += ALIGN(mem->ptr + size, long); + + /* Allocate from current block. */ + ptr = mem->ptr; + mem->ptr += size; + mem->n -= size; + + /* Set to zero if needed. */ + if (zero) + memset(ptr, 0, size); + + return ptr; +}
\ No newline at end of file diff --git a/lib/mlibc/options/posix/musl-generic-regex/tre.h b/lib/mlibc/options/posix/musl-generic-regex/tre.h new file mode 100644 index 0000000..5891f75 --- /dev/null +++ b/lib/mlibc/options/posix/musl-generic-regex/tre.h @@ -0,0 +1,241 @@ +// Taken from musl tre.h +/* + tre-internal.h - TRE internal definitions + + Copyright (c) 2001-2009 Ville Laurikari <vl@iki.fi> + All rights reserved. + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + 2. Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + + THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDER AND CONTRIBUTORS + ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT + HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT + LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +*/ + +#include <regex.h> +#include <wchar.h> +#include <wctype.h> + +#define hidden __attribute__((__visibility__("hidden"))) + +// TODO: These should probably go in limits.h +#define CHARCLASS_NAME_MAX 14 +#define RE_DUP_MAX 255 + +#undef TRE_MBSTATE + +#define NDEBUG + +#define TRE_REGEX_T_FIELD __opaque +typedef int reg_errcode_t; + +typedef wchar_t tre_char_t; + +#define DPRINT(msg) do { } while(0) + +#define elementsof(x) ( sizeof(x) / sizeof(x[0]) ) + +#define tre_mbrtowc(pwc, s, n, ps) (mbtowc((pwc), (s), (n))) + +/* Wide characters. */ +typedef wint_t tre_cint_t; +#define TRE_CHAR_MAX 0x10ffff + +#define tre_isalnum iswalnum +#define tre_isalpha iswalpha +#define tre_isblank iswblank +#define tre_iscntrl iswcntrl +#define tre_isdigit iswdigit +#define tre_isgraph iswgraph +#define tre_islower iswlower +#define tre_isprint iswprint +#define tre_ispunct iswpunct +#define tre_isspace iswspace +#define tre_isupper iswupper +#define tre_isxdigit iswxdigit + +#define tre_tolower towlower +#define tre_toupper towupper +#define tre_strlen wcslen + +/* Use system provided iswctype() and wctype(). */ +typedef wctype_t tre_ctype_t; +#define tre_isctype iswctype +#define tre_ctype wctype + +/* Returns number of bytes to add to (char *)ptr to make it + properly aligned for the type. */ +#define ALIGN(ptr, type) \ + ((((long)ptr) % sizeof(type)) \ + ? (sizeof(type) - (((long)ptr) % sizeof(type))) \ + : 0) + +#undef MAX +#undef MIN +#define MAX(a, b) (((a) >= (b)) ? (a) : (b)) +#define MIN(a, b) (((a) <= (b)) ? (a) : (b)) + +/* TNFA transition type. A TNFA state is an array of transitions, + the terminator is a transition with NULL `state'. */ +typedef struct tnfa_transition tre_tnfa_transition_t; + +struct tnfa_transition { + /* Range of accepted characters. */ + tre_cint_t code_min; + tre_cint_t code_max; + /* Pointer to the destination state. */ + tre_tnfa_transition_t *state; + /* ID number of the destination state. */ + int state_id; + /* -1 terminated array of tags (or NULL). */ + int *tags; + /* Assertion bitmap. */ + int assertions; + /* Assertion parameters. */ + union { + /* Character class assertion. */ + tre_ctype_t class; + /* Back reference assertion. */ + int backref; + } u; + /* Negative character class assertions. */ + tre_ctype_t *neg_classes; +}; + + +/* Assertions. */ +#define ASSERT_AT_BOL 1 /* Beginning of line. */ +#define ASSERT_AT_EOL 2 /* End of line. */ +#define ASSERT_CHAR_CLASS 4 /* Character class in `class'. */ +#define ASSERT_CHAR_CLASS_NEG 8 /* Character classes in `neg_classes'. */ +#define ASSERT_AT_BOW 16 /* Beginning of word. */ +#define ASSERT_AT_EOW 32 /* End of word. */ +#define ASSERT_AT_WB 64 /* Word boundary. */ +#define ASSERT_AT_WB_NEG 128 /* Not a word boundary. */ +#define ASSERT_BACKREF 256 /* A back reference in `backref'. */ +#define ASSERT_LAST 256 + +/* Tag directions. */ +typedef enum { + TRE_TAG_MINIMIZE = 0, + TRE_TAG_MAXIMIZE = 1 +} tre_tag_direction_t; + +/* Instructions to compute submatch register values from tag values + after a successful match. */ +struct tre_submatch_data { + /* Tag that gives the value for rm_so (submatch start offset). */ + int so_tag; + /* Tag that gives the value for rm_eo (submatch end offset). */ + int eo_tag; + /* List of submatches this submatch is contained in. */ + int *parents; +}; + +typedef struct tre_submatch_data tre_submatch_data_t; + + +/* TNFA definition. */ +typedef struct tnfa tre_tnfa_t; + +struct tnfa { + tre_tnfa_transition_t *transitions; + unsigned int num_transitions; + tre_tnfa_transition_t *initial; + tre_tnfa_transition_t *final; + tre_submatch_data_t *submatch_data; + char *firstpos_chars; + int first_char; + unsigned int num_submatches; + tre_tag_direction_t *tag_directions; + int *minimal_tags; + int num_tags; + int num_minimals; + int end_tag; + int num_states; + int cflags; + int have_backrefs; + int have_approx; +}; + +/* from tre-mem.h: */ + +#define TRE_MEM_BLOCK_SIZE 1024 + +typedef struct tre_list { + void *data; + struct tre_list *next; +} tre_list_t; + +typedef struct tre_mem_struct { + tre_list_t *blocks; + tre_list_t *current; + char *ptr; + size_t n; + int failed; + void **provided; +} *tre_mem_t; + +#ifndef __MLIBC_ABI_ONLY + +#define tre_mem_new_impl __tre_mem_new_impl +#define tre_mem_alloc_impl __tre_mem_alloc_impl +#define tre_mem_destroy __tre_mem_destroy + +hidden tre_mem_t tre_mem_new_impl(int provided, void *provided_block); +hidden void *tre_mem_alloc_impl(tre_mem_t mem, int provided, void *provided_block, + int zero, size_t size); + +/* Returns a new memory allocator or NULL if out of memory. */ +#define tre_mem_new() tre_mem_new_impl(0, NULL) + +/* Allocates a block of `size' bytes from `mem'. Returns a pointer to the + allocated block or NULL if an underlying malloc() failed. */ +#define tre_mem_alloc(mem, size) tre_mem_alloc_impl(mem, 0, NULL, 0, size) + +/* Allocates a block of `size' bytes from `mem'. Returns a pointer to the + allocated block or NULL if an underlying malloc() failed. The memory + is set to zero. */ +#define tre_mem_calloc(mem, size) tre_mem_alloc_impl(mem, 0, NULL, 1, size) + +#ifdef TRE_USE_ALLOCA +/* alloca() versions. Like above, but memory is allocated with alloca() + instead of malloc(). */ + +#define tre_mem_newa() \ + tre_mem_new_impl(1, alloca(sizeof(struct tre_mem_struct))) + +#define tre_mem_alloca(mem, size) \ + ((mem)->n >= (size) \ + ? tre_mem_alloc_impl((mem), 1, NULL, 0, (size)) \ + : tre_mem_alloc_impl((mem), 1, alloca(TRE_MEM_BLOCK_SIZE), 0, (size))) +#endif /* TRE_USE_ALLOCA */ + + +/* Frees the memory allocator and all memory allocated with it. */ +hidden void tre_mem_destroy(tre_mem_t mem); + +#define xmalloc malloc +#define xcalloc calloc +#define xfree free +#define xrealloc realloc + +#endif /* !__MLIBC_ABI_ONLY */ diff --git a/lib/mlibc/options/rtdl/aarch64/elf.hpp b/lib/mlibc/options/rtdl/aarch64/elf.hpp new file mode 100644 index 0000000..802d1a2 --- /dev/null +++ b/lib/mlibc/options/rtdl/aarch64/elf.hpp @@ -0,0 +1,37 @@ +#pragma once + +#include <elf.h> + +#define ELF_CLASS ELFCLASS64 +#define ELF_MACHINE EM_AARCH64 + +using elf_ehdr = Elf64_Ehdr; +using elf_phdr = Elf64_Phdr; +using elf_dyn = Elf64_Dyn; +using elf_rel = Elf64_Rel; +using elf_rela = Elf64_Rela; +using elf_relr = Elf64_Relr; +using elf_sym = Elf64_Sym; +using elf_addr = Elf64_Addr; + +using elf_info = Elf64_Xword; +using elf_addend = Elf64_Sxword; + +#define ELF_R_SYM ELF64_R_SYM +#define ELF_R_TYPE ELF64_R_TYPE +#define ELF_ST_BIND ELF64_ST_BIND + +#define R_NONE R_AARCH64_NONE +#define R_JUMP_SLOT R_AARCH64_JUMP_SLOT +#define R_ABSOLUTE R_AARCH64_ABS64 +#define R_GLOB_DAT R_AARCH64_GLOB_DAT +#define R_RELATIVE R_AARCH64_RELATIVE +#define R_IRELATIVE R_AARCH64_IRELATIVE +// #define R_OFFSET +#define R_COPY R_AARCH64_COPY +#define R_TLS_DTPMOD R_AARCH64_TLS_DTPMOD +#define R_TLS_DTPREL R_AARCH64_TLS_DTPREL +#define R_TLS_TPREL R_AARCH64_TLS_TPREL +#define R_TLSDESC R_AARCH64_TLSDESC + +#define TP_TCB_OFFSET (16) diff --git a/lib/mlibc/options/rtdl/aarch64/entry.S b/lib/mlibc/options/rtdl/aarch64/entry.S new file mode 100644 index 0000000..b22af53 --- /dev/null +++ b/lib/mlibc/options/rtdl/aarch64/entry.S @@ -0,0 +1,11 @@ + +.global _start +_start: + bl relocateSelf + + mov x0, sp + bl interpreterMain + + br x0 +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/rtdl/aarch64/runtime.S b/lib/mlibc/options/rtdl/aarch64/runtime.S new file mode 100644 index 0000000..c3e2cff --- /dev/null +++ b/lib/mlibc/options/rtdl/aarch64/runtime.S @@ -0,0 +1,62 @@ + +.global __mlibcTlsdescStatic +.hidden __mlibcTlsdescStatic +.type __mlibcTlsdescStatic,@function +__mlibcTlsdescStatic: + ldr x0, [x0, #8] + ret + +// This function depends on the Tcb layout, since it pulls out the dtv pointer +// out of the thread control block +.global __mlibcTlsdescDynamic +.hidden __mlibcTlsdescDynamic +.type __mlibcTlsdescDynamic,@function +__mlibcTlsdescDynamic: + stp x1, x2, [sp, #-16]! + ldr x0, [x0, #8] + ldp x1, x2, [x0] // tlsIndex, addend + mrs x0, tpidr_el0 // tp + ldr x0, [x0, #-104] // tp->dtvPointers + ldr x0, [x0, x1, lsl 3] // [tlsIndex] + add x0, x0, x2 // + addend + mrs x1, tpidr_el0 // tp + sub x0, x0, x1 // result - tp + ldp x1, x2, [sp], #16 + ret + +.global pltRelocateStub +pltRelocateStub: + // we need to save / restore all registers than can hold function arguments + // we do not need to save callee-saved registers as they will not be trashed by lazyRelocate + // TODO: save floating point argument registers + + stp x0, x1, [sp, #-16]! + + // pointer to PLT entry + ldr x1, [sp, #24] + ldr x0, [x16] + sub x1, x1, x0 + asr x0, x0, #3 + + // pointer GOT + sub x0, x16, #8 // &PLTGOT[1] + + stp x2, x3, [sp, #-16]! + stp x4, x5, [sp, #-16]! + stp x6, x7, [sp, #-16]! + stp x8, x30, [sp, #-16]! + + bl lazyRelocate + mov x9, x0 + + ldp x8, x30, [sp], #16 + ldp x6, x7, [sp], #16 + ldp x4, x5, [sp], #16 + ldp x2, x1, [sp], #16 + + ldp x0, x1, [sp], #16 + add sp, sp, #16 + br x9 + +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/rtdl/generic/linker.cpp b/lib/mlibc/options/rtdl/generic/linker.cpp new file mode 100644 index 0000000..a519c35 --- /dev/null +++ b/lib/mlibc/options/rtdl/generic/linker.cpp @@ -0,0 +1,1872 @@ +#include <mlibc/arch-defs.hpp> +#include <stdint.h> +#include <string.h> + +// keep a list of optional generic relocation types +enum { + R_OFFSET = (uintptr_t) -1, +}; + + +#include <frg/manual_box.hpp> +#include <frg/small_vector.hpp> +#include <mlibc/allocator.hpp> +#include <mlibc/debug.hpp> +#include <mlibc/rtdl-sysdeps.hpp> +#include <mlibc/rtdl-abi.hpp> +#include <mlibc/thread.hpp> +#include <abi-bits/fcntl.h> +#include <internal-config.h> + +#include "elf.hpp" +#include "linker.hpp" + +#if !MLIBC_MMAP_ALLOCATE_DSO +uintptr_t libraryBase = 0x41000000; +#endif + +constexpr bool verbose = false; +constexpr bool stillSlightlyVerbose = false; +constexpr bool logBaseAddresses = false; +constexpr bool logRpath = false; +constexpr bool logLdPath = false; +constexpr bool eagerBinding = true; + +#if defined(__x86_64__) || defined(__i386__) +constexpr inline bool tlsAboveTp = false; +#elif defined(__aarch64__) +constexpr inline bool tlsAboveTp = true; +#elif defined(__riscv) +constexpr inline bool tlsAboveTp = true; +#else +# error Unknown architecture +#endif + +extern DebugInterface globalDebugInterface; +extern uintptr_t __stack_chk_guard; + +extern frg::manual_box<frg::small_vector<frg::string_view, 4, MemoryAllocator>> libraryPaths; +extern frg::manual_box<frg::vector<frg::string_view, MemoryAllocator>> preloads; + +#if MLIBC_STATIC_BUILD +extern "C" size_t __init_array_start[]; +extern "C" size_t __init_array_end[]; +extern "C" size_t __preinit_array_start[]; +extern "C" size_t __preinit_array_end[]; +#endif + +size_t tlsMaxAlignment = 16; + +// This is the global "resolution timestamp" (RTS) counter. +// It is incremented each time __dlapi_open() (i.e. dlopen()) is called. +// Each DSO stores its objectRts (i.e. RTS at the time the object was loaded). +// DSOs in the global scope also store a globalRts (i.e. RTS at the time the +// object became global). This mechanism is used to determine which +// part of the global scope is considered for symbol resolution. +uint64_t rtsCounter = 2; + +bool trySeek(int fd, int64_t offset) { + off_t noff; + return mlibc::sys_seek(fd, offset, SEEK_SET, &noff) == 0; +} + +bool tryReadExactly(int fd, void *data, size_t length) { + size_t offset = 0; + while(offset < length) { + ssize_t chunk; + if(mlibc::sys_read(fd, reinterpret_cast<char *>(data) + offset, + length - offset, &chunk)) + return false; + __ensure(chunk > 0); + offset += chunk; + } + __ensure(offset == length); + return true; +} + +void closeOrDie(int fd) { + if(mlibc::sys_close(fd)) + __ensure(!"sys_close() failed"); +} + +uintptr_t alignUp(uintptr_t address, size_t align) { + return (address + align - 1) & ~(align - 1); +} + +// -------------------------------------------------------- +// ObjectRepository +// -------------------------------------------------------- + +ObjectRepository::ObjectRepository() +: loadedObjects{getAllocator()}, + _nameMap{frg::hash<frg::string_view>{}, getAllocator()} {} + +SharedObject *ObjectRepository::injectObjectFromDts(frg::string_view name, + frg::string<MemoryAllocator> path, uintptr_t base_address, + elf_dyn *dynamic, uint64_t rts) { + __ensure(!findLoadedObject(name)); + + auto object = frg::construct<SharedObject>(getAllocator(), + name.data(), std::move(path), false, globalScope.get(), rts); + object->baseAddress = base_address; + object->dynamic = dynamic; + _parseDynamic(object); + + _addLoadedObject(object); + _discoverDependencies(object, globalScope.get(), rts); + + return object; +} + +SharedObject *ObjectRepository::injectObjectFromPhdrs(frg::string_view name, + frg::string<MemoryAllocator> path, void *phdr_pointer, + size_t phdr_entry_size, size_t num_phdrs, void *entry_pointer, + uint64_t rts) { + __ensure(!findLoadedObject(name)); + + auto object = frg::construct<SharedObject>(getAllocator(), + name.data(), std::move(path), true, globalScope.get(), rts); + _fetchFromPhdrs(object, phdr_pointer, phdr_entry_size, num_phdrs, entry_pointer); + _parseDynamic(object); + + _addLoadedObject(object); + _discoverDependencies(object, globalScope.get(), rts); + + return object; +} + +SharedObject *ObjectRepository::injectStaticObject(frg::string_view name, + frg::string<MemoryAllocator> path, void *phdr_pointer, + size_t phdr_entry_size, size_t num_phdrs, void *entry_pointer, + uint64_t rts) { + __ensure(!findLoadedObject(name)); + auto object = frg::construct<SharedObject>(getAllocator(), + name.data(), std::move(path), true, globalScope.get(), rts); + _fetchFromPhdrs(object, phdr_pointer, phdr_entry_size, num_phdrs, entry_pointer); + +#if MLIBC_STATIC_BUILD + object->initArray = reinterpret_cast<InitFuncPtr*>(__init_array_start); + object->initArraySize = static_cast<size_t>((uintptr_t)__init_array_end - + (uintptr_t)__init_array_start); + object->preInitArray = reinterpret_cast<InitFuncPtr*>(__preinit_array_start); + object->preInitArraySize = static_cast<size_t>((uintptr_t)__preinit_array_end - + (uintptr_t)__preinit_array_start); +#endif + + _addLoadedObject(object); + + return object; +} + +frg::expected<LinkerError, SharedObject *> ObjectRepository::requestObjectWithName(frg::string_view name, + SharedObject *origin, Scope *localScope, bool createScope, uint64_t rts) { + if (auto obj = findLoadedObject(name)) + return obj; + + auto tryToOpen = [&] (const char *path) { + int fd; + if(auto x = mlibc::sys_open(path, O_RDONLY, 0, &fd); x) { + return -1; + } + return fd; + }; + + // TODO(arsen): this process can probably undergo heavy optimization, by + // preprocessing the rpath only once on parse + auto processRpath = [&] (frg::string_view path) { + frg::string<MemoryAllocator> sPath { getAllocator() }; + if (path.starts_with("$ORIGIN")) { + frg::string_view dirname = origin->path; + auto lastsl = dirname.find_last('/'); + if (lastsl != size_t(-1)) { + dirname = dirname.sub_string(0, lastsl); + } else { + dirname = "."; + } + sPath = frg::string<MemoryAllocator>{ getAllocator(), dirname }; + sPath += path.sub_string(7, path.size() - 7); + } else { + sPath = frg::string<MemoryAllocator>{ getAllocator(), path }; + } + if (sPath[sPath.size() - 1] != '/') { + sPath += '/'; + } + sPath += name; + if (logRpath) + mlibc::infoLogger() << "rtdl: trying in rpath " << sPath << frg::endlog; + int fd = tryToOpen(sPath.data()); + if (logRpath && fd >= 0) + mlibc::infoLogger() << "rtdl: found in rpath" << frg::endlog; + return frg::tuple { fd, std::move(sPath) }; + }; + + frg::string<MemoryAllocator> chosenPath { getAllocator() }; + int fd = -1; + if (origin && origin->runPath) { + size_t start = 0; + size_t idx = 0; + frg::string_view rpath { origin->runPath }; + auto next = [&] () { + idx = rpath.find_first(':', start); + if (idx == (size_t)-1) + idx = rpath.size(); + }; + for (next(); idx < rpath.size(); next()) { + auto path = rpath.sub_string(start, idx - start); + start = idx + 1; + auto [fd_, fullPath] = processRpath(path); + if (fd_ != -1) { + fd = fd_; + chosenPath = std::move(fullPath); + break; + } + } + if (fd == -1) { + auto path = rpath.sub_string(start, rpath.size() - start); + auto [fd_, fullPath] = processRpath(path); + if (fd_ != -1) { + fd = fd_; + chosenPath = std::move(fullPath); + } + } + } else if (logRpath) { + mlibc::infoLogger() << "rtdl: no rpath set for object" << frg::endlog; + } + + for(size_t i = 0; i < libraryPaths->size() && fd == -1; i++) { + auto ldPath = (*libraryPaths)[i]; + auto path = frg::string<MemoryAllocator>{getAllocator(), ldPath} + '/' + name; + if(logLdPath) + mlibc::infoLogger() << "rtdl: Trying to load " << name << " from ldpath " << ldPath << "/" << frg::endlog; + fd = tryToOpen(path.data()); + if(fd >= 0) { + chosenPath = std::move(path); + break; + } + } + if(fd == -1) + return LinkerError::notFound; + + if (createScope) { + __ensure(localScope == nullptr); + + // TODO: Free this when the scope is no longer needed. + localScope = frg::construct<Scope>(getAllocator()); + } + + __ensure(localScope != nullptr); + + auto object = frg::construct<SharedObject>(getAllocator(), + name.data(), std::move(chosenPath), false, localScope, rts); + + auto result = _fetchFromFile(object, fd); + closeOrDie(fd); + if(!result) { + frg::destruct(getAllocator(), object); + return result.error(); + } + + _parseDynamic(object); + + _addLoadedObject(object); + _discoverDependencies(object, localScope, rts); + + return object; +} + +frg::expected<LinkerError, SharedObject *> ObjectRepository::requestObjectAtPath(frg::string_view path, + Scope *localScope, bool createScope, uint64_t rts) { + // TODO: Support SONAME correctly. + auto lastSlash = path.find_last('/') + 1; + auto name = path; + if (!lastSlash) { + name = name.sub_string(lastSlash, path.size() - lastSlash); + } + if (auto obj = findLoadedObject(name)) + return obj; + + if (createScope) { + __ensure(localScope == nullptr); + + // TODO: Free this when the scope is no longer needed. + localScope = frg::construct<Scope>(getAllocator()); + } + + __ensure(localScope != nullptr); + + auto object = frg::construct<SharedObject>(getAllocator(), + name.data(), path.data(), false, localScope, rts); + + frg::string<MemoryAllocator> no_prefix(getAllocator(), path); + + int fd; + if(mlibc::sys_open((no_prefix + '\0').data(), O_RDONLY, 0, &fd)) { + frg::destruct(getAllocator(), object); + return LinkerError::notFound; + } + auto result = _fetchFromFile(object, fd); + closeOrDie(fd); + if(!result) { + frg::destruct(getAllocator(), object); + return result.error(); + } + + _parseDynamic(object); + + _addLoadedObject(object); + _discoverDependencies(object, localScope, rts); + + return object; +} + +SharedObject *ObjectRepository::findCaller(void *addr) { + uintptr_t target = reinterpret_cast<uintptr_t>(addr); + + for (auto [name, object] : _nameMap) { + // Search all PT_LOAD segments for the specified address. + for(size_t j = 0; j < object->phdrCount; j++) { + auto phdr = (elf_phdr *)((uintptr_t)object->phdrPointer + j * object->phdrEntrySize); + if (phdr->p_type == PT_LOAD) { + uintptr_t start = object->baseAddress + phdr->p_vaddr; + uintptr_t end = start + phdr->p_memsz; + if (start <= target && target < end) + return object; + } + } + } + + return nullptr; +} + +SharedObject *ObjectRepository::findLoadedObject(frg::string_view name) { + auto it = _nameMap.get(name); + if (it) + return *it; + + for (auto object : loadedObjects) { + // See if any object has a matching SONAME. + if (object->soName && name == object->soName) + return object; + } + + // TODO: We should also look at the device and inode here as a fallback. + return nullptr; +} + +// -------------------------------------------------------- +// ObjectRepository: Fetching methods. +// -------------------------------------------------------- + +void ObjectRepository::_fetchFromPhdrs(SharedObject *object, void *phdr_pointer, + size_t phdr_entry_size, size_t phdr_count, void *entry_pointer) { + __ensure(object->isMainObject); + object->phdrPointer = phdr_pointer; + object->phdrEntrySize = phdr_entry_size; + object->phdrCount = phdr_count; + if(verbose) + mlibc::infoLogger() << "rtdl: Loading " << object->name << frg::endlog; + + // Note: the entry pointer is absolute and not relative to the base address. + object->entry = entry_pointer; + + frg::optional<ptrdiff_t> dynamic_offset; + frg::optional<ptrdiff_t> tls_offset; + + // segments are already mapped, so we just have to find the dynamic section + for(size_t i = 0; i < phdr_count; i++) { + auto phdr = (elf_phdr *)((uintptr_t)phdr_pointer + i * phdr_entry_size); + switch(phdr->p_type) { + case PT_PHDR: + // Determine the executable's base address (in the PIE case) by comparing + // the PHDR segment's load address against it's address in the ELF file. + object->baseAddress = reinterpret_cast<uintptr_t>(phdr_pointer) - phdr->p_vaddr; + if(verbose) + mlibc::infoLogger() << "rtdl: Executable is loaded at " + << (void *)object->baseAddress << frg::endlog; + break; + case PT_DYNAMIC: + dynamic_offset = phdr->p_vaddr; + break; + case PT_TLS: { + object->tlsSegmentSize = phdr->p_memsz; + object->tlsAlignment = phdr->p_align; + object->tlsImageSize = phdr->p_filesz; + tls_offset = phdr->p_vaddr; + break; + case PT_INTERP: + object->interpreterPath = frg::string<MemoryAllocator>{ + (char*)(object->baseAddress + phdr->p_vaddr), + getAllocator() + }; + } break; + default: + //FIXME warn about unknown phdrs + break; + } + } + + if(dynamic_offset) + object->dynamic = (elf_dyn *)(object->baseAddress + *dynamic_offset); + if(tls_offset) + object->tlsImagePtr = (void *)(object->baseAddress + *tls_offset); +} + + +frg::expected<LinkerError, void> ObjectRepository::_fetchFromFile(SharedObject *object, int fd) { + __ensure(!object->isMainObject); + + // read the elf file header + elf_ehdr ehdr; + if(!tryReadExactly(fd, &ehdr, sizeof(elf_ehdr))) + return LinkerError::fileTooShort; + + if(ehdr.e_ident[0] != 0x7F + || ehdr.e_ident[1] != 'E' + || ehdr.e_ident[2] != 'L' + || ehdr.e_ident[3] != 'F') + return LinkerError::notElf; + + if((ehdr.e_type != ET_EXEC && ehdr.e_type != ET_DYN) + || ehdr.e_machine != ELF_MACHINE + || ehdr.e_ident[EI_CLASS] != ELF_CLASS) + return LinkerError::wrongElfType; + + // read the elf program headers + auto phdr_buffer = (char *)getAllocator().allocate(ehdr.e_phnum * ehdr.e_phentsize); + if(!phdr_buffer) + return LinkerError::outOfMemory; + + if(!trySeek(fd, ehdr.e_phoff)) { + getAllocator().deallocate(phdr_buffer, ehdr.e_phnum * ehdr.e_phentsize); + return LinkerError::invalidProgramHeader; + } + if(!tryReadExactly(fd, phdr_buffer, ehdr.e_phnum * ehdr.e_phentsize)) { + getAllocator().deallocate(phdr_buffer, ehdr.e_phnum * ehdr.e_phentsize); + return LinkerError::invalidProgramHeader; + } + + object->phdrPointer = phdr_buffer; + object->phdrCount = ehdr.e_phnum; + object->phdrEntrySize = ehdr.e_phentsize; + + // Allocate virtual address space for the DSO. + constexpr size_t hugeSize = 0x200000; + + uintptr_t highest_address = 0; + for(int i = 0; i < ehdr.e_phnum; i++) { + auto phdr = (elf_phdr *)(phdr_buffer + i * ehdr.e_phentsize); + + if(phdr->p_type != PT_LOAD) + continue; + + auto limit = phdr->p_vaddr + phdr->p_memsz; + if(limit > highest_address) + highest_address = limit; + } + + __ensure(!(object->baseAddress & (hugeSize - 1))); + + highest_address = (highest_address + mlibc::page_size - 1) & ~(mlibc::page_size - 1); + +#if MLIBC_MMAP_ALLOCATE_DSO + void *mappedAddr = nullptr; + + if (mlibc::sys_vm_map(nullptr, + highest_address - object->baseAddress, PROT_NONE, + MAP_PRIVATE | MAP_ANONYMOUS, -1, 0, &mappedAddr)) { + mlibc::infoLogger() << "sys_vm_map failed when allocating address space for DSO \"" + << object->name << "\"" + << ", base " << (void *)object->baseAddress + << ", requested " << (highest_address - object->baseAddress) << " bytes" + << frg::endlog; + getAllocator().deallocate(phdr_buffer, ehdr.e_phnum * ehdr.e_phentsize); + return LinkerError::outOfMemory; + } + + object->baseAddress = reinterpret_cast<uintptr_t>(mappedAddr); +#else + object->baseAddress = libraryBase; + libraryBase += (highest_address + (hugeSize - 1)) & ~(hugeSize - 1); +#endif + + if(verbose || logBaseAddresses) + mlibc::infoLogger() << "rtdl: Loading " << object->name + << " at " << (void *)object->baseAddress << frg::endlog; + + // Load all segments. + constexpr size_t pageSize = 0x1000; + for(int i = 0; i < ehdr.e_phnum; i++) { + auto phdr = (elf_phdr *)(phdr_buffer + i * ehdr.e_phentsize); + + if(phdr->p_type == PT_LOAD) { + size_t misalign = phdr->p_vaddr & (pageSize - 1); + __ensure(phdr->p_memsz > 0); + __ensure(phdr->p_memsz >= phdr->p_filesz); + + // If the following condition is violated, we cannot use mmap() the segment; + // however, GCC only generates ELF files that satisfy this. + __ensure(misalign == (phdr->p_offset & (pageSize - 1))); + + auto map_address = object->baseAddress + phdr->p_vaddr - misalign; + auto backed_map_size = (phdr->p_filesz + misalign + pageSize - 1) & ~(pageSize - 1); + auto total_map_size = (phdr->p_memsz + misalign + pageSize - 1) & ~(pageSize - 1); + + int prot = 0; + if(phdr->p_flags & PF_R) + prot |= PROT_READ; + if(phdr->p_flags & PF_W) + prot |= PROT_WRITE; + if(phdr->p_flags & PF_X) + prot |= PROT_EXEC; + + #if MLIBC_MAP_DSO_SEGMENTS + void *map_pointer; + if(mlibc::sys_vm_map(reinterpret_cast<void *>(map_address), + backed_map_size, prot | PROT_WRITE, + MAP_PRIVATE | MAP_FIXED, fd, phdr->p_offset - misalign, &map_pointer)) + __ensure(!"sys_vm_map failed"); + if(total_map_size > backed_map_size) + if(mlibc::sys_vm_map(reinterpret_cast<void *>(map_address + backed_map_size), + total_map_size - backed_map_size, prot | PROT_WRITE, + MAP_PRIVATE | MAP_FIXED | MAP_ANONYMOUS, -1, 0, &map_pointer)) + __ensure(!"sys_vm_map failed"); + + if(mlibc::sys_vm_readahead) + if(mlibc::sys_vm_readahead(reinterpret_cast<void *>(map_address), + backed_map_size)) + mlibc::infoLogger() << "mlibc: sys_vm_readahead() failed in ld.so" + << frg::endlog; + + // Clear the trailing area at the end of the backed mapping. + // We do not clear the leading area; programs are not supposed to access it. + memset(reinterpret_cast<void *>(map_address + misalign + phdr->p_filesz), + 0, phdr->p_memsz - phdr->p_filesz); + #else + (void)backed_map_size; + + void *map_pointer; + if(mlibc::sys_vm_map(reinterpret_cast<void *>(map_address), + total_map_size, prot | PROT_WRITE, + MAP_PRIVATE | MAP_FIXED | MAP_ANONYMOUS, -1, 0, &map_pointer)) + __ensure(!"sys_vm_map failed"); + + __ensure(trySeek(fd, phdr->p_offset)); + __ensure(tryReadExactly(fd, reinterpret_cast<char *>(map_address) + misalign, + phdr->p_filesz)); + #endif + // Take care of removing superfluous permissions. + if(mlibc::sys_vm_protect && ((prot & PROT_WRITE) == 0)) + if(mlibc::sys_vm_protect(map_pointer, total_map_size, prot)) + mlibc::infoLogger() << "mlibc: sys_vm_protect() failed in ld.so" << frg::endlog; + }else if(phdr->p_type == PT_TLS) { + object->tlsSegmentSize = phdr->p_memsz; + object->tlsAlignment = phdr->p_align; + object->tlsImageSize = phdr->p_filesz; + object->tlsImagePtr = (void *)(object->baseAddress + phdr->p_vaddr); + }else if(phdr->p_type == PT_DYNAMIC) { + object->dynamic = (elf_dyn *)(object->baseAddress + phdr->p_vaddr); + }else if(phdr->p_type == PT_INTERP + || phdr->p_type == PT_PHDR + || phdr->p_type == PT_NOTE + || phdr->p_type == PT_RISCV_ATTRIBUTES + || phdr->p_type == PT_GNU_EH_FRAME + || phdr->p_type == PT_GNU_RELRO + || phdr->p_type == PT_GNU_STACK + || phdr->p_type == PT_GNU_PROPERTY) { + // ignore the phdr + }else{ + mlibc::panicLogger() << "Unexpected PHDR type 0x" + << frg::hex_fmt(phdr->p_type) << " in DSO " << object->name << frg::endlog; + } + } + + return frg::success; +} + +// -------------------------------------------------------- +// ObjectRepository: Parsing methods. +// -------------------------------------------------------- + +void ObjectRepository::_parseDynamic(SharedObject *object) { + if(!object->dynamic) + mlibc::infoLogger() << "ldso: Object '" << object->name + << "' does not have a dynamic section" << frg::endlog; + __ensure(object->dynamic); + + // Fix up these offsets to addresses after the loop, since the + // addresses depend on the value of DT_STRTAB. + frg::optional<ptrdiff_t> runpath_offset; + /* If true, ignore the RPATH. */ + bool runpath_found = false; + frg::optional<ptrdiff_t> soname_offset; + + for(size_t i = 0; object->dynamic[i].d_tag != DT_NULL; i++) { + elf_dyn *dynamic = &object->dynamic[i]; + switch(dynamic->d_tag) { + // handle hash table, symbol table and string table + case DT_HASH: + object->hashStyle = HashStyle::systemV; + object->hashTableOffset = dynamic->d_un.d_ptr; + break; + case DT_GNU_HASH: + object->hashStyle = HashStyle::gnu; + object->hashTableOffset = dynamic->d_un.d_ptr; + break; + case DT_STRTAB: + object->stringTableOffset = dynamic->d_un.d_ptr; + break; + case DT_STRSZ: + break; // we don't need the size of the string table + case DT_SYMTAB: + object->symbolTableOffset = dynamic->d_un.d_ptr; + break; + case DT_SYMENT: + __ensure(dynamic->d_un.d_val == sizeof(elf_sym)); + break; + // handle lazy relocation table + case DT_PLTGOT: + object->globalOffsetTable = (void **)(object->baseAddress + + dynamic->d_un.d_ptr); + break; + case DT_JMPREL: + object->lazyRelocTableOffset = dynamic->d_un.d_ptr; + break; + case DT_PLTRELSZ: + object->lazyTableSize = dynamic->d_un.d_val; + break; + case DT_PLTREL: + if(dynamic->d_un.d_val == DT_RELA) { + object->lazyExplicitAddend = true; + }else{ + __ensure(dynamic->d_un.d_val == DT_REL); + object->lazyExplicitAddend = false; + } + break; + // TODO: Implement this correctly! + case DT_SYMBOLIC: + object->symbolicResolution = true; + break; + case DT_BIND_NOW: + object->eagerBinding = true; + break; + case DT_FLAGS: { + if(dynamic->d_un.d_val & DF_SYMBOLIC) + object->symbolicResolution = true; + if(dynamic->d_un.d_val & DF_STATIC_TLS) + object->haveStaticTls = true; + if(dynamic->d_un.d_val & DF_BIND_NOW) + object->eagerBinding = true; + + auto ignored = DF_BIND_NOW | DF_SYMBOLIC | DF_STATIC_TLS; +#ifdef __riscv + // Work around https://sourceware.org/bugzilla/show_bug.cgi?id=24673. + ignored |= DF_TEXTREL; +#else + if(dynamic->d_un.d_val & DF_TEXTREL) + mlibc::panicLogger() << "\e[31mrtdl: DF_TEXTREL is unimplemented" << frg::endlog; +#endif + if(dynamic->d_un.d_val & ~ignored) + mlibc::infoLogger() << "\e[31mrtdl: DT_FLAGS(" << frg::hex_fmt{dynamic->d_un.d_val & ~ignored} + << ") is not implemented correctly!\e[39m" + << frg::endlog; + } break; + case DT_FLAGS_1: + if(dynamic->d_un.d_val & DF_1_NOW) + object->eagerBinding = true; + // The DF_1_PIE flag is informational only. It is used by e.g file(1). + // The DF_1_NODELETE flag has a similar effect to RTLD_NODELETE, both of which we + // ignore because we don't implement dlclose(). + if(dynamic->d_un.d_val & ~(DF_1_NOW | DF_1_PIE | DF_1_NODELETE)) + mlibc::infoLogger() << "\e[31mrtdl: DT_FLAGS_1(" << frg::hex_fmt{dynamic->d_un.d_val} + << ") is not implemented correctly!\e[39m" + << frg::endlog; + break; + case DT_RPATH: + if (runpath_found) { + /* Ignore RPATH if RUNPATH was present. */ + break; + } + [[fallthrough]]; + case DT_RUNPATH: + runpath_found = dynamic->d_tag == DT_RUNPATH; + runpath_offset = dynamic->d_un.d_val; + break; + case DT_INIT: + if(dynamic->d_un.d_ptr != 0) + object->initPtr = (InitFuncPtr)(object->baseAddress + dynamic->d_un.d_ptr); + break; + case DT_INIT_ARRAY: + if(dynamic->d_un.d_ptr != 0) + object->initArray = (InitFuncPtr *)(object->baseAddress + dynamic->d_un.d_ptr); + break; + case DT_INIT_ARRAYSZ: + object->initArraySize = dynamic->d_un.d_val; + break; + case DT_PREINIT_ARRAY: + if(dynamic->d_un.d_ptr != 0) { + // Only the main object is allowed pre-initializers. + __ensure(object->isMainObject); + object->preInitArray = (InitFuncPtr *)(object->baseAddress + dynamic->d_un.d_ptr); + } + break; + case DT_PREINIT_ARRAYSZ: + // Only the main object is allowed pre-initializers. + __ensure(object->isMainObject); + object->preInitArraySize = dynamic->d_un.d_val; + break; + case DT_DEBUG: +#if ELF_CLASS == ELFCLASS32 + dynamic->d_un.d_val = reinterpret_cast<Elf32_Word>(&globalDebugInterface); +#elif ELF_CLASS == ELFCLASS64 + dynamic->d_un.d_val = reinterpret_cast<Elf64_Xword>(&globalDebugInterface); +#endif + break; + case DT_SONAME: + soname_offset = dynamic->d_un.d_val; + break; + // ignore unimportant tags + case DT_NEEDED: // we handle this later + case DT_FINI: case DT_FINI_ARRAY: case DT_FINI_ARRAYSZ: + case DT_RELA: case DT_RELASZ: case DT_RELAENT: case DT_RELACOUNT: + case DT_REL: case DT_RELSZ: case DT_RELENT: case DT_RELCOUNT: + case DT_RELR: case DT_RELRSZ: case DT_RELRENT: + case DT_VERSYM: + case DT_VERDEF: case DT_VERDEFNUM: + case DT_VERNEED: case DT_VERNEEDNUM: +#ifdef __riscv + case DT_TEXTREL: // Work around https://sourceware.org/bugzilla/show_bug.cgi?id=24673. +#endif + break; + case DT_TLSDESC_PLT: case DT_TLSDESC_GOT: + break; + default: + // Ignore unknown entries in the os-specific area as we don't use them. + if(dynamic->d_tag < DT_LOOS || dynamic->d_tag > DT_HIOS) { + mlibc::panicLogger() << "Unexpected dynamic entry " + << (void *)dynamic->d_tag << " in object" << frg::endlog; + } + } + } + + if(runpath_offset) { + object->runPath = reinterpret_cast<const char *>(object->baseAddress + + object->stringTableOffset + *runpath_offset); + } + if(soname_offset) { + object->soName = reinterpret_cast<const char *>(object->baseAddress + + object->stringTableOffset + *soname_offset); + } +} + +void ObjectRepository::_discoverDependencies(SharedObject *object, + Scope *localScope, uint64_t rts) { + if(object->isMainObject) { + for(auto preload : *preloads) { + frg::expected<LinkerError, SharedObject *> libraryResult; + if (preload.find_first('/') == size_t(-1)) { + libraryResult = requestObjectWithName(preload, object, globalScope.get(), false, 1); + } else { + libraryResult = requestObjectAtPath(preload, globalScope.get(), false, 1); + } + if(!libraryResult) + mlibc::panicLogger() << "rtdl: Could not load preload " << preload << frg::endlog; + + if(verbose) + mlibc::infoLogger() << "rtdl: Preloading " << preload << frg::endlog; + + object->dependencies.push_back(libraryResult.value()); + } + } + + // Load required dynamic libraries. + for(size_t i = 0; object->dynamic[i].d_tag != DT_NULL; i++) { + elf_dyn *dynamic = &object->dynamic[i]; + if(dynamic->d_tag != DT_NEEDED) + continue; + + const char *library_str = (const char *)(object->baseAddress + + object->stringTableOffset + dynamic->d_un.d_val); + + auto library = requestObjectWithName(frg::string_view{library_str}, + object, localScope, false, rts); + if(!library) + mlibc::panicLogger() << "Could not satisfy dependency " << library_str << frg::endlog; + object->dependencies.push(library.value()); + } +} + +void ObjectRepository::_addLoadedObject(SharedObject *object) { + _nameMap.insert(object->name, object); + loadedObjects.push_back(object); +} + +// -------------------------------------------------------- +// SharedObject +// -------------------------------------------------------- + +SharedObject::SharedObject(const char *name, frg::string<MemoryAllocator> path, + bool is_main_object, Scope *local_scope, uint64_t object_rts) + : name(name, getAllocator()), path(std::move(path)), + interpreterPath(getAllocator()), soName(nullptr), + isMainObject(is_main_object), objectRts(object_rts), inLinkMap(false), + baseAddress(0), localScope(local_scope), dynamic(nullptr), + globalOffsetTable(nullptr), entry(nullptr), tlsSegmentSize(0), + tlsAlignment(0), tlsImageSize(0), tlsImagePtr(nullptr), + tlsInitialized(false), hashTableOffset(0), symbolTableOffset(0), + stringTableOffset(0), lazyRelocTableOffset(0), lazyTableSize(0), + lazyExplicitAddend(false), symbolicResolution(false), + eagerBinding(false), haveStaticTls(false), + dependencies(getAllocator()), tlsModel(TlsModel::null), + tlsOffset(0), globalRts(0), wasLinked(false), + scheduledForInit(false), onInitStack(false), + wasInitialized(false) { } + +SharedObject::SharedObject(const char *name, const char *path, + bool is_main_object, Scope *localScope, uint64_t object_rts) + : SharedObject(name, + frg::string<MemoryAllocator> { path, getAllocator() }, + is_main_object, localScope, object_rts) {} + +void processLateRelocation(Relocation rel) { + // resolve the symbol if there is a symbol + frg::optional<ObjectSymbol> p; + if(rel.symbol_index()) { + auto symbol = (elf_sym *)(rel.object()->baseAddress + rel.object()->symbolTableOffset + + rel.symbol_index() * sizeof(elf_sym)); + ObjectSymbol r(rel.object(), symbol); + + p = Scope::resolveGlobalOrLocal(*globalScope, rel.object()->localScope, + r.getString(), rel.object()->objectRts, Scope::resolveCopy); + } + + switch(rel.type()) { + case R_COPY: + __ensure(p); + memcpy(rel.destination(), (void *)p->virtualAddress(), p->symbol()->st_size); + break; + +// TODO: R_IRELATIVE also exists on other architectures but will likely need a different implementation. +#if defined(__x86_64__) || defined(__i386__) + case R_IRELATIVE: { + uintptr_t addr = rel.object()->baseAddress + rel.addend_rel(); + auto* fn = reinterpret_cast<uintptr_t (*)()>(addr); + rel.relocate(fn()); + } break; +#elif defined(__aarch64__) + case R_IRELATIVE: { + uintptr_t addr = rel.object()->baseAddress + rel.addend_rel(); + auto* fn = reinterpret_cast<uintptr_t (*)(uint64_t)>(addr); + // TODO: the function should get passed AT_HWCAP value. + rel.relocate(fn(0)); + } break; +#endif + + default: + break; + } +} + +void processLateRelocations(SharedObject *object) { + frg::optional<uintptr_t> rel_offset; + frg::optional<size_t> rel_length; + + frg::optional<uintptr_t> rela_offset; + frg::optional<size_t> rela_length; + + for(size_t i = 0; object->dynamic[i].d_tag != DT_NULL; i++) { + elf_dyn *dynamic = &object->dynamic[i]; + + switch(dynamic->d_tag) { + case DT_REL: + rel_offset = dynamic->d_un.d_ptr; + break; + case DT_RELSZ: + rel_length = dynamic->d_un.d_val; + break; + case DT_RELENT: + __ensure(dynamic->d_un.d_val == sizeof(elf_rel)); + break; + case DT_RELA: + rela_offset = dynamic->d_un.d_ptr; + break; + case DT_RELASZ: + rela_length = dynamic->d_un.d_val; + break; + case DT_RELAENT: + __ensure(dynamic->d_un.d_val == sizeof(elf_rela)); + break; + } + } + + if(rela_offset && rela_length) { + for(size_t offset = 0; offset < *rela_length; offset += sizeof(elf_rela)) { + auto reloc = (elf_rela *)(object->baseAddress + *rela_offset + offset); + auto r = Relocation(object, reloc); + processLateRelocation(r); + } + } else if(rel_offset && rel_length) { + for(size_t offset = 0; offset < *rel_length; offset += sizeof(elf_rel)) { + auto reloc = (elf_rel *)(object->baseAddress + *rel_offset + offset); + auto r = Relocation(object, reloc); + processLateRelocation(r); + } + }else{ + __ensure(!rela_offset && !rela_length); + __ensure(!rel_offset && !rel_length); + } +} + +void doInitialize(SharedObject *object) { + __ensure(object->wasLinked); + __ensure(!object->wasInitialized); + + // if the object has dependencies we initialize them first + for(size_t i = 0; i < object->dependencies.size(); i++) + __ensure(object->dependencies[i]->wasInitialized); + + if(verbose) + mlibc::infoLogger() << "rtdl: Initialize " << object->name << frg::endlog; + + if(verbose) + mlibc::infoLogger() << "rtdl: Running DT_INIT function" << frg::endlog; + if(object->initPtr != nullptr) + object->initPtr(); + + if(verbose) + mlibc::infoLogger() << "rtdl: Running DT_INIT_ARRAY functions" << frg::endlog; + __ensure((object->initArraySize % sizeof(InitFuncPtr)) == 0); + for(size_t i = 0; i < object->initArraySize / sizeof(InitFuncPtr); i++) + object->initArray[i](); + + if(verbose) + mlibc::infoLogger() << "rtdl: Object initialization complete" << frg::endlog; + object->wasInitialized = true; +} + +// -------------------------------------------------------- +// RuntimeTlsMap +// -------------------------------------------------------- + +RuntimeTlsMap::RuntimeTlsMap() +: initialPtr{0}, initialLimit{0}, indices{getAllocator()} { } + +void initTlsObjects(Tcb *tcb, const frg::vector<SharedObject *, MemoryAllocator> &objects, bool checkInitialized) { + // Initialize TLS segments that follow the static model. + for(auto object : objects) { + if(object->tlsModel == TlsModel::initial) { + if(checkInitialized && object->tlsInitialized) + continue; + + char *tcb_ptr = reinterpret_cast<char *>(tcb); + auto tls_ptr = tcb_ptr + object->tlsOffset; + memset(tls_ptr, 0, object->tlsSegmentSize); + memcpy(tls_ptr, object->tlsImagePtr, object->tlsImageSize); + + if (verbose) { + mlibc::infoLogger() << "rtdl: wrote tls image at " << (void *)tls_ptr + << ", size = 0x" << frg::hex_fmt{object->tlsSegmentSize} << frg::endlog; + } + + if (checkInitialized) + object->tlsInitialized = true; + } + } +} + +Tcb *allocateTcb() { + size_t tlsInitialSize = runtimeTlsMap->initialLimit; + + // To make sure that both the TCB and TLS data are sufficiently aligned, allocate + // slightly more than necessary and adjust alignment afterwards. + size_t alignOverhead = frg::max(alignof(Tcb), tlsMaxAlignment); + size_t allocSize = tlsInitialSize + sizeof(Tcb) + alignOverhead; + auto allocation = reinterpret_cast<uintptr_t>(getAllocator().allocate(allocSize)); + memset(reinterpret_cast<void *>(allocation), 0, allocSize); + + uintptr_t tlsAddress, tcbAddress; + if constexpr (tlsAboveTp) { + // Here we must satisfy two requirements of the TCB and the TLS data: + // 1. One should follow the other immediately in memory. We do this so that + // we can simply add or subtract sizeof(Tcb) to obtain the address of the other. + // 2. Both should be sufficiently aligned. + // To do this, we will fix whichever address has stricter alignment requirements, and + // derive the other from it. + if (tlsMaxAlignment > alignof(Tcb)) { + tlsAddress = alignUp(allocation + sizeof(Tcb), tlsMaxAlignment); + tcbAddress = tlsAddress - sizeof(Tcb); + } else { + tcbAddress = alignUp(allocation, alignof(Tcb)); + tlsAddress = tcbAddress + sizeof(Tcb); + } + __ensure((tlsAddress & (tlsMaxAlignment - 1)) == 0); + __ensure(tlsAddress == tcbAddress + sizeof(Tcb)); + } else { + // The TCB should be aligned such that the preceding blocks are aligned too. + tcbAddress = alignUp(allocation + tlsInitialSize, alignOverhead); + tlsAddress = tcbAddress - tlsInitialSize; + } + __ensure((tcbAddress & (alignof(Tcb) - 1)) == 0); + + if (verbose) { + mlibc::infoLogger() << "rtdl: tcb allocated at " << (void *)tcbAddress + << ", size = 0x" << frg::hex_fmt{sizeof(Tcb)} << frg::endlog; + mlibc::infoLogger() << "rtdl: tls allocated at " << (void *)tlsAddress + << ", size = 0x" << frg::hex_fmt{tlsInitialSize} << frg::endlog; + } + + Tcb *tcb_ptr = new ((char *)tcbAddress) Tcb; + tcb_ptr->selfPointer = tcb_ptr; + + tcb_ptr->stackCanary = __stack_chk_guard; + tcb_ptr->cancelBits = tcbCancelEnableBit; + tcb_ptr->didExit = 0; + tcb_ptr->isJoinable = 1; + memset(&tcb_ptr->returnValue, 0, sizeof(tcb_ptr->returnValue)); + tcb_ptr->localKeys = frg::construct<frg::array<Tcb::LocalKey, PTHREAD_KEYS_MAX>>(getAllocator()); + tcb_ptr->dtvSize = runtimeTlsMap->indices.size(); + tcb_ptr->dtvPointers = frg::construct_n<void *>(getAllocator(), runtimeTlsMap->indices.size()); + memset(tcb_ptr->dtvPointers, 0, sizeof(void *) * runtimeTlsMap->indices.size()); + for(size_t i = 0; i < runtimeTlsMap->indices.size(); ++i) { + auto object = runtimeTlsMap->indices[i]; + if(object->tlsModel != TlsModel::initial) + continue; + tcb_ptr->dtvPointers[i] = reinterpret_cast<char *>(tcb_ptr) + object->tlsOffset; + } + + return tcb_ptr; +} + +void *accessDtv(SharedObject *object) { + Tcb *tcb_ptr = mlibc::get_current_tcb(); + + // We might need to reallocate the DTV. + if(object->tlsIndex >= tcb_ptr->dtvSize) { + // TODO: need to protect runtimeTlsMap against concurrent access. + auto ndtv = frg::construct_n<void *>(getAllocator(), runtimeTlsMap->indices.size()); + memset(ndtv, 0, sizeof(void *) * runtimeTlsMap->indices.size()); + memcpy(ndtv, tcb_ptr->dtvPointers, sizeof(void *) * tcb_ptr->dtvSize); + frg::destruct_n(getAllocator(), tcb_ptr->dtvPointers, tcb_ptr->dtvSize); + tcb_ptr->dtvSize = runtimeTlsMap->indices.size(); + tcb_ptr->dtvPointers = ndtv; + } + + // We might need to fill in a new DTV entry. + if(!tcb_ptr->dtvPointers[object->tlsIndex]) { + __ensure(object->tlsModel == TlsModel::dynamic); + + auto buffer = getAllocator().allocate(object->tlsSegmentSize); + __ensure(!(reinterpret_cast<uintptr_t>(buffer) & (object->tlsAlignment - 1))); + memset(buffer, 0, object->tlsSegmentSize); + memcpy(buffer, object->tlsImagePtr, object->tlsImageSize); + tcb_ptr->dtvPointers[object->tlsIndex] = buffer; + + if (verbose) { + mlibc::infoLogger() << "rtdl: accessDtv wrote tls image at " << buffer + << ", size = 0x" << frg::hex_fmt{object->tlsSegmentSize} << frg::endlog; + } + } + + return (void *)((char *)tcb_ptr->dtvPointers[object->tlsIndex] + TLS_DTV_OFFSET); +} + +void *tryAccessDtv(SharedObject *object) { + Tcb *tcb_ptr = mlibc::get_current_tcb(); + + if (object->tlsIndex >= tcb_ptr->dtvSize) + return nullptr; + if (!tcb_ptr->dtvPointers[object->tlsIndex]) + return nullptr; + + return (void *)((char *)tcb_ptr->dtvPointers[object->tlsIndex] + TLS_DTV_OFFSET); +} + +// -------------------------------------------------------- +// ObjectSymbol +// -------------------------------------------------------- + +ObjectSymbol::ObjectSymbol(SharedObject *object, const elf_sym *symbol) +: _object(object), _symbol(symbol) { } + +const char *ObjectSymbol::getString() { + __ensure(_symbol->st_name != 0); + return (const char *)(_object->baseAddress + + _object->stringTableOffset + _symbol->st_name); +} + +uintptr_t ObjectSymbol::virtualAddress() { + auto bind = ELF_ST_BIND(_symbol->st_info); + __ensure(bind == STB_GLOBAL || bind == STB_WEAK || bind == STB_GNU_UNIQUE); + __ensure(_symbol->st_shndx != SHN_UNDEF); + return _object->baseAddress + _symbol->st_value; +} + +// -------------------------------------------------------- +// Scope +// -------------------------------------------------------- + +uint32_t elf64Hash(frg::string_view string) { + uint32_t h = 0, g; + + for(size_t i = 0; i < string.size(); ++i) { + h = (h << 4) + (uint32_t)string[i]; + g = h & 0xF0000000; + if(g) + h ^= g >> 24; + h &= 0x0FFFFFFF; + } + + return h; +} + +uint32_t gnuHash(frg::string_view string) { + uint32_t h = 5381; + for(size_t i = 0; i < string.size(); ++i) + h = (h << 5) + h + string[i]; + return h; +} + +// TODO: move this to some namespace or class? +frg::optional<ObjectSymbol> resolveInObject(SharedObject *object, frg::string_view string) { + // Checks if the symbol can be used to satisfy the dependency. + auto eligible = [&] (ObjectSymbol cand) { + if(cand.symbol()->st_shndx == SHN_UNDEF) + return false; + + auto bind = ELF_ST_BIND(cand.symbol()->st_info); + if(bind != STB_GLOBAL && bind != STB_WEAK && bind != STB_GNU_UNIQUE) + return false; + + return true; + }; + + if (object->hashStyle == HashStyle::systemV) { + auto hash_table = (Elf64_Word *)(object->baseAddress + object->hashTableOffset); + Elf64_Word num_buckets = hash_table[0]; + auto bucket = elf64Hash(string) % num_buckets; + + auto index = hash_table[2 + bucket]; + while(index != 0) { + ObjectSymbol cand{object, (elf_sym *)(object->baseAddress + + object->symbolTableOffset + index * sizeof(elf_sym))}; + if(eligible(cand) && frg::string_view{cand.getString()} == string) + return cand; + + index = hash_table[2 + num_buckets + index]; + } + + return frg::optional<ObjectSymbol>{}; + }else{ + __ensure(object->hashStyle == HashStyle::gnu); + + struct GnuTable { + uint32_t nBuckets; + uint32_t symbolOffset; + uint32_t bloomSize; + uint32_t bloomShift; + }; + + auto hash_table = reinterpret_cast<const GnuTable *>(object->baseAddress + + object->hashTableOffset); + auto buckets = reinterpret_cast<const uint32_t *>(object->baseAddress + + object->hashTableOffset + sizeof(GnuTable) + + hash_table->bloomSize * sizeof(elf_addr)); + auto chains = reinterpret_cast<const uint32_t *>(object->baseAddress + + object->hashTableOffset + sizeof(GnuTable) + + hash_table->bloomSize * sizeof(elf_addr) + + hash_table->nBuckets * sizeof(uint32_t)); + + // TODO: Use the bloom filter. + + // The symbols of a given bucket are contiguous in the table. + auto hash = gnuHash(string); + auto index = buckets[hash % hash_table->nBuckets]; + + if(!index) + return frg::optional<ObjectSymbol>{}; + + while(true) { + // chains[] contains an array of hashes, parallel to the symbol table. + auto chash = chains[index - hash_table->symbolOffset]; + if ((chash & ~1) == (hash & ~1)) { + ObjectSymbol cand{object, (elf_sym *)(object->baseAddress + + object->symbolTableOffset + index * sizeof(elf_sym))}; + if(eligible(cand) && frg::string_view{cand.getString()} == string) + return cand; + } + + // If we hit the end of the chain, the symbol is not present. + if(chash & 1) + return frg::optional<ObjectSymbol>{}; + index++; + } + } +} + +frg::optional<ObjectSymbol> Scope::_resolveNext(frg::string_view string, + SharedObject *target) { + // Skip objects until we find the target, and only look for symbols after that. + size_t i; + for (i = 0; i < _objects.size(); i++) { + if (_objects[i] == target) + break; + } + + if (i == _objects.size()) { + mlibc::infoLogger() << "rtdl: object passed to Scope::resolveAfter was not found" << frg::endlog; + return frg::optional<ObjectSymbol>(); + } + + for (i = i + 1; i < _objects.size(); i++) { + if(_objects[i]->isMainObject) + continue; + + frg::optional<ObjectSymbol> p = resolveInObject(_objects[i], string); + if(p) + return p; + } + + return frg::optional<ObjectSymbol>(); +} + +Scope::Scope(bool isGlobal) +: isGlobal{isGlobal}, _objects(getAllocator()) { } + +void Scope::appendObject(SharedObject *object) { + // Don't insert duplicates. + for (auto obj : _objects) { + if (obj == object) + return; + } + + _objects.push(object); +} + +frg::optional<ObjectSymbol> Scope::resolveGlobalOrLocal(Scope &globalScope, + Scope *localScope, frg::string_view string, uint64_t skipRts, ResolveFlags flags) { + auto sym = globalScope.resolveSymbol(string, skipRts, flags | skipGlobalAfterRts); + if(!sym && localScope) + sym = localScope->resolveSymbol(string, skipRts, flags | skipGlobalAfterRts); + return sym; +} + +frg::optional<ObjectSymbol> Scope::resolveGlobalOrLocalNext(Scope &globalScope, + Scope *localScope, frg::string_view string, SharedObject *origin) { + auto sym = globalScope._resolveNext(string, origin); + if(!sym && localScope) { + sym = localScope->_resolveNext(string, origin); + } + return sym; +} + +// TODO: let this return uintptr_t +frg::optional<ObjectSymbol> Scope::resolveSymbol(frg::string_view string, + uint64_t skipRts, ResolveFlags flags) { + for (auto object : _objects) { + if((flags & resolveCopy) && object->isMainObject) + continue; + if((flags & skipGlobalAfterRts) && object->globalRts > skipRts) { + // globalRts should be monotone increasing for objects in the global scope, + // so as an optimization we can break early here. + // TODO: If we implement DT_SYMBOLIC, this assumption fails. + if(isGlobal) + break; + else + continue; + } + + frg::optional<ObjectSymbol> p = resolveInObject(object, string); + if(p) + return p; + } + + return frg::optional<ObjectSymbol>(); +} + +// -------------------------------------------------------- +// Loader +// -------------------------------------------------------- + +Loader::Loader(Scope *scope, SharedObject *mainExecutable, bool is_initial_link, uint64_t rts) +: _mainExecutable{mainExecutable}, _loadScope{scope}, _isInitialLink{is_initial_link}, + _linkRts{rts}, _linkBfs{getAllocator()}, _initQueue{getAllocator()} { } + +void Loader::_buildLinkBfs(SharedObject *root) { + __ensure(_linkBfs.size() == 0); + + struct Token {}; + using Set = frg::hash_map<SharedObject *, Token, + frg::hash<SharedObject *>, MemoryAllocator>; + Set set{frg::hash<SharedObject *>{}, getAllocator()}; + _linkBfs.push(root); + + // Loop over indices (not iterators) here: We are adding elements in the loop! + for(size_t i = 0; i < _linkBfs.size(); i++) { + auto current = _linkBfs[i]; + + // At this point the object is loaded and we can fill in its debug struct, + // the linked list fields will be filled later. + current->linkMap.base = current->baseAddress; + current->linkMap.name = current->path.data(); + current->linkMap.dynv = current->dynamic; + + __ensure((current->tlsAlignment & (current->tlsAlignment - 1)) == 0); + + if (_isInitialLink && current->tlsAlignment > tlsMaxAlignment) { + tlsMaxAlignment = current->tlsAlignment; + } + + for (auto dep : current->dependencies) { + if (!set.get(dep)) { + set.insert(dep, Token{}); + _linkBfs.push(dep); + } + } + } +} + +void Loader::linkObjects(SharedObject *root) { + _buildLinkBfs(root); + _buildTlsMaps(); + + // Promote objects to the desired scope. + for(auto object : _linkBfs) { + if (object->globalRts == 0 && _loadScope->isGlobal) + object->globalRts = _linkRts; + + _loadScope->appendObject(object); + } + + // Process regular relocations. + for(auto object : _linkBfs) { + // Some objects have already been linked before. + if(object->objectRts < _linkRts) + continue; + + if(object->dynamic == nullptr) + continue; + + if(verbose) + mlibc::infoLogger() << "rtdl: Linking " << object->name << frg::endlog; + + __ensure(!object->wasLinked); + + // TODO: Support this. + if(object->symbolicResolution) + mlibc::infoLogger() << "\e[31mrtdl: DT_SYMBOLIC is not implemented correctly!\e[39m" + << frg::endlog; + + _processStaticRelocations(object); + _processLazyRelocations(object); + } + + // Process copy relocations. + for(auto object : _linkBfs) { + if(!object->isMainObject) + continue; + + // Some objects have already been linked before. + if(object->objectRts < _linkRts) + continue; + + if(object->dynamic == nullptr) + continue; + + processLateRelocations(object); + } + + for(auto object : _linkBfs) { + object->wasLinked = true; + + if(object->inLinkMap) + continue; + + auto linkMap = reinterpret_cast<LinkMap*>(globalDebugInterface.head); + + object->linkMap.prev = linkMap; + object->linkMap.next = linkMap->next; + if(linkMap->next) + linkMap->next->prev = &(object->linkMap); + linkMap->next = &(object->linkMap); + object->inLinkMap = true; + } +} + +void Loader::_buildTlsMaps() { + if(_isInitialLink) { + __ensure(runtimeTlsMap->initialPtr == 0); + __ensure(runtimeTlsMap->initialLimit == 0); + + __ensure(!_linkBfs.empty()); + __ensure(_linkBfs.front()->isMainObject); + + for(auto object : _linkBfs) { + __ensure(object->tlsModel == TlsModel::null); + + if(object->tlsSegmentSize == 0) + continue; + + // Allocate an index for the object. + object->tlsIndex = runtimeTlsMap->indices.size(); + runtimeTlsMap->indices.push_back(object); + + object->tlsModel = TlsModel::initial; + + if constexpr (tlsAboveTp) { + // As per the comment in allocateTcb(), we may simply add sizeof(Tcb) to + // reach the TLS data. + object->tlsOffset = runtimeTlsMap->initialPtr + sizeof(Tcb); + runtimeTlsMap->initialPtr += object->tlsSegmentSize; + + size_t misalign = runtimeTlsMap->initialPtr & (object->tlsAlignment - 1); + if(misalign) + runtimeTlsMap->initialPtr += object->tlsAlignment - misalign; + } else { + runtimeTlsMap->initialPtr += object->tlsSegmentSize; + + size_t misalign = runtimeTlsMap->initialPtr & (object->tlsAlignment - 1); + if(misalign) + runtimeTlsMap->initialPtr += object->tlsAlignment - misalign; + + object->tlsOffset = -runtimeTlsMap->initialPtr; + } + + if(verbose) + mlibc::infoLogger() << "rtdl: TLS of " << object->name + << " mapped to 0x" << frg::hex_fmt{object->tlsOffset} + << ", size: " << object->tlsSegmentSize + << ", alignment: " << object->tlsAlignment << frg::endlog; + } + + // Reserve some additional space for future libraries. + runtimeTlsMap->initialLimit = runtimeTlsMap->initialPtr + 64; + }else{ + for(auto object : _linkBfs) { + if(object->tlsModel != TlsModel::null) + continue; + if(object->tlsSegmentSize == 0) + continue; + + // Allocate an index for the object. + object->tlsIndex = runtimeTlsMap->indices.size(); + runtimeTlsMap->indices.push_back(object); + + // There are some libraries (e.g. Mesa) that require static TLS even though + // they expect to be dynamically loaded. + if(object->haveStaticTls) { + auto ptr = runtimeTlsMap->initialPtr + object->tlsSegmentSize; + size_t misalign = ptr & (object->tlsAlignment - 1); + if(misalign) + ptr += object->tlsAlignment - misalign; + + if(ptr > runtimeTlsMap->initialLimit) + mlibc::panicLogger() << "rtdl: Static TLS space exhausted while while" + " allocating TLS for " << object->name << frg::endlog; + + object->tlsModel = TlsModel::initial; + + if constexpr (tlsAboveTp) { + size_t tcbSize = ((sizeof(Tcb) + tlsMaxAlignment - 1) & ~(tlsMaxAlignment - 1)); + + object->tlsOffset = runtimeTlsMap->initialPtr + tcbSize; + runtimeTlsMap->initialPtr = ptr; + } else { + runtimeTlsMap->initialPtr = ptr; + object->tlsOffset = -runtimeTlsMap->initialPtr; + } + + if(verbose) + mlibc::infoLogger() << "rtdl: TLS of " << object->name + << " mapped to 0x" << frg::hex_fmt{object->tlsOffset} + << ", size: " << object->tlsSegmentSize + << ", alignment: " << object->tlsAlignment << frg::endlog; + }else{ + object->tlsModel = TlsModel::dynamic; + } + } + } +} + +void Loader::initObjects() { + initTlsObjects(mlibc::get_current_tcb(), _linkBfs, true); + + if (_mainExecutable && _mainExecutable->preInitArray) { + if (verbose) + mlibc::infoLogger() << "rtdl: Running DT_PREINIT_ARRAY functions" << frg::endlog; + + __ensure(_mainExecutable->isMainObject); + __ensure(!_mainExecutable->wasInitialized); + __ensure((_mainExecutable->preInitArraySize % sizeof(InitFuncPtr)) == 0); + for(size_t i = 0; i < _mainExecutable->preInitArraySize / sizeof(InitFuncPtr); i++) + _mainExecutable->preInitArray[i](); + } + + // Convert the breadth-first representation to a depth-first post-order representation, + // so that every object is initialized *after* its dependencies. + for(auto object : _linkBfs) { + if(!object->scheduledForInit) + _scheduleInit(object); + } + + for(auto object : _initQueue) { + if(!object->wasInitialized) + doInitialize(object); + } +} + +// TODO: Use an explicit vector to reduce stack usage to O(1)? +void Loader::_scheduleInit(SharedObject *object) { + // Here we detect cyclic dependencies. + __ensure(!object->onInitStack); + object->onInitStack = true; + + __ensure(!object->scheduledForInit); + object->scheduledForInit = true; + + for(size_t i = 0; i < object->dependencies.size(); i++) { + if(!object->dependencies[i]->scheduledForInit) + _scheduleInit(object->dependencies[i]); + } + + _initQueue.push(object); + object->onInitStack = false; +} + +void Loader::_processRelocations(Relocation &rel) { + // copy and irelative relocations have to be performed after all other relocations + if(rel.type() == R_COPY || rel.type() == R_IRELATIVE) + return; + + // resolve the symbol if there is a symbol + frg::optional<ObjectSymbol> p; + if(rel.symbol_index()) { + auto symbol = (elf_sym *)(rel.object()->baseAddress + rel.object()->symbolTableOffset + + rel.symbol_index() * sizeof(elf_sym)); + ObjectSymbol r(rel.object(), symbol); + + p = Scope::resolveGlobalOrLocal(*globalScope, rel.object()->localScope, + r.getString(), rel.object()->objectRts, 0); + if(!p) { + if(ELF_ST_BIND(symbol->st_info) != STB_WEAK) + mlibc::panicLogger() << "Unresolved load-time symbol " + << r.getString() << " in object " << rel.object()->name << frg::endlog; + + if(verbose) + mlibc::infoLogger() << "rtdl: Unresolved weak load-time symbol " + << r.getString() << " in object " << rel.object()->name << frg::endlog; + } + } + + switch(rel.type()) { + case R_NONE: + break; + + case R_JUMP_SLOT: { + __ensure(!rel.addend_norel()); + uintptr_t symbol_addr = p ? p->virtualAddress() : 0; + rel.relocate(symbol_addr); + } break; + +#if !defined(__riscv) + // on some architectures, R_GLOB_DAT can be defined to other relocations + case R_GLOB_DAT: { + __ensure(rel.symbol_index()); + uintptr_t symbol_addr = p ? p->virtualAddress() : 0; + rel.relocate(symbol_addr + rel.addend_norel()); + } break; +#endif + + case R_ABSOLUTE: { + __ensure(rel.symbol_index()); + uintptr_t symbol_addr = p ? p->virtualAddress() : 0; + rel.relocate(symbol_addr + rel.addend_rel()); + } break; + + case R_RELATIVE: { + __ensure(!rel.symbol_index()); + rel.relocate(rel.object()->baseAddress + rel.addend_rel()); + } break; + + // DTPMOD and DTPREL are dynamic TLS relocations (for __tls_get_addr()). + // TPOFF is a relocation to the initial TLS model. + case R_TLS_DTPMOD: { + // sets the first `sizeof(uintptr_t)` bytes of `struct __abi_tls_entry` + // this means that we can just use the `SharedObject *` to resolve whatever we need + __ensure(!rel.addend_rel()); + if(rel.symbol_index()) { + __ensure(p); + rel.relocate(elf_addr(p->object())); + }else{ + if(stillSlightlyVerbose) + mlibc::infoLogger() << "rtdl: Warning: TLS_DTPMOD64 with no symbol in object " + << rel.object()->name << frg::endlog; + rel.relocate(elf_addr(rel.object())); + } + } break; + case R_TLS_DTPREL: { + __ensure(rel.symbol_index()); + __ensure(p); + rel.relocate(p->symbol()->st_value + rel.addend_rel() - TLS_DTV_OFFSET); + } break; + case R_TLS_TPREL: { + uintptr_t off = rel.addend_rel(); + uintptr_t tls_offset = 0; + + if(rel.symbol_index()) { + __ensure(p); + if(p->object()->tlsModel != TlsModel::initial) + mlibc::panicLogger() << "rtdl: In object " << rel.object()->name + << ": Static TLS relocation to symbol " << p->getString() + << " in dynamically loaded object " + << p->object()->name << frg::endlog; + off += p->symbol()->st_value; + tls_offset = p->object()->tlsOffset; + }else{ + if(stillSlightlyVerbose) + mlibc::infoLogger() << "rtdl: Warning: TPOFF64 with no symbol" + " in object " << rel.object()->name << frg::endlog; + if(rel.object()->tlsModel != TlsModel::initial) + mlibc::panicLogger() << "rtdl: In object " << rel.object()->name + << ": Static TLS relocation to dynamically loaded object " + << rel.object()->name << frg::endlog; + tls_offset = rel.object()->tlsOffset; + } + + if constexpr (tlsAboveTp) { + off += tls_offset - sizeof(Tcb); + } else { + off += tls_offset; + } + + rel.relocate(off); + } break; + default: + mlibc::panicLogger() << "Unexpected relocation type " + << (void *) rel.type() << frg::endlog; + } +} + +void Loader::_processStaticRelocations(SharedObject *object) { + frg::optional<uintptr_t> rela_offset; + frg::optional<size_t> rela_length; + + frg::optional<uintptr_t> rel_offset; + frg::optional<size_t> rel_length; + + frg::optional<uintptr_t> relr_offset; + frg::optional<size_t> relr_length; + + for(size_t i = 0; object->dynamic[i].d_tag != DT_NULL; i++) { + elf_dyn *dynamic = &object->dynamic[i]; + + switch(dynamic->d_tag) { + case DT_RELA: + rela_offset = dynamic->d_un.d_ptr; + break; + case DT_RELASZ: + rela_length = dynamic->d_un.d_val; + break; + case DT_RELAENT: + __ensure(dynamic->d_un.d_val == sizeof(elf_rela)); + break; + case DT_REL: + rel_offset = dynamic->d_un.d_ptr; + break; + case DT_RELSZ: + rel_length = dynamic->d_un.d_val; + break; + case DT_RELENT: + __ensure(dynamic->d_un.d_val == sizeof(elf_rel)); + break; + case DT_RELR: + relr_offset = dynamic->d_un.d_ptr; + break; + case DT_RELRSZ: + relr_length = dynamic->d_un.d_val; + break; + case DT_RELRENT: + __ensure(dynamic->d_un.d_val == sizeof(elf_relr)); + break; + } + } + + if(rela_offset && rela_length) { + __ensure(!rel_offset && !rel_length); + + for(size_t offset = 0; offset < *rela_length; offset += sizeof(elf_rela)) { + auto reloc = (elf_rela *)(object->baseAddress + *rela_offset + offset); + auto r = Relocation(object, reloc); + + _processRelocations(r); + } + }else if(rel_offset && rel_length) { + __ensure(!rela_offset && !rela_length); + + for(size_t offset = 0; offset < *rel_length; offset += sizeof(elf_rel)) { + auto reloc = (elf_rel *)(object->baseAddress + *rel_offset + offset); + auto r = Relocation(object, reloc); + + _processRelocations(r); + } + } + + if(relr_offset && relr_length) { + elf_addr *addr = nullptr; + + for(size_t offset = 0; offset < *relr_length; offset += sizeof(elf_relr)) { + auto entry = *(elf_relr *)(object->baseAddress + *relr_offset + offset); + + // Even entry indicates the beginning address. + if(!(entry & 1)) { + addr = (elf_addr *)(object->baseAddress + entry); + __ensure(addr); + *addr++ += object->baseAddress; + }else { + // Odd entry indicates entry is a bitmap of the subsequent locations to be relocated. + for(int i = 0; entry; ++i) { + if(entry & 1) { + addr[i] += object->baseAddress; + } + entry >>= 1; + } + + // Each entry describes at max 63 (on 64bit) or 31 (on 32bit) subsequent locations. + addr += CHAR_BIT * sizeof(elf_relr) - 1; + } + } + } +} + +// TODO: TLSDESC relocations aren't aarch64 specific +#ifdef __aarch64__ +extern "C" void *__mlibcTlsdescStatic(void *); +extern "C" void *__mlibcTlsdescDynamic(void *); +#endif + +void Loader::_processLazyRelocations(SharedObject *object) { + if(object->globalOffsetTable == nullptr) { + __ensure(object->lazyRelocTableOffset == 0); + return; + } + object->globalOffsetTable[1] = object; + object->globalOffsetTable[2] = (void *)&pltRelocateStub; + + if(!object->lazyTableSize) + return; + + // adjust the addresses of JUMP_SLOT relocations + __ensure(object->lazyExplicitAddend.has_value()); + size_t rel_size = (*object->lazyExplicitAddend) ? sizeof(elf_rela) : sizeof(elf_rel); + + for(size_t offset = 0; offset < object->lazyTableSize; offset += rel_size) { + elf_info type; + elf_info symbol_index; + + uintptr_t rel_addr; + uintptr_t addend [[maybe_unused]] = 0; + + if(*object->lazyExplicitAddend) { + auto reloc = (elf_rela *)(object->baseAddress + object->lazyRelocTableOffset + offset); + type = ELF_R_TYPE(reloc->r_info); + symbol_index = ELF_R_SYM(reloc->r_info); + rel_addr = object->baseAddress + reloc->r_offset; + addend = reloc->r_addend; + } else { + auto reloc = (elf_rel *)(object->baseAddress + object->lazyRelocTableOffset + offset); + type = ELF_R_TYPE(reloc->r_info); + symbol_index = ELF_R_SYM(reloc->r_info); + rel_addr = object->baseAddress + reloc->r_offset; + } + + switch (type) { + case R_JUMP_SLOT: + if(eagerBinding) { + auto symbol = (elf_sym *)(object->baseAddress + object->symbolTableOffset + + symbol_index * sizeof(elf_sym)); + ObjectSymbol r(object, symbol); + auto p = Scope::resolveGlobalOrLocal(*globalScope, object->localScope, r.getString(), object->objectRts, 0); + + if(!p) { + if(ELF_ST_BIND(symbol->st_info) != STB_WEAK) + mlibc::panicLogger() << "rtdl: Unresolved JUMP_SLOT symbol " + << r.getString() << " in object " << object->name << frg::endlog; + + if(verbose) + mlibc::infoLogger() << "rtdl: Unresolved weak JUMP_SLOT symbol " + << r.getString() << " in object " << object->name << frg::endlog; + *((uintptr_t *)rel_addr) = 0; + }else{ + *((uintptr_t *)rel_addr) = p->virtualAddress(); + } + }else{ + *((uintptr_t *)rel_addr) += object->baseAddress; + } + break; +#if defined(__x86_64__) + case R_X86_64_IRELATIVE: { + auto ptr = object->baseAddress + addend; + auto target = reinterpret_cast<uintptr_t (*)(void)>(ptr)(); + *((uintptr_t *)rel_addr) = target; + break; + } +#endif +// TODO: TLSDESC relocations aren't aarch64 specific +#if defined(__aarch64__) + case R_AARCH64_TLSDESC: { + size_t symValue = 0; + SharedObject *target = nullptr; + + if (symbol_index) { + auto symbol = (elf_sym *)(object->baseAddress + object->symbolTableOffset + + symbol_index * sizeof(elf_sym)); + ObjectSymbol r(object, symbol); + auto p = Scope::resolveGlobalOrLocal(*globalScope, object->localScope, r.getString(), object->objectRts, 0); + + if (!p) { + __ensure(ELF_ST_BIND(symbol->st_info) != STB_WEAK); + mlibc::panicLogger() << "rtdl: Unresolved TLSDESC for symbol " + << r.getString() << " in object " << object->name << frg::endlog; + } else { + target = p->object(); + if (p->symbol()) + symValue = p->symbol()->st_value; + } + } else { + target = object; + } + + __ensure(target); + + if (target->tlsModel == TlsModel::initial) { + ((uint64_t *)rel_addr)[0] = reinterpret_cast<uintptr_t>(&__mlibcTlsdescStatic); + // TODO: guard the subtraction of TCB size with `if constexpr (tlsAboveTp)` + // for the arch-generic case + __ensure(tlsAboveTp == true); + ((uint64_t *)rel_addr)[1] = symValue + target->tlsOffset + addend - sizeof(Tcb); + } else { + struct TlsdescData { + uintptr_t tlsIndex; + uintptr_t addend; + }; + + // Access DTV for object to force the entry to be allocated and initialized + accessDtv(target); + + __ensure(target->tlsIndex < mlibc::get_current_tcb()->dtvSize); + + // TODO: We should free this when the DSO gets destroyed + auto data = frg::construct<TlsdescData>(getAllocator()); + data->tlsIndex = target->tlsIndex; + data->addend = symValue + addend; + + ((uint64_t *)rel_addr)[0] = reinterpret_cast<uintptr_t>(&__mlibcTlsdescDynamic); + ((uint64_t *)rel_addr)[1] = reinterpret_cast<uintptr_t>(data); + } + } break; +#endif + default: + mlibc::panicLogger() << "unimplemented lazy relocation type " << type << frg::endlog; + break; + } + } +} + diff --git a/lib/mlibc/options/rtdl/generic/linker.hpp b/lib/mlibc/options/rtdl/generic/linker.hpp new file mode 100644 index 0000000..ad84ca9 --- /dev/null +++ b/lib/mlibc/options/rtdl/generic/linker.hpp @@ -0,0 +1,402 @@ + +#include <frg/hash_map.hpp> +#include <frg/optional.hpp> +#include <frg/string.hpp> +#include <frg/vector.hpp> +#include <frg/expected.hpp> +#include <mlibc/allocator.hpp> +#include <mlibc/tcb.hpp> + +#include "elf.hpp" + +struct ObjectRepository; +struct Scope; +struct Loader; +struct SharedObject; + +extern uint64_t rtsCounter; + +enum class TlsModel { + null, + initial, + dynamic +}; + +enum class LinkerError { + success, + notFound, + fileTooShort, + notElf, + wrongElfType, + outOfMemory, + invalidProgramHeader +}; + +// -------------------------------------------------------- +// ObjectRepository +// -------------------------------------------------------- + +struct ObjectRepository { + ObjectRepository(); + + ObjectRepository(const ObjectRepository &) = delete; + + ObjectRepository &operator= (const ObjectRepository &) = delete; + + // This is primarily used to create a SharedObject for the RTDL itself. + SharedObject *injectObjectFromDts(frg::string_view name, + frg::string<MemoryAllocator> path, + uintptr_t base_address, elf_dyn *dynamic, uint64_t rts); + + // This is used to create a SharedObject for the executable that we want to link. + SharedObject *injectObjectFromPhdrs(frg::string_view name, + frg::string<MemoryAllocator> path, void *phdr_pointer, + size_t phdr_entry_size, size_t num_phdrs, void *entry_pointer, + uint64_t rts); + + SharedObject *injectStaticObject(frg::string_view name, + frg::string<MemoryAllocator> path, void *phdr_pointer, + size_t phdr_entry_size, size_t num_phdrs, void *entry_pointer, + uint64_t rts); + + frg::expected<LinkerError, SharedObject *> requestObjectWithName(frg::string_view name, + SharedObject *origin, Scope *localScope, bool createScope, uint64_t rts); + + frg::expected<LinkerError, SharedObject *> requestObjectAtPath(frg::string_view path, + Scope *localScope, bool createScope, uint64_t rts); + + SharedObject *findCaller(void *address); + + SharedObject *findLoadedObject(frg::string_view name); + + // Used by dl_iterate_phdr: stores objects in the order they are loaded. + frg::vector<SharedObject *, MemoryAllocator> loadedObjects; + +private: + void _fetchFromPhdrs(SharedObject *object, void *phdr_pointer, + size_t phdr_entry_size, size_t num_phdrs, void *entry_pointer); + + frg::expected<LinkerError, void> _fetchFromFile(SharedObject *object, int fd); + + void _parseDynamic(SharedObject *object); + + void _discoverDependencies(SharedObject *object, Scope *localScope, uint64_t rts); + + void _addLoadedObject(SharedObject *object); + + frg::hash_map<frg::string_view, SharedObject *, + frg::hash<frg::string_view>, MemoryAllocator> _nameMap; +}; + +// -------------------------------------------------------- +// SharedObject +// -------------------------------------------------------- + +enum class HashStyle { + none, + systemV, + gnu +}; + +using InitFuncPtr = void (*)(); + +// The ABI of this struct is fixed by GDB +struct DebugInterface { + int ver; + void *head; + void (*brk)(void); + int state; + void *base; +}; + +// The ABI of this struct is fixed by GDB +struct LinkMap { + uintptr_t base = 0; + const char *name = nullptr; + elf_dyn *dynv = nullptr; + LinkMap *next = nullptr, *prev = nullptr; +}; + +struct SharedObject { + // path is copied + SharedObject(const char *name, frg::string<MemoryAllocator> path, + bool is_main_object, Scope *localScope, uint64_t object_rts); + + SharedObject(const char *name, const char *path, bool is_main_object, + Scope *localScope, uint64_t object_rts); + + frg::string<MemoryAllocator> name; + frg::string<MemoryAllocator> path; + frg::string<MemoryAllocator> interpreterPath; + const char *soName; + bool isMainObject; + uint64_t objectRts; + + // link map for debugging + LinkMap linkMap; + bool inLinkMap; + + // base address this shared object was loaded to + uintptr_t baseAddress; + + Scope *localScope; + + // pointers to the dynamic table, GOT and entry point + elf_dyn *dynamic = nullptr; + void **globalOffsetTable; + void *entry; + + // object initialization information + InitFuncPtr initPtr = nullptr; + InitFuncPtr *initArray = nullptr; + InitFuncPtr *preInitArray = nullptr; + size_t initArraySize = 0; + size_t preInitArraySize = 0; + + + // TODO: read this from the PHDR + size_t tlsSegmentSize, tlsAlignment, tlsImageSize; + void *tlsImagePtr; + bool tlsInitialized; + + // symbol and string table of this shared object + HashStyle hashStyle = HashStyle::none; + uintptr_t hashTableOffset; + uintptr_t symbolTableOffset; + uintptr_t stringTableOffset; + + const char *runPath = nullptr; + + // save the lazy JUMP_SLOT relocation table + uintptr_t lazyRelocTableOffset; + size_t lazyTableSize; + frg::optional<bool> lazyExplicitAddend; + + bool symbolicResolution; + bool eagerBinding; + bool haveStaticTls; + + // vector of dependencies + frg::vector<SharedObject *, MemoryAllocator> dependencies; + + TlsModel tlsModel; + size_t tlsIndex; + size_t tlsOffset; + + uint64_t globalRts; + bool wasLinked; + + bool scheduledForInit; + bool onInitStack; + bool wasInitialized; + + // PHDR related stuff, we only set these for the main executable + void *phdrPointer = nullptr; + size_t phdrEntrySize = 0; + size_t phdrCount = 0; +}; + +struct Relocation { + Relocation(SharedObject *object, elf_rela *r) + : object_{object}, type_{Addend::Explicit} { + offset_ = r->r_offset; + info_ = r->r_info; + addend_ = r->r_addend; + } + + Relocation(SharedObject *object, elf_rel *r) + : object_{object}, type_{Addend::Implicit} { + offset_ = r->r_offset; + info_ = r->r_info; + } + + SharedObject *object() { + return object_; + } + + elf_info type() const { + return ELF_R_TYPE(info_); + } + + elf_info symbol_index() const { + return ELF_R_SYM(info_); + } + + elf_addr addend_rel() { + switch(type_) { + case Addend::Explicit: + return addend_; + case Addend::Implicit: { + auto ptr = reinterpret_cast<elf_addr *>(object_->baseAddress + offset_); + return *ptr; + } + } + __builtin_unreachable(); + } + + elf_addr addend_norel() { + switch(type_) { + case Addend::Explicit: + return addend_; + case Addend::Implicit: + return 0; + } + __builtin_unreachable(); + } + + void *destination() { + return reinterpret_cast<void *>(object_->baseAddress + offset_); + } + + void relocate(elf_addr addr) { + auto ptr = destination(); + memcpy(ptr, &addr, sizeof(addr)); + } + +private: + enum class Addend { + Implicit, + Explicit + }; + + SharedObject *object_; + Addend type_; + + elf_addr offset_; + elf_info info_; + elf_addend addend_ = 0; +}; + +void processCopyRelocations(SharedObject *object); + +// -------------------------------------------------------- +// RuntimeTlsMap +// -------------------------------------------------------- + +struct RuntimeTlsMap { + RuntimeTlsMap(); + + // Amount of initialLimit that has already been allocated. + size_t initialPtr; + + // Size of the inital TLS segment. + size_t initialLimit; + + // TLS indices. + frg::vector<SharedObject *, MemoryAllocator> indices; +}; + +extern frg::manual_box<RuntimeTlsMap> runtimeTlsMap; + +Tcb *allocateTcb(); +void initTlsObjects(Tcb *tcb, const frg::vector<SharedObject *, MemoryAllocator> &objects, bool checkInitialized); +void *accessDtv(SharedObject *object); +// Tries to access the DTV, if not allocated, or object doesn't have +// PT_TLS, return nullptr. +void *tryAccessDtv(SharedObject *object); + +// -------------------------------------------------------- +// ObjectSymbol +// -------------------------------------------------------- + +struct ObjectSymbol { + ObjectSymbol(SharedObject *object, const elf_sym *symbol); + + SharedObject *object() { + return _object; + } + + const elf_sym *symbol() { + return _symbol; + } + + const char *getString(); + + uintptr_t virtualAddress(); + +private: + SharedObject *_object; + const elf_sym *_symbol; +}; + +frg::optional<ObjectSymbol> resolveInObject(SharedObject *object, frg::string_view string); + +// -------------------------------------------------------- +// Scope +// -------------------------------------------------------- + +struct Scope { + using ResolveFlags = uint32_t; + static inline constexpr ResolveFlags resolveCopy = 1; + static inline constexpr ResolveFlags skipGlobalAfterRts = 1 << 1; + + static frg::optional<ObjectSymbol> resolveGlobalOrLocal(Scope &globalScope, + Scope *localScope, frg::string_view string, uint64_t skipRts, ResolveFlags flags); + static frg::optional<ObjectSymbol> resolveGlobalOrLocalNext(Scope &globalScope, + Scope *localScope, frg::string_view string, SharedObject *origin); + + Scope(bool isGlobal = false); + + void appendObject(SharedObject *object); + + frg::optional<ObjectSymbol> resolveSymbol(frg::string_view string, uint64_t skipRts, ResolveFlags flags); + + bool isGlobal; + +private: + frg::optional<ObjectSymbol> _resolveNext(frg::string_view string, SharedObject *target); +public: // TODO: Make this private again. (Was made public for __dlapi_reverse()). + frg::vector<SharedObject *, MemoryAllocator> _objects; +}; + +extern frg::manual_box<Scope> globalScope; + +// -------------------------------------------------------- +// Loader +// -------------------------------------------------------- + +class Loader { +public: + Loader(Scope *scope, SharedObject *mainExecutable, bool is_initial_link, uint64_t rts); + +public: + void linkObjects(SharedObject *root); + +private: + void _buildLinkBfs(SharedObject *root); + void _buildTlsMaps(); + + void _processStaticRelocations(SharedObject *object); + void _processLazyRelocations(SharedObject *object); + + void _processRelocations(Relocation &rel); + +public: + void initObjects(); + +private: + void _scheduleInit(SharedObject *object); + +private: + SharedObject *_mainExecutable; + Scope *_loadScope; + bool _isInitialLink; + uint64_t _linkRts; + + frg::vector<SharedObject *, MemoryAllocator> _linkBfs; + + frg::vector<SharedObject *, MemoryAllocator> _initQueue; +}; + +// -------------------------------------------------------- +// Namespace scope functions +// -------------------------------------------------------- + +extern "C" void pltRelocateStub() __attribute__((__visibility__("hidden"))); + +// -------------------------------------------------------- +// RTDL interface +// -------------------------------------------------------- + +void *rtdl_auxvector(); + diff --git a/lib/mlibc/options/rtdl/generic/main.cpp b/lib/mlibc/options/rtdl/generic/main.cpp new file mode 100644 index 0000000..3cff1e4 --- /dev/null +++ b/lib/mlibc/options/rtdl/generic/main.cpp @@ -0,0 +1,844 @@ + +#include <elf.h> +#include <link.h> + +#include <frg/manual_box.hpp> +#include <frg/small_vector.hpp> + +#include <abi-bits/auxv.h> +#include <mlibc/debug.hpp> +#include <mlibc/rtdl-sysdeps.hpp> +#include <mlibc/rtdl-config.hpp> +#include <mlibc/rtdl-abi.hpp> +#include <mlibc/stack_protector.hpp> +#include <internal-config.h> +#include <abi-bits/auxv.h> + +#include "elf.hpp" +#include "linker.hpp" + +#if __MLIBC_POSIX_OPTION +#include <dlfcn.h> +#endif + +#define HIDDEN __attribute__((__visibility__("hidden"))) +#define EXPORT __attribute__((__visibility__("default"))) + +static constexpr bool logEntryExit = false; +static constexpr bool logStartup = false; +static constexpr bool logDlCalls = false; + +#ifndef MLIBC_STATIC_BUILD +extern HIDDEN void *_GLOBAL_OFFSET_TABLE_[]; +extern HIDDEN elf_dyn _DYNAMIC[]; +#endif + +namespace mlibc { + // Declared in options/internal/mlibc/tcb.hpp. + bool tcb_available_flag = false; +} + +mlibc::RtdlConfig rtdlConfig; + +bool ldShowAuxv = false; + +uintptr_t *entryStack; +frg::manual_box<ObjectRepository> initialRepository; +frg::manual_box<Scope> globalScope; + +frg::manual_box<RuntimeTlsMap> runtimeTlsMap; + +// We use a small vector of size 4 to avoid memory allocation for the default library paths +frg::manual_box<frg::small_vector<frg::string_view, 4, MemoryAllocator>> libraryPaths; + +frg::manual_box<frg::vector<frg::string_view, MemoryAllocator>> preloads; + +static SharedObject *executableSO; +extern HIDDEN char __ehdr_start[]; + +// Global debug interface variable +DebugInterface globalDebugInterface; + +#ifndef MLIBC_STATIC_BUILD + +// Use a PC-relative instruction sequence to find our runtime load address. +uintptr_t getLdsoBase() { +#if defined(__x86_64__) || defined(__i386__) || defined(__aarch64__) + // On x86_64, the first GOT entry holds the link-time address of _DYNAMIC. + // TODO: This isn't guaranteed on AArch64, so this might fail with some linkers. + auto linktime_dynamic = reinterpret_cast<uintptr_t>(_GLOBAL_OFFSET_TABLE_[0]); + auto runtime_dynamic = reinterpret_cast<uintptr_t>(_DYNAMIC); + return runtime_dynamic - linktime_dynamic; +#elif defined(__riscv) + return reinterpret_cast<uintptr_t>(&__ehdr_start); +#endif +} + +// Relocates the dynamic linker (i.e. this DSO) itself. +// Assumptions: +// - There are no references to external symbols. +// Note that this code is fragile in the sense that it must not contain relocations itself. +// TODO: Use tooling to verify this at compile time. +extern "C" void relocateSelf() { + size_t rela_offset = 0; + size_t rela_size = 0; + size_t rel_offset = 0; + size_t rel_size = 0; + size_t relr_offset = 0; + size_t relr_size = 0; + for(size_t i = 0; _DYNAMIC[i].d_tag != DT_NULL; i++) { + auto ent = &_DYNAMIC[i]; + switch(ent->d_tag) { + case DT_REL: rel_offset = ent->d_un.d_ptr; break; + case DT_RELSZ: rel_size = ent->d_un.d_val; break; + case DT_RELA: rela_offset = ent->d_un.d_ptr; break; + case DT_RELASZ: rela_size = ent->d_un.d_val; break; + case DT_RELR: relr_offset = ent->d_un.d_ptr; break; + case DT_RELRSZ: relr_size = ent->d_un.d_val; break; + } + } + + auto ldso_base = getLdsoBase(); + + __ensure((rel_offset != 0) ^ (rela_offset != 0)); + + for(size_t disp = 0; disp < rela_size; disp += sizeof(elf_rela)) { + auto reloc = reinterpret_cast<elf_rela *>(ldso_base + rela_offset + disp); + + auto type = ELF_R_TYPE(reloc->r_info); + if(ELF_R_SYM(reloc->r_info)) + __builtin_trap(); + + auto p = reinterpret_cast<uint64_t *>(ldso_base + reloc->r_offset); + switch(type) { + case R_RELATIVE: + *p = ldso_base + reloc->r_addend; + break; + default: + __builtin_trap(); + } + } + + for(size_t disp = 0; disp < rel_size; disp += sizeof(elf_rel)) { + auto reloc = reinterpret_cast<elf_rel *>(ldso_base + rel_offset + disp); + + auto type = ELF_R_TYPE(reloc->r_info); + if(ELF_R_SYM(reloc->r_info)) + __builtin_trap(); + + auto p = reinterpret_cast<uint64_t *>(ldso_base + reloc->r_offset); + switch(type) { + case R_RELATIVE: + *p += ldso_base; + break; + default: + __builtin_trap(); + } + } + + elf_addr *addr = nullptr; + for(size_t disp = 0; disp < relr_size; disp += sizeof(elf_relr)) { + auto entry = *(elf_relr *)(ldso_base + relr_offset + disp); + + // Even entry indicates the beginning address. + if(!(entry & 1)) { + addr = (elf_addr *)(ldso_base + entry); + __ensure(addr); + *addr++ += ldso_base; + }else { + // Odd entry indicates entry is a bitmap of the subsequent locations to be relocated. + for(int i = 0; entry; ++i) { + if(entry & 1) { + addr[i] += ldso_base; + } + entry >>= 1; + } + + // Each entry describes at max 63 (on 64bit) or 31 (on 32bit) subsequent locations. + addr += CHAR_BIT * sizeof(elf_relr) - 1; + } + } +} +#endif + +extern "C" void *lazyRelocate(SharedObject *object, unsigned int rel_index) { + __ensure(object->lazyExplicitAddend); + auto reloc = (elf_rela *)(object->baseAddress + object->lazyRelocTableOffset + + rel_index * sizeof(elf_rela)); + auto type = ELF_R_TYPE(reloc->r_info); + auto symbol_index = ELF_R_SYM(reloc->r_info); + + __ensure(type == R_X86_64_JUMP_SLOT); + __ensure(ELF_CLASS == ELFCLASS64); + + auto symbol = (elf_sym *)(object->baseAddress + object->symbolTableOffset + + symbol_index * sizeof(elf_sym)); + ObjectSymbol r(object, symbol); + auto p = Scope::resolveGlobalOrLocal(*globalScope, object->localScope, r.getString(), object->objectRts, 0); + if(!p) + mlibc::panicLogger() << "Unresolved JUMP_SLOT symbol" << frg::endlog; + + //mlibc::infoLogger() << "Lazy relocation to " << symbol_str + // << " resolved to " << pointer << frg::endlog; + + *(uint64_t *)(object->baseAddress + reloc->r_offset) = p->virtualAddress(); + return (void *)p->virtualAddress(); +} + +extern "C" [[ gnu::visibility("default") ]] void *__rtdl_allocateTcb() { + auto tcb = allocateTcb(); + initTlsObjects(tcb, globalScope->_objects, false); + return tcb; +} + +extern "C" { + [[ gnu::visibility("hidden") ]] void dl_debug_state() { + // This function is used to signal changes in the debugging link map, + // GDB just sets a breakpoint on this function and we can call it + // everytime we update the link map. We don't need to implement + // anything besides defining and calling it. + } +} + +extern "C" [[gnu::alias("dl_debug_state"), gnu::visibility("default")]] void _dl_debug_state() noexcept; + +// This symbol can be used by GDB to find the global interface structure +[[ gnu::visibility("default") ]] DebugInterface *_dl_debug_addr = &globalDebugInterface; + +static frg::vector<frg::string_view, MemoryAllocator> parseList(frg::string_view paths, frg::string_view separators) { + frg::vector<frg::string_view, MemoryAllocator> list{getAllocator()}; + + size_t p = 0; + while(p < paths.size()) { + size_t s; // Offset of next colon or end of string. + if(size_t cs = paths.find_first_of(separators, p); cs != size_t(-1)) { + s = cs; + }else{ + s = paths.size(); + } + + auto path = paths.sub_string(p, s - p); + p = s + 1; + + if(path.size() == 0) + continue; + + if(path.ends_with("/")) { + size_t i = path.size() - 1; + while(i > 0 && path[i] == '/') + i--; + path = path.sub_string(0, i + 1); + } + + if(path == "/") + path = ""; + + list.push_back(path); + } + + return list; +} + +extern "C" void *interpreterMain(uintptr_t *entry_stack) { + if(logEntryExit) + mlibc::infoLogger() << "Entering ld.so" << frg::endlog; + entryStack = entry_stack; + runtimeTlsMap.initialize(); + libraryPaths.initialize(getAllocator()); + preloads.initialize(getAllocator()); + + void *phdr_pointer = 0; + size_t phdr_entry_size = 0; + size_t phdr_count = 0; + void *entry_pointer = 0; + void *stack_entropy = nullptr; + + const char *execfn = "(executable)"; + +#ifndef MLIBC_STATIC_BUILD + using ctor_fn = void(*)(void); + + ctor_fn *ldso_ctors = nullptr; + size_t num_ldso_ctors = 0; + + auto ldso_base = getLdsoBase(); + if(logStartup) { + mlibc::infoLogger() << "ldso: Own base address is: 0x" + << frg::hex_fmt(ldso_base) << frg::endlog; + mlibc::infoLogger() << "ldso: Own dynamic section is at: " << _DYNAMIC << frg::endlog; + } + +#ifdef __x86_64__ + // These entries are reserved on x86_64. + // TODO: Use a fake PLT stub that reports an error message? + _GLOBAL_OFFSET_TABLE_[1] = 0; + _GLOBAL_OFFSET_TABLE_[2] = 0; +#endif + + // Validate our own dynamic section. + // Here, we make sure that the dynamic linker does not need relocations itself. + uintptr_t strtab_offset = 0; + uintptr_t soname_str = 0; + for(size_t i = 0; _DYNAMIC[i].d_tag != DT_NULL; i++) { + auto ent = &_DYNAMIC[i]; + switch(ent->d_tag) { + case DT_STRTAB: strtab_offset = ent->d_un.d_ptr; break; + case DT_SONAME: soname_str = ent->d_un.d_val; break; + case DT_INIT_ARRAY: ldso_ctors = reinterpret_cast<ctor_fn *>(ent->d_un.d_ptr + ldso_base); break; + case DT_INIT_ARRAYSZ: num_ldso_ctors = ent->d_un.d_val / sizeof(ctor_fn); break; + case DT_HASH: + case DT_GNU_HASH: + case DT_STRSZ: + case DT_SYMTAB: + case DT_SYMENT: + case DT_RELA: + case DT_RELASZ: + case DT_RELAENT: + case DT_RELACOUNT: + case DT_DEBUG: + case DT_REL: + case DT_RELSZ: + case DT_RELENT: + case DT_RELCOUNT: + case DT_RELR: + case DT_RELRSZ: + case DT_RELRENT: + continue; + default: + __ensure(!"Unexpected dynamic entry in program interpreter"); + } + } + __ensure(strtab_offset); + __ensure(soname_str); + + // Find the auxiliary vector by skipping args and environment. + auto aux = entryStack; + aux += *aux + 1; // First, we skip argc and all args. + __ensure(!*aux); + aux++; + while(*aux) { // Loop through the environment. + auto env = reinterpret_cast<char *>(*aux); + frg::string_view view{env}; + size_t s = view.find_first('='); + + if(s == size_t(-1)) + mlibc::panicLogger() << "rtdl: environment '" << env << "' is missing a '='" << frg::endlog; + + auto name = view.sub_string(0, s); + auto value = const_cast<char *>(view.data() + s + 1); + + if(name == "LD_SHOW_AUXV" && *value && *value != '0') { + ldShowAuxv = true; + }else if(name == "LD_LIBRARY_PATH" && *value) { + for(auto path : parseList(value, ":;")) + libraryPaths->push_back(path); + }else if(name == "LD_PRELOAD" && *value) { + *preloads = parseList(value, " :"); + } + + aux++; + } + aux++; + + // Add default library paths + libraryPaths->push_back("/lib"); + libraryPaths->push_back("/lib64"); + libraryPaths->push_back("/usr/lib"); + libraryPaths->push_back("/usr/lib64"); + + // Parse the actual vector. + while(true) { + auto value = aux + 1; + if(!(*aux)) + break; + + if(ldShowAuxv) { + switch(*aux) { + case AT_PHDR: mlibc::infoLogger() << "AT_PHDR: 0x" << frg::hex_fmt{*value} << frg::endlog; break; + case AT_PHENT: mlibc::infoLogger() << "AT_PHENT: " << *value << frg::endlog; break; + case AT_PHNUM: mlibc::infoLogger() << "AT_PHNUM: " << *value << frg::endlog; break; + case AT_ENTRY: mlibc::infoLogger() << "AT_ENTRY: 0x" << frg::hex_fmt{*value} << frg::endlog; break; + case AT_PAGESZ: mlibc::infoLogger() << "AT_PAGESZ: " << *value << frg::endlog; break; + case AT_BASE: mlibc::infoLogger() << "AT_BASE: 0x" << frg::hex_fmt{*value} << frg::endlog; break; + case AT_FLAGS: mlibc::infoLogger() << "AT_FLAGS: 0x" << frg::hex_fmt{*value} << frg::endlog; break; + case AT_NOTELF: mlibc::infoLogger() << "AT_NOTELF: " << frg::hex_fmt{*value} << frg::endlog; break; + case AT_UID: mlibc::infoLogger() << "AT_UID: " << *value << frg::endlog; break; + case AT_EUID: mlibc::infoLogger() << "AT_EUID: " << *value << frg::endlog; break; + case AT_GID: mlibc::infoLogger() << "AT_GID: " << *value << frg::endlog; break; + case AT_EGID: mlibc::infoLogger() << "AT_EGID: " << *value << frg::endlog; break; +#ifdef AT_PLATFORM + case AT_PLATFORM: mlibc::infoLogger() << "AT_PLATFORM: " << reinterpret_cast<const char *>(*value) << frg::endlog; break; +#endif +#ifdef AT_HWCAP + case AT_HWCAP: mlibc::infoLogger() << "AT_HWCAP: " << frg::hex_fmt{*value} << frg::endlog; break; +#endif +#ifdef AT_CLKTCK + case AT_CLKTCK: mlibc::infoLogger() << "AT_CLKTCK: " << *value << frg::endlog; break; +#endif +#ifdef AT_FPUCW + case AT_FPUCW: mlibc::infoLogger() << "AT_FPUCW: " << frg::hex_fmt{*value} << frg::endlog; break; +#endif +#ifdef AT_SECURE + case AT_SECURE: mlibc::infoLogger() << "AT_SECURE: " << *value << frg::endlog; break; +#endif +#ifdef AT_RANDOM + case AT_RANDOM: mlibc::infoLogger() << "AT_RANDOM: 0x" << frg::hex_fmt{*value} << frg::endlog; break; +#endif +#ifdef AT_EXECFN + case AT_EXECFN: mlibc::infoLogger() << "AT_EXECFN: " << reinterpret_cast<const char *>(*value) << frg::endlog; break; +#endif +#ifdef AT_SYSINFO_EHDR + case AT_SYSINFO_EHDR: mlibc::infoLogger() << "AT_SYSINFO_EHDR: 0x" << frg::hex_fmt{*value} << frg::endlog; break; +#endif + } + } + + // TODO: Whitelist auxiliary vector entries here? + switch(*aux) { + case AT_PHDR: phdr_pointer = reinterpret_cast<void *>(*value); break; + case AT_PHENT: phdr_entry_size = *value; break; + case AT_PHNUM: phdr_count = *value; break; + case AT_ENTRY: entry_pointer = reinterpret_cast<void *>(*value); break; + case AT_EXECFN: execfn = reinterpret_cast<const char *>(*value); break; + case AT_RANDOM: stack_entropy = reinterpret_cast<void*>(*value); break; + case AT_SECURE: rtdlConfig.secureRequired = reinterpret_cast<uintptr_t>(*value); break; + } + + aux += 2; + } + globalDebugInterface.base = reinterpret_cast<void*>(ldso_base); + +// This is here because libgcc will add a global constructor on glibc Linux +// (which is what it believes we are due to the aarch64-linux-gnu toolchain) +// in order to check if LSE atomics are supported. +// +// This is not necessary on a custom Linux toolchain and is purely an artifact of +// using the host toolchain. +#if defined(__aarch64__) && defined(__gnu_linux__) + for (size_t i = 0; i < num_ldso_ctors; i++) { + if(logStartup) + mlibc::infoLogger() << "ldso: Running own constructor at " + << reinterpret_cast<void *>(ldso_ctors[i]) + << frg::endlog; + ldso_ctors[i](); + } +#else + if (num_ldso_ctors > 0) { + mlibc::panicLogger() << "ldso: Found unexpected own global constructor(s), init_array starts at: " + << ldso_ctors + << frg::endlog; + } +#endif + +#else + auto ehdr = reinterpret_cast<elf_ehdr*>(__ehdr_start); + phdr_pointer = reinterpret_cast<void*>((uintptr_t)ehdr->e_phoff + (uintptr_t)ehdr); + phdr_entry_size = ehdr->e_phentsize; + phdr_count = ehdr->e_phnum; + entry_pointer = reinterpret_cast<void*>(ehdr->e_entry); +#endif + __ensure(phdr_pointer); + __ensure(entry_pointer); + + if(logStartup) + mlibc::infoLogger() << "ldso: Executable PHDRs are at " << phdr_pointer + << frg::endlog; + + // perform the initial dynamic linking + initialRepository.initialize(); + + globalScope.initialize(true); + + // Add the dynamic linker, as well as the exectuable to the repository. +#ifndef MLIBC_STATIC_BUILD + auto ldso_soname = reinterpret_cast<const char *>(ldso_base + strtab_offset + soname_str); + auto ldso = initialRepository->injectObjectFromDts(ldso_soname, + frg::string<MemoryAllocator> { getAllocator() }, + ldso_base, _DYNAMIC, 1); + ldso->phdrPointer = phdr_pointer; + ldso->phdrCount = phdr_count; + ldso->phdrEntrySize = phdr_entry_size; + + // TODO: support non-zero base addresses? + executableSO = initialRepository->injectObjectFromPhdrs(execfn, + frg::string<MemoryAllocator> { execfn, getAllocator() }, + phdr_pointer, phdr_entry_size, phdr_count, entry_pointer, 1); + + // We can't initialise the ldso object after the executable SO, + // so we have to set the ldso path after loading both. + ldso->path = executableSO->interpreterPath; + +#else + executableSO = initialRepository->injectStaticObject(execfn, + frg::string<MemoryAllocator>{ execfn, getAllocator() }, + phdr_pointer, phdr_entry_size, phdr_count, entry_pointer, 1); + globalDebugInterface.base = (void*)executableSO->baseAddress; +#endif + + globalDebugInterface.head = &executableSO->linkMap; + executableSO->inLinkMap = true; + Loader linker{globalScope.get(), executableSO, true, 1}; + linker.linkObjects(executableSO); + + mlibc::initStackGuard(stack_entropy); + + auto tcb = allocateTcb(); + if(mlibc::sys_tcb_set(tcb)) + __ensure(!"sys_tcb_set() failed"); + tcb->tid = mlibc::this_tid(); + mlibc::tcb_available_flag = true; + + globalDebugInterface.ver = 1; + globalDebugInterface.brk = &dl_debug_state; + globalDebugInterface.state = 0; + dl_debug_state(); + + linker.initObjects(); + + if(logEntryExit) + mlibc::infoLogger() << "Leaving ld.so, jump to " + << (void *)executableSO->entry << frg::endlog; + return executableSO->entry; +} + +const char *lastError; + +extern "C" [[ gnu::visibility("default") ]] uintptr_t *__dlapi_entrystack() { + return entryStack; +} + +extern "C" [[ gnu::visibility("default") ]] +const char *__dlapi_error() { + auto error = lastError; + lastError = nullptr; + return error; +} + +extern "C" [[ gnu::visibility("default") ]] +void *__dlapi_get_tls(struct __abi_tls_entry *entry) { + return reinterpret_cast<char *>(accessDtv(entry->object)) + entry->offset; +} + +extern "C" [[ gnu::visibility("default") ]] +const mlibc::RtdlConfig &__dlapi_get_config() { + return rtdlConfig; +} + +#if __MLIBC_POSIX_OPTION + +extern "C" [[ gnu::visibility("default") ]] +void *__dlapi_open(const char *file, int flags, void *returnAddress) { + if (logDlCalls) + mlibc::infoLogger() << "rtdl: __dlapi_open(" << (file ? file : "nullptr") << ")" << frg::endlog; + + if (flags & RTLD_DEEPBIND) + mlibc::infoLogger() << "rtdl: dlopen(RTLD_DEEPBIND) is unsupported" << frg::endlog; + + if(!file) + return executableSO; + + // TODO: Thread-safety! + auto rts = rtsCounter++; + + SharedObject *object; + if (flags & RTLD_NOLOAD) { + object = initialRepository->findLoadedObject(file); + if (object && object->globalRts == 0 && (flags & RTLD_GLOBAL)) { + // The object was opened with RTLD_LOCAL, but we are called with RTLD_NOLOAD | RTLD_GLOBAL. + // According to the man page, we should promote to the global scope here. + object->globalRts = rts; + globalScope->appendObject(object); + } + } else { + bool isGlobal = flags & RTLD_GLOBAL; + Scope *newScope = isGlobal ? globalScope.get() : nullptr; + + frg::expected<LinkerError, SharedObject *> objectResult; + if (frg::string_view{file}.find_first('/') == size_t(-1)) { + // In order to know which RUNPATH / RPATH to process, we must find the calling object. + SharedObject *origin = initialRepository->findCaller(returnAddress); + if (!origin) { + mlibc::panicLogger() << "rtdl: unable to determine calling object of dlopen " + << "(ra = " << returnAddress << ")" << frg::endlog; + } + + objectResult = initialRepository->requestObjectWithName(file, origin, newScope, !isGlobal, rts); + } else { + objectResult = initialRepository->requestObjectAtPath(file, newScope, !isGlobal, rts); + } + + if(!objectResult) { + switch (objectResult.error()) { + case LinkerError::success: + __builtin_unreachable(); + case LinkerError::notFound: + lastError = "Cannot locate requested DSO"; + break; + case LinkerError::fileTooShort: + lastError = "File too short"; + break; + case LinkerError::notElf: + lastError = "File is not an ELF file"; + break; + case LinkerError::wrongElfType: + lastError = "File has wrong ELF type"; + break; + case LinkerError::outOfMemory: + lastError = "Out of memory"; + break; + case LinkerError::invalidProgramHeader: + lastError = "File has invalid program header"; + break; + } + return nullptr; + } + object = objectResult.value(); + + Loader linker{object->localScope, nullptr, false, rts}; + linker.linkObjects(object); + linker.initObjects(); + } + + dl_debug_state(); + + return object; +} + +extern "C" [[ gnu::visibility("default") ]] +void *__dlapi_resolve(void *handle, const char *string, void *returnAddress) { + if (logDlCalls) { + const char *name; + bool quote = false; + if (handle == RTLD_DEFAULT) { + name = "RTLD_DEFAULT"; + } else if (handle == RTLD_NEXT) { + name = "RTLD_NEXT"; + } else { + name = ((SharedObject *)handle)->name.data(); + quote = true; + } + + mlibc::infoLogger() << "rtdl: __dlapi_resolve(" << (quote ? "\"" : "") << name + << (quote ? "\"" : "") << ", \"" << string << "\")" << frg::endlog; + } + + frg::optional<ObjectSymbol> target; + + if (handle == RTLD_DEFAULT) { + target = globalScope->resolveSymbol(string, 0, 0); + } else if (handle == RTLD_NEXT) { + SharedObject *origin = initialRepository->findCaller(returnAddress); + if (!origin) { + mlibc::panicLogger() << "rtdl: unable to determine calling object of dlsym " + << "(ra = " << returnAddress << ")" << frg::endlog; + } + + target = Scope::resolveGlobalOrLocalNext(*globalScope, origin->localScope, string, origin); + } else { + // POSIX does not unambiguously state how dlsym() is supposed to work; it just + // states that "The symbol resolution algorithm used shall be dependency order + // as described in dlopen()". + // + // Linux libc's lookup the symbol in the given DSO and all of its dependencies + // in breadth-first order. That is also what we implement here. + // + // Note that this *differs* from the algorithm that is used for relocations + // (since the algorithm used for relocations takes (i) the global scope, + // and (ii) the local scope of the DSO into account (which can contain more objects + // than just the dependencies of the DSO, if the DSO was loaded as a dependency + // of a dlopen()ed DSO). + + frg::vector<SharedObject *, MemoryAllocator> queue{getAllocator()}; + + struct Token { }; + frg::hash_map< + SharedObject *, Token, + frg::hash<SharedObject *>, MemoryAllocator + > visited{frg::hash<SharedObject *>{}, getAllocator()}; + + auto root = reinterpret_cast<SharedObject *>(handle); + visited.insert(root, Token{}); + queue.push_back(root); + + for(size_t i = 0; i < queue.size(); i++) { + auto current = queue[i]; + + target = resolveInObject(current, string); + if(target) + break; + + for(auto dep : current->dependencies) { + if(visited.get(dep)) + continue; + visited.insert(dep, Token{}); + queue.push_back(dep); + } + } + } + + if (!target) { + if (logDlCalls) + mlibc::infoLogger() << "rtdl: could not resolve \"" << string << "\"" << frg::endlog; + + lastError = "Cannot resolve requested symbol"; + return nullptr; + } + return reinterpret_cast<void *>(target->virtualAddress()); +} + +struct __dlapi_symbol { + const char *file; + void *base; + const char *symbol; + void *address; +}; + +extern "C" [[ gnu::visibility("default") ]] +int __dlapi_reverse(const void *ptr, __dlapi_symbol *info) { + if (logDlCalls) + mlibc::infoLogger() << "rtdl: __dlapi_reverse(" << ptr << ")" << frg::endlog; + + for(size_t i = 0; i < initialRepository->loadedObjects.size(); i++) { + auto object = initialRepository->loadedObjects[i]; + + auto eligible = [&] (ObjectSymbol cand) { + if(cand.symbol()->st_shndx == SHN_UNDEF) + return false; + + auto bind = ELF_ST_BIND(cand.symbol()->st_info); + if(bind != STB_GLOBAL && bind != STB_WEAK) + return false; + + return true; + }; + + auto hash_table = (Elf64_Word *)(object->baseAddress + object->hashTableOffset); + auto num_symbols = hash_table[1]; + for(size_t i = 0; i < num_symbols; i++) { + ObjectSymbol cand{object, (elf_sym *)(object->baseAddress + + object->symbolTableOffset + i * sizeof(elf_sym))}; + if(eligible(cand) && cand.virtualAddress() == reinterpret_cast<uintptr_t>(ptr)) { + if (logDlCalls) + mlibc::infoLogger() << "rtdl: Found symbol " << cand.getString() << " in object " + << object->path << frg::endlog; + + info->file = object->path.data(); + info->base = reinterpret_cast<void *>(object->baseAddress); + info->symbol = cand.getString(); + info->address = reinterpret_cast<void *>(cand.virtualAddress()); + return 0; + } + } + } + + // Not found, find the DSO it should be in. + for(size_t i = 0; i < initialRepository->loadedObjects.size(); i++) { + auto object = initialRepository->loadedObjects[i]; + + for(size_t j = 0; j < object->phdrCount; j++) { + auto phdr = (elf_phdr *)((uintptr_t)object->phdrPointer + j * object->phdrEntrySize); + if(phdr->p_type != PT_LOAD) { + continue; + } + uintptr_t start = object->baseAddress + phdr->p_vaddr; + uintptr_t end = start + phdr->p_memsz; + if(reinterpret_cast<uintptr_t>(ptr) >= start && reinterpret_cast<uintptr_t>(ptr) < end) { + mlibc::infoLogger() << "rtdl: Found DSO " << object->path << frg::endlog; + info->file = object->path.data(); + info->base = reinterpret_cast<void *>(object->baseAddress); + info->symbol = nullptr; + info->address = 0; + return 0; + } + } + } + + if (logDlCalls) + mlibc::infoLogger() << "rtdl: Could not find symbol in __dlapi_reverse()" << frg::endlog; + + return -1; +} + +extern "C" [[ gnu::visibility("default") ]] +int __dlapi_close(void *) { + if (logDlCalls) + mlibc::infoLogger() << "mlibc: dlclose() is a no-op" << frg::endlog; + return 0; +} + +#endif + +extern "C" [[ gnu::visibility("default") ]] +int __dlapi_iterate_phdr(int (*callback)(struct dl_phdr_info *, size_t, void*), void *data) { + int last_return = 0; + for (auto object : initialRepository->loadedObjects) { + struct dl_phdr_info info; + info.dlpi_addr = object->baseAddress; + info.dlpi_name = object->name.data(); + + if(object->isMainObject) { + info.dlpi_name = ""; + } else { + info.dlpi_name = object->name.data(); + } + info.dlpi_phdr = static_cast<ElfW(Phdr)*>(object->phdrPointer); + info.dlpi_phnum = object->phdrCount; + info.dlpi_adds = rtsCounter; + info.dlpi_subs = 0; // TODO(geert): implement dlclose(). + if (object->tlsModel != TlsModel::null) + info.dlpi_tls_modid = object->tlsIndex; + else + info.dlpi_tls_modid = 0; + info.dlpi_tls_data = tryAccessDtv(object); + + last_return = callback(&info, sizeof(struct dl_phdr_info), data); + if(last_return) + return last_return; + } + + return last_return; +} + +extern "C" [[ gnu::visibility("default") ]] +void __dlapi_enter(uintptr_t *entry_stack) { +#if MLIBC_STATIC_BUILD + interpreterMain(entry_stack); +#else + (void)entry_stack; +#endif +} + +// XXX(qookie): +// This is here because libgcc will call into __getauxval on glibc Linux +// (which is what it believes we are due to the aarch64-linux-gnu toolchain) +// in order to find AT_HWCAP to discover if LSE atomics are supported. +// +// This is not necessary on a custom Linux toolchain and is purely an artifact of +// using the host toolchain. + +// __gnu_linux__ is the define checked by libgcc +#if defined(__aarch64__) && defined(__gnu_linux__) && !defined(MLIBC_STATIC_BUILD) + +extern "C" unsigned long __getauxval(unsigned long type) { + // Find the auxiliary vector by skipping args and environment. + auto aux = entryStack; + aux += *aux + 1; // Skip argc and all arguments + __ensure(!*aux); + aux++; + while(*aux) // Now, we skip the environment. + aux++; + aux++; + + // Parse the auxiliary vector. + while(true) { + auto value = aux + 1; + if(*aux == AT_NULL) { + return 0; + }else if(*aux == type) { + return *value; + } + aux += 2; + } +} + +#endif diff --git a/lib/mlibc/options/rtdl/include/mlibc/rtdl-abi.hpp b/lib/mlibc/options/rtdl/include/mlibc/rtdl-abi.hpp new file mode 100644 index 0000000..135b461 --- /dev/null +++ b/lib/mlibc/options/rtdl/include/mlibc/rtdl-abi.hpp @@ -0,0 +1,28 @@ +#ifndef MLIBC_RTDL_ABI +#define MLIBC_RTDL_ABI + +#include <stdint.h> + +#if defined(__x86_64__) || defined(__aarch64__) || defined(__i386__) || defined(__riscv) + +struct __abi_tls_entry { + struct SharedObject *object; + size_t offset; +}; +static_assert(sizeof(__abi_tls_entry) == sizeof(size_t) * 2, "Bad __abi_tls_entry size"); + +extern "C" void *__dlapi_get_tls(struct __abi_tls_entry *); + +#else +#error "Missing architecture specific code." +#endif + +#if defined(__riscv) +constexpr inline unsigned long TLS_DTV_OFFSET = 0x800; +#elif defined(__x86_64__) || defined(__i386__) || defined(__aarch64__) +constexpr inline unsigned long TLS_DTV_OFFSET = 0; +#else +#error "Missing architecture specific code." +#endif + +#endif // MLIBC_RTDL_ABI diff --git a/lib/mlibc/options/rtdl/include/mlibc/rtdl-config.hpp b/lib/mlibc/options/rtdl/include/mlibc/rtdl-config.hpp new file mode 100644 index 0000000..4838880 --- /dev/null +++ b/lib/mlibc/options/rtdl/include/mlibc/rtdl-config.hpp @@ -0,0 +1,24 @@ +#ifndef MLIBC_RTDL_CONFIG +#define MLIBC_RTDL_CONFIG + +namespace mlibc { + +struct RtdlConfig { + bool secureRequired; +}; + +} + +extern "C" const mlibc::RtdlConfig &__dlapi_get_config(); + +#ifndef MLIBC_BUILDING_RTDL +namespace mlibc { + +inline const RtdlConfig &rtdlConfig() { + return __dlapi_get_config(); +} + +} +#endif + +#endif // MLIBC_RTDL_CONFIG diff --git a/lib/mlibc/options/rtdl/include/mlibc/rtdl-sysdeps.hpp b/lib/mlibc/options/rtdl/include/mlibc/rtdl-sysdeps.hpp new file mode 100644 index 0000000..c35271c --- /dev/null +++ b/lib/mlibc/options/rtdl/include/mlibc/rtdl-sysdeps.hpp @@ -0,0 +1,12 @@ +#ifndef MLIBC_RTDL_SYSDEPS +#define MLIBC_RTDL_SYSDEPS + +namespace [[gnu::visibility("hidden")]] mlibc { + +int sys_tcb_set(void *pointer); + +[[gnu::weak]] int sys_vm_readahead(void *pointer, size_t size); + +} // namespace mlibc + +#endif // MLIBC_RTDL_SYSDEPS diff --git a/lib/mlibc/options/rtdl/riscv64/elf.hpp b/lib/mlibc/options/rtdl/riscv64/elf.hpp new file mode 100644 index 0000000..5d7039a --- /dev/null +++ b/lib/mlibc/options/rtdl/riscv64/elf.hpp @@ -0,0 +1,37 @@ +#pragma once + +#include <elf.h> + +#define ELF_CLASS ELFCLASS64 +#define ELF_MACHINE EM_RISCV + +using elf_ehdr = Elf64_Ehdr; +using elf_phdr = Elf64_Phdr; +using elf_dyn = Elf64_Dyn; +using elf_rel = Elf64_Rel; +using elf_rela = Elf64_Rela; +using elf_relr = Elf64_Relr; +using elf_sym = Elf64_Sym; +using elf_addr = Elf64_Addr; + +using elf_info = Elf64_Xword; +using elf_addend = Elf64_Sxword; + +#define ELF_R_SYM ELF64_R_SYM +#define ELF_R_TYPE ELF64_R_TYPE +#define ELF_ST_BIND ELF64_ST_BIND + +#define R_NONE R_RISCV_NONE +#define R_JUMP_SLOT R_RISCV_JUMP_SLOT +#define R_ABSOLUTE R_RISCV_64 +#define R_GLOB_DAT R_RISCV_64 +#define R_RELATIVE R_RISCV_RELATIVE +#define R_IRELATIVE R_RISCV_IRELATIVE +// #define R_OFFSET +#define R_COPY R_RISCV_COPY +#define R_TLS_DTPMOD R_RISCV_TLS_DTPMOD64 +#define R_TLS_DTPREL R_RISCV_TLS_DTPREL64 +#define R_TLS_TPREL R_RISCV_TLS_TPREL64 +#define R_TLSDESC R_RISCV_TLSDESC + +#define TP_TCB_OFFSET 0 diff --git a/lib/mlibc/options/rtdl/riscv64/entry.S b/lib/mlibc/options/rtdl/riscv64/entry.S new file mode 100644 index 0000000..b7cf854 --- /dev/null +++ b/lib/mlibc/options/rtdl/riscv64/entry.S @@ -0,0 +1,11 @@ +.global _start +_start: + call relocateSelf + + mv a0, sp + call interpreterMain + + jr a0 + +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/rtdl/riscv64/runtime.S b/lib/mlibc/options/rtdl/riscv64/runtime.S new file mode 100644 index 0000000..5128fd3 --- /dev/null +++ b/lib/mlibc/options/rtdl/riscv64/runtime.S @@ -0,0 +1,5 @@ +.global pltRelocateStub +pltRelocateStub: + unimp // TODO +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/rtdl/x86/elf.hpp b/lib/mlibc/options/rtdl/x86/elf.hpp new file mode 100644 index 0000000..95800aa --- /dev/null +++ b/lib/mlibc/options/rtdl/x86/elf.hpp @@ -0,0 +1,37 @@ +#pragma once + +#include <elf.h> + +#define ELF_CLASS ELFCLASS32 +#define ELF_MACHINE EM_386 + +using elf_ehdr = Elf32_Ehdr; +using elf_phdr = Elf32_Phdr; +using elf_dyn = Elf32_Dyn; +using elf_rel = Elf32_Rel; +using elf_rela = Elf32_Rela; +using elf_relr = Elf32_Relr; +using elf_sym = Elf32_Sym; +using elf_addr = Elf32_Addr; + +using elf_info = Elf32_Word; +using elf_addend = Elf32_Sword; + +#define ELF_R_SYM ELF32_R_SYM +#define ELF_R_TYPE ELF32_R_TYPE +#define ELF_ST_BIND ELF32_ST_BIND + +#define R_NONE R_386_NONE +#define R_JUMP_SLOT R_386_JMP_SLOT +#define R_ABSOLUTE R_386_32 +#define R_GLOB_DAT R_386_GLOB_DAT +#define R_RELATIVE R_386_RELATIVE +#define R_IRELATIVE R_386_IRELATIVE +#define R_OFFSET R_386_PC32 +#define R_COPY R_386_COPY +#define R_TLS_DTPMOD R_386_TLS_DTPMOD32 +#define R_TLS_DTPREL R_386_TLS_DTPOFF32 +#define R_TLS_TPREL R_386_TLS_TPOFF +#define R_TLSDESC R_386_TLS_DESC + +#define TP_TCB_OFFSET 0 diff --git a/lib/mlibc/options/rtdl/x86/entry.S b/lib/mlibc/options/rtdl/x86/entry.S new file mode 100644 index 0000000..963185b --- /dev/null +++ b/lib/mlibc/options/rtdl/x86/entry.S @@ -0,0 +1,10 @@ +.global _start +_start: + call relocateSelf + + push %esp + call interpreterMain + + jmp *%eax + +.section .note.GNU-stack,"",%progbits diff --git a/lib/mlibc/options/rtdl/x86/runtime.S b/lib/mlibc/options/rtdl/x86/runtime.S new file mode 100755 index 0000000..40a175f --- /dev/null +++ b/lib/mlibc/options/rtdl/x86/runtime.S @@ -0,0 +1,9 @@ +.global pltRelocateStub +# save / restore all registers that can hold function parameters +pltRelocateStub: + # we need to save / restore all registers than can hold function arguments + # we do not need to save callee-saved registers as they will not be trashed by lazyRelocate + # TODO: save floating point argument registers + ud2 + +.section .note.GNU-stack,"",%progbits diff --git a/lib/mlibc/options/rtdl/x86_64/elf.hpp b/lib/mlibc/options/rtdl/x86_64/elf.hpp new file mode 100644 index 0000000..2a80644 --- /dev/null +++ b/lib/mlibc/options/rtdl/x86_64/elf.hpp @@ -0,0 +1,37 @@ +#pragma once + +#include <elf.h> + +#define ELF_CLASS ELFCLASS64 +#define ELF_MACHINE EM_X86_64 + +using elf_ehdr = Elf64_Ehdr; +using elf_phdr = Elf64_Phdr; +using elf_dyn = Elf64_Dyn; +using elf_rel = Elf64_Rel; +using elf_rela = Elf64_Rela; +using elf_relr = Elf64_Relr; +using elf_sym = Elf64_Sym; +using elf_addr = Elf64_Addr; + +using elf_info = Elf64_Xword; +using elf_addend = Elf64_Sxword; + +#define ELF_R_SYM ELF64_R_SYM +#define ELF_R_TYPE ELF64_R_TYPE +#define ELF_ST_BIND ELF64_ST_BIND + +#define R_NONE R_X86_64_NONE +#define R_JUMP_SLOT R_X86_64_JUMP_SLOT +#define R_ABSOLUTE R_X86_64_64 +#define R_GLOB_DAT R_X86_64_GLOB_DAT +#define R_RELATIVE R_X86_64_RELATIVE +#define R_IRELATIVE R_X86_64_IRELATIVE +// #define R_OFFSET +#define R_COPY R_X86_64_COPY +#define R_TLS_DTPMOD R_X86_64_DTPMOD64 +#define R_TLS_DTPREL R_X86_64_DTPOFF64 +#define R_TLS_TPREL R_X86_64_TPOFF64 +#define R_TLSDESC R_X86_64_TLSDESC + +#define TP_TCB_OFFSET 0 diff --git a/lib/mlibc/options/rtdl/x86_64/entry.S b/lib/mlibc/options/rtdl/x86_64/entry.S new file mode 100644 index 0000000..ea64111 --- /dev/null +++ b/lib/mlibc/options/rtdl/x86_64/entry.S @@ -0,0 +1,11 @@ + +.global _start +_start: + call relocateSelf + + mov %rsp, %rdi + call interpreterMain + + jmp *%rax +.section .note.GNU-stack,"",%progbits + diff --git a/lib/mlibc/options/rtdl/x86_64/runtime.S b/lib/mlibc/options/rtdl/x86_64/runtime.S new file mode 100644 index 0000000..d8593c4 --- /dev/null +++ b/lib/mlibc/options/rtdl/x86_64/runtime.S @@ -0,0 +1,36 @@ + +.global pltRelocateStub +pltRelocateStub: + # we need to save / restore all registers than can hold function arguments + # we do not need to save callee-saved registers as they will not be trashed by lazyRelocate + # TODO: save floating point argument registers + + push %rsi + push %rdi + mov 16(%rsp), %rdi + mov 24(%rsp), %rsi + + push %rax + push %rcx + push %rdx + push %r8 + push %r9 + push %r10 + + call lazyRelocate + mov %rax, %r11 + + pop %r10 + pop %r9 + pop %r8 + pop %rdx + pop %rcx + pop %rax + + pop %rdi + pop %rsi + add $16, %rsp + jmp *%r11 + +.section .note.GNU-stack,"",%progbits + |