diff options
author | Ian Moffett <ian@osmora.org> | 2024-03-07 17:28:00 -0500 |
---|---|---|
committer | Ian Moffett <ian@osmora.org> | 2024-03-07 17:28:32 -0500 |
commit | bd5969fc876a10b18613302db7087ef3c40f18e1 (patch) | |
tree | 7c2b8619afe902abf99570df2873fbdf40a4d1a1 /lib/mlibc/options/ansi | |
parent | a95b38b1b92b172e6cc4e8e56a88a30cc65907b0 (diff) |
lib: Add mlibc
Signed-off-by: Ian Moffett <ian@osmora.org>
Diffstat (limited to 'lib/mlibc/options/ansi')
311 files changed, 30252 insertions, 0 deletions
diff --git a/lib/mlibc/options/ansi/generic/assert-stubs.cpp b/lib/mlibc/options/ansi/generic/assert-stubs.cpp new file mode 100644 index 0000000..6ebb6ed --- /dev/null +++ b/lib/mlibc/options/ansi/generic/assert-stubs.cpp @@ -0,0 +1,13 @@ + +#include <assert.h> +#include <stdio.h> +#include <stdlib.h> + +#include <bits/ensure.h> + +[[gnu::noreturn]] void __assert_fail(const char *assertion, const char *file, unsigned int line, + const char *function) { + fprintf(stderr, "In function %s, file %s:%d: Assertion '%s' failed!\n", + function, file, line, assertion); + abort(); +} diff --git a/lib/mlibc/options/ansi/generic/complex-stubs.c b/lib/mlibc/options/ansi/generic/complex-stubs.c new file mode 100644 index 0000000..069626b --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex-stubs.c @@ -0,0 +1,9 @@ +#include <complex.h> + +long double cimagl(long double complex z) { + return __imag__(z); +} + +long double creall(long double complex z) { + return __real__(z); +} diff --git a/lib/mlibc/options/ansi/generic/complex/cabs.c b/lib/mlibc/options/ansi/generic/complex/cabs.c new file mode 100644 index 0000000..2750fab --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cabs.c @@ -0,0 +1,53 @@ +/* $NetBSD: cabs.c,v 1.1 2007/08/20 16:01:30 drochner Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<cabs>>, <<cabsf>>---complex absolute-value + +INDEX + cabs +INDEX + cabsf + +ANSI_SYNOPSIS + #include <complex.h> + double cabs(double complex <[z]>); + float cabsf(float complex <[z]>); + + +DESCRIPTION + These functions compute compute the complex absolute value + (also called norm, modulus, or magnitude) of <[z]>. + + <<cabsf>> is identical to <<cabs>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The cabs functions return the complex absolute value. + +PORTABILITY + <<cabs>> and <<cabsf>> are ISO C99 + +QUICKREF + <<cabs>> and <<cabsf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> + +double +cabs(double complex z) +{ + + return hypot( creal(z), cimag(z) ); +} diff --git a/lib/mlibc/options/ansi/generic/complex/cabsf.c b/lib/mlibc/options/ansi/generic/complex/cabsf.c new file mode 100644 index 0000000..635e23e --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cabsf.c @@ -0,0 +1,19 @@ +/* $NetBSD: cabsf.c,v 1.1 2007/08/20 16:01:30 drochner Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float +cabsf(float complex z) +{ + + return hypotf( crealf(z), cimagf(z) ); +} diff --git a/lib/mlibc/options/ansi/generic/complex/cacos.c b/lib/mlibc/options/ansi/generic/complex/cacos.c new file mode 100644 index 0000000..86e1198 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cacos.c @@ -0,0 +1,99 @@ +/* $NetBSD: cacos.c,v 1.1 2007/08/20 16:01:30 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<cacos>>, <<cacosf>>---complex arc cosine + +INDEX + cacos +INDEX + cacosf + +ANSI_SYNOPSIS + #include <complex.h> + double complex cacos(double complex <[z]>); + float complex cacosf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex arc cosine of <[z]>, + with branch cuts outside the interval [-1, +1] along the real axis. + + <<cacosf>> is identical to <<cacos>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + These functions return the complex arc cosine value, in the range + of a strip mathematically unbounded along the imaginary axis + and in the interval [0, pi] along the real axis. + @end ifnottex + @tex + These functions return the complex arc cosine value, in the range + of a strip mathematically unbounded along the imaginary axis + and in the interval [<<0>>, $\pi$] along the real axis. + @end tex + +PORTABILITY + <<cacos>> and <<cacosf>> are ISO C99 + +QUICKREF + <<cacos>> and <<cacosf>> are ISO C99 + +*/ + +#include <complex.h> +#include <math.h> + +double complex +cacos(double complex z) +{ + double complex w; + + /* FIXME: The original NetBSD code results in an ICE when trying to + build this function on ARM/Thumb using gcc 4.5.1. For now we use + a hopefully temporary workaround. */ +#if 0 + w = casin(z); + w = (M_PI_2 - creal(w)) - cimag(w) * I; +#else + double complex tmp0, tmp1; + + tmp0 = casin(z); + tmp1 = M_PI_2 - creal(tmp0); + w = tmp1 - (cimag(tmp0) * I); +#endif + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cacosf.c b/lib/mlibc/options/ansi/generic/complex/cacosf.c new file mode 100644 index 0000000..3874dd5 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cacosf.c @@ -0,0 +1,46 @@ +/* $NetBSD: cacosf.c,v 1.1 2007/08/20 16:01:30 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +cacosf(float complex z) +{ + float complex w; + + w = casinf(z); + w = ((float)M_PI_2 - crealf(w)) - cimagf(w) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cacosh.c b/lib/mlibc/options/ansi/generic/complex/cacosh.c new file mode 100644 index 0000000..3d42c40 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cacosh.c @@ -0,0 +1,93 @@ +/* $NetBSD: cacosh.c,v 1.2 2009/08/03 19:41:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<cacosh>>, <<cacoshf>>---complex arc hyperbolic cosine + +INDEX + cacosh +INDEX + cacoshf + +ANSI_SYNOPSIS + #include <complex.h> + double complex cacosh(double complex <[z]>); + float complex cacoshf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex arc hyperbolic cosine of <[z]>, + with a branch cut at values less than 1 along the real axis. + + <<cacoshf>> is identical to <<cacosh>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + These functions return the complex arc hyperbolic cosine value, + in the range of a half-strip of non-negative values along the + real axis and in the interval [-i * pi, +i * pi] along the + imaginary axis. + @end ifnottex + @tex + These functions return the complex arc hyperbolic cosine value, + in the range of a half-strip of non-negative values along the + real axis and in the interval [$-i\pi$, $+i\pi$] along the + imaginary axis. + @end tex + +PORTABILITY + <<cacosh>> and <<cacoshf>> are ISO C99 + +QUICKREF + <<cacosh>> and <<cacoshf>> are ISO C99 + +*/ + + +#include <complex.h> + +double complex +cacosh(double complex z) +{ + double complex w; + +#if 0 /* does not give the principal value */ + w = I * cacos(z); +#else + w = clog(z + csqrt(z + 1) * csqrt(z - 1)); +#endif + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cacoshf.c b/lib/mlibc/options/ansi/generic/complex/cacoshf.c new file mode 100644 index 0000000..41a557a --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cacoshf.c @@ -0,0 +1,48 @@ +/* $NetBSD: cacoshf.c,v 1.2 2009/08/03 19:41:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> + +float complex +cacoshf(float complex z) +{ + float complex w; + +#if 0 /* does not give the principal value */ + w = I * cacosf(z); +#else + w = clogf(z + csqrtf(z + 1) * csqrtf(z - 1)); +#endif + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/carg.c b/lib/mlibc/options/ansi/generic/complex/carg.c new file mode 100644 index 0000000..0447420 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/carg.c @@ -0,0 +1,59 @@ +/* $NetBSD: carg.c,v 1.1 2007/08/20 16:01:31 drochner Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<carg>>, <<cargf>>---argument (phase angle) + +INDEX + carg +INDEX + cargf + +ANSI_SYNOPSIS + #include <complex.h> + double carg(double complex <[z]>); + float cargf(float complex <[z]>); + + +DESCRIPTION + These functions compute the argument (also called phase angle) + of <[z]>, with a branch cut along the negative real axis. + + <<cargf>> is identical to <<carg>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + The carg functions return the value of the argument in the + interval [-pi, +pi] + @end ifnottex + @tex + The carg functions return the value of the argument in the + interval [$-\pi$, $+\pi$] + @end tex + +PORTABILITY + <<carg>> and <<cargf>> are ISO C99 + +QUICKREF + <<carg>> and <<cargf>> are ISO C99 + +*/ + +#include <complex.h> +#include <math.h> + +double +carg(double complex z) +{ + + return atan2( cimag(z) , creal(z) ); +} diff --git a/lib/mlibc/options/ansi/generic/complex/cargf.c b/lib/mlibc/options/ansi/generic/complex/cargf.c new file mode 100644 index 0000000..1683d21 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cargf.c @@ -0,0 +1,19 @@ +/* $NetBSD: cargf.c,v 1.1 2007/08/20 16:01:31 drochner Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float +cargf(float complex z) +{ + + return atan2f( cimagf(z), crealf(z) ); +} diff --git a/lib/mlibc/options/ansi/generic/complex/casin.c b/lib/mlibc/options/ansi/generic/complex/casin.c new file mode 100644 index 0000000..5019fd8 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/casin.c @@ -0,0 +1,165 @@ +/* $NetBSD: casin.c,v 1.1 2007/08/20 16:01:31 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<casin>>, <<casinf>>---complex arc sine + +INDEX + casin +INDEX + casinf + +ANSI_SYNOPSIS + #include <complex.h> + double complex casin(double complex <[z]>); + float complex casinf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex arc sine of <[z]>, + with branch cuts outside the interval [-1, +1] along the real axis. + + <<casinf>> is identical to <<casin>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + These functions return the complex arc sine value, in the range + of a strip mathematically unbounded along the imaginary axis + and in the interval [-pi/2, +pi/2] along the real axis. + @end ifnottex + @tex + These functions return the complex arc sine value, in the range + of a strip mathematically unbounded along the imaginary axis + and in the interval [$-\pi/2$, $+\pi/2$] along the real axis. + @end tex + +PORTABILITY + <<casin>> and <<casinf>> are ISO C99 + +QUICKREF + <<casin>> and <<casinf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> + +#ifdef __weak_alias +__weak_alias(casin, _casin) +#endif + +double complex +casin(double complex z) +{ + double complex w; + double complex ca, ct, zz, z2; + double x, y; + + x = creal(z); + y = cimag(z); + +#if 0 /* MD: test is incorrect, casin(>1) is defined */ + if (y == 0.0) { + if (fabs(x) > 1.0) { + w = M_PI_2 + 0.0 * I; +#if 0 + mtherr ("casin", DOMAIN); +#endif + } else { + w = asin(x) + 0.0 * I; + } + return w; + } +#endif + +/* Power series expansion */ +/* +b = cabs(z); +if( b < 0.125 ) +{ +z2.r = (x - y) * (x + y); +z2.i = 2.0 * x * y; + +cn = 1.0; +n = 1.0; +ca.r = x; +ca.i = y; +sum.r = x; +sum.i = y; +do + { + ct.r = z2.r * ca.r - z2.i * ca.i; + ct.i = z2.r * ca.i + z2.i * ca.r; + ca.r = ct.r; + ca.i = ct.i; + + cn *= n; + n += 1.0; + cn /= n; + n += 1.0; + b = cn/n; + + ct.r *= b; + ct.i *= b; + sum.r += ct.r; + sum.i += ct.i; + b = fabs(ct.r) + fabs(ct.i); + } +while( b > MACHEP ); +w->r = sum.r; +w->i = sum.i; +return; +} +*/ + + + ca = x + y * I; + ct = ca * I; + /* sqrt( 1 - z*z) */ + /* cmul( &ca, &ca, &zz ) */ + /*x * x - y * y */ + zz = (x - y) * (x + y) + (2.0 * x * y) * I; + + zz = 1.0 - creal(zz) - cimag(zz) * I; + z2 = csqrt(zz); + + zz = ct + z2; + zz = clog(zz); + /* multiply by 1/i = -i */ + w = zz * (-1.0 * I); + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/casinf.c b/lib/mlibc/options/ansi/generic/complex/casinf.c new file mode 100644 index 0000000..9a9f759 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/casinf.c @@ -0,0 +1,122 @@ +/* $NetBSD: casinf.c,v 1.1 2007/08/20 16:01:31 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +#ifdef __weak_alias +__weak_alias(casinf, _casinf) +#endif + +float complex +casinf(float complex z) +{ + float complex w; + float complex ca, ct, zz, z2; + float x, y; + + x = crealf(z); + y = cimagf(z); + +#if 0 /* MD: test is incorrect, casin(>1) is defined */ + if (y == 0.0f) { + if (fabsf(x) > 1.0) { + w = M_PI_2 + 0.0f * I; +#if 0 + mtherr ("casin", DOMAIN); +#endif + } else { + w = asinf(x) + 0.0f * I; + } + return w; + } +#endif + +/* Power series expansion */ +/* +b = cabsf(z); +if( b < 0.125 ) +{ +z2.r = (x - y) * (x + y); +z2.i = 2.0 * x * y; + +cn = 1.0; +n = 1.0; +ca.r = x; +ca.i = y; +sum.r = x; +sum.i = y; +do + { + ct.r = z2.r * ca.r - z2.i * ca.i; + ct.i = z2.r * ca.i + z2.i * ca.r; + ca.r = ct.r; + ca.i = ct.i; + + cn *= n; + n += 1.0; + cn /= n; + n += 1.0; + b = cn/n; + + ct.r *= b; + ct.i *= b; + sum.r += ct.r; + sum.i += ct.i; + b = fabsf(ct.r) + fabsf(ct.i); + } +while( b > MACHEP ); +w->r = sum.r; +w->i = sum.i; +return; +} +*/ + + + ca = x + y * I; + ct = ca * I; + /* sqrt( 1 - z*z) */ + /* cmul( &ca, &ca, &zz ) */ + /*x * x - y * y */ + zz = (x - y) * (x + y) + (2.0f * x * y) * I; + + zz = 1.0f - crealf(zz) - cimagf(zz) * I; + z2 = csqrtf(zz); + + zz = ct + z2; + zz = clogf(zz); + /* multiply by 1/i = -i */ + w = zz * (-1.0f * I); + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/casinh.c b/lib/mlibc/options/ansi/generic/complex/casinh.c new file mode 100644 index 0000000..16238a6 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/casinh.c @@ -0,0 +1,97 @@ +/* $NetBSD: casinh.c,v 1.1 2007/08/20 16:01:31 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<casinh>>, <<casinhf>>---complex arc hyperbolic sine + +INDEX + casinh +INDEX + casinhf + +ANSI_SYNOPSIS + #include <complex.h> + double complex casinh(double complex <[z]>); + float complex casinhf(float complex <[z]>); + + +DESCRIPTION + @ifnottex + These functions compute the complex arc hyperbolic sine of <[z]>, + with branch cuts outside the interval [-i, +i] along the + imaginary axis. + @end ifnottex + @tex + These functions compute the complex arc hyperbolic sine of <[z]>, + with branch cuts outside the interval [$-i$, $+i$] along the + imaginary axis. + @end tex + + <<casinhf>> is identical to <<casinh>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + These functions return the complex arc hyperbolic sine value, + in the range of a strip mathematically unbounded along the + real axis and in the interval [-i*p/2, +i*p/2] along the + imaginary axis. + @end ifnottex + @tex + These functions return the complex arc hyperbolic sine value, + in the range of a strip mathematically unbounded along the + real axis and in the interval [$-i\pi/2$, $+i\pi/2$] along the + imaginary axis. + @end tex + +PORTABILITY + <<casinh>> and <<casinhf>> are ISO C99 + +QUICKREF + <<casinh>> and <<casinhf>> are ISO C99 + +*/ + + +#include <complex.h> + +double complex +casinh(double complex z) +{ + double complex w; + + w = -1.0 * I * casin(z * I); + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/casinhf.c b/lib/mlibc/options/ansi/generic/complex/casinhf.c new file mode 100644 index 0000000..0db55a0 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/casinhf.c @@ -0,0 +1,44 @@ +/* $NetBSD: casinhf.c,v 1.1 2007/08/20 16:01:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> + +float complex +casinhf(float complex z) +{ + float complex w; + + w = -1.0f * I * casinf(z * I); + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/catan.c b/lib/mlibc/options/ansi/generic/complex/catan.c new file mode 100644 index 0000000..0cf4739 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/catan.c @@ -0,0 +1,130 @@ +/* $NetBSD: catan.c,v 1.1 2007/08/20 16:01:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<catan>>, <<catanf>>---complex arc tangent + +INDEX + catan +INDEX + catanf + +ANSI_SYNOPSIS + #include <complex.h> + double complex catan(double complex <[z]>); + float complex catanf(float complex <[z]>); + + +DESCRIPTION + @ifnottex + These functions compute the complex arc tangent of <[z]>, + with branch cuts outside the interval [-i, +i] along the + imaginary axis. + @end ifnottex + @tex + These functions compute the complex arc tangent of <[z]>, + with branch cuts outside the interval [$-i$, $+i$] along the + imaginary axis. + @end tex + + <<catanf>> is identical to <<catan>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + These functions return the complex arc tangent value, in the range + of a strip mathematically unbounded along the imaginary axis + and in the interval [-pi/2, +pi/2] along the real axis. + @end ifnottex + @tex + These functions return the complex arc tangent, in the range + of a strip mathematically unbounded along the imaginary axis + and in the interval [$-\pi/2$, $+\pi/2$] along the real axis. + @end tex + +PORTABILITY + <<catan>> and <<catanf>> are ISO C99 + +QUICKREF + <<catan>> and <<catanf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> +#include "cephes_subr.h" + +#ifdef __weak_alias +__weak_alias(catan, _catan) +#endif + +double complex +catan(double complex z) +{ + double complex w; + double a, t, x, x2, y; + + x = creal(z); + y = cimag(z); + + if ((x == 0.0) && (y > 1.0)) + goto ovrf; + + x2 = x * x; + a = 1.0 - x2 - (y * y); + if (a == 0.0) + goto ovrf; + + t = 0.5 * atan2(2.0 * x, a); + w = __mlibc_redupi(t); + + t = y - 1.0; + a = x2 + (t * t); + if (a == 0.0) + goto ovrf; + + t = y + 1.0; + a = (x2 + (t * t))/a; + w = w + (0.25 * log(a)) * I; + return w; + +ovrf: +#if 0 + mtherr ("catan", OVERFLOW); +#endif + w = HUGE_VAL + HUGE_VAL * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/catanf.c b/lib/mlibc/options/ansi/generic/complex/catanf.c new file mode 100644 index 0000000..33c47df --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/catanf.c @@ -0,0 +1,79 @@ +/* $NetBSD: catanf.c,v 1.1 2007/08/20 16:01:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> +#include "cephes_subrf.h" + +#ifdef __weak_alias +__weak_alias(catanf, _catanf) +#endif + +float complex +catanf(float complex z) +{ + float complex w; + float a, t, x, x2, y; + + x = crealf(z); + y = cimagf(z); + + if ((x == 0.0f) && (y > 1.0f)) + goto ovrf; + + x2 = x * x; + a = 1.0f - x2 - (y * y); + if (a == 0.0f) + goto ovrf; + + t = 0.5f * atan2f(2.0f * x, a); + w = __mlibc_redupif(t); + + t = y - 1.0f; + a = x2 + (t * t); + if (a == 0.0f) + goto ovrf; + + t = y + 1.0f; + a = (x2 + (t * t))/a; + w = w + (0.25f * logf(a)) * I; + return w; + +ovrf: +#if 0 + mtherr ("catan", OVERFLOW); +#endif + w = HUGE_VALF + HUGE_VALF * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/catanh.c b/lib/mlibc/options/ansi/generic/complex/catanh.c new file mode 100644 index 0000000..2b9ef9e --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/catanh.c @@ -0,0 +1,90 @@ +/* $NetBSD: catanh.c,v 1.1 2007/08/20 16:01:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<catanh>>, <<catanhf>>---complex arc hyperbolic tangent + +INDEX + catanh +INDEX + catanhf + +ANSI_SYNOPSIS + #include <complex.h> + double complex catanh(double complex <[z]>); + float complex catanhf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex arc hyperbolic tan of <[z]>, + with branch cuts outside the interval [-1, +1] along the + real axis. + + <<catanhf>> is identical to <<catanh>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + These functions return the complex arc hyperbolic tangent value, + in the range of a strip mathematically unbounded along the + real axis and in the interval [-i*p/2, +i*p/2] along the + imaginary axis. + @end ifnottex + @tex + These functions return the complex arc hyperbolic tangent value, + in the range of a strip mathematically unbounded along the + real axis and in the interval [$-i\pi/2$, $+i\pi/2$] along the + imaginary axis. + @end tex + +PORTABILITY + <<catanh>> and <<catanhf>> are ISO C99 + +QUICKREF + <<catanh>> and <<catanhf>> are ISO C99 + +*/ + + +#include <complex.h> + +double complex +catanh(double complex z) +{ + double complex w; + + w = -1.0 * I * catan(z * I); + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/catanhf.c b/lib/mlibc/options/ansi/generic/complex/catanhf.c new file mode 100644 index 0000000..fe6127a --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/catanhf.c @@ -0,0 +1,44 @@ +/* $NetBSD: catanhf.c,v 1.1 2007/08/20 16:01:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> + +float complex +catanhf(float complex z) +{ + float complex w; + + w = -1.0f * I * catanf(z * I); + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ccos.c b/lib/mlibc/options/ansi/generic/complex/ccos.c new file mode 100644 index 0000000..ebb52bf --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ccos.c @@ -0,0 +1,81 @@ +/* $NetBSD: ccos.c,v 1.1 2007/08/20 16:01:32 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<ccos>>, <<ccosf>>---complex cosine + +INDEX + ccos +INDEX + ccosf + +ANSI_SYNOPSIS + #include <complex.h> + double complex ccos(double complex <[z]>); + float complex ccosf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex cosine of <[z]>. + + <<ccosf>> is identical to <<ccos>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + These functions return the complex cosine value. + +PORTABILITY + <<ccos>> and <<ccosf>> are ISO C99 + +QUICKREF + <<ccos>> and <<ccosf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> +#include "cephes_subr.h" + +double complex +ccos(double complex z) +{ + double complex w; + double ch, sh; + + __mlibc_cchsh(cimag(z), &ch, &sh); + w = cos(creal(z)) * ch - (sin(creal(z)) * sh) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ccosf.c b/lib/mlibc/options/ansi/generic/complex/ccosf.c new file mode 100644 index 0000000..db7fab3 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ccosf.c @@ -0,0 +1,48 @@ +/* $NetBSD: ccosf.c,v 1.1 2007/08/20 16:01:33 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> +#include "cephes_subrf.h" + +float complex +ccosf(float complex z) +{ + float complex w; + float ch, sh; + + __mlibc_cchshf(cimagf(z), &ch, &sh); + w = cosf(crealf(z)) * ch - (sinf(crealf(z)) * sh) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ccosh.c b/lib/mlibc/options/ansi/generic/complex/ccosh.c new file mode 100644 index 0000000..223a5ed --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ccosh.c @@ -0,0 +1,81 @@ +/* $NetBSD: ccosh.c,v 1.1 2007/08/20 16:01:33 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<ccosh>>, <<ccoshf>>---complex hyperbolic cosine + +INDEX + ccosh +INDEX + ccoshf + +ANSI_SYNOPSIS + #include <complex.h> + double complex ccosh(double complex <[z]>); + float complex ccoshf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex hyperbolic cosine of <[z]>. + + <<ccoshf>> is identical to <<ccosh>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + These functions return the complex hyperbolic cosine value. + +PORTABILITY + <<ccosh>> and <<ccoshf>> are ISO C99 + +QUICKREF + <<ccosh>> and <<ccoshf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> + +double complex +ccosh(double complex z) +{ + double complex w; + double x, y; + + x = creal(z); + y = cimag(z); + w = cosh(x) * cos(y) + (sinh(x) * sin(y)) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ccoshf.c b/lib/mlibc/options/ansi/generic/complex/ccoshf.c new file mode 100644 index 0000000..af11353 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ccoshf.c @@ -0,0 +1,48 @@ +/* $NetBSD: ccoshf.c,v 1.1 2007/08/20 16:01:33 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +ccoshf(float complex z) +{ + float complex w; + float x, y; + + x = crealf(z); + y = cimagf(z); + w = coshf(x) * cosf(y) + (sinhf(x) * sinf(y)) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cephes_subr.c b/lib/mlibc/options/ansi/generic/complex/cephes_subr.c new file mode 100644 index 0000000..fe08b42 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cephes_subr.c @@ -0,0 +1,126 @@ +/* $NetBSD: cephes_subr.c,v 1.1 2007/08/20 16:01:33 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> +#include "cephes_subr.h" + +/* calculate cosh and sinh */ + +void +__mlibc_cchsh(double x, double *c, double *s) +{ + double e, ei; + + if (fabs(x) <= 0.5) { + *c = cosh(x); + *s = sinh(x); + } else { + e = exp(x); + ei = 0.5 / e; + e = 0.5 * e; + *s = e - ei; + *c = e + ei; + } +} + +/* Program to subtract nearest integer multiple of PI */ + +/* extended precision value of PI: */ +static const double DP1 = 3.14159265160560607910E0; +static const double DP2 = 1.98418714791870343106E-9; +static const double DP3 = 1.14423774522196636802E-17; +#define MACHEP 1.1e-16 + +double +__mlibc_redupi(double x) +{ + double t; + long i; + + t = x / M_PI; + if (t >= 0.0) + t += 0.5; + else + t -= 0.5; + + i = t; /* the multiple */ + t = i; + t = ((x - t * DP1) - t * DP2) - t * DP3; + return t; +} + +/* Taylor series expansion for cosh(2y) - cos(2x) */ + +double +__mlibc_ctans(double complex z) +{ + double f, x, x2, y, y2, rn, t; + double d; + + x = fabs(2.0 * creal(z)); + y = fabs(2.0 * cimag(z)); + + x = __mlibc_redupi(x); + + x = x * x; + y = y * y; + x2 = 1.0; + y2 = 1.0; + f = 1.0; + rn = 0.0; + d = 0.0; + do { + rn += 1.0; + f *= rn; + rn += 1.0; + f *= rn; + x2 *= x; + y2 *= y; + t = y2 + x2; + t /= f; + d += t; + + rn += 1.0; + f *= rn; + rn += 1.0; + f *= rn; + x2 *= x; + y2 *= y; + t = y2 - x2; + t /= f; + d += t; + } while (fabs(t/d) > MACHEP); + return d; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cephes_subr.h b/lib/mlibc/options/ansi/generic/complex/cephes_subr.h new file mode 100644 index 0000000..719075e --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cephes_subr.h @@ -0,0 +1,9 @@ +/* $NetBSD: cephes_subr.h,v 1.1 2007/08/20 16:01:33 drochner Exp $ */ + +#ifndef __MLIBC_ABI_ONLY + +void __mlibc_cchsh(double, double *, double *); +double __mlibc_redupi(double); +double __mlibc_ctans(double complex); + +#endif /* !__MLIBC_ABI_ONLY */ diff --git a/lib/mlibc/options/ansi/generic/complex/cephes_subrf.c b/lib/mlibc/options/ansi/generic/complex/cephes_subrf.c new file mode 100644 index 0000000..1ce18e5 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cephes_subrf.c @@ -0,0 +1,125 @@ +/* $NetBSD: cephes_subrf.c,v 1.1 2007/08/20 16:01:34 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> +#include "cephes_subrf.h" + +/* calculate cosh and sinh */ + +void +__mlibc_cchshf(float x, float *c, float *s) +{ + float e, ei; + + if (fabsf(x) <= 0.5f) { + *c = coshf(x); + *s = sinhf(x); + } else { + e = expf(x); + ei = 0.5f / e; + e = 0.5f * e; + *s = e - ei; + *c = e + ei; + } +} + +/* Program to subtract nearest integer multiple of PI */ + +/* extended precision value of PI: */ +static const double DP1 = 3.140625; +static const double DP2 = 9.67502593994140625E-4; +static const double DP3 = 1.509957990978376432E-7; +#define MACHEPF 3.0e-8 + +float +__mlibc_redupif(float x) +{ + float t; + long i; + + t = x / (float)M_PI; + if (t >= 0.0f) + t += 0.5f; + else + t -= 0.5f; + + i = t; /* the multiple */ + t = i; + t = ((x - t * DP1) - t * DP2) - t * DP3; + return t; +} + +/* Taylor series expansion for cosh(2y) - cos(2x) */ + +float +__mlibc_ctansf(float complex z) +{ + float f, x, x2, y, y2, rn, t, d; + + x = fabsf(2.0f * crealf(z)); + y = fabsf(2.0f * cimagf(z)); + + x = __mlibc_redupif(x); + + x = x * x; + y = y * y; + x2 = 1.0f; + y2 = 1.0f; + f = 1.0f; + rn = 0.0f; + d = 0.0f; + do { + rn += 1.0f; + f *= rn; + rn += 1.0f; + f *= rn; + x2 *= x; + y2 *= y; + t = y2 + x2; + t /= f; + d += t; + + rn += 1.0f; + f *= rn; + rn += 1.0f; + f *= rn; + x2 *= x; + y2 *= y; + t = y2 - x2; + t /= f; + d += t; + } while (fabsf(t/d) > MACHEPF); + return d; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cephes_subrf.h b/lib/mlibc/options/ansi/generic/complex/cephes_subrf.h new file mode 100644 index 0000000..84cdd82 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cephes_subrf.h @@ -0,0 +1,9 @@ +/* $NetBSD: cephes_subrf.h,v 1.1 2007/08/20 16:01:34 drochner Exp $ */ + +#ifndef __MLIBC_ABI_ONLY + +void __mlibc_cchshf(float, float *, float *); +float __mlibc_redupif(float); +float __mlibc_ctansf(float complex); + +#endif /* !__MLIBC_ABI_ONLY */ diff --git a/lib/mlibc/options/ansi/generic/complex/cexp.c b/lib/mlibc/options/ansi/generic/complex/cexp.c new file mode 100644 index 0000000..b9a3fd0 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cexp.c @@ -0,0 +1,82 @@ +/* $NetBSD: cexp.c,v 1.1 2007/08/20 16:01:34 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<cexp>>, <<cexpf>>---complex base-e exponential + +INDEX + cexp +INDEX + cexpf + +ANSI_SYNOPSIS + #include <complex.h> + double complex cexp(double complex <[z]>); + float complex cexpf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex base-<[e]> exponential of <[z]>. + + <<cexpf>> is identical to <<cexp>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The cexp functions return the complex base-<[e]> exponential value. + +PORTABILITY + <<cexp>> and <<cexpf>> are ISO C99 + +QUICKREF + <<cexp>> and <<cexpf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> + +double complex +cexp(double complex z) +{ + double complex w; + double r, x, y; + + x = creal(z); + y = cimag(z); + r = exp(x); + w = r * cos(y) + r * sin(y) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cexpf.c b/lib/mlibc/options/ansi/generic/complex/cexpf.c new file mode 100644 index 0000000..07fab1f --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cexpf.c @@ -0,0 +1,49 @@ +/* $NetBSD: cexpf.c,v 1.1 2007/08/20 16:01:34 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +cexpf(float complex z) +{ + float complex w; + float r, x, y; + + x = crealf(z); + y = cimagf(z); + r = expf(x); + w = r * cosf(y) + r * sinf(y) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cimag.c b/lib/mlibc/options/ansi/generic/complex/cimag.c new file mode 100644 index 0000000..24619f0 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cimag.c @@ -0,0 +1,54 @@ +/* $NetBSD: cimag.c,v 1.2 2010/09/15 16:11:29 christos Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<cimag>>, <<cimagf>>---imaginary part + +INDEX + cimag +INDEX + cimagf + +ANSI_SYNOPSIS + #include <complex.h> + double cimag(double complex <[z]>); + float cimagf(float complex <[z]>); + + +DESCRIPTION + These functions compute the imaginary part of <[z]>. + + <<cimagf>> is identical to <<cimag>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The cimag functions return the imaginary part value (as a real). + +PORTABILITY + <<cimag>> and <<cimagf>> are ISO C99 + +QUICKREF + <<cimag>> and <<cimagf>> are ISO C99 + +*/ + + +#include <complex.h> + +#include "fdlibm.h" + +double +cimag(double complex z) +{ + double_complex w = { .z = z }; + + return (IMAG_PART(w)); +} diff --git a/lib/mlibc/options/ansi/generic/complex/cimagf.c b/lib/mlibc/options/ansi/generic/complex/cimagf.c new file mode 100644 index 0000000..28ed81c --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cimagf.c @@ -0,0 +1,21 @@ +/* $NetBSD: cimagf.c,v 1.2 2010/09/15 16:11:29 christos Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> + +#include "fdlibm.h" + +float +cimagf(float complex z) +{ + float_complex w = { .z = z }; + + return (IMAG_PART(w)); +} diff --git a/lib/mlibc/options/ansi/generic/complex/clog.c b/lib/mlibc/options/ansi/generic/complex/clog.c new file mode 100644 index 0000000..f7ad3d2 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/clog.c @@ -0,0 +1,91 @@ +/* $NetBSD: clog.c,v 1.1 2007/08/20 16:01:35 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<clog>>, <<clogf>>---complex base-e logarithm + +INDEX + clog +INDEX + clogf + +ANSI_SYNOPSIS + #include <complex.h> + double complex clog(double complex <[z]>); + float complex clogf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex natural (base-<[e]>) logarithm + of <[z]>, with a branch cut along the negative real axis. + + <<clogf>> is identical to <<clog>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + @ifnottex + The clog functions return the complex natural logarithm value, in + the range of a strip mathematically unbounded along the real axis + and in the interval [-i*pi , +i*pi] along the imaginary axis. + @end ifnottex + @tex + The clog functions return the complex natural logarithm value, in + the range of a strip mathematically unbounded along the real axis + and in the interval [$-i\pi$, $+i\pi$] along the imaginary axis. + @end tex + +PORTABILITY + <<clog>> and <<clogf>> are ISO C99 + +QUICKREF + <<clog>> and <<clogf>> are ISO C99 + +*/ + +#include <complex.h> +#include <math.h> + +double complex +clog(double complex z) +{ + double complex w; + double p, rr; + + rr = cabs(z); + p = log(rr); + rr = atan2(cimag(z), creal(z)); + w = p + rr * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/clogf.c b/lib/mlibc/options/ansi/generic/complex/clogf.c new file mode 100644 index 0000000..078cea5 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/clogf.c @@ -0,0 +1,49 @@ +/* $NetBSD: clogf.c,v 1.1 2007/08/20 16:01:35 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +clogf(float complex z) +{ + float complex w; + float p, rr; + + rr = cabsf(z); + p = logf(rr); + rr = atan2f(cimagf(z), crealf(z)); + w = p + rr * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/conj.c b/lib/mlibc/options/ansi/generic/complex/conj.c new file mode 100644 index 0000000..a761b5a --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/conj.c @@ -0,0 +1,56 @@ +/* $NetBSD: conj.c,v 1.2 2010/09/15 16:11:29 christos Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<conj>>, <<conjf>>---complex conjugate + +INDEX + conj +INDEX + conjf + +ANSI_SYNOPSIS + #include <complex.h> + double complex conj(double complex <[z]>); + float complex conjf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex conjugate of <[z]>, + by reversing the sign of its imaginary part. + + <<conjf>> is identical to <<conj>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The conj functions return the complex conjugate value. + +PORTABILITY + <<conj>> and <<conjf>> are ISO C99 + +QUICKREF + <<conj>> and <<conjf>> are ISO C99 + +*/ + +#include <complex.h> + +#include "fdlibm.h" + +double complex +conj(double complex z) +{ + double_complex w = { .z = z }; + + IMAG_PART(w) = -IMAG_PART(w); + + return (w.z); +} diff --git a/lib/mlibc/options/ansi/generic/complex/conjf.c b/lib/mlibc/options/ansi/generic/complex/conjf.c new file mode 100644 index 0000000..0ca71ef --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/conjf.c @@ -0,0 +1,23 @@ +/* $NetBSD: conjf.c,v 1.2 2010/09/15 16:11:29 christos Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> + +#include "fdlibm.h" + +float complex +conjf(float complex z) +{ + float_complex w = { .z = z }; + + IMAG_PART(w) = -IMAG_PART(w); + + return (w.z); +} diff --git a/lib/mlibc/options/ansi/generic/complex/cpow.c b/lib/mlibc/options/ansi/generic/complex/cpow.c new file mode 100644 index 0000000..b60f7be --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cpow.c @@ -0,0 +1,101 @@ +/* $NetBSD: cpow.c,v 1.1 2007/08/20 16:01:35 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<cpow>>, <<cpowf>>---complex power + +INDEX + cpow +INDEX + cpowf + +ANSI_SYNOPSIS + #include <complex.h> + double complex cpow(double complex <[x]>, double complex <[y]>); + float complex cpowf(float complex <[x]>, float complex <[y]>); + + +DESCRIPTION + @ifnottex + The cpow functions compute the complex power function x^y + power, with a branch cut for the first parameter along the + negative real axis. + @end ifnottex + @tex + The cpow functions compute the complex power function $x^y$ + power, with a branch cut for the first parameter along the + negative real axis. + @end tex + + <<cpowf>> is identical to <<cpow>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The cpow functions return the complex power function value. + +PORTABILITY + <<cpow>> and <<cpowf>> are ISO C99 + +QUICKREF + <<cpow>> and <<cpowf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> + +double complex +cpow(double complex a, double complex z) +{ + double complex w; + double x, y, r, theta, absa, arga; + + x = creal(z); + y = cimag(z); + absa = cabs(a); + if (absa == 0.0) { + return (0.0 + 0.0 * I); + } + arga = carg(a); + r = pow(absa, x); + theta = x * arga; + if (y != 0.0) { + r = r * exp(-y * arga); + theta = theta + y * log(absa); + } + w = r * cos(theta) + (r * sin(theta)) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cpowf.c b/lib/mlibc/options/ansi/generic/complex/cpowf.c new file mode 100644 index 0000000..1e736af --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cpowf.c @@ -0,0 +1,59 @@ +/* $NetBSD: cpowf.c,v 1.1 2007/08/20 16:01:36 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +cpowf(float complex a, float complex z) +{ + float complex w; + float x, y, r, theta, absa, arga; + + x = crealf(z); + y = cimagf(z); + absa = cabsf(a); + if (absa == 0.0f) { + return (0.0f + 0.0f * I); + } + arga = cargf(a); + r = powf(absa, x); + theta = x * arga; + if (y != 0.0f) { + r = r * expf(-y * arga); + theta = theta + y * logf(absa); + } + w = r * cosf(theta) + (r * sinf(theta)) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/cproj.c b/lib/mlibc/options/ansi/generic/complex/cproj.c new file mode 100644 index 0000000..0ed50f2 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cproj.c @@ -0,0 +1,105 @@ +/* $NetBSD: cproj.c,v 1.3 2010/09/20 17:51:38 christos Exp $ */ + +/*- + * Copyright (c) 2010 The NetBSD Foundation, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<cproj>>, <<cprojf>>--- Riemann sphere projection + +INDEX + cproj +INDEX + cprojf + +ANSI_SYNOPSIS + #include <complex.h> + double complex cproj(double complex <[z]>); + float complex cprojf(float complex <[z]>); + + +DESCRIPTION + These functions compute a projection of <[z]> onto the Riemann + sphere: <[z]> projects to <[z]> except that all complex infinities + (even those with one infinite part and one NaN part) project + to positive infinity on the real axis. If <[z]> has an infinite part, + then <<cproj>>(<[z]>) is equivalent to + + INFINITY + I * copysign(0.0, cimag(z)) + + <<cprojf>> is identical to <<cproj>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The cproj functions return the value of the projection onto + the Riemann sphere. + +PORTABILITY + <<cproj>> and <<cprojf>> are ISO C99 + +QUICKREF + <<cproj>> and <<cprojf>> are ISO C99 + +*/ + +/*__RCSID("$NetBSD: cproj.c,v 1.3 2010/09/20 17:51:38 christos Exp $"); */ + +#include <complex.h> +#include <math.h> + +#include "fdlibm.h" + +/* + * cproj(double complex z) + * + * These functions return the value of the projection (not stereographic!) + * onto the Riemann sphere. + * + * z projects to z, except that all complex infinities (even those with one + * infinite part and one NaN part) project to positive infinity on the real axis. + * If z has an infinite part, then cproj(z) shall be equivalent to: + * + * INFINITY + I * copysign(0.0, cimag(z)) + */ +double complex +cproj(double complex z) +{ + double_complex w = { .z = z }; + + if (isinf(creal(z)) || isinf(cimag(z))) { +#ifdef __INFINITY + REAL_PART(w) = __INFINITY; +#else + REAL_PART(w) = INFINITY; +#endif + IMAG_PART(w) = copysign(0.0, cimag(z)); + } + + return (w.z); +} diff --git a/lib/mlibc/options/ansi/generic/complex/cprojf.c b/lib/mlibc/options/ansi/generic/complex/cprojf.c new file mode 100644 index 0000000..76c3d8a --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/cprojf.c @@ -0,0 +1,67 @@ +/* $NetBSD: cprojf.c,v 1.3 2010/09/20 17:51:38 christos Exp $ */ + +/*- + * Copyright (c) 2010 The NetBSD Foundation, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/*__RCSID("$NetBSD: cprojf.c,v 1.3 2010/09/20 17:51:38 christos Exp $"); */ + +#include <complex.h> +#include <math.h> + +#include "fdlibm.h" + +/* + * cprojf(float complex z) + * + * These functions return the value of the projection (not stereographic!) + * onto the Riemann sphere. + * + * z projects to z, except that all complex infinities (even those with one + * infinite part and one NaN part) project to positive infinity on the real axis. + * If z has an infinite part, then cproj(z) shall be equivalent to: + * + * INFINITY + I * copysign(0.0, cimag(z)) + */ + +float complex +cprojf(float complex z) +{ + float_complex w = { .z = z }; + + if (isinf(crealf(z)) || isinf(cimagf(z))) { +#ifdef __INFINITY + REAL_PART(w) = __INFINITY; +#else + REAL_PART(w) = INFINITY; +#endif + IMAG_PART(w) = copysignf(0.0, cimagf(z)); + } + + return (w.z); +} diff --git a/lib/mlibc/options/ansi/generic/complex/creal.c b/lib/mlibc/options/ansi/generic/complex/creal.c new file mode 100644 index 0000000..07bf96f --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/creal.c @@ -0,0 +1,54 @@ +/* $NetBSD: creal.c,v 1.2 2010/09/15 16:11:29 christos Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<creal>>, <<crealf>>---real part + +INDEX + creal +INDEX + crealf + +ANSI_SYNOPSIS + #include <complex.h> + double creal(double complex <[z]>); + float crealf(float complex <[z]>); + + +DESCRIPTION + These functions compute the real part of <[z]>. + + <<crealf>> is identical to <<creal>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The creal functions return the real part value. + +PORTABILITY + <<creal>> and <<crealf>> are ISO C99 + +QUICKREF + <<creal>> and <<crealf>> are ISO C99 + +*/ + + +#include <complex.h> + +#include "fdlibm.h" + +double +creal(double complex z) +{ + double_complex w = { .z = z }; + + return (REAL_PART(w)); +} diff --git a/lib/mlibc/options/ansi/generic/complex/crealf.c b/lib/mlibc/options/ansi/generic/complex/crealf.c new file mode 100644 index 0000000..245986d --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/crealf.c @@ -0,0 +1,21 @@ +/* $NetBSD: crealf.c,v 1.2 2010/09/15 16:11:29 christos Exp $ */ + +/* + * Written by Matthias Drochner <drochner@NetBSD.org>. + * Public domain. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> + +#include "fdlibm.h" + +float +crealf(float complex z) +{ + float_complex w = { .z = z }; + + return (REAL_PART(w)); +} diff --git a/lib/mlibc/options/ansi/generic/complex/csin.c b/lib/mlibc/options/ansi/generic/complex/csin.c new file mode 100644 index 0000000..b32d057 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/csin.c @@ -0,0 +1,81 @@ +/* $NetBSD: csin.c,v 1.1 2007/08/20 16:01:36 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<csin>>, <<csinf>>---complex sine + +INDEX + csin +INDEX + csinf + +ANSI_SYNOPSIS + #include <complex.h> + double complex csin(double complex <[z]>); + float complex csinf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex sine of <[z]>. + + <<csinf>> is identical to <<csin>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + These functions return the complex sine value. + +PORTABILITY + <<csin>> and <<csinf>> are ISO C99 + +QUICKREF + <<csin>> and <<csinf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> +#include "cephes_subr.h" + +double complex +csin(double complex z) +{ + double complex w; + double ch, sh; + + __mlibc_cchsh(cimag(z), &ch, &sh); + w = sin(creal(z)) * ch + (cos(creal(z)) * sh) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/csinf.c b/lib/mlibc/options/ansi/generic/complex/csinf.c new file mode 100644 index 0000000..0d81d41 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/csinf.c @@ -0,0 +1,48 @@ +/* $NetBSD: csinf.c,v 1.1 2007/08/20 16:01:36 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> +#include "cephes_subrf.h" + +float complex +csinf(float complex z) +{ + float complex w; + float ch, sh; + + __mlibc_cchshf(cimagf(z), &ch, &sh); + w = sinf(crealf(z)) * ch + (cosf(crealf(z)) * sh) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/csinh.c b/lib/mlibc/options/ansi/generic/complex/csinh.c new file mode 100644 index 0000000..f117162 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/csinh.c @@ -0,0 +1,80 @@ +/* $NetBSD: csinh.c,v 1.1 2007/08/20 16:01:36 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<csinh>>, <<csinhf>>---complex hyperbolic sine + +INDEX + csinh +INDEX + csinhf + +ANSI_SYNOPSIS + #include <complex.h> + double complex csinh(double complex <[z]>); + float complex csinhf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex hyperbolic sine of <[z]>. + + <<ccoshf>> is identical to <<ccosh>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + These functions return the complex hyperbolic sine value. + +PORTABILITY + <<csinh>> and <<csinhf>> are ISO C99 + +QUICKREF + <<csinh>> and <<csinhf>> are ISO C99 + +*/ + +#include <complex.h> +#include <math.h> + +double complex +csinh(double complex z) +{ + double complex w; + double x, y; + + x = creal(z); + y = cimag(z); + w = sinh(x) * cos(y) + (cosh(x) * sin(y)) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/csinhf.c b/lib/mlibc/options/ansi/generic/complex/csinhf.c new file mode 100644 index 0000000..3cd6ba7 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/csinhf.c @@ -0,0 +1,48 @@ +/* $NetBSD: csinhf.c,v 1.1 2007/08/20 16:01:37 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +csinhf(float complex z) +{ + float complex w; + float x, y; + + x = crealf(z); + y = cimagf(z); + w = sinhf(x) * cosf(y) + (coshf(x) * sinf(y)) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/csqrt.c b/lib/mlibc/options/ansi/generic/complex/csqrt.c new file mode 100644 index 0000000..b144b7c --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/csqrt.c @@ -0,0 +1,137 @@ +/* $NetBSD: csqrt.c,v 1.1 2007/08/20 16:01:37 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<csqrt>>, <<csqrtf>>---complex square root + +INDEX + csqrt +INDEX + csqrtf + +ANSI_SYNOPSIS + #include <complex.h> + double complex csqrt(double complex <[z]>); + float complex csqrtf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex square root of <[z]>, with + a branch cut along the negative real axis. + + <<csqrtf>> is identical to <<csqrt>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + The csqrt functions return the complex square root value, in + the range of the right halfplane (including the imaginary axis). + +PORTABILITY + <<csqrt>> and <<csqrtf>> are ISO C99 + +QUICKREF + <<csqrt>> and <<csqrtf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> + +double complex +csqrt(double complex z) +{ + double complex w; + double x, y, r, t, scale; + + x = creal (z); + y = cimag (z); + + if (y == 0.0) { + if (x == 0.0) { + w = 0.0 + y * I; + } else { + r = fabs(x); + r = sqrt(r); + if (x < 0.0) { + w = 0.0 + r * I; + } else { + w = r + y * I; + } + } + return w; + } + if (x == 0.0) { + r = fabs(y); + r = sqrt(0.5 * r); + if (y > 0) + w = r + r * I; + else + w = r - r * I; + return w; + } + /* Rescale to avoid internal overflow or underflow. */ + if ((fabs(x) > 4.0) || (fabs(y) > 4.0)) { + x *= 0.25; + y *= 0.25; + scale = 2.0; + } else { +#if 1 + x *= 1.8014398509481984e16; /* 2^54 */ + y *= 1.8014398509481984e16; + scale = 7.450580596923828125e-9; /* 2^-27 */ +#else + x *= 4.0; + y *= 4.0; + scale = 0.5; +#endif + } + w = x + y * I; + r = cabs(w); + if (x > 0) { + t = sqrt(0.5 * r + 0.5 * x); + r = scale * fabs((0.5 * y) / t ); + t *= scale; + } else { + r = sqrt(0.5 * r - 0.5 * x); + t = scale * fabs((0.5 * y) / r); + r *= scale; + } + if (y < 0) + w = t - r * I; + else + w = t + r * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/csqrtf.c b/lib/mlibc/options/ansi/generic/complex/csqrtf.c new file mode 100644 index 0000000..13451fa --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/csqrtf.c @@ -0,0 +1,102 @@ +/* $NetBSD: csqrtf.c,v 1.1 2007/08/20 16:01:37 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +csqrtf(float complex z) +{ + float complex w; + float x, y, r, t, scale; + + x = crealf (z); + y = cimagf (z); + + if (y == 0.0f) { + if (x < 0.0f) { + w = 0.0f + sqrtf(-x) * I; + return w; + } else if (x == 0.0f) { + return (0.0f + y * I); + } else { + w = sqrtf(x) + y * I; + return w; + } + } + + if (x == 0.0f) { + r = fabsf(y); + r = sqrtf(0.5f * r); + if (y > 0) + w = r + r * I; + else + w = r - r * I; + return w; + } + + /* Rescale to avoid internal overflow or underflow. */ + if ((fabsf(x) > 4.0f) || (fabsf(y) > 4.0f)) { + x *= 0.25f; + y *= 0.25f; + scale = 2.0f; + } else { +#if 1 + x *= 6.7108864e7f; /* 2^26 */ + y *= 6.7108864e7f; + scale = 1.220703125e-4f; /* 2^-13 */ +#else + x *= 4.0f; + y *= 4.0f; + scale = 0.5f; +#endif + } + w = x + y * I; + r = cabsf(w); + if( x > 0 ) { + t = sqrtf(0.5f * r + 0.5f * x); + r = scale * fabsf((0.5f * y) / t); + t *= scale; + } else { + r = sqrtf(0.5f * r - 0.5f * x); + t = scale * fabsf((0.5f * y) / r); + r *= scale; + } + + if (y < 0) + w = t - r * I; + else + w = t + r * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ctan.c b/lib/mlibc/options/ansi/generic/complex/ctan.c new file mode 100644 index 0000000..600989d --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ctan.c @@ -0,0 +1,91 @@ +/* $NetBSD: ctan.c,v 1.1 2007/08/20 16:01:37 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<ctan>>, <<ctanf>>---complex tangent + +INDEX + ctan +INDEX + ctanf + +ANSI_SYNOPSIS + #include <complex.h> + double complex ctan(double complex <[z]>); + float complex ctanf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex tangent of <[z]>. + + <<ctanf>> is identical to <<ctan>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + These functions return the complex tangent value. + +PORTABILITY + <<ctan>> and <<ctanf>> are ISO C99 + +QUICKREF + <<ctan>> and <<ctanf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> +#include "cephes_subr.h" + +double complex +ctan(double complex z) +{ + double complex w; + double d; + + d = cos(2.0 * creal(z)) + cosh(2.0 * cimag(z)); + + if (fabs(d) < 0.25) + d = __mlibc_ctans(z); + + if (d == 0.0) { + /* mtherr ("ctan", OVERFLOW); */ + w = HUGE_VAL + HUGE_VAL * I; + return w; + } + + w = sin(2.0 * creal(z)) / d + (sinh(2.0 * cimag(z)) / d) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ctanf.c b/lib/mlibc/options/ansi/generic/complex/ctanf.c new file mode 100644 index 0000000..52360e0 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ctanf.c @@ -0,0 +1,58 @@ +/* $NetBSD: ctanf.c,v 1.1 2007/08/20 16:01:38 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> +#include "cephes_subrf.h" + +float complex +ctanf(float complex z) +{ + float complex w; + float d; + + d = cosf(2.0f * crealf(z)) + coshf(2.0f * cimagf(z)); + + if (fabsf(d) < 0.25f) + d = __mlibc_ctansf(z); + + if (d == 0.0f) { + /* mtherr ("ctan", OVERFLOW); */ + w = HUGE_VALF + HUGE_VALF * I; + return w; + } + + w = sinf(2.0f * crealf(z)) / d + (sinhf(2.0f * cimagf(z)) / d) * I; + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ctanh.c b/lib/mlibc/options/ansi/generic/complex/ctanh.c new file mode 100644 index 0000000..db27e5b --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ctanh.c @@ -0,0 +1,83 @@ +/* $NetBSD: ctanh.c,v 1.1 2007/08/20 16:01:38 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +/* +FUNCTION + <<ctanh>>, <<ctanf>>---complex hyperbolic tangent + +INDEX + ctanh +INDEX + ctanhf + +ANSI_SYNOPSIS + #include <complex.h> + double complex ctanh(double complex <[z]>); + float complex ctanhf(float complex <[z]>); + + +DESCRIPTION + These functions compute the complex hyperbolic tangent of <[z]>. + + <<ctanhf>> is identical to <<ctanh>>, except that it performs + its calculations on <<floats complex>>. + +RETURNS + These functions return the complex hyperbolic tangent value. + +PORTABILITY + <<ctanh>> and <<ctanhf>> are ISO C99 + +QUICKREF + <<ctanh>> and <<ctanhf>> are ISO C99 + +*/ + + +#include <complex.h> +#include <math.h> + +double complex +ctanh(double complex z) +{ + double complex w; + double x, y, d; + + x = creal(z); + y = cimag(z); + d = cosh(2.0 * x) + cos(2.0 * y); + w = sinh(2.0 * x) / d + (sin(2.0 * y) / d) * I; + + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/ctanhf.c b/lib/mlibc/options/ansi/generic/complex/ctanhf.c new file mode 100644 index 0000000..6aaf20f --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/ctanhf.c @@ -0,0 +1,50 @@ +/* $NetBSD: ctanhf.c,v 1.1 2007/08/20 16:01:38 drochner Exp $ */ + +/*- + * Copyright (c) 2007 The NetBSD Foundation, Inc. + * All rights reserved. + * + * This code is derived from software written by Stephen L. Moshier. + * It is redistributed by the NetBSD Foundation by permission of the author. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS + * ``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED + * TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR + * PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS + * BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + * + * imported and modified include for newlib 2010/10/03 + * Marco Atzeri <marco_atzeri@yahoo.it> + */ + +#include <complex.h> +#include <math.h> + +float complex +ctanhf(float complex z) +{ + float complex w; + float x, y, d; + + x = crealf(z); + y = cimagf(z); + d = coshf(2.0f * x) + cosf(2.0f * y); + w = sinhf(2.0f * x) / d + (sinf(2.0f * y) / d) * I; + + return w; +} diff --git a/lib/mlibc/options/ansi/generic/complex/fdlibm.h b/lib/mlibc/options/ansi/generic/complex/fdlibm.h new file mode 100644 index 0000000..75cdd2a --- /dev/null +++ b/lib/mlibc/options/ansi/generic/complex/fdlibm.h @@ -0,0 +1,17 @@ +#ifndef __MLIBC_FDLIBM_H +#define __MLIBC_FDLIBM_H + +#define REAL_PART(z) ((z).parts[0]) +#define IMAG_PART(z) ((z).parts[1]) + +typedef union { + float complex z; + float parts[2]; +} float_complex; + +typedef union { + double complex z; + double parts[2]; +} double_complex; + +#endif diff --git a/lib/mlibc/options/ansi/generic/ctype-stubs.cpp b/lib/mlibc/options/ansi/generic/ctype-stubs.cpp new file mode 100644 index 0000000..3ce76e9 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/ctype-stubs.cpp @@ -0,0 +1,326 @@ + +#include <ctype.h> +#include <wctype.h> + +#include <bits/ensure.h> +#include <mlibc/charset.hpp> + +// -------------------------------------------------------------------------------------- +// char ctype functions. +// -------------------------------------------------------------------------------------- + +int isalpha(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_alpha(cp); +} + +int isdigit(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_digit(cp); +} + +int isxdigit(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_xdigit(cp); +} + +int isalnum(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_alnum(cp); +} + +int ispunct(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_punct(cp); +} + +int isgraph(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_graph(cp); +} + +int isblank(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_blank(cp); +} + +int isspace(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_space(cp); +} + +int isprint(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_print(cp); +} + +int islower(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_lower(cp); +} + +int isupper(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_upper(cp); +} + +int iscntrl(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::generic_is_control(cp); +} + +int isascii(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return cp <= 0x7F; +} + +// -------------------------------------------------------------------------------------- +// wchar_t ctype functions. +// -------------------------------------------------------------------------------------- + +int iswalpha(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_alpha(cp); +} + +int iswdigit(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_digit(cp); +} + +int iswxdigit(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_xdigit(cp); +} + +int iswalnum(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_alnum(cp); +} + +int iswpunct(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_punct(cp); +} + +int iswgraph(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_graph(cp); +} + +int iswblank(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_blank(cp); +} + +int iswspace(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_space(cp); +} + +int iswprint(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_print(cp); +} + +int iswlower(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_lower(cp); +} + +int iswupper(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::current_charset()->is_upper(cp); +} + +int iswcntrl(wint_t nc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return 0; + return mlibc::generic_is_control(cp); +} + +// -------------------------------------------------------------------------------------- +// iswctype functions. +// -------------------------------------------------------------------------------------- + +namespace { + enum { + ct_null, + ct_alnum, + ct_alpha, + ct_blank, + ct_cntrl, + ct_digit, + ct_graph, + ct_lower, + ct_print, + ct_punct, + ct_space, + ct_upper, + ct_xdigit, + ct_count + }; +} + +wctype_t wctype(const char *cs) { + frg::string_view s{cs}; + if(s == "alnum") return ct_alnum; + if(s == "alpha") return ct_alpha; + if(s == "blank") return ct_blank; + if(s == "cntrl") return ct_cntrl; + if(s == "digit") return ct_digit; + if(s == "graph") return ct_graph; + if(s == "lower") return ct_lower; + if(s == "print") return ct_print; + if(s == "punct") return ct_punct; + if(s == "space") return ct_space; + if(s == "upper") return ct_upper; + if(s == "xdigit") return ct_xdigit; + mlibc::infoLogger() << "mlibc: wctype(\"" << cs << "\") is not supported" << frg::endlog; + return ct_null; +} + +int iswctype(wint_t wc, wctype_t type) { + switch (type) { + case ct_alnum: + return iswalnum(wc); + case ct_alpha: + return iswalpha(wc); + case ct_blank: + return iswblank(wc); + case ct_cntrl: + return iswcntrl(wc); + case ct_digit: + return iswdigit(wc); + case ct_graph: + return iswgraph(wc); + case ct_lower: + return iswlower(wc); + case ct_print: + return iswprint(wc); + case ct_punct: + return iswpunct(wc); + case ct_space: + return iswspace(wc); + case ct_upper: + return iswupper(wc); + case ct_xdigit: + return iswxdigit(wc); + } + return 0; +} + +// -------------------------------------------------------------------------------------- +// char conversion functions. +// -------------------------------------------------------------------------------------- + +int tolower(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return nc; + return mlibc::current_charset()->to_lower(cp); +} + +int toupper(int nc) { + auto cc = mlibc::current_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(nc, cp); e != mlibc::charcode_error::null) + return nc; + return mlibc::current_charset()->to_upper(cp); +} + +// -------------------------------------------------------------------------------------- +// wchar_t conversion functions. +// -------------------------------------------------------------------------------------- + +wint_t towlower(wint_t wc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(wc, cp); e != mlibc::charcode_error::null) + return wc; + return mlibc::current_charset()->to_lower(cp); +} + +wint_t towupper(wint_t wc) { + auto cc = mlibc::platform_wide_charcode(); + mlibc::codepoint cp; + if(auto e = cc->promote(wc, cp); e != mlibc::charcode_error::null) + return wc; + return mlibc::current_charset()->to_upper(cp); +} + diff --git a/lib/mlibc/options/ansi/generic/environment.cpp b/lib/mlibc/options/ansi/generic/environment.cpp new file mode 100644 index 0000000..5625592 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/environment.cpp @@ -0,0 +1,164 @@ +#include <errno.h> +#include <stdlib.h> +#include <stdio.h> + +#include <bits/ensure.h> +#include <mlibc/allocator.hpp> +#include <mlibc/debug.hpp> + +#include <frg/string.hpp> +#include <frg/vector.hpp> + +namespace { + char *empty_environment[] = { nullptr }; +} + +char **environ = empty_environment; + +namespace { + +size_t find_environ_index(frg::string_view name) { + for(size_t i = 0; environ[i]; i++) { + frg::string_view view{environ[i]}; + size_t s = view.find_first('='); + if(s == size_t(-1)) { + mlibc::infoLogger() << "mlibc: environment string \"" + << frg::escape_fmt{view.data(), view.size()} + << "\" does not contain an equals sign (=)" << frg::endlog; + continue; + } + if(view.sub_string(0, s) == name) + return i; + } + + return -1; +} + +// Environment vector that is mutated by putenv() and setenv(). +// Cannot be global as it is accessed during library initialization. +frg::vector<char *, MemoryAllocator> &get_vector() { + static frg::vector<char *, MemoryAllocator> vector{getAllocator()}; + return vector; +} + +void update_vector() { + auto &vector = get_vector(); + if(environ == vector.data()) + return; + + // If the environ variable was changed, we copy the environment. + // Note that we must only copy the pointers but not the strings themselves! + vector.clear(); + for(size_t i = 0; environ[i]; i++) + vector.push(environ[i]); + vector.push(nullptr); + + environ = vector.data(); +} + +void assign_variable(frg::string_view name, const char *string, bool overwrite) { + auto &vector = get_vector(); + __ensure(environ == vector.data()); + + auto k = find_environ_index(name); + if(k != size_t(-1)) { + if(overwrite) + vector[k] = const_cast<char *>(string); + }else{ + // Last pointer of environ must always be a null delimiter. + __ensure(!vector.back()); + vector.back() = const_cast<char *>(string); + vector.push(nullptr); + } + + // push() might have re-allocated the vector. + environ = vector.data(); +} + +void unassign_variable(frg::string_view name) { + auto &vector = get_vector(); + __ensure(environ == vector.data()); + + auto k = find_environ_index(name); + if(k == size_t(-1)) + return; + + // Last pointer of environ must always be a null delimiter. + __ensure(vector.size() >= 2 && !vector.back()); + std::swap(vector[k], vector[vector.size() - 2]); + vector.pop(); + vector.back() = nullptr; + + // pop() might have re-allocated the vector. + environ = vector.data(); +} + +} // anonymous namespace + +char *getenv(const char *name) { + auto k = find_environ_index(name); + if(k == size_t(-1)) + return nullptr; + + frg::string_view view{environ[k]}; + size_t s = view.find_first('='); + __ensure(s != size_t(-1)); + return const_cast<char *>(view.data() + s + 1); +} + +namespace mlibc { + +int putenv(char *string) { + frg::string_view view{string}; + size_t s = view.find_first('='); + if(s == size_t(-1)) + __ensure(!"Environment strings need to contain an equals sign"); + + update_vector(); + assign_variable(view.sub_string(0, s), string, true); + return 0; +} + +} // namespace mlibc + +#if __MLIBC_POSIX_OPTION + +int putenv(char *string) { + return mlibc::putenv(string); +} + +int setenv(const char *name, const char *value, int overwrite) { + frg::string_view view{name}; + size_t s = view.find_first('='); + if(s != size_t(-1)) { + mlibc::infoLogger() << "mlibc: environment variable \"" + << frg::escape_fmt{view.data(), view.size()} << "\" contains an equals sign" + << frg::endlog; + errno = EINVAL; + return -1; + } + + // We never free strings here. TODO: Reuse them? + char *string; + __ensure(asprintf(&string, "%s=%s", name, value) > 0); + __ensure(string); + + update_vector(); + assign_variable(name, string, overwrite); + return 0; +} + +int unsetenv(const char *name) { + update_vector(); + unassign_variable(name); + return 0; +} + +int clearenv(void) { + auto vector = get_vector(); + vector.clear(); + update_vector(); + return 0; +} + +#endif /* __MLIBC_POSIX_OPTION */ diff --git a/lib/mlibc/options/ansi/generic/errno-stubs.cpp b/lib/mlibc/options/ansi/generic/errno-stubs.cpp new file mode 100644 index 0000000..8229a9a --- /dev/null +++ b/lib/mlibc/options/ansi/generic/errno-stubs.cpp @@ -0,0 +1,12 @@ +#include <errno.h> + +int __thread __mlibc_errno; + +char *program_invocation_name = nullptr; +char *program_invocation_short_name = nullptr; +extern char *__progname __attribute__((__weak__, __alias__("program_invocation_short_name"))); +extern char *__progname_full __attribute__((__weak__, __alias__("program_invocation_name"))); + +int *__errno_location() { + return &__mlibc_errno; +} diff --git a/lib/mlibc/options/ansi/generic/fenv-stubs.cpp b/lib/mlibc/options/ansi/generic/fenv-stubs.cpp new file mode 100644 index 0000000..7153844 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/fenv-stubs.cpp @@ -0,0 +1,43 @@ + +#include <bits/ensure.h> +#include <fenv.h> + +// The functions that are not in this file but are defined in the header +// are implemented like musl does in assembly. +extern "C" __attribute__((__visibility__("hidden"))) int __fesetround(int); + +int fegetexceptflag(fexcept_t *, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int feholdexcept(fenv_t *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int fesetexceptflag(const fexcept_t *, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int fesetround(int r) { + if (r != FE_TONEAREST +#ifdef FE_DOWNWARD + && r != FE_DOWNWARD +#endif +#ifdef FE_UPWARD + && r != FE_UPWARD +#endif +#ifdef FE_TOWARDZERO + && r != FE_TOWARDZERO +#endif + ) + return -1; + return __fesetround(r); +} + +int feupdateenv(const fenv_t *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/ansi/generic/file-io.cpp b/lib/mlibc/options/ansi/generic/file-io.cpp new file mode 100644 index 0000000..e59b109 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/file-io.cpp @@ -0,0 +1,745 @@ + +#include <errno.h> +#include <stdlib.h> +#include <stdint.h> +#include <string.h> +#include <stdio.h> +#if __MLIBC_GLIBC_OPTION +#include <stdio_ext.h> +#endif + +#include <bits/ensure.h> + +#include <mlibc/debug.hpp> + +#include <abi-bits/fcntl.h> +#include <frg/allocation.hpp> +#include <frg/mutex.hpp> +#include <mlibc/allocator.hpp> +#include <mlibc/file-io.hpp> +#include <mlibc/ansi-sysdeps.hpp> +#include <mlibc/lock.hpp> + +namespace mlibc { + +// -------------------------------------------------------------------------------------- +// abstract_file implementation. +// -------------------------------------------------------------------------------------- + +namespace { + using file_list = frg::intrusive_list< + abstract_file, + frg::locate_member< + abstract_file, + frg::default_list_hook<abstract_file>, + &abstract_file::_list_hook + > + >; + + // Useful when debugging the FILE implementation. + constexpr bool globallyDisableBuffering = false; + + // The maximum number of characters we permit the user to ungetc. + constexpr size_t ungetBufferSize = 8; + + // List of files that will be flushed before exit(). + file_list &global_file_list() { + static frg::eternal<file_list> list; + return list.get(); + }; +} + +// For pipe-like streams (seek returns ESPIPE), we need to make sure +// that the buffer only ever contains all-dirty or all-clean data. +// Regarding _type and _bufmode: +// As we might construct FILE objects for FDs that are not actually +// open (e.g. for std{in,out,err}), we defer the type determination and cache the result. + +abstract_file::abstract_file(void (*do_dispose)(abstract_file *)) +: _type{stream_type::unknown}, _bufmode{buffer_mode::unknown}, _do_dispose{do_dispose} { + // TODO: For __fwriting to work correctly, set the __io_mode to 1 if the write is write-only. + __buffer_ptr = nullptr; + __unget_ptr = nullptr; + __buffer_size = 4096; + __offset = 0; + __io_offset = 0; + __valid_limit = 0; + __dirty_begin = 0; + __dirty_end = 0; + __io_mode = 0; + __status_bits = 0; + + global_file_list().push_back(this); +} + +abstract_file::~abstract_file() { + if(__dirty_begin != __dirty_end) + mlibc::infoLogger() << "mlibc warning: File is not flushed before destruction" + << frg::endlog; + + if(__buffer_ptr) + getAllocator().free(__buffer_ptr - ungetBufferSize); + + auto it = global_file_list().iterator_to(this); + global_file_list().erase(it); +} + +void abstract_file::dispose() { + if(!_do_dispose) + return; + _do_dispose(this); +} + +// Note that read() and write() are asymmetric: +// While read() can trigger a write-back, write() can never trigger a read-ahead(). +// This peculiarity is reflected in their code. + +int abstract_file::read(char *buffer, size_t max_size, size_t *actual_size) { + __ensure(max_size); + + if(_init_bufmode()) + return -1; + + size_t unget_length = 0; + if (__unget_ptr != __buffer_ptr) { + unget_length = frg::min(max_size, (size_t)(__buffer_ptr - __unget_ptr)); + memcpy(buffer, __unget_ptr, unget_length); + + __unget_ptr += unget_length; + buffer += unget_length; + max_size -= unget_length; + + if (max_size == 0) { + *actual_size = unget_length; + return 0; + } + } + + if(globallyDisableBuffering || _bufmode == buffer_mode::no_buffer) { + size_t io_size; + if(int e = io_read(buffer, max_size, &io_size); e) { + __status_bits |= __MLIBC_ERROR_BIT; + return e; + } + if(!io_size) + __status_bits |= __MLIBC_EOF_BIT; + *actual_size = io_size + unget_length; + return 0; + } + + // Ensure correct buffer type for pipe-like streams. + // TODO: In order to support pipe-like streams we need to write-back the buffer. + if(__io_mode && __valid_limit) + mlibc::panicLogger() << "mlibc: Cannot read-write to same pipe-like stream" + << frg::endlog; + __io_mode = 0; + + // Clear the buffer, then buffer new data. + if(__offset == __valid_limit) { + // TODO: We only have to write-back/reset if __valid_limit reaches the buffer end. + if(int e = _write_back(); e) + return e; + if(int e = _reset(); e) + return e; + + // Perform a read-ahead. + _ensure_allocation(); + size_t io_size; + if(int e = io_read(__buffer_ptr, __buffer_size, &io_size); e) { + __status_bits |= __MLIBC_ERROR_BIT; + return e; + } + if(!io_size) { + __status_bits |= __MLIBC_EOF_BIT; + *actual_size = 0; + return 0; + } + + __io_offset = io_size; + __valid_limit = io_size; + } + + // Return data from the buffer. + __ensure(__offset < __valid_limit); + + auto chunk = frg::min(size_t(__valid_limit - __offset), max_size); + memcpy(buffer, __buffer_ptr + __offset, chunk); + __offset += chunk; + + *actual_size = chunk + unget_length; + return 0; +} + +int abstract_file::write(const char *buffer, size_t max_size, size_t *actual_size) { + __ensure(max_size); + + if(_init_bufmode()) + return -1; + if(globallyDisableBuffering || _bufmode == buffer_mode::no_buffer) { + // As we do not buffer, nothing can be dirty. + __ensure(__dirty_begin == __dirty_end); + size_t io_size; + if(int e = io_write(buffer, max_size, &io_size); e) { + __status_bits |= __MLIBC_ERROR_BIT; + return e; + } + *actual_size = io_size; + return 0; + } + + // Flush the buffer if necessary. + if(__offset == __buffer_size) { + if(int e = _write_back(); e) + return e; + if(int e = _reset(); e) + return e; + } + + // Ensure correct buffer type for pipe-like streams. + // TODO: We could full support pipe-like files + // by ungetc()ing all data before a write happens, + // however, for now we just report an error. + if(!__io_mode && __valid_limit) // TODO: Only check this for pipe-like streams. + mlibc::panicLogger() << "mlibc: Cannot read-write to same pipe-like stream" + << frg::endlog; + __io_mode = 1; + + __ensure(__offset < __buffer_size); + auto chunk = frg::min(__buffer_size - __offset, max_size); + + // Line-buffered streams perform I/O on full lines. + bool flush_line = false; + if(_bufmode == buffer_mode::line_buffer) { + auto nl = reinterpret_cast<char *>(memchr(buffer, '\n', chunk)); + if(nl) { + chunk = nl + 1 - buffer; + flush_line = true; + } + } + __ensure(chunk); + + // Buffer data (without necessarily performing I/O). + _ensure_allocation(); + memcpy(__buffer_ptr + __offset, buffer, chunk); + + if(__dirty_begin != __dirty_end) { + __dirty_begin = frg::min(__dirty_begin, __offset); + __dirty_end = frg::max(__dirty_end, __offset + chunk); + }else{ + __dirty_begin = __offset; + __dirty_end = __offset + chunk; + } + __valid_limit = frg::max(__offset + chunk, __valid_limit); + __offset += chunk; + + // Flush line-buffered streams. + if(flush_line) { + if(_write_back()) + return -1; + } + + *actual_size = chunk; + return 0; +} + +int abstract_file::unget(char c) { + if (!__unget_ptr) { + // This can happen if the file is unbuffered, but we still need + // a space to store ungetc'd data. + __ensure(!__buffer_ptr); + _ensure_allocation(); + __ensure(__unget_ptr); + } + + if ((size_t)(__buffer_ptr - __unget_ptr) + 1 > ungetBufferSize) + return EOF; + else { + *(--__unget_ptr) = c; + return c; + } +} + +int abstract_file::update_bufmode(buffer_mode mode) { + // setvbuf() has undefined behavior if I/O has been performed. + __ensure(__dirty_begin == __dirty_end + && "update_bufmode() must only be called before performing I/O"); + _bufmode = mode; + return 0; +} + +void abstract_file::purge() { + __offset = 0; + __io_offset = 0; + __valid_limit = 0; + __dirty_end = __dirty_begin; + __unget_ptr = __buffer_ptr; +} + +int abstract_file::flush() { + if (__dirty_end != __dirty_begin) { + if (int e = _write_back(); e) + return e; + } + + if (int e = _save_pos(); e) + return e; + purge(); + return 0; +} + +int abstract_file::tell(off_t *current_offset) { + off_t seek_offset; + if(int e = io_seek(0, SEEK_CUR, &seek_offset); e) + return e; + + *current_offset = seek_offset + (off_t(__offset) - off_t(__io_offset)); + return 0; +} + +int abstract_file::seek(off_t offset, int whence) { + if(int e = _write_back(); e) + return e; + + off_t new_offset; + if(whence == SEEK_CUR) { + auto seek_offset = offset + (off_t(__offset) - off_t(__io_offset)); + if(int e = io_seek(seek_offset, whence, &new_offset); e) { + __status_bits |= __MLIBC_ERROR_BIT; + return e; + } + }else{ + __ensure(whence == SEEK_SET || whence == SEEK_END); + if(int e = io_seek(offset, whence, &new_offset); e) { + __status_bits |= __MLIBC_ERROR_BIT; + return e; + } + } + + // We just forget the current buffer. + // TODO: If the seek is "small", we can just modify our internal offset. + purge(); + + return 0; +} + +int abstract_file::_init_type() { + if(_type != stream_type::unknown) + return 0; + + if(int e = determine_type(&_type); e) + return e; + __ensure(_type != stream_type::unknown); + return 0; +} + +int abstract_file::_init_bufmode() { + if(_bufmode != buffer_mode::unknown) + return 0; + + if(determine_bufmode(&_bufmode)) + return -1; + __ensure(_bufmode != buffer_mode::unknown); + return 0; +} + +int abstract_file::_write_back() { + if(int e = _init_type(); e) + return e; + + if(__dirty_begin == __dirty_end) + return 0; + + // For non-pipe streams, first do a seek to reset the + // I/O position to zero, then do a write(). + if(_type == stream_type::file_like) { + if(__io_offset != __dirty_begin) { + __ensure(__dirty_begin - __io_offset > 0); + off_t new_offset; + if(int e = io_seek(off_t(__dirty_begin) - off_t(__io_offset), SEEK_CUR, &new_offset); e) + return e; + __io_offset = __dirty_begin; + } + }else{ + __ensure(_type == stream_type::pipe_like); + __ensure(__io_offset == __dirty_begin); + } + + // Now, we are in the correct position to write-back everything. + while(__io_offset < __dirty_end) { + size_t io_size; + if(int e = io_write(__buffer_ptr + __io_offset, __dirty_end - __io_offset, &io_size); e) { + __status_bits |= __MLIBC_ERROR_BIT; + return e; + } + __ensure(io_size > 0 && "io_write() is expected to always write at least one byte"); + __io_offset += io_size; + __dirty_begin += io_size; + } + + return 0; +} + +int abstract_file::_save_pos() { + if (int e = _init_type(); e) + return e; + if (int e = _init_bufmode(); e) + return e; + + if (_type == stream_type::file_like && _bufmode != buffer_mode::no_buffer) { + off_t new_offset; + auto seek_offset = (off_t(__offset) - off_t(__io_offset)); + if (int e = io_seek(seek_offset, SEEK_CUR, &new_offset); e) { + __status_bits |= __MLIBC_ERROR_BIT; + mlibc::infoLogger() << "hit io_seek() error " << e << frg::endlog; + return e; + } + return 0; + } + return 0; // nothing to do for the rest +} + +int abstract_file::_reset() { + if(int e = _init_type(); e) + return e; + + // For pipe-like files, we must not forget already read data. + // TODO: Report this error to the user. + if(_type == stream_type::pipe_like) + __ensure(__offset == __valid_limit); + + __ensure(__dirty_begin == __dirty_end); + __offset = 0; + __io_offset = 0; + __valid_limit = 0; + + return 0; +} + +// This may still be called when buffering is disabled, for ungetc. +void abstract_file::_ensure_allocation() { + if(__buffer_ptr) + return; + + auto ptr = getAllocator().allocate(__buffer_size + ungetBufferSize); + __buffer_ptr = reinterpret_cast<char *>(ptr) + ungetBufferSize; + __unget_ptr = __buffer_ptr; +} + +// -------------------------------------------------------------------------------------- +// fd_file implementation. +// -------------------------------------------------------------------------------------- + +fd_file::fd_file(int fd, void (*do_dispose)(abstract_file *), bool force_unbuffered) +: abstract_file{do_dispose}, _fd{fd}, _force_unbuffered{force_unbuffered} { } + +int fd_file::fd() { + return _fd; +} + +int fd_file::close() { + if(__dirty_begin != __dirty_end) + mlibc::infoLogger() << "mlibc warning: File is not flushed before closing" + << frg::endlog; + if(int e = mlibc::sys_close(_fd); e) + return e; + return 0; +} + +int fd_file::reopen(const char *path, const char *mode) { + int mode_flags = parse_modestring(mode); + + int fd; + if(int e = sys_open(path, mode_flags, S_IRUSR|S_IWUSR|S_IRGRP|S_IWGRP|S_IROTH|S_IWOTH, &fd); e) { + return e; + } + + flush(); + close(); + getAllocator().deallocate(__buffer_ptr, __buffer_size + ungetBufferSize); + + __buffer_ptr = nullptr; + __unget_ptr = nullptr; + __buffer_size = 4096; + _reset(); + _fd = fd; + + if(mode_flags & O_APPEND) { + seek(0, SEEK_END); + } + + return 0; +} + +int fd_file::determine_type(stream_type *type) { + off_t offset; + int e = mlibc::sys_seek(_fd, 0, SEEK_CUR, &offset); + if(!e) { + *type = stream_type::file_like; + return 0; + }else if(e == ESPIPE) { + *type = stream_type::pipe_like; + return 0; + }else{ + return e; + } +} + +int fd_file::determine_bufmode(buffer_mode *mode) { + // When isatty() is not implemented, we fall back to the safest default (no buffering). + if(!mlibc::sys_isatty) { + MLIBC_MISSING_SYSDEP(); + *mode = buffer_mode::no_buffer; + return 0; + } + if(_force_unbuffered) { + *mode = buffer_mode::no_buffer; + return 0; + } + + if(int e = mlibc::sys_isatty(_fd); !e) { + *mode = buffer_mode::line_buffer; + return 0; + }else if(e == ENOTTY) { + *mode = buffer_mode::full_buffer; + return 0; + }else{ + mlibc::infoLogger() << "mlibc: sys_isatty() failed while determining whether" + " stream is interactive" << frg::endlog; + return -1; + } +} + +int fd_file::io_read(char *buffer, size_t max_size, size_t *actual_size) { + ssize_t s; + if(int e = mlibc::sys_read(_fd, buffer, max_size, &s); e) + return e; + *actual_size = s; + return 0; +} + +int fd_file::io_write(const char *buffer, size_t max_size, size_t *actual_size) { + ssize_t s; + if(int e = mlibc::sys_write(_fd, buffer, max_size, &s); e) + return e; + *actual_size = s; + return 0; +} + +int fd_file::io_seek(off_t offset, int whence, off_t *new_offset) { + if(int e = mlibc::sys_seek(_fd, offset, whence, new_offset); e) + return e; + return 0; +} + +int fd_file::parse_modestring(const char *mode) { + // Consume the first char; this must be 'r', 'w' or 'a'. + int flags = 0; + bool has_plus = strchr(mode, '+'); + if(*mode == 'r') { + if(has_plus) { + flags = O_RDWR; + }else{ + flags = O_RDONLY; + } + }else if(*mode == 'w') { + if(has_plus) { + flags = O_RDWR; + }else{ + flags = O_WRONLY; + } + flags |= O_CREAT | O_TRUNC; + }else if(*mode == 'a') { + if(has_plus) { + flags = O_APPEND | O_RDWR; + }else{ + flags = O_APPEND | O_WRONLY; + } + flags |= O_CREAT; + }else{ + mlibc::infoLogger() << "Illegal fopen() mode '" << *mode << "'" << frg::endlog; + } + mode += 1; + + // Consume additional flags. + while(*mode) { + if(*mode == '+') { + mode++; // This is already handled above. + }else if(*mode == 'b') { + mode++; // mlibc assumes that there is no distinction between text and binary. + }else if(*mode == 'e') { + flags |= O_CLOEXEC; + mode++; + }else{ + mlibc::infoLogger() << "Illegal fopen() flag '" << mode << "'" << frg::endlog; + mode++; + } + } + + return flags; +} + +} // namespace mlibc + +namespace { + mlibc::fd_file stdin_file{0}; + mlibc::fd_file stdout_file{1}; + mlibc::fd_file stderr_file{2, nullptr, true}; + + struct stdio_guard { + stdio_guard() { } + + ~stdio_guard() { + // Only flush the files but do not close them. + for(auto it : mlibc::global_file_list()) { + if(int e = it->flush(); e) + mlibc::infoLogger() << "mlibc warning: Failed to flush file before exit()" + << frg::endlog; + } + } + } global_stdio_guard; +} + +FILE *stderr = &stderr_file; +FILE *stdin = &stdin_file; +FILE *stdout = &stdout_file; + +int fileno_unlocked(FILE *file_base) { + auto file = static_cast<mlibc::fd_file *>(file_base); + return file->fd(); +} + +int fileno(FILE *file_base) { + auto file = static_cast<mlibc::fd_file *>(file_base); + frg::unique_lock lock(file->_lock); + return fileno_unlocked(file_base); +} + +FILE *fopen(const char *path, const char *mode) { + int flags = mlibc::fd_file::parse_modestring(mode); + + int fd; + if(int e = mlibc::sys_open(path, flags, 0666, &fd); e) { + errno = e; + return nullptr; + } + + return frg::construct<mlibc::fd_file>(getAllocator(), fd, + mlibc::file_dispose_cb<mlibc::fd_file>); +} + +int fclose(FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + int e = 0; + if(file->flush()) + e = EOF; + if(file->close()) + e = EOF; + file->dispose(); + return e; +} + +int fseek(FILE *file_base, long offset, int whence) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + if(int e = file->seek(offset, whence); e) { + errno = e; + return -1; + } + return 0; +} + +long ftell(FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + off_t current_offset; + if(int e = file->tell(¤t_offset); e) { + errno = e; + return -1; + } + return current_offset; +} + +int fflush_unlocked(FILE *file_base) { + if(file_base == NULL) { + // Only flush the files but do not close them. + for(auto it : mlibc::global_file_list()) { + if(int e = it->flush(); e) + mlibc::infoLogger() << "mlibc warning: Failed to flush file" + << frg::endlog; + } + return 0; + } + auto file = static_cast<mlibc::abstract_file *>(file_base); + if(file->flush()) + return EOF; + return 0; +} +int fflush(FILE *file_base) { + if(file_base == NULL) { + // Only flush the files but do not close them. + for(auto it : mlibc::global_file_list()) { + frg::unique_lock lock(it->_lock); + if(int e = it->flush(); e) + mlibc::infoLogger() << "mlibc warning: Failed to flush file" + << frg::endlog; + } + return 0; + } + + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + if (file->flush()) + return EOF; + return 0; +} + +int setvbuf(FILE *file_base, char *, int mode, size_t) { + // TODO: We could also honor the buffer, but for now use just set the mode. + auto file = static_cast<mlibc::abstract_file *>(file_base); + if(mode == _IONBF) { + if(int e = file->update_bufmode(mlibc::buffer_mode::no_buffer); e) { + errno = e; + return -1; + } + }else if(mode == _IOLBF) { + if(int e = file->update_bufmode(mlibc::buffer_mode::line_buffer); e) { + errno = e; + return -1; + } + }else if(mode == _IOFBF) { + if(int e = file->update_bufmode(mlibc::buffer_mode::full_buffer); e) { + errno = e; + return -1; + } + }else{ + errno = EINVAL; + return -1; + } + + return 0; +} + +void rewind(FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + file->seek(0, SEEK_SET); + file_base->__status_bits &= ~(__MLIBC_EOF_BIT | __MLIBC_ERROR_BIT); +} + +int ungetc(int c, FILE *file_base) { + if (c == EOF) + return EOF; + + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + return file->unget(c); +} + +#if __MLIBC_GLIBC_OPTION +void __fpurge(FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + file->purge(); +} +#endif + diff --git a/lib/mlibc/options/ansi/generic/inttypes-stubs.cpp b/lib/mlibc/options/ansi/generic/inttypes-stubs.cpp new file mode 100644 index 0000000..ae0f9e7 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/inttypes-stubs.cpp @@ -0,0 +1,100 @@ + +#include <ctype.h> +#include <inttypes.h> +#include <string.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> + +static const char *__mlibc_digits = "0123456789abcdefghijklmnopqrstuvwxyz"; + +intmax_t imaxabs(intmax_t num) { + return num < 0 ? -num : num; +} +imaxdiv_t imaxdiv(intmax_t number, intmax_t denom) { + imaxdiv_t r; + r.quot = number / denom; + r.rem = number % denom; + return r; +} + +template <class T> T strtoxmax(const char *it, char **out, int base) { + T v = 0; + bool negate = false; + const unsigned char *s = (const unsigned char *)it; + int c; + + if(std::is_signed<T>::value) { + if(*s == '+') { + s++; + }else if(*s == '-') { + negate = true; + s++; + } + } + + do { + c = *s++; + } while (isspace(c)); + if ((base == 0 || base == 16) && c == '0' && (*s == 'x' || *s == 'X')) { + c = s[1]; + s += 2; + base = 16; + } + if (base == 0) + base = c == '0' ? 8 : 10; + + if(base == 8) { + if(*it != 0) + goto parse_digits; + it++; + }else if(base == 16) { + if(*it != 0) + goto parse_digits; + it++; + if(*it != 'x' && *it != 'X') + goto parse_digits; + it++; + } + +parse_digits: + while(*it) { + if(isspace(*it)) { + it++; + continue; + } + + __ensure(base <= 10); // TODO: For base > 10 we need to implement tolower(). + //auto c = strchr(__mlibc_digits, tolower(*it)); + auto c = strchr(__mlibc_digits, *it); + if(!c || (c - __mlibc_digits) >= base) + break; + v = v * base + (c - __mlibc_digits); + it++; + } + + if(std::is_signed<T>::value) { + if(negate) + v = -v; + } + + if(out) + *out = const_cast<char *>(it); + return v; +} + +intmax_t strtoimax(const char *it, char **out, int base) { + // TODO: This function has to check for overflow! + return strtoxmax<intmax_t>(it, out, base); +} +uintmax_t strtoumax(const char *it, char **out, int base) { + return strtoxmax<uintmax_t>(it, out, base); +} +intmax_t wcstoimax(const wchar_t *__restrict, wchar_t **__restrict, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +uintmax_t wcstoumax(const wchar_t *__restrict, wchar_t **__restrict, int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/ansi/generic/locale-stubs.cpp b/lib/mlibc/options/ansi/generic/locale-stubs.cpp new file mode 100644 index 0000000..38f5859 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/locale-stubs.cpp @@ -0,0 +1,195 @@ + +#include <limits.h> +#include <locale.h> +#include <string.h> + +#include <bits/ensure.h> + +#include <mlibc/debug.hpp> +#include <frg/optional.hpp> + +namespace { + // Values of the C locale are defined by the C standard. + constexpr lconv c_lconv = { + const_cast<char *>("."), // decimal_point + const_cast<char *>(""), // thousands_sep + const_cast<char *>(""), // grouping + const_cast<char *>(""), // mon_decimal_point + const_cast<char *>(""), // mon_thousands_sep + const_cast<char *>(""), // mon_grouping + const_cast<char *>(""), // positive_sign + const_cast<char *>(""), // negative_sign + const_cast<char *>(""), // currency_symbol + CHAR_MAX, // frac_digits + CHAR_MAX, // p_cs_precedes + CHAR_MAX, // n_cs_precedes + CHAR_MAX, // p_sep_by_space + CHAR_MAX, // n_sep_by_space + CHAR_MAX, // p_sign_posn + CHAR_MAX, // n_sign_posn + const_cast<char *>(""), // int_curr_symbol + CHAR_MAX, // int_frac_digits + CHAR_MAX, // int_p_cs_precedes + CHAR_MAX, // int_n_cs_precedes + CHAR_MAX, // int_p_sep_by_space + CHAR_MAX, // int_n_sep_by_space + CHAR_MAX, // int_p_sign_posn + CHAR_MAX // int_n_sign_posn + }; +} + +namespace mlibc { + struct locale_description { + // Identifier of this locale. used in setlocale(). + const char *name; + lconv lc; + }; + + constinit const locale_description c_locale{ + .name = "C", + .lc = c_lconv + }; + + constinit const locale_description posix_locale{ + .name = "POSIX", + .lc = c_lconv + }; + + const locale_description *query_locale_description(const char *name) { + if(!strcmp(name, "C")) + return &c_locale; + if(!strcmp(name, "POSIX")) + return &posix_locale; + return nullptr; + } + + const locale_description *collate_facet; + const locale_description *ctype_facet; + const locale_description *monetary_facet; + const locale_description *numeric_facet; + const locale_description *time_facet; + const locale_description *messages_facet; +} + +void __mlibc_initLocale() { + mlibc::collate_facet = &mlibc::c_locale; + mlibc::ctype_facet = &mlibc::c_locale; + mlibc::monetary_facet = &mlibc::c_locale; + mlibc::numeric_facet = &mlibc::c_locale; + mlibc::time_facet = &mlibc::c_locale; + mlibc::messages_facet = &mlibc::c_locale; +} + +char *setlocale(int category, const char *name) { + if(category == LC_ALL) { + // ´TODO: Implement correct return value when categories differ. + auto current_desc = mlibc::collate_facet; + __ensure(current_desc == mlibc::ctype_facet); + __ensure(current_desc == mlibc::monetary_facet); + __ensure(current_desc == mlibc::numeric_facet); + __ensure(current_desc == mlibc::time_facet); + __ensure(current_desc == mlibc::messages_facet); + + if(name) { + // Our default C locale is the C locale. + if(!strlen(name)) + name = "C"; + + auto new_desc = mlibc::query_locale_description(name); + if(!new_desc) { + mlibc::infoLogger() << "mlibc: Locale " << name + << " is not supported" << frg::endlog; + return nullptr; + } + + mlibc::collate_facet = new_desc; + mlibc::ctype_facet = new_desc; + mlibc::monetary_facet = new_desc; + mlibc::numeric_facet = new_desc; + mlibc::time_facet = new_desc; + mlibc::messages_facet = new_desc; + } + return const_cast<char *>(current_desc->name); + }else{ + const mlibc::locale_description **facet_ptr; + switch(category) { + case LC_COLLATE: + facet_ptr = &mlibc::collate_facet; + break; + case LC_CTYPE: + facet_ptr = &mlibc::ctype_facet; + break; + case LC_MONETARY: + facet_ptr = &mlibc::monetary_facet; + break; + case LC_NUMERIC: + facet_ptr = &mlibc::numeric_facet; + break; + case LC_TIME: + facet_ptr = &mlibc::time_facet; + break; + case LC_MESSAGES: + facet_ptr = &mlibc::messages_facet; + break; + default: + mlibc::infoLogger() << "mlibc: Unexpected value " << category + << " for category in setlocale()" << frg::endlog; + return nullptr; + } + + auto current_desc = *facet_ptr; + if(name) { + // Our default C locale is the C locale. + if(!strlen(name)) + name = "C"; + + auto new_desc = mlibc::query_locale_description(name); + if(!new_desc) { + mlibc::infoLogger() << "mlibc: Locale " << name + << " is not supported" << frg::endlog; + return nullptr; + } + + *facet_ptr = new_desc; + } + return const_cast<char *>(current_desc->name); + } +} + +namespace { + lconv effective_lc; +} + +struct lconv *localeconv(void) { + // Numeric locale. + const auto &numeric_lc = mlibc::numeric_facet->lc; + effective_lc.decimal_point = numeric_lc.decimal_point; + effective_lc.thousands_sep = numeric_lc.thousands_sep; + effective_lc.grouping = numeric_lc.grouping; + + // Monetary locale. + const auto &monetary_lc = mlibc::monetary_facet->lc; + effective_lc.mon_decimal_point = monetary_lc.mon_decimal_point; + effective_lc.mon_thousands_sep = monetary_lc.mon_thousands_sep; + effective_lc.mon_grouping = monetary_lc.mon_grouping; + effective_lc.positive_sign = monetary_lc.positive_sign; + effective_lc.negative_sign = monetary_lc.negative_sign; + effective_lc.currency_symbol = monetary_lc.currency_symbol; + effective_lc.frac_digits = monetary_lc.frac_digits; + effective_lc.p_cs_precedes = monetary_lc.p_cs_precedes; + effective_lc.n_cs_precedes = monetary_lc.n_cs_precedes; + effective_lc.p_sep_by_space = monetary_lc.p_sep_by_space; + effective_lc.n_sep_by_space = monetary_lc.n_sep_by_space; + effective_lc.p_sign_posn = monetary_lc.p_sign_posn; + effective_lc.n_sign_posn = monetary_lc.n_sign_posn; + effective_lc.int_curr_symbol = monetary_lc.int_curr_symbol; + effective_lc.int_frac_digits = monetary_lc.int_frac_digits; + effective_lc.int_p_cs_precedes = monetary_lc.int_p_cs_precedes; + effective_lc.int_n_cs_precedes = monetary_lc.int_n_cs_precedes; + effective_lc.int_p_sep_by_space = monetary_lc.int_p_sep_by_space; + effective_lc.int_n_sep_by_space = monetary_lc.int_n_sep_by_space; + effective_lc.int_p_sign_posn = monetary_lc.int_p_sign_posn; + effective_lc.int_n_sign_posn = monetary_lc.int_n_sign_posn; + + return &effective_lc; +} diff --git a/lib/mlibc/options/ansi/generic/math-stubs.ignored-cpp b/lib/mlibc/options/ansi/generic/math-stubs.ignored-cpp new file mode 100644 index 0000000..9be985f --- /dev/null +++ b/lib/mlibc/options/ansi/generic/math-stubs.ignored-cpp @@ -0,0 +1,1831 @@ + +#include <math.h> +#include <immintrin.h> + +#include <bits/ensure.h> + +#include <stdint.h> + +#include <mlibc/debug.hpp> + +// Taken from musl. See musl for the license/copyright! +#define FORCE_EVAL(x) do { \ + if (sizeof(x) == sizeof(float)) { \ + volatile float __x; \ + __x = (x); \ + } else if (sizeof(x) == sizeof(double)) { \ + volatile double __x; \ + __x = (x); \ + } else { \ + volatile long double __x; \ + __x = (x); \ + } \ +} while(0) + +namespace ieee754 { + +struct SoftDouble { + typedef uint64_t Bits; + typedef uint64_t Mantissa; + typedef int16_t Exp; + + static constexpr int kMantissaBits = 52; + static constexpr int kExpBits = 11; + static constexpr int kBias = 1023; + + // this exponent represents zeros (when mantissa = 0) and subnormals (when mantissa != 0) + static constexpr Exp kSubExp = -kBias; + // this exponent represents infinities (when mantissa = 0) and NaNs (when mantissa != 0) + static constexpr Exp kInfExp = ((Exp(1) << kExpBits) - 1) - kBias; + + static constexpr Bits kMantissaMask = (Bits(1) << kMantissaBits) - 1; + static constexpr Bits kExpMask = ((Bits(1) << kExpBits) - 1) << kMantissaBits; + static constexpr Bits kSignMask = Bits(1) << (kMantissaBits + kExpBits); + + SoftDouble(bool negative, Mantissa mantissa, Exp exp) + : negative(negative), mantissa(mantissa), exp(exp) { +// mlibc::infoLogger.log() << "(" << (int)negative << ", " << (void *)mantissa +// << ", " << exp << ")" << frg::end_log; + __ensure(mantissa < (Mantissa(1) << kMantissaBits)); + __ensure((exp + kBias) >= 0); + __ensure((exp + kBias) < (Exp(1) << kExpBits)); + } + + const bool negative; + const Mantissa mantissa; + const Exp exp; +}; + +template<typename F> +using Bits = typename F::Bits; + +template<typename F> +using Mantissa = typename F::Mantissa; + +template<typename F> +using Exp = typename F::Exp; + +template<typename F> +bool isZero(F x) { + return x.exp == F::kSubExp && x.mantissa == 0; +} + +template<typename F> +bool isFinite(F x) { + return x.exp != F::kInfExp; +} + +// -------------------------------------------------------- +// Soft float operations +// -------------------------------------------------------- + +template<typename F> +F constZero(bool negative) { + return F(negative, 0, F::kSubExp); +} + +template<typename F> +F constOne(bool negative) { + return F(negative, 0, 0); +} + +template<typename F> +F floor(F x) { + if(!isFinite(x) || isZero(x)) // TODO: need exception for the not-finite case? + return x; + + if(x.exp > F::kMantissaBits) + return x; // x is already integral + + if(x.exp < 0) { + // TODO: raise inexact + // return -1 or +0 + return x.negative ? constOne<F>(true) : constZero<F>(false); + } + + Mantissa<F> mask = F::kMantissaMask >> x.exp; + if(!(x.mantissa & mask)) + return x; // x is already integral + + // TODO: raise inexact + Mantissa<F> integral_position = (Mantissa<F>(1) << F::kMantissaBits) >> x.exp; + if(x.negative) + return F(true, (x.mantissa + integral_position) & (~mask), x.exp); + return F(false, x.mantissa & (~mask), x.exp); +} + +template<typename F> +F ceil(F x) { + if(!isFinite(x) || isZero(x)) // TODO: need exception for the not-finite case? + return x; + + if(x.exp > F::kMantissaBits) + return x; // x is already integral + + if(x.exp < 0) { + // TODO: raise inexact + // return -0 or +1 + return x.negative ? constZero<F>(true) : constOne<F>(false); + } + + Mantissa<F> mask = F::kMantissaMask >> x.exp; + if(!(x.mantissa & mask)) + return x; // x is already integral + + // TODO: raise inexact + Mantissa<F> integral_position = (Mantissa<F>(1) << F::kMantissaBits) >> x.exp; + if(x.negative) + return F(true, x.mantissa & (~mask), x.exp); + return F(false, (x.mantissa + integral_position) & (~mask), x.exp); +} + +// -------------------------------------------------------- +// Soft float <-> bit string conversion functions +// -------------------------------------------------------- + +template<typename F> +uint64_t compileBits(F soft) { + auto bits = Bits<F>(soft.mantissa) | ((Bits<F>(soft.exp) + F::kBias) << soft.kMantissaBits); + return soft.negative ? (F::kSignMask | bits) : bits; +} + +SoftDouble extractBits(uint64_t bits) { + return SoftDouble(bits & SoftDouble::kSignMask, bits & SoftDouble::kMantissaMask, + ((bits & SoftDouble::kExpMask) >> SoftDouble::kMantissaBits) - SoftDouble::kBias); +} + +// -------------------------------------------------------- +// Soft float -> native float conversion functions +// -------------------------------------------------------- + +union DoubleBits { + double fp; + uint64_t bits; +}; + +double compileNative(SoftDouble soft) { + DoubleBits word; + word.bits = compileBits(soft); + return word.fp; +} + +SoftDouble extractNative(double native) { + DoubleBits word; + word.fp = native; + return extractBits(word.bits); +} + +} // namespace ieee754 + +int __mlibc_fpclassify(double x) { + return __builtin_fpclassify(FP_NAN, FP_INFINITE, FP_NORMAL, FP_SUBNORMAL, FP_ZERO, x); +} +int __mlibc_fpclassifyf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +int __mlibc_fpclassifyl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double acos(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float acosf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double acosl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double asin(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float asinf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double asinl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double atan(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float atanf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double atanl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double atan2(double x, double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float atan2f(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double atan2l(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +// Taken from musl. See musl for the license/copyright! +float __sindf(double x) { + /* |sin(x)/x - s(x)| < 2**-37.5 (~[-4.89e-12, 4.824e-12]). */ + static const double S1 = -0x15555554cbac77.0p-55, /* -0.166666666416265235595 */ + S2 = 0x111110896efbb2.0p-59, /* 0.0083333293858894631756 */ + S3 = -0x1a00f9e2cae774.0p-65, /* -0.000198393348360966317347 */ + S4 = 0x16cd878c3b46a7.0p-71; /* 0.0000027183114939898219064 */ + + double r, s, w, z; + + /* Try to optimize for parallel evaluation as in __tandf.c. */ + z = x*x; + w = z*z; + r = S3 + z*S4; + s = z*x; + return (x + s*(S1 + z*S2)) + s*w*r; +} + +// Taken from musl. See musl for the license/copyright! +float __cosdf(double x) { + /* |cos(x) - c(x)| < 2**-34.1 (~[-5.37e-11, 5.295e-11]). */ + static const double C0 = -0x1ffffffd0c5e81.0p-54, /* -0.499999997251031003120 */ + C1 = 0x155553e1053a42.0p-57, /* 0.0416666233237390631894 */ + C2 = -0x16c087e80f1e27.0p-62, /* -0.00138867637746099294692 */ + C3 = 0x199342e0ee5069.0p-68; /* 0.0000243904487962774090654 */ + + double r, w, z; + + /* Try to optimize for parallel evaluation as in __tandf.c. */ + z = x*x; + w = z*z; + r = C2+z*C3; + return ((1.0+z*C0) + w*C1) + (w*z)*r; +} + +float __tandf(double x, int odd) { + /* |tan(x)/x - t(x)| < 2**-25.5 (~[-2e-08, 2e-08]). */ + static const double T[] = { + 0x15554d3418c99f.0p-54, /* 0.333331395030791399758 */ + 0x1112fd38999f72.0p-55, /* 0.133392002712976742718 */ + 0x1b54c91d865afe.0p-57, /* 0.0533812378445670393523 */ + 0x191df3908c33ce.0p-58, /* 0.0245283181166547278873 */ + 0x185dadfcecf44e.0p-61, /* 0.00297435743359967304927 */ + 0x1362b9bf971bcd.0p-59, /* 0.00946564784943673166728 */ + }; + + double z,r,w,s,t,u; + + z = x*x; + /* + * Split up the polynomial into small independent terms to give + * opportunities for parallel evaluation. The chosen splitting is + * micro-optimized for Athlons (XP, X64). It costs 2 multiplications + * relative to Horner's method on sequential machines. + * + * We add the small terms from lowest degree up for efficiency on + * non-sequential machines (the lowest degree terms tend to be ready + * earlier). Apart from this, we don't care about order of + * operations, and don't need to to care since we have precision to + * spare. However, the chosen splitting is good for accuracy too, + * and would give results as accurate as Horner's method if the + * small terms were added from highest degree down. + */ + r = T[4] + z*T[5]; + t = T[2] + z*T[3]; + w = z*z; + s = z*x; + u = T[0] + z*T[1]; + r = (x + s*u) + (s*w)*(t + w*r); + return odd ? -1.0/r : r; +} + +#define DBL_EPSILON 2.22044604925031308085e-16 +#define EPS DBL_EPSILON + +/* Get a 32 bit int from a float. */ +#define GET_FLOAT_WORD(w,d) \ +do { \ + union {float f; uint32_t i;} __u; \ + __u.f = (d); \ + (w) = __u.i; \ +} while (0) + +/* Get the more significant 32 bit int from a double. */ +#define GET_HIGH_WORD(hi,d) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + (hi) = __u.i >> 32; \ +} while (0) + +/* Get the less significant 32 bit int from a double. */ +#define GET_LOW_WORD(lo,d) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + (lo) = (uint32_t)__u.i; \ +} while (0) + +// Taken from musl. See musl for the license/copyright! +int __rem_pio2_large(double *x, double *y, int e0, int nx, int prec) +{ + static const int init_jk[] = {3,4,4,6}; /* initial value for jk */ + + /* + * Table of constants for 2/pi, 396 Hex digits (476 decimal) of 2/pi + * + * integer array, contains the (24*i)-th to (24*i+23)-th + * bit of 2/pi after binary point. The corresponding + * floating value is + * + * ipio2[i] * 2^(-24(i+1)). + * + * NB: This table must have at least (e0-3)/24 + jk terms. + * For quad precision (e0 <= 16360, jk = 6), this is 686. + */ + static const int32_t ipio2[] = { + 0xA2F983, 0x6E4E44, 0x1529FC, 0x2757D1, 0xF534DD, 0xC0DB62, + 0x95993C, 0x439041, 0xFE5163, 0xABDEBB, 0xC561B7, 0x246E3A, + 0x424DD2, 0xE00649, 0x2EEA09, 0xD1921C, 0xFE1DEB, 0x1CB129, + 0xA73EE8, 0x8235F5, 0x2EBB44, 0x84E99C, 0x7026B4, 0x5F7E41, + 0x3991D6, 0x398353, 0x39F49C, 0x845F8B, 0xBDF928, 0x3B1FF8, + 0x97FFDE, 0x05980F, 0xEF2F11, 0x8B5A0A, 0x6D1F6D, 0x367ECF, + 0x27CB09, 0xB74F46, 0x3F669E, 0x5FEA2D, 0x7527BA, 0xC7EBE5, + 0xF17B3D, 0x0739F7, 0x8A5292, 0xEA6BFB, 0x5FB11F, 0x8D5D08, + 0x560330, 0x46FC7B, 0x6BABF0, 0xCFBC20, 0x9AF436, 0x1DA9E3, + 0x91615E, 0xE61B08, 0x659985, 0x5F14A0, 0x68408D, 0xFFD880, + 0x4D7327, 0x310606, 0x1556CA, 0x73A8C9, 0x60E27B, 0xC08C6B, + + #if LDBL_MAX_EXP > 1024 + 0x47C419, 0xC367CD, 0xDCE809, 0x2A8359, 0xC4768B, 0x961CA6, + 0xDDAF44, 0xD15719, 0x053EA5, 0xFF0705, 0x3F7E33, 0xE832C2, + 0xDE4F98, 0x327DBB, 0xC33D26, 0xEF6B1E, 0x5EF89F, 0x3A1F35, + 0xCAF27F, 0x1D87F1, 0x21907C, 0x7C246A, 0xFA6ED5, 0x772D30, + 0x433B15, 0xC614B5, 0x9D19C3, 0xC2C4AD, 0x414D2C, 0x5D000C, + 0x467D86, 0x2D71E3, 0x9AC69B, 0x006233, 0x7CD2B4, 0x97A7B4, + 0xD55537, 0xF63ED7, 0x1810A3, 0xFC764D, 0x2A9D64, 0xABD770, + 0xF87C63, 0x57B07A, 0xE71517, 0x5649C0, 0xD9D63B, 0x3884A7, + 0xCB2324, 0x778AD6, 0x23545A, 0xB91F00, 0x1B0AF1, 0xDFCE19, + 0xFF319F, 0x6A1E66, 0x615799, 0x47FBAC, 0xD87F7E, 0xB76522, + 0x89E832, 0x60BFE6, 0xCDC4EF, 0x09366C, 0xD43F5D, 0xD7DE16, + 0xDE3B58, 0x929BDE, 0x2822D2, 0xE88628, 0x4D58E2, 0x32CAC6, + 0x16E308, 0xCB7DE0, 0x50C017, 0xA71DF3, 0x5BE018, 0x34132E, + 0x621283, 0x014883, 0x5B8EF5, 0x7FB0AD, 0xF2E91E, 0x434A48, + 0xD36710, 0xD8DDAA, 0x425FAE, 0xCE616A, 0xA4280A, 0xB499D3, + 0xF2A606, 0x7F775C, 0x83C2A3, 0x883C61, 0x78738A, 0x5A8CAF, + 0xBDD76F, 0x63A62D, 0xCBBFF4, 0xEF818D, 0x67C126, 0x45CA55, + 0x36D9CA, 0xD2A828, 0x8D61C2, 0x77C912, 0x142604, 0x9B4612, + 0xC459C4, 0x44C5C8, 0x91B24D, 0xF31700, 0xAD43D4, 0xE54929, + 0x10D5FD, 0xFCBE00, 0xCC941E, 0xEECE70, 0xF53E13, 0x80F1EC, + 0xC3E7B3, 0x28F8C7, 0x940593, 0x3E71C1, 0xB3092E, 0xF3450B, + 0x9C1288, 0x7B20AB, 0x9FB52E, 0xC29247, 0x2F327B, 0x6D550C, + 0x90A772, 0x1FE76B, 0x96CB31, 0x4A1679, 0xE27941, 0x89DFF4, + 0x9794E8, 0x84E6E2, 0x973199, 0x6BED88, 0x365F5F, 0x0EFDBB, + 0xB49A48, 0x6CA467, 0x427271, 0x325D8D, 0xB8159F, 0x09E5BC, + 0x25318D, 0x3974F7, 0x1C0530, 0x010C0D, 0x68084B, 0x58EE2C, + 0x90AA47, 0x02E774, 0x24D6BD, 0xA67DF7, 0x72486E, 0xEF169F, + 0xA6948E, 0xF691B4, 0x5153D1, 0xF20ACF, 0x339820, 0x7E4BF5, + 0x6863B2, 0x5F3EDD, 0x035D40, 0x7F8985, 0x295255, 0xC06437, + 0x10D86D, 0x324832, 0x754C5B, 0xD4714E, 0x6E5445, 0xC1090B, + 0x69F52A, 0xD56614, 0x9D0727, 0x50045D, 0xDB3BB4, 0xC576EA, + 0x17F987, 0x7D6B49, 0xBA271D, 0x296996, 0xACCCC6, 0x5414AD, + 0x6AE290, 0x89D988, 0x50722C, 0xBEA404, 0x940777, 0x7030F3, + 0x27FC00, 0xA871EA, 0x49C266, 0x3DE064, 0x83DD97, 0x973FA3, + 0xFD9443, 0x8C860D, 0xDE4131, 0x9D3992, 0x8C70DD, 0xE7B717, + 0x3BDF08, 0x2B3715, 0xA0805C, 0x93805A, 0x921110, 0xD8E80F, + 0xAF806C, 0x4BFFDB, 0x0F9038, 0x761859, 0x15A562, 0xBBCB61, + 0xB989C7, 0xBD4010, 0x04F2D2, 0x277549, 0xF6B6EB, 0xBB22DB, + 0xAA140A, 0x2F2689, 0x768364, 0x333B09, 0x1A940E, 0xAA3A51, + 0xC2A31D, 0xAEEDAF, 0x12265C, 0x4DC26D, 0x9C7A2D, 0x9756C0, + 0x833F03, 0xF6F009, 0x8C402B, 0x99316D, 0x07B439, 0x15200C, + 0x5BC3D8, 0xC492F5, 0x4BADC6, 0xA5CA4E, 0xCD37A7, 0x36A9E6, + 0x9492AB, 0x6842DD, 0xDE6319, 0xEF8C76, 0x528B68, 0x37DBFC, + 0xABA1AE, 0x3115DF, 0xA1AE00, 0xDAFB0C, 0x664D64, 0xB705ED, + 0x306529, 0xBF5657, 0x3AFF47, 0xB9F96A, 0xF3BE75, 0xDF9328, + 0x3080AB, 0xF68C66, 0x15CB04, 0x0622FA, 0x1DE4D9, 0xA4B33D, + 0x8F1B57, 0x09CD36, 0xE9424E, 0xA4BE13, 0xB52333, 0x1AAAF0, + 0xA8654F, 0xA5C1D2, 0x0F3F0B, 0xCD785B, 0x76F923, 0x048B7B, + 0x721789, 0x53A6C6, 0xE26E6F, 0x00EBEF, 0x584A9B, 0xB7DAC4, + 0xBA66AA, 0xCFCF76, 0x1D02D1, 0x2DF1B1, 0xC1998C, 0x77ADC3, + 0xDA4886, 0xA05DF7, 0xF480C6, 0x2FF0AC, 0x9AECDD, 0xBC5C3F, + 0x6DDED0, 0x1FC790, 0xB6DB2A, 0x3A25A3, 0x9AAF00, 0x9353AD, + 0x0457B6, 0xB42D29, 0x7E804B, 0xA707DA, 0x0EAA76, 0xA1597B, + 0x2A1216, 0x2DB7DC, 0xFDE5FA, 0xFEDB89, 0xFDBE89, 0x6C76E4, + 0xFCA906, 0x70803E, 0x156E85, 0xFF87FD, 0x073E28, 0x336761, + 0x86182A, 0xEABD4D, 0xAFE7B3, 0x6E6D8F, 0x396795, 0x5BBF31, + 0x48D784, 0x16DF30, 0x432DC7, 0x356125, 0xCE70C9, 0xB8CB30, + 0xFD6CBF, 0xA200A4, 0xE46C05, 0xA0DD5A, 0x476F21, 0xD21262, + 0x845CB9, 0x496170, 0xE0566B, 0x015299, 0x375550, 0xB7D51E, + 0xC4F133, 0x5F6E13, 0xE4305D, 0xA92E85, 0xC3B21D, 0x3632A1, + 0xA4B708, 0xD4B1EA, 0x21F716, 0xE4698F, 0x77FF27, 0x80030C, + 0x2D408D, 0xA0CD4F, 0x99A520, 0xD3A2B3, 0x0A5D2F, 0x42F9B4, + 0xCBDA11, 0xD0BE7D, 0xC1DB9B, 0xBD17AB, 0x81A2CA, 0x5C6A08, + 0x17552E, 0x550027, 0xF0147F, 0x8607E1, 0x640B14, 0x8D4196, + 0xDEBE87, 0x2AFDDA, 0xB6256B, 0x34897B, 0xFEF305, 0x9EBFB9, + 0x4F6A68, 0xA82A4A, 0x5AC44F, 0xBCF82D, 0x985AD7, 0x95C7F4, + 0x8D4D0D, 0xA63A20, 0x5F57A4, 0xB13F14, 0x953880, 0x0120CC, + 0x86DD71, 0xB6DEC9, 0xF560BF, 0x11654D, 0x6B0701, 0xACB08C, + 0xD0C0B2, 0x485551, 0x0EFB1E, 0xC37295, 0x3B06A3, 0x3540C0, + 0x7BDC06, 0xCC45E0, 0xFA294E, 0xC8CAD6, 0x41F3E8, 0xDE647C, + 0xD8649B, 0x31BED9, 0xC397A4, 0xD45877, 0xC5E369, 0x13DAF0, + 0x3C3ABA, 0x461846, 0x5F7555, 0xF5BDD2, 0xC6926E, 0x5D2EAC, + 0xED440E, 0x423E1C, 0x87C461, 0xE9FD29, 0xF3D6E7, 0xCA7C22, + 0x35916F, 0xC5E008, 0x8DD7FF, 0xE26A6E, 0xC6FDB0, 0xC10893, + 0x745D7C, 0xB2AD6B, 0x9D6ECD, 0x7B723E, 0x6A11C6, 0xA9CFF7, + 0xDF7329, 0xBAC9B5, 0x5100B7, 0x0DB2E2, 0x24BA74, 0x607DE5, + 0x8AD874, 0x2C150D, 0x0C1881, 0x94667E, 0x162901, 0x767A9F, + 0xBEFDFD, 0xEF4556, 0x367ED9, 0x13D9EC, 0xB9BA8B, 0xFC97C4, + 0x27A831, 0xC36EF1, 0x36C594, 0x56A8D8, 0xB5A8B4, 0x0ECCCF, + 0x2D8912, 0x34576F, 0x89562C, 0xE3CE99, 0xB920D6, 0xAA5E6B, + 0x9C2A3E, 0xCC5F11, 0x4A0BFD, 0xFBF4E1, 0x6D3B8E, 0x2C86E2, + 0x84D4E9, 0xA9B4FC, 0xD1EEEF, 0xC9352E, 0x61392F, 0x442138, + 0xC8D91B, 0x0AFC81, 0x6A4AFB, 0xD81C2F, 0x84B453, 0x8C994E, + 0xCC2254, 0xDC552A, 0xD6C6C0, 0x96190B, 0xB8701A, 0x649569, + 0x605A26, 0xEE523F, 0x0F117F, 0x11B5F4, 0xF5CBFC, 0x2DBC34, + 0xEEBC34, 0xCC5DE8, 0x605EDD, 0x9B8E67, 0xEF3392, 0xB817C9, + 0x9B5861, 0xBC57E1, 0xC68351, 0x103ED8, 0x4871DD, 0xDD1C2D, + 0xA118AF, 0x462C21, 0xD7F359, 0x987AD9, 0xC0549E, 0xFA864F, + 0xFC0656, 0xAE79E5, 0x362289, 0x22AD38, 0xDC9367, 0xAAE855, + 0x382682, 0x9BE7CA, 0xA40D51, 0xB13399, 0x0ED7A9, 0x480569, + 0xF0B265, 0xA7887F, 0x974C88, 0x36D1F9, 0xB39221, 0x4A827B, + 0x21CF98, 0xDC9F40, 0x5547DC, 0x3A74E1, 0x42EB67, 0xDF9DFE, + 0x5FD45E, 0xA4677B, 0x7AACBA, 0xA2F655, 0x23882B, 0x55BA41, + 0x086E59, 0x862A21, 0x834739, 0xE6E389, 0xD49EE5, 0x40FB49, + 0xE956FF, 0xCA0F1C, 0x8A59C5, 0x2BFA94, 0xC5C1D3, 0xCFC50F, + 0xAE5ADB, 0x86C547, 0x624385, 0x3B8621, 0x94792C, 0x876110, + 0x7B4C2A, 0x1A2C80, 0x12BF43, 0x902688, 0x893C78, 0xE4C4A8, + 0x7BDBE5, 0xC23AC4, 0xEAF426, 0x8A67F7, 0xBF920D, 0x2BA365, + 0xB1933D, 0x0B7CBD, 0xDC51A4, 0x63DD27, 0xDDE169, 0x19949A, + 0x9529A8, 0x28CE68, 0xB4ED09, 0x209F44, 0xCA984E, 0x638270, + 0x237C7E, 0x32B90F, 0x8EF5A7, 0xE75614, 0x08F121, 0x2A9DB5, + 0x4D7E6F, 0x5119A5, 0xABF9B5, 0xD6DF82, 0x61DD96, 0x023616, + 0x9F3AC4, 0xA1A283, 0x6DED72, 0x7A8D39, 0xA9B882, 0x5C326B, + 0x5B2746, 0xED3400, 0x7700D2, 0x55F4FC, 0x4D5901, 0x8071E0, + #endif + }; + + static const double PIo2[] = { + 1.57079625129699707031e+00, /* 0x3FF921FB, 0x40000000 */ + 7.54978941586159635335e-08, /* 0x3E74442D, 0x00000000 */ + 5.39030252995776476554e-15, /* 0x3CF84698, 0x80000000 */ + 3.28200341580791294123e-22, /* 0x3B78CC51, 0x60000000 */ + 1.27065575308067607349e-29, /* 0x39F01B83, 0x80000000 */ + 1.22933308981111328932e-36, /* 0x387A2520, 0x40000000 */ + 2.73370053816464559624e-44, /* 0x36E38222, 0x80000000 */ + 2.16741683877804819444e-51, /* 0x3569F31D, 0x00000000 */ + }; + + int32_t jz,jx,jv,jp,jk,carry,n,iq[20],i,j,k,m,q0,ih; + double z,fw,f[20],fq[20],q[20]; + + /* initialize jk*/ + jk = init_jk[prec]; + jp = jk; + + /* determine jx,jv,q0, note that 3>q0 */ + jx = nx-1; + jv = (e0-3)/24; if(jv<0) jv=0; + q0 = e0-24*(jv+1); + + /* set up f[0] to f[jx+jk] where f[jx+jk] = ipio2[jv+jk] */ + j = jv-jx; m = jx+jk; + for (i=0; i<=m; i++,j++) + f[i] = j<0 ? 0.0 : (double)ipio2[j]; + + /* compute q[0],q[1],...q[jk] */ + for (i=0; i<=jk; i++) { + for (j=0,fw=0.0; j<=jx; j++) + fw += x[j]*f[jx+i-j]; + q[i] = fw; + } + + jz = jk; +recompute: + /* distill q[] into iq[] reversingly */ + for (i=0,j=jz,z=q[jz]; j>0; i++,j--) { + fw = (double)(int32_t)(0x1p-24*z); + iq[i] = (int32_t)(z - 0x1p24*fw); + z = q[j-1]+fw; + } + + /* compute n */ + z = scalbn(z,q0); /* actual value of z */ + z -= 8.0*floor(z*0.125); /* trim off integer >= 8 */ + n = (int32_t)z; + z -= (double)n; + ih = 0; + if (q0 > 0) { /* need iq[jz-1] to determine n */ + i = iq[jz-1]>>(24-q0); n += i; + iq[jz-1] -= i<<(24-q0); + ih = iq[jz-1]>>(23-q0); + } + else if (q0 == 0) ih = iq[jz-1]>>23; + else if (z >= 0.5) ih = 2; + + if (ih > 0) { /* q > 0.5 */ + n += 1; carry = 0; + for (i=0; i<jz; i++) { /* compute 1-q */ + j = iq[i]; + if (carry == 0) { + if (j != 0) { + carry = 1; + iq[i] = 0x1000000 - j; + } + } else + iq[i] = 0xffffff - j; + } + if (q0 > 0) { /* rare case: chance is 1 in 12 */ + switch(q0) { + case 1: + iq[jz-1] &= 0x7fffff; break; + case 2: + iq[jz-1] &= 0x3fffff; break; + } + } + if (ih == 2) { + z = 1.0 - z; + if (carry != 0) + z -= scalbn(1.0,q0); + } + } + + /* check if recomputation is needed */ + if (z == 0.0) { + j = 0; + for (i=jz-1; i>=jk; i--) j |= iq[i]; + if (j == 0) { /* need recomputation */ + for (k=1; iq[jk-k]==0; k++); /* k = no. of terms needed */ + + for (i=jz+1; i<=jz+k; i++) { /* add q[jz+1] to q[jz+k] */ + f[jx+i] = (double)ipio2[jv+i]; + for (j=0,fw=0.0; j<=jx; j++) + fw += x[j]*f[jx+i-j]; + q[i] = fw; + } + jz += k; + goto recompute; + } + } + + /* chop off zero terms */ + if (z == 0.0) { + jz -= 1; + q0 -= 24; + while (iq[jz] == 0) { + jz--; + q0 -= 24; + } + } else { /* break z into 24-bit if necessary */ + z = scalbn(z,-q0); + if (z >= 0x1p24) { + fw = (double)(int32_t)(0x1p-24*z); + iq[jz] = (int32_t)(z - 0x1p24*fw); + jz += 1; + q0 += 24; + iq[jz] = (int32_t)fw; + } else + iq[jz] = (int32_t)z; + } + + /* convert integer "bit" chunk to floating-point value */ + fw = scalbn(1.0,q0); + for (i=jz; i>=0; i--) { + q[i] = fw*(double)iq[i]; + fw *= 0x1p-24; + } + + /* compute PIo2[0,...,jp]*q[jz,...,0] */ + for(i=jz; i>=0; i--) { + for (fw=0.0,k=0; k<=jp && k<=jz-i; k++) + fw += PIo2[k]*q[i+k]; + fq[jz-i] = fw; + } + + /* compress fq[] into y[] */ + switch(prec) { + case 0: + fw = 0.0; + for (i=jz; i>=0; i--) + fw += fq[i]; + y[0] = ih==0 ? fw : -fw; + break; + case 1: + case 2: + fw = 0.0; + for (i=jz; i>=0; i--) + fw += fq[i]; + // TODO: drop excess precision here once double_t is used + fw = (double)fw; + y[0] = ih==0 ? fw : -fw; + fw = fq[0]-fw; + for (i=1; i<=jz; i++) + fw += fq[i]; + y[1] = ih==0 ? fw : -fw; + break; + case 3: /* painful */ + for (i=jz; i>0; i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (i=jz; i>1; i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (fw=0.0,i=jz; i>=2; i--) + fw += fq[i]; + if (ih==0) { + y[0] = fq[0]; y[1] = fq[1]; y[2] = fw; + } else { + y[0] = -fq[0]; y[1] = -fq[1]; y[2] = -fw; + } + } + return n&7; +} + +int __rem_pio2f(float x, double *y) { + /* + * invpio2: 53 bits of 2/pi + * pio2_1: first 25 bits of pi/2 + * pio2_1t: pi/2 - pio2_1 + */ + static const double toint = 1.5/EPS, + invpio2 = 6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */ + pio2_1 = 1.57079631090164184570e+00, /* 0x3FF921FB, 0x50000000 */ + pio2_1t = 1.58932547735281966916e-08; /* 0x3E5110b4, 0x611A6263 */ + + union {float f; uint32_t i;} u = {x}; + double tx[1],ty[1]; + double fn; + uint32_t ix; + int n, sign, e0; + + ix = u.i & 0x7fffffff; + /* 25+53 bit pi is good enough for medium size */ + if (ix < 0x4dc90fdb) { /* |x| ~< 2^28*(pi/2), medium size */ + /* Use a specialized rint() to get fn. Assume round-to-nearest. */ + fn = (double)x*invpio2 + toint - toint; + n = (int32_t)fn; + *y = x - fn*pio2_1 - fn*pio2_1t; + return n; + } + if(ix>=0x7f800000) { /* x is inf or NaN */ + *y = x-x; + return 0; + } + /* scale x into [2^23, 2^24-1] */ + sign = u.i>>31; + e0 = (ix>>23) - (0x7f+23); /* e0 = ilogb(|x|)-23, positive */ + u.i = ix - (e0<<23); + tx[0] = u.f; + n = __rem_pio2_large(tx,ty,e0,1,0); + if (sign) { + *y = -ty[0]; + return -n; + } + *y = ty[0]; + return n; +} + +double cos(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +// Taken from musl. See musl for the license/copyright! +float cosf(float x) { + /* Small multiples of pi/2 rounded to double precision. */ + static const double c1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ + c2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ + c3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ + c4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + + double y; + uint32_t ix; + unsigned n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x != 0 */ + FORCE_EVAL(x + 0x1p120f); + return 1.0f; + } + return __cosdf(x); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix > 0x4016cbe3) /* |x| ~> 3*pi/4 */ + return -__cosdf(sign ? x+c2pio2 : x-c2pio2); + else { + if (sign) + return __sindf(x + c1pio2); + else + return __sindf(c1pio2 - x); + } + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix > 0x40afeddf) /* |x| ~> 7*pi/4 */ + return __cosdf(sign ? x+c4pio2 : x-c4pio2); + else { + if (sign) + return __sindf(-x - c3pio2); + else + return __sindf(x - c3pio2); + } + } + + /* cos(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x-x; + + /* general argument reduction needed */ + n = __rem_pio2f(x,&y); + switch (n&3) { + case 0: return __cosdf(y); + case 1: return __sindf(-y); + case 2: return -__cosdf(y); + default: + return __sindf(y); + } +} +long double cosl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double sin(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +// Taken from musl. See musl for the license/copyright! +float sinf(float x) { + /* Small multiples of pi/2 rounded to double precision. */ + static const double s1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ + s2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ + s3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ + s4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + + double y; + uint32_t ix; + int n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00800000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __sindf(x); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix <= 0x4016cbe3) { /* |x| ~<= 3pi/4 */ + if (sign) + return -__cosdf(x + s1pio2); + else + return __cosdf(x - s1pio2); + } + return __sindf(sign ? -(x + s2pio2) : -(x - s2pio2)); + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix <= 0x40afeddf) { /* |x| ~<= 7*pi/4 */ + if (sign) + return __cosdf(x + s3pio2); + else + return -__cosdf(x - s3pio2); + } + return __sindf(sign ? x + s4pio2 : x - s4pio2); + } + + /* sin(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x - x; + + /* general argument reduction needed */ + n = __rem_pio2f(x, &y); + switch (n&3) { + case 0: return __sindf(y); + case 1: return __cosdf(y); + case 2: return __sindf(-y); + default: + return -__cosdf(y); + } +} +long double sinl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double tan(double x) { + mlibc::infoLogger() << "mlibc: tan() is not precise" << frg::endlog; + return tanf(x); +} +// Taken from musl. See musl for the license/copyright! +float tanf(float x) { + /* Small multiples of pi/2 rounded to double precision. */ + static const double t1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ + t2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ + t3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ + t4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + + double y; + uint32_t ix; + unsigned n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00800000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __tandf(x, 0); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix <= 0x4016cbe3) /* |x| ~<= 3pi/4 */ + return __tandf((sign ? x+t1pio2 : x-t1pio2), 1); + else + return __tandf((sign ? x+t2pio2 : x-t2pio2), 0); + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix <= 0x40afeddf) /* |x| ~<= 7*pi/4 */ + return __tandf((sign ? x+t3pio2 : x-t3pio2), 1); + else + return __tandf((sign ? x+t4pio2 : x-t4pio2), 0); + } + + /* tan(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x - x; + + /* argument reduction */ + n = __rem_pio2f(x, &y); + return __tandf(y, n&1); +} +long double tanl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double acosh(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float acoshf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double acoshl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double asinh(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float asinhf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double asinhl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double atanh(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float atanhf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double atanhl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double cosh(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float coshf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double coshl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double sinh(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float sinhf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double sinhl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double tanh(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float tanhf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double tanhl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double exp(double x) { + static const double half[2] = {0.5,-0.5}, + ln2hi = 6.93147180369123816490e-01, /* 0x3fe62e42, 0xfee00000 */ + ln2lo = 1.90821492927058770002e-10, /* 0x3dea39ef, 0x35793c76 */ + invln2 = 1.44269504088896338700e+00, /* 0x3ff71547, 0x652b82fe */ + P1 = 1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */ + P2 = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */ + P3 = 6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */ + P4 = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */ + P5 = 4.13813679705723846039e-08; /* 0x3E663769, 0x72BEA4D0 */ + + double hi, lo, c, xx, y; + int k, sign; + uint32_t hx; + + GET_HIGH_WORD(hx, x); + sign = hx>>31; + hx &= 0x7fffffff; /* high word of |x| */ + + /* special cases */ + if (hx >= 0x4086232b) { /* if |x| >= 708.39... */ + if (isnan(x)) + return x; + if (x > 709.782712893383973096) { + /* overflow if x!=inf */ + x *= 0x1p1023; + return x; + } + if (x < -708.39641853226410622) { + /* underflow if x!=-inf */ + FORCE_EVAL((float)(-0x1p-149/x)); + if (x < -745.13321910194110842) + return 0; + } + } + + /* argument reduction */ + if (hx > 0x3fd62e42) { /* if |x| > 0.5 ln2 */ + if (hx >= 0x3ff0a2b2) /* if |x| >= 1.5 ln2 */ + k = (int)(invln2*x + half[sign]); + else + k = 1 - sign - sign; + hi = x - k*ln2hi; /* k*ln2hi is exact here */ + lo = k*ln2lo; + x = hi - lo; + } else if (hx > 0x3e300000) { /* if |x| > 2**-28 */ + k = 0; + hi = x; + lo = 0; + } else { + /* inexact if x!=0 */ + FORCE_EVAL(0x1p1023 + x); + return 1 + x; + } + + /* x is now in primary range */ + xx = x*x; + c = x - xx*(P1+xx*(P2+xx*(P3+xx*(P4+xx*P5)))); + y = 1 + (x*c/(2-c) - lo + hi); + if (k == 0) + return y; + return scalbn(y, k); +} +float expf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double expl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double exp2(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +// Taken from musl. See musl for the license/copyright! +float exp2f(float x) { + constexpr int TBLSIZE = 16; + + constexpr float redux = 0x1.8p23f / TBLSIZE; + constexpr float P1 = 0x1.62e430p-1f; + constexpr float P2 = 0x1.ebfbe0p-3f; + constexpr float P3 = 0x1.c6b348p-5f; + constexpr float P4 = 0x1.3b2c9cp-7f; + + constexpr double exp2ft[TBLSIZE] = { + 0x1.6a09e667f3bcdp-1, + 0x1.7a11473eb0187p-1, + 0x1.8ace5422aa0dbp-1, + 0x1.9c49182a3f090p-1, + 0x1.ae89f995ad3adp-1, + 0x1.c199bdd85529cp-1, + 0x1.d5818dcfba487p-1, + 0x1.ea4afa2a490dap-1, + 0x1.0000000000000p+0, + 0x1.0b5586cf9890fp+0, + 0x1.172b83c7d517bp+0, + 0x1.2387a6e756238p+0, + 0x1.306fe0a31b715p+0, + 0x1.3dea64c123422p+0, + 0x1.4bfdad5362a27p+0, + 0x1.5ab07dd485429p+0, + }; + + double t, r, z; + union {float f; uint32_t i;} u = {x}; + union {double f; uint64_t i;} uk; + uint32_t ix, i0, k; + + /* Filter out exceptional cases. */ + ix = u.i & 0x7fffffff; + if (ix > 0x42fc0000) { /* |x| > 126 */ + if (ix > 0x7f800000) /* NaN */ + return x; + if (u.i >= 0x43000000 && u.i < 0x80000000) { /* x >= 128 */ + x *= 0x1p127f; + return x; + } + if (u.i >= 0x80000000) { /* x < -126 */ + if (u.i >= 0xc3160000 || (u.i & 0x0000ffff)) + FORCE_EVAL(-0x1p-149f/x); + if (u.i >= 0xc3160000) /* x <= -150 */ + return 0; + } + } else if (ix <= 0x33000000) { /* |x| <= 0x1p-25 */ + return 1.0f + x; + } + + /* Reduce x, computing z, i0, and k. */ + u.f = x + redux; + i0 = u.i; + i0 += TBLSIZE / 2; + k = i0 / TBLSIZE; + uk.i = (uint64_t)(0x3ff + k)<<52; + i0 &= TBLSIZE - 1; + u.f -= redux; + z = x - u.f; + /* Compute r = exp2(y) = exp2ft[i0] * p(z). */ + r = exp2ft[i0]; + t = r * z; + r = r + t * (P1 + z * P2) + t * (z * z) * (P3 + z * P4); + + /* Scale by 2**k */ + return r * uk.f; +} +long double exp2l(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double expm1(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float expm1f(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double expm1l(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double frexp(double x, int *power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float frexpf(float x, int *power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double frexpl(long double x, int *power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double ilogb(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float ilogbf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double ilogbl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double ldexp(double x, int power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float ldexpf(float x, int power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double ldexpl(long double x, int power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double log(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float logf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double logl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double log10(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float log10f(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double log10l(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double log1p(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float log1pf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double log1pl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +// Taken from musl. See musl for the license/copyright! +double log2(double x) { + static const double + ivln2hi = 1.44269504072144627571e+00, /* 0x3ff71547, 0x65200000 */ + ivln2lo = 1.67517131648865118353e-10, /* 0x3de705fc, 0x2eefa200 */ + Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ + Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ + Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ + Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ + Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ + Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ + Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + + union {double f; uint64_t i;} u = {x}; + double hfsq,f,s,z,R,w,t1,t2,y,hi,lo,val_hi,val_lo; + uint32_t hx; + int k; + + hx = u.i>>32; + k = 0; + if (hx < 0x00100000 || hx>>31) { + if (u.i<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (hx>>31) + return (x-x)/0.0; /* log(-#) = NaN */ + /* subnormal number, scale x up */ + k -= 54; + x *= 0x1p54; + u.f = x; + hx = u.i>>32; + } else if (hx >= 0x7ff00000) { + return x; + } else if (hx == 0x3ff00000 && u.i<<32 == 0) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + hx += 0x3ff00000 - 0x3fe6a09e; + k += (int)(hx>>20) - 0x3ff; + hx = (hx&0x000fffff) + 0x3fe6a09e; + u.i = (uint64_t)hx<<32 | (u.i&0xffffffff); + x = u.f; + + f = x - 1.0; + hfsq = 0.5*f*f; + s = f/(2.0+f); + z = s*s; + w = z*z; + t1 = w*(Lg2+w*(Lg4+w*Lg6)); + t2 = z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + R = t2 + t1; + + /* + * f-hfsq must (for args near 1) be evaluated in extra precision + * to avoid a large cancellation when x is near sqrt(2) or 1/sqrt(2). + * This is fairly efficient since f-hfsq only depends on f, so can + * be evaluated in parallel with R. Not combining hfsq with R also + * keeps R small (though not as small as a true `lo' term would be), + * so that extra precision is not needed for terms involving R. + * + * Compiler bugs involving extra precision used to break Dekker's + * theorem for spitting f-hfsq as hi+lo, unless double_t was used + * or the multi-precision calculations were avoided when double_t + * has extra precision. These problems are now automatically + * avoided as a side effect of the optimization of combining the + * Dekker splitting step with the clear-low-bits step. + * + * y must (for args near sqrt(2) and 1/sqrt(2)) be added in extra + * precision to avoid a very large cancellation when x is very near + * these values. Unlike the above cancellations, this problem is + * specific to base 2. It is strange that adding +-1 is so much + * harder than adding +-ln2 or +-log10_2. + * + * This uses Dekker's theorem to normalize y+val_hi, so the + * compiler bugs are back in some configurations, sigh. And I + * don't want to used double_t to avoid them, since that gives a + * pessimization and the support for avoiding the pessimization + * is not yet available. + * + * The multi-precision calculations for the multiplications are + * routine. + */ + + /* hi+lo = f - hfsq + s*(hfsq+R) ~ log(1+f) */ + hi = f - hfsq; + u.f = hi; + u.i &= (uint64_t)-1<<32; + hi = u.f; + lo = f - hi - hfsq + s*(hfsq+R); + + val_hi = hi*ivln2hi; + val_lo = (lo+hi)*ivln2lo + lo*ivln2hi; + + /* spadd(val_hi, val_lo, y), except for not using double_t: */ + y = k; + w = y + val_hi; + val_lo += (y - w) + val_hi; + val_hi = w; + + return val_lo + val_hi; +} +float log2f(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double log2l(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double logb(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float logbf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double logbl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double modf(double x, double *integral) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float modff(float x, float *integral) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double modfl(long double x, long double *integral) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double scalbn(double x, int n) { + union {double f; uint64_t i;} u; + double y = x; + + if (n > 1023) { + y *= 0x1p1023; + n -= 1023; + if (n > 1023) { + y *= 0x1p1023; + n -= 1023; + if (n > 1023) + n = 1023; + } + } else if (n < -1022) { + /* make sure final n < -53 to avoid double + rounding in the subnormal range */ + y *= 0x1p-1022 * 0x1p53; + n += 1022 - 53; + if (n < -1022) { + y *= 0x1p-1022 * 0x1p53; + n += 1022 - 53; + if (n < -1022) + n = -1022; + } + } + u.i = (uint64_t)(0x3ff+n)<<52; + x = y * u.f; + return x; +} +float scalbnf(float x, int power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double scalbnl(long double x, int power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double scalbln(double x, long power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float scalblnf(float x, long power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double scalblnl(long double x, long power) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double cbrt(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float cbrtf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double cbrtl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double fabs(double x) { + return signbit(x) ? -x : x; +} +float fabsf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double fabsl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double hypot(double x, double y) { + __ensure(isfinite(x)); + __ensure(isfinite(y)); + // TODO: fix exception handling + double u = fabs(x); + double v = fabs(y); + if(u > v) + return u * sqrt(1 + (v / u) * (v / u)); + return v * sqrt(1 + (u / v) * (u / v)); +} +float hypotf(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double hypotl(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double pow(double x, double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float powf(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double powl(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double sqrt(double x) { + auto sse_x = _mm_set_sd(x); + return _mm_cvtsd_f64(_mm_sqrt_sd(sse_x, sse_x)); +} +float sqrtf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double sqrtl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double erf(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float erff(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double erfl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double erfc(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float erfcf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double erfcl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double lgamma(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float lgammaf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double lgammal(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double tgamma(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float tgammaf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double tgammal(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double ceil(double x) { + auto soft_x = ieee754::extractNative(x); + auto result = ieee754::ceil(soft_x); + return ieee754::compileNative(result); +} +float ceilf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double ceill(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double floor(double x) { + auto soft_x = ieee754::extractNative(x); + auto result = ieee754::floor(soft_x); + return ieee754::compileNative(result); +} +float floorf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double floorl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double nearbyint(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float nearbyintf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double nearbyintl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double rint(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float rintf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double rintl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +long lrint(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long lrintf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long lrintl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +long long llrint(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long long llrintf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long long llrintl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double round(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float roundf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double roundl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +long lround(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long lroundf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long lroundl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +long long llround(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long long llroundf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long long llroundl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double trunc(double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float truncf(float x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double truncl(long double x) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double fmod(double x, double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float fmodf(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double fmodl(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double remainder(double x, double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float remainderf(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double remainderl(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double remquo(double x, double y, int *quotient) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float remquof(float x, float y, int *quotient) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double remquol(long double x, long double y, int *quotient) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double copysign(double x, double sign) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float copysignf(float x, float sign) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double copysignl(long double x, long double sign) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double nan(const char *tag) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float nanf(const char *tag) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double nanl(const char *tag) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double nextafter(double x, double dir) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float nextafterf(float x, float dir) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double nextafterl(long double x, long double dir) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double nexttoward(double x, long double dir) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float nexttowardf(float x, long double dir) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double nexttowardl(long double x, long double dir) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double fdim(double x, double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +float fdimf(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double fdiml(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double fmax(double x, double y) { + __ensure(isfinite(x) && isfinite(y)); + return x < y ? y : x; +} +float fmaxf(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double fmaxl(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +double fmin(double x, double y) { + __ensure(isfinite(x) && isfinite(y)); + return x < y ? x : y; +} +float fminf(float x, float y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +long double fminl(long double x, long double y) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +//gnu extension + +void sincos(double x, double *sx, double *cx) { + mlibc::infoLogger() << "mlibc: sincos() is not precise" << frg::endlog; + float sxf; + float cxf; + sincosf(x, &sxf, &cxf); + *sx = sxf; + *cx = cxf; +} + +void sincosf(float x, float *sx, float *cx) { + // This is a lazy implementation. + __ensure(sx); + __ensure(cx); + *sx = sinf(x); + *cx = cosf(x); +} +void sincosl(long double, long double *, long double *) { + __ensure(!"sincosl() not implemented"); + __builtin_unreachable(); +} + +double exp10(double) { + __ensure(!"exp10() not implemented"); + __builtin_unreachable(); +} +float exp10f(float) { + __ensure(!"exp10f() not implemented"); + __builtin_unreachable(); +} +long double exp10l(long double) { + __ensure(!"exp10l() not implemented"); + __builtin_unreachable(); +} + +double pow10(double) { + __ensure(!"pow10() not implemented"); + __builtin_unreachable(); +} +float pow10f(float) { + __ensure(!"pow10f() not implemented"); + __builtin_unreachable(); +} +long double pow10l(long double) { + __ensure(!"pow10l() not implemented"); + __builtin_unreachable(); +} + diff --git a/lib/mlibc/options/ansi/generic/signal-stubs.cpp b/lib/mlibc/options/ansi/generic/signal-stubs.cpp new file mode 100644 index 0000000..6da9dc1 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/signal-stubs.cpp @@ -0,0 +1,44 @@ + +#include <bits/ensure.h> +#include <errno.h> +#include <signal.h> + +#include <mlibc/debug.hpp> +#include <mlibc/ansi-sysdeps.hpp> + +__sighandler signal(int sn, __sighandler handler) { + struct sigaction sa; + sa.sa_handler = handler; + sa.sa_flags = 0; + sa.sa_mask = 0; + struct sigaction old; + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_sigaction, SIG_ERR); + if(int e = mlibc::sys_sigaction(sn, &sa, &old)){ + errno = e; + return SIG_ERR; + } + return old.sa_handler; +} + +int raise(int sig) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_getpid && mlibc::sys_kill, -1); + pid_t pid = mlibc::sys_getpid(); + + if (int e = mlibc::sys_kill(pid, sig)) { + errno = e; + return -1; + } + + return 0; +} + +// This is a POSIX extension, but we have it in here for sigsetjmp +int sigprocmask(int how, const sigset_t *__restrict set, sigset_t *__restrict retrieve) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_sigprocmask, -1); + if(int e = mlibc::sys_sigprocmask(how, set, retrieve); e) { + errno = e; + return -1; + } + return 0; +} + diff --git a/lib/mlibc/options/ansi/generic/stdio-stubs.cpp b/lib/mlibc/options/ansi/generic/stdio-stubs.cpp new file mode 100644 index 0000000..479a655 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/stdio-stubs.cpp @@ -0,0 +1,1270 @@ +#include <ctype.h> +#include <errno.h> +#include <stdarg.h> +#include <stdio.h> +#include <string.h> +#include <stdint.h> +#include <stdlib.h> +#include <wchar.h> +#include <ctype.h> +#include <limits.h> + +#include <abi-bits/fcntl.h> + +#include <bits/ensure.h> + +#include <mlibc/lock.hpp> +#include <mlibc/allocator.hpp> +#include <mlibc/debug.hpp> +#include <mlibc/file-io.hpp> +#include <mlibc/ansi-sysdeps.hpp> +#include <frg/mutex.hpp> +#include <frg/expected.hpp> +#include <frg/printf.hpp> + +template<typename F> +struct PrintfAgent { + PrintfAgent(F *formatter, frg::va_struct *vsp) + : _formatter{formatter}, _vsp{vsp} { } + + frg::expected<frg::format_error> operator() (char c) { + _formatter->append(c); + return {}; + } + frg::expected<frg::format_error> operator() (const char *c, size_t n) { + _formatter->append(c, n); + return {}; + } + + frg::expected<frg::format_error> operator() (char t, frg::format_options opts, + frg::printf_size_mod szmod) { + switch(t) { + case 'c': + if (szmod == frg::printf_size_mod::long_size) { + char c_buf[sizeof(wchar_t)]; + auto c = static_cast<wchar_t>(va_arg(_vsp->args, wint_t)); + mbstate_t shift_state = {}; + if (wcrtomb(c_buf, c, &shift_state) == size_t(-1)) + return frg::format_error::agent_error; + _formatter->append(c_buf); + break; + } + frg::do_printf_chars(*_formatter, t, opts, szmod, _vsp); + break; + case 'p': case 's': + frg::do_printf_chars(*_formatter, t, opts, szmod, _vsp); + break; + case 'd': case 'i': case 'o': case 'x': case 'X': case 'u': + frg::do_printf_ints(*_formatter, t, opts, szmod, _vsp); + break; + case 'f': case 'F': case 'g': case 'G': case 'e': case 'E': + frg::do_printf_floats(*_formatter, t, opts, szmod, _vsp); + break; + case 'm': + __ensure(!opts.fill_zeros); + __ensure(!opts.left_justify); + __ensure(!opts.alt_conversion); + __ensure(opts.minimum_width == 0); + __ensure(szmod == frg::printf_size_mod::default_size); + __ensure(!opts.precision); + _formatter->append(strerror(errno)); + break; + case 'n': { + __ensure(szmod == frg::printf_size_mod::default_size); + auto p = va_arg(_vsp->args, int *); + *p = _formatter->count; + break; + } + default: + mlibc::infoLogger() << "\e[31mmlibc: Unknown printf terminator '" + << t << "'\e[39m" << frg::endlog; + __ensure(!"Illegal printf terminator"); + } + + return {}; + } + +private: + F *_formatter; + frg::va_struct *_vsp; +}; + +struct StreamPrinter { + StreamPrinter(FILE *stream) + : stream(stream), count(0) { } + + void append(char c) { + fwrite_unlocked(&c, 1, 1, stream); + count++; + } + + void append(const char *str) { + fwrite_unlocked(str, strlen(str), 1, stream); + count += strlen(str); + } + + void append(const char *str, size_t n) { + fwrite_unlocked(str, n, 1, stream); + count += n; + } + + FILE *stream; + size_t count; +}; + +struct BufferPrinter { + BufferPrinter(char *buffer) + : buffer(buffer), count(0) { } + + void append(char c) { + buffer[count] = c; + count++; + } + + void append(const char *str) { + // TODO: use strcat + for(size_t i = 0; str[i]; i++) { + buffer[count] = str[i]; + count++; + } + } + + void append(const char *str, size_t n) { + // TODO: use strcat + for(size_t i = 0; i < n; i++) { + buffer[count] = str[i]; + count++; + } + } + + char *buffer; + size_t count; +}; + +struct LimitedPrinter { + LimitedPrinter(char *buffer, size_t limit) + : buffer(buffer), limit(limit), count(0) { } + + void append(char c) { + if(count < limit) + buffer[count] = c; + count++; + } + + void append(const char *str) { + // TODO: use strcat + for(size_t i = 0; str[i]; i++) + append(str[i]); + } + + void append(const char *str, size_t n) { + // TODO: use strcat + for(size_t i = 0; i < n; i++) + append(str[i]); + } + + char *buffer; + size_t limit; + size_t count; +}; + +struct ResizePrinter { + ResizePrinter() + : buffer(nullptr), limit(0), count(0) { } + + void expand() { + if(count == limit) { + auto new_limit = frg::max(2 * limit, size_t(16)); + auto new_buffer = reinterpret_cast<char *>(malloc(new_limit)); + __ensure(new_buffer); + memcpy(new_buffer, buffer, count); + free(buffer); + buffer = new_buffer; + limit = new_limit; + } + __ensure(count < limit); + } + + void append(char c) { + expand(); + buffer[count] = c; + count++; + } + + void append(const char *str) { + for(size_t i = 0; str[i]; i++) + append(str[i]); + } + + void append(const char *str, size_t n) { + for(size_t i = 0; i < n; i++) + append(str[i]); + } + + char *buffer; + size_t limit; + size_t count; +}; + +int remove(const char *filename) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_rmdir, -1); + if(int e = mlibc::sys_rmdir(filename); e) { + if (e == ENOTDIR) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_unlinkat, -1); + if(e = mlibc::sys_unlinkat(AT_FDCWD, filename, 0); e) { + errno = e; + return -1; + } + + return 0; + } + return -1; + } + + return 0; +} + +int rename(const char *path, const char *new_path) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_rename, -1); + if(int e = mlibc::sys_rename(path, new_path); e) { + errno = e; + return -1; + } + return 0; +} + +int renameat(int olddirfd, const char *old_path, int newdirfd, const char *new_path) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_renameat, -1); + if(int e = mlibc::sys_renameat(olddirfd, old_path, newdirfd, new_path); e) { + errno = e; + return -1; + } + return 0; +} + +FILE *tmpfile(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +char *tmpnam(char *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +// fflush() is provided by the POSIX sublibrary +// fopen() is provided by the POSIX sublibrary +FILE *freopen(const char *__restrict path, const char *__restrict mode, FILE *__restrict f) { + auto file = static_cast<mlibc::abstract_file *>(f); + frg::unique_lock lock(file->_lock); + + if(file->reopen(path, mode) == -1) { + errno = EINVAL; + return nullptr; + } + + return f; +} + +void setbuf(FILE *__restrict stream, char *__restrict buffer) { + setvbuf(stream, buffer, buffer ? _IOFBF : _IONBF, BUFSIZ); +} +// setvbuf() is provided by the POSIX sublibrary + +void setlinebuf(FILE *stream) { + setvbuf(stream, NULL, _IOLBF, 0); +} + +void setbuffer(FILE *f, char *buf, size_t size) { + setvbuf(f, buf, buf ? _IOFBF : _IONBF, size); +} + +int fprintf(FILE *__restrict stream, const char *__restrict format, ...) { + va_list args; + va_start(args, format); + int result = vfprintf(stream, format, args); + va_end(args); + return result; +} + +int fscanf(FILE *__restrict stream, const char *__restrict format, ...) { + va_list args; + va_start(args, format); + int result = vfscanf(stream, format, args); + va_end(args); + return result; +} + +int printf(const char *__restrict format, ...) { + va_list args; + va_start(args, format); + int result = vfprintf(stdout, format, args); + va_end(args); + return result; +} + +namespace { + enum { + SCANF_TYPE_CHAR, + SCANF_TYPE_SHORT, + SCANF_TYPE_INTMAX, + SCANF_TYPE_L, + SCANF_TYPE_LL, + SCANF_TYPE_PTRDIFF, + SCANF_TYPE_SIZE_T, + SCANF_TYPE_INT + }; +} + +static void store_int(void *dest, unsigned int size, unsigned long long i) { + switch (size) { + case SCANF_TYPE_CHAR: + *(char *)dest = i; + break; + case SCANF_TYPE_SHORT: + *(short *)dest = i; + break; + case SCANF_TYPE_INTMAX: + *(intmax_t *)dest = i; + break; + case SCANF_TYPE_L: + *(long *)dest = i; + break; + case SCANF_TYPE_LL: + *(long long *)dest = i; + break; + case SCANF_TYPE_PTRDIFF: + *(ptrdiff_t *)dest = i; + break; + case SCANF_TYPE_SIZE_T: + *(size_t *)dest = i; + break; + /* fallthrough */ + case SCANF_TYPE_INT: + default: + *(int *)dest = i; + break; + } +} + +template<typename H> +static int do_scanf(H &handler, const char *fmt, __builtin_va_list args) { + int match_count = 0; + for (; *fmt; fmt++) { + + if (isspace(*fmt)) { + while (isspace(fmt[1])) fmt++; + while (isspace(handler.look_ahead())) + handler.consume(); + continue; + } + + if (*fmt != '%' || fmt[1] == '%') { + if (*fmt == '%') + fmt++; + char c = handler.consume(); + if (c != *fmt) + break; + continue; + } + + void *dest = NULL; + /* %n$ format */ + if (isdigit(*fmt) && fmt[1] == '$') { + /* TODO: dest = get_arg_at_pos(args, *fmt -'0'); */ + fmt += 3; + } else { + if (fmt[1] != '*') { + dest = va_arg(args, void*); + } + fmt++; + } + + int width = 0; + if (*fmt == '*') { + fmt++; + } else if (*fmt == '\'') { + /* TODO: numeric seperators locale stuff */ + mlibc::infoLogger() << "do_scanf: \' not implemented!" << frg::endlog; + fmt++; + continue; + } else if (*fmt == 'm') { + /* TODO: allocate buffer for them */ + mlibc::infoLogger() << "do_scanf: m not implemented!" << frg::endlog; + fmt++; + continue; + } else if (*fmt >= '0' && *fmt <= '9') { + /* read in width specifier */ + width = 0; + while (*fmt >= '0' && *fmt <= '9') { + width = width * 10 + (*fmt - '0'); + fmt++; + continue; + } + } + + /* type modifiers */ + unsigned int type = SCANF_TYPE_INT; + unsigned int base = 10; + switch (*fmt) { + case 'h': { + if (fmt[1] == 'h') { + type = SCANF_TYPE_CHAR; + fmt += 2; + break; + } + type = SCANF_TYPE_SHORT; + fmt++; + break; + } + case 'j': { + type = SCANF_TYPE_INTMAX; + fmt++; + break; + } + case 'l': { + if (fmt[1] == 'l') { + type = SCANF_TYPE_LL; + fmt += 2; + break; + } + type = SCANF_TYPE_L; + fmt++; + break; + } + case 'L': { + type = SCANF_TYPE_LL; + fmt++; + break; + } + case 'q': { + type = SCANF_TYPE_LL; + fmt++; + break; + } + case 't': { + type = SCANF_TYPE_PTRDIFF; + fmt++; + break; + } + case 'z': { + type = SCANF_TYPE_SIZE_T; + fmt++; + break; + } + } + + // Leading whitespace is skipped for most conversions except these. + if (*fmt != 'c' && *fmt != '[' && *fmt != 'n') { + while (isspace(handler.look_ahead())) + handler.consume(); + } + + switch (*fmt) { + case 'd': + case 'u': + base = 10; + [[fallthrough]]; + case 'i': { + bool is_negative = false; + unsigned long long res = 0; + + if((*fmt == 'i' || *fmt == 'd') && handler.look_ahead() == '-') { + handler.consume(); + is_negative = true; + } + + if(*fmt == 'i' && handler.look_ahead() == '0') { + handler.consume(); + if(handler.look_ahead() == 'x') { + handler.consume(); + base = 16; + } else { + base = 8; + } + } + + char c = handler.look_ahead(); + switch (base) { + case 10: + if(!isdigit(c)) + return match_count; + while (c >= '0' && c <= '9') { + handler.consume(); + res = res * 10 + (c - '0'); + c = handler.look_ahead(); + } + break; + case 16: + if (c == '0') { + handler.consume(); + c = handler.look_ahead(); + if (c == 'x') { + handler.consume(); + c = handler.look_ahead(); + } + } + while (true) { + if (c >= '0' && c <= '9') { + handler.consume(); + res = res * 16 + (c - '0'); + } else if (c >= 'a' && c <= 'f') { + handler.consume(); + res = res * 16 + (c - 'a' + 10); + } else if (c >= 'A' && c <= 'F') { + handler.consume(); + res = res * 16 + (c - 'A' + 10); + } else { + break; + } + c = handler.look_ahead(); + } + break; + case 8: + while (c >= '0' && c <= '7') { + handler.consume(); + res = res * 8 + (c - '0'); + c = handler.look_ahead(); + } + break; + } + if (dest) { + if(is_negative) + store_int(dest, type, -res); + else + store_int(dest, type, res); + } + break; + } + case 'o': { + unsigned long long res = 0; + char c = handler.look_ahead(); + while (c >= '0' && c <= '7') { + handler.consume(); + res = res * 8 + (c - '0'); + c = handler.look_ahead(); + } + if (dest) + store_int(dest, type, res); + break; + } + case 'x': + case 'X': { + unsigned long long res = 0; + char c = handler.look_ahead(); + if (c == '0') { + handler.consume(); + c = handler.look_ahead(); + if (c == 'x') { + handler.consume(); + c = handler.look_ahead(); + } + } + while (true) { + if (c >= '0' && c <= '9') { + handler.consume(); + res = res * 16 + (c - '0'); + } else if (c >= 'a' && c <= 'f') { + handler.consume(); + res = res * 16 + (c - 'a' + 10); + } else if (c >= 'A' && c <= 'F') { + handler.consume(); + res = res * 16 + (c - 'A' + 10); + } else { + break; + } + c = handler.look_ahead(); + } + if (dest) + store_int(dest, type, res); + break; + } + case 's': { + char *typed_dest = (char *)dest; + char c = handler.look_ahead(); + int count = 0; + while (c && !isspace(c)) { + handler.consume(); + if (typed_dest) + typed_dest[count] = c; + c = handler.look_ahead(); + count++; + if (width && count >= width) + break; + } + if (typed_dest) + typed_dest[count] = '\0'; + break; + } + case 'c': { + char *typed_dest = (char *)dest; + char c = handler.look_ahead(); + int count = 0; + if (!width) + width = 1; + while (c && count < width) { + handler.consume(); + if (typed_dest) + typed_dest[count] = c; + c = handler.look_ahead(); + count++; + } + break; + } + case '[': { + fmt++; + int invert = 0; + if (*fmt == '^') { + invert = 1; + fmt++; + } + + char scanset[257]; + memset(&scanset[0], invert, sizeof(char) * 257); + scanset[0] = '\0'; + + if (*fmt == '-') { + fmt++; + scanset[1+'-'] = 1 - invert; + } else if (*fmt == ']') { + fmt++; + scanset[1+']'] = 1 - invert; + } + + for (; *fmt != ']'; fmt++) { + if (!*fmt) return EOF; + if (*fmt == '-' && *fmt != ']') { + fmt++; + for (char c = *(fmt - 2); c < *fmt; c++) + scanset[1 + c] = 1 - invert; + } + scanset[1 + *fmt] = 1 - invert; + } + + char *typed_dest = (char *)dest; + int count = 0; + char c = handler.look_ahead(); + while (c && (!width || count < width)) { + handler.consume(); + if (!scanset[1 + c]) + break; + if (typed_dest) + typed_dest[count] = c; + c = handler.look_ahead(); + count++; + } + if (typed_dest) + typed_dest[count] = '\0'; + break; + } + case 'p': { + unsigned long long res = 0; + char c = handler.look_ahead(); + if (c == '0') { + handler.consume(); + c = handler.look_ahead(); + if (c == 'x') { + handler.consume(); + c = handler.look_ahead(); + } + } + while (true) { + if (c >= '0' && c <= '9') { + handler.consume(); + res = res * 16 + (c - '0'); + } else if (c >= 'a' && c <= 'f') { + handler.consume(); + res = res * 16 + (c - 'a'); + } else if (c >= 'A' && c <= 'F') { + handler.consume(); + res = res * 16 + (c - 'A'); + } else { + break; + } + c = handler.look_ahead(); + } + void **typed_dest = (void **)dest; + *typed_dest = (void *)(uintptr_t)res; + break; + } + case 'n': { + int *typed_dest = (int *)dest; + if (typed_dest) + *typed_dest = handler.num_consumed; + continue; + } + } + if (dest) match_count++; + } + return match_count; +} + +int scanf(const char *__restrict format, ...) { + va_list args; + va_start(args, format); + int result = vfscanf(stdin, format, args); + va_end(args); + return result; +} + +int snprintf(char *__restrict buffer, size_t max_size, const char *__restrict format, ...) { + va_list args; + va_start(args, format); + int result = vsnprintf(buffer, max_size, format, args); + va_end(args); + return result; +} + +int sprintf(char *__restrict buffer, const char *__restrict format, ...) { + va_list args; + va_start(args, format); + int result = vsprintf(buffer, format, args); + va_end(args); + return result; +} + +int sscanf(const char *__restrict buffer, const char *__restrict format, ...) { + va_list args; + va_start(args, format); + + int result = vsscanf(buffer, format, args); + + va_end(args); + return result; +} + +int vfprintf(FILE *__restrict stream, const char *__restrict format, __builtin_va_list args) { + frg::va_struct vs; + frg::arg arg_list[NL_ARGMAX + 1]; + vs.arg_list = arg_list; + va_copy(vs.args, args); + auto file = static_cast<mlibc::abstract_file *>(stream); + frg::unique_lock lock(file->_lock); + StreamPrinter p{stream}; +// mlibc::infoLogger() << "printf(" << format << ")" << frg::endlog; + auto res = frg::printf_format(PrintfAgent{&p, &vs}, format, &vs); + if (!res) + return -static_cast<int>(res.error()); + + return p.count; +} + +int vfscanf(FILE *__restrict stream, const char *__restrict format, __builtin_va_list args) { + auto file = static_cast<mlibc::abstract_file *>(stream); + frg::unique_lock lock(file->_lock); + + struct { + char look_ahead() { + char c; + size_t actual_size; + file->read(&c, 1, &actual_size); + if (actual_size) + file->unget(c); + return actual_size ? c : 0; + } + + char consume() { + char c; + size_t actual_size; + file->read(&c, 1, &actual_size); + if (actual_size) + num_consumed++; + return actual_size ? c : 0; + } + + mlibc::abstract_file *file; + int num_consumed; + } handler = {file, 0}; + + return do_scanf(handler, format, args); +} + +int vprintf(const char *__restrict format, __builtin_va_list args){ + return vfprintf(stdout, format, args); +} + +int vscanf(const char *__restrict, __builtin_va_list) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int vsnprintf(char *__restrict buffer, size_t max_size, + const char *__restrict format, __builtin_va_list args) { + frg::va_struct vs; + frg::arg arg_list[NL_ARGMAX + 1]; + vs.arg_list = arg_list; + va_copy(vs.args, args); + LimitedPrinter p{buffer, max_size ? max_size - 1 : 0}; +// mlibc::infoLogger() << "printf(" << format << ")" << frg::endlog; + auto res = frg::printf_format(PrintfAgent{&p, &vs}, format, &vs); + if (!res) + return -static_cast<int>(res.error()); + if (max_size) + p.buffer[frg::min(max_size - 1, p.count)] = 0; + return p.count; +} + +int vsprintf(char *__restrict buffer, const char *__restrict format, __builtin_va_list args) { + frg::va_struct vs; + frg::arg arg_list[NL_ARGMAX + 1]; + vs.arg_list = arg_list; + va_copy(vs.args, args); + BufferPrinter p(buffer); +// mlibc::infoLogger() << "printf(" << format << ")" << frg::endlog; + auto res = frg::printf_format(PrintfAgent{&p, &vs}, format, &vs); + if (!res) + return -static_cast<int>(res.error()); + p.buffer[p.count] = 0; + return p.count; +} + +int vsscanf(const char *__restrict buffer, const char *__restrict format, __builtin_va_list args) { + struct { + char look_ahead() { + return *buffer; + } + + char consume() { + num_consumed++; + return *buffer++; + } + + const char *buffer; + int num_consumed; + } handler = {buffer, 0}; + + int result = do_scanf(handler, format, args); + + return result; +} + +int fwprintf(FILE *__restrict, const wchar_t *__restrict, ...) MLIBC_STUB_BODY +int fwscanf(FILE *__restrict, const wchar_t *__restrict, ...) MLIBC_STUB_BODY +int vfwprintf(FILE *__restrict, const wchar_t *__restrict, __builtin_va_list) MLIBC_STUB_BODY +int vfwscanf(FILE *__restrict, const wchar_t *__restrict, __builtin_va_list) MLIBC_STUB_BODY + +int swprintf(wchar_t *__restrict, size_t, const wchar_t *__restrict, ...) MLIBC_STUB_BODY +int swscanf(wchar_t *__restrict, size_t, const wchar_t *__restrict, ...) MLIBC_STUB_BODY +int vswprintf(wchar_t *__restrict, size_t, const wchar_t *__restrict, __builtin_va_list) MLIBC_STUB_BODY +int vswscanf(wchar_t *__restrict, size_t, const wchar_t *__restrict, __builtin_va_list) MLIBC_STUB_BODY + +int wprintf(const wchar_t *__restrict, ...) MLIBC_STUB_BODY +int wscanf(const wchar_t *__restrict, ...) MLIBC_STUB_BODY +int vwprintf(const wchar_t *__restrict, __builtin_va_list) MLIBC_STUB_BODY +int vwscanf(const wchar_t *__restrict, __builtin_va_list) MLIBC_STUB_BODY + +int fgetc(FILE *stream) { + char c; + auto bytes_read = fread(&c, 1, 1, stream); + if(bytes_read != 1) + return EOF; + return c; +} + +char *fgets(char *__restrict buffer, size_t max_size, FILE *__restrict stream) { + auto file = static_cast<mlibc::abstract_file *>(stream); + frg::unique_lock lock(file->_lock); + return fgets_unlocked(buffer, max_size, stream); +} + +int fputc_unlocked(int c, FILE *stream) { + char d = c; + if(fwrite_unlocked(&d, 1, 1, stream) != 1) + return EOF; + return 1; +} + +int fputc(int c, FILE *stream) { + auto file = static_cast<mlibc::abstract_file *>(stream); + frg::unique_lock lock(file->_lock); + return fputc_unlocked(c, stream); +} + +int fputs_unlocked(const char *__restrict string, FILE *__restrict stream) { + if(fwrite_unlocked(string, strlen(string), 1, stream) != 1) + return EOF; + return 1; +} + +int fputs(const char *__restrict string, FILE *__restrict stream) { + auto file = static_cast<mlibc::abstract_file *>(stream); + frg::unique_lock lock(file->_lock); + return fputs_unlocked(string, stream); +} + +int getc_unlocked(FILE *stream) { + return fgetc_unlocked(stream); +} + +int getc(FILE *stream) { + return fgetc(stream); +} + +int getchar_unlocked(void) { + return fgetc_unlocked(stdin); +} + +int getchar(void) { + return fgetc(stdin); +} + +char *gets(char *s){ + return fgets(s, SIZE_MAX, stdin); +} + +int putc_unlocked(int c, FILE *stream) { + char d = c; + if(fwrite_unlocked(&d, 1, 1, stream) != 1) + return EOF; + return c; +} + +int putc(int c, FILE *stream) { + auto file = static_cast<mlibc::abstract_file *>(stream); + frg::unique_lock lock(file->_lock); + return putc_unlocked(c, stream); +} + +int putchar_unlocked(int c) { + return putc_unlocked(c, stdout); +} + +int putchar(int c) { + auto file = static_cast<mlibc::abstract_file *>(stdout); + frg::unique_lock lock(file->_lock); + return putchar_unlocked(c); +} + +int puts(const char *string) { + auto file = static_cast<mlibc::abstract_file *>(stdout); + frg::unique_lock lock(file->_lock); + + size_t progress = 0; + size_t len = strlen(string); + while(progress < len) { + size_t chunk; + if(file->write(string + progress, + len - progress, &chunk)) { + return EOF; + }else if(!chunk) { + return EOF; + } + + progress += chunk; + } + + size_t unused; + if (!file->write("\n", 1, &unused)) { + return EOF; + } + + return 1; +} + +wint_t fgetwc(FILE *) MLIBC_STUB_BODY +wchar_t *fgetws(wchar_t *__restrict, int, FILE *__restrict) MLIBC_STUB_BODY +wint_t fputwc(wchar_t, FILE *) MLIBC_STUB_BODY +int fputws(const wchar_t *__restrict, FILE *__restrict) MLIBC_STUB_BODY +int fwide(FILE *, int) MLIBC_STUB_BODY +wint_t getwc(FILE *) MLIBC_STUB_BODY +wint_t getwchar(void) MLIBC_STUB_BODY +wint_t putwc(wchar_t, FILE *) MLIBC_STUB_BODY +wint_t putwchar(wchar_t) MLIBC_STUB_BODY +wint_t ungetwc(wint_t, FILE *) MLIBC_STUB_BODY + +size_t fread(void *buffer, size_t size, size_t count, FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + return fread_unlocked(buffer, size, count, file_base); +} + +size_t fwrite(const void *buffer, size_t size , size_t count, FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + frg::unique_lock lock(file->_lock); + return fwrite_unlocked(buffer, size, count, file_base); +} + +int fgetpos(FILE *__restrict, fpos_t *__restrict) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +// fseek() is provided by the POSIX sublibrary +int fsetpos(FILE *, const fpos_t *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} +// ftell() is provided by the POSIX sublibrary + +void clearerr(FILE *file_base) { + file_base->__status_bits = 0; +} + +int feof(FILE *file_base) { + return file_base->__status_bits & __MLIBC_EOF_BIT; +} + +int ferror(FILE *file_base) { + return file_base->__status_bits & __MLIBC_ERROR_BIT; +} + +void perror(const char *string) { + int error = errno; + if (string && *string) { + fprintf(stderr, "%s: ", string); + } + fprintf(stderr, "%s\n", strerror(error)); +} + +// POSIX extensions. + +ssize_t getline(char **line, size_t *n, FILE *stream) { + return getdelim(line, n, '\n', stream); +} + +ssize_t getdelim(char **line, size_t *n, int delim, FILE *stream) { + // Otherwise, we cannot store the buffer / size. + if(!line || !n) { + errno = EINVAL; + return -1; + } + + char *buffer = *line; + /* set the starting capacity to 512 if buffer = NULL */ + size_t capacity = (!buffer) ? 512 : *n; + size_t nwritten = 0; + + auto file = static_cast<mlibc::abstract_file *>(stream); + frg::unique_lock lock(file->_lock); + + // Avoid allocating if we've already hit the end + auto c = fgetc_unlocked(stream); + if (c == EOF || ferror(stream)) { + return -1; + } else { + file->unget(c); + } + + while (true) { + // Fill the buffer + while (buffer && capacity > 0 && nwritten < capacity - 1) { + auto c = fgetc_unlocked(stream); + if (ferror(stream)) { + return -1; + } else if (c == EOF) { + buffer[nwritten] = 0; + return nwritten; + } + + buffer[nwritten++] = c; + + if (c == delim) { + buffer[nwritten] = 0; + return nwritten; + } + } + + // Double the size of the buffer (but make sure it's at least 1024) + capacity = (capacity >= 1024) ? capacity * 2 : 1024; + buffer = reinterpret_cast<char *>(getAllocator().reallocate(*line, capacity)); + if (!buffer) { + errno = ENOMEM; + return -1; + } + + *line = buffer; + *n = capacity; + } +} + +// GLIBC extensions. + +int asprintf(char **out, const char *format, ...) { + va_list args; + va_start(args, format); + int result = vasprintf(out, format, args); + va_end(args); + return result; +} + +int vasprintf(char **out, const char *format, __builtin_va_list args) { + frg::va_struct vs; + frg::arg arg_list[NL_ARGMAX + 1]; + vs.arg_list = arg_list; + va_copy(vs.args, args); + ResizePrinter p; +// mlibc::infoLogger() << "printf(" << format << ")" << frg::endlog; + auto res = frg::printf_format(PrintfAgent{&p, &vs}, format, &vs); + if (!res) + return -static_cast<int>(res.error()); + p.expand(); + p.buffer[p.count] = 0; + *out = p.buffer; + return p.count; +} + +// Linux unlocked I/O extensions. + +void flockfile(FILE *file_base) { + static_cast<mlibc::abstract_file *>(file_base)->_lock.lock(); +} + +void funlockfile(FILE *file_base) { + static_cast<mlibc::abstract_file *>(file_base)->_lock.unlock(); +} + +int ftrylockfile(FILE *file_base) { + static_cast<mlibc::abstract_file *>(file_base)->_lock.try_lock(); + return 0; +} + +void clearerr_unlocked(FILE *file_base) { + file_base->__status_bits = 0; +} + +int feof_unlocked(FILE *file_base) { + return file_base->__status_bits & __MLIBC_EOF_BIT; +} + +int ferror_unlocked(FILE *file_base) { + return file_base->__status_bits & __MLIBC_ERROR_BIT; +} + +int fgetc_unlocked(FILE *stream) { + unsigned char d; + if(fread_unlocked(&d, 1, 1, stream) != 1) + return EOF; + return (int)d; +} + +size_t fread_unlocked(void *buffer, size_t size, size_t count, FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + if(!size || !count) + return 0; + + // Distinguish two cases here: If the object size is one, we perform byte-wise reads. + // Otherwise, we try to read each object individually. + if(size == 1) { + size_t progress = 0; + while(progress < count) { + size_t chunk; + if(int e = file->read((char *)buffer + progress, + count - progress, &chunk)) { + errno = e; + return 0; + }else if(!chunk) { + // TODO: Handle eof. + break; + } + + progress += chunk; + } + + return progress; + }else{ + for(size_t i = 0; i < count; i++) { + size_t progress = 0; + while(progress < size) { + size_t chunk; + if(int e = file->read((char *)buffer + i * size + progress, + size - progress, &chunk)) { + errno = e; + return 0; + }else if(!chunk) { + // TODO: Handle eof. + break; + } + + progress += chunk; + } + + if(progress < size) + return i; + } + + return count; + } +} + +size_t fwrite_unlocked(const void *buffer, size_t size, size_t count, FILE *file_base) { + auto file = static_cast<mlibc::abstract_file *>(file_base); + if(!size || !count) + return 0; + + // Distinguish two cases here: If the object size is one, we perform byte-wise writes. + // Otherwise, we try to write each object individually. + if(size == 1) { + size_t progress = 0; + while(progress < count) { + size_t chunk; + if(file->write((const char *)buffer + progress, + count - progress, &chunk)) { + // TODO: Handle I/O errors. + mlibc::infoLogger() << "mlibc: fwrite() I/O errors are not handled" + << frg::endlog; + break; + }else if(!chunk) { + // TODO: Handle eof. + break; + } + + progress += chunk; + } + + return progress; + }else{ + for(size_t i = 0; i < count; i++) { + size_t progress = 0; + while(progress < size) { + size_t chunk; + if(file->write((const char *)buffer + i * size + progress, + size - progress, &chunk)) { + // TODO: Handle I/O errors. + mlibc::infoLogger() << "mlibc: fwrite() I/O errors are not handled" + << frg::endlog; + break; + }else if(!chunk) { + // TODO: Handle eof. + break; + } + + progress += chunk; + } + + if(progress < size) + return i; + } + + return count; + } +} + +char *fgets_unlocked(char *__restrict buffer, int max_size, FILE *stream) { + __ensure(max_size > 0); + for(int i = 0; ; i++) { + if(i == max_size - 1) { + buffer[i] = 0; + return buffer; + } + + auto c = fgetc_unlocked(stream); + + // If fgetc() fails, there is either an EOF or an I/O error. + if(c == EOF) { + if(i) { + buffer[i] = 0; + return buffer; + } else { + // In this case, the buffer is not changed. + return nullptr; + } + } else { + buffer[i] = c; + } + + if(c == '\n') { + buffer[i + 1] = 0; + return buffer; + } + } +} diff --git a/lib/mlibc/options/ansi/generic/stdlib-stubs.cpp b/lib/mlibc/options/ansi/generic/stdlib-stubs.cpp new file mode 100644 index 0000000..86b8a9a --- /dev/null +++ b/lib/mlibc/options/ansi/generic/stdlib-stubs.cpp @@ -0,0 +1,511 @@ + +#include <errno.h> +#include <stdint.h> +#include <stdlib.h> +#include <string.h> +#include <signal.h> +#include <ctype.h> +#include <stdio.h> +#include <wchar.h> +#include <setjmp.h> +#include <limits.h> + +#include <frg/random.hpp> +#include <mlibc/debug.hpp> +#include <bits/ensure.h> +#include <bits/sigset_t.h> + +#include <mlibc/allocator.hpp> +#include <mlibc/charcode.hpp> +#include <mlibc/ansi-sysdeps.hpp> +#include <mlibc/strtofp.hpp> +#include <mlibc/strtol.hpp> +#include <mlibc/global-config.hpp> + +#if __MLIBC_POSIX_OPTION +#include <pthread.h> +#endif // __MLIBC_POSIX_OPTION + +extern "C" int __cxa_atexit(void (*function)(void *), void *argument, void *dso_tag); +void __mlibc_do_finalize(); + +namespace { + // According to the first paragraph of [C11 7.22.7], + // mblen(), mbtowc() and wctomb() have an internal state. + // The string functions mbstowcs() and wcstombs() do *not* have this state. + thread_local __mlibc_mbstate mblen_state = __MLIBC_MBSTATE_INITIALIZER; + thread_local __mlibc_mbstate mbtowc_state = __MLIBC_MBSTATE_INITIALIZER; +} + +double atof(const char *string) { + return strtod(string, NULL); +} +int atoi(const char *string) { + return strtol(string, nullptr, 10); +} +long atol(const char *string) { + return strtol(string, nullptr, 10); +} +long long atoll(const char *string) { + return strtoll(string, nullptr, 10); +} + +// POSIX extensions but are here for simplicities sake. Forward declaration is here +// to avoid exporting sigprocmask when posix is disabled. +int sigprocmask(int, const sigset_t *__restrict, sigset_t *__restrict); +extern "C" { + __attribute__((__returns_twice__)) int __sigsetjmp(sigjmp_buf buffer, int savesigs) { + buffer[0].savesigs = savesigs; + if (savesigs) + sigprocmask(0, NULL, &buffer[0].sigset); + return 0; + } +} + +__attribute__((__noreturn__)) void siglongjmp(sigjmp_buf buffer, int value) { + if (buffer[0].savesigs) + sigprocmask(SIG_SETMASK, &buffer[0].sigset, NULL); + jmp_buf b; + b[0].reg_state = buffer[0].reg_state; + longjmp(b, value); +} + +double strtod(const char *__restrict string, char **__restrict end) { + return mlibc::strtofp<double>(string, end); +} +float strtof(const char *__restrict string, char **__restrict end) { + return mlibc::strtofp<float>(string, end); +} +long double strtold(const char *__restrict string, char **__restrict end) { + return mlibc::strtofp<long double>(string, end); +} + +long strtol(const char *__restrict string, char **__restrict end, int base) { + return mlibc::stringToInteger<long, char>(string, end, base); +} +long long strtoll(const char *__restrict string, char **__restrict end, int base) { + return mlibc::stringToInteger<long long, char>(string, end, base); +} +unsigned long strtoul(const char *__restrict string, char **__restrict end, int base) { + return mlibc::stringToInteger<unsigned long, char>(string, end, base); +} +unsigned long long strtoull(const char *__restrict string, char **__restrict end, int base) { + return mlibc::stringToInteger<unsigned long long, char>(string, end, base); +} + +frg::mt19937 __mlibc_rand_engine; + +int rand() { + // rand() is specified to return a positive number so we discard the MSB. + return static_cast<int>(__mlibc_rand_engine() & 0x7FFFFFFF); +} + +static unsigned temper(unsigned x) { + x ^= x >> 11; + x ^= x << 7 & 0x9D2C5680; + x ^= x << 15 & 0xEFC60000; + x ^= x >> 18; + return x; +} + +int rand_r(unsigned *seed) { + return temper(*seed = *seed * 1103515245 + 12345) / 2; +} + +void srand(unsigned int s) { + __mlibc_rand_engine.seed(s); +} + +void *aligned_alloc(size_t alignment, size_t size) { + void *ptr; + + // alignment must be a power of two, and size % alignment must be 0 + if (alignment & (alignment - 1) || size & (alignment - 1)) { + errno = EINVAL; + return nullptr; + } + + // posix_memalign requires that the alignment is a multiple of sizeof(void *) + if (alignment < sizeof(void *)) + alignment = sizeof(void *); + + int ret = posix_memalign(&ptr, alignment, size); + if (ret) { + errno = ret; + return nullptr; + } + return ptr; + +} +void *calloc(size_t count, size_t size) { + // we want to ensure that count*size > SIZE_MAX doesn't happen + // to prevent overflowing, we divide both sides of the inequality by size and check with that + if(size && count > (SIZE_MAX / size)) { + errno = EINVAL; + return NULL; + } + + // TODO: this could be done more efficient if the OS gives us already zero'd pages + void *ptr = malloc(count * size); + if(!ptr) + return nullptr; + memset(ptr, 0, count * size); + return ptr; +} +// free() is provided by the platform +// malloc() is provided by the platform +// realloc() is provided by the platform + +void abort(void) { + sigset_t set; + sigemptyset(&set); + sigaddset(&set, SIGABRT); + if (mlibc::sys_sigprocmask) { + mlibc::sys_sigprocmask(SIG_UNBLOCK, &set, nullptr); + } + + raise(SIGABRT); + + sigfillset(&set); + sigdelset(&set, SIGABRT); + if (mlibc::sys_sigprocmask) { + mlibc::sys_sigprocmask(SIG_SETMASK, &set, nullptr); + } + + struct sigaction sa; + sa.sa_handler = SIG_DFL; + sa.sa_flags = 0; + sigemptyset(&sa.sa_mask); + + if (mlibc::sys_sigaction(SIGABRT, &sa, nullptr)) + mlibc::panicLogger() << "mlibc: sigaction failed in abort" << frg::endlog; + + if (raise(SIGABRT)) + mlibc::panicLogger() << "mlibc: raise failed in abort" << frg::endlog; + + __builtin_trap(); +} + +int atexit(void (*func)(void)) { + // TODO: the function pointer types are not compatible; + // the conversion here is undefined behavior. its fine to do + // this on the x86_64 abi though. + __cxa_atexit((void (*) (void *))func, nullptr, nullptr); + return 0; +} +int at_quick_exit(void (*func)(void)) { + (void)func; + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void exit(int status) { + __mlibc_do_finalize(); + mlibc::sys_exit(status); +} + +void _Exit(int status) { + mlibc::sys_exit(status); +} + +// getenv() is provided by POSIX +void quick_exit(int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +extern char **environ; + +int system(const char *command) { + int status = -1; + pid_t child; + + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_fork && mlibc::sys_waitpid && + mlibc::sys_execve && mlibc::sys_sigprocmask && mlibc::sys_sigaction, -1); + +#if __MLIBC_POSIX_OPTION + pthread_testcancel(); +#endif // __MLIBC_POSIX_OPTION + + if (!command) { + return 1; + } + + struct sigaction new_sa, old_int, old_quit; + sigset_t new_mask, old_mask; + + new_sa.sa_handler = SIG_IGN; + new_sa.sa_flags = 0; + sigemptyset(&new_sa.sa_mask); + mlibc::sys_sigaction(SIGINT, &new_sa, &old_int); + mlibc::sys_sigaction(SIGQUIT, &new_sa, &old_quit); + + sigemptyset(&new_mask); + sigaddset(&new_mask, SIGCHLD); + mlibc::sys_sigprocmask(SIG_BLOCK, &new_mask, &old_mask); + + if (int e = mlibc::sys_fork(&child)) { + errno = e; + } else if (!child) { + mlibc::sys_sigaction(SIGINT, &old_int, nullptr); + mlibc::sys_sigaction(SIGQUIT, &old_quit, nullptr); + mlibc::sys_sigprocmask(SIG_SETMASK, &old_mask, nullptr); + + const char *args[] = { + "sh", "-c", command, nullptr + }; + + mlibc::sys_execve("/bin/sh", const_cast<char **>(args), environ); + _Exit(127); + } else { + int err; + pid_t unused; + + while ((err = mlibc::sys_waitpid(child, &status, 0, NULL, &unused)) < 0) { + if (err == EINTR) + continue; + + errno = err; + status = -1; + } + } + + mlibc::sys_sigaction(SIGINT, &old_int, nullptr); + mlibc::sys_sigaction(SIGQUIT, &old_quit, nullptr); + mlibc::sys_sigprocmask(SIG_SETMASK, &old_mask, nullptr); + + return status; +} + +char *mktemp(char *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void *bsearch(const void *key, const void *base, size_t count, size_t size, + int (*compare)(const void *, const void *)) { + // Invariant: Element is in the interval [i, j). + size_t i = 0; + size_t j = count; + + while(i < j) { + size_t k = (j - i) / 2; + auto element = reinterpret_cast<const char *>(base) + (i + k) * size; + auto res = compare(key, element); + if(res < 0) { + j = i + k; + }else if(res > 0) { + i = i + k + 1; + }else{ + return const_cast<char *>(element); + } + } + __ensure(i == j); + + return nullptr; +} + +static int qsort_callback(const void *a, const void *b, void *arg) { + auto compare = reinterpret_cast<int (*)(const void *, const void *)>(arg); + + return compare(a, b); +} + +void qsort(void *base, size_t count, size_t size, + int (*compare)(const void *, const void *)) { + return qsort_r(base, count, size, qsort_callback, (void *) compare); +} + +void qsort_r(void *base, size_t count, size_t size, + int (*compare)(const void *, const void *, void *), + void *arg) { + // TODO: implement a faster sort + for(size_t i = 0; i < count; i++) { + void *u = (void *)((uintptr_t)base + i * size); + for(size_t j = i + 1; j < count; j++) { + void *v = (void *)((uintptr_t)base + j * size); + if(compare(u, v, arg) <= 0) + continue; + + // swap u and v + char *u_bytes = (char *)u; + char *v_bytes = (char *)v; + for(size_t k = 0; k < size; k++) { + char temp = u_bytes[k]; + u_bytes[k] = v_bytes[k]; + v_bytes[k] = temp; + } + } + } +} + +int abs(int num) { + return num < 0 ? -num : num; +} + +long labs(long num) { + return num < 0 ? -num : num; +} + +long long llabs(long long num) { + return num < 0 ? -num : num; +} + +div_t div(int number, int denom) { + div_t r; + r.quot = number / denom; + r.rem = number % denom; + return r; +} + +ldiv_t ldiv(long number, long denom) { + ldiv_t r; + r.quot = number / denom; + r.rem = number % denom; + return r; +} + +lldiv_t lldiv(long long number, long long denom) { + lldiv_t r; + r.quot = number / denom; + r.rem = number % denom; + return r; +} + +int mblen(const char *mbs, size_t mb_limit) { + auto cc = mlibc::current_charcode(); + wchar_t wc; + mlibc::code_seq<const char> nseq{mbs, mbs + mb_limit}; + mlibc::code_seq<wchar_t> wseq{&wc, &wc + 1}; + + if(!mbs) { + mblen_state = __MLIBC_MBSTATE_INITIALIZER; + return cc->has_shift_states; + } + + if(auto e = cc->decode_wtranscode(nseq, wseq, mblen_state); e != mlibc::charcode_error::null) + __ensure(!"decode_wtranscode() errors are not handled"); + return nseq.it - mbs; +} + +int mbtowc(wchar_t *__restrict wc, const char *__restrict mb, size_t max_size) { + auto cc = mlibc::current_charcode(); + __ensure(max_size); + + // If wc is NULL, decode into a single local character which we discard + // to obtain the length. + wchar_t tmp_wc; + if (!wc) + wc = &tmp_wc; + + if (mb) { + if (*mb) { + mlibc::code_seq<wchar_t> wseq{wc, wc + 1}; + mlibc::code_seq<const char> nseq{mb, mb + max_size}; + auto e = cc->decode_wtranscode(nseq, wseq, mbtowc_state); + switch(e) { + // We keep the state, so we can simply return here. + case mlibc::charcode_error::input_underflow: + case mlibc::charcode_error::null: { + return nseq.it - mb; + } + case mlibc::charcode_error::illegal_input: { + errno = -EILSEQ; + return -1; + } + case mlibc::charcode_error::dirty: { + mlibc::panicLogger() << "decode_wtranscode() charcode_error::dirty errors are not handled" << frg::endlog; + break; + } + case mlibc::charcode_error::output_overflow: { + mlibc::panicLogger() << "decode_wtranscode() charcode_error::output_overflow errors are not handled" << frg::endlog; + break; + } + } + __builtin_unreachable(); + } else { + *wc = L'\0'; + return 0; // When mbs is a null byte, return 0 + } + } else { + mblen_state = __MLIBC_MBSTATE_INITIALIZER; + return cc->has_shift_states; + } +} + +int wctomb(char *, wchar_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +size_t mbstowcs(wchar_t *wcs, const char *mbs, size_t wc_limit) { + auto cc = mlibc::current_charcode(); + __mlibc_mbstate st = __MLIBC_MBSTATE_INITIALIZER; + mlibc::code_seq<const char> nseq{mbs, nullptr}; + mlibc::code_seq<wchar_t> wseq{wcs, wcs + wc_limit}; + + if(!wcs) { + size_t size; + if(auto e = cc->decode_wtranscode_length(nseq, &size, st); e != mlibc::charcode_error::null) + __ensure(!"decode_wtranscode() errors are not handled"); + return size; + } + + if(auto e = cc->decode_wtranscode(nseq, wseq, st); e != mlibc::charcode_error::null) { + __ensure(!"decode_wtranscode() errors are not handled"); + __builtin_unreachable(); + }else{ + size_t n = wseq.it - wcs; + if(n < wc_limit) // Null-terminate resulting wide string. + wcs[n] = 0; + return n; + } +} + +size_t wcstombs(char *mb_string, const wchar_t *wc_string, size_t max_size) { + return wcsrtombs(mb_string, &wc_string, max_size, 0); +} + +void free(void *ptr) { + // TODO: Print PID only if POSIX option is enabled. + if (mlibc::globalConfig().debugMalloc) { + mlibc::infoLogger() << "mlibc (PID ?): free() on " + << ptr << frg::endlog; + if((uintptr_t)ptr & 1) + mlibc::infoLogger() << __builtin_return_address(0) << frg::endlog; + } + getAllocator().free(ptr); +} + +void *malloc(size_t size) { + auto nptr = getAllocator().allocate(size); + // TODO: Print PID only if POSIX option is enabled. + if (mlibc::globalConfig().debugMalloc) + mlibc::infoLogger() << "mlibc (PID ?): malloc() returns " + << nptr << frg::endlog; + return nptr; +} + +void *realloc(void *ptr, size_t size) { + auto nptr = getAllocator().reallocate(ptr, size); + // TODO: Print PID only if POSIX option is enabled. + if (mlibc::globalConfig().debugMalloc) + mlibc::infoLogger() << "mlibc (PID ?): realloc() on " + << ptr << " returns " << nptr << frg::endlog; + return nptr; +} + +int posix_memalign(void **out, size_t align, size_t size) { + if(align < sizeof(void *)) + return EINVAL; + if(align & (align - 1)) // Make sure that align is a power of two. + return EINVAL; + auto p = getAllocator().allocate(frg::max(align, size)); + if(!p) + return ENOMEM; + // Hope that the alignment was respected. This works on the current allocator. + // TODO: Make the allocator alignment-aware. + __ensure(!(reinterpret_cast<uintptr_t>(p) & (align - 1))); + *out = p; + return 0; +} diff --git a/lib/mlibc/options/ansi/generic/string-stubs.cpp b/lib/mlibc/options/ansi/generic/string-stubs.cpp new file mode 100644 index 0000000..8defd0e --- /dev/null +++ b/lib/mlibc/options/ansi/generic/string-stubs.cpp @@ -0,0 +1,542 @@ +#include <string.h> +#include <errno.h> +#include <wchar.h> +#include <ctype.h> + +#include <bits/ensure.h> +#include <mlibc/strtol.hpp> + +// memset() is defined in options/internals. +// memcpy() is defined in options/internals. +// memmove() is defined in options/internals. +// strlen() is defined in options/internals. + +char *strcpy(char *__restrict dest, const char *src) { + char *dest_bytes = (char *)dest; + char *src_bytes = (char *)src; + while(*src_bytes) + *(dest_bytes++) = *(src_bytes++); + *dest_bytes = 0; + return dest; +} +char *strncpy(char *__restrict dest, const char *src, size_t max_size) { + auto dest_bytes = static_cast<char *>(dest); + auto src_bytes = static_cast<const char *>(src); + size_t i = 0; + while(*src_bytes && i < max_size) { + *(dest_bytes++) = *(src_bytes++); + i++; + } + while(i < max_size) { + *(dest_bytes++) = 0; + i++; + } + return dest; +} + +char *strcat(char *__restrict dest, const char *__restrict src) { + strcpy(dest + strlen(dest), src); + return dest; +} +char *strncat(char *__restrict dest, const char *__restrict src, size_t max_size) { + auto dest_bytes = static_cast<char *>(dest); + auto src_bytes = static_cast<const char *>(src); + dest_bytes += strlen(dest); + size_t i = 0; + while(*src_bytes && i < max_size) { + *(dest_bytes++) = *(src_bytes++); + i++; + } + *dest_bytes = 0; + return dest; +} + +int memcmp(const void *a, const void *b, size_t size) { + for(size_t i = 0; i < size; i++) { + auto a_byte = static_cast<const unsigned char *>(a)[i]; + auto b_byte = static_cast<const unsigned char *>(b)[i]; + if(a_byte < b_byte) + return -1; + if(a_byte > b_byte) + return 1; + } + return 0; +} +int strcmp(const char *a, const char *b) { + size_t i = 0; + while(true) { + unsigned char a_byte = a[i]; + unsigned char b_byte = b[i]; + if(!a_byte && !b_byte) + return 0; + // If only one char is null, one of the following cases applies. + if(a_byte < b_byte) + return -1; + if(a_byte > b_byte) + return 1; + i++; + } +} + +int strcoll(const char *a, const char *b) { + // TODO: strcoll should take "LC_COLLATE" into account. + return strcmp(a, b); +} + +int strncmp(const char *a, const char *b, size_t max_size) { + size_t i = 0; + while(true) { + if(!(i < max_size)) + return 0; + unsigned char a_byte = a[i]; + unsigned char b_byte = b[i]; + if(!a_byte && !b_byte) + return 0; + // If only one char is null, one of the following cases applies. + if(a_byte < b_byte) + return -1; + if(a_byte > b_byte) + return 1; + i++; + } +} + +size_t strxfrm(char *__restrict dest, const char *__restrict src, size_t n) { + // NOTE: This might not work for non ANSI charsets. + size_t l = strlen(src); + + // man page: If the value returned is n or more, the contents of dest are indeterminate. + if(n > l) + strncpy(dest, src, n); + + return l; +} + +void *memchr(const void *s, int c, size_t size) { + auto s_bytes = static_cast<const unsigned char *>(s); + for(size_t i = 0; i < size; i++) + if(s_bytes[i] == static_cast<unsigned char>(c)) + return const_cast<unsigned char *>(s_bytes + i); + return nullptr; +} +char *strchr(const char *s, int c) { + size_t i = 0; + while(s[i]) { + if(s[i] == c) + return const_cast<char *>(&s[i]); + i++; + } + if(c == 0) + return const_cast<char *>(&s[i]); + return nullptr; +} +size_t strcspn(const char *s, const char *chrs) { + size_t n = 0; + while(true) { + if(!s[n] || strchr(chrs, s[n])) + return n; + n++; + } +} +char *strpbrk(const char *s, const char *chrs) { + size_t n = 0; + while(s[n]) { + if(strchr(chrs, s[n])) + return const_cast<char *>(s + n); + n++; + } + return nullptr; +} +char *strrchr(const char *s, int c) { + // The null-terminator is considered to be part of the string. + size_t length = strlen(s); + for(size_t i = 0; i <= length; i++) { + if(s[length - i] == c) + return const_cast<char *>(s + (length - i)); + } + return nullptr; +} +size_t strspn(const char *s, const char *chrs) { + size_t n = 0; + while(true) { + if(!s[n] || !strchr(chrs, s[n])) + return n; + n++; + } +} +char *strstr(const char *s, const char *pattern) { + for(size_t i = 0; s[i]; i++) { + bool found = true; + for(size_t j = 0; pattern[j]; j++) { + if(!pattern[j] || s[i + j] == pattern[j]) + continue; + + found = false; + break; + } + + if(found) + return const_cast<char *>(&s[i]); + } + + return nullptr; +} +char *strtok_r(char *__restrict s, const char *__restrict del, char **__restrict m) { + __ensure(m); + + // We use *m = null to memorize that the entire string was consumed. + char *tok; + if(s) { + tok = s; + }else if(*m) { + tok = *m; + }else { + return nullptr; + } + + // Skip initial delimiters. + // After this loop: *tok is non-null iff we return a token. + while(*tok && strchr(del, *tok)) + tok++; + + // Replace the following delimiter by a null-terminator. + // After this loop: *p is null iff we reached the end of the string. + auto p = tok; + while(*p && !strchr(del, *p)) + p++; + + if(*p) { + *p = 0; + *m = p + 1; + }else{ + *m = nullptr; + } + if(p == tok) + return nullptr; + return tok; +} +char *strtok(char *__restrict s, const char *__restrict delimiter) { + static char *saved; + return strtok_r(s, delimiter, &saved); +} + +// This is a GNU extension. +char *strchrnul(const char *s, int c) { + size_t i = 0; + while(s[i]) { + if(s[i] == c) + return const_cast<char *>(s + i); + i++; + } + return const_cast<char *>(s + i); +} + +double wcstod(const wchar_t *__restrict, wchar_t **__restrict) MLIBC_STUB_BODY +float wcstof(const wchar_t *__restrict, wchar_t **__restrict) MLIBC_STUB_BODY +long double wcstold(const wchar_t *__restrict, wchar_t **__restrict) MLIBC_STUB_BODY + +long wcstol(const wchar_t *__restrict nptr, wchar_t **__restrict endptr, int base) { + return mlibc::stringToInteger<long, wchar_t>(nptr, endptr, base); +} +unsigned long wcstoul(const wchar_t *__restrict nptr, wchar_t **__restrict endptr, int base) { + return mlibc::stringToInteger<unsigned long, wchar_t>(nptr, endptr, base); +} +long long wcstoll(const wchar_t *__restrict nptr, wchar_t **__restrict endptr, int base) { + return mlibc::stringToInteger<long long, wchar_t>(nptr, endptr, base); +} +unsigned long long wcstoull(const wchar_t *__restrict nptr, wchar_t **__restrict endptr, int base) { + return mlibc::stringToInteger<unsigned long long, wchar_t>(nptr, endptr, base); +} + +wchar_t *wcscpy(wchar_t *__restrict dest, const wchar_t *__restrict src) { + wchar_t *a = dest; + while((*dest++ = *src++)); + return a; +} + +wchar_t *wcsncpy(wchar_t *__restrict dest, const wchar_t *__restrict src, size_t n) { + wchar_t *a = dest; + while(n && *src) + n--, *dest++ = *src++; + wmemset(dest, 0, n); + return a; +} + +wchar_t *wmemcpy(wchar_t *__restrict dest, const wchar_t *__restrict src, size_t n) { + memcpy(dest, src, n * sizeof(wchar_t)); + return dest; +} + +wchar_t *wmemmove(wchar_t *dest, const wchar_t *src, size_t n) { + memmove(dest, src, n * sizeof(wchar_t)); + return dest; +} + +wchar_t *wcscat(wchar_t *__restrict dest, const wchar_t *__restrict src) { + wcscpy(dest + wcslen(dest), src); + return dest; +} + +wchar_t *wcsncat(wchar_t *__restrict, const wchar_t *__restrict, size_t) MLIBC_STUB_BODY + +int wcscmp(const wchar_t *l, const wchar_t *r) { + for(; *l == *r && *l && *r; l++, r++); + return *l - *r; +} + +int wcscoll(const wchar_t *, const wchar_t *) MLIBC_STUB_BODY +int wcsncmp(const wchar_t *, const wchar_t *, size_t) MLIBC_STUB_BODY +int wcsxfrm(wchar_t *__restrict, const wchar_t *__restrict, size_t) MLIBC_STUB_BODY + +int wmemcmp(const wchar_t *a, const wchar_t *b, size_t size) { + for(size_t i = 0; i < size; i++) { + auto a_byte = a[i]; + auto b_byte = b[i]; + if(a_byte < b_byte) + return -1; + if(a_byte > b_byte) + return 1; + } + return 0; +} + +wchar_t *wcschr(const wchar_t *s, wchar_t c) { + if(!c) + return (wchar_t *)s + wcslen(s); + for(; *s && *s != c; s++); + return *s ? (wchar_t *)s : 0; +} + +size_t wcscspn(const wchar_t *, const wchar_t *) MLIBC_STUB_BODY +wchar_t *wcspbrk(const wchar_t *, const wchar_t *) MLIBC_STUB_BODY + +wchar_t *wcsrchr(const wchar_t *s, wchar_t c) { + const wchar_t *p; + for(p = s + wcslen(s); p >= s && *p != c; p--); + return p >= s ? (wchar_t *)p : 0; +} + +size_t wcsspn(const wchar_t *, const wchar_t *) MLIBC_STUB_BODY +wchar_t *wcsstr(const wchar_t *, const wchar_t *) MLIBC_STUB_BODY +wchar_t *wcstok(wchar_t *__restrict, const wchar_t *__restrict, wchar_t **__restrict) MLIBC_STUB_BODY + +wchar_t *wmemchr(const wchar_t *s, wchar_t c, size_t size) { + auto s_bytes = s; + for(size_t i = 0; i < size; i++) + if(s_bytes[i] == c) + return const_cast<wchar_t *>(s_bytes + i); + return nullptr; +} + +size_t wcslen(const wchar_t *s) { + const wchar_t *a; + for(a = s; *s; s++); + return s-a; +} + +wchar_t *wmemset(wchar_t *d, wchar_t c, size_t n) { + wchar_t *ret = d; + while(n--) + *d++ = c; + return ret; +} + +char *strerror(int e) { + const char *s; + switch(e) { + case EAGAIN: s = "Operation would block (EAGAIN)"; break; + case EACCES: s = "Access denied (EACCESS)"; break; + case EBADF: s = "Bad file descriptor (EBADF)"; break; + case EEXIST: s = "File exists already (EEXIST)"; break; + case EFAULT: s = "Access violation (EFAULT)"; break; + case EINTR: s = "Operation interrupted (EINTR)"; break; + case EINVAL: s = "Invalid argument (EINVAL)"; break; + case EIO: s = "I/O error (EIO)"; break; + case EISDIR: s = "Resource is directory (EISDIR)"; break; + case ENOENT: s = "No such file or directory (ENOENT)"; break; + case ENOMEM: s = "Out of memory (ENOMEM)"; break; + case ENOTDIR: s = "Expected directory instead of file (ENOTDIR)"; break; + case ENOSYS: s = "Operation not implemented (ENOSYS)"; break; + case EPERM: s = "Operation not permitted (EPERM)"; break; + case EPIPE: s = "Broken pipe (EPIPE)"; break; + case ESPIPE: s = "Seek not possible (ESPIPE)"; break; + case ENXIO: s = "No such device or address (ENXIO)"; break; + case ENOEXEC: s = "Exec format error (ENOEXEC)"; break; + case ENOSPC: s = "No space left on device (ENOSPC)"; break; + case ENOTSOCK: s = "Socket operation on non-socket (ENOTSOCK)"; break; + case ENOTCONN: s = "Transport endpoint is not connected (ENOTCONN)"; break; + case EDOM: s = "Numerical argument out of domain (EDOM)"; break; + case EILSEQ: s = "Invalid or incomplete multibyte or wide character (EILSEQ)"; break; + case ERANGE: s = "Numerical result out of range (ERANGE)"; break; + case E2BIG: s = "Argument list too long (E2BIG)"; break; + case EADDRINUSE: s = "Address already in use (EADDRINUSE)"; break; + case EADDRNOTAVAIL: s = "Cannot assign requested address (EADDRNOTAVAIL)"; break; + case EAFNOSUPPORT: s = "Address family not supported by protocol (EAFNOSUPPORT)"; break; + case EALREADY: s = "Operation already in progress (EALREADY)"; break; + case EBADMSG: s = "Bad message (EBADMSG)"; break; + case EBUSY: s = "Device or resource busy (EBUSY)"; break; + case ECANCELED: s = "Operation canceled (ECANCELED)"; break; + case ECHILD: s = "No child processes (ECHILD)"; break; + case ECONNABORTED: s = "Software caused connection abort (ECONNABORTED)"; break; + case ECONNREFUSED: s = "Connection refused (ECONNREFUSED)"; break; + case ECONNRESET: s = "Connection reset by peer (ECONNRESET)"; break; + case EDEADLK: s = "Resource deadlock avoided (EDEADLK)"; break; + case EDESTADDRREQ: s = "Destination address required (EDESTADDRREQ)"; break; + case EDQUOT: s = "Disk quota exceeded (EDQUOT)"; break; + case EFBIG: s = "File too large (EFBIG)"; break; + case EHOSTUNREACH: s = "No route to host (EHOSTUNREACH)"; break; + case EIDRM: s = "Identifier removed (EIDRM)"; break; + case EINPROGRESS: s = "Operation now in progress (EINPROGRESS)"; break; + case EISCONN: s = "Transport endpoint is already connected (EISCONN)"; break; + case ELOOP: s = "Too many levels of symbolic links (ELOOP)"; break; + case EMFILE: s = "Too many open files (EMFILE)"; break; + case EMLINK: s = "Too many links (EMLINK)"; break; + case EMSGSIZE: s = "Message too long (EMSGSIZE)"; break; + case EMULTIHOP: s = "Multihop attempted (EMULTIHOP)"; break; + case ENAMETOOLONG: s = "File name too long (ENAMETOOLONG)"; break; + case ENETDOWN: s = "Network is down (ENETDOWN)"; break; + case ENETRESET: s = "Network dropped connection on reset (ENETRESET)"; break; + case ENETUNREACH: s = "Network is unreachable (ENETUNREACH)"; break; + case ENFILE: s = "Too many open files in system (ENFILE)"; break; + case ENOBUFS: s = "No buffer space available (ENOBUFS)"; break; + case ENODEV: s = "No such device (ENODEV)"; break; + case ENOLCK: s = "No locks available (ENOLCK)"; break; + case ENOLINK: s = "Link has been severed (ENOLINK)"; break; + case ENOMSG: s = "No message of desired type (ENOMSG)"; break; + case ENOPROTOOPT: s = "Protocol not available (ENOPROTOOPT)"; break; + case ENOTEMPTY: s = "Directory not empty (ENOTEMPTY)"; break; + case ENOTRECOVERABLE: s = "Sate not recoverable (ENOTRECOVERABLE)"; break; + case ENOTSUP: s = "Operation not supported (ENOTSUP)"; break; + case ENOTTY: s = "Inappropriate ioctl for device (ENOTTY)"; break; + case EOVERFLOW: s = "Value too large for defined datatype (EOVERFLOW)"; break; +#if EOPNOTSUPP != ENOTSUP + /* these are aliases on the mlibc abi */ + case EOPNOTSUPP: s = "Operation not supported (EOPNOTSUP)"; break; +#endif + case EOWNERDEAD: s = "Owner died (EOWNERDEAD)"; break; + case EPROTO: s = "Protocol error (EPROTO)"; break; + case EPROTONOSUPPORT: s = "Protocol not supported (EPROTONOSUPPORT)"; break; + case EPROTOTYPE: s = "Protocol wrong type for socket (EPROTOTYPE)"; break; + case EROFS: s = "Read-only file system (EROFS)"; break; + case ESRCH: s = "No such process (ESRCH)"; break; + case ESTALE: s = "Stale file handle (ESTALE)"; break; + case ETIMEDOUT: s = "Connection timed out (ETIMEDOUT)"; break; + case ETXTBSY: s = "Text file busy (ETXTBSY)"; break; + case EXDEV: s = "Invalid cross-device link (EXDEV)"; break; + case ENODATA: s = "No data available (ENODATA)"; break; + case ETIME: s = "Timer expired (ETIME)"; break; + case ENOKEY: s = "Required key not available (ENOKEY)"; break; + case ESHUTDOWN: s = "Cannot send after transport endpoint shutdown (ESHUTDOWN)"; break; + case EHOSTDOWN: s = "Host is down (EHOSTDOWN)"; break; + case EBADFD: s = "File descriptor in bad state (EBADFD)"; break; + case ENOMEDIUM: s = "No medium found (ENOMEDIUM)"; break; + case ENOTBLK: s = "Block device required (ENOTBLK)"; break; + case ENONET: s = "Machine is not on the network (ENONET)"; break; + case EPFNOSUPPORT: s = "Protocol family not supported (EPFNOSUPPORT)"; break; + case ESOCKTNOSUPPORT: s = "Socket type not supported (ESOCKTNOSUPPORT)"; break; + case ESTRPIPE: s = "Streams pipe error (ESTRPIPE)"; break; + case EREMOTEIO: s = "Remote I/O error (EREMOTEIO)"; break; + case ERFKILL: s = "Operation not possible due to RF-kill (ERFKILL)"; break; + case EBADR: s = "Invalid request descriptor (EBADR)"; break; + case EUNATCH: s = "Protocol driver not attached (EUNATCH)"; break; + case EMEDIUMTYPE: s = "Wrong medium type (EMEDIUMTYPE)"; break; + case EREMOTE: s = "Object is remote (EREMOTE)"; break; + case EKEYREJECTED: s = "Key was rejected by service (EKEYREJECTED)"; break; + case EUCLEAN: s = "Structure needs cleaning (EUCLEAN)"; break; + case EBADSLT: s = "Invalid slot (EBADSLT)"; break; + case ENOANO: s = "No anode (ENOANO)"; break; + case ENOCSI: s = "No CSI structure available (ENOCSI)"; break; + case ENOSTR: s = "Device not a stream (ENOSTR)"; break; + case ETOOMANYREFS: s = "Too many references: cannot splice (ETOOMANYREFS)"; break; + case ENOPKG: s = "Package not installed (ENOPKG)"; break; + case EKEYREVOKED: s = "Key has been revoked (EKEYREVOKED)"; break; + case EXFULL: s = "Exchange full (EXFULL)"; break; + case ELNRNG: s = "Link number out of range (ELNRNG)"; break; + case ENOTUNIQ: s = "Name not unique on network (ENOTUNIQ)"; break; + case ERESTART: s = "Interrupted system call should be restarted (ERESTART)"; break; + case EUSERS: s = "Too many users (EUSERS)"; break; + +#ifdef EIEIO + case EIEIO: s = "Computer bought the farm; OS internal error (EIEIO)"; break; +#endif + + default: + s = "Unknown error code (?)"; + } + return const_cast<char *>(s); +} +// strlen() is defined in options/internals. + +// POSIX extensions. + +int strerror_r(int e, char *buffer, size_t bufsz) { + auto s = strerror(e); + strncpy(buffer, s, bufsz); + // Note that strerror_r does not set errno on error! + if(strlen(s) >= bufsz) + return ERANGE; + return 0; +} + +void *mempcpy(void *dest, const void *src, size_t len) { + return (char *)memcpy(dest, src, len) + len; +} + +// GNU extensions. +// Taken from musl. +int strverscmp(const char *l0, const char *r0) { + const unsigned char *l = (const unsigned char *)l0; + const unsigned char *r = (const unsigned char *)r0; + size_t i, dp, j; + int z = 1; + + /* Find maximal matching prefix and track its maximal digit + * suffix and whether those digits are all zeros. */ + for(dp = i = 0; l[i] == r[i]; i++) { + int c = l[i]; + if(!c) + return 0; + if(!isdigit(c)) + dp = i + 1, z = 1; + else if(c != '0') + z = 0; + } + + if(l[dp] != '0' && r[dp] != '0') { + /* If we're not looking at a digit sequence that began + * with a zero, longest digit string is greater. */ + for(j = i; isdigit(l[j]); j++) { + if(!isdigit(r[j])) + return 1; + } + if(isdigit(r[j])) + return -1; + } else if(z && dp < i && (isdigit(l[i]) || isdigit(r[i]))) { + /* Otherwise, if common prefix of digit sequence is + * all zeros, digits order less than non-digits. */ + return (unsigned char)(l[i] - '0') - (unsigned char)(r[i] - '0'); + } + + return l[i] - r[i]; +} + +void *memmem(const void *hs, size_t haystackLen, const void *nd, size_t needleLen) { + const char *haystack = static_cast<const char *>(hs); + const char *needle = static_cast<const char *>(nd); + + for (size_t i = 0; i < haystackLen; i++) { + bool found = true; + + for (size_t j = 0; j < needleLen; j++) { + if (i + j >= haystackLen || haystack[i + j] != needle[j]) { + found = false; + break; + } + } + + if(found) + return const_cast<char *>(&haystack[i]); + } + + return nullptr; +} diff --git a/lib/mlibc/options/ansi/generic/threads.cpp b/lib/mlibc/options/ansi/generic/threads.cpp new file mode 100644 index 0000000..70fa055 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/threads.cpp @@ -0,0 +1,97 @@ +#include <abi-bits/errno.h> +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/thread.hpp> +#include <mlibc/threads.hpp> +#include <threads.h> + +int thrd_create(thrd_t *thr, thrd_start_t func, void *arg) { + int res = mlibc::thread_create(thr, 0, reinterpret_cast<void *>(func), arg, true); + + if(!res) { + return thrd_success; + } + + return (res == ENOMEM) ? thrd_nomem : thrd_error; +} + +int thrd_equal(thrd_t t1, thrd_t t2) { + if(t1 == t2) { + return 1; + } + return 0; +} + +thrd_t thrd_current(void) { + return reinterpret_cast<thrd_t>(mlibc::get_current_tcb()); +} + +int thrd_sleep(const struct timespec *, struct timespec *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +void thrd_yield(void) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int thrd_detach(thrd_t) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int thrd_join(thrd_t thr, int *res) { + if(mlibc::thread_join(thr, res) != 0) { + return thrd_error; + } + + return thrd_success; +} + +__attribute__((__noreturn__)) void thrd_exit(int) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +int mtx_init(mtx_t *mtx, int type) { + struct __mlibc_mutexattr attr; + mlibc::thread_mutexattr_init(&attr); + + if(type & mtx_recursive) { + mlibc::thread_mutexattr_settype(&attr, __MLIBC_THREAD_MUTEX_RECURSIVE); + } + + int res = mlibc::thread_mutex_init(mtx, &attr) == 0 ? thrd_success : thrd_error; + mlibc::thread_mutexattr_destroy(&attr); + + return res; +} + +void mtx_destroy(mtx_t *mtx) { + mlibc::thread_mutex_destroy(mtx); +} + +int mtx_lock(mtx_t *mtx) { + return mlibc::thread_mutex_lock(mtx) == 0 ? thrd_success : thrd_error; +} + +int mtx_unlock(mtx_t *mtx) { + return mlibc::thread_mutex_unlock(mtx) == 0 ? thrd_success : thrd_error; +} + +int cnd_init(cnd_t *cond) { + return mlibc::thread_cond_init(cond, 0) == 0 ? thrd_success : thrd_error; +} + +void cnd_destroy(cnd_t *cond) { + mlibc::thread_cond_destroy(cond); +} + +int cnd_broadcast(cnd_t *cond) { + return mlibc::thread_cond_broadcast(cond) == 0 ? thrd_success : thrd_error; +} + +int cnd_wait(cnd_t *cond, mtx_t *mtx) { + return mlibc::thread_cond_timedwait(cond, mtx, nullptr) == 0 ? thrd_success : thrd_error; +} diff --git a/lib/mlibc/options/ansi/generic/time-stubs.cpp b/lib/mlibc/options/ansi/generic/time-stubs.cpp new file mode 100644 index 0000000..b8c7cf5 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/time-stubs.cpp @@ -0,0 +1,729 @@ + +#include <errno.h> +#include <stdio.h> +#include <string.h> +#include <time.h> +#include <limits.h> +#include <wchar.h> +#include <stdlib.h> +#include <ctype.h> + +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <mlibc/file-window.hpp> +#include <mlibc/ansi-sysdeps.hpp> +#include <mlibc/allocator.hpp> +#include <mlibc/lock.hpp> +#include <mlibc/locale.hpp> +#include <mlibc/bitutil.hpp> +#include <mlibc/strings.hpp> + +#include <frg/mutex.hpp> + +const char __utc[] = "UTC"; + +// Variables defined by POSIX. +int daylight; +long timezone; +char *tzname[2]; + +static FutexLock __time_lock; +static file_window *get_localtime_window() { + static file_window window{"/etc/localtime"}; + return &window; +} + +// Function taken from musl +clock_t clock(void) { + struct timespec ts; + + if(clock_gettime(CLOCK_PROCESS_CPUTIME_ID, &ts)) + return -1; + + if(ts.tv_sec > LONG_MAX / 1000000 || ts.tv_nsec / 1000 > LONG_MAX - 1000000 * ts.tv_sec) + return -1; + + return ts.tv_sec * 1000000 + ts.tv_nsec / 1000; +} + +double difftime(time_t a, time_t b) { + return a - b; +} + +time_t mktime(struct tm *tm) { + return timegm(tm); +} + +/* There is no other implemented value than TIME_UTC; all other values + * are considered erroneous. */ +// Function taken from musl +int timespec_get(struct timespec *ts, int base) { + if(base != TIME_UTC) + return 0; + int ret = clock_gettime(CLOCK_REALTIME, ts); + return ret < 0 ? 0 : base; +} + +char *asctime(const struct tm *ptr) { + static char buf[26]; + return asctime_r(ptr, buf); +} + +char *ctime(const time_t *timer) { + struct tm *tm = localtime(timer); + if(!tm) { + return 0; + } + return asctime(tm); +} + +struct tm *gmtime(const time_t *unix_gmt) { + static thread_local struct tm per_thread_tm; + return gmtime_r(unix_gmt, &per_thread_tm); +} + +struct tm *localtime(const time_t *unix_gmt) { + tzset(); + static thread_local struct tm per_thread_tm; + return localtime_r(unix_gmt, &per_thread_tm); +} + +size_t strftime(char *__restrict dest, size_t max_size, + const char *__restrict format, const struct tm *__restrict tm) { + auto c = format; + auto p = dest; + + while(*c) { + int chunk; + auto space = (dest + max_size) - p; + __ensure(space >= 0); + + if(*c != '%') { + if(!space) + return 0; + *p = *c; + c++; + p++; + continue; + } + + switch(*++c) { + case 'Y': { + chunk = snprintf(p, space, "%d", 1900 + tm->tm_year); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'm': { + chunk = snprintf(p, space, "%.2d", tm->tm_mon + 1); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'd': { + chunk = snprintf(p, space, "%.2d", tm->tm_mday); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'Z': { + chunk = snprintf(p, space, "%s", "GMT"); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'H': { + chunk = snprintf(p, space, "%.2i", tm->tm_hour); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'M': { + chunk = snprintf(p, space, "%.2i", tm->tm_min); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'S': { + chunk = snprintf(p, space, "%.2d", tm->tm_sec); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'R': { + chunk = snprintf(p, space, "%.2i:%.2i", tm->tm_hour, tm->tm_min); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'T': { + chunk = snprintf(p, space, "%.2i:%.2i:%.2i", tm->tm_hour, tm->tm_min, tm->tm_sec); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'F': { + chunk = snprintf(p, space, "%d-%.2d-%.2d", 1900 + tm->tm_year, tm->tm_mon + 1, + tm->tm_mday); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'D': { + chunk = snprintf(p, space, "%.2d/%.2d/%.2d", tm->tm_mon + 1, tm->tm_mday, tm->tm_year % 100); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'a': { + int day = tm->tm_wday; + if(day < 0 || day > 6) + __ensure(!"Day not in bounds."); + + chunk = snprintf(p, space, "%s", mlibc::nl_langinfo(ABDAY_1 + day)); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'b': + case 'B': + case 'h': { + int mon = tm->tm_mon; + if(mon < 0 || mon > 11) + __ensure(!"Month not in bounds."); + + nl_item item = (*c == 'B') ? MON_1 : ABMON_1; + + chunk = snprintf(p, space, "%s", mlibc::nl_langinfo(item + mon)); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'c': { + chunk = snprintf(p, space, "%d/%.2d/%.2d %.2d:%.2d:%.2d", 1900 + tm->tm_year, + tm->tm_mon + 1, tm->tm_mday, tm->tm_hour, tm->tm_min, tm->tm_sec); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'e': { + chunk = snprintf(p, space, "%2d", tm->tm_mday); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'l': { + int hour = tm->tm_hour; + if(!hour) + hour = 12; + if(hour > 12) + hour -= 12; + chunk = snprintf(p, space, "%2d", hour); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'I': { + int hour = tm->tm_hour; + if(!hour) + hour = 12; + if(hour > 12) + hour -= 12; + chunk = snprintf(p, space, "%.2d", hour); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'p': { + chunk = snprintf(p, space, "%s", mlibc::nl_langinfo((tm->tm_hour < 12) ? AM_STR : PM_STR)); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'C': { + chunk = snprintf(p, space, "%.2d", (1900 + tm->tm_year) / 100); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'y': { + chunk = snprintf(p, space, "%.2d", (1900 + tm->tm_year) % 100); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'j': { + chunk = snprintf(p, space, "%.3d", tm->tm_yday + 1); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'A': { + chunk = snprintf(p, space, "%s", mlibc::nl_langinfo(DAY_1 + tm->tm_wday)); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'r': { + int hour = tm->tm_hour; + if(!hour) + hour = 12; + if(hour > 12) + hour -= 12; + chunk = snprintf(p, space, "%.2i:%.2i:%.2i %s", hour, tm->tm_min, tm->tm_sec, + mlibc::nl_langinfo((tm->tm_hour < 12) ? AM_STR : PM_STR)); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case '%': { + chunk = snprintf(p, space, "%%"); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 't': { + chunk = snprintf(p, space, "\t"); + if(chunk >= space) + return 0; + p += chunk; + c++; + break; + } + case 'x': { + return strftime(dest, max_size, mlibc::nl_langinfo(D_FMT), tm); + } + case 'X': { + return strftime(dest, max_size, mlibc::nl_langinfo(T_FMT), tm); + } + case '\0': { + chunk = snprintf(p, space, "%%"); + if(chunk >= space) + return 0; + p += chunk; + break; + } + default: + mlibc::panicLogger() << "mlibc: strftime unknown format type: " << c << frg::endlog; + } + } + + auto space = (dest + max_size) - p; + if(!space) + return 0; + + *p = '\0'; + return (p - dest); +} + +size_t wcsftime(wchar_t *__restrict, size_t, const wchar_t *__restrict, + const struct tm *__restrict) { + mlibc::infoLogger() << "mlibc: wcsftime is a stub" << frg::endlog; + return 0; +} + +namespace { + +struct tzfile { + uint8_t magic[4]; + uint8_t version; + uint8_t reserved[15]; + uint32_t tzh_ttisgmtcnt; + uint32_t tzh_ttisstdcnt; + uint32_t tzh_leapcnt; + uint32_t tzh_timecnt; + uint32_t tzh_typecnt; + uint32_t tzh_charcnt; +}; + +struct[[gnu::packed]] ttinfo { + int32_t tt_gmtoff; + unsigned char tt_isdst; + unsigned char tt_abbrind; +}; + +} + +// TODO(geert): this function doesn't parse the TZ environment variable +// or properly handle the case where information might be missing from /etc/localtime +// also we should probably unify the code for this and unix_local_from_gmt() +void tzset(void) { + frg::unique_lock<FutexLock> lock(__time_lock); + // TODO(geert): we can probably cache this somehow + tzfile tzfile_time; + memcpy(&tzfile_time, reinterpret_cast<char *>(get_localtime_window()->get()), sizeof(tzfile)); + tzfile_time.tzh_ttisgmtcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_ttisgmtcnt); + tzfile_time.tzh_ttisstdcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_ttisstdcnt); + tzfile_time.tzh_leapcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_leapcnt); + tzfile_time.tzh_timecnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_timecnt); + tzfile_time.tzh_typecnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_typecnt); + tzfile_time.tzh_charcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_charcnt); + + if(tzfile_time.magic[0] != 'T' || tzfile_time.magic[1] != 'Z' || tzfile_time.magic[2] != 'i' + || tzfile_time.magic[3] != 'f') { + mlibc::infoLogger() << "mlibc: /etc/localtime is not a valid TZinfo file" << frg::endlog; + return; + } + + if(tzfile_time.version != '\0' && tzfile_time.version != '2' && tzfile_time.version != '3') { + mlibc::infoLogger() << "mlibc: /etc/localtime has an invalid TZinfo version" + << frg::endlog; + return; + } + + // There should be at least one entry in the ttinfo table. + // TODO: If there is not, we might want to fall back to UTC, no DST (?). + __ensure(tzfile_time.tzh_typecnt); + + char *abbrevs = reinterpret_cast<char *>(get_localtime_window()->get()) + sizeof(tzfile) + + tzfile_time.tzh_timecnt * sizeof(int32_t) + + tzfile_time.tzh_timecnt * sizeof(uint8_t) + + tzfile_time.tzh_typecnt * sizeof(struct ttinfo); + // start from the last ttinfo entry, this matches the behaviour of glibc and musl + for (int i = tzfile_time.tzh_typecnt; i > 0; i--) { + ttinfo time_info; + memcpy(&time_info, reinterpret_cast<char *>(get_localtime_window()->get()) + sizeof(tzfile) + + tzfile_time.tzh_timecnt * sizeof(int32_t) + + tzfile_time.tzh_timecnt * sizeof(uint8_t) + + i * sizeof(ttinfo), sizeof(ttinfo)); + time_info.tt_gmtoff = mlibc::bit_util<uint32_t>::byteswap(time_info.tt_gmtoff); + if (!time_info.tt_isdst && !tzname[0]) { + tzname[0] = abbrevs + time_info.tt_abbrind; + timezone = -time_info.tt_gmtoff; + } + if (time_info.tt_isdst && !tzname[1]) { + tzname[1] = abbrevs + time_info.tt_abbrind; + timezone = -time_info.tt_gmtoff; + daylight = 1; + } + } +} + +// POSIX extensions. + +int nanosleep(const struct timespec *req, struct timespec *) { + if (req->tv_sec < 0 || req->tv_nsec > 999999999 || req->tv_nsec < 0) { + errno = EINVAL; + return -1; + } + + if(!mlibc::sys_sleep) { + MLIBC_MISSING_SYSDEP(); + __ensure(!"Cannot continue without sys_sleep()"); + } + + struct timespec tmp = *req; + + int e = mlibc::sys_sleep(&tmp.tv_sec, &tmp.tv_nsec); + if (!e) { + return 0; + } else { + errno = e; + return -1; + } +} + +int clock_getres(clockid_t clockid, struct timespec *res) { + MLIBC_CHECK_OR_ENOSYS(mlibc::sys_clock_getres, -1); + if(int e = mlibc::sys_clock_getres(clockid, &res->tv_sec, &res->tv_nsec); e) { + errno = e; + return -1; + } + return 0; +} + +int clock_gettime(clockid_t clock, struct timespec *time) { + if(int e = mlibc::sys_clock_get(clock, &time->tv_sec, &time->tv_nsec); e) { + errno = e; + return -1; + } + return 0; +} + +int clock_nanosleep(clockid_t clockid, int, const struct timespec *req, struct timespec *) { + mlibc::infoLogger() << "clock_nanosleep is implemented as nanosleep!" << frg::endlog; + __ensure(clockid == CLOCK_REALTIME || clockid == CLOCK_MONOTONIC); + return nanosleep(req, nullptr); +} + +int clock_settime(clockid_t, const struct timespec *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +time_t time(time_t *out) { + time_t secs; + long nanos; + if(int e = mlibc::sys_clock_get(CLOCK_REALTIME, &secs, &nanos); e) { + errno = e; + return (time_t)-1; + } + if(out) + *out = secs; + return secs; +} + +namespace { + +void civil_from_days(time_t days_since_epoch, int *year, unsigned int *month, unsigned int *day) { + time_t time = days_since_epoch + 719468; + int era = (time >= 0 ? time : time - 146096) / 146097; + unsigned int doe = static_cast<unsigned int>(time - era * 146097); + unsigned int yoe = (doe - doe/1460 + doe/36524 - doe/146096) / 365; + int y = static_cast<int>(yoe) + era * 400; + unsigned int doy = doe - (365*yoe + yoe/4 - yoe/100); + unsigned int mp = (5*doy + 2)/153; + unsigned int d = doy - (153*mp+2)/5 + 1; + unsigned int m = mp + (mp < 10 ? 3 : -9); + + *year = y + (m <= 2); + *month = m; + *day = d; +} + +void weekday_from_days(time_t days_since_epoch, unsigned int *weekday) { + *weekday = static_cast<unsigned int>(days_since_epoch >= -4 ? + (days_since_epoch+4) % 7 : (days_since_epoch+5) % 7 + 6); +} + +void yearday_from_date(unsigned int year, unsigned int month, unsigned int day, unsigned int *yday) { + unsigned int n1 = 275 * month / 9; + unsigned int n2 = (month + 9) / 12; + unsigned int n3 = (1 + (year - 4 * year / 4 + 2) / 3); + *yday = n1 - (n2 * n3) + day - 30; +} + +// Looks up the local time rules for a given +// UNIX GMT timestamp (seconds since 1970 GMT, ignoring leap seconds). +// This function assumes the __time_lock has been taken +// TODO(geert): if /etc/localtime isn't available this will fail... In that case +// we should call tzset() and use the variables to compute the variables from +// the tzset() global variables. Look at the musl code for how to do that +int unix_local_from_gmt(time_t unix_gmt, time_t *offset, bool *dst, char **tm_zone) { + tzfile tzfile_time; + memcpy(&tzfile_time, reinterpret_cast<char *>(get_localtime_window()->get()), sizeof(tzfile)); + tzfile_time.tzh_ttisgmtcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_ttisgmtcnt); + tzfile_time.tzh_ttisstdcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_ttisstdcnt); + tzfile_time.tzh_leapcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_leapcnt); + tzfile_time.tzh_timecnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_timecnt); + tzfile_time.tzh_typecnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_typecnt); + tzfile_time.tzh_charcnt = mlibc::bit_util<uint32_t>::byteswap(tzfile_time.tzh_charcnt); + + if(tzfile_time.magic[0] != 'T' || tzfile_time.magic[1] != 'Z' || tzfile_time.magic[2] != 'i' + || tzfile_time.magic[3] != 'f') { + mlibc::infoLogger() << "mlibc: /etc/localtime is not a valid TZinfo file" << frg::endlog; + return -1; + } + + if(tzfile_time.version != '\0' && tzfile_time.version != '2' && tzfile_time.version != '3') { + mlibc::infoLogger() << "mlibc: /etc/localtime has an invalid TZinfo version" + << frg::endlog; + return -1; + } + + int index = -1; + for(size_t i = 0; i < tzfile_time.tzh_timecnt; i++) { + int32_t ttime; + memcpy(&ttime, reinterpret_cast<char *>(get_localtime_window()->get()) + sizeof(tzfile) + + i * sizeof(int32_t), sizeof(int32_t)); + ttime = mlibc::bit_util<uint32_t>::byteswap(ttime); + // If we are before the first transition, the format dicates that + // the first ttinfo entry should be used (and not the ttinfo entry pointed + // to by the first transition time). + if(i && ttime > unix_gmt) { + index = i - 1; + break; + } + } + + // The format dictates that if no transition is applicable, + // the first entry in the file is chosen. + uint8_t ttinfo_index = 0; + if(index >= 0) { + memcpy(&ttinfo_index, reinterpret_cast<char *>(get_localtime_window()->get()) + sizeof(tzfile) + + tzfile_time.tzh_timecnt * sizeof(int32_t) + + index * sizeof(uint8_t), sizeof(uint8_t)); + } + + // There should be at least one entry in the ttinfo table. + // TODO: If there is not, we might want to fall back to UTC, no DST (?). + __ensure(tzfile_time.tzh_typecnt); + + ttinfo time_info; + memcpy(&time_info, reinterpret_cast<char *>(get_localtime_window()->get()) + sizeof(tzfile) + + tzfile_time.tzh_timecnt * sizeof(int32_t) + + tzfile_time.tzh_timecnt * sizeof(uint8_t) + + ttinfo_index * sizeof(ttinfo), sizeof(ttinfo)); + time_info.tt_gmtoff = mlibc::bit_util<uint32_t>::byteswap(time_info.tt_gmtoff); + + char *abbrevs = reinterpret_cast<char *>(get_localtime_window()->get()) + sizeof(tzfile) + + tzfile_time.tzh_timecnt * sizeof(int32_t) + + tzfile_time.tzh_timecnt * sizeof(uint8_t) + + tzfile_time.tzh_typecnt * sizeof(struct ttinfo); + + *offset = time_info.tt_gmtoff; + *dst = time_info.tt_isdst; + *tm_zone = abbrevs + time_info.tt_abbrind; + return 0; +} + +} //anonymous namespace + +struct tm *gmtime_r(const time_t *unix_gmt, struct tm *res) { + int year; + unsigned int month; + unsigned int day; + unsigned int weekday; + unsigned int yday; + + time_t unix_local = *unix_gmt; + + int days_since_epoch = unix_local / (60*60*24); + civil_from_days(days_since_epoch, &year, &month, &day); + weekday_from_days(days_since_epoch, &weekday); + yearday_from_date(year, month, day, &yday); + + res->tm_sec = unix_local % 60; + res->tm_min = (unix_local / 60) % 60; + res->tm_hour = (unix_local / (60*60)) % 24; + res->tm_mday = day; + res->tm_mon = month - 1; + res->tm_year = year - 1900; + res->tm_wday = weekday; + res->tm_yday = yday - 1; + res->tm_isdst = -1; + res->tm_zone = __utc; + res->tm_gmtoff = 0; + + return res; +} + +struct tm *localtime_r(const time_t *unix_gmt, struct tm *res) { + int year; + unsigned int month; + unsigned int day; + unsigned int weekday; + unsigned int yday; + + time_t offset = 0; + bool dst; + char *tm_zone; + frg::unique_lock<FutexLock> lock(__time_lock); + // TODO: Set errno if the conversion fails. + if(unix_local_from_gmt(*unix_gmt, &offset, &dst, &tm_zone)) { + __ensure(!"Error parsing /etc/localtime"); + __builtin_unreachable(); + } + time_t unix_local = *unix_gmt + offset; + + int days_since_epoch = unix_local / (60*60*24); + civil_from_days(days_since_epoch, &year, &month, &day); + weekday_from_days(days_since_epoch, &weekday); + yearday_from_date(year, month, day, &yday); + + res->tm_sec = unix_local % 60; + res->tm_min = (unix_local / 60) % 60; + res->tm_hour = (unix_local / (60*60)) % 24; + res->tm_mday = day; + res->tm_mon = month - 1; + res->tm_year = year - 1900; + res->tm_wday = weekday; + res->tm_yday = yday - 1; + res->tm_isdst = dst; + res->tm_zone = tm_zone; + res->tm_gmtoff = offset; + + return res; +} + +// This implementation of asctime_r is taken from sortix +char *asctime_r(const struct tm *tm, char *buf) { + static char weekday_names[7][4] = + { "Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat" }; + static char month_names[12][4] = + { "Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", + "Nov", "Dec" }; + sprintf(buf, "%.3s %.3s%3d %.2d:%.2d%.2d %d\n", + weekday_names[tm->tm_wday], + month_names[tm->tm_mon], + tm->tm_mday, + tm->tm_hour, + tm->tm_min, + tm->tm_sec, + tm->tm_year + 1900); + return buf; +} + +char *ctime_r(const time_t *clock, char *buf) { + return asctime_r(localtime(clock), buf); +} + +time_t timelocal(struct tm *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} + +constexpr static int days_from_civil(int y, unsigned m, unsigned d) noexcept { + y -= m <= 2; + const int era = (y >= 0 ? y : y - 399) / 400; + const unsigned yoe = static_cast<unsigned>(y - era * 400); // [0, 399] + const unsigned doy = (153 * (m > 2 ? m - 3 : m + 9) + 2) / 5 + d - 1; // [0, 365] + const unsigned doe = yoe * 365 + yoe / 4 - yoe / 100 + doy; // [0, 146096] + return era * 146097 + static_cast<int>(doe) - 719468; +} + +time_t timegm(struct tm *tm) { + time_t year = tm->tm_year + 1900; + time_t month = tm->tm_mon + 1; + time_t days = days_from_civil(year, month, tm->tm_mday); + time_t secs = (days * 86400) + (tm->tm_hour * 60 * 60) + (tm->tm_min * 60) + tm->tm_sec; + return secs; +} diff --git a/lib/mlibc/options/ansi/generic/uchar.cpp b/lib/mlibc/options/ansi/generic/uchar.cpp new file mode 100644 index 0000000..cb13c12 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/uchar.cpp @@ -0,0 +1,23 @@ +#include <bits/ensure.h> +#include <uchar.h> +#include <wchar.h> + +size_t c32rtomb(char *, char32_t, mbstate_t *) MLIBC_STUB_BODY + +size_t mbrtoc32(char32_t *__restrict pc32, const char *__restrict pmb, size_t max, mbstate_t *__restrict ps) { + static mbstate_t internal_state; + + if(!ps) + ps = &internal_state; + + if(!pmb) + return mbrtoc32(0, "", 1, ps); + + wchar_t wc; + size_t ret = mbrtowc(&wc, pmb, max, ps); + + if (ret <= 4 && pc32) + *pc32 = wc; + + return ret; +} diff --git a/lib/mlibc/options/ansi/generic/wchar-stubs.cpp b/lib/mlibc/options/ansi/generic/wchar-stubs.cpp new file mode 100644 index 0000000..d9f6598 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/wchar-stubs.cpp @@ -0,0 +1,783 @@ + +#include <errno.h> +#include <stdlib.h> +#include <stdio.h> +#include <wchar.h> +#include <wctype.h> +#include <bits/ensure.h> + +#include <mlibc/charcode.hpp> +#include <mlibc/debug.hpp> + +namespace { + // All conversion functions mbrlen(), mbrtowc(), wcrtomb(), + // mbsrtowcs() and wcsrtombs() have an internal state. + __mlibc_mbstate mbrlen_state = __MLIBC_MBSTATE_INITIALIZER; + __mlibc_mbstate mbrtowc_state = __MLIBC_MBSTATE_INITIALIZER; + __mlibc_mbstate mbsrtowcs_state = __MLIBC_MBSTATE_INITIALIZER; + __mlibc_mbstate wcsrtombs_state = __MLIBC_MBSTATE_INITIALIZER; +} + +wint_t btowc(int c) { + if(c == EOF) + return WEOF; + + char nc = c; + auto cc = mlibc::current_charcode(); + wchar_t wc; + if(auto e = cc->promote_wtranscode(nc, wc); e != mlibc::charcode_error::null) + return WEOF; + return wc; +} + +int wctob(wint_t wc) { + // TODO: Revisit this once we have character encoding functions. + return wc; +} + +int mbsinit(const mbstate_t *stp) { + if(!stp) + return -1; + return !stp->__progress && !stp->__shift; +} + +size_t mbrlen(const char *mbs, size_t mb_limit, mbstate_t *stp) { + auto cc = mlibc::current_charcode(); + wchar_t wc; + + if(!stp) + stp = &mbrlen_state; + if(!mbs) { + *stp = __MLIBC_MBSTATE_INITIALIZER; + return 0; + } + + mlibc::code_seq<const char> nseq{mbs, mbs + mb_limit}; + mlibc::code_seq<wchar_t> wseq{&wc, &wc + 1}; + if(auto e = cc->decode_wtranscode(nseq, wseq, *stp); e != mlibc::charcode_error::null) + __ensure(!"decode_wtranscode() errors are not handled"); + return nseq.it - mbs; +} + +size_t mbrtowc(wchar_t *wcp, const char *mbs, size_t mb_limit, mbstate_t *stp) { + auto cc = mlibc::current_charcode(); + + if(!stp) + stp = &mbrtowc_state; + if(!mbs) { + *stp = __MLIBC_MBSTATE_INITIALIZER; + return 0; + } + + wchar_t temp = 0; + if(!wcp) + wcp = &temp; + + mlibc::code_seq<const char> nseq{mbs, mbs + mb_limit}; + mlibc::code_seq<wchar_t> wseq{wcp, wcp + 1}; + if(auto e = cc->decode_wtranscode(nseq, wseq, *stp); e != mlibc::charcode_error::null) { + if(e == mlibc::charcode_error::input_underflow) + return static_cast<size_t>(-2); + __ensure(e == mlibc::charcode_error::illegal_input); + errno = EILSEQ; + return static_cast<size_t>(-1); + }else{ + if (*mbs) { + return nseq.it - mbs; + } else { + *stp = __MLIBC_MBSTATE_INITIALIZER; + *wcp = 0; + return 0; + } + } +} + +size_t wcrtomb(char *mbs, wchar_t wc, mbstate_t *stp) { + auto cc = mlibc::current_charcode(); + + // wcrtomb() always takes a mbstate_t. + __ensure(stp); + + // TODO: Implement the following case: + __ensure(mbs); + + mlibc::code_seq<const wchar_t> wseq{&wc, &wc + 1}; + mlibc::code_seq<char> nseq{mbs, mbs + 4}; // TODO: Replace 4 by some named constant. + if(auto e = cc->encode_wtranscode(nseq, wseq, *stp); e != mlibc::charcode_error::null) { + __ensure(!"encode_wtranscode() errors are not handled"); + __builtin_unreachable(); + }else{ + size_t n = nseq.it - mbs; + if(!n) // Null-terminate resulting wide string. + *mbs = 0; + return n; + } +} + +size_t mbsrtowcs(wchar_t *wcs, const char **mbsp, size_t wc_limit, mbstate_t *stp) { + __ensure(mbsp); + + auto cc = mlibc::current_charcode(); + __mlibc_mbstate st = __MLIBC_MBSTATE_INITIALIZER; + mlibc::code_seq<const char> nseq{*mbsp, nullptr}; + mlibc::code_seq<wchar_t> wseq{wcs, wcs + wc_limit}; + + if(!stp) + stp = &mbsrtowcs_state; + + if(!wcs) { + size_t size; + if(auto e = cc->decode_wtranscode_length(nseq, &size, st); e != mlibc::charcode_error::null) + __ensure(!"decode_wtranscode() errors are not handled"); + return size; + } + + if(auto e = cc->decode_wtranscode(nseq, wseq, st); e != mlibc::charcode_error::null) { + __ensure(!"decode_wtranscode() errors are not handled"); + __builtin_unreachable(); + }else{ + size_t n = wseq.it - wcs; + if(n < wc_limit) // Null-terminate resulting wide string. + wcs[n] = 0; + *mbsp = nullptr; + return n; + } +} + +size_t mbsnrtowcs(wchar_t *wcs, const char **mbsp, size_t mb_limit, size_t wc_limit, mbstate_t *stp) { + __ensure(mbsp); + + auto cc = mlibc::current_charcode(); + __mlibc_mbstate st = __MLIBC_MBSTATE_INITIALIZER; + mlibc::code_seq<const char> nseq{*mbsp, (*mbsp) + mb_limit}; + mlibc::code_seq<wchar_t> wseq{wcs, wcs + wc_limit}; + + if(!stp) + stp = &mbsrtowcs_state; + + if(!wcs) { + size_t size; + if(auto e = cc->decode_wtranscode_length(nseq, &size, st); e != mlibc::charcode_error::null) + __ensure(!"decode_wtranscode() errors are not handled"); + return size; + } + + if(auto e = cc->decode_wtranscode(nseq, wseq, st); e != mlibc::charcode_error::null) { + __ensure(!"decode_wtranscode() errors are not handled"); + __builtin_unreachable(); + }else{ + size_t n = wseq.it - wcs; + if(n < wc_limit) // Null-terminate resulting wide string. + wcs[n] = 0; + *mbsp = nullptr; + return n; + } +} + +size_t wcsrtombs(char *mbs, const wchar_t **wcsp, size_t mb_limit, mbstate_t *stp) { + __ensure(wcsp && "wcsrtombs() with null input"); + auto cc = mlibc::current_charcode(); + mlibc::code_seq<char> nseq{mbs, mbs + mb_limit}; + mlibc::code_seq<const wchar_t> wseq{*wcsp, nullptr}; + + if(!stp) + stp = &wcsrtombs_state; + + if(!mbs) { + size_t size; + if(auto e = cc->encode_wtranscode_length(wseq, &size, *stp); e != mlibc::charcode_error::null) + __ensure(!"decode_wtranscode() errors are not handled"); + return size; + } + + if(auto e = cc->encode_wtranscode(nseq, wseq, *stp); e != mlibc::charcode_error::null) { + __ensure(!"encode_wtranscode() errors are not handled"); + __builtin_unreachable(); + }else{ + *wcsp = wseq.it; + size_t n = nseq.it - mbs; + if(n < mb_limit) // Null-terminate resulting narrow string. + mbs[n] = 0; + return n; + } +} + +size_t wcsnrtombs(char *mbs, const wchar_t **wcsp, size_t wc_limit, size_t mb_limit, mbstate_t *stp) { + __ensure(wcsp && "wcsrtombs() with null input"); + auto cc = mlibc::current_charcode(); + mlibc::code_seq<char> nseq{mbs, mbs + mb_limit}; + mlibc::code_seq<const wchar_t> wseq{*wcsp, (*wcsp) + wc_limit}; + + if(!stp) + stp = &wcsrtombs_state; + + if(!mbs) { + size_t size; + if(auto e = cc->encode_wtranscode_length(wseq, &size, *stp); e != mlibc::charcode_error::null) + __ensure(!"decode_wtranscode() errors are not handled"); + return size; + } + + if(auto e = cc->encode_wtranscode(nseq, wseq, *stp); e != mlibc::charcode_error::null) { + __ensure(!"encode_wtranscode() errors are not handled"); + __builtin_unreachable(); + }else{ + *wcsp = wseq.it; + size_t n = nseq.it - mbs; + if(n < mb_limit) // Null-terminate resulting narrow string. + mbs[n] = 0; + return n; + } +} + +/* + * The code in this anonymous namespace and the wcwidth function below + * are taken from https://github.com/termux/wcwidth/, under the following license: + * + * Copyright (C) Fredrik Fornwall 2016. + * Distributed under the MIT License. + * + * Implementation of wcwidth(3) as a C port of: + * https://github.com/jquast/wcwidth + * + * Report issues at: + * https://github.com/termux/wcwidth + */ + +namespace { + +struct width_interval { + int start; + int end; +}; + +// From https://github.com/jquast/wcwidth/blob/master/wcwidth/table_zero.py +// at commit b29897e5a1b403a0e36f7fc991614981cbc42475 (2020-07-14): +struct width_interval ZERO_WIDTH[] = { + {0x00300, 0x0036f}, // Combining Grave Accent ..Combining Latin Small Le + {0x00483, 0x00489}, // Combining Cyrillic Titlo..Combining Cyrillic Milli + {0x00591, 0x005bd}, // Hebrew Accent Etnahta ..Hebrew Point Meteg + {0x005bf, 0x005bf}, // Hebrew Point Rafe ..Hebrew Point Rafe + {0x005c1, 0x005c2}, // Hebrew Point Shin Dot ..Hebrew Point Sin Dot + {0x005c4, 0x005c5}, // Hebrew Mark Upper Dot ..Hebrew Mark Lower Dot + {0x005c7, 0x005c7}, // Hebrew Point Qamats Qata..Hebrew Point Qamats Qata + {0x00610, 0x0061a}, // Arabic Sign Sallallahou ..Arabic Small Kasra + {0x0064b, 0x0065f}, // Arabic Fathatan ..Arabic Wavy Hamza Below + {0x00670, 0x00670}, // Arabic Letter Superscrip..Arabic Letter Superscrip + {0x006d6, 0x006dc}, // Arabic Small High Ligatu..Arabic Small High Seen + {0x006df, 0x006e4}, // Arabic Small High Rounde..Arabic Small High Madda + {0x006e7, 0x006e8}, // Arabic Small High Yeh ..Arabic Small High Noon + {0x006ea, 0x006ed}, // Arabic Empty Centre Low ..Arabic Small Low Meem + {0x00711, 0x00711}, // Syriac Letter Superscrip..Syriac Letter Superscrip + {0x00730, 0x0074a}, // Syriac Pthaha Above ..Syriac Barrekh + {0x007a6, 0x007b0}, // Thaana Abafili ..Thaana Sukun + {0x007eb, 0x007f3}, // Nko Combining Short High..Nko Combining Double Dot + {0x007fd, 0x007fd}, // Nko Dantayalan ..Nko Dantayalan + {0x00816, 0x00819}, // Samaritan Mark In ..Samaritan Mark Dagesh + {0x0081b, 0x00823}, // Samaritan Mark Epentheti..Samaritan Vowel Sign A + {0x00825, 0x00827}, // Samaritan Vowel Sign Sho..Samaritan Vowel Sign U + {0x00829, 0x0082d}, // Samaritan Vowel Sign Lon..Samaritan Mark Nequdaa + {0x00859, 0x0085b}, // Mandaic Affrication Mark..Mandaic Gemination Mark + {0x008d3, 0x008e1}, // Arabic Small Low Waw ..Arabic Small High Sign S + {0x008e3, 0x00902}, // Arabic Turned Damma Belo..Devanagari Sign Anusvara + {0x0093a, 0x0093a}, // Devanagari Vowel Sign Oe..Devanagari Vowel Sign Oe + {0x0093c, 0x0093c}, // Devanagari Sign Nukta ..Devanagari Sign Nukta + {0x00941, 0x00948}, // Devanagari Vowel Sign U ..Devanagari Vowel Sign Ai + {0x0094d, 0x0094d}, // Devanagari Sign Virama ..Devanagari Sign Virama + {0x00951, 0x00957}, // Devanagari Stress Sign U..Devanagari Vowel Sign Uu + {0x00962, 0x00963}, // Devanagari Vowel Sign Vo..Devanagari Vowel Sign Vo + {0x00981, 0x00981}, // Bengali Sign Candrabindu..Bengali Sign Candrabindu + {0x009bc, 0x009bc}, // Bengali Sign Nukta ..Bengali Sign Nukta + {0x009c1, 0x009c4}, // Bengali Vowel Sign U ..Bengali Vowel Sign Vocal + {0x009cd, 0x009cd}, // Bengali Sign Virama ..Bengali Sign Virama + {0x009e2, 0x009e3}, // Bengali Vowel Sign Vocal..Bengali Vowel Sign Vocal + {0x009fe, 0x009fe}, // Bengali Sandhi Mark ..Bengali Sandhi Mark + {0x00a01, 0x00a02}, // Gurmukhi Sign Adak Bindi..Gurmukhi Sign Bindi + {0x00a3c, 0x00a3c}, // Gurmukhi Sign Nukta ..Gurmukhi Sign Nukta + {0x00a41, 0x00a42}, // Gurmukhi Vowel Sign U ..Gurmukhi Vowel Sign Uu + {0x00a47, 0x00a48}, // Gurmukhi Vowel Sign Ee ..Gurmukhi Vowel Sign Ai + {0x00a4b, 0x00a4d}, // Gurmukhi Vowel Sign Oo ..Gurmukhi Sign Virama + {0x00a51, 0x00a51}, // Gurmukhi Sign Udaat ..Gurmukhi Sign Udaat + {0x00a70, 0x00a71}, // Gurmukhi Tippi ..Gurmukhi Addak + {0x00a75, 0x00a75}, // Gurmukhi Sign Yakash ..Gurmukhi Sign Yakash + {0x00a81, 0x00a82}, // Gujarati Sign Candrabind..Gujarati Sign Anusvara + {0x00abc, 0x00abc}, // Gujarati Sign Nukta ..Gujarati Sign Nukta + {0x00ac1, 0x00ac5}, // Gujarati Vowel Sign U ..Gujarati Vowel Sign Cand + {0x00ac7, 0x00ac8}, // Gujarati Vowel Sign E ..Gujarati Vowel Sign Ai + {0x00acd, 0x00acd}, // Gujarati Sign Virama ..Gujarati Sign Virama + {0x00ae2, 0x00ae3}, // Gujarati Vowel Sign Voca..Gujarati Vowel Sign Voca + {0x00afa, 0x00aff}, // Gujarati Sign Sukun ..Gujarati Sign Two-circle + {0x00b01, 0x00b01}, // Oriya Sign Candrabindu ..Oriya Sign Candrabindu + {0x00b3c, 0x00b3c}, // Oriya Sign Nukta ..Oriya Sign Nukta + {0x00b3f, 0x00b3f}, // Oriya Vowel Sign I ..Oriya Vowel Sign I + {0x00b41, 0x00b44}, // Oriya Vowel Sign U ..Oriya Vowel Sign Vocalic + {0x00b4d, 0x00b4d}, // Oriya Sign Virama ..Oriya Sign Virama + {0x00b55, 0x00b56}, // (nil) ..Oriya Ai Length Mark + {0x00b62, 0x00b63}, // Oriya Vowel Sign Vocalic..Oriya Vowel Sign Vocalic + {0x00b82, 0x00b82}, // Tamil Sign Anusvara ..Tamil Sign Anusvara + {0x00bc0, 0x00bc0}, // Tamil Vowel Sign Ii ..Tamil Vowel Sign Ii + {0x00bcd, 0x00bcd}, // Tamil Sign Virama ..Tamil Sign Virama + {0x00c00, 0x00c00}, // Telugu Sign Combining Ca..Telugu Sign Combining Ca + {0x00c04, 0x00c04}, // Telugu Sign Combining An..Telugu Sign Combining An + {0x00c3e, 0x00c40}, // Telugu Vowel Sign Aa ..Telugu Vowel Sign Ii + {0x00c46, 0x00c48}, // Telugu Vowel Sign E ..Telugu Vowel Sign Ai + {0x00c4a, 0x00c4d}, // Telugu Vowel Sign O ..Telugu Sign Virama + {0x00c55, 0x00c56}, // Telugu Length Mark ..Telugu Ai Length Mark + {0x00c62, 0x00c63}, // Telugu Vowel Sign Vocali..Telugu Vowel Sign Vocali + {0x00c81, 0x00c81}, // Kannada Sign Candrabindu..Kannada Sign Candrabindu + {0x00cbc, 0x00cbc}, // Kannada Sign Nukta ..Kannada Sign Nukta + {0x00cbf, 0x00cbf}, // Kannada Vowel Sign I ..Kannada Vowel Sign I + {0x00cc6, 0x00cc6}, // Kannada Vowel Sign E ..Kannada Vowel Sign E + {0x00ccc, 0x00ccd}, // Kannada Vowel Sign Au ..Kannada Sign Virama + {0x00ce2, 0x00ce3}, // Kannada Vowel Sign Vocal..Kannada Vowel Sign Vocal + {0x00d00, 0x00d01}, // Malayalam Sign Combining..Malayalam Sign Candrabin + {0x00d3b, 0x00d3c}, // Malayalam Sign Vertical ..Malayalam Sign Circular + {0x00d41, 0x00d44}, // Malayalam Vowel Sign U ..Malayalam Vowel Sign Voc + {0x00d4d, 0x00d4d}, // Malayalam Sign Virama ..Malayalam Sign Virama + {0x00d62, 0x00d63}, // Malayalam Vowel Sign Voc..Malayalam Vowel Sign Voc + {0x00d81, 0x00d81}, // (nil) ..(nil) + {0x00dca, 0x00dca}, // Sinhala Sign Al-lakuna ..Sinhala Sign Al-lakuna + {0x00dd2, 0x00dd4}, // Sinhala Vowel Sign Ketti..Sinhala Vowel Sign Ketti + {0x00dd6, 0x00dd6}, // Sinhala Vowel Sign Diga ..Sinhala Vowel Sign Diga + {0x00e31, 0x00e31}, // Thai Character Mai Han-a..Thai Character Mai Han-a + {0x00e34, 0x00e3a}, // Thai Character Sara I ..Thai Character Phinthu + {0x00e47, 0x00e4e}, // Thai Character Maitaikhu..Thai Character Yamakkan + {0x00eb1, 0x00eb1}, // Lao Vowel Sign Mai Kan ..Lao Vowel Sign Mai Kan + {0x00eb4, 0x00ebc}, // Lao Vowel Sign I ..Lao Semivowel Sign Lo + {0x00ec8, 0x00ecd}, // Lao Tone Mai Ek ..Lao Niggahita + {0x00f18, 0x00f19}, // Tibetan Astrological Sig..Tibetan Astrological Sig + {0x00f35, 0x00f35}, // Tibetan Mark Ngas Bzung ..Tibetan Mark Ngas Bzung + {0x00f37, 0x00f37}, // Tibetan Mark Ngas Bzung ..Tibetan Mark Ngas Bzung + {0x00f39, 0x00f39}, // Tibetan Mark Tsa -phru ..Tibetan Mark Tsa -phru + {0x00f71, 0x00f7e}, // Tibetan Vowel Sign Aa ..Tibetan Sign Rjes Su Nga + {0x00f80, 0x00f84}, // Tibetan Vowel Sign Rever..Tibetan Mark Halanta + {0x00f86, 0x00f87}, // Tibetan Sign Lci Rtags ..Tibetan Sign Yang Rtags + {0x00f8d, 0x00f97}, // Tibetan Subjoined Sign L..Tibetan Subjoined Letter + {0x00f99, 0x00fbc}, // Tibetan Subjoined Letter..Tibetan Subjoined Letter + {0x00fc6, 0x00fc6}, // Tibetan Symbol Padma Gda..Tibetan Symbol Padma Gda + {0x0102d, 0x01030}, // Myanmar Vowel Sign I ..Myanmar Vowel Sign Uu + {0x01032, 0x01037}, // Myanmar Vowel Sign Ai ..Myanmar Sign Dot Below + {0x01039, 0x0103a}, // Myanmar Sign Virama ..Myanmar Sign Asat + {0x0103d, 0x0103e}, // Myanmar Consonant Sign M..Myanmar Consonant Sign M + {0x01058, 0x01059}, // Myanmar Vowel Sign Vocal..Myanmar Vowel Sign Vocal + {0x0105e, 0x01060}, // Myanmar Consonant Sign M..Myanmar Consonant Sign M + {0x01071, 0x01074}, // Myanmar Vowel Sign Geba ..Myanmar Vowel Sign Kayah + {0x01082, 0x01082}, // Myanmar Consonant Sign S..Myanmar Consonant Sign S + {0x01085, 0x01086}, // Myanmar Vowel Sign Shan ..Myanmar Vowel Sign Shan + {0x0108d, 0x0108d}, // Myanmar Sign Shan Counci..Myanmar Sign Shan Counci + {0x0109d, 0x0109d}, // Myanmar Vowel Sign Aiton..Myanmar Vowel Sign Aiton + {0x0135d, 0x0135f}, // Ethiopic Combining Gemin..Ethiopic Combining Gemin + {0x01712, 0x01714}, // Tagalog Vowel Sign I ..Tagalog Sign Virama + {0x01732, 0x01734}, // Hanunoo Vowel Sign I ..Hanunoo Sign Pamudpod + {0x01752, 0x01753}, // Buhid Vowel Sign I ..Buhid Vowel Sign U + {0x01772, 0x01773}, // Tagbanwa Vowel Sign I ..Tagbanwa Vowel Sign U + {0x017b4, 0x017b5}, // Khmer Vowel Inherent Aq ..Khmer Vowel Inherent Aa + {0x017b7, 0x017bd}, // Khmer Vowel Sign I ..Khmer Vowel Sign Ua + {0x017c6, 0x017c6}, // Khmer Sign Nikahit ..Khmer Sign Nikahit + {0x017c9, 0x017d3}, // Khmer Sign Muusikatoan ..Khmer Sign Bathamasat + {0x017dd, 0x017dd}, // Khmer Sign Atthacan ..Khmer Sign Atthacan + {0x0180b, 0x0180d}, // Mongolian Free Variation..Mongolian Free Variation + {0x01885, 0x01886}, // Mongolian Letter Ali Gal..Mongolian Letter Ali Gal + {0x018a9, 0x018a9}, // Mongolian Letter Ali Gal..Mongolian Letter Ali Gal + {0x01920, 0x01922}, // Limbu Vowel Sign A ..Limbu Vowel Sign U + {0x01927, 0x01928}, // Limbu Vowel Sign E ..Limbu Vowel Sign O + {0x01932, 0x01932}, // Limbu Small Letter Anusv..Limbu Small Letter Anusv + {0x01939, 0x0193b}, // Limbu Sign Mukphreng ..Limbu Sign Sa-i + {0x01a17, 0x01a18}, // Buginese Vowel Sign I ..Buginese Vowel Sign U + {0x01a1b, 0x01a1b}, // Buginese Vowel Sign Ae ..Buginese Vowel Sign Ae + {0x01a56, 0x01a56}, // Tai Tham Consonant Sign ..Tai Tham Consonant Sign + {0x01a58, 0x01a5e}, // Tai Tham Sign Mai Kang L..Tai Tham Consonant Sign + {0x01a60, 0x01a60}, // Tai Tham Sign Sakot ..Tai Tham Sign Sakot + {0x01a62, 0x01a62}, // Tai Tham Vowel Sign Mai ..Tai Tham Vowel Sign Mai + {0x01a65, 0x01a6c}, // Tai Tham Vowel Sign I ..Tai Tham Vowel Sign Oa B + {0x01a73, 0x01a7c}, // Tai Tham Vowel Sign Oa A..Tai Tham Sign Khuen-lue + {0x01a7f, 0x01a7f}, // Tai Tham Combining Crypt..Tai Tham Combining Crypt + {0x01ab0, 0x01ac0}, // Combining Doubled Circum..(nil) + {0x01b00, 0x01b03}, // Balinese Sign Ulu Ricem ..Balinese Sign Surang + {0x01b34, 0x01b34}, // Balinese Sign Rerekan ..Balinese Sign Rerekan + {0x01b36, 0x01b3a}, // Balinese Vowel Sign Ulu ..Balinese Vowel Sign Ra R + {0x01b3c, 0x01b3c}, // Balinese Vowel Sign La L..Balinese Vowel Sign La L + {0x01b42, 0x01b42}, // Balinese Vowel Sign Pepe..Balinese Vowel Sign Pepe + {0x01b6b, 0x01b73}, // Balinese Musical Symbol ..Balinese Musical Symbol + {0x01b80, 0x01b81}, // Sundanese Sign Panyecek ..Sundanese Sign Panglayar + {0x01ba2, 0x01ba5}, // Sundanese Consonant Sign..Sundanese Vowel Sign Pan + {0x01ba8, 0x01ba9}, // Sundanese Vowel Sign Pam..Sundanese Vowel Sign Pan + {0x01bab, 0x01bad}, // Sundanese Sign Virama ..Sundanese Consonant Sign + {0x01be6, 0x01be6}, // Batak Sign Tompi ..Batak Sign Tompi + {0x01be8, 0x01be9}, // Batak Vowel Sign Pakpak ..Batak Vowel Sign Ee + {0x01bed, 0x01bed}, // Batak Vowel Sign Karo O ..Batak Vowel Sign Karo O + {0x01bef, 0x01bf1}, // Batak Vowel Sign U For S..Batak Consonant Sign H + {0x01c2c, 0x01c33}, // Lepcha Vowel Sign E ..Lepcha Consonant Sign T + {0x01c36, 0x01c37}, // Lepcha Sign Ran ..Lepcha Sign Nukta + {0x01cd0, 0x01cd2}, // Vedic Tone Karshana ..Vedic Tone Prenkha + {0x01cd4, 0x01ce0}, // Vedic Sign Yajurvedic Mi..Vedic Tone Rigvedic Kash + {0x01ce2, 0x01ce8}, // Vedic Sign Visarga Svari..Vedic Sign Visarga Anuda + {0x01ced, 0x01ced}, // Vedic Sign Tiryak ..Vedic Sign Tiryak + {0x01cf4, 0x01cf4}, // Vedic Tone Candra Above ..Vedic Tone Candra Above + {0x01cf8, 0x01cf9}, // Vedic Tone Ring Above ..Vedic Tone Double Ring A + {0x01dc0, 0x01df9}, // Combining Dotted Grave A..Combining Wide Inverted + {0x01dfb, 0x01dff}, // Combining Deletion Mark ..Combining Right Arrowhea + {0x020d0, 0x020f0}, // Combining Left Harpoon A..Combining Asterisk Above + {0x02cef, 0x02cf1}, // Coptic Combining Ni Abov..Coptic Combining Spiritu + {0x02d7f, 0x02d7f}, // Tifinagh Consonant Joine..Tifinagh Consonant Joine + {0x02de0, 0x02dff}, // Combining Cyrillic Lette..Combining Cyrillic Lette + {0x0302a, 0x0302d}, // Ideographic Level Tone M..Ideographic Entering Ton + {0x03099, 0x0309a}, // Combining Katakana-hirag..Combining Katakana-hirag + {0x0a66f, 0x0a672}, // Combining Cyrillic Vzmet..Combining Cyrillic Thous + {0x0a674, 0x0a67d}, // Combining Cyrillic Lette..Combining Cyrillic Payer + {0x0a69e, 0x0a69f}, // Combining Cyrillic Lette..Combining Cyrillic Lette + {0x0a6f0, 0x0a6f1}, // Bamum Combining Mark Koq..Bamum Combining Mark Tuk + {0x0a802, 0x0a802}, // Syloti Nagri Sign Dvisva..Syloti Nagri Sign Dvisva + {0x0a806, 0x0a806}, // Syloti Nagri Sign Hasant..Syloti Nagri Sign Hasant + {0x0a80b, 0x0a80b}, // Syloti Nagri Sign Anusva..Syloti Nagri Sign Anusva + {0x0a825, 0x0a826}, // Syloti Nagri Vowel Sign ..Syloti Nagri Vowel Sign + {0x0a82c, 0x0a82c}, // (nil) ..(nil) + {0x0a8c4, 0x0a8c5}, // Saurashtra Sign Virama ..Saurashtra Sign Candrabi + {0x0a8e0, 0x0a8f1}, // Combining Devanagari Dig..Combining Devanagari Sig + {0x0a8ff, 0x0a8ff}, // Devanagari Vowel Sign Ay..Devanagari Vowel Sign Ay + {0x0a926, 0x0a92d}, // Kayah Li Vowel Ue ..Kayah Li Tone Calya Plop + {0x0a947, 0x0a951}, // Rejang Vowel Sign I ..Rejang Consonant Sign R + {0x0a980, 0x0a982}, // Javanese Sign Panyangga ..Javanese Sign Layar + {0x0a9b3, 0x0a9b3}, // Javanese Sign Cecak Telu..Javanese Sign Cecak Telu + {0x0a9b6, 0x0a9b9}, // Javanese Vowel Sign Wulu..Javanese Vowel Sign Suku + {0x0a9bc, 0x0a9bd}, // Javanese Vowel Sign Pepe..Javanese Consonant Sign + {0x0a9e5, 0x0a9e5}, // Myanmar Sign Shan Saw ..Myanmar Sign Shan Saw + {0x0aa29, 0x0aa2e}, // Cham Vowel Sign Aa ..Cham Vowel Sign Oe + {0x0aa31, 0x0aa32}, // Cham Vowel Sign Au ..Cham Vowel Sign Ue + {0x0aa35, 0x0aa36}, // Cham Consonant Sign La ..Cham Consonant Sign Wa + {0x0aa43, 0x0aa43}, // Cham Consonant Sign Fina..Cham Consonant Sign Fina + {0x0aa4c, 0x0aa4c}, // Cham Consonant Sign Fina..Cham Consonant Sign Fina + {0x0aa7c, 0x0aa7c}, // Myanmar Sign Tai Laing T..Myanmar Sign Tai Laing T + {0x0aab0, 0x0aab0}, // Tai Viet Mai Kang ..Tai Viet Mai Kang + {0x0aab2, 0x0aab4}, // Tai Viet Vowel I ..Tai Viet Vowel U + {0x0aab7, 0x0aab8}, // Tai Viet Mai Khit ..Tai Viet Vowel Ia + {0x0aabe, 0x0aabf}, // Tai Viet Vowel Am ..Tai Viet Tone Mai Ek + {0x0aac1, 0x0aac1}, // Tai Viet Tone Mai Tho ..Tai Viet Tone Mai Tho + {0x0aaec, 0x0aaed}, // Meetei Mayek Vowel Sign ..Meetei Mayek Vowel Sign + {0x0aaf6, 0x0aaf6}, // Meetei Mayek Virama ..Meetei Mayek Virama + {0x0abe5, 0x0abe5}, // Meetei Mayek Vowel Sign ..Meetei Mayek Vowel Sign + {0x0abe8, 0x0abe8}, // Meetei Mayek Vowel Sign ..Meetei Mayek Vowel Sign + {0x0abed, 0x0abed}, // Meetei Mayek Apun Iyek ..Meetei Mayek Apun Iyek + {0x0fb1e, 0x0fb1e}, // Hebrew Point Judeo-spani..Hebrew Point Judeo-spani + {0x0fe00, 0x0fe0f}, // Variation Selector-1 ..Variation Selector-16 + {0x0fe20, 0x0fe2f}, // Combining Ligature Left ..Combining Cyrillic Titlo + {0x101fd, 0x101fd}, // Phaistos Disc Sign Combi..Phaistos Disc Sign Combi + {0x102e0, 0x102e0}, // Coptic Epact Thousands M..Coptic Epact Thousands M + {0x10376, 0x1037a}, // Combining Old Permic Let..Combining Old Permic Let + {0x10a01, 0x10a03}, // Kharoshthi Vowel Sign I ..Kharoshthi Vowel Sign Vo + {0x10a05, 0x10a06}, // Kharoshthi Vowel Sign E ..Kharoshthi Vowel Sign O + {0x10a0c, 0x10a0f}, // Kharoshthi Vowel Length ..Kharoshthi Sign Visarga + {0x10a38, 0x10a3a}, // Kharoshthi Sign Bar Abov..Kharoshthi Sign Dot Belo + {0x10a3f, 0x10a3f}, // Kharoshthi Virama ..Kharoshthi Virama + {0x10ae5, 0x10ae6}, // Manichaean Abbreviation ..Manichaean Abbreviation + {0x10d24, 0x10d27}, // Hanifi Rohingya Sign Har..Hanifi Rohingya Sign Tas + {0x10eab, 0x10eac}, // (nil) ..(nil) + {0x10f46, 0x10f50}, // Sogdian Combining Dot Be..Sogdian Combining Stroke + {0x11001, 0x11001}, // Brahmi Sign Anusvara ..Brahmi Sign Anusvara + {0x11038, 0x11046}, // Brahmi Vowel Sign Aa ..Brahmi Virama + {0x1107f, 0x11081}, // Brahmi Number Joiner ..Kaithi Sign Anusvara + {0x110b3, 0x110b6}, // Kaithi Vowel Sign U ..Kaithi Vowel Sign Ai + {0x110b9, 0x110ba}, // Kaithi Sign Virama ..Kaithi Sign Nukta + {0x11100, 0x11102}, // Chakma Sign Candrabindu ..Chakma Sign Visarga + {0x11127, 0x1112b}, // Chakma Vowel Sign A ..Chakma Vowel Sign Uu + {0x1112d, 0x11134}, // Chakma Vowel Sign Ai ..Chakma Maayyaa + {0x11173, 0x11173}, // Mahajani Sign Nukta ..Mahajani Sign Nukta + {0x11180, 0x11181}, // Sharada Sign Candrabindu..Sharada Sign Anusvara + {0x111b6, 0x111be}, // Sharada Vowel Sign U ..Sharada Vowel Sign O + {0x111c9, 0x111cc}, // Sharada Sandhi Mark ..Sharada Extra Short Vowe + {0x111cf, 0x111cf}, // (nil) ..(nil) + {0x1122f, 0x11231}, // Khojki Vowel Sign U ..Khojki Vowel Sign Ai + {0x11234, 0x11234}, // Khojki Sign Anusvara ..Khojki Sign Anusvara + {0x11236, 0x11237}, // Khojki Sign Nukta ..Khojki Sign Shadda + {0x1123e, 0x1123e}, // Khojki Sign Sukun ..Khojki Sign Sukun + {0x112df, 0x112df}, // Khudawadi Sign Anusvara ..Khudawadi Sign Anusvara + {0x112e3, 0x112ea}, // Khudawadi Vowel Sign U ..Khudawadi Sign Virama + {0x11300, 0x11301}, // Grantha Sign Combining A..Grantha Sign Candrabindu + {0x1133b, 0x1133c}, // Combining Bindu Below ..Grantha Sign Nukta + {0x11340, 0x11340}, // Grantha Vowel Sign Ii ..Grantha Vowel Sign Ii + {0x11366, 0x1136c}, // Combining Grantha Digit ..Combining Grantha Digit + {0x11370, 0x11374}, // Combining Grantha Letter..Combining Grantha Letter + {0x11438, 0x1143f}, // Newa Vowel Sign U ..Newa Vowel Sign Ai + {0x11442, 0x11444}, // Newa Sign Virama ..Newa Sign Anusvara + {0x11446, 0x11446}, // Newa Sign Nukta ..Newa Sign Nukta + {0x1145e, 0x1145e}, // Newa Sandhi Mark ..Newa Sandhi Mark + {0x114b3, 0x114b8}, // Tirhuta Vowel Sign U ..Tirhuta Vowel Sign Vocal + {0x114ba, 0x114ba}, // Tirhuta Vowel Sign Short..Tirhuta Vowel Sign Short + {0x114bf, 0x114c0}, // Tirhuta Sign Candrabindu..Tirhuta Sign Anusvara + {0x114c2, 0x114c3}, // Tirhuta Sign Virama ..Tirhuta Sign Nukta + {0x115b2, 0x115b5}, // Siddham Vowel Sign U ..Siddham Vowel Sign Vocal + {0x115bc, 0x115bd}, // Siddham Sign Candrabindu..Siddham Sign Anusvara + {0x115bf, 0x115c0}, // Siddham Sign Virama ..Siddham Sign Nukta + {0x115dc, 0x115dd}, // Siddham Vowel Sign Alter..Siddham Vowel Sign Alter + {0x11633, 0x1163a}, // Modi Vowel Sign U ..Modi Vowel Sign Ai + {0x1163d, 0x1163d}, // Modi Sign Anusvara ..Modi Sign Anusvara + {0x1163f, 0x11640}, // Modi Sign Virama ..Modi Sign Ardhacandra + {0x116ab, 0x116ab}, // Takri Sign Anusvara ..Takri Sign Anusvara + {0x116ad, 0x116ad}, // Takri Vowel Sign Aa ..Takri Vowel Sign Aa + {0x116b0, 0x116b5}, // Takri Vowel Sign U ..Takri Vowel Sign Au + {0x116b7, 0x116b7}, // Takri Sign Nukta ..Takri Sign Nukta + {0x1171d, 0x1171f}, // Ahom Consonant Sign Medi..Ahom Consonant Sign Medi + {0x11722, 0x11725}, // Ahom Vowel Sign I ..Ahom Vowel Sign Uu + {0x11727, 0x1172b}, // Ahom Vowel Sign Aw ..Ahom Sign Killer + {0x1182f, 0x11837}, // Dogra Vowel Sign U ..Dogra Sign Anusvara + {0x11839, 0x1183a}, // Dogra Sign Virama ..Dogra Sign Nukta + {0x1193b, 0x1193c}, // (nil) ..(nil) + {0x1193e, 0x1193e}, // (nil) ..(nil) + {0x11943, 0x11943}, // (nil) ..(nil) + {0x119d4, 0x119d7}, // Nandinagari Vowel Sign U..Nandinagari Vowel Sign V + {0x119da, 0x119db}, // Nandinagari Vowel Sign E..Nandinagari Vowel Sign A + {0x119e0, 0x119e0}, // Nandinagari Sign Virama ..Nandinagari Sign Virama + {0x11a01, 0x11a0a}, // Zanabazar Square Vowel S..Zanabazar Square Vowel L + {0x11a33, 0x11a38}, // Zanabazar Square Final C..Zanabazar Square Sign An + {0x11a3b, 0x11a3e}, // Zanabazar Square Cluster..Zanabazar Square Cluster + {0x11a47, 0x11a47}, // Zanabazar Square Subjoin..Zanabazar Square Subjoin + {0x11a51, 0x11a56}, // Soyombo Vowel Sign I ..Soyombo Vowel Sign Oe + {0x11a59, 0x11a5b}, // Soyombo Vowel Sign Vocal..Soyombo Vowel Length Mar + {0x11a8a, 0x11a96}, // Soyombo Final Consonant ..Soyombo Sign Anusvara + {0x11a98, 0x11a99}, // Soyombo Gemination Mark ..Soyombo Subjoiner + {0x11c30, 0x11c36}, // Bhaiksuki Vowel Sign I ..Bhaiksuki Vowel Sign Voc + {0x11c38, 0x11c3d}, // Bhaiksuki Vowel Sign E ..Bhaiksuki Sign Anusvara + {0x11c3f, 0x11c3f}, // Bhaiksuki Sign Virama ..Bhaiksuki Sign Virama + {0x11c92, 0x11ca7}, // Marchen Subjoined Letter..Marchen Subjoined Letter + {0x11caa, 0x11cb0}, // Marchen Subjoined Letter..Marchen Vowel Sign Aa + {0x11cb2, 0x11cb3}, // Marchen Vowel Sign U ..Marchen Vowel Sign E + {0x11cb5, 0x11cb6}, // Marchen Sign Anusvara ..Marchen Sign Candrabindu + {0x11d31, 0x11d36}, // Masaram Gondi Vowel Sign..Masaram Gondi Vowel Sign + {0x11d3a, 0x11d3a}, // Masaram Gondi Vowel Sign..Masaram Gondi Vowel Sign + {0x11d3c, 0x11d3d}, // Masaram Gondi Vowel Sign..Masaram Gondi Vowel Sign + {0x11d3f, 0x11d45}, // Masaram Gondi Vowel Sign..Masaram Gondi Virama + {0x11d47, 0x11d47}, // Masaram Gondi Ra-kara ..Masaram Gondi Ra-kara + {0x11d90, 0x11d91}, // Gunjala Gondi Vowel Sign..Gunjala Gondi Vowel Sign + {0x11d95, 0x11d95}, // Gunjala Gondi Sign Anusv..Gunjala Gondi Sign Anusv + {0x11d97, 0x11d97}, // Gunjala Gondi Virama ..Gunjala Gondi Virama + {0x11ef3, 0x11ef4}, // Makasar Vowel Sign I ..Makasar Vowel Sign U + {0x16af0, 0x16af4}, // Bassa Vah Combining High..Bassa Vah Combining High + {0x16b30, 0x16b36}, // Pahawh Hmong Mark Cim Tu..Pahawh Hmong Mark Cim Ta + {0x16f4f, 0x16f4f}, // Miao Sign Consonant Modi..Miao Sign Consonant Modi + {0x16f8f, 0x16f92}, // Miao Tone Right ..Miao Tone Below + {0x16fe4, 0x16fe4}, // (nil) ..(nil) + {0x1bc9d, 0x1bc9e}, // Duployan Thick Letter Se..Duployan Double Mark + {0x1d167, 0x1d169}, // Musical Symbol Combining..Musical Symbol Combining + {0x1d17b, 0x1d182}, // Musical Symbol Combining..Musical Symbol Combining + {0x1d185, 0x1d18b}, // Musical Symbol Combining..Musical Symbol Combining + {0x1d1aa, 0x1d1ad}, // Musical Symbol Combining..Musical Symbol Combining + {0x1d242, 0x1d244}, // Combining Greek Musical ..Combining Greek Musical + {0x1da00, 0x1da36}, // Signwriting Head Rim ..Signwriting Air Sucking + {0x1da3b, 0x1da6c}, // Signwriting Mouth Closed..Signwriting Excitement + {0x1da75, 0x1da75}, // Signwriting Upper Body T..Signwriting Upper Body T + {0x1da84, 0x1da84}, // Signwriting Location Hea..Signwriting Location Hea + {0x1da9b, 0x1da9f}, // Signwriting Fill Modifie..Signwriting Fill Modifie + {0x1daa1, 0x1daaf}, // Signwriting Rotation Mod..Signwriting Rotation Mod + {0x1e000, 0x1e006}, // Combining Glagolitic Let..Combining Glagolitic Let + {0x1e008, 0x1e018}, // Combining Glagolitic Let..Combining Glagolitic Let + {0x1e01b, 0x1e021}, // Combining Glagolitic Let..Combining Glagolitic Let + {0x1e023, 0x1e024}, // Combining Glagolitic Let..Combining Glagolitic Let + {0x1e026, 0x1e02a}, // Combining Glagolitic Let..Combining Glagolitic Let + {0x1e130, 0x1e136}, // Nyiakeng Puachue Hmong T..Nyiakeng Puachue Hmong T + {0x1e2ec, 0x1e2ef}, // Wancho Tone Tup ..Wancho Tone Koini + {0x1e8d0, 0x1e8d6}, // Mende Kikakui Combining ..Mende Kikakui Combining + {0x1e944, 0x1e94a}, // Adlam Alif Lengthener ..Adlam Nukta + {0xe0100, 0xe01ef}, // Variation Selector-17 ..Variation Selector-256 +}; + +// https://github.com/jquast/wcwidth/blob/master/wcwidth/table_wide.py +// at commit b29897e5a1b403a0e36f7fc991614981cbc42475 (2020-07-14): +struct width_interval WIDE_EASTASIAN[] = { + {0x01100, 0x0115f}, // Hangul Choseong Kiyeok ..Hangul Choseong Filler + {0x0231a, 0x0231b}, // Watch ..Hourglass + {0x02329, 0x0232a}, // Left-pointing Angle Brac..Right-pointing Angle Bra + {0x023e9, 0x023ec}, // Black Right-pointing Dou..Black Down-pointing Doub + {0x023f0, 0x023f0}, // Alarm Clock ..Alarm Clock + {0x023f3, 0x023f3}, // Hourglass With Flowing S..Hourglass With Flowing S + {0x025fd, 0x025fe}, // White Medium Small Squar..Black Medium Small Squar + {0x02614, 0x02615}, // Umbrella With Rain Drops..Hot Beverage + {0x02648, 0x02653}, // Aries ..Pisces + {0x0267f, 0x0267f}, // Wheelchair Symbol ..Wheelchair Symbol + {0x02693, 0x02693}, // Anchor ..Anchor + {0x026a1, 0x026a1}, // High Voltage Sign ..High Voltage Sign + {0x026aa, 0x026ab}, // Medium White Circle ..Medium Black Circle + {0x026bd, 0x026be}, // Soccer Ball ..Baseball + {0x026c4, 0x026c5}, // Snowman Without Snow ..Sun Behind Cloud + {0x026ce, 0x026ce}, // Ophiuchus ..Ophiuchus + {0x026d4, 0x026d4}, // No Entry ..No Entry + {0x026ea, 0x026ea}, // Church ..Church + {0x026f2, 0x026f3}, // Fountain ..Flag In Hole + {0x026f5, 0x026f5}, // Sailboat ..Sailboat + {0x026fa, 0x026fa}, // Tent ..Tent + {0x026fd, 0x026fd}, // Fuel Pump ..Fuel Pump + {0x02705, 0x02705}, // White Heavy Check Mark ..White Heavy Check Mark + {0x0270a, 0x0270b}, // Raised Fist ..Raised Hand + {0x02728, 0x02728}, // Sparkles ..Sparkles + {0x0274c, 0x0274c}, // Cross Mark ..Cross Mark + {0x0274e, 0x0274e}, // Negative Squared Cross M..Negative Squared Cross M + {0x02753, 0x02755}, // Black Question Mark Orna..White Exclamation Mark O + {0x02757, 0x02757}, // Heavy Exclamation Mark S..Heavy Exclamation Mark S + {0x02795, 0x02797}, // Heavy Plus Sign ..Heavy Division Sign + {0x027b0, 0x027b0}, // Curly Loop ..Curly Loop + {0x027bf, 0x027bf}, // Double Curly Loop ..Double Curly Loop + {0x02b1b, 0x02b1c}, // Black Large Square ..White Large Square + {0x02b50, 0x02b50}, // White Medium Star ..White Medium Star + {0x02b55, 0x02b55}, // Heavy Large Circle ..Heavy Large Circle + {0x02e80, 0x02e99}, // Cjk Radical Repeat ..Cjk Radical Rap + {0x02e9b, 0x02ef3}, // Cjk Radical Choke ..Cjk Radical C-simplified + {0x02f00, 0x02fd5}, // Kangxi Radical One ..Kangxi Radical Flute + {0x02ff0, 0x02ffb}, // Ideographic Description ..Ideographic Description + {0x03000, 0x0303e}, // Ideographic Space ..Ideographic Variation In + {0x03041, 0x03096}, // Hiragana Letter Small A ..Hiragana Letter Small Ke + {0x03099, 0x030ff}, // Combining Katakana-hirag..Katakana Digraph Koto + {0x03105, 0x0312f}, // Bopomofo Letter B ..Bopomofo Letter Nn + {0x03131, 0x0318e}, // Hangul Letter Kiyeok ..Hangul Letter Araeae + {0x03190, 0x031e3}, // Ideographic Annotation L..Cjk Stroke Q + {0x031f0, 0x0321e}, // Katakana Letter Small Ku..Parenthesized Korean Cha + {0x03220, 0x03247}, // Parenthesized Ideograph ..Circled Ideograph Koto + {0x03250, 0x04dbf}, // Partnership Sign ..(nil) + {0x04e00, 0x0a48c}, // Cjk Unified Ideograph-4e..Yi Syllable Yyr + {0x0a490, 0x0a4c6}, // Yi Radical Qot ..Yi Radical Ke + {0x0a960, 0x0a97c}, // Hangul Choseong Tikeut-m..Hangul Choseong Ssangyeo + {0x0ac00, 0x0d7a3}, // Hangul Syllable Ga ..Hangul Syllable Hih + {0x0f900, 0x0faff}, // Cjk Compatibility Ideogr..(nil) + {0x0fe10, 0x0fe19}, // Presentation Form For Ve..Presentation Form For Ve + {0x0fe30, 0x0fe52}, // Presentation Form For Ve..Small Full Stop + {0x0fe54, 0x0fe66}, // Small Semicolon ..Small Equals Sign + {0x0fe68, 0x0fe6b}, // Small Reverse Solidus ..Small Commercial At + {0x0ff01, 0x0ff60}, // Fullwidth Exclamation Ma..Fullwidth Right White Pa + {0x0ffe0, 0x0ffe6}, // Fullwidth Cent Sign ..Fullwidth Won Sign + {0x16fe0, 0x16fe4}, // Tangut Iteration Mark ..(nil) + {0x16ff0, 0x16ff1}, // (nil) ..(nil) + {0x17000, 0x187f7}, // (nil) ..(nil) + {0x18800, 0x18cd5}, // Tangut Component-001 ..(nil) + {0x18d00, 0x18d08}, // (nil) ..(nil) + {0x1b000, 0x1b11e}, // Katakana Letter Archaic ..Hentaigana Letter N-mu-m + {0x1b150, 0x1b152}, // Hiragana Letter Small Wi..Hiragana Letter Small Wo + {0x1b164, 0x1b167}, // Katakana Letter Small Wi..Katakana Letter Small N + {0x1b170, 0x1b2fb}, // Nushu Character-1b170 ..Nushu Character-1b2fb + {0x1f004, 0x1f004}, // Mahjong Tile Red Dragon ..Mahjong Tile Red Dragon + {0x1f0cf, 0x1f0cf}, // Playing Card Black Joker..Playing Card Black Joker + {0x1f18e, 0x1f18e}, // Negative Squared Ab ..Negative Squared Ab + {0x1f191, 0x1f19a}, // Squared Cl ..Squared Vs + {0x1f200, 0x1f202}, // Square Hiragana Hoka ..Squared Katakana Sa + {0x1f210, 0x1f23b}, // Squared Cjk Unified Ideo..Squared Cjk Unified Ideo + {0x1f240, 0x1f248}, // Tortoise Shell Bracketed..Tortoise Shell Bracketed + {0x1f250, 0x1f251}, // Circled Ideograph Advant..Circled Ideograph Accept + {0x1f260, 0x1f265}, // Rounded Symbol For Fu ..Rounded Symbol For Cai + {0x1f300, 0x1f320}, // Cyclone ..Shooting Star + {0x1f32d, 0x1f335}, // Hot Dog ..Cactus + {0x1f337, 0x1f37c}, // Tulip ..Baby Bottle + {0x1f37e, 0x1f393}, // Bottle With Popping Cork..Graduation Cap + {0x1f3a0, 0x1f3ca}, // Carousel Horse ..Swimmer + {0x1f3cf, 0x1f3d3}, // Cricket Bat And Ball ..Table Tennis Paddle And + {0x1f3e0, 0x1f3f0}, // House Building ..European Castle + {0x1f3f4, 0x1f3f4}, // Waving Black Flag ..Waving Black Flag + {0x1f3f8, 0x1f43e}, // Badminton Racquet And Sh..Paw Prints + {0x1f440, 0x1f440}, // Eyes ..Eyes + {0x1f442, 0x1f4fc}, // Ear ..Videocassette + {0x1f4ff, 0x1f53d}, // Prayer Beads ..Down-pointing Small Red + {0x1f54b, 0x1f54e}, // Kaaba ..Menorah With Nine Branch + {0x1f550, 0x1f567}, // Clock Face One Oclock ..Clock Face Twelve-thirty + {0x1f57a, 0x1f57a}, // Man Dancing ..Man Dancing + {0x1f595, 0x1f596}, // Reversed Hand With Middl..Raised Hand With Part Be + {0x1f5a4, 0x1f5a4}, // Black Heart ..Black Heart + {0x1f5fb, 0x1f64f}, // Mount Fuji ..Person With Folded Hands + {0x1f680, 0x1f6c5}, // Rocket ..Left Luggage + {0x1f6cc, 0x1f6cc}, // Sleeping Accommodation ..Sleeping Accommodation + {0x1f6d0, 0x1f6d2}, // Place Of Worship ..Shopping Trolley + {0x1f6d5, 0x1f6d7}, // Hindu Temple ..(nil) + {0x1f6eb, 0x1f6ec}, // Airplane Departure ..Airplane Arriving + {0x1f6f4, 0x1f6fc}, // Scooter ..(nil) + {0x1f7e0, 0x1f7eb}, // Large Orange Circle ..Large Brown Square + {0x1f90c, 0x1f93a}, // (nil) ..Fencer + {0x1f93c, 0x1f945}, // Wrestlers ..Goal Net + {0x1f947, 0x1f978}, // First Place Medal ..(nil) + {0x1f97a, 0x1f9cb}, // Face With Pleading Eyes ..(nil) + {0x1f9cd, 0x1f9ff}, // Standing Person ..Nazar Amulet + {0x1fa70, 0x1fa74}, // Ballet Shoes ..(nil) + {0x1fa78, 0x1fa7a}, // Drop Of Blood ..Stethoscope + {0x1fa80, 0x1fa86}, // Yo-yo ..(nil) + {0x1fa90, 0x1faa8}, // Ringed Planet ..(nil) + {0x1fab0, 0x1fab6}, // (nil) ..(nil) + {0x1fac0, 0x1fac2}, // (nil) ..(nil) + {0x1fad0, 0x1fad6}, // (nil) ..(nil) + {0x20000, 0x2fffd}, // Cjk Unified Ideograph-20..(nil) + {0x30000, 0x3fffd}, // (nil) ..(nil) +}; + +bool intable(struct width_interval* table, int table_length, int c) { + // First quick check for Latin1 etc. characters. + if (c < table[0].start) return false; + + // Binary search in table. + int bot = 0; + int top = table_length - 1; + while (top >= bot) { + int mid = (bot + top) / 2; + if (table[mid].end < c) { + bot = mid + 1; + } else if (table[mid].start > c) { + top = mid - 1; + } else { + return true; + } + } + return false; +} + +} + +int wcwidth(wchar_t ucs) { + // NOTE: created by hand, there isn't anything identifiable other than + // general Cf category code to identify these, and some characters in Cf + // category code are of non-zero width. + if (ucs == 0 || ucs == 0x034F || (0x200B <= ucs && ucs <= 0x200F) || + ucs == 0x2028 || ucs == 0x2029 || (0x202A <= ucs && ucs <= 0x202E) || + (0x2060 <= ucs && ucs <= 0x2063)) { + return 0; + } + + // C0/C1 control characters. + if (ucs < 32 || (0x07F <= ucs && ucs < 0x0A0)) return -1; + + // Combining characters with zero width. + if (intable(ZERO_WIDTH, sizeof(ZERO_WIDTH) / sizeof(struct width_interval), ucs)) return 0; + + return intable(WIDE_EASTASIAN, sizeof(WIDE_EASTASIAN) / sizeof(struct width_interval), ucs) ? 2 : 1; +} + +int wcswidth(const wchar_t *wcs, size_t n) { + int ret = 0; + for(size_t i = 0; i < n && wcs[i]; i++) { + int cols = wcwidth(wcs[i]); + if (cols < 0) + return -1; + ret += cols; + } + + return ret; +} + +wchar_t *wcsdup(const wchar_t *s) { + size_t len = wcslen(s); + wchar_t *ret = (wchar_t *) malloc(sizeof(wchar_t) * (len + 1)); + if(!ret) + return NULL; + wmemcpy(ret, s, len + 1); + return ret; +} + +int wcsncasecmp(const wchar_t* s1, const wchar_t* s2, size_t n) { + for(size_t i = 0; i < n; i++) { + wint_t c1 = towlower(s1[i]); + wint_t c2 = towlower(s2[i]); + if(c1 == L'\0' && c2 == L'\0') + return 0; + if(c1 < c2) + return -1; + if(c1 > c2) + return 1; + } + return 0; +} + +int wcscasecmp(const wchar_t *, const wchar_t *) { + __ensure(!"Not implemented"); + __builtin_unreachable(); +} diff --git a/lib/mlibc/options/ansi/generic/wctype.cpp b/lib/mlibc/options/ansi/generic/wctype.cpp new file mode 100644 index 0000000..57dcbc9 --- /dev/null +++ b/lib/mlibc/options/ansi/generic/wctype.cpp @@ -0,0 +1,9 @@ + +#include <wctype.h> +#include <bits/ensure.h> +#include <mlibc/debug.hpp> +#include <frg/string.hpp> + +wctrans_t wctrans(const char *) MLIBC_STUB_BODY +wint_t towctrans(wint_t, wctrans_t) MLIBC_STUB_BODY + diff --git a/lib/mlibc/options/ansi/include/alloca.h b/lib/mlibc/options/ansi/include/alloca.h new file mode 100644 index 0000000..0cc6bcb --- /dev/null +++ b/lib/mlibc/options/ansi/include/alloca.h @@ -0,0 +1,8 @@ + +#ifndef _ALLOCA_H +#define _ALLOCA_H + +#define alloca __builtin_alloca + +#endif // _ALLOCA_H + diff --git a/lib/mlibc/options/ansi/include/assert.h b/lib/mlibc/options/ansi/include/assert.h new file mode 100644 index 0000000..7eccae0 --- /dev/null +++ b/lib/mlibc/options/ansi/include/assert.h @@ -0,0 +1,46 @@ + +#ifndef _ASSERT_H +#define _ASSERT_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +// NOTE: This is not ISO C. Declared in LSB +__attribute__ ((__noreturn__)) void __assert_fail(const char *assertion, const char *file, unsigned int line, + const char *function); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _ASSERT_H + +#include <mlibc-config.h> + +#if __MLIBC_GLIBC_OPTION +# include <bits/glibc/glibc_assert.h> +#endif + +// NOTE: [7.2] requires this be outside the include guard +#ifdef NDEBUG + +#undef assert +#define assert(ignore) ((void)0) + +#else // NDEBUG + +#undef assert +#define assert(assertion) ((void)((assertion) \ + || (__assert_fail(#assertion, __FILE__, __LINE__, __func__), 0))) + +#endif // NDEBUG + +#ifndef __cplusplus +#undef static_assert +#define static_assert _Static_assert +#endif diff --git a/lib/mlibc/options/ansi/include/bits/ansi/fenv.h b/lib/mlibc/options/ansi/include/bits/ansi/fenv.h new file mode 100644 index 0000000..677ddaa --- /dev/null +++ b/lib/mlibc/options/ansi/include/bits/ansi/fenv.h @@ -0,0 +1,54 @@ +#ifndef MLIBC_FENV_H +#define MLIBC_FENV_H + +#if defined(__x86_64__) || defined(__i386__) + +#define FE_DENORMAL 2 +#define FE_DIVBYZERO 4 +#define FE_INEXACT 32 +#define FE_INVALID 1 +#define FE_OVERFLOW 8 +#define FE_UNDERFLOW 16 + +#define FE_ALL_EXCEPT (FE_DENORMAL | FE_DIVBYZERO | FE_INEXACT | FE_INVALID | FE_OVERFLOW | FE_UNDERFLOW) + +#define FE_TONEAREST 0 +#define FE_DOWNWARD 0x400 +#define FE_UPWARD 0x800 +#define FE_TOWARDZERO 0xC00 + +#elif defined(__aarch64__) + +#define FE_INVALID 1 +#define FE_DIVBYZERO 2 +#define FE_OVERFLOW 4 +#define FE_UNDERFLOW 8 +#define FE_INEXACT 16 + +#define FE_ALL_EXCEPT 31 + +#define FE_TONEAREST 0 +#define FE_UPWARD 0x400000 +#define FE_DOWNWARD 0x800000 +#define FE_TOWARDZERO 0xC00000 + +#elif defined(__riscv) && __riscv_xlen == 64 + +#define FE_INEXACT 1 +#define FE_UNDERFLOW 2 +#define FE_OVERFLOW 4 +#define FE_DIVBYZERO 8 +#define FE_INVALID 16 + +#define FE_ALL_EXCEPT 31 + +#define FE_TONEAREST 0 +#define FE_TOWARDZERO 1 +#define FE_DOWNWARD 2 +#define FE_UPWARD 3 + +#else +#error Unknown architecture +#endif + +#endif // MLIBC_FENV_H diff --git a/lib/mlibc/options/ansi/include/bits/ansi/time_t.h b/lib/mlibc/options/ansi/include/bits/ansi/time_t.h new file mode 100644 index 0000000..1c29fa0 --- /dev/null +++ b/lib/mlibc/options/ansi/include/bits/ansi/time_t.h @@ -0,0 +1,8 @@ + +#ifndef MLIBC_TIME_T +#define MLIBC_TIME_T + +typedef long time_t; + +#endif + diff --git a/lib/mlibc/options/ansi/include/bits/ansi/timespec.h b/lib/mlibc/options/ansi/include/bits/ansi/timespec.h new file mode 100644 index 0000000..d34aa64 --- /dev/null +++ b/lib/mlibc/options/ansi/include/bits/ansi/timespec.h @@ -0,0 +1,13 @@ + +#ifndef MLIBC_TIMESPEC_H +#define MLIBC_TIMESPEC_H + +#include <bits/ansi/time_t.h> + +struct timespec { + time_t tv_sec; + long tv_nsec; +}; + +#endif // MLIBC_TIMESPEC_H + diff --git a/lib/mlibc/options/ansi/include/complex.h b/lib/mlibc/options/ansi/include/complex.h new file mode 100644 index 0000000..6191f28 --- /dev/null +++ b/lib/mlibc/options/ansi/include/complex.h @@ -0,0 +1,134 @@ +/* $NetBSD: complex.h,v 1.3 2010/09/15 16:11:30 christos Exp $ */ + +/* + * Written by Matthias Drochner. + * Public domain. + */ + +#ifndef _COMPLEX_H +#define _COMPLEX_H + +#define complex _Complex +#define _Complex_I 1.0fi +#define I _Complex_I + +#define CMPLX(x, y) ((double complex)__builtin_complex((double)(x), (double)(y))) +#define CMPLXF(x, y) ((float complex)__builtin_complex((float)(x), (float)(y))) +#define CMPLXL(x, y) ((long double complex)__builtin_complex((long double)(x), (long double)(y))) + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +/* 7.3.5 Trigonometric functions */ +/* 7.3.5.1 The cacos functions */ +double complex cacos(double complex); +float complex cacosf(float complex); + +/* 7.3.5.2 The casin functions */ +double complex casin(double complex); +float complex casinf(float complex); + +/* 7.3.5.1 The catan functions */ +double complex catan(double complex); +float complex catanf(float complex); + +/* 7.3.5.1 The ccos functions */ +double complex ccos(double complex); +float complex ccosf(float complex); + +/* 7.3.5.1 The csin functions */ +double complex csin(double complex); +float complex csinf(float complex); + +/* 7.3.5.1 The ctan functions */ +double complex ctan(double complex); +float complex ctanf(float complex); + +/* 7.3.6 Hyperbolic functions */ +/* 7.3.6.1 The cacosh functions */ +double complex cacosh(double complex); +float complex cacoshf(float complex); + +/* 7.3.6.2 The casinh functions */ +double complex casinh(double complex); +float complex casinhf(float complex); + +/* 7.3.6.3 The catanh functions */ +double complex catanh(double complex); +float complex catanhf(float complex); + +/* 7.3.6.4 The ccosh functions */ +double complex ccosh(double complex); +float complex ccoshf(float complex); + +/* 7.3.6.5 The csinh functions */ +double complex csinh(double complex); +float complex csinhf(float complex); + +/* 7.3.6.6 The ctanh functions */ +double complex ctanh(double complex); +float complex ctanhf(float complex); + +/* 7.3.7 Exponential and logarithmic functions */ +/* 7.3.7.1 The cexp functions */ +double complex cexp(double complex); +float complex cexpf(float complex); + +/* 7.3.7.2 The clog functions */ +double complex clog(double complex); +float complex clogf(float complex); + +/* 7.3.8 Power and absolute-value functions */ +/* 7.3.8.1 The cabs functions */ +/*#ifndef __LIBM0_SOURCE__ */ +/* avoid conflict with historical cabs(struct complex) */ +/* double cabs(double complex) __RENAME(__c99_cabs); + float cabsf(float complex) __RENAME(__c99_cabsf); + #endif +*/ +double cabs(double complex) ; +float cabsf(float complex) ; + +/* 7.3.8.2 The cpow functions */ +double complex cpow(double complex, double complex); +float complex cpowf(float complex, float complex); + +/* 7.3.8.3 The csqrt functions */ +double complex csqrt(double complex); +float complex csqrtf(float complex); + +/* 7.3.9 Manipulation functions */ +/* 7.3.9.1 The carg functions */ +double carg(double complex); +float cargf(float complex); + +/* 7.3.9.2 The cimag functions */ +double cimag(double complex); +float cimagf(float complex); +long double cimagl(long double complex); + +/* 7.3.9.3 The conj functions */ +double complex conj(double complex); +float complex conjf(float complex); +/*long double complex conjl(long double complex); */ + +/* 7.3.9.4 The cproj functions */ +double complex cproj(double complex); +float complex cprojf(float complex); +/*long double complex cprojl(long double complex); */ + +/* 7.3.9.5 The creal functions */ +double creal(double complex); +float crealf(float complex); +long double creall(long double complex); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* ! _COMPLEX_H */ diff --git a/lib/mlibc/options/ansi/include/ctype.h b/lib/mlibc/options/ansi/include/ctype.h new file mode 100644 index 0000000..7cd1ec8 --- /dev/null +++ b/lib/mlibc/options/ansi/include/ctype.h @@ -0,0 +1,46 @@ +#ifndef _CTYPE_H +#define _CTYPE_H + +#include <mlibc-config.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +// Character classification function [7.4.1] +int isalnum(int c); +int isalpha(int c); +int isblank(int c); +int iscntrl(int c); +int isdigit(int c); +int isgraph(int c); +int islower(int c); +int isprint(int c); +int ispunct(int c); +int isspace(int c); +int isupper(int c); +int isxdigit(int c); + +// glibc extensions. +int isascii(int c); + +// Character case mapping functions [7.4.2] +int tolower(int c); +int toupper(int c); + +#endif /* !__MLIBC_ABI_ONLY */ + +// Borrowed from glibc +#define toascii(c) ((c) & 0x7f) + +#ifdef __cplusplus +} +#endif + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_ctype.h> +#endif + +#endif // _CTYPE_H diff --git a/lib/mlibc/options/ansi/include/errno.h b/lib/mlibc/options/ansi/include/errno.h new file mode 100644 index 0000000..7730b16 --- /dev/null +++ b/lib/mlibc/options/ansi/include/errno.h @@ -0,0 +1,31 @@ +#ifndef _ERRNO_H +#define _ERRNO_H + +#include <abi-bits/errno.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +// Some programs define their own errno as an "extern int" if it is not a macro. +#define errno __mlibc_errno +extern __thread int __mlibc_errno; + +int *__errno_location(void); + +// Linux extensions. + +extern char *program_invocation_name; +extern char *program_invocation_short_name; +extern char *__progname; +extern char *__progname_full; + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _ERRNO_H diff --git a/lib/mlibc/options/ansi/include/fenv.h b/lib/mlibc/options/ansi/include/fenv.h new file mode 100644 index 0000000..11e38f3 --- /dev/null +++ b/lib/mlibc/options/ansi/include/fenv.h @@ -0,0 +1,44 @@ + +#ifndef _FENV_H +#define _FENV_H + +#include <bits/types.h> +#include <bits/ansi/fenv.h> + +#ifdef __cplusplus +extern "C" { +#endif + +typedef struct { + __mlibc_uint32 __control_word; + __mlibc_uint32 __status_word; + __mlibc_uint32 __unused[5]; + __mlibc_uint32 __mxcsr; +} fenv_t; + +typedef __mlibc_uint16 fexcept_t; + +#ifndef __MLIBC_ABI_ONLY + +int feclearexcept(int); +int fegetenv(fenv_t *); +int fegetexceptflag(fexcept_t *, int); +int fegetround(void); +int feholdexcept(fenv_t *); +int feraiseexcept(int); +int fesetenv(const fenv_t *); +int fesetexceptflag(const fexcept_t *, int); +int fesetround(int); +int fetestexcept(int); +int feupdateenv(const fenv_t *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#define FE_DFL_ENV ((const fenv_t *) -1) + +#endif // _FENV_H + diff --git a/lib/mlibc/options/ansi/include/inttypes.h b/lib/mlibc/options/ansi/include/inttypes.h new file mode 100644 index 0000000..5495440 --- /dev/null +++ b/lib/mlibc/options/ansi/include/inttypes.h @@ -0,0 +1,146 @@ +#ifndef _STDINT_H +#define _STDINT_H + +#include <stdint.h> + +/* Even though this is not strictly not-ABI, it is mlibc-printf specific therefore */ +/* gate behind !__MLIBC_ABI_ONLY */ +#ifndef __MLIBC_ABI_ONLY + +#if UINTPTR_MAX == UINT64_MAX +# define __PRI64 "l" +# define __PRIPTR "l" +#else +# define __PRI64 "ll" +# define __PRIPTR "" +#endif + +// TODO: This is extremly unelegant and fragile. +#define PRId8 "d" +#define PRIi8 "i" +#define PRIdLEAST8 "d" +#define PRIiLEAST8 "i" +#define PRIdFAST8 "d" +#define PRIiFAST8 "i" +#define PRId16 "d" +#define PRIi16 "i" +#define PRIdLEAST16 "d" +#define PRIiLEAST16 "i" +#define PRIdFAST16 "ld" +#define PRIiFAST16 "li" +#define PRId32 "d" +#define PRIi32 "i" +#define PRIdLEAST32 "d" +#define PRIiLEAST32 "i" +#define PRIdFAST32 "ld" +#define PRIiFAST32 "li" +#define PRId64 __PRI64 "d" +#define PRIi64 __PRI64 "i" +#define PRIdLEAST64 __PRI64 "d" +#define PRIiLEAST64 __PRI64 "i" +#define PRIdFAST64 __PRI64 "d" +#define PRIiFAST64 __PRI64 "i" +#define PRIdMAX __PRI64 "d" +#define PRIiMAX __PRI64 "i" +#define PRIdPTR __PRIPTR "d" +#define PRIiPTR __PRIPTR "i" +#define PRIo8 "o" +#define PRIu8 "u" +#define PRIx8 "x" +#define PRIX8 "X" +#define PRIoLEAST8 "o" +#define PRIuLEAST8 "u" +#define PRIxLEAST8 "x" +#define PRIXLEAST8 "X" +#define PRIoFAST8 "o" +#define PRIuFAST8 "u" +#define PRIxFAST8 "x" +#define PRIXFAST8 "X" +#define PRIo16 "o" +#define PRIu16 "u" +#define PRIx16 "x" +#define PRIX16 "X" +#define PRIoLEAST16 "o" +#define PRIuLEAST16 "u" +#define PRIxLEAST16 "x" +#define PRIXLEAST16 "X" +#define PRIoFAST16 "lo" +#define PRIuFAST16 "lu" +#define PRIxFAST16 "lx" +#define PRIXFAST16 "lX" +#define PRIo32 "o" +#define PRIu32 "u" +#define PRIx32 "x" +#define PRIX32 "X" +#define PRIoLEAST32 "o" +#define PRIuLEAST32 "u" +#define PRIxLEAST32 "x" +#define PRIXLEAST32 "X" +#define PRIoFAST32 "lo" +#define PRIuFAST32 "lu" +#define PRIxFAST32 "lx" +#define PRIXFAST32 "lX" +#define PRIo64 __PRI64 "o" +#define PRIu64 __PRI64 "u" +#define PRIx64 __PRI64 "x" +#define PRIX64 __PRI64 "X" +#define PRIoLEAST64 __PRI64 "o" +#define PRIuLEAST64 __PRI64 "u" +#define PRIxLEAST64 __PRI64 "x" +#define PRIXLEAST64 __PRI64 "X" +#define PRIoFAST64 __PRI64 "o" +#define PRIuFAST64 __PRI64 "u" +#define PRIxFAST64 __PRI64 "x" +#define PRIXFAST64 __PRI64 "X" +#define PRIoMAX __PRI64 "o" +#define PRIuMAX __PRI64 "u" +#define PRIxMAX __PRI64 "x" +#define PRIXMAX __PRI64 "X" +#define PRIoPTR __PRIPTR "o" +#define PRIuPTR __PRIPTR "u" +#define PRIxPTR __PRIPTR "x" +#define PRIXPTR __PRIPTR "X" + +#define SCNu32 "u" +#define SCNu64 __PRI64 "u" +#define SCNuMAX __PRI64 "u" +#define SCNx16 "hx" +#define SCNx32 "x" +#define SCNx64 __PRI64 "x" +#define SCNxMAX __PRI64 "x" +#define SCNi8 "hhi" +#define SCNxPTR __PRIPTR "x" + +#define SCNi8 "hhi" +#define SCNi64 __PRI64 "i" + +#define SCNd32 "d" +#define SCNd64 __PRI64 "d" + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +extern "C" { +#endif + +typedef struct { + intmax_t quot; + intmax_t rem; +} imaxdiv_t; + +#ifndef __MLIBC_ABI_ONLY + +intmax_t imaxabs(intmax_t); +imaxdiv_t imaxdiv(intmax_t, intmax_t); +intmax_t strtoimax(const char *__restrict, char **__restrict, int); +uintmax_t strtoumax(const char *__restrict, char **__restrict, int); +intmax_t wcstoimax(const __WCHAR_TYPE__ *__restrict, __WCHAR_TYPE__ **__restrict, int); +uintmax_t wcstoumax(const __WCHAR_TYPE__ *__restrict, __WCHAR_TYPE__ **__restrict, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _STDINT_H diff --git a/lib/mlibc/options/ansi/include/limits.h b/lib/mlibc/options/ansi/include/limits.h new file mode 100644 index 0000000..86b786e --- /dev/null +++ b/lib/mlibc/options/ansi/include/limits.h @@ -0,0 +1,117 @@ +#ifndef _LIMITS_H +#define _LIMITS_H + +#define CHAR_BIT 8 + +#ifndef MB_LEN_MAX +# define MB_LEN_MAX 4 +#endif + +#ifdef LONG_MAX +# ifdef LONG_MAX == INT32_MAX +# define LONG_BIT 32 +# else +// Safe assumption +# define LONG_BIT 64 +# endif +#elif defined __LONG_MAX__ +# if __LONG_MAX__ == INT32_MAX +# define LONG_BIT 32 +# else +// Safe assumption +# define LONG_BIT 64 +# endif +#else +# error "Unsupported configuration, please define either LONG_MAX or __LONG_MAX__" +#endif + +#undef SCHAR_MIN +#undef SCHAR_MAX +#undef CHAR_MIN +#undef CHAR_MAX +#undef UCHAR_MAX +#undef SHRT_MIN +#undef SHRT_MAX +#undef USHRT_MAX +#undef INT_MIN +#undef INT_MAX +#undef UINT_MAX +#undef LONG_MIN +#undef LONG_MAX +#undef ULONG_MAX +#undef LLONG_MIN +#undef LLONG_MAX +#undef ULLONG_MAX + +#define SCHAR_MIN (-__SCHAR_MAX__ - 1) +#define SCHAR_MAX __SCHAR_MAX__ +#if __SCHAR_MAX__ == __INT_MAX__ +# define UCHAR_MAX (__SCHAR_MAX__ * 2U + 1U) +#else +# define UCHAR_MAX (__SCHAR_MAX__ * 2 + 1) +#endif + +#ifdef __CHAR_UNSIGNED__ +# define CHAR_MAX UCHAR_MAX +# if __SCHAR_MAX__ == __INT_MAX__ +# define CHAR_MIN 0U +# else +# define CHAR_MIN 0 +# endif +#else +# define CHAR_MAX SCHAR_MAX +# define CHAR_MIN SCHAR_MIN +#endif + +#define SHRT_MIN (-__SHRT_MAX__ - 1) +#define SHRT_MAX __SHRT_MAX__ +#if __SHRT_MAX_ == __INT_MAX__ +# define USHRT_MAX (__SHRT_MAX__ * 2U + 1U) +#else +# define USHRT_MAX (__SHRT_MAX__ * 2 + 1) +#endif + +#define INT_MIN (-__INT_MAX__ - 1) +#define INT_MAX __INT_MAX__ +#define UINT_MAX (__INT_MAX__ * 2 + 1) + +#define LONG_MIN (-__LONG_MAX__ - 1L) +#define LONG_MAX __LONG_MAX__ +#define ULONG_MAX (__LONG_MAX__ * 2UL + 1UL) + +#define LLONG_MIN (-__LONG_LONG_MAX__ - 1LL) +#define LLONG_MAX __LONG_LONG_MAX__ +#define ULLONG_MAX (__LONG_LONG_MAX__ * 2ULL + 1ULL) + +#define NAME_MAX 255 +#define PATH_MAX 4096 +#define LINE_MAX 4096 +#define PIPE_BUF 4096 + +#define CHARCLASS_NAME_MAX 14 +#define RE_DUP_MAX 255 + +// This value is a guaranteed minimum, get the current maximum from sysconf +#define NGROUPS_MAX 8 +// POSIX states 9 is the minimum for NL_ARGMAX +#define NL_ARGMAX 9 + +#if INTPTR_MAX == INT64_MAX +# define SSIZE_MAX LONG_MAX +#elif INTPTR_MAX == INT32_MAX +# define SSIZE_MAX INT_MAX +#endif + +#define _POSIX_ARG_MAX 4096 +#define _POSIX_OPEN_MAX 16 +#define _POSIX_HOST_NAME_MAX 255 +#define _POSIX_NAME_MAX 14 +#define _POSIX_TZNAME_MAX 6 +#define _XOPEN_NAME_MAX 255 + +#define PTHREAD_STACK_MIN 16384 +#define PTHREAD_KEYS_MAX 1024 + +#include <abi-bits/limits.h> + +#endif // _LIMITS_H diff --git a/lib/mlibc/options/ansi/include/locale.h b/lib/mlibc/options/ansi/include/locale.h new file mode 100644 index 0000000..3b4773d --- /dev/null +++ b/lib/mlibc/options/ansi/include/locale.h @@ -0,0 +1,81 @@ + +#ifndef _LOCALE_H +#define _LOCALE_H + +#include <mlibc-config.h> + +#include <bits/null.h> + +#define LC_ALL 1 +#define LC_COLLATE 2 +#define LC_CTYPE 3 +#define LC_MONETARY 4 +#define LC_NUMERIC 5 +#define LC_TIME 6 +#define LC_MESSAGES 7 + +#define LC_GLOBAL_LOCALE ((locale_t) -1L) + +#define LC_CTYPE_MASK (1<<LC_CTYPE) +#define LC_NUMERIC_MASK (1<<LC_NUMERIC) +#define LC_TIME_MASK (1<<LC_TIME) +#define LC_COLLATE_MASK (1<<LC_COLLATE) +#define LC_MONETARY_MASK (1<<LC_MONETARY) +#define LC_MESSAGES_MASK (1<<LC_MESSAGES) +#define LC_ALL_MASK 0x7FFFFFFF + +#ifdef __cplusplus +extern "C" { +#endif + +struct lconv { + char *decimal_point; + char *thousands_sep; + char *grouping; + char *mon_decimal_point; + char *mon_thousands_sep; + char *mon_grouping; + char *positive_sign; + char *negative_sign; + char *currency_symbol; + char frac_digits; + char p_cs_precedes; + char n_cs_precedes; + char p_sep_by_space; + char n_sep_by_space; + char p_sign_posn; + char n_sign_posn; + char *int_curr_symbol; + char int_frac_digits; + char int_p_cs_precedes; + char int_n_cs_precedes; + char int_p_sep_by_space; + char int_n_sep_by_space; + char int_p_sign_posn; + char int_n_sign_posn; +}; + +#ifndef __MLIBC_ABI_ONLY + +// [C11/7.11.1] setlocale() function + +char *setlocale(int category, const char *locale); + +// [C11/7.11.2] Locale inquiry function + +struct lconv *localeconv(void); + +#endif /* !__MLIBC_ABI_ONLY */ + +// posix extension + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_locale.h> +#endif // __MLIBC_POSIX_OPTION + +#ifdef __cplusplus +} +#endif + +#endif // _LOCALE_H + diff --git a/lib/mlibc/options/ansi/include/math.h b/lib/mlibc/options/ansi/include/math.h new file mode 100644 index 0000000..7d7ab3c --- /dev/null +++ b/lib/mlibc/options/ansi/include/math.h @@ -0,0 +1,383 @@ + +#ifndef _MATH_H +#define _MATH_H + +#include <bits/inline-definition.h> + +// this is a posix extension +#define M_E 2.7182818284590452354 +#define M_LOG2E 1.4426950408889634074 +#define M_LOG10E 0.43429448190325182765 +#define M_LN2 0.69314718055994530942 +#define M_LN10 2.30258509299404568402 +#define M_PI 3.14159265358979323846 +#define M_PI_2 1.57079632679489661923 +#define M_PI_4 0.78539816339744830962 +#define M_1_PI 0.31830988618379067154 +#define M_2_PI 0.63661977236758134308 +#define M_2_SQRTPI 1.12837916709551257390 +#define M_SQRT2 1.41421356237309504880 +#define M_SQRT1_2 0.70710678118654752440 +#define M_PIl 3.141592653589793238462643383279502884L + +// The following two definitions are from musl. +#define FP_ILOGBNAN (-1 - (int)(((unsigned)-1) >> 1)) +#define FP_ILOGB0 FP_ILOGBNAN + +#ifdef __cplusplus +extern "C" { +#endif + +typedef double double_t; +typedef float float_t; + +#define HUGE_VAL (__builtin_huge_val()) +#define HUGE_VALF (__builtin_huge_valf()) +#define HUGE_VALL (__builtin_huge_vall()) +#define INFINITY (__builtin_inff()) +#define NAN (__builtin_nanf("")) + +// [C11/7.12.1 Treatment of error conditions] + +#define MATH_ERRNO 1 +#define MATH_ERREXCEPT 2 +#define math_errhandling 3 + +// [C11/7.12.3 Classification macros] + +// NOTE: fpclassify always returns exactly one of those constants +// However making them bitwise disjoint simplifies isfinite() etc. +#define FP_INFINITE 1 +#define FP_NAN 2 +#define FP_NORMAL 4 +#define FP_SUBNORMAL 8 +#define FP_ZERO 16 + +#ifndef __MLIBC_ABI_ONLY + +int __fpclassify(double x); +int __fpclassifyf(float x); +int __fpclassifyl(long double x); + +#define fpclassify(x) \ + (sizeof(x) == sizeof(double) ? __fpclassify(x) : \ + (sizeof(x) == sizeof(float) ? __fpclassifyf(x) : \ + (sizeof(x) == sizeof(long double) ? __fpclassifyl(x) : \ + 0))) + +#define isfinite(x) (fpclassify(x) & (FP_NORMAL | FP_SUBNORMAL | FP_ZERO)) +#define isnan(x) (fpclassify(x) == FP_NAN) +#define isinf(x) (fpclassify(x) == FP_INFINITE) +#define isnormal(x) (fpclassify(x) == FP_NORMAL) + +// FIXME: this is gcc specific +#define signbit(x) (__builtin_signbit(x)) + +// [C11/7.12.14 Comparison macros] +#define isunordered(x,y) (isnan((x)) ? ((void)(y),1) : isnan((y))) + +__MLIBC_INLINE_DEFINITION int __mlibc_isless(double_t x, double_t y) { return !isunordered(x, y) && x < y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessf(float_t x, float_t y) { return !isunordered(x, y) && x < y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessl(long double x, long double y) { return !isunordered(x, y) && x < y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessequal(double_t x, double_t y) { return !isunordered(x, y) && x <= y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessequalf(float_t x, float_t y) { return !isunordered(x, y) && x <= y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessequall(long double x, long double y) { return !isunordered(x, y) && x <= y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessgreater(double_t x, double_t y) { return !isunordered(x, y) && x != y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessgreaterf(float_t x, float_t y) { return !isunordered(x, y) && x != y; } +__MLIBC_INLINE_DEFINITION int __mlibc_islessgreaterl(long double x, long double y) { return !isunordered(x, y) && x != y; } +__MLIBC_INLINE_DEFINITION int __mlibc_isgreater(double_t x, double_t y) { return !isunordered(x, y) && x > y; } +__MLIBC_INLINE_DEFINITION int __mlibc_isgreaterf(float_t x, float_t y) { return !isunordered(x, y) && x > y; } +__MLIBC_INLINE_DEFINITION int __mlibc_isgreaterl(long double x, long double y) { return !isunordered(x, y) && x > y; } +__MLIBC_INLINE_DEFINITION int __mlibc_isgreaterequal(double_t x, double_t y) { return !isunordered(x, y) && x >= y; } +__MLIBC_INLINE_DEFINITION int __mlibc_isgreaterequalf(float_t x, float_t y) { return !isunordered(x, y) && x >= y; } +__MLIBC_INLINE_DEFINITION int __mlibc_isgreaterequall(long double x, long double y) { return !isunordered(x, y) && x >= y; } + +// TODO: We chould use _Generic here but that does not work in C++ code. +#define __MLIBC_CHOOSE_COMPARISON(x, y, p) ( \ + sizeof((x)+(y)) == sizeof(float) ? p##f(x, y) : \ + sizeof((x)+(y)) == sizeof(double) ? p(x, y) : \ + p##l(x, y) ) + +#define isless(x, y) __MLIBC_CHOOSE_COMPARISON(x, y, __mlibc_isless) +#define islessequal(x, y) __MLIBC_CHOOSE_COMPARISON(x, y, __mlibc_islessequal) +#define islessgreater(x, y) __MLIBC_CHOOSE_COMPARISON(x, y, __mlibc_islessgreater) +#define isgreater(x, y) __MLIBC_CHOOSE_COMPARISON(x, y, __mlibc_isgreater) +#define isgreaterequal(x, y) __MLIBC_CHOOSE_COMPARISON(x, y, __mlibc_isgreaterequal) + +// this is a gnu extension +void sincos(double, double *, double *); +void sincosf(float, float *, float *); +void sincosl(long double, long double *, long double *); + +double exp10(double); +float exp10f(float); +long double exp10l(long double); + +double pow10(double); +float pow10f(float); +long double pow10l(long double); + +// [C11/7.12.4 Trigonometric functions] + +double acos(double x); +float acosf(float x); +long double acosl(long double x); + +double asin(double x); +float asinf(float x); +long double asinl(long double x); + +double atan(double x); +float atanf(float x); +long double atanl(long double x); + +double atan2(double x, double y); +float atan2f(float x, float y); +long double atan2l(long double x, long double y); + +double cos(double x); +float cosf(float x); +long double cosl(long double x); + +double sin(double x); +float sinf(float x); +long double sinl(long double x); + +double tan(double x); +float tanf(float x); +long double tanl(long double x); + +// [C11/7.12.5 Hyperbolic functions] + +double acosh(double x); +float acoshf(float x); +long double acoshl(long double x); + +double asinh(double x); +float asinhf(float x); +long double asinhl(long double x); + +double atanh(double x); +float atanhf(float x); +long double atanhl(long double x); + +double cosh(double x); +float coshf(float x); +long double coshl(long double x); + +double sinh(double x); +float sinhf(float x); +long double sinhl(long double x); + +double tanh(double x); +float tanhf(float x); +long double tanhl(long double x); + +// [C11/7.12.6 Exponential and logarithmic functions] + +double exp(double x); +float expf(float x); +long double expl(long double x); + +double exp2(double x); +float exp2f(float x); +long double exp2l(long double x); + +double expm1(double x); +float expm1f(float x); +long double expm1l(long double x); + +double frexp(double x, int *power); +float frexpf(float x, int *power); +long double frexpl(long double x, int *power); + +int ilogb(double x); +int ilogbf(float x); +int ilogbl(long double x); + +double ldexp(double x, int power); +float ldexpf(float x, int power); +long double ldexpl(long double x, int power); + +double log(double x); +float logf(float x); +long double logl(long double x); + +double log10(double x); +float log10f(float x); +long double log10l(long double x); + +double log1p(double x); +float log1pf(float x); +long double log1pl(long double x); + +double log2(double x); +float log2f(float x); +long double log2l(long double x); + +double logb(double x); +float logbf(float x); +long double logbl(long double x); + +double modf(double x, double *integral); +float modff(float x, float *integral); +long double modfl(long double x, long double *integral); + +double scalbn(double x, int power); +float scalbnf(float x, int power); +long double scalbnl(long double x, int power); + +double scalbln(double x, long power); +float scalblnf(float x, long power); +long double scalblnl(long double x, long power); + +// [C11/7.12.7 Power and absolute-value functions] + +double cbrt(double x); +float cbrtf(float x); +long double cbrtl(long double x); + +double fabs(double x); +float fabsf(float x); +long double fabsl(long double x); + +double hypot(double x, double y); +float hypotf(float x, float y); +long double hypotl(long double x, long double y); + +double pow(double x, double y); +float powf(float x, float y); +long double powl(long double x, long double y); + +double sqrt(double x); +float sqrtf(float x); +long double sqrtl(long double x); + +// [C11/7.12.8 Error and gamma functions] + +double erf(double x); +float erff(float x); +long double erfl(long double x); + +double erfc(double x); +float erfcf(float x); +long double erfcl(long double x); + +double lgamma(double x); +float lgammaf(float x); +long double lgammal(long double x); + +double tgamma(double x); +float tgammaf(float x); +long double tgammal(long double x); + +// [C11/7.12.9 Nearest integer functions] + +double ceil(double x); +float ceilf(float x); +long double ceill(long double x); + +double floor(double x); +float floorf(float x); +long double floorl(long double x); + +double nearbyint(double x); +float nearbyintf(float x); +long double nearbyintl(long double x); + +double rint(double x); +float rintf(float x); +long double rintl(long double x); + +long lrint(double x); +long lrintf(float x); +long lrintl(long double x); + +long long llrint(double x); +long long llrintf(float x); +long long llrintl(long double x); + +double round(double x); +float roundf(float x); +long double roundl(long double x); + +long lround(double x); +long lroundf(float x); +long lroundl(long double x); + +long long llround(double x); +long long llroundf(float x); +long long llroundl(long double x); + +double trunc(double x); +float truncf(float x); +long double truncl(long double x); + +// [C11/7.12.10 Remainder functions] + +double fmod(double x, double y); +float fmodf(float x, float y); +long double fmodl(long double x, long double y); + +double remainder(double x, double y); +float remainderf(float x, float y); +long double remainderl(long double x, long double y); + +double remquo(double x, double y, int *quotient); +float remquof(float x, float y, int *quotient); +long double remquol(long double x, long double y, int *quotient); + +// [C11/7.12.11 Manipulation functions] + +double copysign(double x, double sign); +float copysignf(float x, float sign); +long double copysignl(long double x, long double sign); + +double nan(const char *tag); +float nanf(const char *tag); +long double nanl(const char *tag); + +double nextafter(double x, double dir); +float nextafterf(float x, float dir); +long double nextafterl(long double x, long double dir); + +double nexttoward(double x, long double dir); +float nexttowardf(float x, long double dir); +long double nexttowardl(long double x, long double dir); + +// [C11/7.12.12 Maximum, minimum and positive difference functions] + +double fdim(double x, double y); +float fdimf(float x, float y); +long double fdiml(long double x, long double y); + +double fmax(double x, double y); +float fmaxf(float x, float y); +long double fmaxl(long double x, long double y); + +double fmin(double x, double y); +float fminf(float x, float y); +long double fminl(long double x, long double y); + +// [C11/7.12.13 Floating multiply-add] + +double fma(double, double, double); +float fmaf(float, float, float); +long double fmal(long double, long double, long double); + +extern int signgam; +#define __signgam signgam + +// BSD floating-point classification functions - obsolete + +int finite(double x); +int finitef(float x); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _MATH_H + diff --git a/lib/mlibc/options/ansi/include/mlibc/ansi-sysdeps.hpp b/lib/mlibc/options/ansi/include/mlibc/ansi-sysdeps.hpp new file mode 100644 index 0000000..203084e --- /dev/null +++ b/lib/mlibc/options/ansi/include/mlibc/ansi-sysdeps.hpp @@ -0,0 +1,71 @@ +#ifndef MLIBC_ANSI_SYSDEPS +#define MLIBC_ANSI_SYSDEPS + +#include <stddef.h> + +#include <abi-bits/seek-whence.h> +#include <abi-bits/vm-flags.h> +#include <abi-bits/pid_t.h> +#include <abi-bits/mode_t.h> +#include <bits/off_t.h> +#include <bits/ssize_t.h> +#include <bits/ansi/time_t.h> +#include <signal.h> +#include <stdarg.h> + +struct rusage; + +namespace [[gnu::visibility("hidden")]] mlibc { + +[[noreturn]] void sys_exit(int status); +[[noreturn, gnu::weak]] void sys_thread_exit(); + +// If *stack is not null, it should point to the lowest addressable byte of the stack. +// Returns the new stack pointer in *stack and the stack base in *stack_base. +[[gnu::weak]] int sys_prepare_stack(void **stack, void *entry, void *user_arg, void* tcb, size_t *stack_size, size_t *guard_size, void **stack_base); +[[gnu::weak]] int sys_clone(void *tcb, pid_t *pid_out, void *stack); + +int sys_futex_wait(int *pointer, int expected, const struct timespec *time); +int sys_futex_wake(int *pointer); + +int sys_open(const char *pathname, int flags, mode_t mode, int *fd); +[[gnu::weak]] int sys_flock(int fd, int options); + +[[gnu::weak]] int sys_open_dir(const char *path, int *handle); +[[gnu::weak]] int sys_read_entries(int handle, void *buffer, size_t max_size, + size_t *bytes_read); + +int sys_read(int fd, void *buf, size_t count, ssize_t *bytes_read); + +int sys_write(int fd, const void *buf, size_t count, ssize_t *bytes_written); +[[gnu::weak]] int sys_pread(int fd, void *buf, size_t n, off_t off, ssize_t *bytes_read); + +int sys_seek(int fd, off_t offset, int whence, off_t *new_offset); +int sys_close(int fd); + +int sys_clock_get(int clock, time_t *secs, long *nanos); +[[gnu::weak]] int sys_clock_getres(int clock, time_t *secs, long *nanos); +[[gnu::weak]] int sys_sleep(time_t *secs, long *nanos); +// In contrast to the isatty() library function, the sysdep function uses return value +// zero (and not one) to indicate that the file is a terminal. +[[gnu::weak]] int sys_isatty(int fd); +[[gnu::weak]] int sys_rmdir(const char *path); +[[gnu::weak]] int sys_unlinkat(int dirfd, const char *path, int flags); +[[gnu::weak]] int sys_rename(const char *path, const char *new_path); +[[gnu::weak]] int sys_renameat(int olddirfd, const char *old_path, int newdirfd, const char *new_path); + +[[gnu::weak]] int sys_sigprocmask(int how, const sigset_t *__restrict set, + sigset_t *__restrict retrieve); +[[gnu::weak]] int sys_sigaction(int, const struct sigaction *__restrict, + struct sigaction *__restrict); + +[[gnu::weak]] int sys_fork(pid_t *child); +[[gnu::weak]] int sys_waitpid(pid_t pid, int *status, int flags, struct rusage *ru, pid_t *ret_pid); +[[gnu::weak]] int sys_execve(const char *path, char *const argv[], char *const envp[]); + +[[gnu::weak]] pid_t sys_getpid(); +[[gnu::weak]] int sys_kill(int, int); + +} //namespace mlibc + +#endif // MLIBC_ANSI_SYSDEPS diff --git a/lib/mlibc/options/ansi/include/mlibc/environment.hpp b/lib/mlibc/options/ansi/include/mlibc/environment.hpp new file mode 100644 index 0000000..7fd5cf9 --- /dev/null +++ b/lib/mlibc/options/ansi/include/mlibc/environment.hpp @@ -0,0 +1,10 @@ +#ifndef MLIBC_ENVIRONMENT_HPP +#define MLIBC_ENVIRONMENT_HPP + +namespace mlibc { + +int putenv(char *string); + +} // namespace mlibc + +#endif // MLIBC_ENVIRONMENT_HPP diff --git a/lib/mlibc/options/ansi/include/mlibc/file-io.hpp b/lib/mlibc/options/ansi/include/mlibc/file-io.hpp new file mode 100644 index 0000000..1155a2b --- /dev/null +++ b/lib/mlibc/options/ansi/include/mlibc/file-io.hpp @@ -0,0 +1,111 @@ +#ifndef MLIBC_FILE_IO_HPP +#define MLIBC_FILE_IO_HPP + +#include <stdio.h> + +#include <mlibc/lock.hpp> +#include <mlibc/allocator.hpp> +#include <frg/list.hpp> + +namespace mlibc { + +enum class stream_type { + unknown, + file_like, + pipe_like +}; + +enum class buffer_mode { + unknown, + no_buffer, + line_buffer, + full_buffer +}; + +struct abstract_file : __mlibc_file_base { +public: + abstract_file(void (*do_dispose)(abstract_file *) = nullptr); + + abstract_file(const abstract_file &) = delete; + + abstract_file &operator= (const abstract_file &) = delete; + + virtual ~abstract_file(); + + void dispose(); + + virtual int close() = 0; + virtual int reopen(const char *path, const char *mode) = 0; + + int read(char *buffer, size_t max_size, size_t *actual_size); + int write(const char *buffer, size_t max_size, size_t *actual_size); + int unget(char c); + + int update_bufmode(buffer_mode mode); + + void purge(); + int flush(); + + int tell(off_t *current_offset); + int seek(off_t offset, int whence); + +protected: + virtual int determine_type(stream_type *type) = 0; + virtual int determine_bufmode(buffer_mode *mode) = 0; + virtual int io_read(char *buffer, size_t max_size, size_t *actual_size) = 0; + virtual int io_write(const char *buffer, size_t max_size, size_t *actual_size) = 0; + virtual int io_seek(off_t offset, int whence, off_t *new_offset) = 0; + + int _reset(); +private: + int _init_type(); + int _init_bufmode(); + + int _write_back(); + int _save_pos(); + + void _ensure_allocation(); + + stream_type _type; + buffer_mode _bufmode; + void (*_do_dispose)(abstract_file *); + +public: + // lock for file operations + RecursiveFutexLock _lock; + // All files are stored in a global linked list, so that they can be flushed at exit(). + frg::default_list_hook<abstract_file> _list_hook; +}; + +struct fd_file : abstract_file { + fd_file(int fd, void (*do_dispose)(abstract_file *) = nullptr, bool force_unbuffered = false); + + int fd(); + + int close() override; + int reopen(const char *path, const char *mode) override; + + static int parse_modestring(const char *mode); + +protected: + int determine_type(stream_type *type) override; + int determine_bufmode(buffer_mode *mode) override; + + int io_read(char *buffer, size_t max_size, size_t *actual_size) override; + int io_write(const char *buffer, size_t max_size, size_t *actual_size) override; + int io_seek(off_t offset, int whence, off_t *new_offset) override; + +private: + // Underlying file descriptor. + int _fd; + bool _force_unbuffered; +}; + +template <typename T> +void file_dispose_cb(abstract_file *base) { + frg::destruct(getAllocator(), static_cast<T *>(base)); +} + +} // namespace mlibc + +#endif // MLIBC_FILE_IO_HPP diff --git a/lib/mlibc/options/ansi/include/setjmp.h b/lib/mlibc/options/ansi/include/setjmp.h new file mode 100644 index 0000000..30346f0 --- /dev/null +++ b/lib/mlibc/options/ansi/include/setjmp.h @@ -0,0 +1,48 @@ + +#ifndef _SETJMP_H +#define _SETJMP_H + +#include <mlibc-config.h> +#include <bits/machine.h> +#include <abi-bits/signal.h> + +#ifdef __cplusplus +extern "C" { +#endif + +// [C11/7.13] Non-local jumps + +typedef struct __jmp_buf { + struct __mlibc_jmpbuf_register_state reg_state; +} jmp_buf[1]; + +#ifndef __MLIBC_ABI_ONLY + +__attribute__((__returns_twice__)) int setjmp(jmp_buf buffer); +__attribute__((__noreturn__)) void longjmp(jmp_buf buffer, int value); + +#endif /* !__MLIBC_ABI_ONLY */ + +// POSIX Non-local jumps signal extensions + +typedef struct __sigjmp_buf { + struct __mlibc_jmpbuf_register_state reg_state; + int savesigs; + sigset_t sigset; +} sigjmp_buf[1]; + +#ifndef __MLIBC_ABI_ONLY + +#if __MLIBC_POSIX_OPTION +__attribute__((__returns_twice__)) int sigsetjmp(sigjmp_buf buffer, int savesigs); +__attribute__((__noreturn__)) void siglongjmp(sigjmp_buf buffer, int value); +#endif // __MLIBC_POSIX_OPTION + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _SETJMP_H + diff --git a/lib/mlibc/options/ansi/include/signal.h b/lib/mlibc/options/ansi/include/signal.h new file mode 100644 index 0000000..e27592b --- /dev/null +++ b/lib/mlibc/options/ansi/include/signal.h @@ -0,0 +1,48 @@ +#ifndef _SIGNAL_H +#define _SIGNAL_H + +#include <abi-bits/signal.h> +#include <mlibc-config.h> + +#ifdef __cplusplus +extern "C" { +#endif + +// [7.14] Signal handling basics + +typedef int sig_atomic_t; + +#define CLD_EXITED 1 +#define CLD_KILLED 2 +#define CLD_DUMPED 3 +#define CLD_TRAPPED 4 +#define CLD_STOPPED 5 +#define CLD_CONTINUED 6 + +#ifndef __MLIBC_ABI_ONLY + +// [7.14.1] signal() function + +__sighandler signal(int sig, __sighandler handler); + +// [7.14.2] raise() function + +int raise(int sig); + +#endif /* !__MLIBC_ABI_ONLY */ + +#define _NSIG NSIG + +#ifdef __cplusplus +} +#endif + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_signal.h> +#endif + +#if __MLIBC_GLIBC_OPTION +# include <bits/glibc/glibc_signal.h> +#endif + +#endif // _SIGNAL_H diff --git a/lib/mlibc/options/ansi/include/stdc-predef.h b/lib/mlibc/options/ansi/include/stdc-predef.h new file mode 100644 index 0000000..a0e3e92 --- /dev/null +++ b/lib/mlibc/options/ansi/include/stdc-predef.h @@ -0,0 +1,6 @@ +#ifndef _STDC_PREDEF_H +#define _STDC_PREDEF_H + +#define __STDC_ISO_10646__ 201206L + +#endif /* _STDC_PREDEF_H */ diff --git a/lib/mlibc/options/ansi/include/stdio.h b/lib/mlibc/options/ansi/include/stdio.h new file mode 100644 index 0000000..168a3c7 --- /dev/null +++ b/lib/mlibc/options/ansi/include/stdio.h @@ -0,0 +1,229 @@ + +#ifndef _STDIO_H +#define _STDIO_H + +#include <abi-bits/seek-whence.h> +#include <bits/null.h> +#include <bits/size_t.h> +#include <mlibc-config.h> + +// Glibc extensions require ssize_t. +#include <bits/ssize_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +// [C11-7.21.1] I/O related types + +#define __MLIBC_EOF_BIT 1 +#define __MLIBC_ERROR_BIT 2 + +struct __mlibc_file_base { + // Buffer for I/O operations. + // We reserve a few extra bytes for ungetc operations. This means + // that __buffer_ptr will point a few bytes *into* the allocation. + char *__buffer_ptr; + + // Number of bytes the buffer can hold. + size_t __buffer_size; + + // Current offset inside the buffer. + size_t __offset; + + // Position inside the buffer that matches the current file pointer. + size_t __io_offset; + + // Valid region of the buffer. + size_t __valid_limit; + + // Begin and end of the dirty region inside the buffer. + size_t __dirty_begin; + size_t __dirty_end; + + // This points to the same place as __buffer_ptr, or a few bytes earlier + // if there are bytes pushed by ungetc. If buffering is disabled, calls + // to ungetc will trigger an allocation. + char *__unget_ptr; + + // 0 if we are currently reading from the buffer. + // 1 if we are currently writing to the buffer. + // This is only really important for pipe-like streams. + int __io_mode; + + // EOF and error bits. + int __status_bits; +}; + +typedef struct __mlibc_file_base FILE; +typedef size_t fpos_t; + +// [C11-7.21.1] I/O related macros + +#define _IOFBF 1 +#define _IOLBF 2 +#define _IONBF 3 + +#define BUFSIZ 512 + +#define EOF (-1) + +#define FOPEN_MAX 1024 +#define FILENAME_MAX 256 +#define L_tmpnam 256 + +#define TMP_MAX 1024 + +#ifndef __MLIBC_ABI_ONLY + +extern FILE *stderr; +extern FILE *stdin; +extern FILE *stdout; + +// [C11-7.21.4] Operations on files + +int remove(const char *filename); +int rename(const char *old_path, const char *new_path); +int renameat(int olddirfd, const char *old_path, int newdirfd, const char *new_path); +FILE *tmpfile(void); +char *tmpnam(char *buffer); + +// [C11-7.21.5] File access functions + +int fclose(FILE *stream); +int fflush(FILE *stream); +FILE *fopen(const char *__restrict filename, const char *__restrict mode); +FILE *freopen(const char *__restrict filename, const char *__restrict mode, FILE *__restrict stream); +void setbuf(FILE *__restrict stream, char *__restrict buffer); +int setvbuf(FILE *__restrict stream, char *__restrict buffer, int mode, size_t size); +void setlinebuf(FILE *stream); +void setbuffer(FILE *, char *, size_t); + +// [C11-7.21.6] Formatted input/output functions + +__attribute__((__format__(printf, 2, 3))) +int fprintf(FILE *__restrict stream, const char *__restrict format, ...); + +__attribute__((__format__(scanf, 2, 3))) +int fscanf(FILE *__restrict stream, const char *__restrict format, ...); + +__attribute__((__format__(printf, 1, 2))) +int printf(const char *__restrict format, ...); + +__attribute__((__format__(scanf, 1, 2))) +int scanf(const char *__restrict format, ...); + +__attribute__((__format__(printf, 3, 4))) +int snprintf(char *__restrict buffer, size_t max_size, const char *__restrict format, ...); + +__attribute__((__format__(printf, 2, 3))) +int sprintf(char *__restrict buffer, const char *__restrict format, ...); + +__attribute__((__format__(scanf, 2, 3))) +int sscanf(const char *__restrict buffer, const char *__restrict format, ...); + +__attribute__((__format__(printf, 2, 0))) +int vfprintf(FILE *__restrict stream, const char *__restrict format, __builtin_va_list args); + +__attribute__((__format__(scanf, 2, 0))) +int vfscanf(FILE *__restrict stream, const char *__restrict format, __builtin_va_list args); + +__attribute__((__format__(printf, 1, 0))) +int vprintf(const char *__restrict format, __builtin_va_list args); + +__attribute__((__format__(scanf, 1, 0))) +int vscanf(const char *__restrict format, __builtin_va_list args); + +__attribute__((__format__(printf, 3, 0))) +int vsnprintf(char *__restrict buffer, size_t max_size, + const char *__restrict format, __builtin_va_list args); + +__attribute__((__format__(printf, 2, 0))) +int vsprintf(char *__restrict buffer, const char *__restrict format, __builtin_va_list args); + +__attribute__((__format__(scanf, 2, 0))) +int vsscanf(const char *__restrict buffer, const char *__restrict format, __builtin_va_list args); + +// this is a gnu extension +__attribute__((__format__(printf, 2, 0))) +int vasprintf(char **, const char *, __builtin_va_list); + +// [C11-7.21.7] Character input/output functions + +int fgetc(FILE *stream); +char *fgets(char *__restrict buffer, size_t max_size, FILE *__restrict stream); +int fputc(int c, FILE *stream); +int fputs(const char *__restrict string, FILE *__restrict stream); +char *gets(char *s); +int getc(FILE *stream); +int getchar(void); +int putc(int c, FILE *stream); +int putchar(int c); +int puts(const char *string); +int ungetc(int c, FILE *stream); + +// [C11-7.21.8] Direct input/output functions + +size_t fread(void *__restrict buffer, size_t size, size_t count, FILE *__restrict stream); +size_t fwrite(const void *__restrict buffer, size_t size, size_t count, FILE *__restrict stream); + +// [C11-7.21.9] File positioning functions + +int fgetpos(FILE *__restrict stream, fpos_t *__restrict position); +int fseek(FILE *stream, long offset, int whence); +int fsetpos(FILE *stream, const fpos_t *position); +long ftell(FILE *stream); +void rewind(FILE *stream); + +// [C11-7.21.10] Error handling functions + +void clearerr(FILE *stream); +int feof(FILE *stream); +int ferror(FILE *stream); +void perror(const char *string); + +// POSIX unlocked I/O extensions. + +int getc_unlocked(FILE *); +int getchar_unlocked(void); +int putc_unlocked(int, FILE *); +int putchar_unlocked(int); + +// GLIBC extensions. + +ssize_t getline(char **, size_t *, FILE *); +ssize_t getdelim(char **, size_t *, int, FILE *); + +int asprintf(char **, const char *, ...); + +// Linux unlocked I/O extensions. + +void flockfile(FILE *); +void funlockfile(FILE *); +int ftrylockfile(FILE *); + +void clearerr_unlocked(FILE *); +int feof_unlocked(FILE *); +int ferror_unlocked(FILE *); +int fileno_unlocked(FILE *); +int fflush_unlocked(FILE *); +int fgetc_unlocked(FILE *); +int fputc_unlocked(int, FILE *); +size_t fread_unlocked(void *__restrict, size_t, size_t, FILE *__restrict); +size_t fwrite_unlocked(const void *__restrict, size_t, size_t, FILE *__restrict); + +char *fgets_unlocked(char *, int, FILE *); +int fputs_unlocked(const char *, FILE *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_stdio.h> +#endif + +#endif // _STDIO_H + diff --git a/lib/mlibc/options/ansi/include/stdlib.h b/lib/mlibc/options/ansi/include/stdlib.h new file mode 100644 index 0000000..d0e916a --- /dev/null +++ b/lib/mlibc/options/ansi/include/stdlib.h @@ -0,0 +1,128 @@ +#ifndef _STDLIB_H +#define _STDLIB_H + +#include <alloca.h> +#include <mlibc-config.h> +#include <bits/null.h> +#include <bits/size_t.h> +#include <bits/wchar_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +// [7.22] General utilities + +typedef struct { + int quot, rem; +} div_t; + +typedef struct { + long quot, rem; +} ldiv_t; + +typedef struct { + long long quot, rem; +} lldiv_t; + +#define EXIT_FAILURE 1 +#define EXIT_SUCCESS 0 + +#define RAND_MAX 0x7FFFFFFF + +// TODO: this should not be a compile-time constant +#define MB_CUR_MAX 4 + +#ifndef __MLIBC_ABI_ONLY + +// [7.22.1] Numeric conversion functions + +double atof(const char *string); +int atoi(const char *string); +long atol(const char *string); +long long atoll(const char *string); +double strtod(const char *__restrict string, char **__restrict end); +float strtof(const char *__restrict string, char **__restrict end); +long double strtold(const char *__restrict string, char **__restrict end); +long strtol(const char *__restrict string, char **__restrict end, int base); +long long strtoll(const char *__restrict string, char **__restrict end, int base); +unsigned long strtoul(const char *__restrict string, char **__restrict end, int base); +unsigned long long strtoull(const char *__restrict string, char **__restrict end, int base); + +// [7.22.2] Pseudo-random sequence generation functions + +int rand(void); +int rand_r(unsigned *); +void srand(unsigned int); + +// [7.22.3] Memory management functions + +void *aligned_alloc(size_t alignment, size_t size); +void *calloc(size_t count, size_t size); +void free(void *pointer); +void *malloc(size_t size); +void *realloc(void *pointer, size_t size); + +int posix_memalign(void **, size_t, size_t); + +// [7.22.4] Communication with the environment + +__attribute__((__noreturn__)) void abort(void); +int atexit(void (*func)(void)); +int at_quick_exit(void (*func)(void)); +__attribute__((__noreturn__)) void exit(int status); +__attribute__((__noreturn__)) void _Exit(int status); +char *getenv(const char *name); +__attribute__((__noreturn__)) void quick_exit(int status); +int system(const char *string); + +// GLIBC extension. +char *mktemp(char *); + +// [7.22.5] Searching and sorting utilities + +void *bsearch(const void *key, const void *base, size_t count, size_t size, + int (*compare)(const void *, const void *)); +void qsort(void *base, size_t count, size_t size, + int (*compare)(const void *, const void *)); +void qsort_r(void *base, size_t nmemb, size_t size, + int (*compar)(const void *, const void *, void *), + void *arg); + +// [7.22.6] Integer arithmetic functions + +int abs(int number); +long labs(long number); +long long llabs(long long number); + +div_t div(int number, int denom); +ldiv_t ldiv(long number, long denom); +lldiv_t lldiv(long long number, long long denom); + +// [7.22.7] Multibyte character conversion functions + +int mblen(const char *, size_t); +int mbtowc(wchar_t *__restrict wc, const char *__restrict mb_chr, size_t max_size); +int wctomb(char *mb_chr, wchar_t wc); + +// [7.22.8] Multibyte string conversion functions + +size_t mbstowcs(wchar_t *__restrict wc_string, const char *__restrict mb_string, size_t max_size); +size_t wcstombs(char *mb_string, const wchar_t *__restrict wc_string, size_t max_size); + +#endif /* !__MLIBC_ABI_ONLY */ + +#if __MLIBC_GLIBC_OPTION +typedef int (*comparison_fn_t) (const void *, const void *); +#endif + +#ifdef __cplusplus +} +#endif + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_stdlib.h> +#endif + +#endif // _STDLIB_H + diff --git a/lib/mlibc/options/ansi/include/string.h b/lib/mlibc/options/ansi/include/string.h new file mode 100644 index 0000000..5297e36 --- /dev/null +++ b/lib/mlibc/options/ansi/include/string.h @@ -0,0 +1,107 @@ +#ifndef _STRING_H +#define _STRING_H + +#include <mlibc-config.h> +#include <bits/null.h> +#include <bits/size_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +// [7.24.2] Copying functions + +void *memcpy(void *__restrict dest, const void *__restrict src, size_t size); +void *memmove(void *dest, const void *src, size_t size); +char *strcpy(char *__restrict dest, const char *src); +char *strncpy(char *__restrict dest, const char *src, size_t max_size); + +// [7.24.3] Concatenation functions + +char *strcat(char *__restrict dest, const char *__restrict src); +char *strncat(char *__restrict dest, const char *__restrict src, size_t max_size); + +// [7.24.4] Comparison functions + +int memcmp(const void *a, const void *b, size_t size); +int strcmp(const char *a, const char *b); +int strcoll(const char *a, const char *b); +int strncmp(const char *a, const char *b, size_t max_size); +size_t strxfrm(char *__restrict dest, const char *__restrict src, size_t max_size); + +// [7.24.5] Search functions + +void *memchr(const void *s, int c, size_t size); +char *strchr(const char *s, int c); +size_t strcspn(const char *s, const char *chrs); +char *strpbrk(const char *s, const char *chrs); +char *strrchr(const char *s, int c); +size_t strspn(const char *s, const char *chrs); +char *strstr(const char *pattern, const char *s); +char *strtok(char *__restrict s, const char *__restrict delimiter); + +// This is a GNU extension. +char *strchrnul(const char *, int); + +// [7.24.6] Miscellaneous functions + +void *memset(void *dest, int c, size_t size); +char *strerror(int errnum); +size_t strlen(const char *s); + +#endif /* !__MLIBC_ABI_ONLY */ + +#if __MLIBC_POSIX_OPTION && (defined(_BSD_SOURCE) || defined(_GNU_SOURCE)) +#include <strings.h> +#endif + +#ifndef __MLIBC_ABI_ONLY + +// POSIX extensions. +int strerror_r(int, char *, size_t); +void *mempcpy(void *, const void *, size_t); + +// GNU extensions. +int strverscmp(const char *l0, const char *r0); +int ffsl(long i); +int ffsll(long long i); +void *memmem(const void *, size_t, const void *, size_t); + +/* Handling the basename mess: + * If <libgen.h> is included *at all*, we use the XPG-defined basename + * implementation, otherwise, we use the GNU one. Since our ABI previously + * provided the XPG one under basename, we'll have to diverge from GNU here and + * provide __mlibc_gnu_basename instead. + */ +#if __MLIBC_GLIBC_OPTION && defined(_GNU_SOURCE) && !defined(basename) +char *__mlibc_gnu_basename_c(const char *path); + +# ifdef __cplusplus +extern "C++" { +static inline const char *__mlibc_gnu_basename(const char *path) { + return __mlibc_gnu_basename_c(path); +} +static inline char *__mlibc_gnu_basename(char *path) { + return __mlibc_gnu_basename_c(path); +} +} +# else +# define __mlibc_gnu_basename __mlibc_gnu_basename_c +# endif + +#define basename __mlibc_gnu_basename +#endif + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_string.h> +#endif + +#endif // _STRING_H diff --git a/lib/mlibc/options/ansi/include/threads.h b/lib/mlibc/options/ansi/include/threads.h new file mode 100644 index 0000000..f96abcd --- /dev/null +++ b/lib/mlibc/options/ansi/include/threads.h @@ -0,0 +1,61 @@ +#ifndef _THREADS_H +#define _THREADS_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/threads.h> + +enum { + mtx_plain, + mtx_recursive, + mtx_timed, +}; + +enum { + thrd_success, + thrd_timedout, + thrd_busy, + thrd_error, + thrd_nomem, +}; + +typedef struct __mlibc_thread_data *thrd_t; +typedef struct __mlibc_mutex mtx_t; +typedef struct __mlibc_cond cnd_t; +#ifndef __cplusplus +#define thread_local _Thread_local +#endif + +typedef int (*thrd_start_t)(void*); + +#ifndef __MLIBC_ABI_ONLY + +int thrd_create(thrd_t *thr, thrd_start_t func, void *arg); +int thrd_equal(thrd_t lhs, thrd_t rhs); +thrd_t thrd_current(void); +int thrd_sleep(const struct timespec *duration, struct timespec *remaining); +void thrd_yield(void); +int thrd_detach(thrd_t thr); +int thrd_join(thrd_t thr, int *res); +__attribute__((__noreturn__)) void thrd_exit(int res); + +int mtx_init(mtx_t *mtx, int type); +void mtx_destroy(mtx_t *mtx); +int mtx_lock(mtx_t *mtx); +int mtx_unlock(mtx_t *mtx); + +int cnd_init(cnd_t *cond); +void cnd_destroy(cnd_t *cond); +int cnd_broadcast(cnd_t *cond); +int cnd_wait(cnd_t *cond, mtx_t *mtx); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* _THREADS_H */ + diff --git a/lib/mlibc/options/ansi/include/time.h b/lib/mlibc/options/ansi/include/time.h new file mode 100644 index 0000000..a3239e9 --- /dev/null +++ b/lib/mlibc/options/ansi/include/time.h @@ -0,0 +1,154 @@ +#ifndef _TIME_H +#define _TIME_H + +#include <bits/null.h> +#include <bits/size_t.h> +#include <bits/ansi/time_t.h> +#include <bits/ansi/timespec.h> +#include <mlibc-config.h> + +// [7.27.1] Components of time + +#define CLOCKS_PER_SEC ((clock_t)1000000) + +#define TIME_UTC 1 + +// POSIX extensions. + +#define CLOCK_REALTIME 0 +#define CLOCK_MONOTONIC 1 +#define CLOCK_PROCESS_CPUTIME_ID 2 +#define CLOCK_THREAD_CPUTIME_ID 3 +#define CLOCK_MONOTONIC_RAW 4 +#define CLOCK_REALTIME_COARSE 5 +#define CLOCK_MONOTONIC_COARSE 6 +#define CLOCK_BOOTTIME 7 +#define CLOCK_REALTIME_ALARM 8 +#define CLOCK_BOOTTIME_ALARM 9 + +#ifdef __cplusplus +extern "C" { +#endif + +// [7.27.1] Components of time + +typedef long clock_t; // Matches Linux' ABI. + +struct tm { + int tm_sec; + int tm_min; + int tm_hour; + int tm_mday; + int tm_mon; + int tm_year; + int tm_wday; + int tm_yday; + int tm_isdst; + long int tm_gmtoff; + const char *tm_zone; +}; + +#ifndef __MLIBC_ABI_ONLY + +// [7.27.2] Time manipulation functions + +clock_t clock(void); +double difftime(time_t a, time_t b); +time_t mktime(struct tm *ptr); +time_t time(time_t *timer); +int timespec_get(struct timespec *ptr, int base); + +// [7.27.3] Time conversion functions + +char *asctime(const struct tm *ptr); +char *ctime(const time_t *timer); +struct tm *gmtime(const time_t *timer); +struct tm *gmtime_r(const time_t *__restrict timer, struct tm *__restrict result); +struct tm *localtime(const time_t *timer); +size_t strftime(char *__restrict dest, size_t max_size, + const char *__restrict format, const struct tm *__restrict ptr); + +void tzset(void); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +// POSIX extensions. + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_time.h> +# include <bits/posix/timer_t.h> +#endif // __MLIBC_POSIX_OPTION + +#include <abi-bits/clockid_t.h> + +#define TIMER_ABSTIME 1 + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +extern int daylight; +extern long timezone; +extern char *tzname[2]; + +int nanosleep(const struct timespec *, struct timespec *); + +int clock_getres(clockid_t, struct timespec *); +int clock_gettime(clockid_t, struct timespec *); +int clock_nanosleep(clockid_t, int, const struct timespec *, struct timespec *); +int clock_settime(clockid_t, const struct timespec *); + +struct tm *localtime_r(const time_t *, struct tm *); +char *asctime_r(const struct tm *tm, char *buf); +char *ctime_r(const time_t *, char *); + +#if __MLIBC_POSIX_OPTION +char *strptime(const char *__restrict, const char *__restrict, + struct tm *__restrict); +#endif /* __MLIBC_POSIX_OPTION */ + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +// GNU extensions. + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef __MLIBC_ABI_ONLY + +time_t timelocal(struct tm *); +time_t timegm(struct tm *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +// Linux extensions. + +#ifdef __cplusplus +extern "C" { +#endif + +struct itimerspec { + struct timespec it_interval; + struct timespec it_value; +}; + +#ifdef __cplusplus +} +#endif + +#endif // _TIME_H diff --git a/lib/mlibc/options/ansi/include/uchar.h b/lib/mlibc/options/ansi/include/uchar.h new file mode 100644 index 0000000..3651a60 --- /dev/null +++ b/lib/mlibc/options/ansi/include/uchar.h @@ -0,0 +1,29 @@ +#ifndef _UCHAR_H +#define _UCHAR_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <bits/mbstate.h> +#include <bits/size_t.h> + +#ifndef __cplusplus +typedef __CHAR16_TYPE__ char16_t; +typedef __CHAR32_TYPE__ char32_t; +#endif /* __cplusplus */ + +typedef struct __mlibc_mbstate mbstate_t; + +#ifndef __MLIBC_ABI_ONLY + +size_t c32rtomb(char *pmb, char32_t c32, mbstate_t *ps); +size_t mbrtoc32(char32_t *pc32, const char *pmb, size_t max, mbstate_t *ps); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif /* _UCHAR_H */ diff --git a/lib/mlibc/options/ansi/include/wchar.h b/lib/mlibc/options/ansi/include/wchar.h new file mode 100644 index 0000000..27198c5 --- /dev/null +++ b/lib/mlibc/options/ansi/include/wchar.h @@ -0,0 +1,128 @@ +#ifndef _WCHAR_H +#define _WCHAR_H + +#include <bits/null.h> +#include <bits/size_t.h> +#include <bits/wchar_t.h> +#include <bits/wchar.h> +#include <bits/wint_t.h> +#include <bits/mbstate.h> + +#define WEOF 0xffffffffU + +#ifdef __cplusplus +extern "C" { +#endif + +typedef struct __mlibc_file_base FILE; + +typedef struct __mlibc_mbstate mbstate_t; + +// MISSING: struct tm + +#ifndef __MLIBC_ABI_ONLY + +// [7.28.2] Wide formatted I/O functions + +int fwprintf(FILE *__restrict, const wchar_t *__restrict, ...); +int fwscanf(FILE *__restrict, const wchar_t *__restrict, ...); +int vfwprintf(FILE *__restrict, const wchar_t *__restrict, __builtin_va_list); +int vfwscanf(FILE *__restrict, const wchar_t *__restrict, __builtin_va_list); + +int swprintf(wchar_t *__restrict, size_t, const wchar_t *__restrict, ...); +int swscanf(wchar_t *__restrict, size_t, const wchar_t *__restrict, ...); +int vswprintf(wchar_t *__restrict, size_t, const wchar_t *__restrict, __builtin_va_list); +int vswscanf(wchar_t *__restrict, size_t, const wchar_t *__restrict, __builtin_va_list); + +int wprintf(const wchar_t *__restrict, ...); +int wscanf(const wchar_t *__restrict, ...); +int vwprintf(const wchar_t *__restrict, __builtin_va_list); +int vwscanf(const wchar_t *__restrict, __builtin_va_list); + +// [7.28.3] Wide character I/O functions + +wint_t fgetwc(FILE *); +wchar_t *fgetws(wchar_t *__restrict, int, FILE *__restrict); +wint_t fputwc(wchar_t, FILE *); +int fputws(const wchar_t *__restrict, FILE *__restrict); +int fwide(FILE *, int); +wint_t getwc(FILE *); +wint_t getwchar(void); +wint_t putwc(wchar_t, FILE *); +wint_t putwchar(wchar_t); +wint_t ungetwc(wint_t, FILE *); + +// [7.28.4] Wide string functions + +double wcstod(const wchar_t *__restrict, wchar_t **__restrict); +float wcstof(const wchar_t *__restrict, wchar_t **__restrict); +long double wcstold(const wchar_t *__restrict, wchar_t **__restrict); + +long wcstol(const wchar_t *__restrict, wchar_t **__restrict, int); +long long wcstoll(const wchar_t *__restrict, wchar_t **__restrict, int); +unsigned long wcstoul(const wchar_t *__restrict, wchar_t **__restrict, int); +unsigned long long wcstoull(const wchar_t *__restrict, wchar_t **__restrict, int); + +wchar_t *wcscpy(wchar_t *__restrict, const wchar_t *__restrict); +wchar_t *wcsncpy(wchar_t *__restrict, const wchar_t *__restrict, size_t); +wchar_t *wmemcpy(wchar_t *__restrict, const wchar_t *__restrict, size_t); +wchar_t *wmemmove(wchar_t *, const wchar_t *, size_t); + +wchar_t *wcscat(wchar_t *__restrict, const wchar_t *__restrict); +wchar_t *wcsncat(wchar_t *__restrict, const wchar_t *__restrict, size_t); + +int wcscmp(const wchar_t *, const wchar_t *); +int wcscoll(const wchar_t *, const wchar_t *); +int wcsncmp(const wchar_t *, const wchar_t *, size_t); +int wcsxfrm(wchar_t *__restrict, const wchar_t *__restrict, size_t); +int wmemcmp(const wchar_t *, const wchar_t *, size_t); + +wchar_t *wcschr(const wchar_t *, wchar_t); +size_t wcscspn(const wchar_t *, const wchar_t *); +wchar_t *wcspbrk(const wchar_t *, const wchar_t *); +wchar_t *wcsrchr(const wchar_t *, wchar_t); +size_t wcsspn(const wchar_t *, const wchar_t *); +wchar_t *wcsstr(const wchar_t *, const wchar_t *); +wchar_t *wcstok(wchar_t *__restrict, const wchar_t *__restrict, wchar_t **__restrict); +wchar_t *wmemchr(const wchar_t *, wchar_t, size_t); + +size_t wcslen(const wchar_t *); +wchar_t *wmemset(wchar_t *, wchar_t, size_t); + +// [7.28.5] Wide date/time functions + +/* POSIX says: + * The tag tm is declared as naming an incomplete structure type, the contents of which are + * described in the header <time.h>. */ +struct tm; +size_t wcsftime(wchar_t *__restrict, size_t, const wchar_t *__restrict, + const struct tm *__restrict); + +// [7.28.6] Wide conversion functions + +wint_t btowc(int c); +int wctob(wint_t); + +int mbsinit(const mbstate_t *); +size_t mbrlen(const char *__restrict, size_t, mbstate_t *__restrict); +size_t mbrtowc(wchar_t *__restrict, const char *__restrict, size_t, mbstate_t *__restrict); +size_t wcrtomb(char *__restrict, wchar_t, mbstate_t *__restrict); +size_t mbsrtowcs(wchar_t *__restrict, const char **__restrict, size_t, mbstate_t *__restrict); +size_t mbsnrtowcs(wchar_t *__restrict, const char **__restrict, size_t, size_t, mbstate_t *__restrict); +size_t wcsrtombs(char *__restrict, const wchar_t **__restrict, size_t, mbstate_t *__restrict); +size_t wcsnrtombs(char *__restrict, const wchar_t **__restrict, size_t, size_t, mbstate_t *__restrict); + +// POSIX extensions +int wcwidth(wchar_t wc); +int wcswidth(const wchar_t *, size_t); +wchar_t *wcsdup(const wchar_t *s); +int wcsncasecmp(const wchar_t*, const wchar_t*, size_t); +int wcscasecmp(const wchar_t *, const wchar_t *); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#endif // _WCHAR_H diff --git a/lib/mlibc/options/ansi/include/wctype.h b/lib/mlibc/options/ansi/include/wctype.h new file mode 100644 index 0000000..df5d37a --- /dev/null +++ b/lib/mlibc/options/ansi/include/wctype.h @@ -0,0 +1,52 @@ +#ifndef _WCTYPE_H +#define _WCTYPE_H + +#include <mlibc-config.h> +#include <bits/wint_t.h> + +#ifdef __cplusplus +extern "C" { +#endif + +typedef unsigned long wctype_t; +typedef unsigned long wctrans_t; + +#ifndef __MLIBC_ABI_ONLY + +// [C11/7.30.2.2] Extensible wide character classification functions. + +int iswalnum(wint_t); +int iswalpha(wint_t); +int iswblank(wint_t); +int iswcntrl(wint_t); +int iswdigit(wint_t); +int iswgraph(wint_t); +int iswlower(wint_t); +int iswprint(wint_t); +int iswpunct(wint_t); +int iswspace(wint_t); +int iswupper(wint_t); +int iswxdigit(wint_t); + +wctype_t wctype(const char *); +int iswctype(wint_t, wctype_t); + +// [C11/7.30.3] Wide character case mapping utilities. + +wint_t towlower(wint_t); +wint_t towupper(wint_t); + +wctrans_t wctrans(const char *); +wint_t towctrans(wint_t, wctrans_t); + +#endif /* !__MLIBC_ABI_ONLY */ + +#ifdef __cplusplus +} +#endif + +#if __MLIBC_POSIX_OPTION +# include <bits/posix/posix_wctype.h> +#endif + +#endif // _WCTYPE_H diff --git a/lib/mlibc/options/ansi/meson.build b/lib/mlibc/options/ansi/meson.build new file mode 100644 index 0000000..ae1d3ad --- /dev/null +++ b/lib/mlibc/options/ansi/meson.build @@ -0,0 +1,326 @@ + +if disable_ansi_option + subdir_done() +endif + +ansi_sources = files( + 'generic/stdlib-stubs.cpp', + 'generic/assert-stubs.cpp', + 'generic/complex-stubs.c', + + 'generic/complex/csqrt.c', + 'generic/complex/csinhf.c', + 'generic/complex/ccoshf.c', + 'generic/complex/cacosh.c', + 'generic/complex/casinf.c', + 'generic/complex/clogf.c', + 'generic/complex/csqrtf.c', + 'generic/complex/cimag.c', + 'generic/complex/catanh.c', + 'generic/complex/carg.c', + 'generic/complex/cproj.c', + 'generic/complex/cephes_subr.c', + 'generic/complex/ccos.c', + 'generic/complex/cexp.c', + 'generic/complex/crealf.c', + 'generic/complex/cabs.c', + 'generic/complex/csinh.c', + 'generic/complex/casinhf.c', + 'generic/complex/cephes_subrf.c', + 'generic/complex/creal.c', + 'generic/complex/casin.c', + 'generic/complex/conjf.c', + 'generic/complex/cpowf.c', + 'generic/complex/cacosf.c', + 'generic/complex/csinf.c', + 'generic/complex/ctanh.c', + 'generic/complex/ctanhf.c', + 'generic/complex/cargf.c', + 'generic/complex/cabsf.c', + 'generic/complex/cpow.c', + 'generic/complex/csin.c', + 'generic/complex/cprojf.c', + 'generic/complex/catan.c', + 'generic/complex/ctanf.c', + 'generic/complex/ctan.c', + 'generic/complex/clog.c', + 'generic/complex/catanf.c', + 'generic/complex/cacos.c', + 'generic/complex/cexpf.c', + 'generic/complex/ccosh.c', + 'generic/complex/cimagf.c', + 'generic/complex/cacoshf.c', + 'generic/complex/conj.c', + 'generic/complex/catanhf.c', + 'generic/complex/ccosf.c', + 'generic/complex/casinh.c', + + 'generic/ctype-stubs.cpp', + 'generic/environment.cpp', + 'generic/errno-stubs.cpp', + 'generic/fenv-stubs.cpp', + 'generic/file-io.cpp', + 'generic/inttypes-stubs.cpp', + 'generic/locale-stubs.cpp', + 'generic/signal-stubs.cpp', + 'generic/stdio-stubs.cpp', + 'generic/stdlib-stubs.cpp', + 'generic/string-stubs.cpp', + 'generic/threads.cpp', + 'generic/time-stubs.cpp', + 'generic/uchar.cpp', + 'generic/wchar-stubs.cpp', + 'generic/wctype.cpp', +) + +if not no_headers + install_headers( + 'include/alloca.h', + 'include/assert.h', + 'include/complex.h', + 'include/ctype.h', + 'include/errno.h', + 'include/fenv.h', + 'include/inttypes.h', + 'include/limits.h', + 'include/locale.h', + 'include/math.h', + 'include/setjmp.h', + 'include/signal.h', + 'include/stdc-predef.h', + 'include/stdio.h', + 'include/stdlib.h', + 'include/string.h', + 'include/threads.h', + 'include/time.h', + 'include/uchar.h', + 'include/wchar.h', + 'include/wctype.h', + ) + install_headers( + 'include/bits/ansi/timespec.h', + 'include/bits/ansi/time_t.h', + 'include/bits/ansi/fenv.h', + subdir: 'bits/ansi' + ) +endif + +if not headers_only + libc_sublibs += static_library('mlibc-musl-math', + 'musl-generic-math/acos.c', + 'musl-generic-math/acosf.c', + 'musl-generic-math/acosh.c', + 'musl-generic-math/acoshf.c', + 'musl-generic-math/acoshl.c', + 'musl-generic-math/acosl.c', + 'musl-generic-math/asin.c', + 'musl-generic-math/asinf.c', + 'musl-generic-math/asinh.c', + 'musl-generic-math/asinhf.c', + 'musl-generic-math/asinhl.c', + 'musl-generic-math/asinl.c', + 'musl-generic-math/atan2.c', + 'musl-generic-math/atan2f.c', + 'musl-generic-math/atan2l.c', + 'musl-generic-math/atan.c', + 'musl-generic-math/atanf.c', + 'musl-generic-math/atanh.c', + 'musl-generic-math/atanhf.c', + 'musl-generic-math/atanhl.c', + 'musl-generic-math/atanl.c', + 'musl-generic-math/cbrt.c', + 'musl-generic-math/cbrtf.c', + 'musl-generic-math/cbrtl.c', + 'musl-generic-math/ceil.c', + 'musl-generic-math/ceilf.c', + 'musl-generic-math/ceill.c', + 'musl-generic-math/copysign.c', + 'musl-generic-math/copysignf.c', + 'musl-generic-math/copysignl.c', + 'musl-generic-math/__cos.c', + 'musl-generic-math/cos.c', + 'musl-generic-math/__cosdf.c', + 'musl-generic-math/cosf.c', + 'musl-generic-math/cosh.c', + 'musl-generic-math/coshf.c', + 'musl-generic-math/coshl.c', + 'musl-generic-math/__cosl.c', + 'musl-generic-math/cosl.c', + 'musl-generic-math/erf.c', + 'musl-generic-math/erff.c', + 'musl-generic-math/erfl.c', + 'musl-generic-math/exp10.c', + 'musl-generic-math/exp10f.c', + 'musl-generic-math/exp10l.c', + 'musl-generic-math/exp2.c', + 'musl-generic-math/exp2f.c', + 'musl-generic-math/exp2l.c', + 'musl-generic-math/exp.c', + 'musl-generic-math/expf.c', + 'musl-generic-math/expl.c', + 'musl-generic-math/expm1.c', + 'musl-generic-math/expm1f.c', + 'musl-generic-math/expm1l.c', + 'musl-generic-math/__expo2.c', + 'musl-generic-math/__expo2f.c', + 'musl-generic-math/fabs.c', + 'musl-generic-math/fabsf.c', + 'musl-generic-math/fabsl.c', + 'musl-generic-math/fdim.c', + 'musl-generic-math/fdimf.c', + 'musl-generic-math/fdiml.c', + 'musl-generic-math/finite.c', + 'musl-generic-math/finitef.c', + 'musl-generic-math/floor.c', + 'musl-generic-math/floorf.c', + 'musl-generic-math/floorl.c', + 'musl-generic-math/fma.c', + 'musl-generic-math/fmaf.c', + 'musl-generic-math/fmal.c', + 'musl-generic-math/fmax.c', + 'musl-generic-math/fmaxf.c', + 'musl-generic-math/fmaxl.c', + 'musl-generic-math/fmin.c', + 'musl-generic-math/fminf.c', + 'musl-generic-math/fminl.c', + 'musl-generic-math/fmod.c', + 'musl-generic-math/fmodf.c', + 'musl-generic-math/fmodl.c', + 'musl-generic-math/__fpclassify.c', + 'musl-generic-math/__fpclassifyf.c', + 'musl-generic-math/__fpclassifyl.c', + 'musl-generic-math/frexp.c', + 'musl-generic-math/frexpf.c', + 'musl-generic-math/frexpl.c', + 'musl-generic-math/hypot.c', + 'musl-generic-math/hypotf.c', + 'musl-generic-math/hypotl.c', + 'musl-generic-math/ilogb.c', + 'musl-generic-math/ilogbf.c', + 'musl-generic-math/ilogbl.c', + 'musl-generic-math/__invtrigl.c', + 'musl-generic-math/j0.c', + 'musl-generic-math/j0f.c', + 'musl-generic-math/j1.c', + 'musl-generic-math/j1f.c', + 'musl-generic-math/jn.c', + 'musl-generic-math/jnf.c', + 'musl-generic-math/ldexp.c', + 'musl-generic-math/ldexpf.c', + 'musl-generic-math/ldexpl.c', + 'musl-generic-math/lgamma.c', + 'musl-generic-math/lgammaf.c', + 'musl-generic-math/lgammaf_r.c', + 'musl-generic-math/lgammal.c', + 'musl-generic-math/lgamma_r.c', + 'musl-generic-math/llrint.c', + 'musl-generic-math/llrintf.c', + 'musl-generic-math/llrintl.c', + 'musl-generic-math/llround.c', + 'musl-generic-math/llroundf.c', + 'musl-generic-math/llroundl.c', + 'musl-generic-math/log10.c', + 'musl-generic-math/log10f.c', + 'musl-generic-math/log10l.c', + 'musl-generic-math/log1p.c', + 'musl-generic-math/log1pf.c', + 'musl-generic-math/log1pl.c', + 'musl-generic-math/log2.c', + 'musl-generic-math/log2f.c', + 'musl-generic-math/log2l.c', + 'musl-generic-math/logb.c', + 'musl-generic-math/logbf.c', + 'musl-generic-math/logbl.c', + 'musl-generic-math/log.c', + 'musl-generic-math/logf.c', + 'musl-generic-math/logl.c', + 'musl-generic-math/lrint.c', + 'musl-generic-math/lrintf.c', + 'musl-generic-math/lrintl.c', + 'musl-generic-math/lround.c', + 'musl-generic-math/lroundf.c', + 'musl-generic-math/lroundl.c', + 'musl-generic-math/modf.c', + 'musl-generic-math/modff.c', + 'musl-generic-math/modfl.c', + 'musl-generic-math/nan.c', + 'musl-generic-math/nanf.c', + 'musl-generic-math/nanl.c', + 'musl-generic-math/nearbyint.c', + 'musl-generic-math/nearbyintf.c', + 'musl-generic-math/nearbyintl.c', + 'musl-generic-math/nextafter.c', + 'musl-generic-math/nextafterf.c', + 'musl-generic-math/nextafterl.c', + 'musl-generic-math/nexttoward.c', + 'musl-generic-math/nexttowardf.c', + 'musl-generic-math/nexttowardl.c', + 'musl-generic-math/__polevll.c', + 'musl-generic-math/pow.c', + 'musl-generic-math/powf.c', + 'musl-generic-math/powl.c', + 'musl-generic-math/remainder.c', + 'musl-generic-math/remainderf.c', + 'musl-generic-math/remainderl.c', + 'musl-generic-math/__rem_pio2.c', + 'musl-generic-math/__rem_pio2f.c', + 'musl-generic-math/__rem_pio2_large.c', + 'musl-generic-math/__rem_pio2l.c', + 'musl-generic-math/remquo.c', + 'musl-generic-math/remquof.c', + 'musl-generic-math/remquol.c', + 'musl-generic-math/rint.c', + 'musl-generic-math/rintf.c', + 'musl-generic-math/rintl.c', + 'musl-generic-math/round.c', + 'musl-generic-math/roundf.c', + 'musl-generic-math/roundl.c', + 'musl-generic-math/scalb.c', + 'musl-generic-math/scalbf.c', + 'musl-generic-math/scalbln.c', + 'musl-generic-math/scalblnf.c', + 'musl-generic-math/scalblnl.c', + 'musl-generic-math/scalbn.c', + 'musl-generic-math/scalbnf.c', + 'musl-generic-math/scalbnl.c', + 'musl-generic-math/__signbit.c', + 'musl-generic-math/__signbitf.c', + 'musl-generic-math/__signbitl.c', + 'musl-generic-math/signgam.c', + 'musl-generic-math/significand.c', + 'musl-generic-math/significandf.c', + 'musl-generic-math/__sin.c', + 'musl-generic-math/sin.c', + 'musl-generic-math/sincos.c', + 'musl-generic-math/sincosf.c', + 'musl-generic-math/sincosl.c', + 'musl-generic-math/__sindf.c', + 'musl-generic-math/sinf.c', + 'musl-generic-math/sinh.c', + 'musl-generic-math/sinhf.c', + 'musl-generic-math/sinhl.c', + 'musl-generic-math/__sinl.c', + 'musl-generic-math/sinl.c', + 'musl-generic-math/sqrt.c', + 'musl-generic-math/sqrtf.c', + 'musl-generic-math/sqrtl.c', + 'musl-generic-math/__tan.c', + 'musl-generic-math/tan.c', + 'musl-generic-math/__tandf.c', + 'musl-generic-math/tanf.c', + 'musl-generic-math/tanh.c', + 'musl-generic-math/tanhf.c', + 'musl-generic-math/tanhl.c', + 'musl-generic-math/__tanl.c', + 'musl-generic-math/tanl.c', + 'musl-generic-math/tgamma.c', + 'musl-generic-math/tgammaf.c', + 'musl-generic-math/tgammal.c', + 'musl-generic-math/trunc.c', + 'musl-generic-math/truncf.c', + 'musl-generic-math/truncl.c', + pic: true, + include_directories: libc_include_dirs, + dependencies: libc_deps, + c_args: ['-Wno-unused', '-Wno-implicit', '-Wno-parentheses', '-Wno-sign-compare', '-Wno-attributes', '-Wno-unknown-pragmas', '-Wno-maybe-uninitialized']) +endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__cos.c b/lib/mlibc/options/ansi/musl-generic-math/__cos.c new file mode 100644 index 0000000..46cefb3 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__cos.c @@ -0,0 +1,71 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_cos.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * __cos( x, y ) + * kernel cos function on [-pi/4, pi/4], pi/4 ~ 0.785398164 + * Input x is assumed to be bounded by ~pi/4 in magnitude. + * Input y is the tail of x. + * + * Algorithm + * 1. Since cos(-x) = cos(x), we need only to consider positive x. + * 2. if x < 2^-27 (hx<0x3e400000 0), return 1 with inexact if x!=0. + * 3. cos(x) is approximated by a polynomial of degree 14 on + * [0,pi/4] + * 4 14 + * cos(x) ~ 1 - x*x/2 + C1*x + ... + C6*x + * where the remez error is + * + * | 2 4 6 8 10 12 14 | -58 + * |cos(x)-(1-.5*x +C1*x +C2*x +C3*x +C4*x +C5*x +C6*x )| <= 2 + * | | + * + * 4 6 8 10 12 14 + * 4. let r = C1*x +C2*x +C3*x +C4*x +C5*x +C6*x , then + * cos(x) ~ 1 - x*x/2 + r + * since cos(x+y) ~ cos(x) - sin(x)*y + * ~ cos(x) - x*y, + * a correction term is necessary in cos(x) and hence + * cos(x+y) = 1 - (x*x/2 - (r - x*y)) + * For better accuracy, rearrange to + * cos(x+y) ~ w + (tmp + (r-x*y)) + * where w = 1 - x*x/2 and tmp is a tiny correction term + * (1 - x*x/2 == w + tmp exactly in infinite precision). + * The exactness of w + tmp in infinite precision depends on w + * and tmp having the same precision as x. If they have extra + * precision due to compiler bugs, then the extra precision is + * only good provided it is retained in all terms of the final + * expression for cos(). Retention happens in all cases tested + * under FreeBSD, so don't pessimize things by forcibly clipping + * any extra precision in w. + */ + +#include "libm.h" + +static const double +C1 = 4.16666666666666019037e-02, /* 0x3FA55555, 0x5555554C */ +C2 = -1.38888888888741095749e-03, /* 0xBF56C16C, 0x16C15177 */ +C3 = 2.48015872894767294178e-05, /* 0x3EFA01A0, 0x19CB1590 */ +C4 = -2.75573143513906633035e-07, /* 0xBE927E4F, 0x809C52AD */ +C5 = 2.08757232129817482790e-09, /* 0x3E21EE9E, 0xBDB4B1C4 */ +C6 = -1.13596475577881948265e-11; /* 0xBDA8FAE9, 0xBE8838D4 */ + +double __cos(double x, double y) +{ + double_t hz,z,r,w; + + z = x*x; + w = z*z; + r = z*(C1+z*(C2+z*C3)) + w*w*(C4+z*(C5+z*C6)); + hz = 0.5*z; + w = 1.0-hz; + return w + (((1.0-w)-hz) + (z*r-x*y)); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__cosdf.c b/lib/mlibc/options/ansi/musl-generic-math/__cosdf.c new file mode 100644 index 0000000..2124989 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__cosdf.c @@ -0,0 +1,35 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_cosf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Debugged and optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* |cos(x) - c(x)| < 2**-34.1 (~[-5.37e-11, 5.295e-11]). */ +static const double +C0 = -0x1ffffffd0c5e81.0p-54, /* -0.499999997251031003120 */ +C1 = 0x155553e1053a42.0p-57, /* 0.0416666233237390631894 */ +C2 = -0x16c087e80f1e27.0p-62, /* -0.00138867637746099294692 */ +C3 = 0x199342e0ee5069.0p-68; /* 0.0000243904487962774090654 */ + +float __cosdf(double x) +{ + double_t r, w, z; + + /* Try to optimize for parallel evaluation as in __tandf.c. */ + z = x*x; + w = z*z; + r = C2+z*C3; + return ((1.0+z*C0) + w*C1) + (w*z)*r; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__cosl.c b/lib/mlibc/options/ansi/musl-generic-math/__cosl.c new file mode 100644 index 0000000..fa522dd --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__cosl.c @@ -0,0 +1,96 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/k_cosl.c */ +/* origin: FreeBSD /usr/src/lib/msun/ld128/k_cosl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * Copyright (c) 2008 Steven G. Kargl, David Schultz, Bruce D. Evans. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + + +#include "libm.h" + +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#if LDBL_MANT_DIG == 64 +/* + * ld80 version of __cos.c. See __cos.c for most comments. + */ +/* + * Domain [-0.7854, 0.7854], range ~[-2.43e-23, 2.425e-23]: + * |cos(x) - c(x)| < 2**-75.1 + * + * The coefficients of c(x) were generated by a pari-gp script using + * a Remez algorithm that searches for the best higher coefficients + * after rounding leading coefficients to a specified precision. + * + * Simpler methods like Chebyshev or basic Remez barely suffice for + * cos() in 64-bit precision, because we want the coefficient of x^2 + * to be precisely -0.5 so that multiplying by it is exact, and plain + * rounding of the coefficients of a good polynomial approximation only + * gives this up to about 64-bit precision. Plain rounding also gives + * a mediocre approximation for the coefficient of x^4, but a rounding + * error of 0.5 ulps for this coefficient would only contribute ~0.01 + * ulps to the final error, so this is unimportant. Rounding errors in + * higher coefficients are even less important. + * + * In fact, coefficients above the x^4 one only need to have 53-bit + * precision, and this is more efficient. We get this optimization + * almost for free from the complications needed to search for the best + * higher coefficients. + */ +static const long double +C1 = 0.0416666666666666666136L; /* 0xaaaaaaaaaaaaaa9b.0p-68 */ +static const double +C2 = -0.0013888888888888874, /* -0x16c16c16c16c10.0p-62 */ +C3 = 0.000024801587301571716, /* 0x1a01a01a018e22.0p-68 */ +C4 = -0.00000027557319215507120, /* -0x127e4fb7602f22.0p-74 */ +C5 = 0.0000000020876754400407278, /* 0x11eed8caaeccf1.0p-81 */ +C6 = -1.1470297442401303e-11, /* -0x19393412bd1529.0p-89 */ +C7 = 4.7383039476436467e-14; /* 0x1aac9d9af5c43e.0p-97 */ +#define POLY(z) (z*(C1+z*(C2+z*(C3+z*(C4+z*(C5+z*(C6+z*C7))))))) +#elif LDBL_MANT_DIG == 113 +/* + * ld128 version of __cos.c. See __cos.c for most comments. + */ +/* + * Domain [-0.7854, 0.7854], range ~[-1.80e-37, 1.79e-37]: + * |cos(x) - c(x))| < 2**-122.0 + * + * 113-bit precision requires more care than 64-bit precision, since + * simple methods give a minimax polynomial with coefficient for x^2 + * that is 1 ulp below 0.5, but we want it to be precisely 0.5. See + * above for more details. + */ +static const long double +C1 = 0.04166666666666666666666666666666658424671L, +C2 = -0.001388888888888888888888888888863490893732L, +C3 = 0.00002480158730158730158730158600795304914210L, +C4 = -0.2755731922398589065255474947078934284324e-6L, +C5 = 0.2087675698786809897659225313136400793948e-8L, +C6 = -0.1147074559772972315817149986812031204775e-10L, +C7 = 0.4779477332386808976875457937252120293400e-13L; +static const double +C8 = -0.1561920696721507929516718307820958119868e-15, +C9 = 0.4110317413744594971475941557607804508039e-18, +C10 = -0.8896592467191938803288521958313920156409e-21, +C11 = 0.1601061435794535138244346256065192782581e-23; +#define POLY(z) (z*(C1+z*(C2+z*(C3+z*(C4+z*(C5+z*(C6+z*(C7+ \ + z*(C8+z*(C9+z*(C10+z*C11))))))))))) +#endif + +long double __cosl(long double x, long double y) +{ + long double hz,z,r,w; + + z = x*x; + r = POLY(z); + hz = 0.5*z; + w = 1.0-hz; + return w + (((1.0-w)-hz) + (z*r-x*y)); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__expo2.c b/lib/mlibc/options/ansi/musl-generic-math/__expo2.c new file mode 100644 index 0000000..740ac68 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__expo2.c @@ -0,0 +1,16 @@ +#include "libm.h" + +/* k is such that k*ln2 has minimal relative error and x - kln2 > log(DBL_MIN) */ +static const int k = 2043; +static const double kln2 = 0x1.62066151add8bp+10; + +/* exp(x)/2 for x >= log(DBL_MAX), slightly better than 0.5*exp(x/2)*exp(x/2) */ +double __expo2(double x) +{ + double scale; + + /* note that k is odd and scale*scale overflows */ + INSERT_WORDS(scale, (uint32_t)(0x3ff + k/2) << 20, 0); + /* exp(x - k ln2) * 2**(k-1) */ + return exp(x - kln2) * scale * scale; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__expo2f.c b/lib/mlibc/options/ansi/musl-generic-math/__expo2f.c new file mode 100644 index 0000000..5163e41 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__expo2f.c @@ -0,0 +1,16 @@ +#include "libm.h" + +/* k is such that k*ln2 has minimal relative error and x - kln2 > log(FLT_MIN) */ +static const int k = 235; +static const float kln2 = 0x1.45c778p+7f; + +/* expf(x)/2 for x >= log(FLT_MAX), slightly better than 0.5f*expf(x/2)*expf(x/2) */ +float __expo2f(float x) +{ + float scale; + + /* note that k is odd and scale*scale overflows */ + SET_FLOAT_WORD(scale, (uint32_t)(0x7f + k/2) << 23); + /* exp(x - k ln2) * 2**(k-1) */ + return expf(x - kln2) * scale * scale; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__fpclassify.c b/lib/mlibc/options/ansi/musl-generic-math/__fpclassify.c new file mode 100644 index 0000000..f7c0e2d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__fpclassify.c @@ -0,0 +1,11 @@ +#include <math.h> +#include <stdint.h> + +int __fpclassify(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i>>52 & 0x7ff; + if (!e) return u.i<<1 ? FP_SUBNORMAL : FP_ZERO; + if (e==0x7ff) return u.i<<12 ? FP_NAN : FP_INFINITE; + return FP_NORMAL; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__fpclassifyf.c b/lib/mlibc/options/ansi/musl-generic-math/__fpclassifyf.c new file mode 100644 index 0000000..fd00eb1 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__fpclassifyf.c @@ -0,0 +1,11 @@ +#include <math.h> +#include <stdint.h> + +int __fpclassifyf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = u.i>>23 & 0xff; + if (!e) return u.i<<1 ? FP_SUBNORMAL : FP_ZERO; + if (e==0xff) return u.i<<9 ? FP_NAN : FP_INFINITE; + return FP_NORMAL; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__fpclassifyl.c b/lib/mlibc/options/ansi/musl-generic-math/__fpclassifyl.c new file mode 100644 index 0000000..481c0b9 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__fpclassifyl.c @@ -0,0 +1,34 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +int __fpclassifyl(long double x) +{ + return __fpclassify(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +int __fpclassifyl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + int msb = u.i.m>>63; + if (!e && !msb) + return u.i.m ? FP_SUBNORMAL : FP_ZERO; + if (!msb) + return FP_NAN; + if (e == 0x7fff) + return u.i.m << 1 ? FP_NAN : FP_INFINITE; + return FP_NORMAL; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +int __fpclassifyl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + u.i.se = 0; + if (!e) + return u.i2.lo | u.i2.hi ? FP_SUBNORMAL : FP_ZERO; + if (e == 0x7fff) + return u.i2.lo | u.i2.hi ? FP_NAN : FP_INFINITE; + return FP_NORMAL; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__invtrigl.c b/lib/mlibc/options/ansi/musl-generic-math/__invtrigl.c new file mode 100644 index 0000000..48f83aa --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__invtrigl.c @@ -0,0 +1,63 @@ +#include <float.h> +#include "__invtrigl.h" + +#if LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +static const long double +pS0 = 1.66666666666666666631e-01L, +pS1 = -4.16313987993683104320e-01L, +pS2 = 3.69068046323246813704e-01L, +pS3 = -1.36213932016738603108e-01L, +pS4 = 1.78324189708471965733e-02L, +pS5 = -2.19216428382605211588e-04L, +pS6 = -7.10526623669075243183e-06L, +qS1 = -2.94788392796209867269e+00L, +qS2 = 3.27309890266528636716e+00L, +qS3 = -1.68285799854822427013e+00L, +qS4 = 3.90699412641738801874e-01L, +qS5 = -3.14365703596053263322e-02L; + +const long double pio2_hi = 1.57079632679489661926L; +const long double pio2_lo = -2.50827880633416601173e-20L; + +/* used in asinl() and acosl() */ +/* R(x^2) is a rational approximation of (asin(x)-x)/x^3 with Remez algorithm */ +long double __invtrigl_R(long double z) +{ + long double p, q; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*(pS5+z*pS6)))))); + q = 1.0+z*(qS1+z*(qS2+z*(qS3+z*(qS4+z*qS5)))); + return p/q; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +static const long double +pS0 = 1.66666666666666666666666666666700314e-01L, +pS1 = -7.32816946414566252574527475428622708e-01L, +pS2 = 1.34215708714992334609030036562143589e+00L, +pS3 = -1.32483151677116409805070261790752040e+00L, +pS4 = 7.61206183613632558824485341162121989e-01L, +pS5 = -2.56165783329023486777386833928147375e-01L, +pS6 = 4.80718586374448793411019434585413855e-02L, +pS7 = -4.42523267167024279410230886239774718e-03L, +pS8 = 1.44551535183911458253205638280410064e-04L, +pS9 = -2.10558957916600254061591040482706179e-07L, +qS1 = -4.84690167848739751544716485245697428e+00L, +qS2 = 9.96619113536172610135016921140206980e+00L, +qS3 = -1.13177895428973036660836798461641458e+01L, +qS4 = 7.74004374389488266169304117714658761e+00L, +qS5 = -3.25871986053534084709023539900339905e+00L, +qS6 = 8.27830318881232209752469022352928864e-01L, +qS7 = -1.18768052702942805423330715206348004e-01L, +qS8 = 8.32600764660522313269101537926539470e-03L, +qS9 = -1.99407384882605586705979504567947007e-04L; + +const long double pio2_hi = 1.57079632679489661923132169163975140L; +const long double pio2_lo = 4.33590506506189051239852201302167613e-35L; + +long double __invtrigl_R(long double z) +{ + long double p, q; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*(pS5+z*(pS6+z*(pS7+z*(pS8+z*pS9))))))))); + q = 1.0+z*(qS1+z*(qS2+z*(qS3+z*(qS4+z*(qS5+z*(qS6+z*(qS7+z*(qS8+z*qS9)))))))); + return p/q; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__invtrigl.h b/lib/mlibc/options/ansi/musl-generic-math/__invtrigl.h new file mode 100644 index 0000000..6dedac3 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__invtrigl.h @@ -0,0 +1,11 @@ +/* shared by acosl, asinl and atan2l */ +#define pio2_hi __pio2_hi +#define pio2_lo __pio2_lo + +#ifndef __MLIBC_ABI_ONLY + +extern const long double pio2_hi, pio2_lo; + +long double __invtrigl_R(long double z); + +#endif /* !__MLIBC_ABI_ONLY */ diff --git a/lib/mlibc/options/ansi/musl-generic-math/__polevll.c b/lib/mlibc/options/ansi/musl-generic-math/__polevll.c new file mode 100644 index 0000000..ce1a840 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__polevll.c @@ -0,0 +1,93 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/polevll.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Evaluate polynomial + * + * + * SYNOPSIS: + * + * int N; + * long double x, y, coef[N+1], polevl[]; + * + * y = polevll( x, coef, N ); + * + * + * DESCRIPTION: + * + * Evaluates polynomial of degree N: + * + * 2 N + * y = C + C x + C x +...+ C x + * 0 1 2 N + * + * Coefficients are stored in reverse order: + * + * coef[0] = C , ..., coef[N] = C . + * N 0 + * + * The function p1evll() assumes that coef[N] = 1.0 and is + * omitted from the array. Its calling arguments are + * otherwise the same as polevll(). + * + * + * SPEED: + * + * In the interest of speed, there are no checks for out + * of bounds arithmetic. This routine is used by most of + * the functions in the library. Depending on available + * equipment features, the user may wish to rewrite the + * program in microcode or assembly language. + * + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +#else +/* + * Polynomial evaluator: + * P[0] x^n + P[1] x^(n-1) + ... + P[n] + */ +long double __polevll(long double x, const long double *P, int n) +{ + long double y; + + y = *P++; + do { + y = y * x + *P++; + } while (--n); + + return y; +} + +/* + * Polynomial evaluator: + * x^n + P[0] x^(n-1) + P[1] x^(n-2) + ... + P[n] + */ +long double __p1evll(long double x, const long double *P, int n) +{ + long double y; + + n -= 1; + y = x + *P++; + do { + y = y * x + *P++; + } while (--n); + + return y; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2.c b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2.c new file mode 100644 index 0000000..d403f81 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2.c @@ -0,0 +1,177 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_rem_pio2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + * Optimized by Bruce D. Evans. + */ +/* __rem_pio2(x,y) + * + * return the remainder of x rem pi/2 in y[0]+y[1] + * use __rem_pio2_large() for large x + */ + +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif + +/* + * invpio2: 53 bits of 2/pi + * pio2_1: first 33 bit of pi/2 + * pio2_1t: pi/2 - pio2_1 + * pio2_2: second 33 bit of pi/2 + * pio2_2t: pi/2 - (pio2_1+pio2_2) + * pio2_3: third 33 bit of pi/2 + * pio2_3t: pi/2 - (pio2_1+pio2_2+pio2_3) + */ +static const double +toint = 1.5/EPS, +invpio2 = 6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */ +pio2_1 = 1.57079632673412561417e+00, /* 0x3FF921FB, 0x54400000 */ +pio2_1t = 6.07710050650619224932e-11, /* 0x3DD0B461, 0x1A626331 */ +pio2_2 = 6.07710050630396597660e-11, /* 0x3DD0B461, 0x1A600000 */ +pio2_2t = 2.02226624879595063154e-21, /* 0x3BA3198A, 0x2E037073 */ +pio2_3 = 2.02226624871116645580e-21, /* 0x3BA3198A, 0x2E000000 */ +pio2_3t = 8.47842766036889956997e-32; /* 0x397B839A, 0x252049C1 */ + +/* caller must handle the case when reduction is not needed: |x| ~<= pi/4 */ +int __rem_pio2(double x, double *y) +{ + union {double f; uint64_t i;} u = {x}; + double_t z,w,t,r,fn; + double tx[3],ty[2]; + uint32_t ix; + int sign, n, ex, ey, i; + + sign = u.i>>63; + ix = u.i>>32 & 0x7fffffff; + if (ix <= 0x400f6a7a) { /* |x| ~<= 5pi/4 */ + if ((ix & 0xfffff) == 0x921fb) /* |x| ~= pi/2 or 2pi/2 */ + goto medium; /* cancellation -- use medium case */ + if (ix <= 0x4002d97c) { /* |x| ~<= 3pi/4 */ + if (!sign) { + z = x - pio2_1; /* one round good to 85 bits */ + y[0] = z - pio2_1t; + y[1] = (z-y[0]) - pio2_1t; + return 1; + } else { + z = x + pio2_1; + y[0] = z + pio2_1t; + y[1] = (z-y[0]) + pio2_1t; + return -1; + } + } else { + if (!sign) { + z = x - 2*pio2_1; + y[0] = z - 2*pio2_1t; + y[1] = (z-y[0]) - 2*pio2_1t; + return 2; + } else { + z = x + 2*pio2_1; + y[0] = z + 2*pio2_1t; + y[1] = (z-y[0]) + 2*pio2_1t; + return -2; + } + } + } + if (ix <= 0x401c463b) { /* |x| ~<= 9pi/4 */ + if (ix <= 0x4015fdbc) { /* |x| ~<= 7pi/4 */ + if (ix == 0x4012d97c) /* |x| ~= 3pi/2 */ + goto medium; + if (!sign) { + z = x - 3*pio2_1; + y[0] = z - 3*pio2_1t; + y[1] = (z-y[0]) - 3*pio2_1t; + return 3; + } else { + z = x + 3*pio2_1; + y[0] = z + 3*pio2_1t; + y[1] = (z-y[0]) + 3*pio2_1t; + return -3; + } + } else { + if (ix == 0x401921fb) /* |x| ~= 4pi/2 */ + goto medium; + if (!sign) { + z = x - 4*pio2_1; + y[0] = z - 4*pio2_1t; + y[1] = (z-y[0]) - 4*pio2_1t; + return 4; + } else { + z = x + 4*pio2_1; + y[0] = z + 4*pio2_1t; + y[1] = (z-y[0]) + 4*pio2_1t; + return -4; + } + } + } + if (ix < 0x413921fb) { /* |x| ~< 2^20*(pi/2), medium size */ +medium: + /* rint(x/(pi/2)), Assume round-to-nearest. */ + fn = (double_t)x*invpio2 + toint - toint; + n = (int32_t)fn; + r = x - fn*pio2_1; + w = fn*pio2_1t; /* 1st round, good to 85 bits */ + y[0] = r - w; + u.f = y[0]; + ey = u.i>>52 & 0x7ff; + ex = ix>>20; + if (ex - ey > 16) { /* 2nd round, good to 118 bits */ + t = r; + w = fn*pio2_2; + r = t - w; + w = fn*pio2_2t - ((t-r)-w); + y[0] = r - w; + u.f = y[0]; + ey = u.i>>52 & 0x7ff; + if (ex - ey > 49) { /* 3rd round, good to 151 bits, covers all cases */ + t = r; + w = fn*pio2_3; + r = t - w; + w = fn*pio2_3t - ((t-r)-w); + y[0] = r - w; + } + } + y[1] = (r - y[0]) - w; + return n; + } + /* + * all other (large) arguments + */ + if (ix >= 0x7ff00000) { /* x is inf or NaN */ + y[0] = y[1] = x - x; + return 0; + } + /* set z = scalbn(|x|,-ilogb(x)+23) */ + u.f = x; + u.i &= (uint64_t)-1>>12; + u.i |= (uint64_t)(0x3ff + 23)<<52; + z = u.f; + for (i=0; i < 2; i++) { + tx[i] = (double)(int32_t)z; + z = (z-tx[i])*0x1p24; + } + tx[i] = z; + /* skip zero terms, first term is non-zero */ + while (tx[i] == 0.0) + i--; + n = __rem_pio2_large(tx,ty,(int)(ix>>20)-(0x3ff+23),i+1,1); + if (sign) { + y[0] = -ty[0]; + y[1] = -ty[1]; + return -n; + } + y[0] = ty[0]; + y[1] = ty[1]; + return n; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2_large.c b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2_large.c new file mode 100644 index 0000000..958f28c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2_large.c @@ -0,0 +1,442 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_rem_pio2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * __rem_pio2_large(x,y,e0,nx,prec) + * double x[],y[]; int e0,nx,prec; + * + * __rem_pio2_large return the last three digits of N with + * y = x - N*pi/2 + * so that |y| < pi/2. + * + * The method is to compute the integer (mod 8) and fraction parts of + * (2/pi)*x without doing the full multiplication. In general we + * skip the part of the product that are known to be a huge integer ( + * more accurately, = 0 mod 8 ). Thus the number of operations are + * independent of the exponent of the input. + * + * (2/pi) is represented by an array of 24-bit integers in ipio2[]. + * + * Input parameters: + * x[] The input value (must be positive) is broken into nx + * pieces of 24-bit integers in double precision format. + * x[i] will be the i-th 24 bit of x. The scaled exponent + * of x[0] is given in input parameter e0 (i.e., x[0]*2^e0 + * match x's up to 24 bits. + * + * Example of breaking a double positive z into x[0]+x[1]+x[2]: + * e0 = ilogb(z)-23 + * z = scalbn(z,-e0) + * for i = 0,1,2 + * x[i] = floor(z) + * z = (z-x[i])*2**24 + * + * + * y[] ouput result in an array of double precision numbers. + * The dimension of y[] is: + * 24-bit precision 1 + * 53-bit precision 2 + * 64-bit precision 2 + * 113-bit precision 3 + * The actual value is the sum of them. Thus for 113-bit + * precison, one may have to do something like: + * + * long double t,w,r_head, r_tail; + * t = (long double)y[2] + (long double)y[1]; + * w = (long double)y[0]; + * r_head = t+w; + * r_tail = w - (r_head - t); + * + * e0 The exponent of x[0]. Must be <= 16360 or you need to + * expand the ipio2 table. + * + * nx dimension of x[] + * + * prec an integer indicating the precision: + * 0 24 bits (single) + * 1 53 bits (double) + * 2 64 bits (extended) + * 3 113 bits (quad) + * + * External function: + * double scalbn(), floor(); + * + * + * Here is the description of some local variables: + * + * jk jk+1 is the initial number of terms of ipio2[] needed + * in the computation. The minimum and recommended value + * for jk is 3,4,4,6 for single, double, extended, and quad. + * jk+1 must be 2 larger than you might expect so that our + * recomputation test works. (Up to 24 bits in the integer + * part (the 24 bits of it that we compute) and 23 bits in + * the fraction part may be lost to cancelation before we + * recompute.) + * + * jz local integer variable indicating the number of + * terms of ipio2[] used. + * + * jx nx - 1 + * + * jv index for pointing to the suitable ipio2[] for the + * computation. In general, we want + * ( 2^e0*x[0] * ipio2[jv-1]*2^(-24jv) )/8 + * is an integer. Thus + * e0-3-24*jv >= 0 or (e0-3)/24 >= jv + * Hence jv = max(0,(e0-3)/24). + * + * jp jp+1 is the number of terms in PIo2[] needed, jp = jk. + * + * q[] double array with integral value, representing the + * 24-bits chunk of the product of x and 2/pi. + * + * q0 the corresponding exponent of q[0]. Note that the + * exponent for q[i] would be q0-24*i. + * + * PIo2[] double precision array, obtained by cutting pi/2 + * into 24 bits chunks. + * + * f[] ipio2[] in floating point + * + * iq[] integer array by breaking up q[] in 24-bits chunk. + * + * fq[] final product of x*(2/pi) in fq[0],..,fq[jk] + * + * ih integer. If >0 it indicates q[] is >= 0.5, hence + * it also indicates the *sign* of the result. + * + */ +/* + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "libm.h" + +static const int init_jk[] = {3,4,4,6}; /* initial value for jk */ + +/* + * Table of constants for 2/pi, 396 Hex digits (476 decimal) of 2/pi + * + * integer array, contains the (24*i)-th to (24*i+23)-th + * bit of 2/pi after binary point. The corresponding + * floating value is + * + * ipio2[i] * 2^(-24(i+1)). + * + * NB: This table must have at least (e0-3)/24 + jk terms. + * For quad precision (e0 <= 16360, jk = 6), this is 686. + */ +static const int32_t ipio2[] = { +0xA2F983, 0x6E4E44, 0x1529FC, 0x2757D1, 0xF534DD, 0xC0DB62, +0x95993C, 0x439041, 0xFE5163, 0xABDEBB, 0xC561B7, 0x246E3A, +0x424DD2, 0xE00649, 0x2EEA09, 0xD1921C, 0xFE1DEB, 0x1CB129, +0xA73EE8, 0x8235F5, 0x2EBB44, 0x84E99C, 0x7026B4, 0x5F7E41, +0x3991D6, 0x398353, 0x39F49C, 0x845F8B, 0xBDF928, 0x3B1FF8, +0x97FFDE, 0x05980F, 0xEF2F11, 0x8B5A0A, 0x6D1F6D, 0x367ECF, +0x27CB09, 0xB74F46, 0x3F669E, 0x5FEA2D, 0x7527BA, 0xC7EBE5, +0xF17B3D, 0x0739F7, 0x8A5292, 0xEA6BFB, 0x5FB11F, 0x8D5D08, +0x560330, 0x46FC7B, 0x6BABF0, 0xCFBC20, 0x9AF436, 0x1DA9E3, +0x91615E, 0xE61B08, 0x659985, 0x5F14A0, 0x68408D, 0xFFD880, +0x4D7327, 0x310606, 0x1556CA, 0x73A8C9, 0x60E27B, 0xC08C6B, + +#if LDBL_MAX_EXP > 1024 +0x47C419, 0xC367CD, 0xDCE809, 0x2A8359, 0xC4768B, 0x961CA6, +0xDDAF44, 0xD15719, 0x053EA5, 0xFF0705, 0x3F7E33, 0xE832C2, +0xDE4F98, 0x327DBB, 0xC33D26, 0xEF6B1E, 0x5EF89F, 0x3A1F35, +0xCAF27F, 0x1D87F1, 0x21907C, 0x7C246A, 0xFA6ED5, 0x772D30, +0x433B15, 0xC614B5, 0x9D19C3, 0xC2C4AD, 0x414D2C, 0x5D000C, +0x467D86, 0x2D71E3, 0x9AC69B, 0x006233, 0x7CD2B4, 0x97A7B4, +0xD55537, 0xF63ED7, 0x1810A3, 0xFC764D, 0x2A9D64, 0xABD770, +0xF87C63, 0x57B07A, 0xE71517, 0x5649C0, 0xD9D63B, 0x3884A7, +0xCB2324, 0x778AD6, 0x23545A, 0xB91F00, 0x1B0AF1, 0xDFCE19, +0xFF319F, 0x6A1E66, 0x615799, 0x47FBAC, 0xD87F7E, 0xB76522, +0x89E832, 0x60BFE6, 0xCDC4EF, 0x09366C, 0xD43F5D, 0xD7DE16, +0xDE3B58, 0x929BDE, 0x2822D2, 0xE88628, 0x4D58E2, 0x32CAC6, +0x16E308, 0xCB7DE0, 0x50C017, 0xA71DF3, 0x5BE018, 0x34132E, +0x621283, 0x014883, 0x5B8EF5, 0x7FB0AD, 0xF2E91E, 0x434A48, +0xD36710, 0xD8DDAA, 0x425FAE, 0xCE616A, 0xA4280A, 0xB499D3, +0xF2A606, 0x7F775C, 0x83C2A3, 0x883C61, 0x78738A, 0x5A8CAF, +0xBDD76F, 0x63A62D, 0xCBBFF4, 0xEF818D, 0x67C126, 0x45CA55, +0x36D9CA, 0xD2A828, 0x8D61C2, 0x77C912, 0x142604, 0x9B4612, +0xC459C4, 0x44C5C8, 0x91B24D, 0xF31700, 0xAD43D4, 0xE54929, +0x10D5FD, 0xFCBE00, 0xCC941E, 0xEECE70, 0xF53E13, 0x80F1EC, +0xC3E7B3, 0x28F8C7, 0x940593, 0x3E71C1, 0xB3092E, 0xF3450B, +0x9C1288, 0x7B20AB, 0x9FB52E, 0xC29247, 0x2F327B, 0x6D550C, +0x90A772, 0x1FE76B, 0x96CB31, 0x4A1679, 0xE27941, 0x89DFF4, +0x9794E8, 0x84E6E2, 0x973199, 0x6BED88, 0x365F5F, 0x0EFDBB, +0xB49A48, 0x6CA467, 0x427271, 0x325D8D, 0xB8159F, 0x09E5BC, +0x25318D, 0x3974F7, 0x1C0530, 0x010C0D, 0x68084B, 0x58EE2C, +0x90AA47, 0x02E774, 0x24D6BD, 0xA67DF7, 0x72486E, 0xEF169F, +0xA6948E, 0xF691B4, 0x5153D1, 0xF20ACF, 0x339820, 0x7E4BF5, +0x6863B2, 0x5F3EDD, 0x035D40, 0x7F8985, 0x295255, 0xC06437, +0x10D86D, 0x324832, 0x754C5B, 0xD4714E, 0x6E5445, 0xC1090B, +0x69F52A, 0xD56614, 0x9D0727, 0x50045D, 0xDB3BB4, 0xC576EA, +0x17F987, 0x7D6B49, 0xBA271D, 0x296996, 0xACCCC6, 0x5414AD, +0x6AE290, 0x89D988, 0x50722C, 0xBEA404, 0x940777, 0x7030F3, +0x27FC00, 0xA871EA, 0x49C266, 0x3DE064, 0x83DD97, 0x973FA3, +0xFD9443, 0x8C860D, 0xDE4131, 0x9D3992, 0x8C70DD, 0xE7B717, +0x3BDF08, 0x2B3715, 0xA0805C, 0x93805A, 0x921110, 0xD8E80F, +0xAF806C, 0x4BFFDB, 0x0F9038, 0x761859, 0x15A562, 0xBBCB61, +0xB989C7, 0xBD4010, 0x04F2D2, 0x277549, 0xF6B6EB, 0xBB22DB, +0xAA140A, 0x2F2689, 0x768364, 0x333B09, 0x1A940E, 0xAA3A51, +0xC2A31D, 0xAEEDAF, 0x12265C, 0x4DC26D, 0x9C7A2D, 0x9756C0, +0x833F03, 0xF6F009, 0x8C402B, 0x99316D, 0x07B439, 0x15200C, +0x5BC3D8, 0xC492F5, 0x4BADC6, 0xA5CA4E, 0xCD37A7, 0x36A9E6, +0x9492AB, 0x6842DD, 0xDE6319, 0xEF8C76, 0x528B68, 0x37DBFC, +0xABA1AE, 0x3115DF, 0xA1AE00, 0xDAFB0C, 0x664D64, 0xB705ED, +0x306529, 0xBF5657, 0x3AFF47, 0xB9F96A, 0xF3BE75, 0xDF9328, +0x3080AB, 0xF68C66, 0x15CB04, 0x0622FA, 0x1DE4D9, 0xA4B33D, +0x8F1B57, 0x09CD36, 0xE9424E, 0xA4BE13, 0xB52333, 0x1AAAF0, +0xA8654F, 0xA5C1D2, 0x0F3F0B, 0xCD785B, 0x76F923, 0x048B7B, +0x721789, 0x53A6C6, 0xE26E6F, 0x00EBEF, 0x584A9B, 0xB7DAC4, +0xBA66AA, 0xCFCF76, 0x1D02D1, 0x2DF1B1, 0xC1998C, 0x77ADC3, +0xDA4886, 0xA05DF7, 0xF480C6, 0x2FF0AC, 0x9AECDD, 0xBC5C3F, +0x6DDED0, 0x1FC790, 0xB6DB2A, 0x3A25A3, 0x9AAF00, 0x9353AD, +0x0457B6, 0xB42D29, 0x7E804B, 0xA707DA, 0x0EAA76, 0xA1597B, +0x2A1216, 0x2DB7DC, 0xFDE5FA, 0xFEDB89, 0xFDBE89, 0x6C76E4, +0xFCA906, 0x70803E, 0x156E85, 0xFF87FD, 0x073E28, 0x336761, +0x86182A, 0xEABD4D, 0xAFE7B3, 0x6E6D8F, 0x396795, 0x5BBF31, +0x48D784, 0x16DF30, 0x432DC7, 0x356125, 0xCE70C9, 0xB8CB30, +0xFD6CBF, 0xA200A4, 0xE46C05, 0xA0DD5A, 0x476F21, 0xD21262, +0x845CB9, 0x496170, 0xE0566B, 0x015299, 0x375550, 0xB7D51E, +0xC4F133, 0x5F6E13, 0xE4305D, 0xA92E85, 0xC3B21D, 0x3632A1, +0xA4B708, 0xD4B1EA, 0x21F716, 0xE4698F, 0x77FF27, 0x80030C, +0x2D408D, 0xA0CD4F, 0x99A520, 0xD3A2B3, 0x0A5D2F, 0x42F9B4, +0xCBDA11, 0xD0BE7D, 0xC1DB9B, 0xBD17AB, 0x81A2CA, 0x5C6A08, +0x17552E, 0x550027, 0xF0147F, 0x8607E1, 0x640B14, 0x8D4196, +0xDEBE87, 0x2AFDDA, 0xB6256B, 0x34897B, 0xFEF305, 0x9EBFB9, +0x4F6A68, 0xA82A4A, 0x5AC44F, 0xBCF82D, 0x985AD7, 0x95C7F4, +0x8D4D0D, 0xA63A20, 0x5F57A4, 0xB13F14, 0x953880, 0x0120CC, +0x86DD71, 0xB6DEC9, 0xF560BF, 0x11654D, 0x6B0701, 0xACB08C, +0xD0C0B2, 0x485551, 0x0EFB1E, 0xC37295, 0x3B06A3, 0x3540C0, +0x7BDC06, 0xCC45E0, 0xFA294E, 0xC8CAD6, 0x41F3E8, 0xDE647C, +0xD8649B, 0x31BED9, 0xC397A4, 0xD45877, 0xC5E369, 0x13DAF0, +0x3C3ABA, 0x461846, 0x5F7555, 0xF5BDD2, 0xC6926E, 0x5D2EAC, +0xED440E, 0x423E1C, 0x87C461, 0xE9FD29, 0xF3D6E7, 0xCA7C22, +0x35916F, 0xC5E008, 0x8DD7FF, 0xE26A6E, 0xC6FDB0, 0xC10893, +0x745D7C, 0xB2AD6B, 0x9D6ECD, 0x7B723E, 0x6A11C6, 0xA9CFF7, +0xDF7329, 0xBAC9B5, 0x5100B7, 0x0DB2E2, 0x24BA74, 0x607DE5, +0x8AD874, 0x2C150D, 0x0C1881, 0x94667E, 0x162901, 0x767A9F, +0xBEFDFD, 0xEF4556, 0x367ED9, 0x13D9EC, 0xB9BA8B, 0xFC97C4, +0x27A831, 0xC36EF1, 0x36C594, 0x56A8D8, 0xB5A8B4, 0x0ECCCF, +0x2D8912, 0x34576F, 0x89562C, 0xE3CE99, 0xB920D6, 0xAA5E6B, +0x9C2A3E, 0xCC5F11, 0x4A0BFD, 0xFBF4E1, 0x6D3B8E, 0x2C86E2, +0x84D4E9, 0xA9B4FC, 0xD1EEEF, 0xC9352E, 0x61392F, 0x442138, +0xC8D91B, 0x0AFC81, 0x6A4AFB, 0xD81C2F, 0x84B453, 0x8C994E, +0xCC2254, 0xDC552A, 0xD6C6C0, 0x96190B, 0xB8701A, 0x649569, +0x605A26, 0xEE523F, 0x0F117F, 0x11B5F4, 0xF5CBFC, 0x2DBC34, +0xEEBC34, 0xCC5DE8, 0x605EDD, 0x9B8E67, 0xEF3392, 0xB817C9, +0x9B5861, 0xBC57E1, 0xC68351, 0x103ED8, 0x4871DD, 0xDD1C2D, +0xA118AF, 0x462C21, 0xD7F359, 0x987AD9, 0xC0549E, 0xFA864F, +0xFC0656, 0xAE79E5, 0x362289, 0x22AD38, 0xDC9367, 0xAAE855, +0x382682, 0x9BE7CA, 0xA40D51, 0xB13399, 0x0ED7A9, 0x480569, +0xF0B265, 0xA7887F, 0x974C88, 0x36D1F9, 0xB39221, 0x4A827B, +0x21CF98, 0xDC9F40, 0x5547DC, 0x3A74E1, 0x42EB67, 0xDF9DFE, +0x5FD45E, 0xA4677B, 0x7AACBA, 0xA2F655, 0x23882B, 0x55BA41, +0x086E59, 0x862A21, 0x834739, 0xE6E389, 0xD49EE5, 0x40FB49, +0xE956FF, 0xCA0F1C, 0x8A59C5, 0x2BFA94, 0xC5C1D3, 0xCFC50F, +0xAE5ADB, 0x86C547, 0x624385, 0x3B8621, 0x94792C, 0x876110, +0x7B4C2A, 0x1A2C80, 0x12BF43, 0x902688, 0x893C78, 0xE4C4A8, +0x7BDBE5, 0xC23AC4, 0xEAF426, 0x8A67F7, 0xBF920D, 0x2BA365, +0xB1933D, 0x0B7CBD, 0xDC51A4, 0x63DD27, 0xDDE169, 0x19949A, +0x9529A8, 0x28CE68, 0xB4ED09, 0x209F44, 0xCA984E, 0x638270, +0x237C7E, 0x32B90F, 0x8EF5A7, 0xE75614, 0x08F121, 0x2A9DB5, +0x4D7E6F, 0x5119A5, 0xABF9B5, 0xD6DF82, 0x61DD96, 0x023616, +0x9F3AC4, 0xA1A283, 0x6DED72, 0x7A8D39, 0xA9B882, 0x5C326B, +0x5B2746, 0xED3400, 0x7700D2, 0x55F4FC, 0x4D5901, 0x8071E0, +#endif +}; + +static const double PIo2[] = { + 1.57079625129699707031e+00, /* 0x3FF921FB, 0x40000000 */ + 7.54978941586159635335e-08, /* 0x3E74442D, 0x00000000 */ + 5.39030252995776476554e-15, /* 0x3CF84698, 0x80000000 */ + 3.28200341580791294123e-22, /* 0x3B78CC51, 0x60000000 */ + 1.27065575308067607349e-29, /* 0x39F01B83, 0x80000000 */ + 1.22933308981111328932e-36, /* 0x387A2520, 0x40000000 */ + 2.73370053816464559624e-44, /* 0x36E38222, 0x80000000 */ + 2.16741683877804819444e-51, /* 0x3569F31D, 0x00000000 */ +}; + +int __rem_pio2_large(double *x, double *y, int e0, int nx, int prec) +{ + int32_t jz,jx,jv,jp,jk,carry,n,iq[20],i,j,k,m,q0,ih; + double z,fw,f[20],fq[20],q[20]; + + /* initialize jk*/ + jk = init_jk[prec]; + jp = jk; + + /* determine jx,jv,q0, note that 3>q0 */ + jx = nx-1; + jv = (e0-3)/24; if(jv<0) jv=0; + q0 = e0-24*(jv+1); + + /* set up f[0] to f[jx+jk] where f[jx+jk] = ipio2[jv+jk] */ + j = jv-jx; m = jx+jk; + for (i=0; i<=m; i++,j++) + f[i] = j<0 ? 0.0 : (double)ipio2[j]; + + /* compute q[0],q[1],...q[jk] */ + for (i=0; i<=jk; i++) { + for (j=0,fw=0.0; j<=jx; j++) + fw += x[j]*f[jx+i-j]; + q[i] = fw; + } + + jz = jk; +recompute: + /* distill q[] into iq[] reversingly */ + for (i=0,j=jz,z=q[jz]; j>0; i++,j--) { + fw = (double)(int32_t)(0x1p-24*z); + iq[i] = (int32_t)(z - 0x1p24*fw); + z = q[j-1]+fw; + } + + /* compute n */ + z = scalbn(z,q0); /* actual value of z */ + z -= 8.0*floor(z*0.125); /* trim off integer >= 8 */ + n = (int32_t)z; + z -= (double)n; + ih = 0; + if (q0 > 0) { /* need iq[jz-1] to determine n */ + i = iq[jz-1]>>(24-q0); n += i; + iq[jz-1] -= i<<(24-q0); + ih = iq[jz-1]>>(23-q0); + } + else if (q0 == 0) ih = iq[jz-1]>>23; + else if (z >= 0.5) ih = 2; + + if (ih > 0) { /* q > 0.5 */ + n += 1; carry = 0; + for (i=0; i<jz; i++) { /* compute 1-q */ + j = iq[i]; + if (carry == 0) { + if (j != 0) { + carry = 1; + iq[i] = 0x1000000 - j; + } + } else + iq[i] = 0xffffff - j; + } + if (q0 > 0) { /* rare case: chance is 1 in 12 */ + switch(q0) { + case 1: + iq[jz-1] &= 0x7fffff; break; + case 2: + iq[jz-1] &= 0x3fffff; break; + } + } + if (ih == 2) { + z = 1.0 - z; + if (carry != 0) + z -= scalbn(1.0,q0); + } + } + + /* check if recomputation is needed */ + if (z == 0.0) { + j = 0; + for (i=jz-1; i>=jk; i--) j |= iq[i]; + if (j == 0) { /* need recomputation */ + for (k=1; iq[jk-k]==0; k++); /* k = no. of terms needed */ + + for (i=jz+1; i<=jz+k; i++) { /* add q[jz+1] to q[jz+k] */ + f[jx+i] = (double)ipio2[jv+i]; + for (j=0,fw=0.0; j<=jx; j++) + fw += x[j]*f[jx+i-j]; + q[i] = fw; + } + jz += k; + goto recompute; + } + } + + /* chop off zero terms */ + if (z == 0.0) { + jz -= 1; + q0 -= 24; + while (iq[jz] == 0) { + jz--; + q0 -= 24; + } + } else { /* break z into 24-bit if necessary */ + z = scalbn(z,-q0); + if (z >= 0x1p24) { + fw = (double)(int32_t)(0x1p-24*z); + iq[jz] = (int32_t)(z - 0x1p24*fw); + jz += 1; + q0 += 24; + iq[jz] = (int32_t)fw; + } else + iq[jz] = (int32_t)z; + } + + /* convert integer "bit" chunk to floating-point value */ + fw = scalbn(1.0,q0); + for (i=jz; i>=0; i--) { + q[i] = fw*(double)iq[i]; + fw *= 0x1p-24; + } + + /* compute PIo2[0,...,jp]*q[jz,...,0] */ + for(i=jz; i>=0; i--) { + for (fw=0.0,k=0; k<=jp && k<=jz-i; k++) + fw += PIo2[k]*q[i+k]; + fq[jz-i] = fw; + } + + /* compress fq[] into y[] */ + switch(prec) { + case 0: + fw = 0.0; + for (i=jz; i>=0; i--) + fw += fq[i]; + y[0] = ih==0 ? fw : -fw; + break; + case 1: + case 2: + fw = 0.0; + for (i=jz; i>=0; i--) + fw += fq[i]; + // TODO: drop excess precision here once double_t is used + fw = (double)fw; + y[0] = ih==0 ? fw : -fw; + fw = fq[0]-fw; + for (i=1; i<=jz; i++) + fw += fq[i]; + y[1] = ih==0 ? fw : -fw; + break; + case 3: /* painful */ + for (i=jz; i>0; i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (i=jz; i>1; i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (fw=0.0,i=jz; i>=2; i--) + fw += fq[i]; + if (ih==0) { + y[0] = fq[0]; y[1] = fq[1]; y[2] = fw; + } else { + y[0] = -fq[0]; y[1] = -fq[1]; y[2] = -fw; + } + } + return n&7; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2f.c b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2f.c new file mode 100644 index 0000000..4473c1c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2f.c @@ -0,0 +1,75 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_rem_pio2f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Debugged and optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* __rem_pio2f(x,y) + * + * return the remainder of x rem pi/2 in *y + * use double precision for everything except passing x + * use __rem_pio2_large() for large x + */ + +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif + +/* + * invpio2: 53 bits of 2/pi + * pio2_1: first 25 bits of pi/2 + * pio2_1t: pi/2 - pio2_1 + */ +static const double +toint = 1.5/EPS, +invpio2 = 6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */ +pio2_1 = 1.57079631090164184570e+00, /* 0x3FF921FB, 0x50000000 */ +pio2_1t = 1.58932547735281966916e-08; /* 0x3E5110b4, 0x611A6263 */ + +int __rem_pio2f(float x, double *y) +{ + union {float f; uint32_t i;} u = {x}; + double tx[1],ty[1]; + double_t fn; + uint32_t ix; + int n, sign, e0; + + ix = u.i & 0x7fffffff; + /* 25+53 bit pi is good enough for medium size */ + if (ix < 0x4dc90fdb) { /* |x| ~< 2^28*(pi/2), medium size */ + /* Use a specialized rint() to get fn. Assume round-to-nearest. */ + fn = (double_t)x*invpio2 + toint - toint; + n = (int32_t)fn; + *y = x - fn*pio2_1 - fn*pio2_1t; + return n; + } + if(ix>=0x7f800000) { /* x is inf or NaN */ + *y = x-x; + return 0; + } + /* scale x into [2^23, 2^24-1] */ + sign = u.i>>31; + e0 = (ix>>23) - (0x7f+23); /* e0 = ilogb(|x|)-23, positive */ + u.i = ix - (e0<<23); + tx[0] = u.f; + n = __rem_pio2_large(tx,ty,e0,1,0); + if (sign) { + *y = -ty[0]; + return -n; + } + *y = ty[0]; + return n; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2l.c b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2l.c new file mode 100644 index 0000000..77255bd --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__rem_pio2l.c @@ -0,0 +1,141 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/e_rem_pio2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * Copyright (c) 2008 Steven G. Kargl, David Schultz, Bruce D. Evans. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + * Optimized by Bruce D. Evans. + */ +#include "libm.h" +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +/* ld80 and ld128 version of __rem_pio2(x,y) + * + * return the remainder of x rem pi/2 in y[0]+y[1] + * use __rem_pio2_large() for large x + */ + +static const long double toint = 1.5/LDBL_EPSILON; + +#if LDBL_MANT_DIG == 64 +/* u ~< 0x1p25*pi/2 */ +#define SMALL(u) (((u.i.se & 0x7fffU)<<16 | u.i.m>>48) < ((0x3fff + 25)<<16 | 0x921f>>1 | 0x8000)) +#define QUOBITS(x) ((uint32_t)(int32_t)x & 0x7fffffff) +#define ROUND1 22 +#define ROUND2 61 +#define NX 3 +#define NY 2 +/* + * invpio2: 64 bits of 2/pi + * pio2_1: first 39 bits of pi/2 + * pio2_1t: pi/2 - pio2_1 + * pio2_2: second 39 bits of pi/2 + * pio2_2t: pi/2 - (pio2_1+pio2_2) + * pio2_3: third 39 bits of pi/2 + * pio2_3t: pi/2 - (pio2_1+pio2_2+pio2_3) + */ +static const double +pio2_1 = 1.57079632679597125389e+00, /* 0x3FF921FB, 0x54444000 */ +pio2_2 = -1.07463465549783099519e-12, /* -0x12e7b967674000.0p-92 */ +pio2_3 = 6.36831716351370313614e-25; /* 0x18a2e037074000.0p-133 */ +static const long double +invpio2 = 6.36619772367581343076e-01L, /* 0xa2f9836e4e44152a.0p-64 */ +pio2_1t = -1.07463465549719416346e-12L, /* -0x973dcb3b399d747f.0p-103 */ +pio2_2t = 6.36831716351095013979e-25L, /* 0xc51701b839a25205.0p-144 */ +pio2_3t = -2.75299651904407171810e-37L; /* -0xbb5bf6c7ddd660ce.0p-185 */ +#elif LDBL_MANT_DIG == 113 +/* u ~< 0x1p45*pi/2 */ +#define SMALL(u) (((u.i.se & 0x7fffU)<<16 | u.i.top) < ((0x3fff + 45)<<16 | 0x921f)) +#define QUOBITS(x) ((uint32_t)(int64_t)x & 0x7fffffff) +#define ROUND1 51 +#define ROUND2 119 +#define NX 5 +#define NY 3 +static const long double +invpio2 = 6.3661977236758134307553505349005747e-01L, /* 0x145f306dc9c882a53f84eafa3ea6a.0p-113 */ +pio2_1 = 1.5707963267948966192292994253909555e+00L, /* 0x1921fb54442d18469800000000000.0p-112 */ +pio2_1t = 2.0222662487959507323996846200947577e-21L, /* 0x13198a2e03707344a4093822299f3.0p-181 */ +pio2_2 = 2.0222662487959507323994779168837751e-21L, /* 0x13198a2e03707344a400000000000.0p-181 */ +pio2_2t = 2.0670321098263988236496903051604844e-43L, /* 0x127044533e63a0105df531d89cd91.0p-254 */ +pio2_3 = 2.0670321098263988236499468110329591e-43L, /* 0x127044533e63a0105e00000000000.0p-254 */ +pio2_3t = -2.5650587247459238361625433492959285e-65L; /* -0x159c4ec64ddaeb5f78671cbfb2210.0p-327 */ +#endif + +int __rem_pio2l(long double x, long double *y) +{ + union ldshape u,uz; + long double z,w,t,r,fn; + double tx[NX],ty[NY]; + int ex,ey,n,i; + + u.f = x; + ex = u.i.se & 0x7fff; + if (SMALL(u)) { + /* rint(x/(pi/2)), Assume round-to-nearest. */ + fn = x*invpio2 + toint - toint; + n = QUOBITS(fn); + r = x-fn*pio2_1; + w = fn*pio2_1t; /* 1st round good to 102/180 bits (ld80/ld128) */ + y[0] = r-w; + u.f = y[0]; + ey = u.i.se & 0x7fff; + if (ex - ey > ROUND1) { /* 2nd iteration needed, good to 141/248 (ld80/ld128) */ + t = r; + w = fn*pio2_2; + r = t-w; + w = fn*pio2_2t-((t-r)-w); + y[0] = r-w; + u.f = y[0]; + ey = u.i.se & 0x7fff; + if (ex - ey > ROUND2) { /* 3rd iteration, good to 180/316 bits */ + t = r; /* will cover all possible cases (not verified for ld128) */ + w = fn*pio2_3; + r = t-w; + w = fn*pio2_3t-((t-r)-w); + y[0] = r-w; + } + } + y[1] = (r - y[0]) - w; + return n; + } + /* + * all other (large) arguments + */ + if (ex == 0x7fff) { /* x is inf or NaN */ + y[0] = y[1] = x - x; + return 0; + } + /* set z = scalbn(|x|,-ilogb(x)+23) */ + uz.f = x; + uz.i.se = 0x3fff + 23; + z = uz.f; + for (i=0; i < NX - 1; i++) { + tx[i] = (double)(int32_t)z; + z = (z-tx[i])*0x1p24; + } + tx[i] = z; + while (tx[i] == 0) + i--; + n = __rem_pio2_large(tx, ty, ex-0x3fff-23, i+1, NY); + w = ty[1]; + if (NY == 3) + w += ty[2]; + r = ty[0] + w; + /* TODO: for ld128 this does not follow the recommendation of the + comments of __rem_pio2_large which seem wrong if |ty[0]| > |ty[1]+ty[2]| */ + w -= r - ty[0]; + if (u.i.se >> 15) { + y[0] = -r; + y[1] = -w; + return -n; + } + y[0] = r; + y[1] = w; + return n; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__signbit.c b/lib/mlibc/options/ansi/musl-generic-math/__signbit.c new file mode 100644 index 0000000..e700b6b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__signbit.c @@ -0,0 +1,13 @@ +#include "libm.h" + +// FIXME: macro in math.h +int __signbit(double x) +{ + union { + double d; + uint64_t i; + } y = { x }; + return y.i>>63; +} + + diff --git a/lib/mlibc/options/ansi/musl-generic-math/__signbitf.c b/lib/mlibc/options/ansi/musl-generic-math/__signbitf.c new file mode 100644 index 0000000..40ad3cf --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__signbitf.c @@ -0,0 +1,11 @@ +#include "libm.h" + +// FIXME: macro in math.h +int __signbitf(float x) +{ + union { + float f; + uint32_t i; + } y = { x }; + return y.i>>31; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__signbitl.c b/lib/mlibc/options/ansi/musl-generic-math/__signbitl.c new file mode 100644 index 0000000..63b3dc5 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__signbitl.c @@ -0,0 +1,14 @@ +#include "libm.h" + +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +int __signbitl(long double x) +{ + union ldshape u = {x}; + return u.i.se >> 15; +} +#elif LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +int __signbitl(long double x) +{ + return __signbit(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__sin.c b/lib/mlibc/options/ansi/musl-generic-math/__sin.c new file mode 100644 index 0000000..4030949 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__sin.c @@ -0,0 +1,64 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_sin.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* __sin( x, y, iy) + * kernel sin function on ~[-pi/4, pi/4] (except on -0), pi/4 ~ 0.7854 + * Input x is assumed to be bounded by ~pi/4 in magnitude. + * Input y is the tail of x. + * Input iy indicates whether y is 0. (if iy=0, y assume to be 0). + * + * Algorithm + * 1. Since sin(-x) = -sin(x), we need only to consider positive x. + * 2. Callers must return sin(-0) = -0 without calling here since our + * odd polynomial is not evaluated in a way that preserves -0. + * Callers may do the optimization sin(x) ~ x for tiny x. + * 3. sin(x) is approximated by a polynomial of degree 13 on + * [0,pi/4] + * 3 13 + * sin(x) ~ x + S1*x + ... + S6*x + * where + * + * |sin(x) 2 4 6 8 10 12 | -58 + * |----- - (1+S1*x +S2*x +S3*x +S4*x +S5*x +S6*x )| <= 2 + * | x | + * + * 4. sin(x+y) = sin(x) + sin'(x')*y + * ~ sin(x) + (1-x*x/2)*y + * For better accuracy, let + * 3 2 2 2 2 + * r = x *(S2+x *(S3+x *(S4+x *(S5+x *S6)))) + * then 3 2 + * sin(x) = x + (S1*x + (x *(r-y/2)+y)) + */ + +#include "libm.h" + +static const double +S1 = -1.66666666666666324348e-01, /* 0xBFC55555, 0x55555549 */ +S2 = 8.33333333332248946124e-03, /* 0x3F811111, 0x1110F8A6 */ +S3 = -1.98412698298579493134e-04, /* 0xBF2A01A0, 0x19C161D5 */ +S4 = 2.75573137070700676789e-06, /* 0x3EC71DE3, 0x57B1FE7D */ +S5 = -2.50507602534068634195e-08, /* 0xBE5AE5E6, 0x8A2B9CEB */ +S6 = 1.58969099521155010221e-10; /* 0x3DE5D93A, 0x5ACFD57C */ + +double __sin(double x, double y, int iy) +{ + double_t z,r,v,w; + + z = x*x; + w = z*z; + r = S2 + z*(S3 + z*S4) + z*w*(S5 + z*S6); + v = z*x; + if (iy == 0) + return x + v*(S1 + z*r); + else + return x - ((z*(0.5*y - v*r) - y) - v*S1); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__sindf.c b/lib/mlibc/options/ansi/musl-generic-math/__sindf.c new file mode 100644 index 0000000..8fec2a3 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__sindf.c @@ -0,0 +1,36 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_sinf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* |sin(x)/x - s(x)| < 2**-37.5 (~[-4.89e-12, 4.824e-12]). */ +static const double +S1 = -0x15555554cbac77.0p-55, /* -0.166666666416265235595 */ +S2 = 0x111110896efbb2.0p-59, /* 0.0083333293858894631756 */ +S3 = -0x1a00f9e2cae774.0p-65, /* -0.000198393348360966317347 */ +S4 = 0x16cd878c3b46a7.0p-71; /* 0.0000027183114939898219064 */ + +float __sindf(double x) +{ + double_t r, s, w, z; + + /* Try to optimize for parallel evaluation as in __tandf.c. */ + z = x*x; + w = z*z; + r = S3 + z*S4; + s = z*x; + return (x + s*(S1 + z*S2)) + s*w*r; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__sinl.c b/lib/mlibc/options/ansi/musl-generic-math/__sinl.c new file mode 100644 index 0000000..2525bbe --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__sinl.c @@ -0,0 +1,78 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/k_sinl.c */ +/* origin: FreeBSD /usr/src/lib/msun/ld128/k_sinl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * Copyright (c) 2008 Steven G. Kargl, David Schultz, Bruce D. Evans. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#if LDBL_MANT_DIG == 64 +/* + * ld80 version of __sin.c. See __sin.c for most comments. + */ +/* + * Domain [-0.7854, 0.7854], range ~[-1.89e-22, 1.915e-22] + * |sin(x)/x - s(x)| < 2**-72.1 + * + * See __cosl.c for more details about the polynomial. + */ +static const long double +S1 = -0.166666666666666666671L; /* -0xaaaaaaaaaaaaaaab.0p-66 */ +static const double +S2 = 0.0083333333333333332, /* 0x11111111111111.0p-59 */ +S3 = -0.00019841269841269427, /* -0x1a01a01a019f81.0p-65 */ +S4 = 0.0000027557319223597490, /* 0x171de3a55560f7.0p-71 */ +S5 = -0.000000025052108218074604, /* -0x1ae64564f16cad.0p-78 */ +S6 = 1.6059006598854211e-10, /* 0x161242b90243b5.0p-85 */ +S7 = -7.6429779983024564e-13, /* -0x1ae42ebd1b2e00.0p-93 */ +S8 = 2.6174587166648325e-15; /* 0x179372ea0b3f64.0p-101 */ +#define POLY(z) (S2+z*(S3+z*(S4+z*(S5+z*(S6+z*(S7+z*S8)))))) +#elif LDBL_MANT_DIG == 113 +/* + * ld128 version of __sin.c. See __sin.c for most comments. + */ +/* + * Domain [-0.7854, 0.7854], range ~[-1.53e-37, 1.659e-37] + * |sin(x)/x - s(x)| < 2**-122.1 + * + * See __cosl.c for more details about the polynomial. + */ +static const long double +S1 = -0.16666666666666666666666666666666666606732416116558L, +S2 = 0.0083333333333333333333333333333331135404851288270047L, +S3 = -0.00019841269841269841269841269839935785325638310428717L, +S4 = 0.27557319223985890652557316053039946268333231205686e-5L, +S5 = -0.25052108385441718775048214826384312253862930064745e-7L, +S6 = 0.16059043836821614596571832194524392581082444805729e-9L, +S7 = -0.76471637318198151807063387954939213287488216303768e-12L, +S8 = 0.28114572543451292625024967174638477283187397621303e-14L; +static const double +S9 = -0.82206352458348947812512122163446202498005154296863e-17, +S10 = 0.19572940011906109418080609928334380560135358385256e-19, +S11 = -0.38680813379701966970673724299207480965452616911420e-22, +S12 = 0.64038150078671872796678569586315881020659912139412e-25; +#define POLY(z) (S2+z*(S3+z*(S4+z*(S5+z*(S6+z*(S7+z*(S8+ \ + z*(S9+z*(S10+z*(S11+z*S12)))))))))) +#endif + +long double __sinl(long double x, long double y, int iy) +{ + long double z,r,v; + + z = x*x; + v = z*x; + r = POLY(z); + if (iy == 0) + return x+v*(S1+z*r); + return x-((z*(0.5*y-v*r)-y)-v*S1); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/__tan.c b/lib/mlibc/options/ansi/musl-generic-math/__tan.c new file mode 100644 index 0000000..8019844 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__tan.c @@ -0,0 +1,110 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_tan.c */ +/* + * ==================================================== + * Copyright 2004 Sun Microsystems, Inc. All Rights Reserved. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* __tan( x, y, k ) + * kernel tan function on ~[-pi/4, pi/4] (except on -0), pi/4 ~ 0.7854 + * Input x is assumed to be bounded by ~pi/4 in magnitude. + * Input y is the tail of x. + * Input odd indicates whether tan (if odd = 0) or -1/tan (if odd = 1) is returned. + * + * Algorithm + * 1. Since tan(-x) = -tan(x), we need only to consider positive x. + * 2. Callers must return tan(-0) = -0 without calling here since our + * odd polynomial is not evaluated in a way that preserves -0. + * Callers may do the optimization tan(x) ~ x for tiny x. + * 3. tan(x) is approximated by a odd polynomial of degree 27 on + * [0,0.67434] + * 3 27 + * tan(x) ~ x + T1*x + ... + T13*x + * where + * + * |tan(x) 2 4 26 | -59.2 + * |----- - (1+T1*x +T2*x +.... +T13*x )| <= 2 + * | x | + * + * Note: tan(x+y) = tan(x) + tan'(x)*y + * ~ tan(x) + (1+x*x)*y + * Therefore, for better accuracy in computing tan(x+y), let + * 3 2 2 2 2 + * r = x *(T2+x *(T3+x *(...+x *(T12+x *T13)))) + * then + * 3 2 + * tan(x+y) = x + (T1*x + (x *(r+y)+y)) + * + * 4. For x in [0.67434,pi/4], let y = pi/4 - x, then + * tan(x) = tan(pi/4-y) = (1-tan(y))/(1+tan(y)) + * = 1 - 2*(tan(y) - (tan(y)^2)/(1+tan(y))) + */ + +#include "libm.h" + +static const double T[] = { + 3.33333333333334091986e-01, /* 3FD55555, 55555563 */ + 1.33333333333201242699e-01, /* 3FC11111, 1110FE7A */ + 5.39682539762260521377e-02, /* 3FABA1BA, 1BB341FE */ + 2.18694882948595424599e-02, /* 3F9664F4, 8406D637 */ + 8.86323982359930005737e-03, /* 3F8226E3, E96E8493 */ + 3.59207910759131235356e-03, /* 3F6D6D22, C9560328 */ + 1.45620945432529025516e-03, /* 3F57DBC8, FEE08315 */ + 5.88041240820264096874e-04, /* 3F4344D8, F2F26501 */ + 2.46463134818469906812e-04, /* 3F3026F7, 1A8D1068 */ + 7.81794442939557092300e-05, /* 3F147E88, A03792A6 */ + 7.14072491382608190305e-05, /* 3F12B80F, 32F0A7E9 */ + -1.85586374855275456654e-05, /* BEF375CB, DB605373 */ + 2.59073051863633712884e-05, /* 3EFB2A70, 74BF7AD4 */ +}, +pio4 = 7.85398163397448278999e-01, /* 3FE921FB, 54442D18 */ +pio4lo = 3.06161699786838301793e-17; /* 3C81A626, 33145C07 */ + +double __tan(double x, double y, int odd) +{ + double_t z, r, v, w, s, a; + double w0, a0; + uint32_t hx; + int big, sign; + + GET_HIGH_WORD(hx,x); + big = (hx&0x7fffffff) >= 0x3FE59428; /* |x| >= 0.6744 */ + if (big) { + sign = hx>>31; + if (sign) { + x = -x; + y = -y; + } + x = (pio4 - x) + (pio4lo - y); + y = 0.0; + } + z = x * x; + w = z * z; + /* + * Break x^5*(T[1]+x^2*T[2]+...) into + * x^5(T[1]+x^4*T[3]+...+x^20*T[11]) + + * x^5(x^2*(T[2]+x^4*T[4]+...+x^22*[T12])) + */ + r = T[1] + w*(T[3] + w*(T[5] + w*(T[7] + w*(T[9] + w*T[11])))); + v = z*(T[2] + w*(T[4] + w*(T[6] + w*(T[8] + w*(T[10] + w*T[12]))))); + s = z * x; + r = y + z*(s*(r + v) + y) + s*T[0]; + w = x + r; + if (big) { + s = 1 - 2*odd; + v = s - 2.0 * (x + (r - w*w/(w + s))); + return sign ? -v : v; + } + if (!odd) + return w; + /* -1.0/(x+r) has up to 2ulp error, so compute it accurately */ + w0 = w; + SET_LOW_WORD(w0, 0); + v = r - (w0 - x); /* w0+v = r+x */ + a0 = a = -1.0 / w; + SET_LOW_WORD(a0, 0); + return a0 + a*(1.0 + a0*w0 + a0*v); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__tandf.c b/lib/mlibc/options/ansi/musl-generic-math/__tandf.c new file mode 100644 index 0000000..25047ee --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__tandf.c @@ -0,0 +1,54 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/k_tanf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright 2004 Sun Microsystems, Inc. All Rights Reserved. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* |tan(x)/x - t(x)| < 2**-25.5 (~[-2e-08, 2e-08]). */ +static const double T[] = { + 0x15554d3418c99f.0p-54, /* 0.333331395030791399758 */ + 0x1112fd38999f72.0p-55, /* 0.133392002712976742718 */ + 0x1b54c91d865afe.0p-57, /* 0.0533812378445670393523 */ + 0x191df3908c33ce.0p-58, /* 0.0245283181166547278873 */ + 0x185dadfcecf44e.0p-61, /* 0.00297435743359967304927 */ + 0x1362b9bf971bcd.0p-59, /* 0.00946564784943673166728 */ +}; + +float __tandf(double x, int odd) +{ + double_t z,r,w,s,t,u; + + z = x*x; + /* + * Split up the polynomial into small independent terms to give + * opportunities for parallel evaluation. The chosen splitting is + * micro-optimized for Athlons (XP, X64). It costs 2 multiplications + * relative to Horner's method on sequential machines. + * + * We add the small terms from lowest degree up for efficiency on + * non-sequential machines (the lowest degree terms tend to be ready + * earlier). Apart from this, we don't care about order of + * operations, and don't need to to care since we have precision to + * spare. However, the chosen splitting is good for accuracy too, + * and would give results as accurate as Horner's method if the + * small terms were added from highest degree down. + */ + r = T[4] + z*T[5]; + t = T[2] + z*T[3]; + w = z*z; + s = z*x; + u = T[0] + z*T[1]; + r = (x + s*u) + (s*w)*(t + w*r); + return odd ? -1.0/r : r; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/__tanl.c b/lib/mlibc/options/ansi/musl-generic-math/__tanl.c new file mode 100644 index 0000000..54abc3d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/__tanl.c @@ -0,0 +1,143 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/k_tanl.c */ +/* origin: FreeBSD /usr/src/lib/msun/ld128/k_tanl.c */ +/* + * ==================================================== + * Copyright 2004 Sun Microsystems, Inc. All Rights Reserved. + * Copyright (c) 2008 Steven G. Kargl, David Schultz, Bruce D. Evans. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +#if (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#if LDBL_MANT_DIG == 64 +/* + * ld80 version of __tan.c. See __tan.c for most comments. + */ +/* + * Domain [-0.67434, 0.67434], range ~[-2.25e-22, 1.921e-22] + * |tan(x)/x - t(x)| < 2**-71.9 + * + * See __cosl.c for more details about the polynomial. + */ +static const long double +T3 = 0.333333333333333333180L, /* 0xaaaaaaaaaaaaaaa5.0p-65 */ +T5 = 0.133333333333333372290L, /* 0x88888888888893c3.0p-66 */ +T7 = 0.0539682539682504975744L, /* 0xdd0dd0dd0dc13ba2.0p-68 */ +pio4 = 0.785398163397448309628L, /* 0xc90fdaa22168c235.0p-64 */ +pio4lo = -1.25413940316708300586e-20L; /* -0xece675d1fc8f8cbb.0p-130 */ +static const double +T9 = 0.021869488536312216, /* 0x1664f4882cc1c2.0p-58 */ +T11 = 0.0088632355256619590, /* 0x1226e355c17612.0p-59 */ +T13 = 0.0035921281113786528, /* 0x1d6d3d185d7ff8.0p-61 */ +T15 = 0.0014558334756312418, /* 0x17da354aa3f96b.0p-62 */ +T17 = 0.00059003538700862256, /* 0x13559358685b83.0p-63 */ +T19 = 0.00023907843576635544, /* 0x1f56242026b5be.0p-65 */ +T21 = 0.000097154625656538905, /* 0x1977efc26806f4.0p-66 */ +T23 = 0.000038440165747303162, /* 0x14275a09b3ceac.0p-67 */ +T25 = 0.000018082171885432524, /* 0x12f5e563e5487e.0p-68 */ +T27 = 0.0000024196006108814377, /* 0x144c0d80cc6896.0p-71 */ +T29 = 0.0000078293456938132840, /* 0x106b59141a6cb3.0p-69 */ +T31 = -0.0000032609076735050182, /* -0x1b5abef3ba4b59.0p-71 */ +T33 = 0.0000023261313142559411; /* 0x13835436c0c87f.0p-71 */ +#define RPOLY(w) (T5 + w * (T9 + w * (T13 + w * (T17 + w * (T21 + \ + w * (T25 + w * (T29 + w * T33))))))) +#define VPOLY(w) (T7 + w * (T11 + w * (T15 + w * (T19 + w * (T23 + \ + w * (T27 + w * T31)))))) +#elif LDBL_MANT_DIG == 113 +/* + * ld128 version of __tan.c. See __tan.c for most comments. + */ +/* + * Domain [-0.67434, 0.67434], range ~[-3.37e-36, 1.982e-37] + * |tan(x)/x - t(x)| < 2**-117.8 (XXX should be ~1e-37) + * + * See __cosl.c for more details about the polynomial. + */ +static const long double +T3 = 0x1.5555555555555555555555555553p-2L, +T5 = 0x1.1111111111111111111111111eb5p-3L, +T7 = 0x1.ba1ba1ba1ba1ba1ba1ba1b694cd6p-5L, +T9 = 0x1.664f4882c10f9f32d6bbe09d8bcdp-6L, +T11 = 0x1.226e355e6c23c8f5b4f5762322eep-7L, +T13 = 0x1.d6d3d0e157ddfb5fed8e84e27b37p-9L, +T15 = 0x1.7da36452b75e2b5fce9ee7c2c92ep-10L, +T17 = 0x1.355824803674477dfcf726649efep-11L, +T19 = 0x1.f57d7734d1656e0aceb716f614c2p-13L, +T21 = 0x1.967e18afcb180ed942dfdc518d6cp-14L, +T23 = 0x1.497d8eea21e95bc7e2aa79b9f2cdp-15L, +T25 = 0x1.0b132d39f055c81be49eff7afd50p-16L, +T27 = 0x1.b0f72d33eff7bfa2fbc1059d90b6p-18L, +T29 = 0x1.5ef2daf21d1113df38d0fbc00267p-19L, +T31 = 0x1.1c77d6eac0234988cdaa04c96626p-20L, +T33 = 0x1.cd2a5a292b180e0bdd701057dfe3p-22L, +T35 = 0x1.75c7357d0298c01a31d0a6f7d518p-23L, +T37 = 0x1.2f3190f4718a9a520f98f50081fcp-24L, +pio4 = 0x1.921fb54442d18469898cc51701b8p-1L, +pio4lo = 0x1.cd129024e088a67cc74020bbea60p-116L; +static const double +T39 = 0.000000028443389121318352, /* 0x1e8a7592977938.0p-78 */ +T41 = 0.000000011981013102001973, /* 0x19baa1b1223219.0p-79 */ +T43 = 0.0000000038303578044958070, /* 0x107385dfb24529.0p-80 */ +T45 = 0.0000000034664378216909893, /* 0x1dc6c702a05262.0p-81 */ +T47 = -0.0000000015090641701997785, /* -0x19ecef3569ebb6.0p-82 */ +T49 = 0.0000000029449552300483952, /* 0x194c0668da786a.0p-81 */ +T51 = -0.0000000022006995706097711, /* -0x12e763b8845268.0p-81 */ +T53 = 0.0000000015468200913196612, /* 0x1a92fc98c29554.0p-82 */ +T55 = -0.00000000061311613386849674, /* -0x151106cbc779a9.0p-83 */ +T57 = 1.4912469681508012e-10; /* 0x147edbdba6f43a.0p-85 */ +#define RPOLY(w) (T5 + w * (T9 + w * (T13 + w * (T17 + w * (T21 + \ + w * (T25 + w * (T29 + w * (T33 + w * (T37 + w * (T41 + \ + w * (T45 + w * (T49 + w * (T53 + w * T57))))))))))))) +#define VPOLY(w) (T7 + w * (T11 + w * (T15 + w * (T19 + w * (T23 + \ + w * (T27 + w * (T31 + w * (T35 + w * (T39 + w * (T43 + \ + w * (T47 + w * (T51 + w * T55)))))))))))) +#endif + +long double __tanl(long double x, long double y, int odd) { + long double z, r, v, w, s, a, t; + int big, sign; + + big = fabsl(x) >= 0.67434; + if (big) { + sign = 0; + if (x < 0) { + sign = 1; + x = -x; + y = -y; + } + x = (pio4 - x) + (pio4lo - y); + y = 0.0; + } + z = x * x; + w = z * z; + r = RPOLY(w); + v = z * VPOLY(w); + s = z * x; + r = y + z * (s * (r + v) + y) + T3 * s; + w = x + r; + if (big) { + s = 1 - 2*odd; + v = s - 2.0 * (x + (r - w * w / (w + s))); + return sign ? -v : v; + } + if (!odd) + return w; + /* + * if allow error up to 2 ulp, simply return + * -1.0 / (x+r) here + */ + /* compute -1.0 / (x+r) accurately */ + z = w; + z = z + 0x1p32 - 0x1p32; + v = r - (z - x); /* z+v = r+x */ + t = a = -1.0 / w; /* a = -1.0/w */ + t = t + 0x1p32 - 0x1p32; + s = 1.0 + t * z; + return t + a * (s + t * v); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/acos.c b/lib/mlibc/options/ansi/musl-generic-math/acos.c new file mode 100644 index 0000000..ea9c87b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/acos.c @@ -0,0 +1,101 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_acos.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* acos(x) + * Method : + * acos(x) = pi/2 - asin(x) + * acos(-x) = pi/2 + asin(x) + * For |x|<=0.5 + * acos(x) = pi/2 - (x + x*x^2*R(x^2)) (see asin.c) + * For x>0.5 + * acos(x) = pi/2 - (pi/2 - 2asin(sqrt((1-x)/2))) + * = 2asin(sqrt((1-x)/2)) + * = 2s + 2s*z*R(z) ...z=(1-x)/2, s=sqrt(z) + * = 2f + (2c + 2s*z*R(z)) + * where f=hi part of s, and c = (z-f*f)/(s+f) is the correction term + * for f so that f+c ~ sqrt(z). + * For x<-0.5 + * acos(x) = pi - 2asin(sqrt((1-|x|)/2)) + * = pi - 0.5*(s+s*z*R(z)), where z=(1-|x|)/2,s=sqrt(z) + * + * Special cases: + * if x is NaN, return x itself; + * if |x|>1, return NaN with invalid signal. + * + * Function needed: sqrt + */ + +#include "libm.h" + +static const double +pio2_hi = 1.57079632679489655800e+00, /* 0x3FF921FB, 0x54442D18 */ +pio2_lo = 6.12323399573676603587e-17, /* 0x3C91A626, 0x33145C07 */ +pS0 = 1.66666666666666657415e-01, /* 0x3FC55555, 0x55555555 */ +pS1 = -3.25565818622400915405e-01, /* 0xBFD4D612, 0x03EB6F7D */ +pS2 = 2.01212532134862925881e-01, /* 0x3FC9C155, 0x0E884455 */ +pS3 = -4.00555345006794114027e-02, /* 0xBFA48228, 0xB5688F3B */ +pS4 = 7.91534994289814532176e-04, /* 0x3F49EFE0, 0x7501B288 */ +pS5 = 3.47933107596021167570e-05, /* 0x3F023DE1, 0x0DFDF709 */ +qS1 = -2.40339491173441421878e+00, /* 0xC0033A27, 0x1C8A2D4B */ +qS2 = 2.02094576023350569471e+00, /* 0x40002AE5, 0x9C598AC8 */ +qS3 = -6.88283971605453293030e-01, /* 0xBFE6066C, 0x1B8D0159 */ +qS4 = 7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */ + +static double R(double z) +{ + double_t p, q; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5))))); + q = 1.0+z*(qS1+z*(qS2+z*(qS3+z*qS4))); + return p/q; +} + +double acos(double x) +{ + double z,w,s,c,df; + uint32_t hx,ix; + + GET_HIGH_WORD(hx, x); + ix = hx & 0x7fffffff; + /* |x| >= 1 or nan */ + if (ix >= 0x3ff00000) { + uint32_t lx; + + GET_LOW_WORD(lx,x); + if ((ix-0x3ff00000 | lx) == 0) { + /* acos(1)=0, acos(-1)=pi */ + if (hx >> 31) + return 2*pio2_hi + 0x1p-120f; + return 0; + } + return 0/(x-x); + } + /* |x| < 0.5 */ + if (ix < 0x3fe00000) { + if (ix <= 0x3c600000) /* |x| < 2**-57 */ + return pio2_hi + 0x1p-120f; + return pio2_hi - (x - (pio2_lo-x*R(x*x))); + } + /* x < -0.5 */ + if (hx >> 31) { + z = (1.0+x)*0.5; + s = sqrt(z); + w = R(z)*s-pio2_lo; + return 2*(pio2_hi - (s+w)); + } + /* x > 0.5 */ + z = (1.0-x)*0.5; + s = sqrt(z); + df = s; + SET_LOW_WORD(df,0); + c = (z-df*df)/(s+df); + w = R(z)*s+c; + return 2*(df+w); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/acosf.c b/lib/mlibc/options/ansi/musl-generic-math/acosf.c new file mode 100644 index 0000000..8ee1a71 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/acosf.c @@ -0,0 +1,71 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_acosf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +pio2_hi = 1.5707962513e+00, /* 0x3fc90fda */ +pio2_lo = 7.5497894159e-08, /* 0x33a22168 */ +pS0 = 1.6666586697e-01, +pS1 = -4.2743422091e-02, +pS2 = -8.6563630030e-03, +qS1 = -7.0662963390e-01; + +static float R(float z) +{ + float_t p, q; + p = z*(pS0+z*(pS1+z*pS2)); + q = 1.0f+z*qS1; + return p/q; +} + +float acosf(float x) +{ + float z,w,s,c,df; + uint32_t hx,ix; + + GET_FLOAT_WORD(hx, x); + ix = hx & 0x7fffffff; + /* |x| >= 1 or nan */ + if (ix >= 0x3f800000) { + if (ix == 0x3f800000) { + if (hx >> 31) + return 2*pio2_hi + 0x1p-120f; + return 0; + } + return 0/(x-x); + } + /* |x| < 0.5 */ + if (ix < 0x3f000000) { + if (ix <= 0x32800000) /* |x| < 2**-26 */ + return pio2_hi + 0x1p-120f; + return pio2_hi - (x - (pio2_lo-x*R(x*x))); + } + /* x < -0.5 */ + if (hx >> 31) { + z = (1+x)*0.5f; + s = sqrtf(z); + w = R(z)*s-pio2_lo; + return 2*(pio2_hi - (s+w)); + } + /* x > 0.5 */ + z = (1-x)*0.5f; + s = sqrtf(z); + GET_FLOAT_WORD(hx,s); + SET_FLOAT_WORD(df,hx&0xfffff000); + c = (z-df*df)/(s+df); + w = R(z)*s+c; + return 2*(df+w); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/acosh.c b/lib/mlibc/options/ansi/musl-generic-math/acosh.c new file mode 100644 index 0000000..badbf90 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/acosh.c @@ -0,0 +1,24 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==2 +#undef sqrt +#define sqrt sqrtl +#endif + +/* acosh(x) = log(x + sqrt(x*x-1)) */ +double acosh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + unsigned e = u.i >> 52 & 0x7ff; + + /* x < 1 domain error is handled in the called functions */ + + if (e < 0x3ff + 1) + /* |x| < 2, up to 2ulp error in [1,1.125] */ + return log1p(x-1 + sqrt((x-1)*(x-1)+2*(x-1))); + if (e < 0x3ff + 26) + /* |x| < 0x1p26 */ + return log(2*x - 1/(x+sqrt(x*x-1))); + /* |x| >= 0x1p26 or nan */ + return log(x) + 0.693147180559945309417232121458176568; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/acoshf.c b/lib/mlibc/options/ansi/musl-generic-math/acoshf.c new file mode 100644 index 0000000..8a4ec4d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/acoshf.c @@ -0,0 +1,26 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==2 +#undef sqrtf +#define sqrtf sqrtl +#elif FLT_EVAL_METHOD==1 +#undef sqrtf +#define sqrtf sqrt +#endif + +/* acosh(x) = log(x + sqrt(x*x-1)) */ +float acoshf(float x) +{ + union {float f; uint32_t i;} u = {x}; + uint32_t a = u.i & 0x7fffffff; + + if (a < 0x3f800000+(1<<23)) + /* |x| < 2, invalid if x < 1 or nan */ + /* up to 2ulp error in [1,1.125] */ + return log1pf(x-1 + sqrtf((x-1)*(x-1)+2*(x-1))); + if (a < 0x3f800000+(12<<23)) + /* |x| < 0x1p12 */ + return logf(2*x - 1/(x+sqrtf(x*x-1))); + /* x >= 0x1p12 */ + return logf(x) + 0.693147180559945309417232121458176568f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/acoshl.c b/lib/mlibc/options/ansi/musl-generic-math/acoshl.c new file mode 100644 index 0000000..8d4b43f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/acoshl.c @@ -0,0 +1,29 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double acoshl(long double x) +{ + return acosh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* acosh(x) = log(x + sqrt(x*x-1)) */ +long double acoshl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + + if (e < 0x3fff + 1) + /* |x| < 2, invalid if x < 1 or nan */ + return log1pl(x-1 + sqrtl((x-1)*(x-1)+2*(x-1))); + if (e < 0x3fff + 32) + /* |x| < 0x1p32 */ + return logl(2*x - 1/(x+sqrtl(x*x-1))); + return logl(x) + 0.693147180559945309417232121458176568L; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double acoshl(long double x) +{ + return acosh(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/acosl.c b/lib/mlibc/options/ansi/musl-generic-math/acosl.c new file mode 100644 index 0000000..c03bdf0 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/acosl.c @@ -0,0 +1,67 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_acosl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in acos.c. + * Converted to long double by David Schultz <das@FreeBSD.ORG>. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double acosl(long double x) +{ + return acos(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#include "__invtrigl.h" +#if LDBL_MANT_DIG == 64 +#define CLEARBOTTOM(u) (u.i.m &= -1ULL << 32) +#elif LDBL_MANT_DIG == 113 +#define CLEARBOTTOM(u) (u.i.lo = 0) +#endif + +long double acosl(long double x) +{ + union ldshape u = {x}; + long double z, s, c, f; + uint16_t e = u.i.se & 0x7fff; + + /* |x| >= 1 or nan */ + if (e >= 0x3fff) { + if (x == 1) + return 0; + if (x == -1) + return 2*pio2_hi + 0x1p-120f; + return 0/(x-x); + } + /* |x| < 0.5 */ + if (e < 0x3fff - 1) { + if (e < 0x3fff - LDBL_MANT_DIG - 1) + return pio2_hi + 0x1p-120f; + return pio2_hi - (__invtrigl_R(x*x)*x - pio2_lo + x); + } + /* x < -0.5 */ + if (u.i.se >> 15) { + z = (1 + x)*0.5; + s = sqrtl(z); + return 2*(pio2_hi - (__invtrigl_R(z)*s - pio2_lo + s)); + } + /* x > 0.5 */ + z = (1 - x)*0.5; + s = sqrtl(z); + u.f = s; + CLEARBOTTOM(u); + f = u.f; + c = (z - f*f)/(s + f); + return 2*(__invtrigl_R(z)*s + c + f); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/asin.c b/lib/mlibc/options/ansi/musl-generic-math/asin.c new file mode 100644 index 0000000..c926b18 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/asin.c @@ -0,0 +1,107 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_asin.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* asin(x) + * Method : + * Since asin(x) = x + x^3/6 + x^5*3/40 + x^7*15/336 + ... + * we approximate asin(x) on [0,0.5] by + * asin(x) = x + x*x^2*R(x^2) + * where + * R(x^2) is a rational approximation of (asin(x)-x)/x^3 + * and its remez error is bounded by + * |(asin(x)-x)/x^3 - R(x^2)| < 2^(-58.75) + * + * For x in [0.5,1] + * asin(x) = pi/2-2*asin(sqrt((1-x)/2)) + * Let y = (1-x), z = y/2, s := sqrt(z), and pio2_hi+pio2_lo=pi/2; + * then for x>0.98 + * asin(x) = pi/2 - 2*(s+s*z*R(z)) + * = pio2_hi - (2*(s+s*z*R(z)) - pio2_lo) + * For x<=0.98, let pio4_hi = pio2_hi/2, then + * f = hi part of s; + * c = sqrt(z) - f = (z-f*f)/(s+f) ...f+c=sqrt(z) + * and + * asin(x) = pi/2 - 2*(s+s*z*R(z)) + * = pio4_hi+(pio4-2s)-(2s*z*R(z)-pio2_lo) + * = pio4_hi+(pio4-2f)-(2s*z*R(z)-(pio2_lo+2c)) + * + * Special cases: + * if x is NaN, return x itself; + * if |x|>1, return NaN with invalid signal. + * + */ + +#include "libm.h" + +static const double +pio2_hi = 1.57079632679489655800e+00, /* 0x3FF921FB, 0x54442D18 */ +pio2_lo = 6.12323399573676603587e-17, /* 0x3C91A626, 0x33145C07 */ +/* coefficients for R(x^2) */ +pS0 = 1.66666666666666657415e-01, /* 0x3FC55555, 0x55555555 */ +pS1 = -3.25565818622400915405e-01, /* 0xBFD4D612, 0x03EB6F7D */ +pS2 = 2.01212532134862925881e-01, /* 0x3FC9C155, 0x0E884455 */ +pS3 = -4.00555345006794114027e-02, /* 0xBFA48228, 0xB5688F3B */ +pS4 = 7.91534994289814532176e-04, /* 0x3F49EFE0, 0x7501B288 */ +pS5 = 3.47933107596021167570e-05, /* 0x3F023DE1, 0x0DFDF709 */ +qS1 = -2.40339491173441421878e+00, /* 0xC0033A27, 0x1C8A2D4B */ +qS2 = 2.02094576023350569471e+00, /* 0x40002AE5, 0x9C598AC8 */ +qS3 = -6.88283971605453293030e-01, /* 0xBFE6066C, 0x1B8D0159 */ +qS4 = 7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */ + +static double R(double z) +{ + double_t p, q; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5))))); + q = 1.0+z*(qS1+z*(qS2+z*(qS3+z*qS4))); + return p/q; +} + +double asin(double x) +{ + double z,r,s; + uint32_t hx,ix; + + GET_HIGH_WORD(hx, x); + ix = hx & 0x7fffffff; + /* |x| >= 1 or nan */ + if (ix >= 0x3ff00000) { + uint32_t lx; + GET_LOW_WORD(lx, x); + if ((ix-0x3ff00000 | lx) == 0) + /* asin(1) = +-pi/2 with inexact */ + return x*pio2_hi + 0x1p-120f; + return 0/(x-x); + } + /* |x| < 0.5 */ + if (ix < 0x3fe00000) { + /* if 0x1p-1022 <= |x| < 0x1p-26, avoid raising underflow */ + if (ix < 0x3e500000 && ix >= 0x00100000) + return x; + return x + x*R(x*x); + } + /* 1 > |x| >= 0.5 */ + z = (1 - fabs(x))*0.5; + s = sqrt(z); + r = R(z); + if (ix >= 0x3fef3333) { /* if |x| > 0.975 */ + x = pio2_hi-(2*(s+s*r)-pio2_lo); + } else { + double f,c; + /* f+c = sqrt(z) */ + f = s; + SET_LOW_WORD(f,0); + c = (z-f*f)/(s+f); + x = 0.5*pio2_hi - (2*s*r - (pio2_lo-2*c) - (0.5*pio2_hi-2*f)); + } + if (hx >> 31) + return -x; + return x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/asinf.c b/lib/mlibc/options/ansi/musl-generic-math/asinf.c new file mode 100644 index 0000000..bcd304a --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/asinf.c @@ -0,0 +1,61 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_asinf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +#include "libm.h" + +static const double +pio2 = 1.570796326794896558e+00; + +static const float +/* coefficients for R(x^2) */ +pS0 = 1.6666586697e-01, +pS1 = -4.2743422091e-02, +pS2 = -8.6563630030e-03, +qS1 = -7.0662963390e-01; + +static float R(float z) +{ + float_t p, q; + p = z*(pS0+z*(pS1+z*pS2)); + q = 1.0f+z*qS1; + return p/q; +} + +float asinf(float x) +{ + double s; + float z; + uint32_t hx,ix; + + GET_FLOAT_WORD(hx, x); + ix = hx & 0x7fffffff; + if (ix >= 0x3f800000) { /* |x| >= 1 */ + if (ix == 0x3f800000) /* |x| == 1 */ + return x*pio2 + 0x1p-120f; /* asin(+-1) = +-pi/2 with inexact */ + return 0/(x-x); /* asin(|x|>1) is NaN */ + } + if (ix < 0x3f000000) { /* |x| < 0.5 */ + /* if 0x1p-126 <= |x| < 0x1p-12, avoid raising underflow */ + if (ix < 0x39800000 && ix >= 0x00800000) + return x; + return x + x*R(x*x); + } + /* 1 > |x| >= 0.5 */ + z = (1 - fabsf(x))*0.5f; + s = sqrt(z); + x = pio2 - 2*(s+s*R(z)); + if (hx >> 31) + return -x; + return x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/asinh.c b/lib/mlibc/options/ansi/musl-generic-math/asinh.c new file mode 100644 index 0000000..0829f22 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/asinh.c @@ -0,0 +1,28 @@ +#include "libm.h" + +/* asinh(x) = sign(x)*log(|x|+sqrt(x*x+1)) ~= x - x^3/6 + o(x^5) */ +double asinh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + unsigned e = u.i >> 52 & 0x7ff; + unsigned s = u.i >> 63; + + /* |x| */ + u.i &= (uint64_t)-1/2; + x = u.f; + + if (e >= 0x3ff + 26) { + /* |x| >= 0x1p26 or inf or nan */ + x = log(x) + 0.693147180559945309417232121458176568; + } else if (e >= 0x3ff + 1) { + /* |x| >= 2 */ + x = log(2*x + 1/(sqrt(x*x+1)+x)); + } else if (e >= 0x3ff - 26) { + /* |x| >= 0x1p-26, up to 1.6ulp error in [0.125,0.5] */ + x = log1p(x + x*x/(sqrt(x*x+1)+1)); + } else { + /* |x| < 0x1p-26, raise inexact if x != 0 */ + FORCE_EVAL(x + 0x1p120f); + } + return s ? -x : x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/asinhf.c b/lib/mlibc/options/ansi/musl-generic-math/asinhf.c new file mode 100644 index 0000000..fc9f091 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/asinhf.c @@ -0,0 +1,28 @@ +#include "libm.h" + +/* asinh(x) = sign(x)*log(|x|+sqrt(x*x+1)) ~= x - x^3/6 + o(x^5) */ +float asinhf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + uint32_t i = u.i & 0x7fffffff; + unsigned s = u.i >> 31; + + /* |x| */ + u.i = i; + x = u.f; + + if (i >= 0x3f800000 + (12<<23)) { + /* |x| >= 0x1p12 or inf or nan */ + x = logf(x) + 0.693147180559945309417232121458176568f; + } else if (i >= 0x3f800000 + (1<<23)) { + /* |x| >= 2 */ + x = logf(2*x + 1/(sqrtf(x*x+1)+x)); + } else if (i >= 0x3f800000 - (12<<23)) { + /* |x| >= 0x1p-12, up to 1.6ulp error in [0.125,0.5] */ + x = log1pf(x + x*x/(sqrtf(x*x+1)+1)); + } else { + /* |x| < 0x1p-12, raise inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + } + return s ? -x : x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/asinhl.c b/lib/mlibc/options/ansi/musl-generic-math/asinhl.c new file mode 100644 index 0000000..8635f52 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/asinhl.c @@ -0,0 +1,41 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double asinhl(long double x) +{ + return asinh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* asinh(x) = sign(x)*log(|x|+sqrt(x*x+1)) ~= x - x^3/6 + o(x^5) */ +long double asinhl(long double x) +{ + union ldshape u = {x}; + unsigned e = u.i.se & 0x7fff; + unsigned s = u.i.se >> 15; + + /* |x| */ + u.i.se = e; + x = u.f; + + if (e >= 0x3fff + 32) { + /* |x| >= 0x1p32 or inf or nan */ + x = logl(x) + 0.693147180559945309417232121458176568L; + } else if (e >= 0x3fff + 1) { + /* |x| >= 2 */ + x = logl(2*x + 1/(sqrtl(x*x+1)+x)); + } else if (e >= 0x3fff - 32) { + /* |x| >= 0x1p-32 */ + x = log1pl(x + x*x/(sqrtl(x*x+1)+1)); + } else { + /* |x| < 0x1p-32, raise inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + } + return s ? -x : x; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double asinhl(long double x) +{ + return asinh(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/asinl.c b/lib/mlibc/options/ansi/musl-generic-math/asinl.c new file mode 100644 index 0000000..347c535 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/asinl.c @@ -0,0 +1,71 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_asinl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in asin.c. + * Converted to long double by David Schultz <das@FreeBSD.ORG>. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double asinl(long double x) +{ + return asin(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#include "__invtrigl.h" +#if LDBL_MANT_DIG == 64 +#define CLOSETO1(u) (u.i.m>>56 >= 0xf7) +#define CLEARBOTTOM(u) (u.i.m &= -1ULL << 32) +#elif LDBL_MANT_DIG == 113 +#define CLOSETO1(u) (u.i.top >= 0xee00) +#define CLEARBOTTOM(u) (u.i.lo = 0) +#endif + +long double asinl(long double x) +{ + union ldshape u = {x}; + long double z, r, s; + uint16_t e = u.i.se & 0x7fff; + int sign = u.i.se >> 15; + + if (e >= 0x3fff) { /* |x| >= 1 or nan */ + /* asin(+-1)=+-pi/2 with inexact */ + if (x == 1 || x == -1) + return x*pio2_hi + 0x1p-120f; + return 0/(x-x); + } + if (e < 0x3fff - 1) { /* |x| < 0.5 */ + if (e < 0x3fff - (LDBL_MANT_DIG+1)/2) { + /* return x with inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + return x; + } + return x + x*__invtrigl_R(x*x); + } + /* 1 > |x| >= 0.5 */ + z = (1.0 - fabsl(x))*0.5; + s = sqrtl(z); + r = __invtrigl_R(z); + if (CLOSETO1(u)) { + x = pio2_hi - (2*(s+s*r)-pio2_lo); + } else { + long double f, c; + u.f = s; + CLEARBOTTOM(u); + f = u.f; + c = (z - f*f)/(s + f); + x = 0.5*pio2_hi-(2*s*r - (pio2_lo-2*c) - (0.5*pio2_hi-2*f)); + } + return sign ? -x : x; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/atan.c b/lib/mlibc/options/ansi/musl-generic-math/atan.c new file mode 100644 index 0000000..63b0ab2 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atan.c @@ -0,0 +1,116 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_atan.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* atan(x) + * Method + * 1. Reduce x to positive by atan(x) = -atan(-x). + * 2. According to the integer k=4t+0.25 chopped, t=x, the argument + * is further reduced to one of the following intervals and the + * arctangent of t is evaluated by the corresponding formula: + * + * [0,7/16] atan(x) = t-t^3*(a1+t^2*(a2+...(a10+t^2*a11)...) + * [7/16,11/16] atan(x) = atan(1/2) + atan( (t-0.5)/(1+t/2) ) + * [11/16.19/16] atan(x) = atan( 1 ) + atan( (t-1)/(1+t) ) + * [19/16,39/16] atan(x) = atan(3/2) + atan( (t-1.5)/(1+1.5t) ) + * [39/16,INF] atan(x) = atan(INF) + atan( -1/t ) + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + + +#include "libm.h" + +static const double atanhi[] = { + 4.63647609000806093515e-01, /* atan(0.5)hi 0x3FDDAC67, 0x0561BB4F */ + 7.85398163397448278999e-01, /* atan(1.0)hi 0x3FE921FB, 0x54442D18 */ + 9.82793723247329054082e-01, /* atan(1.5)hi 0x3FEF730B, 0xD281F69B */ + 1.57079632679489655800e+00, /* atan(inf)hi 0x3FF921FB, 0x54442D18 */ +}; + +static const double atanlo[] = { + 2.26987774529616870924e-17, /* atan(0.5)lo 0x3C7A2B7F, 0x222F65E2 */ + 3.06161699786838301793e-17, /* atan(1.0)lo 0x3C81A626, 0x33145C07 */ + 1.39033110312309984516e-17, /* atan(1.5)lo 0x3C700788, 0x7AF0CBBD */ + 6.12323399573676603587e-17, /* atan(inf)lo 0x3C91A626, 0x33145C07 */ +}; + +static const double aT[] = { + 3.33333333333329318027e-01, /* 0x3FD55555, 0x5555550D */ + -1.99999999998764832476e-01, /* 0xBFC99999, 0x9998EBC4 */ + 1.42857142725034663711e-01, /* 0x3FC24924, 0x920083FF */ + -1.11111104054623557880e-01, /* 0xBFBC71C6, 0xFE231671 */ + 9.09088713343650656196e-02, /* 0x3FB745CD, 0xC54C206E */ + -7.69187620504482999495e-02, /* 0xBFB3B0F2, 0xAF749A6D */ + 6.66107313738753120669e-02, /* 0x3FB10D66, 0xA0D03D51 */ + -5.83357013379057348645e-02, /* 0xBFADDE2D, 0x52DEFD9A */ + 4.97687799461593236017e-02, /* 0x3FA97B4B, 0x24760DEB */ + -3.65315727442169155270e-02, /* 0xBFA2B444, 0x2C6A6C2F */ + 1.62858201153657823623e-02, /* 0x3F90AD3A, 0xE322DA11 */ +}; + +double atan(double x) +{ + double_t w,s1,s2,z; + uint32_t ix,sign; + int id; + + GET_HIGH_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + if (ix >= 0x44100000) { /* if |x| >= 2^66 */ + if (isnan(x)) + return x; + z = atanhi[3] + 0x1p-120f; + return sign ? -z : z; + } + if (ix < 0x3fdc0000) { /* |x| < 0.4375 */ + if (ix < 0x3e400000) { /* |x| < 2^-27 */ + if (ix < 0x00100000) + /* raise underflow for subnormal x */ + FORCE_EVAL((float)x); + return x; + } + id = -1; + } else { + x = fabs(x); + if (ix < 0x3ff30000) { /* |x| < 1.1875 */ + if (ix < 0x3fe60000) { /* 7/16 <= |x| < 11/16 */ + id = 0; + x = (2.0*x-1.0)/(2.0+x); + } else { /* 11/16 <= |x| < 19/16 */ + id = 1; + x = (x-1.0)/(x+1.0); + } + } else { + if (ix < 0x40038000) { /* |x| < 2.4375 */ + id = 2; + x = (x-1.5)/(1.0+1.5*x); + } else { /* 2.4375 <= |x| < 2^66 */ + id = 3; + x = -1.0/x; + } + } + } + /* end of argument reduction */ + z = x*x; + w = z*z; + /* break sum from i=0 to 10 aT[i]z**(i+1) into odd and even poly */ + s1 = z*(aT[0]+w*(aT[2]+w*(aT[4]+w*(aT[6]+w*(aT[8]+w*aT[10]))))); + s2 = w*(aT[1]+w*(aT[3]+w*(aT[5]+w*(aT[7]+w*aT[9])))); + if (id < 0) + return x - x*(s1+s2); + z = atanhi[id] - (x*(s1+s2) - atanlo[id] - x); + return sign ? -z : z; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/atan2.c b/lib/mlibc/options/ansi/musl-generic-math/atan2.c new file mode 100644 index 0000000..5a1903c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atan2.c @@ -0,0 +1,107 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_atan2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ +/* atan2(y,x) + * Method : + * 1. Reduce y to positive by atan2(y,x)=-atan2(-y,x). + * 2. Reduce x to positive by (if x and y are unexceptional): + * ARG (x+iy) = arctan(y/x) ... if x > 0, + * ARG (x+iy) = pi - arctan[y/(-x)] ... if x < 0, + * + * Special cases: + * + * ATAN2((anything), NaN ) is NaN; + * ATAN2(NAN , (anything) ) is NaN; + * ATAN2(+-0, +(anything but NaN)) is +-0 ; + * ATAN2(+-0, -(anything but NaN)) is +-pi ; + * ATAN2(+-(anything but 0 and NaN), 0) is +-pi/2; + * ATAN2(+-(anything but INF and NaN), +INF) is +-0 ; + * ATAN2(+-(anything but INF and NaN), -INF) is +-pi; + * ATAN2(+-INF,+INF ) is +-pi/4 ; + * ATAN2(+-INF,-INF ) is +-3pi/4; + * ATAN2(+-INF, (anything but,0,NaN, and INF)) is +-pi/2; + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "libm.h" + +static const double +pi = 3.1415926535897931160E+00, /* 0x400921FB, 0x54442D18 */ +pi_lo = 1.2246467991473531772E-16; /* 0x3CA1A626, 0x33145C07 */ + +double atan2(double y, double x) +{ + double z; + uint32_t m,lx,ly,ix,iy; + + if (isnan(x) || isnan(y)) + return x+y; + EXTRACT_WORDS(ix, lx, x); + EXTRACT_WORDS(iy, ly, y); + if ((ix-0x3ff00000 | lx) == 0) /* x = 1.0 */ + return atan(y); + m = ((iy>>31)&1) | ((ix>>30)&2); /* 2*sign(x)+sign(y) */ + ix = ix & 0x7fffffff; + iy = iy & 0x7fffffff; + + /* when y = 0 */ + if ((iy|ly) == 0) { + switch(m) { + case 0: + case 1: return y; /* atan(+-0,+anything)=+-0 */ + case 2: return pi; /* atan(+0,-anything) = pi */ + case 3: return -pi; /* atan(-0,-anything) =-pi */ + } + } + /* when x = 0 */ + if ((ix|lx) == 0) + return m&1 ? -pi/2 : pi/2; + /* when x is INF */ + if (ix == 0x7ff00000) { + if (iy == 0x7ff00000) { + switch(m) { + case 0: return pi/4; /* atan(+INF,+INF) */ + case 1: return -pi/4; /* atan(-INF,+INF) */ + case 2: return 3*pi/4; /* atan(+INF,-INF) */ + case 3: return -3*pi/4; /* atan(-INF,-INF) */ + } + } else { + switch(m) { + case 0: return 0.0; /* atan(+...,+INF) */ + case 1: return -0.0; /* atan(-...,+INF) */ + case 2: return pi; /* atan(+...,-INF) */ + case 3: return -pi; /* atan(-...,-INF) */ + } + } + } + /* |y/x| > 0x1p64 */ + if (ix+(64<<20) < iy || iy == 0x7ff00000) + return m&1 ? -pi/2 : pi/2; + + /* z = atan(|y/x|) without spurious underflow */ + if ((m&2) && iy+(64<<20) < ix) /* |y/x| < 0x1p-64, x<0 */ + z = 0; + else + z = atan(fabs(y/x)); + switch (m) { + case 0: return z; /* atan(+,+) */ + case 1: return -z; /* atan(-,+) */ + case 2: return pi - (z-pi_lo); /* atan(+,-) */ + default: /* case 3 */ + return (z-pi_lo) - pi; /* atan(-,-) */ + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/atan2f.c b/lib/mlibc/options/ansi/musl-generic-math/atan2f.c new file mode 100644 index 0000000..c634d00 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atan2f.c @@ -0,0 +1,83 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_atan2f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +pi = 3.1415927410e+00, /* 0x40490fdb */ +pi_lo = -8.7422776573e-08; /* 0xb3bbbd2e */ + +float atan2f(float y, float x) +{ + float z; + uint32_t m,ix,iy; + + if (isnan(x) || isnan(y)) + return x+y; + GET_FLOAT_WORD(ix, x); + GET_FLOAT_WORD(iy, y); + if (ix == 0x3f800000) /* x=1.0 */ + return atanf(y); + m = ((iy>>31)&1) | ((ix>>30)&2); /* 2*sign(x)+sign(y) */ + ix &= 0x7fffffff; + iy &= 0x7fffffff; + + /* when y = 0 */ + if (iy == 0) { + switch (m) { + case 0: + case 1: return y; /* atan(+-0,+anything)=+-0 */ + case 2: return pi; /* atan(+0,-anything) = pi */ + case 3: return -pi; /* atan(-0,-anything) =-pi */ + } + } + /* when x = 0 */ + if (ix == 0) + return m&1 ? -pi/2 : pi/2; + /* when x is INF */ + if (ix == 0x7f800000) { + if (iy == 0x7f800000) { + switch (m) { + case 0: return pi/4; /* atan(+INF,+INF) */ + case 1: return -pi/4; /* atan(-INF,+INF) */ + case 2: return 3*pi/4; /*atan(+INF,-INF)*/ + case 3: return -3*pi/4; /*atan(-INF,-INF)*/ + } + } else { + switch (m) { + case 0: return 0.0f; /* atan(+...,+INF) */ + case 1: return -0.0f; /* atan(-...,+INF) */ + case 2: return pi; /* atan(+...,-INF) */ + case 3: return -pi; /* atan(-...,-INF) */ + } + } + } + /* |y/x| > 0x1p26 */ + if (ix+(26<<23) < iy || iy == 0x7f800000) + return m&1 ? -pi/2 : pi/2; + + /* z = atan(|y/x|) with correct underflow */ + if ((m&2) && iy+(26<<23) < ix) /*|y/x| < 0x1p-26, x < 0 */ + z = 0.0; + else + z = atanf(fabsf(y/x)); + switch (m) { + case 0: return z; /* atan(+,+) */ + case 1: return -z; /* atan(-,+) */ + case 2: return pi - (z-pi_lo); /* atan(+,-) */ + default: /* case 3 */ + return (z-pi_lo) - pi; /* atan(-,-) */ + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/atan2l.c b/lib/mlibc/options/ansi/musl-generic-math/atan2l.c new file mode 100644 index 0000000..f0937a9 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atan2l.c @@ -0,0 +1,85 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_atan2l.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ +/* + * See comments in atan2.c. + * Converted to long double by David Schultz <das@FreeBSD.ORG>. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double atan2l(long double y, long double x) +{ + return atan2(y, x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#include "__invtrigl.h" + +long double atan2l(long double y, long double x) +{ + union ldshape ux, uy; + long double z; + int m, ex, ey; + + if (isnan(x) || isnan(y)) + return x+y; + if (x == 1) + return atanl(y); + ux.f = x; + uy.f = y; + ex = ux.i.se & 0x7fff; + ey = uy.i.se & 0x7fff; + m = 2*(ux.i.se>>15) | uy.i.se>>15; + if (y == 0) { + switch(m) { + case 0: + case 1: return y; /* atan(+-0,+anything)=+-0 */ + case 2: return 2*pio2_hi; /* atan(+0,-anything) = pi */ + case 3: return -2*pio2_hi; /* atan(-0,-anything) =-pi */ + } + } + if (x == 0) + return m&1 ? -pio2_hi : pio2_hi; + if (ex == 0x7fff) { + if (ey == 0x7fff) { + switch(m) { + case 0: return pio2_hi/2; /* atan(+INF,+INF) */ + case 1: return -pio2_hi/2; /* atan(-INF,+INF) */ + case 2: return 1.5*pio2_hi; /* atan(+INF,-INF) */ + case 3: return -1.5*pio2_hi; /* atan(-INF,-INF) */ + } + } else { + switch(m) { + case 0: return 0.0; /* atan(+...,+INF) */ + case 1: return -0.0; /* atan(-...,+INF) */ + case 2: return 2*pio2_hi; /* atan(+...,-INF) */ + case 3: return -2*pio2_hi; /* atan(-...,-INF) */ + } + } + } + if (ex+120 < ey || ey == 0x7fff) + return m&1 ? -pio2_hi : pio2_hi; + /* z = atan(|y/x|) without spurious underflow */ + if ((m&2) && ey+120 < ex) /* |y/x| < 0x1p-120, x<0 */ + z = 0.0; + else + z = atanl(fabsl(y/x)); + switch (m) { + case 0: return z; /* atan(+,+) */ + case 1: return -z; /* atan(-,+) */ + case 2: return 2*pio2_hi-(z-2*pio2_lo); /* atan(+,-) */ + default: /* case 3 */ + return (z-2*pio2_lo)-2*pio2_hi; /* atan(-,-) */ + } +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/atanf.c b/lib/mlibc/options/ansi/musl-generic-math/atanf.c new file mode 100644 index 0000000..178341b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atanf.c @@ -0,0 +1,94 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_atanf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + + +#include "libm.h" + +static const float atanhi[] = { + 4.6364760399e-01, /* atan(0.5)hi 0x3eed6338 */ + 7.8539812565e-01, /* atan(1.0)hi 0x3f490fda */ + 9.8279368877e-01, /* atan(1.5)hi 0x3f7b985e */ + 1.5707962513e+00, /* atan(inf)hi 0x3fc90fda */ +}; + +static const float atanlo[] = { + 5.0121582440e-09, /* atan(0.5)lo 0x31ac3769 */ + 3.7748947079e-08, /* atan(1.0)lo 0x33222168 */ + 3.4473217170e-08, /* atan(1.5)lo 0x33140fb4 */ + 7.5497894159e-08, /* atan(inf)lo 0x33a22168 */ +}; + +static const float aT[] = { + 3.3333328366e-01, + -1.9999158382e-01, + 1.4253635705e-01, + -1.0648017377e-01, + 6.1687607318e-02, +}; + +float atanf(float x) +{ + float_t w,s1,s2,z; + uint32_t ix,sign; + int id; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x4c800000) { /* if |x| >= 2**26 */ + if (isnan(x)) + return x; + z = atanhi[3] + 0x1p-120f; + return sign ? -z : z; + } + if (ix < 0x3ee00000) { /* |x| < 0.4375 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + if (ix < 0x00800000) + /* raise underflow for subnormal x */ + FORCE_EVAL(x*x); + return x; + } + id = -1; + } else { + x = fabsf(x); + if (ix < 0x3f980000) { /* |x| < 1.1875 */ + if (ix < 0x3f300000) { /* 7/16 <= |x| < 11/16 */ + id = 0; + x = (2.0f*x - 1.0f)/(2.0f + x); + } else { /* 11/16 <= |x| < 19/16 */ + id = 1; + x = (x - 1.0f)/(x + 1.0f); + } + } else { + if (ix < 0x401c0000) { /* |x| < 2.4375 */ + id = 2; + x = (x - 1.5f)/(1.0f + 1.5f*x); + } else { /* 2.4375 <= |x| < 2**26 */ + id = 3; + x = -1.0f/x; + } + } + } + /* end of argument reduction */ + z = x*x; + w = z*z; + /* break sum from i=0 to 10 aT[i]z**(i+1) into odd and even poly */ + s1 = z*(aT[0]+w*(aT[2]+w*aT[4])); + s2 = w*(aT[1]+w*aT[3]); + if (id < 0) + return x - x*(s1+s2); + z = atanhi[id] - ((x*(s1+s2) - atanlo[id]) - x); + return sign ? -z : z; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/atanh.c b/lib/mlibc/options/ansi/musl-generic-math/atanh.c new file mode 100644 index 0000000..63a035d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atanh.c @@ -0,0 +1,29 @@ +#include "libm.h" + +/* atanh(x) = log((1+x)/(1-x))/2 = log1p(2x/(1-x))/2 ~= x + x^3/3 + o(x^5) */ +double atanh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + unsigned e = u.i >> 52 & 0x7ff; + unsigned s = u.i >> 63; + double_t y; + + /* |x| */ + u.i &= (uint64_t)-1/2; + y = u.f; + + if (e < 0x3ff - 1) { + if (e < 0x3ff - 32) { + /* handle underflow */ + if (e == 0) + FORCE_EVAL((float)y); + } else { + /* |x| < 0.5, up to 1.7ulp error */ + y = 0.5*log1p(2*y + 2*y*y/(1-y)); + } + } else { + /* avoid overflow */ + y = 0.5*log1p(2*(y/(1-y))); + } + return s ? -y : y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/atanhf.c b/lib/mlibc/options/ansi/musl-generic-math/atanhf.c new file mode 100644 index 0000000..65f07c0 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atanhf.c @@ -0,0 +1,28 @@ +#include "libm.h" + +/* atanh(x) = log((1+x)/(1-x))/2 = log1p(2x/(1-x))/2 ~= x + x^3/3 + o(x^5) */ +float atanhf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + unsigned s = u.i >> 31; + float_t y; + + /* |x| */ + u.i &= 0x7fffffff; + y = u.f; + + if (u.i < 0x3f800000 - (1<<23)) { + if (u.i < 0x3f800000 - (32<<23)) { + /* handle underflow */ + if (u.i < (1<<23)) + FORCE_EVAL((float)(y*y)); + } else { + /* |x| < 0.5, up to 1.7ulp error */ + y = 0.5f*log1pf(2*y + 2*y*y/(1-y)); + } + } else { + /* avoid overflow */ + y = 0.5f*log1pf(2*(y/(1-y))); + } + return s ? -y : y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/atanhl.c b/lib/mlibc/options/ansi/musl-generic-math/atanhl.c new file mode 100644 index 0000000..87cd1cd --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atanhl.c @@ -0,0 +1,35 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double atanhl(long double x) +{ + return atanh(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +/* atanh(x) = log((1+x)/(1-x))/2 = log1p(2x/(1-x))/2 ~= x + x^3/3 + o(x^5) */ +long double atanhl(long double x) +{ + union ldshape u = {x}; + unsigned e = u.i.se & 0x7fff; + unsigned s = u.i.se >> 15; + + /* |x| */ + u.i.se = e; + x = u.f; + + if (e < 0x3ff - 1) { + if (e < 0x3ff - LDBL_MANT_DIG/2) { + /* handle underflow */ + if (e == 0) + FORCE_EVAL((float)x); + } else { + /* |x| < 0.5, up to 1.7ulp error */ + x = 0.5*log1pl(2*x + 2*x*x/(1-x)); + } + } else { + /* avoid overflow */ + x = 0.5*log1pl(2*(x/(1-x))); + } + return s ? -x : x; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/atanl.c b/lib/mlibc/options/ansi/musl-generic-math/atanl.c new file mode 100644 index 0000000..79a3edb --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/atanl.c @@ -0,0 +1,184 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_atanl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in atan.c. + * Converted to long double by David Schultz <das@FreeBSD.ORG>. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double atanl(long double x) +{ + return atan(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +#if LDBL_MANT_DIG == 64 +#define EXPMAN(u) ((u.i.se & 0x7fff)<<8 | (u.i.m>>55 & 0xff)) + +static const long double atanhi[] = { + 4.63647609000806116202e-01L, + 7.85398163397448309628e-01L, + 9.82793723247329067960e-01L, + 1.57079632679489661926e+00L, +}; + +static const long double atanlo[] = { + 1.18469937025062860669e-20L, + -1.25413940316708300586e-20L, + 2.55232234165405176172e-20L, + -2.50827880633416601173e-20L, +}; + +static const long double aT[] = { + 3.33333333333333333017e-01L, + -1.99999999999999632011e-01L, + 1.42857142857046531280e-01L, + -1.11111111100562372733e-01L, + 9.09090902935647302252e-02L, + -7.69230552476207730353e-02L, + 6.66661718042406260546e-02L, + -5.88158892835030888692e-02L, + 5.25499891539726639379e-02L, + -4.70119845393155721494e-02L, + 4.03539201366454414072e-02L, + -2.91303858419364158725e-02L, + 1.24822046299269234080e-02L, +}; + +static long double T_even(long double x) +{ + return aT[0] + x * (aT[2] + x * (aT[4] + x * (aT[6] + + x * (aT[8] + x * (aT[10] + x * aT[12]))))); +} + +static long double T_odd(long double x) +{ + return aT[1] + x * (aT[3] + x * (aT[5] + x * (aT[7] + + x * (aT[9] + x * aT[11])))); +} +#elif LDBL_MANT_DIG == 113 +#define EXPMAN(u) ((u.i.se & 0x7fff)<<8 | u.i.top>>8) + +const long double atanhi[] = { + 4.63647609000806116214256231461214397e-01L, + 7.85398163397448309615660845819875699e-01L, + 9.82793723247329067985710611014666038e-01L, + 1.57079632679489661923132169163975140e+00L, +}; + +const long double atanlo[] = { + 4.89509642257333492668618435220297706e-36L, + 2.16795253253094525619926100651083806e-35L, + -2.31288434538183565909319952098066272e-35L, + 4.33590506506189051239852201302167613e-35L, +}; + +const long double aT[] = { + 3.33333333333333333333333333333333125e-01L, + -1.99999999999999999999999999999180430e-01L, + 1.42857142857142857142857142125269827e-01L, + -1.11111111111111111111110834490810169e-01L, + 9.09090909090909090908522355708623681e-02L, + -7.69230769230769230696553844935357021e-02L, + 6.66666666666666660390096773046256096e-02L, + -5.88235294117646671706582985209643694e-02L, + 5.26315789473666478515847092020327506e-02L, + -4.76190476189855517021024424991436144e-02L, + 4.34782608678695085948531993458097026e-02L, + -3.99999999632663469330634215991142368e-02L, + 3.70370363987423702891250829918659723e-02L, + -3.44827496515048090726669907612335954e-02L, + 3.22579620681420149871973710852268528e-02L, + -3.03020767654269261041647570626778067e-02L, + 2.85641979882534783223403715930946138e-02L, + -2.69824879726738568189929461383741323e-02L, + 2.54194698498808542954187110873675769e-02L, + -2.35083879708189059926183138130183215e-02L, + 2.04832358998165364349957325067131428e-02L, + -1.54489555488544397858507248612362957e-02L, + 8.64492360989278761493037861575248038e-03L, + -2.58521121597609872727919154569765469e-03L, +}; + +static long double T_even(long double x) +{ + return (aT[0] + x * (aT[2] + x * (aT[4] + x * (aT[6] + x * (aT[8] + + x * (aT[10] + x * (aT[12] + x * (aT[14] + x * (aT[16] + + x * (aT[18] + x * (aT[20] + x * aT[22]))))))))))); +} + +static long double T_odd(long double x) +{ + return (aT[1] + x * (aT[3] + x * (aT[5] + x * (aT[7] + x * (aT[9] + + x * (aT[11] + x * (aT[13] + x * (aT[15] + x * (aT[17] + + x * (aT[19] + x * (aT[21] + x * aT[23]))))))))))); +} +#endif + +long double atanl(long double x) +{ + union ldshape u = {x}; + long double w, s1, s2, z; + int id; + unsigned e = u.i.se & 0x7fff; + unsigned sign = u.i.se >> 15; + unsigned expman; + + if (e >= 0x3fff + LDBL_MANT_DIG + 1) { /* if |x| is large, atan(x)~=pi/2 */ + if (isnan(x)) + return x; + return sign ? -atanhi[3] : atanhi[3]; + } + /* Extract the exponent and the first few bits of the mantissa. */ + expman = EXPMAN(u); + if (expman < ((0x3fff - 2) << 8) + 0xc0) { /* |x| < 0.4375 */ + if (e < 0x3fff - (LDBL_MANT_DIG+1)/2) { /* if |x| is small, atanl(x)~=x */ + /* raise underflow if subnormal */ + if (e == 0) + FORCE_EVAL((float)x); + return x; + } + id = -1; + } else { + x = fabsl(x); + if (expman < (0x3fff << 8) + 0x30) { /* |x| < 1.1875 */ + if (expman < ((0x3fff - 1) << 8) + 0x60) { /* 7/16 <= |x| < 11/16 */ + id = 0; + x = (2.0*x-1.0)/(2.0+x); + } else { /* 11/16 <= |x| < 19/16 */ + id = 1; + x = (x-1.0)/(x+1.0); + } + } else { + if (expman < ((0x3fff + 1) << 8) + 0x38) { /* |x| < 2.4375 */ + id = 2; + x = (x-1.5)/(1.0+1.5*x); + } else { /* 2.4375 <= |x| */ + id = 3; + x = -1.0/x; + } + } + } + /* end of argument reduction */ + z = x*x; + w = z*z; + /* break sum aT[i]z**(i+1) into odd and even poly */ + s1 = z*T_even(w); + s2 = w*T_odd(w); + if (id < 0) + return x - x*(s1+s2); + z = atanhi[id] - ((x*(s1+s2) - atanlo[id]) - x); + return sign ? -z : z; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/cbrt.c b/lib/mlibc/options/ansi/musl-generic-math/cbrt.c new file mode 100644 index 0000000..7599d3e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/cbrt.c @@ -0,0 +1,103 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cbrt.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + * Optimized by Bruce D. Evans. + */ +/* cbrt(x) + * Return cube root of x + */ + +#include <math.h> +#include <stdint.h> + +static const uint32_t +B1 = 715094163, /* B1 = (1023-1023/3-0.03306235651)*2**20 */ +B2 = 696219795; /* B2 = (1023-1023/3-54/3-0.03306235651)*2**20 */ + +/* |1/cbrt(x) - p(x)| < 2**-23.5 (~[-7.93e-8, 7.929e-8]). */ +static const double +P0 = 1.87595182427177009643, /* 0x3ffe03e6, 0x0f61e692 */ +P1 = -1.88497979543377169875, /* 0xbffe28e0, 0x92f02420 */ +P2 = 1.621429720105354466140, /* 0x3ff9f160, 0x4a49d6c2 */ +P3 = -0.758397934778766047437, /* 0xbfe844cb, 0xbee751d9 */ +P4 = 0.145996192886612446982; /* 0x3fc2b000, 0xd4e4edd7 */ + +double cbrt(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t r,s,t,w; + uint32_t hx = u.i>>32 & 0x7fffffff; + + if (hx >= 0x7ff00000) /* cbrt(NaN,INF) is itself */ + return x+x; + + /* + * Rough cbrt to 5 bits: + * cbrt(2**e*(1+m) ~= 2**(e/3)*(1+(e%3+m)/3) + * where e is integral and >= 0, m is real and in [0, 1), and "/" and + * "%" are integer division and modulus with rounding towards minus + * infinity. The RHS is always >= the LHS and has a maximum relative + * error of about 1 in 16. Adding a bias of -0.03306235651 to the + * (e%3+m)/3 term reduces the error to about 1 in 32. With the IEEE + * floating point representation, for finite positive normal values, + * ordinary integer divison of the value in bits magically gives + * almost exactly the RHS of the above provided we first subtract the + * exponent bias (1023 for doubles) and later add it back. We do the + * subtraction virtually to keep e >= 0 so that ordinary integer + * division rounds towards minus infinity; this is also efficient. + */ + if (hx < 0x00100000) { /* zero or subnormal? */ + u.f = x*0x1p54; + hx = u.i>>32 & 0x7fffffff; + if (hx == 0) + return x; /* cbrt(0) is itself */ + hx = hx/3 + B2; + } else + hx = hx/3 + B1; + u.i &= 1ULL<<63; + u.i |= (uint64_t)hx << 32; + t = u.f; + + /* + * New cbrt to 23 bits: + * cbrt(x) = t*cbrt(x/t**3) ~= t*P(t**3/x) + * where P(r) is a polynomial of degree 4 that approximates 1/cbrt(r) + * to within 2**-23.5 when |r - 1| < 1/10. The rough approximation + * has produced t such than |t/cbrt(x) - 1| ~< 1/32, and cubing this + * gives us bounds for r = t**3/x. + * + * Try to optimize for parallel evaluation as in __tanf.c. + */ + r = (t*t)*(t/x); + t = t*((P0+r*(P1+r*P2))+((r*r)*r)*(P3+r*P4)); + + /* + * Round t away from zero to 23 bits (sloppily except for ensuring that + * the result is larger in magnitude than cbrt(x) but not much more than + * 2 23-bit ulps larger). With rounding towards zero, the error bound + * would be ~5/6 instead of ~4/6. With a maximum error of 2 23-bit ulps + * in the rounded t, the infinite-precision error in the Newton + * approximation barely affects third digit in the final error + * 0.667; the error in the rounded t can be up to about 3 23-bit ulps + * before the final error is larger than 0.667 ulps. + */ + u.f = t; + u.i = (u.i + 0x80000000) & 0xffffffffc0000000ULL; + t = u.f; + + /* one step Newton iteration to 53 bits with error < 0.667 ulps */ + s = t*t; /* t*t is exact */ + r = x/s; /* error <= 0.5 ulps; |r| < |t| */ + w = t+t; /* t+t is exact */ + r = (r-t)/(w+r); /* r-t is exact; w+r ~= 3*t */ + t = t+t*r; /* error <= 0.5 + 0.5/3 + epsilon */ + return t; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/cbrtf.c b/lib/mlibc/options/ansi/musl-generic-math/cbrtf.c new file mode 100644 index 0000000..89c2c86 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/cbrtf.c @@ -0,0 +1,66 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cbrtf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Debugged and optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* cbrtf(x) + * Return cube root of x + */ + +#include <math.h> +#include <stdint.h> + +static const unsigned +B1 = 709958130, /* B1 = (127-127.0/3-0.03306235651)*2**23 */ +B2 = 642849266; /* B2 = (127-127.0/3-24/3-0.03306235651)*2**23 */ + +float cbrtf(float x) +{ + double_t r,T; + union {float f; uint32_t i;} u = {x}; + uint32_t hx = u.i & 0x7fffffff; + + if (hx >= 0x7f800000) /* cbrt(NaN,INF) is itself */ + return x + x; + + /* rough cbrt to 5 bits */ + if (hx < 0x00800000) { /* zero or subnormal? */ + if (hx == 0) + return x; /* cbrt(+-0) is itself */ + u.f = x*0x1p24f; + hx = u.i & 0x7fffffff; + hx = hx/3 + B2; + } else + hx = hx/3 + B1; + u.i &= 0x80000000; + u.i |= hx; + + /* + * First step Newton iteration (solving t*t-x/t == 0) to 16 bits. In + * double precision so that its terms can be arranged for efficiency + * without causing overflow or underflow. + */ + T = u.f; + r = T*T*T; + T = T*((double_t)x+x+r)/(x+r+r); + + /* + * Second step Newton iteration to 47 bits. In double precision for + * efficiency and accuracy. + */ + r = T*T*T; + T = T*((double_t)x+x+r)/(x+r+r); + + /* rounding to 24 bits is perfect in round-to-nearest mode */ + return T; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/cbrtl.c b/lib/mlibc/options/ansi/musl-generic-math/cbrtl.c new file mode 100644 index 0000000..ceff913 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/cbrtl.c @@ -0,0 +1,124 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cbrtl.c */ +/*- + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * Copyright (c) 2009-2011, Bruce D. Evans, Steven G. Kargl, David Schultz. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + * The argument reduction and testing for exceptional cases was + * written by Steven G. Kargl with input from Bruce D. Evans + * and David A. Schultz. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double cbrtl(long double x) +{ + return cbrt(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +static const unsigned B1 = 709958130; /* B1 = (127-127.0/3-0.03306235651)*2**23 */ + +long double cbrtl(long double x) +{ + union ldshape u = {x}, v; + union {float f; uint32_t i;} uft; + long double r, s, t, w; + double_t dr, dt, dx; + float_t ft; + int e = u.i.se & 0x7fff; + int sign = u.i.se & 0x8000; + + /* + * If x = +-Inf, then cbrt(x) = +-Inf. + * If x = NaN, then cbrt(x) = NaN. + */ + if (e == 0x7fff) + return x + x; + if (e == 0) { + /* Adjust subnormal numbers. */ + u.f *= 0x1p120; + e = u.i.se & 0x7fff; + /* If x = +-0, then cbrt(x) = +-0. */ + if (e == 0) + return x; + e -= 120; + } + e -= 0x3fff; + u.i.se = 0x3fff; + x = u.f; + switch (e % 3) { + case 1: + case -2: + x *= 2; + e--; + break; + case 2: + case -1: + x *= 4; + e -= 2; + break; + } + v.f = 1.0; + v.i.se = sign | (0x3fff + e/3); + + /* + * The following is the guts of s_cbrtf, with the handling of + * special values removed and extra care for accuracy not taken, + * but with most of the extra accuracy not discarded. + */ + + /* ~5-bit estimate: */ + uft.f = x; + uft.i = (uft.i & 0x7fffffff)/3 + B1; + ft = uft.f; + + /* ~16-bit estimate: */ + dx = x; + dt = ft; + dr = dt * dt * dt; + dt = dt * (dx + dx + dr) / (dx + dr + dr); + + /* ~47-bit estimate: */ + dr = dt * dt * dt; + dt = dt * (dx + dx + dr) / (dx + dr + dr); + +#if LDBL_MANT_DIG == 64 + /* + * dt is cbrtl(x) to ~47 bits (after x has been reduced to 1 <= x < 8). + * Round it away from zero to 32 bits (32 so that t*t is exact, and + * away from zero for technical reasons). + */ + t = dt + (0x1.0p32L + 0x1.0p-31L) - 0x1.0p32; +#elif LDBL_MANT_DIG == 113 + /* + * Round dt away from zero to 47 bits. Since we don't trust the 47, + * add 2 47-bit ulps instead of 1 to round up. Rounding is slow and + * might be avoidable in this case, since on most machines dt will + * have been evaluated in 53-bit precision and the technical reasons + * for rounding up might not apply to either case in cbrtl() since + * dt is much more accurate than needed. + */ + t = dt + 0x2.0p-46 + 0x1.0p60L - 0x1.0p60; +#endif + + /* + * Final step Newton iteration to 64 or 113 bits with + * error < 0.667 ulps + */ + s = t*t; /* t*t is exact */ + r = x/s; /* error <= 0.5 ulps; |r| < |t| */ + w = t+t; /* t+t is exact */ + r = (r-t)/(w+r); /* r-t is exact; w+r ~= 3*t */ + t = t+t*r; /* error <= 0.5 + 0.5/3 + epsilon */ + + t *= v.f; + return t; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/ceil.c b/lib/mlibc/options/ansi/musl-generic-math/ceil.c new file mode 100644 index 0000000..b13e6f2 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ceil.c @@ -0,0 +1,31 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const double_t toint = 1/EPS; + +double ceil(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i >> 52 & 0x7ff; + double_t y; + + if (e >= 0x3ff+52 || x == 0) + return x; + /* y = int(x) - x, where int(x) is an integer neighbor of x */ + if (u.i >> 63) + y = x - toint + toint - x; + else + y = x + toint - toint - x; + /* special case because of non-nearest rounding modes */ + if (e <= 0x3ff-1) { + FORCE_EVAL(y); + return u.i >> 63 ? -0.0 : 1; + } + if (y < 0) + return x + y + 1; + return x + y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/ceilf.c b/lib/mlibc/options/ansi/musl-generic-math/ceilf.c new file mode 100644 index 0000000..869835f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ceilf.c @@ -0,0 +1,27 @@ +#include "libm.h" + +float ceilf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = (int)(u.i >> 23 & 0xff) - 0x7f; + uint32_t m; + + if (e >= 23) + return x; + if (e >= 0) { + m = 0x007fffff >> e; + if ((u.i & m) == 0) + return x; + FORCE_EVAL(x + 0x1p120f); + if (u.i >> 31 == 0) + u.i += m; + u.i &= ~m; + } else { + FORCE_EVAL(x + 0x1p120f); + if (u.i >> 31) + u.f = -0.0; + else if (u.i << 1) + u.f = 1.0; + } + return u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/ceill.c b/lib/mlibc/options/ansi/musl-generic-math/ceill.c new file mode 100644 index 0000000..60a8302 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ceill.c @@ -0,0 +1,34 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double ceill(long double x) +{ + return ceil(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double ceill(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1 || x == 0) + return x; + /* y = int(x) - x, where int(x) is an integer neighbor of x */ + if (u.i.se >> 15) + y = x - toint + toint - x; + else + y = x + toint - toint - x; + /* special case because of non-nearest rounding modes */ + if (e <= 0x3fff-1) { + FORCE_EVAL(y); + return u.i.se >> 15 ? -0.0 : 1; + } + if (y < 0) + return x + y + 1; + return x + y; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/copysign.c b/lib/mlibc/options/ansi/musl-generic-math/copysign.c new file mode 100644 index 0000000..b09331b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/copysign.c @@ -0,0 +1,8 @@ +#include "libm.h" + +double copysign(double x, double y) { + union {double f; uint64_t i;} ux={x}, uy={y}; + ux.i &= -1ULL/2; + ux.i |= uy.i & 1ULL<<63; + return ux.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/copysignf.c b/lib/mlibc/options/ansi/musl-generic-math/copysignf.c new file mode 100644 index 0000000..0af6ae9 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/copysignf.c @@ -0,0 +1,10 @@ +#include <math.h> +#include <stdint.h> + +float copysignf(float x, float y) +{ + union {float f; uint32_t i;} ux={x}, uy={y}; + ux.i &= 0x7fffffff; + ux.i |= uy.i & 0x80000000; + return ux.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/copysignl.c b/lib/mlibc/options/ansi/musl-generic-math/copysignl.c new file mode 100644 index 0000000..9dd933c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/copysignl.c @@ -0,0 +1,16 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double copysignl(long double x, long double y) +{ + return copysign(x, y); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double copysignl(long double x, long double y) +{ + union ldshape ux = {x}, uy = {y}; + ux.i.se &= 0x7fff; + ux.i.se |= uy.i.se & 0x8000; + return ux.f; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/cos.c b/lib/mlibc/options/ansi/musl-generic-math/cos.c new file mode 100644 index 0000000..ee97f68 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/cos.c @@ -0,0 +1,77 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cos.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* cos(x) + * Return cosine function of x. + * + * kernel function: + * __sin ... sine function on [-pi/4,pi/4] + * __cos ... cosine function on [-pi/4,pi/4] + * __rem_pio2 ... argument reduction routine + * + * Method. + * Let S,C and T denote the sin, cos and tan respectively on + * [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 + * in [-pi/4 , +pi/4], and let n = k mod 4. + * We have + * + * n sin(x) cos(x) tan(x) + * ---------------------------------------------------------- + * 0 S C T + * 1 C -S -1/T + * 2 -S -C T + * 3 -C S -1/T + * ---------------------------------------------------------- + * + * Special cases: + * Let trig be any of sin, cos, or tan. + * trig(+-INF) is NaN, with signals; + * trig(NaN) is that NaN; + * + * Accuracy: + * TRIG(x) returns trig(x) nearly rounded + */ + +#include "libm.h" + +double cos(double x) +{ + double y[2]; + uint32_t ix; + unsigned n; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* |x| ~< pi/4 */ + if (ix <= 0x3fe921fb) { + if (ix < 0x3e46a09e) { /* |x| < 2**-27 * sqrt(2) */ + /* raise inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + return 1.0; + } + return __cos(x, 0); + } + + /* cos(Inf or NaN) is NaN */ + if (ix >= 0x7ff00000) + return x-x; + + /* argument reduction */ + n = __rem_pio2(x, y); + switch (n&3) { + case 0: return __cos(y[0], y[1]); + case 1: return -__sin(y[0], y[1], 1); + case 2: return -__cos(y[0], y[1]); + default: + return __sin(y[0], y[1], 1); + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/cosf.c b/lib/mlibc/options/ansi/musl-generic-math/cosf.c new file mode 100644 index 0000000..23f3e5b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/cosf.c @@ -0,0 +1,78 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_cosf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* Small multiples of pi/2 rounded to double precision. */ +static const double +c1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ +c2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ +c3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ +c4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + +float cosf(float x) +{ + double y; + uint32_t ix; + unsigned n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x != 0 */ + FORCE_EVAL(x + 0x1p120f); + return 1.0f; + } + return __cosdf(x); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix > 0x4016cbe3) /* |x| ~> 3*pi/4 */ + return -__cosdf(sign ? x+c2pio2 : x-c2pio2); + else { + if (sign) + return __sindf(x + c1pio2); + else + return __sindf(c1pio2 - x); + } + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix > 0x40afeddf) /* |x| ~> 7*pi/4 */ + return __cosdf(sign ? x+c4pio2 : x-c4pio2); + else { + if (sign) + return __sindf(-x - c3pio2); + else + return __sindf(x - c3pio2); + } + } + + /* cos(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x-x; + + /* general argument reduction needed */ + n = __rem_pio2f(x,&y); + switch (n&3) { + case 0: return __cosdf(y); + case 1: return __sindf(-y); + case 2: return -__cosdf(y); + default: + return __sindf(y); + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/cosh.c b/lib/mlibc/options/ansi/musl-generic-math/cosh.c new file mode 100644 index 0000000..100f823 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/cosh.c @@ -0,0 +1,40 @@ +#include "libm.h" + +/* cosh(x) = (exp(x) + 1/exp(x))/2 + * = 1 + 0.5*(exp(x)-1)*(exp(x)-1)/exp(x) + * = 1 + x*x/2 + o(x^4) + */ +double cosh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + uint32_t w; + double t; + + /* |x| */ + u.i &= (uint64_t)-1/2; + x = u.f; + w = u.i >> 32; + + /* |x| < log(2) */ + if (w < 0x3fe62e42) { + if (w < 0x3ff00000 - (26<<20)) { + /* raise inexact if x!=0 */ + FORCE_EVAL(x + 0x1p120f); + return 1; + } + t = expm1(x); + return 1 + t*t/(2*(1+t)); + } + + /* |x| < log(DBL_MAX) */ + if (w < 0x40862e42) { + t = exp(x); + /* note: if x>log(0x1p26) then the 1/t is not needed */ + return 0.5*(t + 1/t); + } + + /* |x| > log(DBL_MAX) or nan */ + /* note: the result is stored to handle overflow */ + t = __expo2(x); + return t; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/coshf.c b/lib/mlibc/options/ansi/musl-generic-math/coshf.c new file mode 100644 index 0000000..b09f2ee --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/coshf.c @@ -0,0 +1,33 @@ +#include "libm.h" + +float coshf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + uint32_t w; + float t; + + /* |x| */ + u.i &= 0x7fffffff; + x = u.f; + w = u.i; + + /* |x| < log(2) */ + if (w < 0x3f317217) { + if (w < 0x3f800000 - (12<<23)) { + FORCE_EVAL(x + 0x1p120f); + return 1; + } + t = expm1f(x); + return 1 + t*t/(2*(1+t)); + } + + /* |x| < log(FLT_MAX) */ + if (w < 0x42b17217) { + t = expf(x); + return 0.5f*(t + 1/t); + } + + /* |x| > log(FLT_MAX) or nan */ + t = __expo2f(x); + return t; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/coshl.c b/lib/mlibc/options/ansi/musl-generic-math/coshl.c new file mode 100644 index 0000000..06a56fe --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/coshl.c @@ -0,0 +1,47 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double coshl(long double x) +{ + return cosh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +long double coshl(long double x) +{ + union ldshape u = {x}; + unsigned ex = u.i.se & 0x7fff; + uint32_t w; + long double t; + + /* |x| */ + u.i.se = ex; + x = u.f; + w = u.i.m >> 32; + + /* |x| < log(2) */ + if (ex < 0x3fff-1 || (ex == 0x3fff-1 && w < 0xb17217f7)) { + if (ex < 0x3fff-32) { + FORCE_EVAL(x + 0x1p120f); + return 1; + } + t = expm1l(x); + return 1 + t*t/(2*(1+t)); + } + + /* |x| < log(LDBL_MAX) */ + if (ex < 0x3fff+13 || (ex == 0x3fff+13 && w < 0xb17217f7)) { + t = expl(x); + return 0.5*(t + 1/t); + } + + /* |x| > log(LDBL_MAX) or nan */ + t = expl(0.5*x); + return 0.5*t*t; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double coshl(long double x) +{ + return cosh(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/cosl.c b/lib/mlibc/options/ansi/musl-generic-math/cosl.c new file mode 100644 index 0000000..79c41c7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/cosl.c @@ -0,0 +1,39 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double cosl(long double x) { + return cos(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double cosl(long double x) +{ + union ldshape u = {x}; + unsigned n; + long double y[2], hi, lo; + + u.i.se &= 0x7fff; + if (u.i.se == 0x7fff) + return x - x; + x = u.f; + if (x < M_PI_4) { + if (u.i.se < 0x3fff - LDBL_MANT_DIG) + /* raise inexact if x!=0 */ + return 1.0 + x; + return __cosl(x, 0); + } + n = __rem_pio2l(x, y); + hi = y[0]; + lo = y[1]; + switch (n & 3) { + case 0: + return __cosl(hi, lo); + case 1: + return -__sinl(hi, lo, 1); + case 2: + return -__cosl(hi, lo); + case 3: + default: + return __sinl(hi, lo, 1); + } +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/erf.c b/lib/mlibc/options/ansi/musl-generic-math/erf.c new file mode 100644 index 0000000..2f30a29 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/erf.c @@ -0,0 +1,273 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_erf.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* double erf(double x) + * double erfc(double x) + * x + * 2 |\ + * erf(x) = --------- | exp(-t*t)dt + * sqrt(pi) \| + * 0 + * + * erfc(x) = 1-erf(x) + * Note that + * erf(-x) = -erf(x) + * erfc(-x) = 2 - erfc(x) + * + * Method: + * 1. For |x| in [0, 0.84375] + * erf(x) = x + x*R(x^2) + * erfc(x) = 1 - erf(x) if x in [-.84375,0.25] + * = 0.5 + ((0.5-x)-x*R) if x in [0.25,0.84375] + * where R = P/Q where P is an odd poly of degree 8 and + * Q is an odd poly of degree 10. + * -57.90 + * | R - (erf(x)-x)/x | <= 2 + * + * + * Remark. The formula is derived by noting + * erf(x) = (2/sqrt(pi))*(x - x^3/3 + x^5/10 - x^7/42 + ....) + * and that + * 2/sqrt(pi) = 1.128379167095512573896158903121545171688 + * is close to one. The interval is chosen because the fix + * point of erf(x) is near 0.6174 (i.e., erf(x)=x when x is + * near 0.6174), and by some experiment, 0.84375 is chosen to + * guarantee the error is less than one ulp for erf. + * + * 2. For |x| in [0.84375,1.25], let s = |x| - 1, and + * c = 0.84506291151 rounded to single (24 bits) + * erf(x) = sign(x) * (c + P1(s)/Q1(s)) + * erfc(x) = (1-c) - P1(s)/Q1(s) if x > 0 + * 1+(c+P1(s)/Q1(s)) if x < 0 + * |P1/Q1 - (erf(|x|)-c)| <= 2**-59.06 + * Remark: here we use the taylor series expansion at x=1. + * erf(1+s) = erf(1) + s*Poly(s) + * = 0.845.. + P1(s)/Q1(s) + * That is, we use rational approximation to approximate + * erf(1+s) - (c = (single)0.84506291151) + * Note that |P1/Q1|< 0.078 for x in [0.84375,1.25] + * where + * P1(s) = degree 6 poly in s + * Q1(s) = degree 6 poly in s + * + * 3. For x in [1.25,1/0.35(~2.857143)], + * erfc(x) = (1/x)*exp(-x*x-0.5625+R1/S1) + * erf(x) = 1 - erfc(x) + * where + * R1(z) = degree 7 poly in z, (z=1/x^2) + * S1(z) = degree 8 poly in z + * + * 4. For x in [1/0.35,28] + * erfc(x) = (1/x)*exp(-x*x-0.5625+R2/S2) if x > 0 + * = 2.0 - (1/x)*exp(-x*x-0.5625+R2/S2) if -6<x<0 + * = 2.0 - tiny (if x <= -6) + * erf(x) = sign(x)*(1.0 - erfc(x)) if x < 6, else + * erf(x) = sign(x)*(1.0 - tiny) + * where + * R2(z) = degree 6 poly in z, (z=1/x^2) + * S2(z) = degree 7 poly in z + * + * Note1: + * To compute exp(-x*x-0.5625+R/S), let s be a single + * precision number and s := x; then + * -x*x = -s*s + (s-x)*(s+x) + * exp(-x*x-0.5626+R/S) = + * exp(-s*s-0.5625)*exp((s-x)*(s+x)+R/S); + * Note2: + * Here 4 and 5 make use of the asymptotic series + * exp(-x*x) + * erfc(x) ~ ---------- * ( 1 + Poly(1/x^2) ) + * x*sqrt(pi) + * We use rational approximation to approximate + * g(s)=f(1/x^2) = log(erfc(x)*x) - x*x + 0.5625 + * Here is the error bound for R1/S1 and R2/S2 + * |R1/S1 - f(x)| < 2**(-62.57) + * |R2/S2 - f(x)| < 2**(-61.52) + * + * 5. For inf > x >= 28 + * erf(x) = sign(x) *(1 - tiny) (raise inexact) + * erfc(x) = tiny*tiny (raise underflow) if x > 0 + * = 2 - tiny if x<0 + * + * 7. Special case: + * erf(0) = 0, erf(inf) = 1, erf(-inf) = -1, + * erfc(0) = 1, erfc(inf) = 0, erfc(-inf) = 2, + * erfc/erf(NaN) is NaN + */ + +#include "libm.h" + +static const double +erx = 8.45062911510467529297e-01, /* 0x3FEB0AC1, 0x60000000 */ +/* + * Coefficients for approximation to erf on [0,0.84375] + */ +efx8 = 1.02703333676410069053e+00, /* 0x3FF06EBA, 0x8214DB69 */ +pp0 = 1.28379167095512558561e-01, /* 0x3FC06EBA, 0x8214DB68 */ +pp1 = -3.25042107247001499370e-01, /* 0xBFD4CD7D, 0x691CB913 */ +pp2 = -2.84817495755985104766e-02, /* 0xBF9D2A51, 0xDBD7194F */ +pp3 = -5.77027029648944159157e-03, /* 0xBF77A291, 0x236668E4 */ +pp4 = -2.37630166566501626084e-05, /* 0xBEF8EAD6, 0x120016AC */ +qq1 = 3.97917223959155352819e-01, /* 0x3FD97779, 0xCDDADC09 */ +qq2 = 6.50222499887672944485e-02, /* 0x3FB0A54C, 0x5536CEBA */ +qq3 = 5.08130628187576562776e-03, /* 0x3F74D022, 0xC4D36B0F */ +qq4 = 1.32494738004321644526e-04, /* 0x3F215DC9, 0x221C1A10 */ +qq5 = -3.96022827877536812320e-06, /* 0xBED09C43, 0x42A26120 */ +/* + * Coefficients for approximation to erf in [0.84375,1.25] + */ +pa0 = -2.36211856075265944077e-03, /* 0xBF6359B8, 0xBEF77538 */ +pa1 = 4.14856118683748331666e-01, /* 0x3FDA8D00, 0xAD92B34D */ +pa2 = -3.72207876035701323847e-01, /* 0xBFD7D240, 0xFBB8C3F1 */ +pa3 = 3.18346619901161753674e-01, /* 0x3FD45FCA, 0x805120E4 */ +pa4 = -1.10894694282396677476e-01, /* 0xBFBC6398, 0x3D3E28EC */ +pa5 = 3.54783043256182359371e-02, /* 0x3FA22A36, 0x599795EB */ +pa6 = -2.16637559486879084300e-03, /* 0xBF61BF38, 0x0A96073F */ +qa1 = 1.06420880400844228286e-01, /* 0x3FBB3E66, 0x18EEE323 */ +qa2 = 5.40397917702171048937e-01, /* 0x3FE14AF0, 0x92EB6F33 */ +qa3 = 7.18286544141962662868e-02, /* 0x3FB2635C, 0xD99FE9A7 */ +qa4 = 1.26171219808761642112e-01, /* 0x3FC02660, 0xE763351F */ +qa5 = 1.36370839120290507362e-02, /* 0x3F8BEDC2, 0x6B51DD1C */ +qa6 = 1.19844998467991074170e-02, /* 0x3F888B54, 0x5735151D */ +/* + * Coefficients for approximation to erfc in [1.25,1/0.35] + */ +ra0 = -9.86494403484714822705e-03, /* 0xBF843412, 0x600D6435 */ +ra1 = -6.93858572707181764372e-01, /* 0xBFE63416, 0xE4BA7360 */ +ra2 = -1.05586262253232909814e+01, /* 0xC0251E04, 0x41B0E726 */ +ra3 = -6.23753324503260060396e+01, /* 0xC04F300A, 0xE4CBA38D */ +ra4 = -1.62396669462573470355e+02, /* 0xC0644CB1, 0x84282266 */ +ra5 = -1.84605092906711035994e+02, /* 0xC067135C, 0xEBCCABB2 */ +ra6 = -8.12874355063065934246e+01, /* 0xC0545265, 0x57E4D2F2 */ +ra7 = -9.81432934416914548592e+00, /* 0xC023A0EF, 0xC69AC25C */ +sa1 = 1.96512716674392571292e+01, /* 0x4033A6B9, 0xBD707687 */ +sa2 = 1.37657754143519042600e+02, /* 0x4061350C, 0x526AE721 */ +sa3 = 4.34565877475229228821e+02, /* 0x407B290D, 0xD58A1A71 */ +sa4 = 6.45387271733267880336e+02, /* 0x40842B19, 0x21EC2868 */ +sa5 = 4.29008140027567833386e+02, /* 0x407AD021, 0x57700314 */ +sa6 = 1.08635005541779435134e+02, /* 0x405B28A3, 0xEE48AE2C */ +sa7 = 6.57024977031928170135e+00, /* 0x401A47EF, 0x8E484A93 */ +sa8 = -6.04244152148580987438e-02, /* 0xBFAEEFF2, 0xEE749A62 */ +/* + * Coefficients for approximation to erfc in [1/.35,28] + */ +rb0 = -9.86494292470009928597e-03, /* 0xBF843412, 0x39E86F4A */ +rb1 = -7.99283237680523006574e-01, /* 0xBFE993BA, 0x70C285DE */ +rb2 = -1.77579549177547519889e+01, /* 0xC031C209, 0x555F995A */ +rb3 = -1.60636384855821916062e+02, /* 0xC064145D, 0x43C5ED98 */ +rb4 = -6.37566443368389627722e+02, /* 0xC083EC88, 0x1375F228 */ +rb5 = -1.02509513161107724954e+03, /* 0xC0900461, 0x6A2E5992 */ +rb6 = -4.83519191608651397019e+02, /* 0xC07E384E, 0x9BDC383F */ +sb1 = 3.03380607434824582924e+01, /* 0x403E568B, 0x261D5190 */ +sb2 = 3.25792512996573918826e+02, /* 0x40745CAE, 0x221B9F0A */ +sb3 = 1.53672958608443695994e+03, /* 0x409802EB, 0x189D5118 */ +sb4 = 3.19985821950859553908e+03, /* 0x40A8FFB7, 0x688C246A */ +sb5 = 2.55305040643316442583e+03, /* 0x40A3F219, 0xCEDF3BE6 */ +sb6 = 4.74528541206955367215e+02, /* 0x407DA874, 0xE79FE763 */ +sb7 = -2.24409524465858183362e+01; /* 0xC03670E2, 0x42712D62 */ + +static double erfc1(double x) +{ + double_t s,P,Q; + + s = fabs(x) - 1; + P = pa0+s*(pa1+s*(pa2+s*(pa3+s*(pa4+s*(pa5+s*pa6))))); + Q = 1+s*(qa1+s*(qa2+s*(qa3+s*(qa4+s*(qa5+s*qa6))))); + return 1 - erx - P/Q; +} + +static double erfc2(uint32_t ix, double x) +{ + double_t s,R,S; + double z; + + if (ix < 0x3ff40000) /* |x| < 1.25 */ + return erfc1(x); + + x = fabs(x); + s = 1/(x*x); + if (ix < 0x4006db6d) { /* |x| < 1/.35 ~ 2.85714 */ + R = ra0+s*(ra1+s*(ra2+s*(ra3+s*(ra4+s*( + ra5+s*(ra6+s*ra7)))))); + S = 1.0+s*(sa1+s*(sa2+s*(sa3+s*(sa4+s*( + sa5+s*(sa6+s*(sa7+s*sa8))))))); + } else { /* |x| > 1/.35 */ + R = rb0+s*(rb1+s*(rb2+s*(rb3+s*(rb4+s*( + rb5+s*rb6))))); + S = 1.0+s*(sb1+s*(sb2+s*(sb3+s*(sb4+s*( + sb5+s*(sb6+s*sb7)))))); + } + z = x; + SET_LOW_WORD(z,0); + return exp(-z*z-0.5625)*exp((z-x)*(z+x)+R/S)/x; +} + +double erf(double x) +{ + double r,s,z,y; + uint32_t ix; + int sign; + + GET_HIGH_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7ff00000) { + /* erf(nan)=nan, erf(+-inf)=+-1 */ + return 1-2*sign + 1/x; + } + if (ix < 0x3feb0000) { /* |x| < 0.84375 */ + if (ix < 0x3e300000) { /* |x| < 2**-28 */ + /* avoid underflow */ + return 0.125*(8*x + efx8*x); + } + z = x*x; + r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4))); + s = 1.0+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5)))); + y = r/s; + return x + x*y; + } + if (ix < 0x40180000) /* 0.84375 <= |x| < 6 */ + y = 1 - erfc2(ix,x); + else + y = 1 - 0x1p-1022; + return sign ? -y : y; +} + +double erfc(double x) +{ + double r,s,z,y; + uint32_t ix; + int sign; + + GET_HIGH_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7ff00000) { + /* erfc(nan)=nan, erfc(+-inf)=0,2 */ + return 2*sign + 1/x; + } + if (ix < 0x3feb0000) { /* |x| < 0.84375 */ + if (ix < 0x3c700000) /* |x| < 2**-56 */ + return 1.0 - x; + z = x*x; + r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4))); + s = 1.0+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5)))); + y = r/s; + if (sign || ix < 0x3fd00000) { /* x < 1/4 */ + return 1.0 - (x+x*y); + } + return 0.5 - (x - 0.5 + x*y); + } + if (ix < 0x403c0000) { /* 0.84375 <= |x| < 28 */ + return sign ? 2 - erfc2(ix,x) : erfc2(ix,x); + } + return sign ? 2 - 0x1p-1022 : 0x1p-1022*0x1p-1022; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/erff.c b/lib/mlibc/options/ansi/musl-generic-math/erff.c new file mode 100644 index 0000000..ed5f397 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/erff.c @@ -0,0 +1,183 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_erff.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +erx = 8.4506291151e-01, /* 0x3f58560b */ +/* + * Coefficients for approximation to erf on [0,0.84375] + */ +efx8 = 1.0270333290e+00, /* 0x3f8375d4 */ +pp0 = 1.2837916613e-01, /* 0x3e0375d4 */ +pp1 = -3.2504209876e-01, /* 0xbea66beb */ +pp2 = -2.8481749818e-02, /* 0xbce9528f */ +pp3 = -5.7702702470e-03, /* 0xbbbd1489 */ +pp4 = -2.3763017452e-05, /* 0xb7c756b1 */ +qq1 = 3.9791721106e-01, /* 0x3ecbbbce */ +qq2 = 6.5022252500e-02, /* 0x3d852a63 */ +qq3 = 5.0813062117e-03, /* 0x3ba68116 */ +qq4 = 1.3249473704e-04, /* 0x390aee49 */ +qq5 = -3.9602282413e-06, /* 0xb684e21a */ +/* + * Coefficients for approximation to erf in [0.84375,1.25] + */ +pa0 = -2.3621185683e-03, /* 0xbb1acdc6 */ +pa1 = 4.1485610604e-01, /* 0x3ed46805 */ +pa2 = -3.7220788002e-01, /* 0xbebe9208 */ +pa3 = 3.1834661961e-01, /* 0x3ea2fe54 */ +pa4 = -1.1089469492e-01, /* 0xbde31cc2 */ +pa5 = 3.5478305072e-02, /* 0x3d1151b3 */ +pa6 = -2.1663755178e-03, /* 0xbb0df9c0 */ +qa1 = 1.0642088205e-01, /* 0x3dd9f331 */ +qa2 = 5.4039794207e-01, /* 0x3f0a5785 */ +qa3 = 7.1828655899e-02, /* 0x3d931ae7 */ +qa4 = 1.2617121637e-01, /* 0x3e013307 */ +qa5 = 1.3637083583e-02, /* 0x3c5f6e13 */ +qa6 = 1.1984500103e-02, /* 0x3c445aa3 */ +/* + * Coefficients for approximation to erfc in [1.25,1/0.35] + */ +ra0 = -9.8649440333e-03, /* 0xbc21a093 */ +ra1 = -6.9385856390e-01, /* 0xbf31a0b7 */ +ra2 = -1.0558626175e+01, /* 0xc128f022 */ +ra3 = -6.2375331879e+01, /* 0xc2798057 */ +ra4 = -1.6239666748e+02, /* 0xc322658c */ +ra5 = -1.8460508728e+02, /* 0xc3389ae7 */ +ra6 = -8.1287437439e+01, /* 0xc2a2932b */ +ra7 = -9.8143291473e+00, /* 0xc11d077e */ +sa1 = 1.9651271820e+01, /* 0x419d35ce */ +sa2 = 1.3765776062e+02, /* 0x4309a863 */ +sa3 = 4.3456588745e+02, /* 0x43d9486f */ +sa4 = 6.4538726807e+02, /* 0x442158c9 */ +sa5 = 4.2900814819e+02, /* 0x43d6810b */ +sa6 = 1.0863500214e+02, /* 0x42d9451f */ +sa7 = 6.5702495575e+00, /* 0x40d23f7c */ +sa8 = -6.0424413532e-02, /* 0xbd777f97 */ +/* + * Coefficients for approximation to erfc in [1/.35,28] + */ +rb0 = -9.8649431020e-03, /* 0xbc21a092 */ +rb1 = -7.9928326607e-01, /* 0xbf4c9dd4 */ +rb2 = -1.7757955551e+01, /* 0xc18e104b */ +rb3 = -1.6063638306e+02, /* 0xc320a2ea */ +rb4 = -6.3756646729e+02, /* 0xc41f6441 */ +rb5 = -1.0250950928e+03, /* 0xc480230b */ +rb6 = -4.8351919556e+02, /* 0xc3f1c275 */ +sb1 = 3.0338060379e+01, /* 0x41f2b459 */ +sb2 = 3.2579251099e+02, /* 0x43a2e571 */ +sb3 = 1.5367296143e+03, /* 0x44c01759 */ +sb4 = 3.1998581543e+03, /* 0x4547fdbb */ +sb5 = 2.5530502930e+03, /* 0x451f90ce */ +sb6 = 4.7452853394e+02, /* 0x43ed43a7 */ +sb7 = -2.2440952301e+01; /* 0xc1b38712 */ + +static float erfc1(float x) +{ + float_t s,P,Q; + + s = fabsf(x) - 1; + P = pa0+s*(pa1+s*(pa2+s*(pa3+s*(pa4+s*(pa5+s*pa6))))); + Q = 1+s*(qa1+s*(qa2+s*(qa3+s*(qa4+s*(qa5+s*qa6))))); + return 1 - erx - P/Q; +} + +static float erfc2(uint32_t ix, float x) +{ + float_t s,R,S; + float z; + + if (ix < 0x3fa00000) /* |x| < 1.25 */ + return erfc1(x); + + x = fabsf(x); + s = 1/(x*x); + if (ix < 0x4036db6d) { /* |x| < 1/0.35 */ + R = ra0+s*(ra1+s*(ra2+s*(ra3+s*(ra4+s*( + ra5+s*(ra6+s*ra7)))))); + S = 1.0f+s*(sa1+s*(sa2+s*(sa3+s*(sa4+s*( + sa5+s*(sa6+s*(sa7+s*sa8))))))); + } else { /* |x| >= 1/0.35 */ + R = rb0+s*(rb1+s*(rb2+s*(rb3+s*(rb4+s*( + rb5+s*rb6))))); + S = 1.0f+s*(sb1+s*(sb2+s*(sb3+s*(sb4+s*( + sb5+s*(sb6+s*sb7)))))); + } + GET_FLOAT_WORD(ix, x); + SET_FLOAT_WORD(z, ix&0xffffe000); + return expf(-z*z - 0.5625f) * expf((z-x)*(z+x) + R/S)/x; +} + +float erff(float x) +{ + float r,s,z,y; + uint32_t ix; + int sign; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7f800000) { + /* erf(nan)=nan, erf(+-inf)=+-1 */ + return 1-2*sign + 1/x; + } + if (ix < 0x3f580000) { /* |x| < 0.84375 */ + if (ix < 0x31800000) { /* |x| < 2**-28 */ + /*avoid underflow */ + return 0.125f*(8*x + efx8*x); + } + z = x*x; + r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4))); + s = 1+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5)))); + y = r/s; + return x + x*y; + } + if (ix < 0x40c00000) /* |x| < 6 */ + y = 1 - erfc2(ix,x); + else + y = 1 - 0x1p-120f; + return sign ? -y : y; +} + +float erfcf(float x) +{ + float r,s,z,y; + uint32_t ix; + int sign; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7f800000) { + /* erfc(nan)=nan, erfc(+-inf)=0,2 */ + return 2*sign + 1/x; + } + + if (ix < 0x3f580000) { /* |x| < 0.84375 */ + if (ix < 0x23800000) /* |x| < 2**-56 */ + return 1.0f - x; + z = x*x; + r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4))); + s = 1.0f+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5)))); + y = r/s; + if (sign || ix < 0x3e800000) /* x < 1/4 */ + return 1.0f - (x+x*y); + return 0.5f - (x - 0.5f + x*y); + } + if (ix < 0x41e00000) { /* |x| < 28 */ + return sign ? 2 - erfc2(ix,x) : erfc2(ix,x); + } + return sign ? 2 - 0x1p-120f : 0x1p-120f*0x1p-120f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/erfl.c b/lib/mlibc/options/ansi/musl-generic-math/erfl.c new file mode 100644 index 0000000..e267c23 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/erfl.c @@ -0,0 +1,353 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_erfl.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* double erf(double x) + * double erfc(double x) + * x + * 2 |\ + * erf(x) = --------- | exp(-t*t)dt + * sqrt(pi) \| + * 0 + * + * erfc(x) = 1-erf(x) + * Note that + * erf(-x) = -erf(x) + * erfc(-x) = 2 - erfc(x) + * + * Method: + * 1. For |x| in [0, 0.84375] + * erf(x) = x + x*R(x^2) + * erfc(x) = 1 - erf(x) if x in [-.84375,0.25] + * = 0.5 + ((0.5-x)-x*R) if x in [0.25,0.84375] + * Remark. The formula is derived by noting + * erf(x) = (2/sqrt(pi))*(x - x^3/3 + x^5/10 - x^7/42 + ....) + * and that + * 2/sqrt(pi) = 1.128379167095512573896158903121545171688 + * is close to one. The interval is chosen because the fix + * point of erf(x) is near 0.6174 (i.e., erf(x)=x when x is + * near 0.6174), and by some experiment, 0.84375 is chosen to + * guarantee the error is less than one ulp for erf. + * + * 2. For |x| in [0.84375,1.25], let s = |x| - 1, and + * c = 0.84506291151 rounded to single (24 bits) + * erf(x) = sign(x) * (c + P1(s)/Q1(s)) + * erfc(x) = (1-c) - P1(s)/Q1(s) if x > 0 + * 1+(c+P1(s)/Q1(s)) if x < 0 + * Remark: here we use the taylor series expansion at x=1. + * erf(1+s) = erf(1) + s*Poly(s) + * = 0.845.. + P1(s)/Q1(s) + * Note that |P1/Q1|< 0.078 for x in [0.84375,1.25] + * + * 3. For x in [1.25,1/0.35(~2.857143)], + * erfc(x) = (1/x)*exp(-x*x-0.5625+R1(z)/S1(z)) + * z=1/x^2 + * erf(x) = 1 - erfc(x) + * + * 4. For x in [1/0.35,107] + * erfc(x) = (1/x)*exp(-x*x-0.5625+R2/S2) if x > 0 + * = 2.0 - (1/x)*exp(-x*x-0.5625+R2(z)/S2(z)) + * if -6.666<x<0 + * = 2.0 - tiny (if x <= -6.666) + * z=1/x^2 + * erf(x) = sign(x)*(1.0 - erfc(x)) if x < 6.666, else + * erf(x) = sign(x)*(1.0 - tiny) + * Note1: + * To compute exp(-x*x-0.5625+R/S), let s be a single + * precision number and s := x; then + * -x*x = -s*s + (s-x)*(s+x) + * exp(-x*x-0.5626+R/S) = + * exp(-s*s-0.5625)*exp((s-x)*(s+x)+R/S); + * Note2: + * Here 4 and 5 make use of the asymptotic series + * exp(-x*x) + * erfc(x) ~ ---------- * ( 1 + Poly(1/x^2) ) + * x*sqrt(pi) + * + * 5. For inf > x >= 107 + * erf(x) = sign(x) *(1 - tiny) (raise inexact) + * erfc(x) = tiny*tiny (raise underflow) if x > 0 + * = 2 - tiny if x<0 + * + * 7. Special case: + * erf(0) = 0, erf(inf) = 1, erf(-inf) = -1, + * erfc(0) = 1, erfc(inf) = 0, erfc(-inf) = 2, + * erfc/erf(NaN) is NaN + */ + + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double erfl(long double x) +{ + return erf(x); +} +long double erfcl(long double x) +{ + return erfc(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +static const long double +erx = 0.845062911510467529296875L, + +/* + * Coefficients for approximation to erf on [0,0.84375] + */ +/* 8 * (2/sqrt(pi) - 1) */ +efx8 = 1.0270333367641005911692712249723613735048E0L, +pp[6] = { + 1.122751350964552113068262337278335028553E6L, + -2.808533301997696164408397079650699163276E6L, + -3.314325479115357458197119660818768924100E5L, + -6.848684465326256109712135497895525446398E4L, + -2.657817695110739185591505062971929859314E3L, + -1.655310302737837556654146291646499062882E2L, +}, +qq[6] = { + 8.745588372054466262548908189000448124232E6L, + 3.746038264792471129367533128637019611485E6L, + 7.066358783162407559861156173539693900031E5L, + 7.448928604824620999413120955705448117056E4L, + 4.511583986730994111992253980546131408924E3L, + 1.368902937933296323345610240009071254014E2L, + /* 1.000000000000000000000000000000000000000E0 */ +}, + +/* + * Coefficients for approximation to erf in [0.84375,1.25] + */ +/* erf(x+1) = 0.845062911510467529296875 + pa(x)/qa(x) + -0.15625 <= x <= +.25 + Peak relative error 8.5e-22 */ +pa[8] = { + -1.076952146179812072156734957705102256059E0L, + 1.884814957770385593365179835059971587220E2L, + -5.339153975012804282890066622962070115606E1L, + 4.435910679869176625928504532109635632618E1L, + 1.683219516032328828278557309642929135179E1L, + -2.360236618396952560064259585299045804293E0L, + 1.852230047861891953244413872297940938041E0L, + 9.394994446747752308256773044667843200719E-2L, +}, +qa[7] = { + 4.559263722294508998149925774781887811255E2L, + 3.289248982200800575749795055149780689738E2L, + 2.846070965875643009598627918383314457912E2L, + 1.398715859064535039433275722017479994465E2L, + 6.060190733759793706299079050985358190726E1L, + 2.078695677795422351040502569964299664233E1L, + 4.641271134150895940966798357442234498546E0L, + /* 1.000000000000000000000000000000000000000E0 */ +}, + +/* + * Coefficients for approximation to erfc in [1.25,1/0.35] + */ +/* erfc(1/x) = x exp (-1/x^2 - 0.5625 + ra(x^2)/sa(x^2)) + 1/2.85711669921875 < 1/x < 1/1.25 + Peak relative error 3.1e-21 */ +ra[] = { + 1.363566591833846324191000679620738857234E-1L, + 1.018203167219873573808450274314658434507E1L, + 1.862359362334248675526472871224778045594E2L, + 1.411622588180721285284945138667933330348E3L, + 5.088538459741511988784440103218342840478E3L, + 8.928251553922176506858267311750789273656E3L, + 7.264436000148052545243018622742770549982E3L, + 2.387492459664548651671894725748959751119E3L, + 2.220916652813908085449221282808458466556E2L, +}, +sa[] = { + -1.382234625202480685182526402169222331847E1L, + -3.315638835627950255832519203687435946482E2L, + -2.949124863912936259747237164260785326692E3L, + -1.246622099070875940506391433635999693661E4L, + -2.673079795851665428695842853070996219632E4L, + -2.880269786660559337358397106518918220991E4L, + -1.450600228493968044773354186390390823713E4L, + -2.874539731125893533960680525192064277816E3L, + -1.402241261419067750237395034116942296027E2L, + /* 1.000000000000000000000000000000000000000E0 */ +}, + +/* + * Coefficients for approximation to erfc in [1/.35,107] + */ +/* erfc(1/x) = x exp (-1/x^2 - 0.5625 + rb(x^2)/sb(x^2)) + 1/6.6666259765625 < 1/x < 1/2.85711669921875 + Peak relative error 4.2e-22 */ +rb[] = { + -4.869587348270494309550558460786501252369E-5L, + -4.030199390527997378549161722412466959403E-3L, + -9.434425866377037610206443566288917589122E-2L, + -9.319032754357658601200655161585539404155E-1L, + -4.273788174307459947350256581445442062291E0L, + -8.842289940696150508373541814064198259278E0L, + -7.069215249419887403187988144752613025255E0L, + -1.401228723639514787920274427443330704764E0L, +}, +sb[] = { + 4.936254964107175160157544545879293019085E-3L, + 1.583457624037795744377163924895349412015E-1L, + 1.850647991850328356622940552450636420484E0L, + 9.927611557279019463768050710008450625415E0L, + 2.531667257649436709617165336779212114570E1L, + 2.869752886406743386458304052862814690045E1L, + 1.182059497870819562441683560749192539345E1L, + /* 1.000000000000000000000000000000000000000E0 */ +}, +/* erfc(1/x) = x exp (-1/x^2 - 0.5625 + rc(x^2)/sc(x^2)) + 1/107 <= 1/x <= 1/6.6666259765625 + Peak relative error 1.1e-21 */ +rc[] = { + -8.299617545269701963973537248996670806850E-5L, + -6.243845685115818513578933902532056244108E-3L, + -1.141667210620380223113693474478394397230E-1L, + -7.521343797212024245375240432734425789409E-1L, + -1.765321928311155824664963633786967602934E0L, + -1.029403473103215800456761180695263439188E0L, +}, +sc[] = { + 8.413244363014929493035952542677768808601E-3L, + 2.065114333816877479753334599639158060979E-1L, + 1.639064941530797583766364412782135680148E0L, + 4.936788463787115555582319302981666347450E0L, + 5.005177727208955487404729933261347679090E0L, + /* 1.000000000000000000000000000000000000000E0 */ +}; + +static long double erfc1(long double x) +{ + long double s,P,Q; + + s = fabsl(x) - 1; + P = pa[0] + s * (pa[1] + s * (pa[2] + + s * (pa[3] + s * (pa[4] + s * (pa[5] + s * (pa[6] + s * pa[7])))))); + Q = qa[0] + s * (qa[1] + s * (qa[2] + + s * (qa[3] + s * (qa[4] + s * (qa[5] + s * (qa[6] + s)))))); + return 1 - erx - P / Q; +} + +static long double erfc2(uint32_t ix, long double x) +{ + union ldshape u; + long double s,z,R,S; + + if (ix < 0x3fffa000) /* 0.84375 <= |x| < 1.25 */ + return erfc1(x); + + x = fabsl(x); + s = 1 / (x * x); + if (ix < 0x4000b6db) { /* 1.25 <= |x| < 2.857 ~ 1/.35 */ + R = ra[0] + s * (ra[1] + s * (ra[2] + s * (ra[3] + s * (ra[4] + + s * (ra[5] + s * (ra[6] + s * (ra[7] + s * ra[8]))))))); + S = sa[0] + s * (sa[1] + s * (sa[2] + s * (sa[3] + s * (sa[4] + + s * (sa[5] + s * (sa[6] + s * (sa[7] + s * (sa[8] + s)))))))); + } else if (ix < 0x4001d555) { /* 2.857 <= |x| < 6.6666259765625 */ + R = rb[0] + s * (rb[1] + s * (rb[2] + s * (rb[3] + s * (rb[4] + + s * (rb[5] + s * (rb[6] + s * rb[7])))))); + S = sb[0] + s * (sb[1] + s * (sb[2] + s * (sb[3] + s * (sb[4] + + s * (sb[5] + s * (sb[6] + s)))))); + } else { /* 6.666 <= |x| < 107 (erfc only) */ + R = rc[0] + s * (rc[1] + s * (rc[2] + s * (rc[3] + + s * (rc[4] + s * rc[5])))); + S = sc[0] + s * (sc[1] + s * (sc[2] + s * (sc[3] + + s * (sc[4] + s)))); + } + u.f = x; + u.i.m &= -1ULL << 40; + z = u.f; + return expl(-z*z - 0.5625) * expl((z - x) * (z + x) + R / S) / x; +} + +long double erfl(long double x) +{ + long double r, s, z, y; + union ldshape u = {x}; + uint32_t ix = (u.i.se & 0x7fffU)<<16 | u.i.m>>48; + int sign = u.i.se >> 15; + + if (ix >= 0x7fff0000) + /* erf(nan)=nan, erf(+-inf)=+-1 */ + return 1 - 2*sign + 1/x; + if (ix < 0x3ffed800) { /* |x| < 0.84375 */ + if (ix < 0x3fde8000) { /* |x| < 2**-33 */ + return 0.125 * (8 * x + efx8 * x); /* avoid underflow */ + } + z = x * x; + r = pp[0] + z * (pp[1] + + z * (pp[2] + z * (pp[3] + z * (pp[4] + z * pp[5])))); + s = qq[0] + z * (qq[1] + + z * (qq[2] + z * (qq[3] + z * (qq[4] + z * (qq[5] + z))))); + y = r / s; + return x + x * y; + } + if (ix < 0x4001d555) /* |x| < 6.6666259765625 */ + y = 1 - erfc2(ix,x); + else + y = 1 - 0x1p-16382L; + return sign ? -y : y; +} + +long double erfcl(long double x) +{ + long double r, s, z, y; + union ldshape u = {x}; + uint32_t ix = (u.i.se & 0x7fffU)<<16 | u.i.m>>48; + int sign = u.i.se >> 15; + + if (ix >= 0x7fff0000) + /* erfc(nan) = nan, erfc(+-inf) = 0,2 */ + return 2*sign + 1/x; + if (ix < 0x3ffed800) { /* |x| < 0.84375 */ + if (ix < 0x3fbe0000) /* |x| < 2**-65 */ + return 1.0 - x; + z = x * x; + r = pp[0] + z * (pp[1] + + z * (pp[2] + z * (pp[3] + z * (pp[4] + z * pp[5])))); + s = qq[0] + z * (qq[1] + + z * (qq[2] + z * (qq[3] + z * (qq[4] + z * (qq[5] + z))))); + y = r / s; + if (ix < 0x3ffd8000) /* x < 1/4 */ + return 1.0 - (x + x * y); + return 0.5 - (x - 0.5 + x * y); + } + if (ix < 0x4005d600) /* |x| < 107 */ + return sign ? 2 - erfc2(ix,x) : erfc2(ix,x); + y = 0x1p-16382L; + return sign ? 2 - y : y*y; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double erfl(long double x) +{ + return erf(x); +} +long double erfcl(long double x) +{ + return erfc(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/exp.c b/lib/mlibc/options/ansi/musl-generic-math/exp.c new file mode 100644 index 0000000..9ea672f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/exp.c @@ -0,0 +1,134 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_exp.c */ +/* + * ==================================================== + * Copyright (C) 2004 by Sun Microsystems, Inc. All rights reserved. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* exp(x) + * Returns the exponential of x. + * + * Method + * 1. Argument reduction: + * Reduce x to an r so that |r| <= 0.5*ln2 ~ 0.34658. + * Given x, find r and integer k such that + * + * x = k*ln2 + r, |r| <= 0.5*ln2. + * + * Here r will be represented as r = hi-lo for better + * accuracy. + * + * 2. Approximation of exp(r) by a special rational function on + * the interval [0,0.34658]: + * Write + * R(r**2) = r*(exp(r)+1)/(exp(r)-1) = 2 + r*r/6 - r**4/360 + ... + * We use a special Remez algorithm on [0,0.34658] to generate + * a polynomial of degree 5 to approximate R. The maximum error + * of this polynomial approximation is bounded by 2**-59. In + * other words, + * R(z) ~ 2.0 + P1*z + P2*z**2 + P3*z**3 + P4*z**4 + P5*z**5 + * (where z=r*r, and the values of P1 to P5 are listed below) + * and + * | 5 | -59 + * | 2.0+P1*z+...+P5*z - R(z) | <= 2 + * | | + * The computation of exp(r) thus becomes + * 2*r + * exp(r) = 1 + ---------- + * R(r) - r + * r*c(r) + * = 1 + r + ----------- (for better accuracy) + * 2 - c(r) + * where + * 2 4 10 + * c(r) = r - (P1*r + P2*r + ... + P5*r ). + * + * 3. Scale back to obtain exp(x): + * From step 1, we have + * exp(x) = 2^k * exp(r) + * + * Special cases: + * exp(INF) is INF, exp(NaN) is NaN; + * exp(-INF) is 0, and + * for finite argument, only exp(0)=1 is exact. + * + * Accuracy: + * according to an error analysis, the error is always less than + * 1 ulp (unit in the last place). + * + * Misc. info. + * For IEEE double + * if x > 709.782712893383973096 then exp(x) overflows + * if x < -745.133219101941108420 then exp(x) underflows + */ + +#include "libm.h" + +static const double +half[2] = {0.5,-0.5}, +ln2hi = 6.93147180369123816490e-01, /* 0x3fe62e42, 0xfee00000 */ +ln2lo = 1.90821492927058770002e-10, /* 0x3dea39ef, 0x35793c76 */ +invln2 = 1.44269504088896338700e+00, /* 0x3ff71547, 0x652b82fe */ +P1 = 1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */ +P2 = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */ +P3 = 6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */ +P4 = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */ +P5 = 4.13813679705723846039e-08; /* 0x3E663769, 0x72BEA4D0 */ + +double exp(double x) +{ + double_t hi, lo, c, xx, y; + int k, sign; + uint32_t hx; + + GET_HIGH_WORD(hx, x); + sign = hx>>31; + hx &= 0x7fffffff; /* high word of |x| */ + + /* special cases */ + if (hx >= 0x4086232b) { /* if |x| >= 708.39... */ + if (isnan(x)) + return x; + if (x > 709.782712893383973096) { + /* overflow if x!=inf */ + x *= 0x1p1023; + return x; + } + if (x < -708.39641853226410622) { + /* underflow if x!=-inf */ + FORCE_EVAL((float)(-0x1p-149/x)); + if (x < -745.13321910194110842) + return 0; + } + } + + /* argument reduction */ + if (hx > 0x3fd62e42) { /* if |x| > 0.5 ln2 */ + if (hx >= 0x3ff0a2b2) /* if |x| >= 1.5 ln2 */ + k = (int)(invln2*x + half[sign]); + else + k = 1 - sign - sign; + hi = x - k*ln2hi; /* k*ln2hi is exact here */ + lo = k*ln2lo; + x = hi - lo; + } else if (hx > 0x3e300000) { /* if |x| > 2**-28 */ + k = 0; + hi = x; + lo = 0; + } else { + /* inexact if x!=0 */ + FORCE_EVAL(0x1p1023 + x); + return 1 + x; + } + + /* x is now in primary range */ + xx = x*x; + c = x - xx*(P1+xx*(P2+xx*(P3+xx*(P4+xx*P5)))); + y = 1 + (x*c/(2-c) - lo + hi); + if (k == 0) + return y; + return scalbn(y, k); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/exp10.c b/lib/mlibc/options/ansi/musl-generic-math/exp10.c new file mode 100644 index 0000000..47b4dc7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/exp10.c @@ -0,0 +1,26 @@ +#define _GNU_SOURCE +#include <math.h> +#include <stdint.h> +#include "weak_alias.h" +//#include "libc.h" + +double exp10(double x) +{ + static const double p10[] = { + 1e-15, 1e-14, 1e-13, 1e-12, 1e-11, 1e-10, + 1e-9, 1e-8, 1e-7, 1e-6, 1e-5, 1e-4, 1e-3, 1e-2, 1e-1, + 1, 1e1, 1e2, 1e3, 1e4, 1e5, 1e6, 1e7, 1e8, 1e9, + 1e10, 1e11, 1e12, 1e13, 1e14, 1e15 + }; + double n, y = modf(x, &n); + union {double f; uint64_t i;} u = {n}; + /* fabs(n) < 16 without raising invalid on nan */ + if ((u.i>>52 & 0x7ff) < 0x3ff+4) { + if (!y) return p10[(int)n+15]; + y = exp2(3.32192809488736234787031942948939 * y); + return y * p10[(int)n+15]; + } + return pow(10.0, x); +} + +weak_alias(exp10, pow10); diff --git a/lib/mlibc/options/ansi/musl-generic-math/exp10f.c b/lib/mlibc/options/ansi/musl-generic-math/exp10f.c new file mode 100644 index 0000000..74f8909 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/exp10f.c @@ -0,0 +1,24 @@ +#define _GNU_SOURCE +#include <math.h> +#include <stdint.h> +#include "weak_alias.h" +//#include "libc.h" + +float exp10f(float x) +{ + static const float p10[] = { + 1e-7f, 1e-6f, 1e-5f, 1e-4f, 1e-3f, 1e-2f, 1e-1f, + 1, 1e1, 1e2, 1e3, 1e4, 1e5, 1e6, 1e7 + }; + float n, y = modff(x, &n); + union {float f; uint32_t i;} u = {n}; + /* fabsf(n) < 8 without raising invalid on nan */ + if ((u.i>>23 & 0xff) < 0x7f+3) { + if (!y) return p10[(int)n+7]; + y = exp2f(3.32192809488736234787031942948939f * y); + return y * p10[(int)n+7]; + } + return exp2(3.32192809488736234787031942948939 * x); +} + +weak_alias(exp10f, pow10f); diff --git a/lib/mlibc/options/ansi/musl-generic-math/exp10l.c b/lib/mlibc/options/ansi/musl-generic-math/exp10l.c new file mode 100644 index 0000000..f18e554 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/exp10l.c @@ -0,0 +1,34 @@ +#define _GNU_SOURCE +#include <float.h> +#include <math.h> +//#include "libc.h" +#include "libm.h" +#include "weak_alias.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double exp10l(long double x) +{ + return exp10(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double exp10l(long double x) +{ + static const long double p10[] = { + 1e-15L, 1e-14L, 1e-13L, 1e-12L, 1e-11L, 1e-10L, + 1e-9L, 1e-8L, 1e-7L, 1e-6L, 1e-5L, 1e-4L, 1e-3L, 1e-2L, 1e-1L, + 1, 1e1, 1e2, 1e3, 1e4, 1e5, 1e6, 1e7, 1e8, 1e9, + 1e10, 1e11, 1e12, 1e13, 1e14, 1e15 + }; + long double n, y = modfl(x, &n); + union ldshape u = {n}; + /* fabsl(n) < 16 without raising invalid on nan */ + if ((u.i.se & 0x7fff) < 0x3fff+4) { + if (!y) return p10[(int)n+15]; + y = exp2l(3.32192809488736234787031942948939L * y); + return y * p10[(int)n+15]; + } + return powl(10.0, x); +} +#endif + +weak_alias(exp10l, pow10l); diff --git a/lib/mlibc/options/ansi/musl-generic-math/exp2.c b/lib/mlibc/options/ansi/musl-generic-math/exp2.c new file mode 100644 index 0000000..e14adba --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/exp2.c @@ -0,0 +1,375 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_exp2.c */ +/*- + * Copyright (c) 2005 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#include "libm.h" + +#define TBLSIZE 256 + +static const double +redux = 0x1.8p52 / TBLSIZE, +P1 = 0x1.62e42fefa39efp-1, +P2 = 0x1.ebfbdff82c575p-3, +P3 = 0x1.c6b08d704a0a6p-5, +P4 = 0x1.3b2ab88f70400p-7, +P5 = 0x1.5d88003875c74p-10; + +static const double tbl[TBLSIZE * 2] = { +/* exp2(z + eps) eps */ + 0x1.6a09e667f3d5dp-1, 0x1.9880p-44, + 0x1.6b052fa751744p-1, 0x1.8000p-50, + 0x1.6c012750bd9fep-1, -0x1.8780p-45, + 0x1.6cfdcddd476bfp-1, 0x1.ec00p-46, + 0x1.6dfb23c651a29p-1, -0x1.8000p-50, + 0x1.6ef9298593ae3p-1, -0x1.c000p-52, + 0x1.6ff7df9519386p-1, -0x1.fd80p-45, + 0x1.70f7466f42da3p-1, -0x1.c880p-45, + 0x1.71f75e8ec5fc3p-1, 0x1.3c00p-46, + 0x1.72f8286eacf05p-1, -0x1.8300p-44, + 0x1.73f9a48a58152p-1, -0x1.0c00p-47, + 0x1.74fbd35d7ccfcp-1, 0x1.f880p-45, + 0x1.75feb564267f1p-1, 0x1.3e00p-47, + 0x1.77024b1ab6d48p-1, -0x1.7d00p-45, + 0x1.780694fde5d38p-1, -0x1.d000p-50, + 0x1.790b938ac1d00p-1, 0x1.3000p-49, + 0x1.7a11473eb0178p-1, -0x1.d000p-49, + 0x1.7b17b0976d060p-1, 0x1.0400p-45, + 0x1.7c1ed0130c133p-1, 0x1.0000p-53, + 0x1.7d26a62ff8636p-1, -0x1.6900p-45, + 0x1.7e2f336cf4e3bp-1, -0x1.2e00p-47, + 0x1.7f3878491c3e8p-1, -0x1.4580p-45, + 0x1.80427543e1b4ep-1, 0x1.3000p-44, + 0x1.814d2add1071ap-1, 0x1.f000p-47, + 0x1.82589994ccd7ep-1, -0x1.1c00p-45, + 0x1.8364c1eb942d0p-1, 0x1.9d00p-45, + 0x1.8471a4623cab5p-1, 0x1.7100p-43, + 0x1.857f4179f5bbcp-1, 0x1.2600p-45, + 0x1.868d99b4491afp-1, -0x1.2c40p-44, + 0x1.879cad931a395p-1, -0x1.3000p-45, + 0x1.88ac7d98a65b8p-1, -0x1.a800p-45, + 0x1.89bd0a4785800p-1, -0x1.d000p-49, + 0x1.8ace5422aa223p-1, 0x1.3280p-44, + 0x1.8be05bad619fap-1, 0x1.2b40p-43, + 0x1.8cf3216b54383p-1, -0x1.ed00p-45, + 0x1.8e06a5e08664cp-1, -0x1.0500p-45, + 0x1.8f1ae99157807p-1, 0x1.8280p-45, + 0x1.902fed0282c0ep-1, -0x1.cb00p-46, + 0x1.9145b0b91ff96p-1, -0x1.5e00p-47, + 0x1.925c353aa2ff9p-1, 0x1.5400p-48, + 0x1.93737b0cdc64ap-1, 0x1.7200p-46, + 0x1.948b82b5f98aep-1, -0x1.9000p-47, + 0x1.95a44cbc852cbp-1, 0x1.5680p-45, + 0x1.96bdd9a766f21p-1, -0x1.6d00p-44, + 0x1.97d829fde4e2ap-1, -0x1.1000p-47, + 0x1.98f33e47a23a3p-1, 0x1.d000p-45, + 0x1.9a0f170ca0604p-1, -0x1.8a40p-44, + 0x1.9b2bb4d53ff89p-1, 0x1.55c0p-44, + 0x1.9c49182a3f15bp-1, 0x1.6b80p-45, + 0x1.9d674194bb8c5p-1, -0x1.c000p-49, + 0x1.9e86319e3238ep-1, 0x1.7d00p-46, + 0x1.9fa5e8d07f302p-1, 0x1.6400p-46, + 0x1.a0c667b5de54dp-1, -0x1.5000p-48, + 0x1.a1e7aed8eb8f6p-1, 0x1.9e00p-47, + 0x1.a309bec4a2e27p-1, 0x1.ad80p-45, + 0x1.a42c980460a5dp-1, -0x1.af00p-46, + 0x1.a5503b23e259bp-1, 0x1.b600p-47, + 0x1.a674a8af46213p-1, 0x1.8880p-44, + 0x1.a799e1330b3a7p-1, 0x1.1200p-46, + 0x1.a8bfe53c12e8dp-1, 0x1.6c00p-47, + 0x1.a9e6b5579fcd2p-1, -0x1.9b80p-45, + 0x1.ab0e521356fb8p-1, 0x1.b700p-45, + 0x1.ac36bbfd3f381p-1, 0x1.9000p-50, + 0x1.ad5ff3a3c2780p-1, 0x1.4000p-49, + 0x1.ae89f995ad2a3p-1, -0x1.c900p-45, + 0x1.afb4ce622f367p-1, 0x1.6500p-46, + 0x1.b0e07298db790p-1, 0x1.fd40p-45, + 0x1.b20ce6c9a89a9p-1, 0x1.2700p-46, + 0x1.b33a2b84f1a4bp-1, 0x1.d470p-43, + 0x1.b468415b747e7p-1, -0x1.8380p-44, + 0x1.b59728de5593ap-1, 0x1.8000p-54, + 0x1.b6c6e29f1c56ap-1, 0x1.ad00p-47, + 0x1.b7f76f2fb5e50p-1, 0x1.e800p-50, + 0x1.b928cf22749b2p-1, -0x1.4c00p-47, + 0x1.ba5b030a10603p-1, -0x1.d700p-47, + 0x1.bb8e0b79a6f66p-1, 0x1.d900p-47, + 0x1.bcc1e904bc1ffp-1, 0x1.2a00p-47, + 0x1.bdf69c3f3a16fp-1, -0x1.f780p-46, + 0x1.bf2c25bd71db8p-1, -0x1.0a00p-46, + 0x1.c06286141b2e9p-1, -0x1.1400p-46, + 0x1.c199bdd8552e0p-1, 0x1.be00p-47, + 0x1.c2d1cd9fa64eep-1, -0x1.9400p-47, + 0x1.c40ab5fffd02fp-1, -0x1.ed00p-47, + 0x1.c544778fafd15p-1, 0x1.9660p-44, + 0x1.c67f12e57d0cbp-1, -0x1.a100p-46, + 0x1.c7ba88988c1b6p-1, -0x1.8458p-42, + 0x1.c8f6d9406e733p-1, -0x1.a480p-46, + 0x1.ca3405751c4dfp-1, 0x1.b000p-51, + 0x1.cb720dcef9094p-1, 0x1.1400p-47, + 0x1.ccb0f2e6d1689p-1, 0x1.0200p-48, + 0x1.cdf0b555dc412p-1, 0x1.3600p-48, + 0x1.cf3155b5bab3bp-1, -0x1.6900p-47, + 0x1.d072d4a0789bcp-1, 0x1.9a00p-47, + 0x1.d1b532b08c8fap-1, -0x1.5e00p-46, + 0x1.d2f87080d8a85p-1, 0x1.d280p-46, + 0x1.d43c8eacaa203p-1, 0x1.1a00p-47, + 0x1.d5818dcfba491p-1, 0x1.f000p-50, + 0x1.d6c76e862e6a1p-1, -0x1.3a00p-47, + 0x1.d80e316c9834ep-1, -0x1.cd80p-47, + 0x1.d955d71ff6090p-1, 0x1.4c00p-48, + 0x1.da9e603db32aep-1, 0x1.f900p-48, + 0x1.dbe7cd63a8325p-1, 0x1.9800p-49, + 0x1.dd321f301b445p-1, -0x1.5200p-48, + 0x1.de7d5641c05bfp-1, -0x1.d700p-46, + 0x1.dfc97337b9aecp-1, -0x1.6140p-46, + 0x1.e11676b197d5ep-1, 0x1.b480p-47, + 0x1.e264614f5a3e7p-1, 0x1.0ce0p-43, + 0x1.e3b333b16ee5cp-1, 0x1.c680p-47, + 0x1.e502ee78b3fb4p-1, -0x1.9300p-47, + 0x1.e653924676d68p-1, -0x1.5000p-49, + 0x1.e7a51fbc74c44p-1, -0x1.7f80p-47, + 0x1.e8f7977cdb726p-1, -0x1.3700p-48, + 0x1.ea4afa2a490e8p-1, 0x1.5d00p-49, + 0x1.eb9f4867ccae4p-1, 0x1.61a0p-46, + 0x1.ecf482d8e680dp-1, 0x1.5500p-48, + 0x1.ee4aaa2188514p-1, 0x1.6400p-51, + 0x1.efa1bee615a13p-1, -0x1.e800p-49, + 0x1.f0f9c1cb64106p-1, -0x1.a880p-48, + 0x1.f252b376bb963p-1, -0x1.c900p-45, + 0x1.f3ac948dd7275p-1, 0x1.a000p-53, + 0x1.f50765b6e4524p-1, -0x1.4f00p-48, + 0x1.f6632798844fdp-1, 0x1.a800p-51, + 0x1.f7bfdad9cbe38p-1, 0x1.abc0p-48, + 0x1.f91d802243c82p-1, -0x1.4600p-50, + 0x1.fa7c1819e908ep-1, -0x1.b0c0p-47, + 0x1.fbdba3692d511p-1, -0x1.0e00p-51, + 0x1.fd3c22b8f7194p-1, -0x1.0de8p-46, + 0x1.fe9d96b2a23eep-1, 0x1.e430p-49, + 0x1.0000000000000p+0, 0x0.0000p+0, + 0x1.00b1afa5abcbep+0, -0x1.3400p-52, + 0x1.0163da9fb3303p+0, -0x1.2170p-46, + 0x1.02168143b0282p+0, 0x1.a400p-52, + 0x1.02c9a3e77806cp+0, 0x1.f980p-49, + 0x1.037d42e11bbcap+0, -0x1.7400p-51, + 0x1.04315e86e7f89p+0, 0x1.8300p-50, + 0x1.04e5f72f65467p+0, -0x1.a3f0p-46, + 0x1.059b0d315855ap+0, -0x1.2840p-47, + 0x1.0650a0e3c1f95p+0, 0x1.1600p-48, + 0x1.0706b29ddf71ap+0, 0x1.5240p-46, + 0x1.07bd42b72a82dp+0, -0x1.9a00p-49, + 0x1.0874518759bd0p+0, 0x1.6400p-49, + 0x1.092bdf66607c8p+0, -0x1.0780p-47, + 0x1.09e3ecac6f383p+0, -0x1.8000p-54, + 0x1.0a9c79b1f3930p+0, 0x1.fa00p-48, + 0x1.0b5586cf988fcp+0, -0x1.ac80p-48, + 0x1.0c0f145e46c8ap+0, 0x1.9c00p-50, + 0x1.0cc922b724816p+0, 0x1.5200p-47, + 0x1.0d83b23395dd8p+0, -0x1.ad00p-48, + 0x1.0e3ec32d3d1f3p+0, 0x1.bac0p-46, + 0x1.0efa55fdfa9a6p+0, -0x1.4e80p-47, + 0x1.0fb66affed2f0p+0, -0x1.d300p-47, + 0x1.1073028d7234bp+0, 0x1.1500p-48, + 0x1.11301d0125b5bp+0, 0x1.c000p-49, + 0x1.11edbab5e2af9p+0, 0x1.6bc0p-46, + 0x1.12abdc06c31d5p+0, 0x1.8400p-49, + 0x1.136a814f2047dp+0, -0x1.ed00p-47, + 0x1.1429aaea92de9p+0, 0x1.8e00p-49, + 0x1.14e95934f3138p+0, 0x1.b400p-49, + 0x1.15a98c8a58e71p+0, 0x1.5300p-47, + 0x1.166a45471c3dfp+0, 0x1.3380p-47, + 0x1.172b83c7d5211p+0, 0x1.8d40p-45, + 0x1.17ed48695bb9fp+0, -0x1.5d00p-47, + 0x1.18af9388c8d93p+0, -0x1.c880p-46, + 0x1.1972658375d66p+0, 0x1.1f00p-46, + 0x1.1a35beb6fcba7p+0, 0x1.0480p-46, + 0x1.1af99f81387e3p+0, -0x1.7390p-43, + 0x1.1bbe084045d54p+0, 0x1.4e40p-45, + 0x1.1c82f95281c43p+0, -0x1.a200p-47, + 0x1.1d4873168b9b2p+0, 0x1.3800p-49, + 0x1.1e0e75eb44031p+0, 0x1.ac00p-49, + 0x1.1ed5022fcd938p+0, 0x1.1900p-47, + 0x1.1f9c18438cdf7p+0, -0x1.b780p-46, + 0x1.2063b88628d8fp+0, 0x1.d940p-45, + 0x1.212be3578a81ep+0, 0x1.8000p-50, + 0x1.21f49917ddd41p+0, 0x1.b340p-45, + 0x1.22bdda2791323p+0, 0x1.9f80p-46, + 0x1.2387a6e7561e7p+0, -0x1.9c80p-46, + 0x1.2451ffb821427p+0, 0x1.2300p-47, + 0x1.251ce4fb2a602p+0, -0x1.3480p-46, + 0x1.25e85711eceb0p+0, 0x1.2700p-46, + 0x1.26b4565e27d16p+0, 0x1.1d00p-46, + 0x1.2780e341de00fp+0, 0x1.1ee0p-44, + 0x1.284dfe1f5633ep+0, -0x1.4c00p-46, + 0x1.291ba7591bb30p+0, -0x1.3d80p-46, + 0x1.29e9df51fdf09p+0, 0x1.8b00p-47, + 0x1.2ab8a66d10e9bp+0, -0x1.27c0p-45, + 0x1.2b87fd0dada3ap+0, 0x1.a340p-45, + 0x1.2c57e39771af9p+0, -0x1.0800p-46, + 0x1.2d285a6e402d9p+0, -0x1.ed00p-47, + 0x1.2df961f641579p+0, -0x1.4200p-48, + 0x1.2ecafa93e2ecfp+0, -0x1.4980p-45, + 0x1.2f9d24abd8822p+0, -0x1.6300p-46, + 0x1.306fe0a31b625p+0, -0x1.2360p-44, + 0x1.31432edeea50bp+0, -0x1.0df8p-40, + 0x1.32170fc4cd7b8p+0, -0x1.2480p-45, + 0x1.32eb83ba8e9a2p+0, -0x1.5980p-45, + 0x1.33c08b2641766p+0, 0x1.ed00p-46, + 0x1.3496266e3fa27p+0, -0x1.c000p-50, + 0x1.356c55f929f0fp+0, -0x1.0d80p-44, + 0x1.36431a2de88b9p+0, 0x1.2c80p-45, + 0x1.371a7373aaa39p+0, 0x1.0600p-45, + 0x1.37f26231e74fep+0, -0x1.6600p-46, + 0x1.38cae6d05d838p+0, -0x1.ae00p-47, + 0x1.39a401b713ec3p+0, -0x1.4720p-43, + 0x1.3a7db34e5a020p+0, 0x1.8200p-47, + 0x1.3b57fbfec6e95p+0, 0x1.e800p-44, + 0x1.3c32dc313a8f2p+0, 0x1.f800p-49, + 0x1.3d0e544ede122p+0, -0x1.7a00p-46, + 0x1.3dea64c1234bbp+0, 0x1.6300p-45, + 0x1.3ec70df1c4eccp+0, -0x1.8a60p-43, + 0x1.3fa4504ac7e8cp+0, -0x1.cdc0p-44, + 0x1.40822c367a0bbp+0, 0x1.5b80p-45, + 0x1.4160a21f72e95p+0, 0x1.ec00p-46, + 0x1.423fb27094646p+0, -0x1.3600p-46, + 0x1.431f5d950a920p+0, 0x1.3980p-45, + 0x1.43ffa3f84b9ebp+0, 0x1.a000p-48, + 0x1.44e0860618919p+0, -0x1.6c00p-48, + 0x1.45c2042a7d201p+0, -0x1.bc00p-47, + 0x1.46a41ed1d0016p+0, -0x1.2800p-46, + 0x1.4786d668b3326p+0, 0x1.0e00p-44, + 0x1.486a2b5c13c00p+0, -0x1.d400p-45, + 0x1.494e1e192af04p+0, 0x1.c200p-47, + 0x1.4a32af0d7d372p+0, -0x1.e500p-46, + 0x1.4b17dea6db801p+0, 0x1.7800p-47, + 0x1.4bfdad53629e1p+0, -0x1.3800p-46, + 0x1.4ce41b817c132p+0, 0x1.0800p-47, + 0x1.4dcb299fddddbp+0, 0x1.c700p-45, + 0x1.4eb2d81d8ab96p+0, -0x1.ce00p-46, + 0x1.4f9b2769d2d02p+0, 0x1.9200p-46, + 0x1.508417f4531c1p+0, -0x1.8c00p-47, + 0x1.516daa2cf662ap+0, -0x1.a000p-48, + 0x1.5257de83f51eap+0, 0x1.a080p-43, + 0x1.5342b569d4edap+0, -0x1.6d80p-45, + 0x1.542e2f4f6ac1ap+0, -0x1.2440p-44, + 0x1.551a4ca5d94dbp+0, 0x1.83c0p-43, + 0x1.56070dde9116bp+0, 0x1.4b00p-45, + 0x1.56f4736b529dep+0, 0x1.15a0p-43, + 0x1.57e27dbe2c40ep+0, -0x1.9e00p-45, + 0x1.58d12d497c76fp+0, -0x1.3080p-45, + 0x1.59c0827ff0b4cp+0, 0x1.dec0p-43, + 0x1.5ab07dd485427p+0, -0x1.4000p-51, + 0x1.5ba11fba87af4p+0, 0x1.0080p-44, + 0x1.5c9268a59460bp+0, -0x1.6c80p-45, + 0x1.5d84590998e3fp+0, 0x1.69a0p-43, + 0x1.5e76f15ad20e1p+0, -0x1.b400p-46, + 0x1.5f6a320dcebcap+0, 0x1.7700p-46, + 0x1.605e1b976dcb8p+0, 0x1.6f80p-45, + 0x1.6152ae6cdf715p+0, 0x1.1000p-47, + 0x1.6247eb03a5531p+0, -0x1.5d00p-46, + 0x1.633dd1d1929b5p+0, -0x1.2d00p-46, + 0x1.6434634ccc313p+0, -0x1.a800p-49, + 0x1.652b9febc8efap+0, -0x1.8600p-45, + 0x1.6623882553397p+0, 0x1.1fe0p-40, + 0x1.671c1c708328ep+0, -0x1.7200p-44, + 0x1.68155d44ca97ep+0, 0x1.6800p-49, + 0x1.690f4b19e9471p+0, -0x1.9780p-45, +}; + +/* + * exp2(x): compute the base 2 exponential of x + * + * Accuracy: Peak error < 0.503 ulp for normalized results. + * + * Method: (accurate tables) + * + * Reduce x: + * x = k + y, for integer k and |y| <= 1/2. + * Thus we have exp2(x) = 2**k * exp2(y). + * + * Reduce y: + * y = i/TBLSIZE + z - eps[i] for integer i near y * TBLSIZE. + * Thus we have exp2(y) = exp2(i/TBLSIZE) * exp2(z - eps[i]), + * with |z - eps[i]| <= 2**-9 + 2**-39 for the table used. + * + * We compute exp2(i/TBLSIZE) via table lookup and exp2(z - eps[i]) via + * a degree-5 minimax polynomial with maximum error under 1.3 * 2**-61. + * The values in exp2t[] and eps[] are chosen such that + * exp2t[i] = exp2(i/TBLSIZE + eps[i]), and eps[i] is a small offset such + * that exp2t[i] is accurate to 2**-64. + * + * Note that the range of i is +-TBLSIZE/2, so we actually index the tables + * by i0 = i + TBLSIZE/2. For cache efficiency, exp2t[] and eps[] are + * virtual tables, interleaved in the real table tbl[]. + * + * This method is due to Gal, with many details due to Gal and Bachelis: + * + * Gal, S. and Bachelis, B. An Accurate Elementary Mathematical Library + * for the IEEE Floating Point Standard. TOMS 17(1), 26-46 (1991). + */ +double exp2(double x) +{ + double_t r, t, z; + uint32_t ix, i0; + union {double f; uint64_t i;} u = {x}; + union {uint32_t u; int32_t i;} k; + + /* Filter out exceptional cases. */ + ix = u.i>>32 & 0x7fffffff; + if (ix >= 0x408ff000) { /* |x| >= 1022 or nan */ + if (ix >= 0x40900000 && u.i>>63 == 0) { /* x >= 1024 or nan */ + /* overflow */ + x *= 0x1p1023; + return x; + } + if (ix >= 0x7ff00000) /* -inf or -nan */ + return -1/x; + if (u.i>>63) { /* x <= -1022 */ + /* underflow */ + if (x <= -1075 || x - 0x1p52 + 0x1p52 != x) + FORCE_EVAL((float)(-0x1p-149/x)); + if (x <= -1075) + return 0; + } + } else if (ix < 0x3c900000) { /* |x| < 0x1p-54 */ + return 1.0 + x; + } + + /* Reduce x, computing z, i0, and k. */ + u.f = x + redux; + i0 = u.i; + i0 += TBLSIZE / 2; + k.u = i0 / TBLSIZE * TBLSIZE; + k.i /= TBLSIZE; + i0 %= TBLSIZE; + u.f -= redux; + z = x - u.f; + + /* Compute r = exp2(y) = exp2t[i0] * p(z - eps[i]). */ + t = tbl[2*i0]; /* exp2t[i0] */ + z -= tbl[2*i0 + 1]; /* eps[i0] */ + r = t + t * z * (P1 + z * (P2 + z * (P3 + z * (P4 + z * P5)))); + + return scalbn(r, k.i); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/exp2f.c b/lib/mlibc/options/ansi/musl-generic-math/exp2f.c new file mode 100644 index 0000000..296b634 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/exp2f.c @@ -0,0 +1,126 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_exp2f.c */ +/*- + * Copyright (c) 2005 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#include "libm.h" + +#define TBLSIZE 16 + +static const float +redux = 0x1.8p23f / TBLSIZE, +P1 = 0x1.62e430p-1f, +P2 = 0x1.ebfbe0p-3f, +P3 = 0x1.c6b348p-5f, +P4 = 0x1.3b2c9cp-7f; + +static const double exp2ft[TBLSIZE] = { + 0x1.6a09e667f3bcdp-1, + 0x1.7a11473eb0187p-1, + 0x1.8ace5422aa0dbp-1, + 0x1.9c49182a3f090p-1, + 0x1.ae89f995ad3adp-1, + 0x1.c199bdd85529cp-1, + 0x1.d5818dcfba487p-1, + 0x1.ea4afa2a490dap-1, + 0x1.0000000000000p+0, + 0x1.0b5586cf9890fp+0, + 0x1.172b83c7d517bp+0, + 0x1.2387a6e756238p+0, + 0x1.306fe0a31b715p+0, + 0x1.3dea64c123422p+0, + 0x1.4bfdad5362a27p+0, + 0x1.5ab07dd485429p+0, +}; + +/* + * exp2f(x): compute the base 2 exponential of x + * + * Accuracy: Peak error < 0.501 ulp; location of peak: -0.030110927. + * + * Method: (equally-spaced tables) + * + * Reduce x: + * x = k + y, for integer k and |y| <= 1/2. + * Thus we have exp2f(x) = 2**k * exp2(y). + * + * Reduce y: + * y = i/TBLSIZE + z for integer i near y * TBLSIZE. + * Thus we have exp2(y) = exp2(i/TBLSIZE) * exp2(z), + * with |z| <= 2**-(TBLSIZE+1). + * + * We compute exp2(i/TBLSIZE) via table lookup and exp2(z) via a + * degree-4 minimax polynomial with maximum error under 1.4 * 2**-33. + * Using double precision for everything except the reduction makes + * roundoff error insignificant and simplifies the scaling step. + * + * This method is due to Tang, but I do not use his suggested parameters: + * + * Tang, P. Table-driven Implementation of the Exponential Function + * in IEEE Floating-Point Arithmetic. TOMS 15(2), 144-157 (1989). + */ +float exp2f(float x) +{ + double_t t, r, z; + union {float f; uint32_t i;} u = {x}; + union {double f; uint64_t i;} uk; + uint32_t ix, i0, k; + + /* Filter out exceptional cases. */ + ix = u.i & 0x7fffffff; + if (ix > 0x42fc0000) { /* |x| > 126 */ + if (ix > 0x7f800000) /* NaN */ + return x; + if (u.i >= 0x43000000 && u.i < 0x80000000) { /* x >= 128 */ + x *= 0x1p127f; + return x; + } + if (u.i >= 0x80000000) { /* x < -126 */ + if (u.i >= 0xc3160000 || (u.i & 0x0000ffff)) + FORCE_EVAL(-0x1p-149f/x); + if (u.i >= 0xc3160000) /* x <= -150 */ + return 0; + } + } else if (ix <= 0x33000000) { /* |x| <= 0x1p-25 */ + return 1.0f + x; + } + + /* Reduce x, computing z, i0, and k. */ + u.f = x + redux; + i0 = u.i; + i0 += TBLSIZE / 2; + k = i0 / TBLSIZE; + uk.i = (uint64_t)(0x3ff + k)<<52; + i0 &= TBLSIZE - 1; + u.f -= redux; + z = x - u.f; + /* Compute r = exp2(y) = exp2ft[i0] * p(z). */ + r = exp2ft[i0]; + t = r * z; + r = r + t * (P1 + z * P2) + t * (z * z) * (P3 + z * P4); + + /* Scale by 2**k */ + return r * uk.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/exp2l.c b/lib/mlibc/options/ansi/musl-generic-math/exp2l.c new file mode 100644 index 0000000..3565c1e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/exp2l.c @@ -0,0 +1,619 @@ +/* origin: FreeBSD /usr/src/lib/msun/ld80/s_exp2l.c and /usr/src/lib/msun/ld128/s_exp2l.c */ +/*- + * Copyright (c) 2005-2008 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double exp2l(long double x) +{ + return exp2(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +#define TBLBITS 7 +#define TBLSIZE (1 << TBLBITS) + +static const double +redux = 0x1.8p63 / TBLSIZE, +P1 = 0x1.62e42fefa39efp-1, +P2 = 0x1.ebfbdff82c58fp-3, +P3 = 0x1.c6b08d7049fap-5, +P4 = 0x1.3b2ab6fba4da5p-7, +P5 = 0x1.5d8804780a736p-10, +P6 = 0x1.430918835e33dp-13; + +static const double tbl[TBLSIZE * 2] = { + 0x1.6a09e667f3bcdp-1, -0x1.bdd3413b2648p-55, + 0x1.6c012750bdabfp-1, -0x1.2895667ff0cp-57, + 0x1.6dfb23c651a2fp-1, -0x1.bbe3a683c88p-58, + 0x1.6ff7df9519484p-1, -0x1.83c0f25860fp-56, + 0x1.71f75e8ec5f74p-1, -0x1.16e4786887bp-56, + 0x1.73f9a48a58174p-1, -0x1.0a8d96c65d5p-55, + 0x1.75feb564267c9p-1, -0x1.0245957316ep-55, + 0x1.780694fde5d3fp-1, 0x1.866b80a0216p-55, + 0x1.7a11473eb0187p-1, -0x1.41577ee0499p-56, + 0x1.7c1ed0130c132p-1, 0x1.f124cd1164ep-55, + 0x1.7e2f336cf4e62p-1, 0x1.05d02ba157ap-57, + 0x1.80427543e1a12p-1, -0x1.27c86626d97p-55, + 0x1.82589994cce13p-1, -0x1.d4c1dd41533p-55, + 0x1.8471a4623c7adp-1, -0x1.8d684a341cep-56, + 0x1.868d99b4492edp-1, -0x1.fc6f89bd4f68p-55, + 0x1.88ac7d98a6699p-1, 0x1.994c2f37cb5p-55, + 0x1.8ace5422aa0dbp-1, 0x1.6e9f156864bp-55, + 0x1.8cf3216b5448cp-1, -0x1.0d55e32e9e4p-57, + 0x1.8f1ae99157736p-1, 0x1.5cc13a2e397p-56, + 0x1.9145b0b91ffc6p-1, -0x1.dd6792e5825p-55, + 0x1.93737b0cdc5e5p-1, -0x1.75fc781b58p-58, + 0x1.95a44cbc8520fp-1, -0x1.64b7c96a5fp-57, + 0x1.97d829fde4e5p-1, -0x1.d185b7c1b86p-55, + 0x1.9a0f170ca07bap-1, -0x1.173bd91cee6p-55, + 0x1.9c49182a3f09p-1, 0x1.c7c46b071f2p-57, + 0x1.9e86319e32323p-1, 0x1.824ca78e64cp-57, + 0x1.a0c667b5de565p-1, -0x1.359495d1cd5p-55, + 0x1.a309bec4a2d33p-1, 0x1.6305c7ddc368p-55, + 0x1.a5503b23e255dp-1, -0x1.d2f6edb8d42p-55, + 0x1.a799e1330b358p-1, 0x1.bcb7ecac564p-55, + 0x1.a9e6b5579fdbfp-1, 0x1.0fac90ef7fdp-55, + 0x1.ac36bbfd3f37ap-1, -0x1.f9234cae76dp-56, + 0x1.ae89f995ad3adp-1, 0x1.7a1cd345dcc8p-55, + 0x1.b0e07298db666p-1, -0x1.bdef54c80e4p-55, + 0x1.b33a2b84f15fbp-1, -0x1.2805e3084d8p-58, + 0x1.b59728de5593ap-1, -0x1.c71dfbbba6ep-55, + 0x1.b7f76f2fb5e47p-1, -0x1.5584f7e54acp-57, + 0x1.ba5b030a1064ap-1, -0x1.efcd30e5429p-55, + 0x1.bcc1e904bc1d2p-1, 0x1.23dd07a2d9fp-56, + 0x1.bf2c25bd71e09p-1, -0x1.efdca3f6b9c8p-55, + 0x1.c199bdd85529cp-1, 0x1.11065895049p-56, + 0x1.c40ab5fffd07ap-1, 0x1.b4537e083c6p-55, + 0x1.c67f12e57d14bp-1, 0x1.2884dff483c8p-55, + 0x1.c8f6d9406e7b5p-1, 0x1.1acbc48805cp-57, + 0x1.cb720dcef9069p-1, 0x1.503cbd1e94ap-57, + 0x1.cdf0b555dc3fap-1, -0x1.dd83b53829dp-56, + 0x1.d072d4a07897cp-1, -0x1.cbc3743797a8p-55, + 0x1.d2f87080d89f2p-1, -0x1.d487b719d858p-55, + 0x1.d5818dcfba487p-1, 0x1.2ed02d75b37p-56, + 0x1.d80e316c98398p-1, -0x1.11ec18bedep-55, + 0x1.da9e603db3285p-1, 0x1.c2300696db5p-55, + 0x1.dd321f301b46p-1, 0x1.2da5778f019p-55, + 0x1.dfc97337b9b5fp-1, -0x1.1a5cd4f184b8p-55, + 0x1.e264614f5a129p-1, -0x1.7b627817a148p-55, + 0x1.e502ee78b3ff6p-1, 0x1.39e8980a9cdp-56, + 0x1.e7a51fbc74c83p-1, 0x1.2d522ca0c8ep-55, + 0x1.ea4afa2a490dap-1, -0x1.e9c23179c288p-55, + 0x1.ecf482d8e67f1p-1, -0x1.c93f3b411ad8p-55, + 0x1.efa1bee615a27p-1, 0x1.dc7f486a4b68p-55, + 0x1.f252b376bba97p-1, 0x1.3a1a5bf0d8e8p-55, + 0x1.f50765b6e454p-1, 0x1.9d3e12dd8a18p-55, + 0x1.f7bfdad9cbe14p-1, -0x1.dbb12d00635p-55, + 0x1.fa7c1819e90d8p-1, 0x1.74853f3a593p-56, + 0x1.fd3c22b8f71f1p-1, 0x1.2eb74966578p-58, + 0x1p+0, 0x0p+0, + 0x1.0163da9fb3335p+0, 0x1.b61299ab8cd8p-54, + 0x1.02c9a3e778061p+0, -0x1.19083535b08p-56, + 0x1.04315e86e7f85p+0, -0x1.0a31c1977c98p-54, + 0x1.059b0d3158574p+0, 0x1.d73e2a475b4p-55, + 0x1.0706b29ddf6dep+0, -0x1.c91dfe2b13cp-55, + 0x1.0874518759bc8p+0, 0x1.186be4bb284p-57, + 0x1.09e3ecac6f383p+0, 0x1.14878183161p-54, + 0x1.0b5586cf9890fp+0, 0x1.8a62e4adc61p-54, + 0x1.0cc922b7247f7p+0, 0x1.01edc16e24f8p-54, + 0x1.0e3ec32d3d1a2p+0, 0x1.03a1727c58p-59, + 0x1.0fb66affed31bp+0, -0x1.b9bedc44ebcp-57, + 0x1.11301d0125b51p+0, -0x1.6c51039449bp-54, + 0x1.12abdc06c31ccp+0, -0x1.1b514b36ca8p-58, + 0x1.1429aaea92dep+0, -0x1.32fbf9af1368p-54, + 0x1.15a98c8a58e51p+0, 0x1.2406ab9eeabp-55, + 0x1.172b83c7d517bp+0, -0x1.19041b9d78ap-55, + 0x1.18af9388c8deap+0, -0x1.11023d1970f8p-54, + 0x1.1a35beb6fcb75p+0, 0x1.e5b4c7b4969p-55, + 0x1.1bbe084045cd4p+0, -0x1.95386352ef6p-54, + 0x1.1d4873168b9aap+0, 0x1.e016e00a264p-54, + 0x1.1ed5022fcd91dp+0, -0x1.1df98027bb78p-54, + 0x1.2063b88628cd6p+0, 0x1.dc775814a85p-55, + 0x1.21f49917ddc96p+0, 0x1.2a97e9494a6p-55, + 0x1.2387a6e756238p+0, 0x1.9b07eb6c7058p-54, + 0x1.251ce4fb2a63fp+0, 0x1.ac155bef4f5p-55, + 0x1.26b4565e27cddp+0, 0x1.2bd339940eap-55, + 0x1.284dfe1f56381p+0, -0x1.a4c3a8c3f0d8p-54, + 0x1.29e9df51fdee1p+0, 0x1.612e8afad12p-55, + 0x1.2b87fd0dad99p+0, -0x1.10adcd6382p-59, + 0x1.2d285a6e4030bp+0, 0x1.0024754db42p-54, + 0x1.2ecafa93e2f56p+0, 0x1.1ca0f45d524p-56, + 0x1.306fe0a31b715p+0, 0x1.6f46ad23183p-55, + 0x1.32170fc4cd831p+0, 0x1.a9ce78e1804p-55, + 0x1.33c08b26416ffp+0, 0x1.327218436598p-54, + 0x1.356c55f929ff1p+0, -0x1.b5cee5c4e46p-55, + 0x1.371a7373aa9cbp+0, -0x1.63aeabf42ebp-54, + 0x1.38cae6d05d866p+0, -0x1.e958d3c99048p-54, + 0x1.3a7db34e59ff7p+0, -0x1.5e436d661f6p-56, + 0x1.3c32dc313a8e5p+0, -0x1.efff8375d2ap-54, + 0x1.3dea64c123422p+0, 0x1.ada0911f09fp-55, + 0x1.3fa4504ac801cp+0, -0x1.7d023f956fap-54, + 0x1.4160a21f72e2ap+0, -0x1.ef3691c309p-58, + 0x1.431f5d950a897p+0, -0x1.1c7dde35f7ap-55, + 0x1.44e086061892dp+0, 0x1.89b7a04ef8p-59, + 0x1.46a41ed1d0057p+0, 0x1.c944bd1648a8p-54, + 0x1.486a2b5c13cdp+0, 0x1.3c1a3b69062p-56, + 0x1.4a32af0d7d3dep+0, 0x1.9cb62f3d1be8p-54, + 0x1.4bfdad5362a27p+0, 0x1.d4397afec42p-56, + 0x1.4dcb299fddd0dp+0, 0x1.8ecdbbc6a78p-54, + 0x1.4f9b2769d2ca7p+0, -0x1.4b309d25958p-54, + 0x1.516daa2cf6642p+0, -0x1.f768569bd94p-55, + 0x1.5342b569d4f82p+0, -0x1.07abe1db13dp-55, + 0x1.551a4ca5d920fp+0, -0x1.d689cefede6p-55, + 0x1.56f4736b527dap+0, 0x1.9bb2c011d938p-54, + 0x1.58d12d497c7fdp+0, 0x1.295e15b9a1ep-55, + 0x1.5ab07dd485429p+0, 0x1.6324c0546478p-54, + 0x1.5c9268a5946b7p+0, 0x1.c4b1b81698p-60, + 0x1.5e76f15ad2148p+0, 0x1.ba6f93080e68p-54, + 0x1.605e1b976dc09p+0, -0x1.3e2429b56de8p-54, + 0x1.6247eb03a5585p+0, -0x1.383c17e40b48p-54, + 0x1.6434634ccc32p+0, -0x1.c483c759d89p-55, + 0x1.6623882552225p+0, -0x1.bb60987591cp-54, + 0x1.68155d44ca973p+0, 0x1.038ae44f74p-57, +}; + +/* + * exp2l(x): compute the base 2 exponential of x + * + * Accuracy: Peak error < 0.511 ulp. + * + * Method: (equally-spaced tables) + * + * Reduce x: + * x = 2**k + y, for integer k and |y| <= 1/2. + * Thus we have exp2l(x) = 2**k * exp2(y). + * + * Reduce y: + * y = i/TBLSIZE + z for integer i near y * TBLSIZE. + * Thus we have exp2(y) = exp2(i/TBLSIZE) * exp2(z), + * with |z| <= 2**-(TBLBITS+1). + * + * We compute exp2(i/TBLSIZE) via table lookup and exp2(z) via a + * degree-6 minimax polynomial with maximum error under 2**-69. + * The table entries each have 104 bits of accuracy, encoded as + * a pair of double precision values. + */ +long double exp2l(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double r, z; + uint32_t i0; + union {uint32_t u; int32_t i;} k; + + /* Filter out exceptional cases. */ + if (e >= 0x3fff + 13) { /* |x| >= 8192 or x is NaN */ + if (u.i.se >= 0x3fff + 14 && u.i.se >> 15 == 0) + /* overflow */ + return x * 0x1p16383L; + if (e == 0x7fff) /* -inf or -nan */ + return -1/x; + if (x < -16382) { + if (x <= -16446 || x - 0x1p63 + 0x1p63 != x) + /* underflow */ + FORCE_EVAL((float)(-0x1p-149/x)); + if (x <= -16446) + return 0; + } + } else if (e < 0x3fff - 64) { + return 1 + x; + } + + /* + * Reduce x, computing z, i0, and k. The low bits of x + redux + * contain the 16-bit integer part of the exponent (k) followed by + * TBLBITS fractional bits (i0). We use bit tricks to extract these + * as integers, then set z to the remainder. + * + * Example: Suppose x is 0xabc.123456p0 and TBLBITS is 8. + * Then the low-order word of x + redux is 0x000abc12, + * We split this into k = 0xabc and i0 = 0x12 (adjusted to + * index into the table), then we compute z = 0x0.003456p0. + */ + u.f = x + redux; + i0 = u.i.m + TBLSIZE / 2; + k.u = i0 / TBLSIZE * TBLSIZE; + k.i /= TBLSIZE; + i0 %= TBLSIZE; + u.f -= redux; + z = x - u.f; + + /* Compute r = exp2l(y) = exp2lt[i0] * p(z). */ + long double t_hi = tbl[2*i0]; + long double t_lo = tbl[2*i0 + 1]; + /* XXX This gives > 1 ulp errors outside of FE_TONEAREST mode */ + r = t_lo + (t_hi + t_lo) * z * (P1 + z * (P2 + z * (P3 + z * (P4 + + z * (P5 + z * P6))))) + t_hi; + + return scalbnl(r, k.i); +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +#define TBLBITS 7 +#define TBLSIZE (1 << TBLBITS) + +static const long double + P1 = 0x1.62e42fefa39ef35793c7673007e6p-1L, + P2 = 0x1.ebfbdff82c58ea86f16b06ec9736p-3L, + P3 = 0x1.c6b08d704a0bf8b33a762bad3459p-5L, + P4 = 0x1.3b2ab6fba4e7729ccbbe0b4f3fc2p-7L, + P5 = 0x1.5d87fe78a67311071dee13fd11d9p-10L, + P6 = 0x1.430912f86c7876f4b663b23c5fe5p-13L; + +static const double + P7 = 0x1.ffcbfc588b041p-17, + P8 = 0x1.62c0223a5c7c7p-20, + P9 = 0x1.b52541ff59713p-24, + P10 = 0x1.e4cf56a391e22p-28, + redux = 0x1.8p112 / TBLSIZE; + +static const long double tbl[TBLSIZE] = { + 0x1.6a09e667f3bcc908b2fb1366dfeap-1L, + 0x1.6c012750bdabeed76a99800f4edep-1L, + 0x1.6dfb23c651a2ef220e2cbe1bc0d4p-1L, + 0x1.6ff7df9519483cf87e1b4f3e1e98p-1L, + 0x1.71f75e8ec5f73dd2370f2ef0b148p-1L, + 0x1.73f9a48a58173bd5c9a4e68ab074p-1L, + 0x1.75feb564267c8bf6e9aa33a489a8p-1L, + 0x1.780694fde5d3f619ae02808592a4p-1L, + 0x1.7a11473eb0186d7d51023f6ccb1ap-1L, + 0x1.7c1ed0130c1327c49334459378dep-1L, + 0x1.7e2f336cf4e62105d02ba1579756p-1L, + 0x1.80427543e1a11b60de67649a3842p-1L, + 0x1.82589994cce128acf88afab34928p-1L, + 0x1.8471a4623c7acce52f6b97c6444cp-1L, + 0x1.868d99b4492ec80e41d90ac2556ap-1L, + 0x1.88ac7d98a669966530bcdf2d4cc0p-1L, + 0x1.8ace5422aa0db5ba7c55a192c648p-1L, + 0x1.8cf3216b5448bef2aa1cd161c57ap-1L, + 0x1.8f1ae991577362b982745c72eddap-1L, + 0x1.9145b0b91ffc588a61b469f6b6a0p-1L, + 0x1.93737b0cdc5e4f4501c3f2540ae8p-1L, + 0x1.95a44cbc8520ee9b483695a0e7fep-1L, + 0x1.97d829fde4e4f8b9e920f91e8eb6p-1L, + 0x1.9a0f170ca07b9ba3109b8c467844p-1L, + 0x1.9c49182a3f0901c7c46b071f28dep-1L, + 0x1.9e86319e323231824ca78e64c462p-1L, + 0x1.a0c667b5de564b29ada8b8cabbacp-1L, + 0x1.a309bec4a2d3358c171f770db1f4p-1L, + 0x1.a5503b23e255c8b424491caf88ccp-1L, + 0x1.a799e1330b3586f2dfb2b158f31ep-1L, + 0x1.a9e6b5579fdbf43eb243bdff53a2p-1L, + 0x1.ac36bbfd3f379c0db966a3126988p-1L, + 0x1.ae89f995ad3ad5e8734d17731c80p-1L, + 0x1.b0e07298db66590842acdfc6fb4ep-1L, + 0x1.b33a2b84f15faf6bfd0e7bd941b0p-1L, + 0x1.b59728de559398e3881111648738p-1L, + 0x1.b7f76f2fb5e46eaa7b081ab53ff6p-1L, + 0x1.ba5b030a10649840cb3c6af5b74cp-1L, + 0x1.bcc1e904bc1d2247ba0f45b3d06cp-1L, + 0x1.bf2c25bd71e088408d7025190cd0p-1L, + 0x1.c199bdd85529c2220cb12a0916bap-1L, + 0x1.c40ab5fffd07a6d14df820f17deap-1L, + 0x1.c67f12e57d14b4a2137fd20f2a26p-1L, + 0x1.c8f6d9406e7b511acbc48805c3f6p-1L, + 0x1.cb720dcef90691503cbd1e949d0ap-1L, + 0x1.cdf0b555dc3f9c44f8958fac4f12p-1L, + 0x1.d072d4a07897b8d0f22f21a13792p-1L, + 0x1.d2f87080d89f18ade123989ea50ep-1L, + 0x1.d5818dcfba48725da05aeb66dff8p-1L, + 0x1.d80e316c98397bb84f9d048807a0p-1L, + 0x1.da9e603db3285708c01a5b6d480cp-1L, + 0x1.dd321f301b4604b695de3c0630c0p-1L, + 0x1.dfc97337b9b5eb968cac39ed284cp-1L, + 0x1.e264614f5a128a12761fa17adc74p-1L, + 0x1.e502ee78b3ff6273d130153992d0p-1L, + 0x1.e7a51fbc74c834b548b2832378a4p-1L, + 0x1.ea4afa2a490d9858f73a18f5dab4p-1L, + 0x1.ecf482d8e67f08db0312fb949d50p-1L, + 0x1.efa1bee615a27771fd21a92dabb6p-1L, + 0x1.f252b376bba974e8696fc3638f24p-1L, + 0x1.f50765b6e4540674f84b762861a6p-1L, + 0x1.f7bfdad9cbe138913b4bfe72bd78p-1L, + 0x1.fa7c1819e90d82e90a7e74b26360p-1L, + 0x1.fd3c22b8f71f10975ba4b32bd006p-1L, + 0x1.0000000000000000000000000000p+0L, + 0x1.0163da9fb33356d84a66ae336e98p+0L, + 0x1.02c9a3e778060ee6f7caca4f7a18p+0L, + 0x1.04315e86e7f84bd738f9a20da442p+0L, + 0x1.059b0d31585743ae7c548eb68c6ap+0L, + 0x1.0706b29ddf6ddc6dc403a9d87b1ep+0L, + 0x1.0874518759bc808c35f25d942856p+0L, + 0x1.09e3ecac6f3834521e060c584d5cp+0L, + 0x1.0b5586cf9890f6298b92b7184200p+0L, + 0x1.0cc922b7247f7407b705b893dbdep+0L, + 0x1.0e3ec32d3d1a2020742e4f8af794p+0L, + 0x1.0fb66affed31af232091dd8a169ep+0L, + 0x1.11301d0125b50a4ebbf1aed9321cp+0L, + 0x1.12abdc06c31cbfb92bad324d6f84p+0L, + 0x1.1429aaea92ddfb34101943b2588ep+0L, + 0x1.15a98c8a58e512480d573dd562aep+0L, + 0x1.172b83c7d517adcdf7c8c50eb162p+0L, + 0x1.18af9388c8de9bbbf70b9a3c269cp+0L, + 0x1.1a35beb6fcb753cb698f692d2038p+0L, + 0x1.1bbe084045cd39ab1e72b442810ep+0L, + 0x1.1d4873168b9aa7805b8028990be8p+0L, + 0x1.1ed5022fcd91cb8819ff61121fbep+0L, + 0x1.2063b88628cd63b8eeb0295093f6p+0L, + 0x1.21f49917ddc962552fd29294bc20p+0L, + 0x1.2387a6e75623866c1fadb1c159c0p+0L, + 0x1.251ce4fb2a63f3582ab7de9e9562p+0L, + 0x1.26b4565e27cdd257a673281d3068p+0L, + 0x1.284dfe1f5638096cf15cf03c9fa0p+0L, + 0x1.29e9df51fdee12c25d15f5a25022p+0L, + 0x1.2b87fd0dad98ffddea46538fca24p+0L, + 0x1.2d285a6e4030b40091d536d0733ep+0L, + 0x1.2ecafa93e2f5611ca0f45d5239a4p+0L, + 0x1.306fe0a31b7152de8d5a463063bep+0L, + 0x1.32170fc4cd8313539cf1c3009330p+0L, + 0x1.33c08b26416ff4c9c8610d96680ep+0L, + 0x1.356c55f929ff0c94623476373be4p+0L, + 0x1.371a7373aa9caa7145502f45452ap+0L, + 0x1.38cae6d05d86585a9cb0d9bed530p+0L, + 0x1.3a7db34e59ff6ea1bc9299e0a1fep+0L, + 0x1.3c32dc313a8e484001f228b58cf0p+0L, + 0x1.3dea64c12342235b41223e13d7eep+0L, + 0x1.3fa4504ac801ba0bf701aa417b9cp+0L, + 0x1.4160a21f72e29f84325b8f3dbacap+0L, + 0x1.431f5d950a896dc704439410b628p+0L, + 0x1.44e086061892d03136f409df0724p+0L, + 0x1.46a41ed1d005772512f459229f0ap+0L, + 0x1.486a2b5c13cd013c1a3b69062f26p+0L, + 0x1.4a32af0d7d3de672d8bcf46f99b4p+0L, + 0x1.4bfdad5362a271d4397afec42e36p+0L, + 0x1.4dcb299fddd0d63b36ef1a9e19dep+0L, + 0x1.4f9b2769d2ca6ad33d8b69aa0b8cp+0L, + 0x1.516daa2cf6641c112f52c84d6066p+0L, + 0x1.5342b569d4f81df0a83c49d86bf4p+0L, + 0x1.551a4ca5d920ec52ec620243540cp+0L, + 0x1.56f4736b527da66ecb004764e61ep+0L, + 0x1.58d12d497c7fd252bc2b7343d554p+0L, + 0x1.5ab07dd48542958c93015191e9a8p+0L, + 0x1.5c9268a5946b701c4b1b81697ed4p+0L, + 0x1.5e76f15ad21486e9be4c20399d12p+0L, + 0x1.605e1b976dc08b076f592a487066p+0L, + 0x1.6247eb03a5584b1f0fa06fd2d9eap+0L, + 0x1.6434634ccc31fc76f8714c4ee122p+0L, + 0x1.66238825522249127d9e29b92ea2p+0L, + 0x1.68155d44ca973081c57227b9f69ep+0L, +}; + +static const float eps[TBLSIZE] = { + -0x1.5c50p-101, + -0x1.5d00p-106, + 0x1.8e90p-102, + -0x1.5340p-103, + 0x1.1bd0p-102, + -0x1.4600p-105, + -0x1.7a40p-104, + 0x1.d590p-102, + -0x1.d590p-101, + 0x1.b100p-103, + -0x1.0d80p-105, + 0x1.6b00p-103, + -0x1.9f00p-105, + 0x1.c400p-103, + 0x1.e120p-103, + -0x1.c100p-104, + -0x1.9d20p-103, + 0x1.a800p-108, + 0x1.4c00p-106, + -0x1.9500p-106, + 0x1.6900p-105, + -0x1.29d0p-100, + 0x1.4c60p-103, + 0x1.13a0p-102, + -0x1.5b60p-103, + -0x1.1c40p-103, + 0x1.db80p-102, + 0x1.91a0p-102, + 0x1.dc00p-105, + 0x1.44c0p-104, + 0x1.9710p-102, + 0x1.8760p-103, + -0x1.a720p-103, + 0x1.ed20p-103, + -0x1.49c0p-102, + -0x1.e000p-111, + 0x1.86a0p-103, + 0x1.2b40p-103, + -0x1.b400p-108, + 0x1.1280p-99, + -0x1.02d8p-102, + -0x1.e3d0p-103, + -0x1.b080p-105, + -0x1.f100p-107, + -0x1.16c0p-105, + -0x1.1190p-103, + -0x1.a7d2p-100, + 0x1.3450p-103, + -0x1.67c0p-105, + 0x1.4b80p-104, + -0x1.c4e0p-103, + 0x1.6000p-108, + -0x1.3f60p-105, + 0x1.93f0p-104, + 0x1.5fe0p-105, + 0x1.6f80p-107, + -0x1.7600p-106, + 0x1.21e0p-106, + -0x1.3a40p-106, + -0x1.40c0p-104, + -0x1.9860p-105, + -0x1.5d40p-108, + -0x1.1d70p-106, + 0x1.2760p-105, + 0x0.0000p+0, + 0x1.21e2p-104, + -0x1.9520p-108, + -0x1.5720p-106, + -0x1.4810p-106, + -0x1.be00p-109, + 0x1.0080p-105, + -0x1.5780p-108, + -0x1.d460p-105, + -0x1.6140p-105, + 0x1.4630p-104, + 0x1.ad50p-103, + 0x1.82e0p-105, + 0x1.1d3cp-101, + 0x1.6100p-107, + 0x1.ec30p-104, + 0x1.f200p-108, + 0x1.0b40p-103, + 0x1.3660p-102, + 0x1.d9d0p-103, + -0x1.02d0p-102, + 0x1.b070p-103, + 0x1.b9c0p-104, + -0x1.01c0p-103, + -0x1.dfe0p-103, + 0x1.1b60p-104, + -0x1.ae94p-101, + -0x1.3340p-104, + 0x1.b3d8p-102, + -0x1.6e40p-105, + -0x1.3670p-103, + 0x1.c140p-104, + 0x1.1840p-101, + 0x1.1ab0p-102, + -0x1.a400p-104, + 0x1.1f00p-104, + -0x1.7180p-103, + 0x1.4ce0p-102, + 0x1.9200p-107, + -0x1.54c0p-103, + 0x1.1b80p-105, + -0x1.1828p-101, + 0x1.5720p-102, + -0x1.a060p-100, + 0x1.9160p-102, + 0x1.a280p-104, + 0x1.3400p-107, + 0x1.2b20p-102, + 0x1.7800p-108, + 0x1.cfd0p-101, + 0x1.2ef0p-102, + -0x1.2760p-99, + 0x1.b380p-104, + 0x1.0048p-101, + -0x1.60b0p-102, + 0x1.a1ccp-100, + -0x1.a640p-104, + -0x1.08a0p-101, + 0x1.7e60p-102, + 0x1.22c0p-103, + -0x1.7200p-106, + 0x1.f0f0p-102, + 0x1.eb4ep-99, + 0x1.c6e0p-103, +}; + +/* + * exp2l(x): compute the base 2 exponential of x + * + * Accuracy: Peak error < 0.502 ulp. + * + * Method: (accurate tables) + * + * Reduce x: + * x = 2**k + y, for integer k and |y| <= 1/2. + * Thus we have exp2(x) = 2**k * exp2(y). + * + * Reduce y: + * y = i/TBLSIZE + z - eps[i] for integer i near y * TBLSIZE. + * Thus we have exp2(y) = exp2(i/TBLSIZE) * exp2(z - eps[i]), + * with |z - eps[i]| <= 2**-8 + 2**-98 for the table used. + * + * We compute exp2(i/TBLSIZE) via table lookup and exp2(z - eps[i]) via + * a degree-10 minimax polynomial with maximum error under 2**-120. + * The values in exp2t[] and eps[] are chosen such that + * exp2t[i] = exp2(i/TBLSIZE + eps[i]), and eps[i] is a small offset such + * that exp2t[i] is accurate to 2**-122. + * + * Note that the range of i is +-TBLSIZE/2, so we actually index the tables + * by i0 = i + TBLSIZE/2. + * + * This method is due to Gal, with many details due to Gal and Bachelis: + * + * Gal, S. and Bachelis, B. An Accurate Elementary Mathematical Library + * for the IEEE Floating Point Standard. TOMS 17(1), 26-46 (1991). + */ +long double +exp2l(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double r, z, t; + uint32_t i0; + union {uint32_t u; int32_t i;} k; + + /* Filter out exceptional cases. */ + if (e >= 0x3fff + 14) { /* |x| >= 16384 or x is NaN */ + if (u.i.se >= 0x3fff + 15 && u.i.se >> 15 == 0) + /* overflow */ + return x * 0x1p16383L; + if (e == 0x7fff) /* -inf or -nan */ + return -1/x; + if (x < -16382) { + if (x <= -16495 || x - 0x1p112 + 0x1p112 != x) + /* underflow */ + FORCE_EVAL((float)(-0x1p-149/x)); + if (x <= -16446) + return 0; + } + } else if (e < 0x3fff - 114) { + return 1 + x; + } + + /* + * Reduce x, computing z, i0, and k. The low bits of x + redux + * contain the 16-bit integer part of the exponent (k) followed by + * TBLBITS fractional bits (i0). We use bit tricks to extract these + * as integers, then set z to the remainder. + * + * Example: Suppose x is 0xabc.123456p0 and TBLBITS is 8. + * Then the low-order word of x + redux is 0x000abc12, + * We split this into k = 0xabc and i0 = 0x12 (adjusted to + * index into the table), then we compute z = 0x0.003456p0. + */ + u.f = x + redux; + i0 = u.i2.lo + TBLSIZE / 2; + k.u = i0 / TBLSIZE * TBLSIZE; + k.i /= TBLSIZE; + i0 %= TBLSIZE; + u.f -= redux; + z = x - u.f; + + /* Compute r = exp2(y) = exp2t[i0] * p(z - eps[i]). */ + t = tbl[i0]; + z -= eps[i0]; + r = t + t * z * (P1 + z * (P2 + z * (P3 + z * (P4 + z * (P5 + z * (P6 + + z * (P7 + z * (P8 + z * (P9 + z * P10))))))))); + + return scalbnl(r, k.i); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/expf.c b/lib/mlibc/options/ansi/musl-generic-math/expf.c new file mode 100644 index 0000000..feee2b0 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/expf.c @@ -0,0 +1,83 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_expf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +half[2] = {0.5,-0.5}, +ln2hi = 6.9314575195e-1f, /* 0x3f317200 */ +ln2lo = 1.4286067653e-6f, /* 0x35bfbe8e */ +invln2 = 1.4426950216e+0f, /* 0x3fb8aa3b */ +/* + * Domain [-0.34568, 0.34568], range ~[-4.278e-9, 4.447e-9]: + * |x*(exp(x)+1)/(exp(x)-1) - p(x)| < 2**-27.74 + */ +P1 = 1.6666625440e-1f, /* 0xaaaa8f.0p-26 */ +P2 = -2.7667332906e-3f; /* -0xb55215.0p-32 */ + +float expf(float x) +{ + float_t hi, lo, c, xx, y; + int k, sign; + uint32_t hx; + + GET_FLOAT_WORD(hx, x); + sign = hx >> 31; /* sign bit of x */ + hx &= 0x7fffffff; /* high word of |x| */ + + /* special cases */ + if (hx >= 0x42aeac50) { /* if |x| >= -87.33655f or NaN */ + if (hx > 0x7f800000) /* NaN */ + return x; + if (hx >= 0x42b17218 && !sign) { /* x >= 88.722839f */ + /* overflow */ + x *= 0x1p127f; + return x; + } + if (sign) { + /* underflow */ + FORCE_EVAL(-0x1p-149f/x); + if (hx >= 0x42cff1b5) /* x <= -103.972084f */ + return 0; + } + } + + /* argument reduction */ + if (hx > 0x3eb17218) { /* if |x| > 0.5 ln2 */ + if (hx > 0x3f851592) /* if |x| > 1.5 ln2 */ + k = invln2*x + half[sign]; + else + k = 1 - sign - sign; + hi = x - k*ln2hi; /* k*ln2hi is exact here */ + lo = k*ln2lo; + x = hi - lo; + } else if (hx > 0x39000000) { /* |x| > 2**-14 */ + k = 0; + hi = x; + lo = 0; + } else { + /* raise inexact */ + FORCE_EVAL(0x1p127f + x); + return 1 + x; + } + + /* x is now in primary range */ + xx = x*x; + c = x - xx*(P1+xx*P2); + y = 1 + (x*c/(2-c) - lo + hi); + if (k == 0) + return y; + return scalbnf(y, k); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/expl.c b/lib/mlibc/options/ansi/musl-generic-math/expl.c new file mode 100644 index 0000000..0a7f44f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/expl.c @@ -0,0 +1,128 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_expl.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Exponential function, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, expl(); + * + * y = expl( x ); + * + * + * DESCRIPTION: + * + * Returns e (2.71828...) raised to the x power. + * + * Range reduction is accomplished by separating the argument + * into an integer k and fraction f such that + * + * x k f + * e = 2 e. + * + * A Pade' form of degree 5/6 is used to approximate exp(f) - 1 + * in the basic range [-0.5 ln 2, 0.5 ln 2]. + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE +-10000 50000 1.12e-19 2.81e-20 + * + * + * Error amplification in the exponential function can be + * a serious matter. The error propagation involves + * exp( X(1+delta) ) = exp(X) ( 1 + X*delta + ... ), + * which shows that a 1 lsb error in representing X produces + * a relative error of X times 1 lsb in the function. + * While the routine gives an accurate result for arguments + * that are exactly represented by a long double precision + * computer number, the result contains amplified roundoff + * error for large arguments not exactly represented. + * + * + * ERROR MESSAGES: + * + * message condition value returned + * exp underflow x < MINLOG 0.0 + * exp overflow x > MAXLOG MAXNUM + * + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double expl(long double x) +{ + return exp(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 + +static const long double P[3] = { + 1.2617719307481059087798E-4L, + 3.0299440770744196129956E-2L, + 9.9999999999999999991025E-1L, +}; +static const long double Q[4] = { + 3.0019850513866445504159E-6L, + 2.5244834034968410419224E-3L, + 2.2726554820815502876593E-1L, + 2.0000000000000000000897E0L, +}; +static const long double +LN2HI = 6.9314575195312500000000E-1L, +LN2LO = 1.4286068203094172321215E-6L, +LOG2E = 1.4426950408889634073599E0L; + +long double expl(long double x) +{ + long double px, xx; + int k; + + if (isnan(x)) + return x; + if (x > 11356.5234062941439488L) /* x > ln(2^16384 - 0.5) */ + return x * 0x1p16383L; + if (x < -11399.4985314888605581L) /* x < ln(2^-16446) */ + return -0x1p-16445L/x; + + /* Express e**x = e**f 2**k + * = e**(f + k ln(2)) + */ + px = floorl(LOG2E * x + 0.5); + k = px; + x -= px * LN2HI; + x -= px * LN2LO; + + /* rational approximation of the fractional part: + * e**x = 1 + 2x P(x**2)/(Q(x**2) - x P(x**2)) + */ + xx = x * x; + px = x * __polevll(xx, P, 2); + x = px/(__polevll(xx, Q, 3) - px); + x = 1.0 + 2.0 * x; + return scalbnl(x, k); +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double expl(long double x) +{ + return exp(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/expm1.c b/lib/mlibc/options/ansi/musl-generic-math/expm1.c new file mode 100644 index 0000000..ac1e61e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/expm1.c @@ -0,0 +1,201 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_expm1.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* expm1(x) + * Returns exp(x)-1, the exponential of x minus 1. + * + * Method + * 1. Argument reduction: + * Given x, find r and integer k such that + * + * x = k*ln2 + r, |r| <= 0.5*ln2 ~ 0.34658 + * + * Here a correction term c will be computed to compensate + * the error in r when rounded to a floating-point number. + * + * 2. Approximating expm1(r) by a special rational function on + * the interval [0,0.34658]: + * Since + * r*(exp(r)+1)/(exp(r)-1) = 2+ r^2/6 - r^4/360 + ... + * we define R1(r*r) by + * r*(exp(r)+1)/(exp(r)-1) = 2+ r^2/6 * R1(r*r) + * That is, + * R1(r**2) = 6/r *((exp(r)+1)/(exp(r)-1) - 2/r) + * = 6/r * ( 1 + 2.0*(1/(exp(r)-1) - 1/r)) + * = 1 - r^2/60 + r^4/2520 - r^6/100800 + ... + * We use a special Remez algorithm on [0,0.347] to generate + * a polynomial of degree 5 in r*r to approximate R1. The + * maximum error of this polynomial approximation is bounded + * by 2**-61. In other words, + * R1(z) ~ 1.0 + Q1*z + Q2*z**2 + Q3*z**3 + Q4*z**4 + Q5*z**5 + * where Q1 = -1.6666666666666567384E-2, + * Q2 = 3.9682539681370365873E-4, + * Q3 = -9.9206344733435987357E-6, + * Q4 = 2.5051361420808517002E-7, + * Q5 = -6.2843505682382617102E-9; + * z = r*r, + * with error bounded by + * | 5 | -61 + * | 1.0+Q1*z+...+Q5*z - R1(z) | <= 2 + * | | + * + * expm1(r) = exp(r)-1 is then computed by the following + * specific way which minimize the accumulation rounding error: + * 2 3 + * r r [ 3 - (R1 + R1*r/2) ] + * expm1(r) = r + --- + --- * [--------------------] + * 2 2 [ 6 - r*(3 - R1*r/2) ] + * + * To compensate the error in the argument reduction, we use + * expm1(r+c) = expm1(r) + c + expm1(r)*c + * ~ expm1(r) + c + r*c + * Thus c+r*c will be added in as the correction terms for + * expm1(r+c). Now rearrange the term to avoid optimization + * screw up: + * ( 2 2 ) + * ({ ( r [ R1 - (3 - R1*r/2) ] ) } r ) + * expm1(r+c)~r - ({r*(--- * [--------------------]-c)-c} - --- ) + * ({ ( 2 [ 6 - r*(3 - R1*r/2) ] ) } 2 ) + * ( ) + * + * = r - E + * 3. Scale back to obtain expm1(x): + * From step 1, we have + * expm1(x) = either 2^k*[expm1(r)+1] - 1 + * = or 2^k*[expm1(r) + (1-2^-k)] + * 4. Implementation notes: + * (A). To save one multiplication, we scale the coefficient Qi + * to Qi*2^i, and replace z by (x^2)/2. + * (B). To achieve maximum accuracy, we compute expm1(x) by + * (i) if x < -56*ln2, return -1.0, (raise inexact if x!=inf) + * (ii) if k=0, return r-E + * (iii) if k=-1, return 0.5*(r-E)-0.5 + * (iv) if k=1 if r < -0.25, return 2*((r+0.5)- E) + * else return 1.0+2.0*(r-E); + * (v) if (k<-2||k>56) return 2^k(1-(E-r)) - 1 (or exp(x)-1) + * (vi) if k <= 20, return 2^k((1-2^-k)-(E-r)), else + * (vii) return 2^k(1-((E+2^-k)-r)) + * + * Special cases: + * expm1(INF) is INF, expm1(NaN) is NaN; + * expm1(-INF) is -1, and + * for finite argument, only expm1(0)=0 is exact. + * + * Accuracy: + * according to an error analysis, the error is always less than + * 1 ulp (unit in the last place). + * + * Misc. info. + * For IEEE double + * if x > 7.09782712893383973096e+02 then expm1(x) overflow + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "libm.h" + +static const double +o_threshold = 7.09782712893383973096e+02, /* 0x40862E42, 0xFEFA39EF */ +ln2_hi = 6.93147180369123816490e-01, /* 0x3fe62e42, 0xfee00000 */ +ln2_lo = 1.90821492927058770002e-10, /* 0x3dea39ef, 0x35793c76 */ +invln2 = 1.44269504088896338700e+00, /* 0x3ff71547, 0x652b82fe */ +/* Scaled Q's: Qn_here = 2**n * Qn_above, for R(2*z) where z = hxs = x*x/2: */ +Q1 = -3.33333333333331316428e-02, /* BFA11111 111110F4 */ +Q2 = 1.58730158725481460165e-03, /* 3F5A01A0 19FE5585 */ +Q3 = -7.93650757867487942473e-05, /* BF14CE19 9EAADBB7 */ +Q4 = 4.00821782732936239552e-06, /* 3ED0CFCA 86E65239 */ +Q5 = -2.01099218183624371326e-07; /* BE8AFDB7 6E09C32D */ + +double expm1(double x) +{ + double_t y,hi,lo,c,t,e,hxs,hfx,r1,twopk; + union {double f; uint64_t i;} u = {x}; + uint32_t hx = u.i>>32 & 0x7fffffff; + int k, sign = u.i>>63; + + /* filter out huge and non-finite argument */ + if (hx >= 0x4043687A) { /* if |x|>=56*ln2 */ + if (isnan(x)) + return x; + if (sign) + return -1; + if (x > o_threshold) { + x *= 0x1p1023; + return x; + } + } + + /* argument reduction */ + if (hx > 0x3fd62e42) { /* if |x| > 0.5 ln2 */ + if (hx < 0x3FF0A2B2) { /* and |x| < 1.5 ln2 */ + if (!sign) { + hi = x - ln2_hi; + lo = ln2_lo; + k = 1; + } else { + hi = x + ln2_hi; + lo = -ln2_lo; + k = -1; + } + } else { + k = invln2*x + (sign ? -0.5 : 0.5); + t = k; + hi = x - t*ln2_hi; /* t*ln2_hi is exact here */ + lo = t*ln2_lo; + } + x = hi-lo; + c = (hi-x)-lo; + } else if (hx < 0x3c900000) { /* |x| < 2**-54, return x */ + if (hx < 0x00100000) + FORCE_EVAL((float)x); + return x; + } else + k = 0; + + /* x is now in primary range */ + hfx = 0.5*x; + hxs = x*hfx; + r1 = 1.0+hxs*(Q1+hxs*(Q2+hxs*(Q3+hxs*(Q4+hxs*Q5)))); + t = 3.0-r1*hfx; + e = hxs*((r1-t)/(6.0 - x*t)); + if (k == 0) /* c is 0 */ + return x - (x*e-hxs); + e = x*(e-c) - c; + e -= hxs; + /* exp(x) ~ 2^k (x_reduced - e + 1) */ + if (k == -1) + return 0.5*(x-e) - 0.5; + if (k == 1) { + if (x < -0.25) + return -2.0*(e-(x+0.5)); + return 1.0+2.0*(x-e); + } + u.i = (uint64_t)(0x3ff + k)<<52; /* 2^k */ + twopk = u.f; + if (k < 0 || k > 56) { /* suffice to return exp(x)-1 */ + y = x - e + 1.0; + if (k == 1024) + y = y*2.0*0x1p1023; + else + y = y*twopk; + return y - 1.0; + } + u.i = (uint64_t)(0x3ff - k)<<52; /* 2^-k */ + if (k < 20) + y = (x-e+(1-u.f))*twopk; + else + y = (x-(e+u.f)+1)*twopk; + return y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/expm1f.c b/lib/mlibc/options/ansi/musl-generic-math/expm1f.c new file mode 100644 index 0000000..297e0b4 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/expm1f.c @@ -0,0 +1,111 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_expm1f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +o_threshold = 8.8721679688e+01, /* 0x42b17180 */ +ln2_hi = 6.9313812256e-01, /* 0x3f317180 */ +ln2_lo = 9.0580006145e-06, /* 0x3717f7d1 */ +invln2 = 1.4426950216e+00, /* 0x3fb8aa3b */ +/* + * Domain [-0.34568, 0.34568], range ~[-6.694e-10, 6.696e-10]: + * |6 / x * (1 + 2 * (1 / (exp(x) - 1) - 1 / x)) - q(x)| < 2**-30.04 + * Scaled coefficients: Qn_here = 2**n * Qn_for_q (see s_expm1.c): + */ +Q1 = -3.3333212137e-2, /* -0x888868.0p-28 */ +Q2 = 1.5807170421e-3; /* 0xcf3010.0p-33 */ + +float expm1f(float x) +{ + float_t y,hi,lo,c,t,e,hxs,hfx,r1,twopk; + union {float f; uint32_t i;} u = {x}; + uint32_t hx = u.i & 0x7fffffff; + int k, sign = u.i >> 31; + + /* filter out huge and non-finite argument */ + if (hx >= 0x4195b844) { /* if |x|>=27*ln2 */ + if (hx > 0x7f800000) /* NaN */ + return x; + if (sign) + return -1; + if (x > o_threshold) { + x *= 0x1p127f; + return x; + } + } + + /* argument reduction */ + if (hx > 0x3eb17218) { /* if |x| > 0.5 ln2 */ + if (hx < 0x3F851592) { /* and |x| < 1.5 ln2 */ + if (!sign) { + hi = x - ln2_hi; + lo = ln2_lo; + k = 1; + } else { + hi = x + ln2_hi; + lo = -ln2_lo; + k = -1; + } + } else { + k = invln2*x + (sign ? -0.5f : 0.5f); + t = k; + hi = x - t*ln2_hi; /* t*ln2_hi is exact here */ + lo = t*ln2_lo; + } + x = hi-lo; + c = (hi-x)-lo; + } else if (hx < 0x33000000) { /* when |x|<2**-25, return x */ + if (hx < 0x00800000) + FORCE_EVAL(x*x); + return x; + } else + k = 0; + + /* x is now in primary range */ + hfx = 0.5f*x; + hxs = x*hfx; + r1 = 1.0f+hxs*(Q1+hxs*Q2); + t = 3.0f - r1*hfx; + e = hxs*((r1-t)/(6.0f - x*t)); + if (k == 0) /* c is 0 */ + return x - (x*e-hxs); + e = x*(e-c) - c; + e -= hxs; + /* exp(x) ~ 2^k (x_reduced - e + 1) */ + if (k == -1) + return 0.5f*(x-e) - 0.5f; + if (k == 1) { + if (x < -0.25f) + return -2.0f*(e-(x+0.5f)); + return 1.0f + 2.0f*(x-e); + } + u.i = (0x7f+k)<<23; /* 2^k */ + twopk = u.f; + if (k < 0 || k > 56) { /* suffice to return exp(x)-1 */ + y = x - e + 1.0f; + if (k == 128) + y = y*2.0f*0x1p127f; + else + y = y*twopk; + return y - 1.0f; + } + u.i = (0x7f-k)<<23; /* 2^-k */ + if (k < 23) + y = (x-e+(1-u.f))*twopk; + else + y = (x-(e+u.f)+1)*twopk; + return y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/expm1l.c b/lib/mlibc/options/ansi/musl-generic-math/expm1l.c new file mode 100644 index 0000000..d171507 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/expm1l.c @@ -0,0 +1,123 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_expm1l.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Exponential function, minus 1 + * Long double precision + * + * + * SYNOPSIS: + * + * long double x, y, expm1l(); + * + * y = expm1l( x ); + * + * + * DESCRIPTION: + * + * Returns e (2.71828...) raised to the x power, minus 1. + * + * Range reduction is accomplished by separating the argument + * into an integer k and fraction f such that + * + * x k f + * e = 2 e. + * + * An expansion x + .5 x^2 + x^3 R(x) approximates exp(f) - 1 + * in the basic range [-0.5 ln 2, 0.5 ln 2]. + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE -45,+maxarg 200,000 1.2e-19 2.5e-20 + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double expm1l(long double x) +{ + return expm1(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 + +/* exp(x) - 1 = x + 0.5 x^2 + x^3 P(x)/Q(x) + -.5 ln 2 < x < .5 ln 2 + Theoretical peak relative error = 3.4e-22 */ +static const long double +P0 = -1.586135578666346600772998894928250240826E4L, +P1 = 2.642771505685952966904660652518429479531E3L, +P2 = -3.423199068835684263987132888286791620673E2L, +P3 = 1.800826371455042224581246202420972737840E1L, +P4 = -5.238523121205561042771939008061958820811E-1L, +Q0 = -9.516813471998079611319047060563358064497E4L, +Q1 = 3.964866271411091674556850458227710004570E4L, +Q2 = -7.207678383830091850230366618190187434796E3L, +Q3 = 7.206038318724600171970199625081491823079E2L, +Q4 = -4.002027679107076077238836622982900945173E1L, +/* Q5 = 1.000000000000000000000000000000000000000E0 */ +/* C1 + C2 = ln 2 */ +C1 = 6.93145751953125E-1L, +C2 = 1.428606820309417232121458176568075500134E-6L, +/* ln 2^-65 */ +minarg = -4.5054566736396445112120088E1L, +/* ln 2^16384 */ +maxarg = 1.1356523406294143949492E4L; + +long double expm1l(long double x) +{ + long double px, qx, xx; + int k; + + if (isnan(x)) + return x; + if (x > maxarg) + return x*0x1p16383L; /* overflow, unless x==inf */ + if (x == 0.0) + return x; + if (x < minarg) + return -1.0; + + xx = C1 + C2; + /* Express x = ln 2 (k + remainder), remainder not exceeding 1/2. */ + px = floorl(0.5 + x / xx); + k = px; + /* remainder times ln 2 */ + x -= px * C1; + x -= px * C2; + + /* Approximate exp(remainder ln 2).*/ + px = (((( P4 * x + P3) * x + P2) * x + P1) * x + P0) * x; + qx = (((( x + Q4) * x + Q3) * x + Q2) * x + Q1) * x + Q0; + xx = x * x; + qx = x + (0.5 * xx + xx * px / qx); + + /* exp(x) = exp(k ln 2) exp(remainder ln 2) = 2^k exp(remainder ln 2). + We have qx = exp(remainder ln 2) - 1, so + exp(x) - 1 = 2^k (qx + 1) - 1 = 2^k qx + 2^k - 1. */ + px = scalbnl(1.0, k); + x = px * qx + (px - 1.0); + return x; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double expm1l(long double x) +{ + return expm1(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/fabs.c b/lib/mlibc/options/ansi/musl-generic-math/fabs.c new file mode 100644 index 0000000..e8258cf --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fabs.c @@ -0,0 +1,9 @@ +#include <math.h> +#include <stdint.h> + +double fabs(double x) +{ + union {double f; uint64_t i;} u = {x}; + u.i &= -1ULL/2; + return u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fabsf.c b/lib/mlibc/options/ansi/musl-generic-math/fabsf.c new file mode 100644 index 0000000..4efc8d6 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fabsf.c @@ -0,0 +1,9 @@ +#include <math.h> +#include <stdint.h> + +float fabsf(float x) +{ + union {float f; uint32_t i;} u = {x}; + u.i &= 0x7fffffff; + return u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fabsl.c b/lib/mlibc/options/ansi/musl-generic-math/fabsl.c new file mode 100644 index 0000000..c4f36ec --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fabsl.c @@ -0,0 +1,15 @@ +#include "libm.h" +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fabsl(long double x) +{ + return fabs(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double fabsl(long double x) +{ + union ldshape u = {x}; + + u.i.se &= 0x7fff; + return u.f; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/fdim.c b/lib/mlibc/options/ansi/musl-generic-math/fdim.c new file mode 100644 index 0000000..9585460 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fdim.c @@ -0,0 +1,10 @@ +#include <math.h> + +double fdim(double x, double y) +{ + if (isnan(x)) + return x; + if (isnan(y)) + return y; + return x > y ? x - y : 0; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fdimf.c b/lib/mlibc/options/ansi/musl-generic-math/fdimf.c new file mode 100644 index 0000000..543c364 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fdimf.c @@ -0,0 +1,10 @@ +#include <math.h> + +float fdimf(float x, float y) +{ + if (isnan(x)) + return x; + if (isnan(y)) + return y; + return x > y ? x - y : 0; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fdiml.c b/lib/mlibc/options/ansi/musl-generic-math/fdiml.c new file mode 100644 index 0000000..62e29b7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fdiml.c @@ -0,0 +1,18 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fdiml(long double x, long double y) +{ + return fdim(x, y); +} +#else +long double fdiml(long double x, long double y) +{ + if (isnan(x)) + return x; + if (isnan(y)) + return y; + return x > y ? x - y : 0; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/finite.c b/lib/mlibc/options/ansi/musl-generic-math/finite.c new file mode 100644 index 0000000..25a0575 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/finite.c @@ -0,0 +1,7 @@ +#define _GNU_SOURCE +#include <math.h> + +int finite(double x) +{ + return isfinite(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/finitef.c b/lib/mlibc/options/ansi/musl-generic-math/finitef.c new file mode 100644 index 0000000..2c4c771 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/finitef.c @@ -0,0 +1,7 @@ +#define _GNU_SOURCE +#include <math.h> + +int finitef(float x) +{ + return isfinite(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/floor.c b/lib/mlibc/options/ansi/musl-generic-math/floor.c new file mode 100644 index 0000000..14a31cd --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/floor.c @@ -0,0 +1,31 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const double_t toint = 1/EPS; + +double floor(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i >> 52 & 0x7ff; + double_t y; + + if (e >= 0x3ff+52 || x == 0) + return x; + /* y = int(x) - x, where int(x) is an integer neighbor of x */ + if (u.i >> 63) + y = x - toint + toint - x; + else + y = x + toint - toint - x; + /* special case because of non-nearest rounding modes */ + if (e <= 0x3ff-1) { + FORCE_EVAL(y); + return u.i >> 63 ? -1 : 0; + } + if (y > 0) + return x + y - 1; + return x + y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/floorf.c b/lib/mlibc/options/ansi/musl-generic-math/floorf.c new file mode 100644 index 0000000..dceec73 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/floorf.c @@ -0,0 +1,27 @@ +#include "libm.h" + +float floorf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = (int)(u.i >> 23 & 0xff) - 0x7f; + uint32_t m; + + if (e >= 23) + return x; + if (e >= 0) { + m = 0x007fffff >> e; + if ((u.i & m) == 0) + return x; + FORCE_EVAL(x + 0x1p120f); + if (u.i >> 31) + u.i += m; + u.i &= ~m; + } else { + FORCE_EVAL(x + 0x1p120f); + if (u.i >> 31 == 0) + u.i = 0; + else if (u.i << 1) + u.f = -1.0; + } + return u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/floorl.c b/lib/mlibc/options/ansi/musl-generic-math/floorl.c new file mode 100644 index 0000000..16aaec4 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/floorl.c @@ -0,0 +1,34 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double floorl(long double x) +{ + return floor(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double floorl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1 || x == 0) + return x; + /* y = int(x) - x, where int(x) is an integer neighbor of x */ + if (u.i.se >> 15) + y = x - toint + toint - x; + else + y = x + toint - toint - x; + /* special case because of non-nearest rounding modes */ + if (e <= 0x3fff-1) { + FORCE_EVAL(y); + return u.i.se >> 15 ? -1 : 0; + } + if (y > 0) + return x + y - 1; + return x + y; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/fma.c b/lib/mlibc/options/ansi/musl-generic-math/fma.c new file mode 100644 index 0000000..f65eab7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fma.c @@ -0,0 +1,194 @@ +#include <stdint.h> +#include <float.h> +#include <math.h> + +static inline int a_clz_64(uint64_t x) +{ + uint32_t y; + int r; + if (x>>32) y=x>>32, r=0; else y=x, r=32; + if (y>>16) y>>=16; else r |= 16; + if (y>>8) y>>=8; else r |= 8; + if (y>>4) y>>=4; else r |= 4; + if (y>>2) y>>=2; else r |= 2; + return r | !(y>>1); +} + +#define ASUINT64(x) ((union {double f; uint64_t i;}){x}).i +#define ZEROINFNAN (0x7ff-0x3ff-52-1) + +struct num { uint64_t m; int e; int sign; }; + +static struct num normalize(double x) +{ + uint64_t ix = ASUINT64(x); + int e = ix>>52; + int sign = e & 0x800; + e &= 0x7ff; + if (!e) { + ix = ASUINT64(x*0x1p63); + e = ix>>52 & 0x7ff; + e = e ? e-63 : 0x800; + } + ix &= (1ull<<52)-1; + ix |= 1ull<<52; + ix <<= 1; + e -= 0x3ff + 52 + 1; + return (struct num){ix,e,sign}; +} + +static void mul(uint64_t *hi, uint64_t *lo, uint64_t x, uint64_t y) +{ + uint64_t t1,t2,t3; + uint64_t xlo = (uint32_t)x, xhi = x>>32; + uint64_t ylo = (uint32_t)y, yhi = y>>32; + + t1 = xlo*ylo; + t2 = xlo*yhi + xhi*ylo; + t3 = xhi*yhi; + *lo = t1 + (t2<<32); + *hi = t3 + (t2>>32) + (t1 > *lo); +} + +double fma(double x, double y, double z) +{ + #pragma STDC FENV_ACCESS ON + + /* normalize so top 10bits and last bit are 0 */ + struct num nx, ny, nz; + nx = normalize(x); + ny = normalize(y); + nz = normalize(z); + + if (nx.e >= ZEROINFNAN || ny.e >= ZEROINFNAN) + return x*y + z; + if (nz.e >= ZEROINFNAN) { + if (nz.e > ZEROINFNAN) /* z==0 */ + return x*y + z; + return z; + } + + /* mul: r = x*y */ + uint64_t rhi, rlo, zhi, zlo; + mul(&rhi, &rlo, nx.m, ny.m); + /* either top 20 or 21 bits of rhi and last 2 bits of rlo are 0 */ + + /* align exponents */ + int e = nx.e + ny.e; + int d = nz.e - e; + /* shift bits z<<=kz, r>>=kr, so kz+kr == d, set e = e+kr (== ez-kz) */ + if (d > 0) { + if (d < 64) { + zlo = nz.m<<d; + zhi = nz.m>>64-d; + } else { + zlo = 0; + zhi = nz.m; + e = nz.e - 64; + d -= 64; + if (d == 0) { + } else if (d < 64) { + rlo = rhi<<64-d | rlo>>d | !!(rlo<<64-d); + rhi = rhi>>d; + } else { + rlo = 1; + rhi = 0; + } + } + } else { + zhi = 0; + d = -d; + if (d == 0) { + zlo = nz.m; + } else if (d < 64) { + zlo = nz.m>>d | !!(nz.m<<64-d); + } else { + zlo = 1; + } + } + + /* add */ + int sign = nx.sign^ny.sign; + int samesign = !(sign^nz.sign); + int nonzero = 1; + if (samesign) { + /* r += z */ + rlo += zlo; + rhi += zhi + (rlo < zlo); + } else { + /* r -= z */ + uint64_t t = rlo; + rlo -= zlo; + rhi = rhi - zhi - (t < rlo); + if (rhi>>63) { + rlo = -rlo; + rhi = -rhi-!!rlo; + sign = !sign; + } + nonzero = !!rhi; + } + + /* set rhi to top 63bit of the result (last bit is sticky) */ + if (nonzero) { + e += 64; + d = a_clz_64(rhi)-1; + /* note: d > 0 */ + rhi = rhi<<d | rlo>>64-d | !!(rlo<<d); + } else if (rlo) { + d = a_clz_64(rlo)-1; + if (d < 0) + rhi = rlo>>1 | (rlo&1); + else + rhi = rlo<<d; + } else { + /* exact +-0 */ + return x*y + z; + } + e -= d; + + /* convert to double */ + int64_t i = rhi; /* i is in [1<<62,(1<<63)-1] */ + if (sign) + i = -i; + double r = i; /* |r| is in [0x1p62,0x1p63] */ + + if (e < -1022-62) { + /* result is subnormal before rounding */ + if (e == -1022-63) { + double c = 0x1p63; + if (sign) + c = -c; + if (r == c) { + /* min normal after rounding, underflow depends + on arch behaviour which can be imitated by + a double to float conversion */ + float fltmin = 0x0.ffffff8p-63*FLT_MIN * r; + return DBL_MIN/FLT_MIN * fltmin; + } + /* one bit is lost when scaled, add another top bit to + only round once at conversion if it is inexact */ + if (rhi << 53) { + i = rhi>>1 | (rhi&1) | 1ull<<62; + if (sign) + i = -i; + r = i; + r = 2*r - c; /* remove top bit */ + + /* raise underflow portably, such that it + cannot be optimized away */ + { + double_t tiny = DBL_MIN/FLT_MIN * r; + r += (double)(tiny*tiny) * (r-r); + } + } + } else { + /* only round once when scaled */ + d = 10; + i = ( rhi>>d | !!(rhi<<64-d) ) << d; + if (sign) + i = -i; + r = i; + } + } + return scalbn(r, e); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmaf.c b/lib/mlibc/options/ansi/musl-generic-math/fmaf.c new file mode 100644 index 0000000..aa57feb --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmaf.c @@ -0,0 +1,93 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_fmaf.c */ +/*- + * Copyright (c) 2005-2011 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#include <fenv.h> +#include <math.h> +#include <stdint.h> + +/* + * Fused multiply-add: Compute x * y + z with a single rounding error. + * + * A double has more than twice as much precision than a float, so + * direct double-precision arithmetic suffices, except where double + * rounding occurs. + */ +float fmaf(float x, float y, float z) +{ + #pragma STDC FENV_ACCESS ON + double xy, result; + union {double f; uint64_t i;} u; + int e; + + xy = (double)x * y; + result = xy + z; + u.f = result; + e = u.i>>52 & 0x7ff; + /* Common case: The double precision result is fine. */ + if ((u.i & 0x1fffffff) != 0x10000000 || /* not a halfway case */ + e == 0x7ff || /* NaN */ + result - xy == z || /* exact */ + fegetround() != FE_TONEAREST) /* not round-to-nearest */ + { + /* + underflow may not be raised correctly, example: + fmaf(0x1p-120f, 0x1p-120f, 0x1p-149f) + */ +#if defined(FE_INEXACT) && defined(FE_UNDERFLOW) + if (e < 0x3ff-126 && e >= 0x3ff-149 && fetestexcept(FE_INEXACT)) { + feclearexcept(FE_INEXACT); + /* TODO: gcc and clang bug workaround */ + volatile float vz = z; + result = xy + vz; + if (fetestexcept(FE_INEXACT)) + feraiseexcept(FE_UNDERFLOW); + else + feraiseexcept(FE_INEXACT); + } +#endif + z = result; + return z; + } + + /* + * If result is inexact, and exactly halfway between two float values, + * we need to adjust the low-order bit in the direction of the error. + */ +#ifdef FE_TOWARDZERO + fesetround(FE_TOWARDZERO); +#endif + volatile double vxy = xy; /* XXX work around gcc CSE bug */ + double adjusted_result = vxy + z; + fesetround(FE_TONEAREST); + if (result == adjusted_result) { + u.f = adjusted_result; + u.i++; + adjusted_result = u.f; + } + z = adjusted_result; + return z; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmal.c b/lib/mlibc/options/ansi/musl-generic-math/fmal.c new file mode 100644 index 0000000..4506aac --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmal.c @@ -0,0 +1,293 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_fmal.c */ +/*- + * Copyright (c) 2005-2011 David Schultz <das@FreeBSD.ORG> + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + + +#include "libm.h" +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fmal(long double x, long double y, long double z) +{ + return fma(x, y, z); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#include <fenv.h> +#if LDBL_MANT_DIG == 64 +#define LASTBIT(u) (u.i.m & 1) +#define SPLIT (0x1p32L + 1) +#elif LDBL_MANT_DIG == 113 +#define LASTBIT(u) (u.i.lo & 1) +#define SPLIT (0x1p57L + 1) +#endif + +/* + * A struct dd represents a floating-point number with twice the precision + * of a long double. We maintain the invariant that "hi" stores the high-order + * bits of the result. + */ +struct dd { + long double hi; + long double lo; +}; + +/* + * Compute a+b exactly, returning the exact result in a struct dd. We assume + * that both a and b are finite, but make no assumptions about their relative + * magnitudes. + */ +static inline struct dd dd_add(long double a, long double b) +{ + struct dd ret; + long double s; + + ret.hi = a + b; + s = ret.hi - a; + ret.lo = (a - (ret.hi - s)) + (b - s); + return (ret); +} + +/* + * Compute a+b, with a small tweak: The least significant bit of the + * result is adjusted into a sticky bit summarizing all the bits that + * were lost to rounding. This adjustment negates the effects of double + * rounding when the result is added to another number with a higher + * exponent. For an explanation of round and sticky bits, see any reference + * on FPU design, e.g., + * + * J. Coonen. An Implementation Guide to a Proposed Standard for + * Floating-Point Arithmetic. Computer, vol. 13, no. 1, Jan 1980. + */ +static inline long double add_adjusted(long double a, long double b) +{ + struct dd sum; + union ldshape u; + + sum = dd_add(a, b); + if (sum.lo != 0) { + u.f = sum.hi; + if (!LASTBIT(u)) + sum.hi = nextafterl(sum.hi, INFINITY * sum.lo); + } + return (sum.hi); +} + +/* + * Compute ldexp(a+b, scale) with a single rounding error. It is assumed + * that the result will be subnormal, and care is taken to ensure that + * double rounding does not occur. + */ +static inline long double add_and_denormalize(long double a, long double b, int scale) +{ + struct dd sum; + int bits_lost; + union ldshape u; + + sum = dd_add(a, b); + + /* + * If we are losing at least two bits of accuracy to denormalization, + * then the first lost bit becomes a round bit, and we adjust the + * lowest bit of sum.hi to make it a sticky bit summarizing all the + * bits in sum.lo. With the sticky bit adjusted, the hardware will + * break any ties in the correct direction. + * + * If we are losing only one bit to denormalization, however, we must + * break the ties manually. + */ + if (sum.lo != 0) { + u.f = sum.hi; + bits_lost = -u.i.se - scale + 1; + if ((bits_lost != 1) ^ LASTBIT(u)) + sum.hi = nextafterl(sum.hi, INFINITY * sum.lo); + } + return scalbnl(sum.hi, scale); +} + +/* + * Compute a*b exactly, returning the exact result in a struct dd. We assume + * that both a and b are normalized, so no underflow or overflow will occur. + * The current rounding mode must be round-to-nearest. + */ +static inline struct dd dd_mul(long double a, long double b) +{ + struct dd ret; + long double ha, hb, la, lb, p, q; + + p = a * SPLIT; + ha = a - p; + ha += p; + la = a - ha; + + p = b * SPLIT; + hb = b - p; + hb += p; + lb = b - hb; + + p = ha * hb; + q = ha * lb + la * hb; + + ret.hi = p + q; + ret.lo = p - ret.hi + q + la * lb; + return (ret); +} + +/* + * Fused multiply-add: Compute x * y + z with a single rounding error. + * + * We use scaling to avoid overflow/underflow, along with the + * canonical precision-doubling technique adapted from: + * + * Dekker, T. A Floating-Point Technique for Extending the + * Available Precision. Numer. Math. 18, 224-242 (1971). + */ +long double fmal(long double x, long double y, long double z) +{ + #pragma STDC FENV_ACCESS ON + long double xs, ys, zs, adj; + struct dd xy, r; + int oround; + int ex, ey, ez; + int spread; + + /* + * Handle special cases. The order of operations and the particular + * return values here are crucial in handling special cases involving + * infinities, NaNs, overflows, and signed zeroes correctly. + */ + if (!isfinite(x) || !isfinite(y)) + return (x * y + z); + if (!isfinite(z)) + return (z); + if (x == 0.0 || y == 0.0) + return (x * y + z); + if (z == 0.0) + return (x * y); + + xs = frexpl(x, &ex); + ys = frexpl(y, &ey); + zs = frexpl(z, &ez); + oround = fegetround(); + spread = ex + ey - ez; + + /* + * If x * y and z are many orders of magnitude apart, the scaling + * will overflow, so we handle these cases specially. Rounding + * modes other than FE_TONEAREST are painful. + */ + if (spread < -LDBL_MANT_DIG) { +#ifdef FE_INEXACT + feraiseexcept(FE_INEXACT); +#endif +#ifdef FE_UNDERFLOW + if (!isnormal(z)) + feraiseexcept(FE_UNDERFLOW); +#endif + switch (oround) { + default: /* FE_TONEAREST */ + return (z); +#ifdef FE_TOWARDZERO + case FE_TOWARDZERO: + if (x > 0.0 ^ y < 0.0 ^ z < 0.0) + return (z); + else + return (nextafterl(z, 0)); +#endif +#ifdef FE_DOWNWARD + case FE_DOWNWARD: + if (x > 0.0 ^ y < 0.0) + return (z); + else + return (nextafterl(z, -INFINITY)); +#endif +#ifdef FE_UPWARD + case FE_UPWARD: + if (x > 0.0 ^ y < 0.0) + return (nextafterl(z, INFINITY)); + else + return (z); +#endif + } + } + if (spread <= LDBL_MANT_DIG * 2) + zs = scalbnl(zs, -spread); + else + zs = copysignl(LDBL_MIN, zs); + + fesetround(FE_TONEAREST); + + /* + * Basic approach for round-to-nearest: + * + * (xy.hi, xy.lo) = x * y (exact) + * (r.hi, r.lo) = xy.hi + z (exact) + * adj = xy.lo + r.lo (inexact; low bit is sticky) + * result = r.hi + adj (correctly rounded) + */ + xy = dd_mul(xs, ys); + r = dd_add(xy.hi, zs); + + spread = ex + ey; + + if (r.hi == 0.0) { + /* + * When the addends cancel to 0, ensure that the result has + * the correct sign. + */ + fesetround(oround); + volatile long double vzs = zs; /* XXX gcc CSE bug workaround */ + return xy.hi + vzs + scalbnl(xy.lo, spread); + } + + if (oround != FE_TONEAREST) { + /* + * There is no need to worry about double rounding in directed + * rounding modes. + * But underflow may not be raised correctly, example in downward rounding: + * fmal(0x1.0000000001p-16000L, 0x1.0000000001p-400L, -0x1p-16440L) + */ + long double ret; +#if defined(FE_INEXACT) && defined(FE_UNDERFLOW) + int e = fetestexcept(FE_INEXACT); + feclearexcept(FE_INEXACT); +#endif + fesetround(oround); + adj = r.lo + xy.lo; + ret = scalbnl(r.hi + adj, spread); +#if defined(FE_INEXACT) && defined(FE_UNDERFLOW) + if (ilogbl(ret) < -16382 && fetestexcept(FE_INEXACT)) + feraiseexcept(FE_UNDERFLOW); + else if (e) + feraiseexcept(FE_INEXACT); +#endif + return ret; + } + + adj = add_adjusted(r.lo, xy.lo); + if (spread + ilogbl(r.hi) > -16383) + return scalbnl(r.hi + adj, spread); + else + return add_and_denormalize(r.hi, adj, spread); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmax.c b/lib/mlibc/options/ansi/musl-generic-math/fmax.c new file mode 100644 index 0000000..94f0caa --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmax.c @@ -0,0 +1,13 @@ +#include <math.h> + +double fmax(double x, double y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? y : x; + return x < y ? y : x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmaxf.c b/lib/mlibc/options/ansi/musl-generic-math/fmaxf.c new file mode 100644 index 0000000..695d817 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmaxf.c @@ -0,0 +1,13 @@ +#include <math.h> + +float fmaxf(float x, float y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeroes, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? y : x; + return x < y ? y : x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmaxl.c b/lib/mlibc/options/ansi/musl-generic-math/fmaxl.c new file mode 100644 index 0000000..4b03158 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmaxl.c @@ -0,0 +1,21 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fmaxl(long double x, long double y) +{ + return fmax(x, y); +} +#else +long double fmaxl(long double x, long double y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? y : x; + return x < y ? y : x; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmin.c b/lib/mlibc/options/ansi/musl-generic-math/fmin.c new file mode 100644 index 0000000..08a8fd1 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmin.c @@ -0,0 +1,13 @@ +#include <math.h> + +double fmin(double x, double y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? x : y; + return x < y ? x : y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fminf.c b/lib/mlibc/options/ansi/musl-generic-math/fminf.c new file mode 100644 index 0000000..3573c7d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fminf.c @@ -0,0 +1,13 @@ +#include <math.h> + +float fminf(float x, float y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? x : y; + return x < y ? x : y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fminl.c b/lib/mlibc/options/ansi/musl-generic-math/fminl.c new file mode 100644 index 0000000..69bc24a --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fminl.c @@ -0,0 +1,21 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fminl(long double x, long double y) +{ + return fmin(x, y); +} +#else +long double fminl(long double x, long double y) +{ + if (isnan(x)) + return y; + if (isnan(y)) + return x; + /* handle signed zeros, see C99 Annex F.9.9.2 */ + if (signbit(x) != signbit(y)) + return signbit(x) ? x : y; + return x < y ? x : y; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmod.c b/lib/mlibc/options/ansi/musl-generic-math/fmod.c new file mode 100644 index 0000000..6849722 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmod.c @@ -0,0 +1,68 @@ +#include <math.h> +#include <stdint.h> + +double fmod(double x, double y) +{ + union {double f; uint64_t i;} ux = {x}, uy = {y}; + int ex = ux.i>>52 & 0x7ff; + int ey = uy.i>>52 & 0x7ff; + int sx = ux.i>>63; + uint64_t i; + + /* in the followings uxi should be ux.i, but then gcc wrongly adds */ + /* float load/store to inner loops ruining performance and code size */ + uint64_t uxi = ux.i; + + if (uy.i<<1 == 0 || isnan(y) || ex == 0x7ff) + return (x*y)/(x*y); + if (uxi<<1 <= uy.i<<1) { + if (uxi<<1 == uy.i<<1) + return 0*x; + return x; + } + + /* normalize x and y */ + if (!ex) { + for (i = uxi<<12; i>>63 == 0; ex--, i <<= 1); + uxi <<= -ex + 1; + } else { + uxi &= -1ULL >> 12; + uxi |= 1ULL << 52; + } + if (!ey) { + for (i = uy.i<<12; i>>63 == 0; ey--, i <<= 1); + uy.i <<= -ey + 1; + } else { + uy.i &= -1ULL >> 12; + uy.i |= 1ULL << 52; + } + + /* x mod y */ + for (; ex > ey; ex--) { + i = uxi - uy.i; + if (i >> 63 == 0) { + if (i == 0) + return 0*x; + uxi = i; + } + uxi <<= 1; + } + i = uxi - uy.i; + if (i >> 63 == 0) { + if (i == 0) + return 0*x; + uxi = i; + } + for (; uxi>>52 == 0; uxi <<= 1, ex--); + + /* scale result */ + if (ex > 0) { + uxi -= 1ULL << 52; + uxi |= (uint64_t)ex << 52; + } else { + uxi >>= -ex + 1; + } + uxi |= (uint64_t)sx << 63; + ux.i = uxi; + return ux.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmodf.c b/lib/mlibc/options/ansi/musl-generic-math/fmodf.c new file mode 100644 index 0000000..ff58f93 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmodf.c @@ -0,0 +1,65 @@ +#include <math.h> +#include <stdint.h> + +float fmodf(float x, float y) +{ + union {float f; uint32_t i;} ux = {x}, uy = {y}; + int ex = ux.i>>23 & 0xff; + int ey = uy.i>>23 & 0xff; + uint32_t sx = ux.i & 0x80000000; + uint32_t i; + uint32_t uxi = ux.i; + + if (uy.i<<1 == 0 || isnan(y) || ex == 0xff) + return (x*y)/(x*y); + if (uxi<<1 <= uy.i<<1) { + if (uxi<<1 == uy.i<<1) + return 0*x; + return x; + } + + /* normalize x and y */ + if (!ex) { + for (i = uxi<<9; i>>31 == 0; ex--, i <<= 1); + uxi <<= -ex + 1; + } else { + uxi &= -1U >> 9; + uxi |= 1U << 23; + } + if (!ey) { + for (i = uy.i<<9; i>>31 == 0; ey--, i <<= 1); + uy.i <<= -ey + 1; + } else { + uy.i &= -1U >> 9; + uy.i |= 1U << 23; + } + + /* x mod y */ + for (; ex > ey; ex--) { + i = uxi - uy.i; + if (i >> 31 == 0) { + if (i == 0) + return 0*x; + uxi = i; + } + uxi <<= 1; + } + i = uxi - uy.i; + if (i >> 31 == 0) { + if (i == 0) + return 0*x; + uxi = i; + } + for (; uxi>>23 == 0; uxi <<= 1, ex--); + + /* scale result up */ + if (ex > 0) { + uxi -= 1U << 23; + uxi |= (uint32_t)ex << 23; + } else { + uxi >>= -ex + 1; + } + uxi |= sx; + ux.i = uxi; + return ux.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/fmodl.c b/lib/mlibc/options/ansi/musl-generic-math/fmodl.c new file mode 100644 index 0000000..9f5b873 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/fmodl.c @@ -0,0 +1,105 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double fmodl(long double x, long double y) +{ + return fmod(x, y); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double fmodl(long double x, long double y) +{ + union ldshape ux = {x}, uy = {y}; + int ex = ux.i.se & 0x7fff; + int ey = uy.i.se & 0x7fff; + int sx = ux.i.se & 0x8000; + + if (y == 0 || isnan(y) || ex == 0x7fff) + return (x*y)/(x*y); + ux.i.se = ex; + uy.i.se = ey; + if (ux.f <= uy.f) { + if (ux.f == uy.f) + return 0*x; + return x; + } + + /* normalize x and y */ + if (!ex) { + ux.f *= 0x1p120f; + ex = ux.i.se - 120; + } + if (!ey) { + uy.f *= 0x1p120f; + ey = uy.i.se - 120; + } + + /* x mod y */ +#if LDBL_MANT_DIG == 64 + uint64_t i, mx, my; + mx = ux.i.m; + my = uy.i.m; + for (; ex > ey; ex--) { + i = mx - my; + if (mx >= my) { + if (i == 0) + return 0*x; + mx = 2*i; + } else if (2*mx < mx) { + mx = 2*mx - my; + } else { + mx = 2*mx; + } + } + i = mx - my; + if (mx >= my) { + if (i == 0) + return 0*x; + mx = i; + } + for (; mx >> 63 == 0; mx *= 2, ex--); + ux.i.m = mx; +#elif LDBL_MANT_DIG == 113 + uint64_t hi, lo, xhi, xlo, yhi, ylo; + xhi = (ux.i2.hi & -1ULL>>16) | 1ULL<<48; + yhi = (uy.i2.hi & -1ULL>>16) | 1ULL<<48; + xlo = ux.i2.lo; + ylo = uy.i2.lo; + for (; ex > ey; ex--) { + hi = xhi - yhi; + lo = xlo - ylo; + if (xlo < ylo) + hi -= 1; + if (hi >> 63 == 0) { + if ((hi|lo) == 0) + return 0*x; + xhi = 2*hi + (lo>>63); + xlo = 2*lo; + } else { + xhi = 2*xhi + (xlo>>63); + xlo = 2*xlo; + } + } + hi = xhi - yhi; + lo = xlo - ylo; + if (xlo < ylo) + hi -= 1; + if (hi >> 63 == 0) { + if ((hi|lo) == 0) + return 0*x; + xhi = hi; + xlo = lo; + } + for (; xhi >> 48 == 0; xhi = 2*xhi + (xlo>>63), xlo = 2*xlo, ex--); + ux.i2.hi = xhi; + ux.i2.lo = xlo; +#endif + + /* scale result */ + if (ex <= 0) { + ux.i.se = (ex+120)|sx; + ux.f *= 0x1p-120f; + } else + ux.i.se = ex|sx; + return ux.f; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/frexp.c b/lib/mlibc/options/ansi/musl-generic-math/frexp.c new file mode 100644 index 0000000..27b6266 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/frexp.c @@ -0,0 +1,23 @@ +#include <math.h> +#include <stdint.h> + +double frexp(double x, int *e) +{ + union { double d; uint64_t i; } y = { x }; + int ee = y.i>>52 & 0x7ff; + + if (!ee) { + if (x) { + x = frexp(x*0x1p64, e); + *e -= 64; + } else *e = 0; + return x; + } else if (ee == 0x7ff) { + return x; + } + + *e = ee - 0x3fe; + y.i &= 0x800fffffffffffffull; + y.i |= 0x3fe0000000000000ull; + return y.d; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/frexpf.c b/lib/mlibc/options/ansi/musl-generic-math/frexpf.c new file mode 100644 index 0000000..0787097 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/frexpf.c @@ -0,0 +1,23 @@ +#include <math.h> +#include <stdint.h> + +float frexpf(float x, int *e) +{ + union { float f; uint32_t i; } y = { x }; + int ee = y.i>>23 & 0xff; + + if (!ee) { + if (x) { + x = frexpf(x*0x1p64, e); + *e -= 64; + } else *e = 0; + return x; + } else if (ee == 0xff) { + return x; + } + + *e = ee - 0x7e; + y.i &= 0x807ffffful; + y.i |= 0x3f000000ul; + return y.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/frexpl.c b/lib/mlibc/options/ansi/musl-generic-math/frexpl.c new file mode 100644 index 0000000..3c1b553 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/frexpl.c @@ -0,0 +1,29 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double frexpl(long double x, int *e) +{ + return frexp(x, e); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double frexpl(long double x, int *e) +{ + union ldshape u = {x}; + int ee = u.i.se & 0x7fff; + + if (!ee) { + if (x) { + x = frexpl(x*0x1p120, e); + *e -= 120; + } else *e = 0; + return x; + } else if (ee == 0x7fff) { + return x; + } + + *e = ee - 0x3ffe; + u.i.se &= 0x8000; + u.i.se |= 0x3ffe; + return u.f; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/hypot.c b/lib/mlibc/options/ansi/musl-generic-math/hypot.c new file mode 100644 index 0000000..6071bf1 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/hypot.c @@ -0,0 +1,67 @@ +#include <math.h> +#include <stdint.h> +#include <float.h> + +#if FLT_EVAL_METHOD > 1U && LDBL_MANT_DIG == 64 +#define SPLIT (0x1p32 + 1) +#else +#define SPLIT (0x1p27 + 1) +#endif + +static void sq(double_t *hi, double_t *lo, double x) +{ + double_t xh, xl, xc; + + xc = (double_t)x*SPLIT; + xh = x - xc + xc; + xl = x - xh; + *hi = (double_t)x*x; + *lo = xh*xh - *hi + 2*xh*xl + xl*xl; +} + +double hypot(double x, double y) +{ + union {double f; uint64_t i;} ux = {x}, uy = {y}, ut; + int ex, ey; + double_t hx, lx, hy, ly, z; + + /* arrange |x| >= |y| */ + ux.i &= -1ULL>>1; + uy.i &= -1ULL>>1; + if (ux.i < uy.i) { + ut = ux; + ux = uy; + uy = ut; + } + + /* special cases */ + ex = ux.i>>52; + ey = uy.i>>52; + x = ux.f; + y = uy.f; + /* note: hypot(inf,nan) == inf */ + if (ey == 0x7ff) + return y; + if (ex == 0x7ff || uy.i == 0) + return x; + /* note: hypot(x,y) ~= x + y*y/x/2 with inexact for small y/x */ + /* 64 difference is enough for ld80 double_t */ + if (ex - ey > 64) + return x + y; + + /* precise sqrt argument in nearest rounding mode without overflow */ + /* xh*xh must not overflow and xl*xl must not underflow in sq */ + z = 1; + if (ex > 0x3ff+510) { + z = 0x1p700; + x *= 0x1p-700; + y *= 0x1p-700; + } else if (ey < 0x3ff-450) { + z = 0x1p-700; + x *= 0x1p700; + y *= 0x1p700; + } + sq(&hx, &lx, x); + sq(&hy, &ly, y); + return z*sqrt(ly+lx+hy+hx); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/hypotf.c b/lib/mlibc/options/ansi/musl-generic-math/hypotf.c new file mode 100644 index 0000000..2fc214b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/hypotf.c @@ -0,0 +1,35 @@ +#include <math.h> +#include <stdint.h> + +float hypotf(float x, float y) +{ + union {float f; uint32_t i;} ux = {x}, uy = {y}, ut; + float_t z; + + ux.i &= -1U>>1; + uy.i &= -1U>>1; + if (ux.i < uy.i) { + ut = ux; + ux = uy; + uy = ut; + } + + x = ux.f; + y = uy.f; + if (uy.i == 0xff<<23) + return y; + if (ux.i >= 0xff<<23 || uy.i == 0 || ux.i - uy.i >= 25<<23) + return x + y; + + z = 1; + if (ux.i >= (0x7f+60)<<23) { + z = 0x1p90f; + x *= 0x1p-90f; + y *= 0x1p-90f; + } else if (uy.i < (0x7f-60)<<23) { + z = 0x1p-90f; + x *= 0x1p90f; + y *= 0x1p90f; + } + return z*sqrtf((double)x*x + (double)y*y); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/hypotl.c b/lib/mlibc/options/ansi/musl-generic-math/hypotl.c new file mode 100644 index 0000000..479aa92 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/hypotl.c @@ -0,0 +1,66 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double hypotl(long double x, long double y) +{ + return hypot(x, y); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +#if LDBL_MANT_DIG == 64 +#define SPLIT (0x1p32L+1) +#elif LDBL_MANT_DIG == 113 +#define SPLIT (0x1p57L+1) +#endif + +static void sq(long double *hi, long double *lo, long double x) +{ + long double xh, xl, xc; + xc = x*SPLIT; + xh = x - xc + xc; + xl = x - xh; + *hi = x*x; + *lo = xh*xh - *hi + 2*xh*xl + xl*xl; +} + +long double hypotl(long double x, long double y) +{ + union ldshape ux = {x}, uy = {y}; + int ex, ey; + long double hx, lx, hy, ly, z; + + ux.i.se &= 0x7fff; + uy.i.se &= 0x7fff; + if (ux.i.se < uy.i.se) { + ex = uy.i.se; + ey = ux.i.se; + x = uy.f; + y = ux.f; + } else { + ex = ux.i.se; + ey = uy.i.se; + x = ux.f; + y = uy.f; + } + + if (ex == 0x7fff && isinf(y)) + return y; + if (ex == 0x7fff || y == 0) + return x; + if (ex - ey > LDBL_MANT_DIG) + return x + y; + + z = 1; + if (ex > 0x3fff+8000) { + z = 0x1p10000L; + x *= 0x1p-10000L; + y *= 0x1p-10000L; + } else if (ey < 0x3fff-8000) { + z = 0x1p-10000L; + x *= 0x1p10000L; + y *= 0x1p10000L; + } + sq(&hx, &lx, x); + sq(&hy, &ly, y); + return z*sqrtl(ly+lx+hy+hx); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/ilogb.c b/lib/mlibc/options/ansi/musl-generic-math/ilogb.c new file mode 100644 index 0000000..64d4015 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ilogb.c @@ -0,0 +1,26 @@ +#include <limits.h> +#include "libm.h" + +int ilogb(double x) +{ + #pragma STDC FENV_ACCESS ON + union {double f; uint64_t i;} u = {x}; + uint64_t i = u.i; + int e = i>>52 & 0x7ff; + + if (!e) { + i <<= 12; + if (i == 0) { + FORCE_EVAL(0/0.0f); + return FP_ILOGB0; + } + /* subnormal x */ + for (e = -0x3ff; i>>63 == 0; e--, i<<=1); + return e; + } + if (e == 0x7ff) { + FORCE_EVAL(0/0.0f); + return i<<12 ? FP_ILOGBNAN : INT_MAX; + } + return e - 0x3ff; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/ilogbf.c b/lib/mlibc/options/ansi/musl-generic-math/ilogbf.c new file mode 100644 index 0000000..e23ba20 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ilogbf.c @@ -0,0 +1,26 @@ +#include <limits.h> +#include "libm.h" + +int ilogbf(float x) +{ + #pragma STDC FENV_ACCESS ON + union {float f; uint32_t i;} u = {x}; + uint32_t i = u.i; + int e = i>>23 & 0xff; + + if (!e) { + i <<= 9; + if (i == 0) { + FORCE_EVAL(0/0.0f); + return FP_ILOGB0; + } + /* subnormal x */ + for (e = -0x7f; i>>31 == 0; e--, i<<=1); + return e; + } + if (e == 0xff) { + FORCE_EVAL(0/0.0f); + return i<<9 ? FP_ILOGBNAN : INT_MAX; + } + return e - 0x7f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/ilogbl.c b/lib/mlibc/options/ansi/musl-generic-math/ilogbl.c new file mode 100644 index 0000000..7b1a9cf --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ilogbl.c @@ -0,0 +1,55 @@ +#include <limits.h> +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +int ilogbl(long double x) +{ + return ilogb(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +int ilogbl(long double x) +{ + #pragma STDC FENV_ACCESS ON + union ldshape u = {x}; + uint64_t m = u.i.m; + int e = u.i.se & 0x7fff; + + if (!e) { + if (m == 0) { + FORCE_EVAL(0/0.0f); + return FP_ILOGB0; + } + /* subnormal x */ + for (e = -0x3fff+1; m>>63 == 0; e--, m<<=1); + return e; + } + if (e == 0x7fff) { + FORCE_EVAL(0/0.0f); + return m<<1 ? FP_ILOGBNAN : INT_MAX; + } + return e - 0x3fff; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +int ilogbl(long double x) +{ + #pragma STDC FENV_ACCESS ON + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + + if (!e) { + if (x == 0) { + FORCE_EVAL(0/0.0f); + return FP_ILOGB0; + } + /* subnormal x */ + x *= 0x1p120; + return ilogbl(x) - 120; + } + if (e == 0x7fff) { + FORCE_EVAL(0/0.0f); + u.i.se = 0; + return u.f ? FP_ILOGBNAN : INT_MAX; + } + return e - 0x3fff; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/j0.c b/lib/mlibc/options/ansi/musl-generic-math/j0.c new file mode 100644 index 0000000..d722d94 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/j0.c @@ -0,0 +1,375 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_j0.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* j0(x), y0(x) + * Bessel function of the first and second kinds of order zero. + * Method -- j0(x): + * 1. For tiny x, we use j0(x) = 1 - x^2/4 + x^4/64 - ... + * 2. Reduce x to |x| since j0(x)=j0(-x), and + * for x in (0,2) + * j0(x) = 1-z/4+ z^2*R0/S0, where z = x*x; + * (precision: |j0-1+z/4-z^2R0/S0 |<2**-63.67 ) + * for x in (2,inf) + * j0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)-q0(x)*sin(x0)) + * where x0 = x-pi/4. It is better to compute sin(x0),cos(x0) + * as follow: + * cos(x0) = cos(x)cos(pi/4)+sin(x)sin(pi/4) + * = 1/sqrt(2) * (cos(x) + sin(x)) + * sin(x0) = sin(x)cos(pi/4)-cos(x)sin(pi/4) + * = 1/sqrt(2) * (sin(x) - cos(x)) + * (To avoid cancellation, use + * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) + * to compute the worse one.) + * + * 3 Special cases + * j0(nan)= nan + * j0(0) = 1 + * j0(inf) = 0 + * + * Method -- y0(x): + * 1. For x<2. + * Since + * y0(x) = 2/pi*(j0(x)*(ln(x/2)+Euler) + x^2/4 - ...) + * therefore y0(x)-2/pi*j0(x)*ln(x) is an even function. + * We use the following function to approximate y0, + * y0(x) = U(z)/V(z) + (2/pi)*(j0(x)*ln(x)), z= x^2 + * where + * U(z) = u00 + u01*z + ... + u06*z^6 + * V(z) = 1 + v01*z + ... + v04*z^4 + * with absolute approximation error bounded by 2**-72. + * Note: For tiny x, U/V = u0 and j0(x)~1, hence + * y0(tiny) = u0 + (2/pi)*ln(tiny), (choose tiny<2**-27) + * 2. For x>=2. + * y0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)+q0(x)*sin(x0)) + * where x0 = x-pi/4. It is better to compute sin(x0),cos(x0) + * by the method mentioned above. + * 3. Special cases: y0(0)=-inf, y0(x<0)=NaN, y0(inf)=0. + */ + +#include "libm.h" + +static double pzero(double), qzero(double); + +static const double +invsqrtpi = 5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */ +tpi = 6.36619772367581382433e-01; /* 0x3FE45F30, 0x6DC9C883 */ + +/* common method when |x|>=2 */ +static double common(uint32_t ix, double x, int y0) +{ + double s,c,ss,cc,z; + + /* + * j0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x-pi/4)-q0(x)*sin(x-pi/4)) + * y0(x) = sqrt(2/(pi*x))*(p0(x)*sin(x-pi/4)+q0(x)*cos(x-pi/4)) + * + * sin(x-pi/4) = (sin(x) - cos(x))/sqrt(2) + * cos(x-pi/4) = (sin(x) + cos(x))/sqrt(2) + * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) + */ + s = sin(x); + c = cos(x); + if (y0) + c = -c; + cc = s+c; + /* avoid overflow in 2*x, big ulp error when x>=0x1p1023 */ + if (ix < 0x7fe00000) { + ss = s-c; + z = -cos(2*x); + if (s*c < 0) + cc = z/ss; + else + ss = z/cc; + if (ix < 0x48000000) { + if (y0) + ss = -ss; + cc = pzero(x)*cc-qzero(x)*ss; + } + } + return invsqrtpi*cc/sqrt(x); +} + +/* R0/S0 on [0, 2.00] */ +static const double +R02 = 1.56249999999999947958e-02, /* 0x3F8FFFFF, 0xFFFFFFFD */ +R03 = -1.89979294238854721751e-04, /* 0xBF28E6A5, 0xB61AC6E9 */ +R04 = 1.82954049532700665670e-06, /* 0x3EBEB1D1, 0x0C503919 */ +R05 = -4.61832688532103189199e-09, /* 0xBE33D5E7, 0x73D63FCE */ +S01 = 1.56191029464890010492e-02, /* 0x3F8FFCE8, 0x82C8C2A4 */ +S02 = 1.16926784663337450260e-04, /* 0x3F1EA6D2, 0xDD57DBF4 */ +S03 = 5.13546550207318111446e-07, /* 0x3EA13B54, 0xCE84D5A9 */ +S04 = 1.16614003333790000205e-09; /* 0x3E1408BC, 0xF4745D8F */ + +double j0(double x) +{ + double z,r,s; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* j0(+-inf)=0, j0(nan)=nan */ + if (ix >= 0x7ff00000) + return 1/(x*x); + x = fabs(x); + + if (ix >= 0x40000000) { /* |x| >= 2 */ + /* large ulp error near zeros: 2.4, 5.52, 8.6537,.. */ + return common(ix,x,0); + } + + /* 1 - x*x/4 + x*x*R(x^2)/S(x^2) */ + if (ix >= 0x3f200000) { /* |x| >= 2**-13 */ + /* up to 4ulp error close to 2 */ + z = x*x; + r = z*(R02+z*(R03+z*(R04+z*R05))); + s = 1+z*(S01+z*(S02+z*(S03+z*S04))); + return (1+x/2)*(1-x/2) + z*(r/s); + } + + /* 1 - x*x/4 */ + /* prevent underflow */ + /* inexact should be raised when x!=0, this is not done correctly */ + if (ix >= 0x38000000) /* |x| >= 2**-127 */ + x = 0.25*x*x; + return 1 - x; +} + +static const double +u00 = -7.38042951086872317523e-02, /* 0xBFB2E4D6, 0x99CBD01F */ +u01 = 1.76666452509181115538e-01, /* 0x3FC69D01, 0x9DE9E3FC */ +u02 = -1.38185671945596898896e-02, /* 0xBF8C4CE8, 0xB16CFA97 */ +u03 = 3.47453432093683650238e-04, /* 0x3F36C54D, 0x20B29B6B */ +u04 = -3.81407053724364161125e-06, /* 0xBECFFEA7, 0x73D25CAD */ +u05 = 1.95590137035022920206e-08, /* 0x3E550057, 0x3B4EABD4 */ +u06 = -3.98205194132103398453e-11, /* 0xBDC5E43D, 0x693FB3C8 */ +v01 = 1.27304834834123699328e-02, /* 0x3F8A1270, 0x91C9C71A */ +v02 = 7.60068627350353253702e-05, /* 0x3F13ECBB, 0xF578C6C1 */ +v03 = 2.59150851840457805467e-07, /* 0x3E91642D, 0x7FF202FD */ +v04 = 4.41110311332675467403e-10; /* 0x3DFE5018, 0x3BD6D9EF */ + +double y0(double x) +{ + double z,u,v; + uint32_t ix,lx; + + EXTRACT_WORDS(ix, lx, x); + + /* y0(nan)=nan, y0(<0)=nan, y0(0)=-inf, y0(inf)=0 */ + if ((ix<<1 | lx) == 0) + return -1/0.0; + if (ix>>31) + return 0/0.0; + if (ix >= 0x7ff00000) + return 1/x; + + if (ix >= 0x40000000) { /* x >= 2 */ + /* large ulp errors near zeros: 3.958, 7.086,.. */ + return common(ix,x,1); + } + + /* U(x^2)/V(x^2) + (2/pi)*j0(x)*log(x) */ + if (ix >= 0x3e400000) { /* x >= 2**-27 */ + /* large ulp error near the first zero, x ~= 0.89 */ + z = x*x; + u = u00+z*(u01+z*(u02+z*(u03+z*(u04+z*(u05+z*u06))))); + v = 1.0+z*(v01+z*(v02+z*(v03+z*v04))); + return u/v + tpi*(j0(x)*log(x)); + } + return u00 + tpi*log(x); +} + +/* The asymptotic expansions of pzero is + * 1 - 9/128 s^2 + 11025/98304 s^4 - ..., where s = 1/x. + * For x >= 2, We approximate pzero by + * pzero(x) = 1 + (R/S) + * where R = pR0 + pR1*s^2 + pR2*s^4 + ... + pR5*s^10 + * S = 1 + pS0*s^2 + ... + pS4*s^10 + * and + * | pzero(x)-1-R/S | <= 2 ** ( -60.26) + */ +static const double pR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ + -7.03124999999900357484e-02, /* 0xBFB1FFFF, 0xFFFFFD32 */ + -8.08167041275349795626e+00, /* 0xC02029D0, 0xB44FA779 */ + -2.57063105679704847262e+02, /* 0xC0701102, 0x7B19E863 */ + -2.48521641009428822144e+03, /* 0xC0A36A6E, 0xCD4DCAFC */ + -5.25304380490729545272e+03, /* 0xC0B4850B, 0x36CC643D */ +}; +static const double pS8[5] = { + 1.16534364619668181717e+02, /* 0x405D2233, 0x07A96751 */ + 3.83374475364121826715e+03, /* 0x40ADF37D, 0x50596938 */ + 4.05978572648472545552e+04, /* 0x40E3D2BB, 0x6EB6B05F */ + 1.16752972564375915681e+05, /* 0x40FC810F, 0x8F9FA9BD */ + 4.76277284146730962675e+04, /* 0x40E74177, 0x4F2C49DC */ +}; + +static const double pR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + -1.14125464691894502584e-11, /* 0xBDA918B1, 0x47E495CC */ + -7.03124940873599280078e-02, /* 0xBFB1FFFF, 0xE69AFBC6 */ + -4.15961064470587782438e+00, /* 0xC010A370, 0xF90C6BBF */ + -6.76747652265167261021e+01, /* 0xC050EB2F, 0x5A7D1783 */ + -3.31231299649172967747e+02, /* 0xC074B3B3, 0x6742CC63 */ + -3.46433388365604912451e+02, /* 0xC075A6EF, 0x28A38BD7 */ +}; +static const double pS5[5] = { + 6.07539382692300335975e+01, /* 0x404E6081, 0x0C98C5DE */ + 1.05125230595704579173e+03, /* 0x40906D02, 0x5C7E2864 */ + 5.97897094333855784498e+03, /* 0x40B75AF8, 0x8FBE1D60 */ + 9.62544514357774460223e+03, /* 0x40C2CCB8, 0xFA76FA38 */ + 2.40605815922939109441e+03, /* 0x40A2CC1D, 0xC70BE864 */ +}; + +static const double pR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ + -2.54704601771951915620e-09, /* 0xBE25E103, 0x6FE1AA86 */ + -7.03119616381481654654e-02, /* 0xBFB1FFF6, 0xF7C0E24B */ + -2.40903221549529611423e+00, /* 0xC00345B2, 0xAEA48074 */ + -2.19659774734883086467e+01, /* 0xC035F74A, 0x4CB94E14 */ + -5.80791704701737572236e+01, /* 0xC04D0A22, 0x420A1A45 */ + -3.14479470594888503854e+01, /* 0xC03F72AC, 0xA892D80F */ +}; +static const double pS3[5] = { + 3.58560338055209726349e+01, /* 0x4041ED92, 0x84077DD3 */ + 3.61513983050303863820e+02, /* 0x40769839, 0x464A7C0E */ + 1.19360783792111533330e+03, /* 0x4092A66E, 0x6D1061D6 */ + 1.12799679856907414432e+03, /* 0x40919FFC, 0xB8C39B7E */ + 1.73580930813335754692e+02, /* 0x4065B296, 0xFC379081 */ +}; + +static const double pR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + -8.87534333032526411254e-08, /* 0xBE77D316, 0xE927026D */ + -7.03030995483624743247e-02, /* 0xBFB1FF62, 0x495E1E42 */ + -1.45073846780952986357e+00, /* 0xBFF73639, 0x8A24A843 */ + -7.63569613823527770791e+00, /* 0xC01E8AF3, 0xEDAFA7F3 */ + -1.11931668860356747786e+01, /* 0xC02662E6, 0xC5246303 */ + -3.23364579351335335033e+00, /* 0xC009DE81, 0xAF8FE70F */ +}; +static const double pS2[5] = { + 2.22202997532088808441e+01, /* 0x40363865, 0x908B5959 */ + 1.36206794218215208048e+02, /* 0x4061069E, 0x0EE8878F */ + 2.70470278658083486789e+02, /* 0x4070E786, 0x42EA079B */ + 1.53875394208320329881e+02, /* 0x40633C03, 0x3AB6FAFF */ + 1.46576176948256193810e+01, /* 0x402D50B3, 0x44391809 */ +}; + +static double pzero(double x) +{ + const double *p,*q; + double_t z,r,s; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x40200000){p = pR8; q = pS8;} + else if (ix >= 0x40122E8B){p = pR5; q = pS5;} + else if (ix >= 0x4006DB6D){p = pR3; q = pS3;} + else /*ix >= 0x40000000*/ {p = pR2; q = pS2;} + z = 1.0/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4])))); + return 1.0 + r/s; +} + + +/* For x >= 8, the asymptotic expansions of qzero is + * -1/8 s + 75/1024 s^3 - ..., where s = 1/x. + * We approximate pzero by + * qzero(x) = s*(-1.25 + (R/S)) + * where R = qR0 + qR1*s^2 + qR2*s^4 + ... + qR5*s^10 + * S = 1 + qS0*s^2 + ... + qS5*s^12 + * and + * | qzero(x)/s +1.25-R/S | <= 2 ** ( -61.22) + */ +static const double qR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ + 7.32421874999935051953e-02, /* 0x3FB2BFFF, 0xFFFFFE2C */ + 1.17682064682252693899e+01, /* 0x40278952, 0x5BB334D6 */ + 5.57673380256401856059e+02, /* 0x40816D63, 0x15301825 */ + 8.85919720756468632317e+03, /* 0x40C14D99, 0x3E18F46D */ + 3.70146267776887834771e+04, /* 0x40E212D4, 0x0E901566 */ +}; +static const double qS8[6] = { + 1.63776026895689824414e+02, /* 0x406478D5, 0x365B39BC */ + 8.09834494656449805916e+03, /* 0x40BFA258, 0x4E6B0563 */ + 1.42538291419120476348e+05, /* 0x41016652, 0x54D38C3F */ + 8.03309257119514397345e+05, /* 0x412883DA, 0x83A52B43 */ + 8.40501579819060512818e+05, /* 0x4129A66B, 0x28DE0B3D */ + -3.43899293537866615225e+05, /* 0xC114FD6D, 0x2C9530C5 */ +}; + +static const double qR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + 1.84085963594515531381e-11, /* 0x3DB43D8F, 0x29CC8CD9 */ + 7.32421766612684765896e-02, /* 0x3FB2BFFF, 0xD172B04C */ + 5.83563508962056953777e+00, /* 0x401757B0, 0xB9953DD3 */ + 1.35111577286449829671e+02, /* 0x4060E392, 0x0A8788E9 */ + 1.02724376596164097464e+03, /* 0x40900CF9, 0x9DC8C481 */ + 1.98997785864605384631e+03, /* 0x409F17E9, 0x53C6E3A6 */ +}; +static const double qS5[6] = { + 8.27766102236537761883e+01, /* 0x4054B1B3, 0xFB5E1543 */ + 2.07781416421392987104e+03, /* 0x40A03BA0, 0xDA21C0CE */ + 1.88472887785718085070e+04, /* 0x40D267D2, 0x7B591E6D */ + 5.67511122894947329769e+04, /* 0x40EBB5E3, 0x97E02372 */ + 3.59767538425114471465e+04, /* 0x40E19118, 0x1F7A54A0 */ + -5.35434275601944773371e+03, /* 0xC0B4EA57, 0xBEDBC609 */ +}; + +static const double qR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ + 4.37741014089738620906e-09, /* 0x3E32CD03, 0x6ADECB82 */ + 7.32411180042911447163e-02, /* 0x3FB2BFEE, 0x0E8D0842 */ + 3.34423137516170720929e+00, /* 0x400AC0FC, 0x61149CF5 */ + 4.26218440745412650017e+01, /* 0x40454F98, 0x962DAEDD */ + 1.70808091340565596283e+02, /* 0x406559DB, 0xE25EFD1F */ + 1.66733948696651168575e+02, /* 0x4064D77C, 0x81FA21E0 */ +}; +static const double qS3[6] = { + 4.87588729724587182091e+01, /* 0x40486122, 0xBFE343A6 */ + 7.09689221056606015736e+02, /* 0x40862D83, 0x86544EB3 */ + 3.70414822620111362994e+03, /* 0x40ACF04B, 0xE44DFC63 */ + 6.46042516752568917582e+03, /* 0x40B93C6C, 0xD7C76A28 */ + 2.51633368920368957333e+03, /* 0x40A3A8AA, 0xD94FB1C0 */ + -1.49247451836156386662e+02, /* 0xC062A7EB, 0x201CF40F */ +}; + +static const double qR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + 1.50444444886983272379e-07, /* 0x3E84313B, 0x54F76BDB */ + 7.32234265963079278272e-02, /* 0x3FB2BEC5, 0x3E883E34 */ + 1.99819174093815998816e+00, /* 0x3FFFF897, 0xE727779C */ + 1.44956029347885735348e+01, /* 0x402CFDBF, 0xAAF96FE5 */ + 3.16662317504781540833e+01, /* 0x403FAA8E, 0x29FBDC4A */ + 1.62527075710929267416e+01, /* 0x403040B1, 0x71814BB4 */ +}; +static const double qS2[6] = { + 3.03655848355219184498e+01, /* 0x403E5D96, 0xF7C07AED */ + 2.69348118608049844624e+02, /* 0x4070D591, 0xE4D14B40 */ + 8.44783757595320139444e+02, /* 0x408A6645, 0x22B3BF22 */ + 8.82935845112488550512e+02, /* 0x408B977C, 0x9C5CC214 */ + 2.12666388511798828631e+02, /* 0x406A9553, 0x0E001365 */ + -5.31095493882666946917e+00, /* 0xC0153E6A, 0xF8B32931 */ +}; + +static double qzero(double x) +{ + const double *p,*q; + double_t s,r,z; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x40200000){p = qR8; q = qS8;} + else if (ix >= 0x40122E8B){p = qR5; q = qS5;} + else if (ix >= 0x4006DB6D){p = qR3; q = qS3;} + else /*ix >= 0x40000000*/ {p = qR2; q = qS2;} + z = 1.0/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5]))))); + return (-.125 + r/s)/x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/j0f.c b/lib/mlibc/options/ansi/musl-generic-math/j0f.c new file mode 100644 index 0000000..fab554a --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/j0f.c @@ -0,0 +1,314 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_j0f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include "libm.h" + +static float pzerof(float), qzerof(float); + +static const float +invsqrtpi = 5.6418961287e-01, /* 0x3f106ebb */ +tpi = 6.3661974669e-01; /* 0x3f22f983 */ + +static float common(uint32_t ix, float x, int y0) +{ + float z,s,c,ss,cc; + /* + * j0(x) = 1/sqrt(pi) * (P(0,x)*cc - Q(0,x)*ss) / sqrt(x) + * y0(x) = 1/sqrt(pi) * (P(0,x)*ss + Q(0,x)*cc) / sqrt(x) + */ + s = sinf(x); + c = cosf(x); + if (y0) + c = -c; + cc = s+c; + if (ix < 0x7f000000) { + ss = s-c; + z = -cosf(2*x); + if (s*c < 0) + cc = z/ss; + else + ss = z/cc; + if (ix < 0x58800000) { + if (y0) + ss = -ss; + cc = pzerof(x)*cc-qzerof(x)*ss; + } + } + return invsqrtpi*cc/sqrtf(x); +} + +/* R0/S0 on [0, 2.00] */ +static const float +R02 = 1.5625000000e-02, /* 0x3c800000 */ +R03 = -1.8997929874e-04, /* 0xb947352e */ +R04 = 1.8295404516e-06, /* 0x35f58e88 */ +R05 = -4.6183270541e-09, /* 0xb19eaf3c */ +S01 = 1.5619102865e-02, /* 0x3c7fe744 */ +S02 = 1.1692678527e-04, /* 0x38f53697 */ +S03 = 5.1354652442e-07, /* 0x3509daa6 */ +S04 = 1.1661400734e-09; /* 0x30a045e8 */ + +float j0f(float x) +{ + float z,r,s; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x7f800000) + return 1/(x*x); + x = fabsf(x); + + if (ix >= 0x40000000) { /* |x| >= 2 */ + /* large ulp error near zeros */ + return common(ix, x, 0); + } + if (ix >= 0x3a000000) { /* |x| >= 2**-11 */ + /* up to 4ulp error near 2 */ + z = x*x; + r = z*(R02+z*(R03+z*(R04+z*R05))); + s = 1+z*(S01+z*(S02+z*(S03+z*S04))); + return (1+x/2)*(1-x/2) + z*(r/s); + } + if (ix >= 0x21800000) /* |x| >= 2**-60 */ + x = 0.25f*x*x; + return 1 - x; +} + +static const float +u00 = -7.3804296553e-02, /* 0xbd9726b5 */ +u01 = 1.7666645348e-01, /* 0x3e34e80d */ +u02 = -1.3818567619e-02, /* 0xbc626746 */ +u03 = 3.4745343146e-04, /* 0x39b62a69 */ +u04 = -3.8140706238e-06, /* 0xb67ff53c */ +u05 = 1.9559013964e-08, /* 0x32a802ba */ +u06 = -3.9820518410e-11, /* 0xae2f21eb */ +v01 = 1.2730483897e-02, /* 0x3c509385 */ +v02 = 7.6006865129e-05, /* 0x389f65e0 */ +v03 = 2.5915085189e-07, /* 0x348b216c */ +v04 = 4.4111031494e-10; /* 0x2ff280c2 */ + +float y0f(float x) +{ + float z,u,v; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + if ((ix & 0x7fffffff) == 0) + return -1/0.0f; + if (ix>>31) + return 0/0.0f; + if (ix >= 0x7f800000) + return 1/x; + if (ix >= 0x40000000) { /* |x| >= 2.0 */ + /* large ulp error near zeros */ + return common(ix,x,1); + } + if (ix >= 0x39000000) { /* x >= 2**-13 */ + /* large ulp error at x ~= 0.89 */ + z = x*x; + u = u00+z*(u01+z*(u02+z*(u03+z*(u04+z*(u05+z*u06))))); + v = 1+z*(v01+z*(v02+z*(v03+z*v04))); + return u/v + tpi*(j0f(x)*logf(x)); + } + return u00 + tpi*logf(x); +} + +/* The asymptotic expansions of pzero is + * 1 - 9/128 s^2 + 11025/98304 s^4 - ..., where s = 1/x. + * For x >= 2, We approximate pzero by + * pzero(x) = 1 + (R/S) + * where R = pR0 + pR1*s^2 + pR2*s^4 + ... + pR5*s^10 + * S = 1 + pS0*s^2 + ... + pS4*s^10 + * and + * | pzero(x)-1-R/S | <= 2 ** ( -60.26) + */ +static const float pR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.0000000000e+00, /* 0x00000000 */ + -7.0312500000e-02, /* 0xbd900000 */ + -8.0816707611e+00, /* 0xc1014e86 */ + -2.5706311035e+02, /* 0xc3808814 */ + -2.4852163086e+03, /* 0xc51b5376 */ + -5.2530439453e+03, /* 0xc5a4285a */ +}; +static const float pS8[5] = { + 1.1653436279e+02, /* 0x42e91198 */ + 3.8337448730e+03, /* 0x456f9beb */ + 4.0597855469e+04, /* 0x471e95db */ + 1.1675296875e+05, /* 0x47e4087c */ + 4.7627726562e+04, /* 0x473a0bba */ +}; +static const float pR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + -1.1412546255e-11, /* 0xad48c58a */ + -7.0312492549e-02, /* 0xbd8fffff */ + -4.1596107483e+00, /* 0xc0851b88 */ + -6.7674766541e+01, /* 0xc287597b */ + -3.3123129272e+02, /* 0xc3a59d9b */ + -3.4643338013e+02, /* 0xc3ad3779 */ +}; +static const float pS5[5] = { + 6.0753936768e+01, /* 0x42730408 */ + 1.0512523193e+03, /* 0x44836813 */ + 5.9789707031e+03, /* 0x45bad7c4 */ + 9.6254453125e+03, /* 0x461665c8 */ + 2.4060581055e+03, /* 0x451660ee */ +}; + +static const float pR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ + -2.5470459075e-09, /* 0xb12f081b */ + -7.0311963558e-02, /* 0xbd8fffb8 */ + -2.4090321064e+00, /* 0xc01a2d95 */ + -2.1965976715e+01, /* 0xc1afba52 */ + -5.8079170227e+01, /* 0xc2685112 */ + -3.1447946548e+01, /* 0xc1fb9565 */ +}; +static const float pS3[5] = { + 3.5856033325e+01, /* 0x420f6c94 */ + 3.6151397705e+02, /* 0x43b4c1ca */ + 1.1936077881e+03, /* 0x44953373 */ + 1.1279968262e+03, /* 0x448cffe6 */ + 1.7358093262e+02, /* 0x432d94b8 */ +}; + +static const float pR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + -8.8753431271e-08, /* 0xb3be98b7 */ + -7.0303097367e-02, /* 0xbd8ffb12 */ + -1.4507384300e+00, /* 0xbfb9b1cc */ + -7.6356959343e+00, /* 0xc0f4579f */ + -1.1193166733e+01, /* 0xc1331736 */ + -3.2336456776e+00, /* 0xc04ef40d */ +}; +static const float pS2[5] = { + 2.2220300674e+01, /* 0x41b1c32d */ + 1.3620678711e+02, /* 0x430834f0 */ + 2.7047027588e+02, /* 0x43873c32 */ + 1.5387539673e+02, /* 0x4319e01a */ + 1.4657617569e+01, /* 0x416a859a */ +}; + +static float pzerof(float x) +{ + const float *p,*q; + float_t z,r,s; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x41000000){p = pR8; q = pS8;} + else if (ix >= 0x409173eb){p = pR5; q = pS5;} + else if (ix >= 0x4036d917){p = pR3; q = pS3;} + else /*ix >= 0x40000000*/ {p = pR2; q = pS2;} + z = 1.0f/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0f+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4])))); + return 1.0f + r/s; +} + + +/* For x >= 8, the asymptotic expansions of qzero is + * -1/8 s + 75/1024 s^3 - ..., where s = 1/x. + * We approximate pzero by + * qzero(x) = s*(-1.25 + (R/S)) + * where R = qR0 + qR1*s^2 + qR2*s^4 + ... + qR5*s^10 + * S = 1 + qS0*s^2 + ... + qS5*s^12 + * and + * | qzero(x)/s +1.25-R/S | <= 2 ** ( -61.22) + */ +static const float qR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.0000000000e+00, /* 0x00000000 */ + 7.3242187500e-02, /* 0x3d960000 */ + 1.1768206596e+01, /* 0x413c4a93 */ + 5.5767340088e+02, /* 0x440b6b19 */ + 8.8591972656e+03, /* 0x460a6cca */ + 3.7014625000e+04, /* 0x471096a0 */ +}; +static const float qS8[6] = { + 1.6377603149e+02, /* 0x4323c6aa */ + 8.0983447266e+03, /* 0x45fd12c2 */ + 1.4253829688e+05, /* 0x480b3293 */ + 8.0330925000e+05, /* 0x49441ed4 */ + 8.4050156250e+05, /* 0x494d3359 */ + -3.4389928125e+05, /* 0xc8a7eb69 */ +}; + +static const float qR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + 1.8408595828e-11, /* 0x2da1ec79 */ + 7.3242180049e-02, /* 0x3d95ffff */ + 5.8356351852e+00, /* 0x40babd86 */ + 1.3511157227e+02, /* 0x43071c90 */ + 1.0272437744e+03, /* 0x448067cd */ + 1.9899779053e+03, /* 0x44f8bf4b */ +}; +static const float qS5[6] = { + 8.2776611328e+01, /* 0x42a58da0 */ + 2.0778142090e+03, /* 0x4501dd07 */ + 1.8847289062e+04, /* 0x46933e94 */ + 5.6751113281e+04, /* 0x475daf1d */ + 3.5976753906e+04, /* 0x470c88c1 */ + -5.3543427734e+03, /* 0xc5a752be */ +}; + +static const float qR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ + 4.3774099900e-09, /* 0x3196681b */ + 7.3241114616e-02, /* 0x3d95ff70 */ + 3.3442313671e+00, /* 0x405607e3 */ + 4.2621845245e+01, /* 0x422a7cc5 */ + 1.7080809021e+02, /* 0x432acedf */ + 1.6673394775e+02, /* 0x4326bbe4 */ +}; +static const float qS3[6] = { + 4.8758872986e+01, /* 0x42430916 */ + 7.0968920898e+02, /* 0x44316c1c */ + 3.7041481934e+03, /* 0x4567825f */ + 6.4604252930e+03, /* 0x45c9e367 */ + 2.5163337402e+03, /* 0x451d4557 */ + -1.4924745178e+02, /* 0xc3153f59 */ +}; + +static const float qR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + 1.5044444979e-07, /* 0x342189db */ + 7.3223426938e-02, /* 0x3d95f62a */ + 1.9981917143e+00, /* 0x3fffc4bf */ + 1.4495602608e+01, /* 0x4167edfd */ + 3.1666231155e+01, /* 0x41fd5471 */ + 1.6252708435e+01, /* 0x4182058c */ +}; +static const float qS2[6] = { + 3.0365585327e+01, /* 0x41f2ecb8 */ + 2.6934811401e+02, /* 0x4386ac8f */ + 8.4478375244e+02, /* 0x44533229 */ + 8.8293585205e+02, /* 0x445cbbe5 */ + 2.1266638184e+02, /* 0x4354aa98 */ + -5.3109550476e+00, /* 0xc0a9f358 */ +}; + +static float qzerof(float x) +{ + const float *p,*q; + float_t s,r,z; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x41000000){p = qR8; q = qS8;} + else if (ix >= 0x409173eb){p = qR5; q = qS5;} + else if (ix >= 0x4036d917){p = qR3; q = qS3;} + else /*ix >= 0x40000000*/ {p = qR2; q = qS2;} + z = 1.0f/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0f+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5]))))); + return (-.125f + r/s)/x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/j1.c b/lib/mlibc/options/ansi/musl-generic-math/j1.c new file mode 100644 index 0000000..df724d1 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/j1.c @@ -0,0 +1,362 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_j1.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* j1(x), y1(x) + * Bessel function of the first and second kinds of order zero. + * Method -- j1(x): + * 1. For tiny x, we use j1(x) = x/2 - x^3/16 + x^5/384 - ... + * 2. Reduce x to |x| since j1(x)=-j1(-x), and + * for x in (0,2) + * j1(x) = x/2 + x*z*R0/S0, where z = x*x; + * (precision: |j1/x - 1/2 - R0/S0 |<2**-61.51 ) + * for x in (2,inf) + * j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x1)-q1(x)*sin(x1)) + * y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1)) + * where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1) + * as follow: + * cos(x1) = cos(x)cos(3pi/4)+sin(x)sin(3pi/4) + * = 1/sqrt(2) * (sin(x) - cos(x)) + * sin(x1) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4) + * = -1/sqrt(2) * (sin(x) + cos(x)) + * (To avoid cancellation, use + * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) + * to compute the worse one.) + * + * 3 Special cases + * j1(nan)= nan + * j1(0) = 0 + * j1(inf) = 0 + * + * Method -- y1(x): + * 1. screen out x<=0 cases: y1(0)=-inf, y1(x<0)=NaN + * 2. For x<2. + * Since + * y1(x) = 2/pi*(j1(x)*(ln(x/2)+Euler)-1/x-x/2+5/64*x^3-...) + * therefore y1(x)-2/pi*j1(x)*ln(x)-1/x is an odd function. + * We use the following function to approximate y1, + * y1(x) = x*U(z)/V(z) + (2/pi)*(j1(x)*ln(x)-1/x), z= x^2 + * where for x in [0,2] (abs err less than 2**-65.89) + * U(z) = U0[0] + U0[1]*z + ... + U0[4]*z^4 + * V(z) = 1 + v0[0]*z + ... + v0[4]*z^5 + * Note: For tiny x, 1/x dominate y1 and hence + * y1(tiny) = -2/pi/tiny, (choose tiny<2**-54) + * 3. For x>=2. + * y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1)) + * where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1) + * by method mentioned above. + */ + +#include "libm.h" + +static double pone(double), qone(double); + +static const double +invsqrtpi = 5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */ +tpi = 6.36619772367581382433e-01; /* 0x3FE45F30, 0x6DC9C883 */ + +static double common(uint32_t ix, double x, int y1, int sign) +{ + double z,s,c,ss,cc; + + /* + * j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x-3pi/4)-q1(x)*sin(x-3pi/4)) + * y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x-3pi/4)+q1(x)*cos(x-3pi/4)) + * + * sin(x-3pi/4) = -(sin(x) + cos(x))/sqrt(2) + * cos(x-3pi/4) = (sin(x) - cos(x))/sqrt(2) + * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) + */ + s = sin(x); + if (y1) + s = -s; + c = cos(x); + cc = s-c; + if (ix < 0x7fe00000) { + /* avoid overflow in 2*x */ + ss = -s-c; + z = cos(2*x); + if (s*c > 0) + cc = z/ss; + else + ss = z/cc; + if (ix < 0x48000000) { + if (y1) + ss = -ss; + cc = pone(x)*cc-qone(x)*ss; + } + } + if (sign) + cc = -cc; + return invsqrtpi*cc/sqrt(x); +} + +/* R0/S0 on [0,2] */ +static const double +r00 = -6.25000000000000000000e-02, /* 0xBFB00000, 0x00000000 */ +r01 = 1.40705666955189706048e-03, /* 0x3F570D9F, 0x98472C61 */ +r02 = -1.59955631084035597520e-05, /* 0xBEF0C5C6, 0xBA169668 */ +r03 = 4.96727999609584448412e-08, /* 0x3E6AAAFA, 0x46CA0BD9 */ +s01 = 1.91537599538363460805e-02, /* 0x3F939D0B, 0x12637E53 */ +s02 = 1.85946785588630915560e-04, /* 0x3F285F56, 0xB9CDF664 */ +s03 = 1.17718464042623683263e-06, /* 0x3EB3BFF8, 0x333F8498 */ +s04 = 5.04636257076217042715e-09, /* 0x3E35AC88, 0xC97DFF2C */ +s05 = 1.23542274426137913908e-11; /* 0x3DAB2ACF, 0xCFB97ED8 */ + +double j1(double x) +{ + double z,r,s; + uint32_t ix; + int sign; + + GET_HIGH_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7ff00000) + return 1/(x*x); + if (ix >= 0x40000000) /* |x| >= 2 */ + return common(ix, fabs(x), 0, sign); + if (ix >= 0x38000000) { /* |x| >= 2**-127 */ + z = x*x; + r = z*(r00+z*(r01+z*(r02+z*r03))); + s = 1+z*(s01+z*(s02+z*(s03+z*(s04+z*s05)))); + z = r/s; + } else + /* avoid underflow, raise inexact if x!=0 */ + z = x; + return (0.5 + z)*x; +} + +static const double U0[5] = { + -1.96057090646238940668e-01, /* 0xBFC91866, 0x143CBC8A */ + 5.04438716639811282616e-02, /* 0x3FA9D3C7, 0x76292CD1 */ + -1.91256895875763547298e-03, /* 0xBF5F55E5, 0x4844F50F */ + 2.35252600561610495928e-05, /* 0x3EF8AB03, 0x8FA6B88E */ + -9.19099158039878874504e-08, /* 0xBE78AC00, 0x569105B8 */ +}; +static const double V0[5] = { + 1.99167318236649903973e-02, /* 0x3F94650D, 0x3F4DA9F0 */ + 2.02552581025135171496e-04, /* 0x3F2A8C89, 0x6C257764 */ + 1.35608801097516229404e-06, /* 0x3EB6C05A, 0x894E8CA6 */ + 6.22741452364621501295e-09, /* 0x3E3ABF1D, 0x5BA69A86 */ + 1.66559246207992079114e-11, /* 0x3DB25039, 0xDACA772A */ +}; + +double y1(double x) +{ + double z,u,v; + uint32_t ix,lx; + + EXTRACT_WORDS(ix, lx, x); + /* y1(nan)=nan, y1(<0)=nan, y1(0)=-inf, y1(inf)=0 */ + if ((ix<<1 | lx) == 0) + return -1/0.0; + if (ix>>31) + return 0/0.0; + if (ix >= 0x7ff00000) + return 1/x; + + if (ix >= 0x40000000) /* x >= 2 */ + return common(ix, x, 1, 0); + if (ix < 0x3c900000) /* x < 2**-54 */ + return -tpi/x; + z = x*x; + u = U0[0]+z*(U0[1]+z*(U0[2]+z*(U0[3]+z*U0[4]))); + v = 1+z*(V0[0]+z*(V0[1]+z*(V0[2]+z*(V0[3]+z*V0[4])))); + return x*(u/v) + tpi*(j1(x)*log(x)-1/x); +} + +/* For x >= 8, the asymptotic expansions of pone is + * 1 + 15/128 s^2 - 4725/2^15 s^4 - ..., where s = 1/x. + * We approximate pone by + * pone(x) = 1 + (R/S) + * where R = pr0 + pr1*s^2 + pr2*s^4 + ... + pr5*s^10 + * S = 1 + ps0*s^2 + ... + ps4*s^10 + * and + * | pone(x)-1-R/S | <= 2 ** ( -60.06) + */ + +static const double pr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ + 1.17187499999988647970e-01, /* 0x3FBDFFFF, 0xFFFFFCCE */ + 1.32394806593073575129e+01, /* 0x402A7A9D, 0x357F7FCE */ + 4.12051854307378562225e+02, /* 0x4079C0D4, 0x652EA590 */ + 3.87474538913960532227e+03, /* 0x40AE457D, 0xA3A532CC */ + 7.91447954031891731574e+03, /* 0x40BEEA7A, 0xC32782DD */ +}; +static const double ps8[5] = { + 1.14207370375678408436e+02, /* 0x405C8D45, 0x8E656CAC */ + 3.65093083420853463394e+03, /* 0x40AC85DC, 0x964D274F */ + 3.69562060269033463555e+04, /* 0x40E20B86, 0x97C5BB7F */ + 9.76027935934950801311e+04, /* 0x40F7D42C, 0xB28F17BB */ + 3.08042720627888811578e+04, /* 0x40DE1511, 0x697A0B2D */ +}; + +static const double pr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + 1.31990519556243522749e-11, /* 0x3DAD0667, 0xDAE1CA7D */ + 1.17187493190614097638e-01, /* 0x3FBDFFFF, 0xE2C10043 */ + 6.80275127868432871736e+00, /* 0x401B3604, 0x6E6315E3 */ + 1.08308182990189109773e+02, /* 0x405B13B9, 0x452602ED */ + 5.17636139533199752805e+02, /* 0x40802D16, 0xD052D649 */ + 5.28715201363337541807e+02, /* 0x408085B8, 0xBB7E0CB7 */ +}; +static const double ps5[5] = { + 5.92805987221131331921e+01, /* 0x404DA3EA, 0xA8AF633D */ + 9.91401418733614377743e+02, /* 0x408EFB36, 0x1B066701 */ + 5.35326695291487976647e+03, /* 0x40B4E944, 0x5706B6FB */ + 7.84469031749551231769e+03, /* 0x40BEA4B0, 0xB8A5BB15 */ + 1.50404688810361062679e+03, /* 0x40978030, 0x036F5E51 */ +}; + +static const double pr3[6] = { + 3.02503916137373618024e-09, /* 0x3E29FC21, 0xA7AD9EDD */ + 1.17186865567253592491e-01, /* 0x3FBDFFF5, 0x5B21D17B */ + 3.93297750033315640650e+00, /* 0x400F76BC, 0xE85EAD8A */ + 3.51194035591636932736e+01, /* 0x40418F48, 0x9DA6D129 */ + 9.10550110750781271918e+01, /* 0x4056C385, 0x4D2C1837 */ + 4.85590685197364919645e+01, /* 0x4048478F, 0x8EA83EE5 */ +}; +static const double ps3[5] = { + 3.47913095001251519989e+01, /* 0x40416549, 0xA134069C */ + 3.36762458747825746741e+02, /* 0x40750C33, 0x07F1A75F */ + 1.04687139975775130551e+03, /* 0x40905B7C, 0x5037D523 */ + 8.90811346398256432622e+02, /* 0x408BD67D, 0xA32E31E9 */ + 1.03787932439639277504e+02, /* 0x4059F26D, 0x7C2EED53 */ +}; + +static const double pr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + 1.07710830106873743082e-07, /* 0x3E7CE9D4, 0xF65544F4 */ + 1.17176219462683348094e-01, /* 0x3FBDFF42, 0xBE760D83 */ + 2.36851496667608785174e+00, /* 0x4002F2B7, 0xF98FAEC0 */ + 1.22426109148261232917e+01, /* 0x40287C37, 0x7F71A964 */ + 1.76939711271687727390e+01, /* 0x4031B1A8, 0x177F8EE2 */ + 5.07352312588818499250e+00, /* 0x40144B49, 0xA574C1FE */ +}; +static const double ps2[5] = { + 2.14364859363821409488e+01, /* 0x40356FBD, 0x8AD5ECDC */ + 1.25290227168402751090e+02, /* 0x405F5293, 0x14F92CD5 */ + 2.32276469057162813669e+02, /* 0x406D08D8, 0xD5A2DBD9 */ + 1.17679373287147100768e+02, /* 0x405D6B7A, 0xDA1884A9 */ + 8.36463893371618283368e+00, /* 0x4020BAB1, 0xF44E5192 */ +}; + +static double pone(double x) +{ + const double *p,*q; + double_t z,r,s; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x40200000){p = pr8; q = ps8;} + else if (ix >= 0x40122E8B){p = pr5; q = ps5;} + else if (ix >= 0x4006DB6D){p = pr3; q = ps3;} + else /*ix >= 0x40000000*/ {p = pr2; q = ps2;} + z = 1.0/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4])))); + return 1.0+ r/s; +} + +/* For x >= 8, the asymptotic expansions of qone is + * 3/8 s - 105/1024 s^3 - ..., where s = 1/x. + * We approximate pone by + * qone(x) = s*(0.375 + (R/S)) + * where R = qr1*s^2 + qr2*s^4 + ... + qr5*s^10 + * S = 1 + qs1*s^2 + ... + qs6*s^12 + * and + * | qone(x)/s -0.375-R/S | <= 2 ** ( -61.13) + */ + +static const double qr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ + -1.02539062499992714161e-01, /* 0xBFBA3FFF, 0xFFFFFDF3 */ + -1.62717534544589987888e+01, /* 0xC0304591, 0xA26779F7 */ + -7.59601722513950107896e+02, /* 0xC087BCD0, 0x53E4B576 */ + -1.18498066702429587167e+04, /* 0xC0C724E7, 0x40F87415 */ + -4.84385124285750353010e+04, /* 0xC0E7A6D0, 0x65D09C6A */ +}; +static const double qs8[6] = { + 1.61395369700722909556e+02, /* 0x40642CA6, 0xDE5BCDE5 */ + 7.82538599923348465381e+03, /* 0x40BE9162, 0xD0D88419 */ + 1.33875336287249578163e+05, /* 0x4100579A, 0xB0B75E98 */ + 7.19657723683240939863e+05, /* 0x4125F653, 0x72869C19 */ + 6.66601232617776375264e+05, /* 0x412457D2, 0x7719AD5C */ + -2.94490264303834643215e+05, /* 0xC111F969, 0x0EA5AA18 */ +}; + +static const double qr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + -2.08979931141764104297e-11, /* 0xBDB6FA43, 0x1AA1A098 */ + -1.02539050241375426231e-01, /* 0xBFBA3FFF, 0xCB597FEF */ + -8.05644828123936029840e+00, /* 0xC0201CE6, 0xCA03AD4B */ + -1.83669607474888380239e+02, /* 0xC066F56D, 0x6CA7B9B0 */ + -1.37319376065508163265e+03, /* 0xC09574C6, 0x6931734F */ + -2.61244440453215656817e+03, /* 0xC0A468E3, 0x88FDA79D */ +}; +static const double qs5[6] = { + 8.12765501384335777857e+01, /* 0x405451B2, 0xFF5A11B2 */ + 1.99179873460485964642e+03, /* 0x409F1F31, 0xE77BF839 */ + 1.74684851924908907677e+04, /* 0x40D10F1F, 0x0D64CE29 */ + 4.98514270910352279316e+04, /* 0x40E8576D, 0xAABAD197 */ + 2.79480751638918118260e+04, /* 0x40DB4B04, 0xCF7C364B */ + -4.71918354795128470869e+03, /* 0xC0B26F2E, 0xFCFFA004 */ +}; + +static const double qr3[6] = { + -5.07831226461766561369e-09, /* 0xBE35CFA9, 0xD38FC84F */ + -1.02537829820837089745e-01, /* 0xBFBA3FEB, 0x51AEED54 */ + -4.61011581139473403113e+00, /* 0xC01270C2, 0x3302D9FF */ + -5.78472216562783643212e+01, /* 0xC04CEC71, 0xC25D16DA */ + -2.28244540737631695038e+02, /* 0xC06C87D3, 0x4718D55F */ + -2.19210128478909325622e+02, /* 0xC06B66B9, 0x5F5C1BF6 */ +}; +static const double qs3[6] = { + 4.76651550323729509273e+01, /* 0x4047D523, 0xCCD367E4 */ + 6.73865112676699709482e+02, /* 0x40850EEB, 0xC031EE3E */ + 3.38015286679526343505e+03, /* 0x40AA684E, 0x448E7C9A */ + 5.54772909720722782367e+03, /* 0x40B5ABBA, 0xA61D54A6 */ + 1.90311919338810798763e+03, /* 0x409DBC7A, 0x0DD4DF4B */ + -1.35201191444307340817e+02, /* 0xC060E670, 0x290A311F */ +}; + +static const double qr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + -1.78381727510958865572e-07, /* 0xBE87F126, 0x44C626D2 */ + -1.02517042607985553460e-01, /* 0xBFBA3E8E, 0x9148B010 */ + -2.75220568278187460720e+00, /* 0xC0060484, 0x69BB4EDA */ + -1.96636162643703720221e+01, /* 0xC033A9E2, 0xC168907F */ + -4.23253133372830490089e+01, /* 0xC04529A3, 0xDE104AAA */ + -2.13719211703704061733e+01, /* 0xC0355F36, 0x39CF6E52 */ +}; +static const double qs2[6] = { + 2.95333629060523854548e+01, /* 0x403D888A, 0x78AE64FF */ + 2.52981549982190529136e+02, /* 0x406F9F68, 0xDB821CBA */ + 7.57502834868645436472e+02, /* 0x4087AC05, 0xCE49A0F7 */ + 7.39393205320467245656e+02, /* 0x40871B25, 0x48D4C029 */ + 1.55949003336666123687e+02, /* 0x40637E5E, 0x3C3ED8D4 */ + -4.95949898822628210127e+00, /* 0xC013D686, 0xE71BE86B */ +}; + +static double qone(double x) +{ + const double *p,*q; + double_t s,r,z; + uint32_t ix; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x40200000){p = qr8; q = qs8;} + else if (ix >= 0x40122E8B){p = qr5; q = qs5;} + else if (ix >= 0x4006DB6D){p = qr3; q = qs3;} + else /*ix >= 0x40000000*/ {p = qr2; q = qs2;} + z = 1.0/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5]))))); + return (.375 + r/s)/x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/j1f.c b/lib/mlibc/options/ansi/musl-generic-math/j1f.c new file mode 100644 index 0000000..3434c53 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/j1f.c @@ -0,0 +1,310 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_j1f.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include "libm.h" + +static float ponef(float), qonef(float); + +static const float +invsqrtpi = 5.6418961287e-01, /* 0x3f106ebb */ +tpi = 6.3661974669e-01; /* 0x3f22f983 */ + +static float common(uint32_t ix, float x, int y1, int sign) +{ + double z,s,c,ss,cc; + + s = sinf(x); + if (y1) + s = -s; + c = cosf(x); + cc = s-c; + if (ix < 0x7f000000) { + ss = -s-c; + z = cosf(2*x); + if (s*c > 0) + cc = z/ss; + else + ss = z/cc; + if (ix < 0x58800000) { + if (y1) + ss = -ss; + cc = ponef(x)*cc-qonef(x)*ss; + } + } + if (sign) + cc = -cc; + return invsqrtpi*cc/sqrtf(x); +} + +/* R0/S0 on [0,2] */ +static const float +r00 = -6.2500000000e-02, /* 0xbd800000 */ +r01 = 1.4070566976e-03, /* 0x3ab86cfd */ +r02 = -1.5995563444e-05, /* 0xb7862e36 */ +r03 = 4.9672799207e-08, /* 0x335557d2 */ +s01 = 1.9153760746e-02, /* 0x3c9ce859 */ +s02 = 1.8594678841e-04, /* 0x3942fab6 */ +s03 = 1.1771846857e-06, /* 0x359dffc2 */ +s04 = 5.0463624390e-09, /* 0x31ad6446 */ +s05 = 1.2354227016e-11; /* 0x2d59567e */ + +float j1f(float x) +{ + float z,r,s; + uint32_t ix; + int sign; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix >= 0x7f800000) + return 1/(x*x); + if (ix >= 0x40000000) /* |x| >= 2 */ + return common(ix, fabsf(x), 0, sign); + if (ix >= 0x39000000) { /* |x| >= 2**-13 */ + z = x*x; + r = z*(r00+z*(r01+z*(r02+z*r03))); + s = 1+z*(s01+z*(s02+z*(s03+z*(s04+z*s05)))); + z = 0.5f + r/s; + } else + z = 0.5f; + return z*x; +} + +static const float U0[5] = { + -1.9605709612e-01, /* 0xbe48c331 */ + 5.0443872809e-02, /* 0x3d4e9e3c */ + -1.9125689287e-03, /* 0xbafaaf2a */ + 2.3525259166e-05, /* 0x37c5581c */ + -9.1909917899e-08, /* 0xb3c56003 */ +}; +static const float V0[5] = { + 1.9916731864e-02, /* 0x3ca3286a */ + 2.0255257550e-04, /* 0x3954644b */ + 1.3560879779e-06, /* 0x35b602d4 */ + 6.2274145840e-09, /* 0x31d5f8eb */ + 1.6655924903e-11, /* 0x2d9281cf */ +}; + +float y1f(float x) +{ + float z,u,v; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + if ((ix & 0x7fffffff) == 0) + return -1/0.0f; + if (ix>>31) + return 0/0.0f; + if (ix >= 0x7f800000) + return 1/x; + if (ix >= 0x40000000) /* |x| >= 2.0 */ + return common(ix,x,1,0); + if (ix < 0x33000000) /* x < 2**-25 */ + return -tpi/x; + z = x*x; + u = U0[0]+z*(U0[1]+z*(U0[2]+z*(U0[3]+z*U0[4]))); + v = 1.0f+z*(V0[0]+z*(V0[1]+z*(V0[2]+z*(V0[3]+z*V0[4])))); + return x*(u/v) + tpi*(j1f(x)*logf(x)-1.0f/x); +} + +/* For x >= 8, the asymptotic expansions of pone is + * 1 + 15/128 s^2 - 4725/2^15 s^4 - ..., where s = 1/x. + * We approximate pone by + * pone(x) = 1 + (R/S) + * where R = pr0 + pr1*s^2 + pr2*s^4 + ... + pr5*s^10 + * S = 1 + ps0*s^2 + ... + ps4*s^10 + * and + * | pone(x)-1-R/S | <= 2 ** ( -60.06) + */ + +static const float pr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.0000000000e+00, /* 0x00000000 */ + 1.1718750000e-01, /* 0x3df00000 */ + 1.3239480972e+01, /* 0x4153d4ea */ + 4.1205184937e+02, /* 0x43ce06a3 */ + 3.8747453613e+03, /* 0x45722bed */ + 7.9144794922e+03, /* 0x45f753d6 */ +}; +static const float ps8[5] = { + 1.1420736694e+02, /* 0x42e46a2c */ + 3.6509309082e+03, /* 0x45642ee5 */ + 3.6956207031e+04, /* 0x47105c35 */ + 9.7602796875e+04, /* 0x47bea166 */ + 3.0804271484e+04, /* 0x46f0a88b */ +}; + +static const float pr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + 1.3199052094e-11, /* 0x2d68333f */ + 1.1718749255e-01, /* 0x3defffff */ + 6.8027510643e+00, /* 0x40d9b023 */ + 1.0830818176e+02, /* 0x42d89dca */ + 5.1763616943e+02, /* 0x440168b7 */ + 5.2871520996e+02, /* 0x44042dc6 */ +}; +static const float ps5[5] = { + 5.9280597687e+01, /* 0x426d1f55 */ + 9.9140142822e+02, /* 0x4477d9b1 */ + 5.3532670898e+03, /* 0x45a74a23 */ + 7.8446904297e+03, /* 0x45f52586 */ + 1.5040468750e+03, /* 0x44bc0180 */ +}; + +static const float pr3[6] = { + 3.0250391081e-09, /* 0x314fe10d */ + 1.1718686670e-01, /* 0x3defffab */ + 3.9329774380e+00, /* 0x407bb5e7 */ + 3.5119403839e+01, /* 0x420c7a45 */ + 9.1055007935e+01, /* 0x42b61c2a */ + 4.8559066772e+01, /* 0x42423c7c */ +}; +static const float ps3[5] = { + 3.4791309357e+01, /* 0x420b2a4d */ + 3.3676245117e+02, /* 0x43a86198 */ + 1.0468714600e+03, /* 0x4482dbe3 */ + 8.9081134033e+02, /* 0x445eb3ed */ + 1.0378793335e+02, /* 0x42cf936c */ +}; + +static const float pr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + 1.0771083225e-07, /* 0x33e74ea8 */ + 1.1717621982e-01, /* 0x3deffa16 */ + 2.3685150146e+00, /* 0x401795c0 */ + 1.2242610931e+01, /* 0x4143e1bc */ + 1.7693971634e+01, /* 0x418d8d41 */ + 5.0735230446e+00, /* 0x40a25a4d */ +}; +static const float ps2[5] = { + 2.1436485291e+01, /* 0x41ab7dec */ + 1.2529022980e+02, /* 0x42fa9499 */ + 2.3227647400e+02, /* 0x436846c7 */ + 1.1767937469e+02, /* 0x42eb5bd7 */ + 8.3646392822e+00, /* 0x4105d590 */ +}; + +static float ponef(float x) +{ + const float *p,*q; + float_t z,r,s; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x41000000){p = pr8; q = ps8;} + else if (ix >= 0x409173eb){p = pr5; q = ps5;} + else if (ix >= 0x4036d917){p = pr3; q = ps3;} + else /*ix >= 0x40000000*/ {p = pr2; q = ps2;} + z = 1.0f/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0f+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4])))); + return 1.0f + r/s; +} + +/* For x >= 8, the asymptotic expansions of qone is + * 3/8 s - 105/1024 s^3 - ..., where s = 1/x. + * We approximate pone by + * qone(x) = s*(0.375 + (R/S)) + * where R = qr1*s^2 + qr2*s^4 + ... + qr5*s^10 + * S = 1 + qs1*s^2 + ... + qs6*s^12 + * and + * | qone(x)/s -0.375-R/S | <= 2 ** ( -61.13) + */ + +static const float qr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ + 0.0000000000e+00, /* 0x00000000 */ + -1.0253906250e-01, /* 0xbdd20000 */ + -1.6271753311e+01, /* 0xc1822c8d */ + -7.5960174561e+02, /* 0xc43de683 */ + -1.1849806641e+04, /* 0xc639273a */ + -4.8438511719e+04, /* 0xc73d3683 */ +}; +static const float qs8[6] = { + 1.6139537048e+02, /* 0x43216537 */ + 7.8253862305e+03, /* 0x45f48b17 */ + 1.3387534375e+05, /* 0x4802bcd6 */ + 7.1965775000e+05, /* 0x492fb29c */ + 6.6660125000e+05, /* 0x4922be94 */ + -2.9449025000e+05, /* 0xc88fcb48 */ +}; + +static const float qr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ + -2.0897993405e-11, /* 0xadb7d219 */ + -1.0253904760e-01, /* 0xbdd1fffe */ + -8.0564479828e+00, /* 0xc100e736 */ + -1.8366960144e+02, /* 0xc337ab6b */ + -1.3731937256e+03, /* 0xc4aba633 */ + -2.6124443359e+03, /* 0xc523471c */ +}; +static const float qs5[6] = { + 8.1276550293e+01, /* 0x42a28d98 */ + 1.9917987061e+03, /* 0x44f8f98f */ + 1.7468484375e+04, /* 0x468878f8 */ + 4.9851425781e+04, /* 0x4742bb6d */ + 2.7948074219e+04, /* 0x46da5826 */ + -4.7191835938e+03, /* 0xc5937978 */ +}; + +static const float qr3[6] = { + -5.0783124372e-09, /* 0xb1ae7d4f */ + -1.0253783315e-01, /* 0xbdd1ff5b */ + -4.6101160049e+00, /* 0xc0938612 */ + -5.7847221375e+01, /* 0xc267638e */ + -2.2824453735e+02, /* 0xc3643e9a */ + -2.1921012878e+02, /* 0xc35b35cb */ +}; +static const float qs3[6] = { + 4.7665153503e+01, /* 0x423ea91e */ + 6.7386511230e+02, /* 0x4428775e */ + 3.3801528320e+03, /* 0x45534272 */ + 5.5477290039e+03, /* 0x45ad5dd5 */ + 1.9031191406e+03, /* 0x44ede3d0 */ + -1.3520118713e+02, /* 0xc3073381 */ +}; + +static const float qr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ + -1.7838172539e-07, /* 0xb43f8932 */ + -1.0251704603e-01, /* 0xbdd1f475 */ + -2.7522056103e+00, /* 0xc0302423 */ + -1.9663616180e+01, /* 0xc19d4f16 */ + -4.2325313568e+01, /* 0xc2294d1f */ + -2.1371921539e+01, /* 0xc1aaf9b2 */ +}; +static const float qs2[6] = { + 2.9533363342e+01, /* 0x41ec4454 */ + 2.5298155212e+02, /* 0x437cfb47 */ + 7.5750280762e+02, /* 0x443d602e */ + 7.3939318848e+02, /* 0x4438d92a */ + 1.5594900513e+02, /* 0x431bf2f2 */ + -4.9594988823e+00, /* 0xc09eb437 */ +}; + +static float qonef(float x) +{ + const float *p,*q; + float_t s,r,z; + uint32_t ix; + + GET_FLOAT_WORD(ix, x); + ix &= 0x7fffffff; + if (ix >= 0x41000000){p = qr8; q = qs8;} + else if (ix >= 0x409173eb){p = qr5; q = qs5;} + else if (ix >= 0x4036d917){p = qr3; q = qs3;} + else /*ix >= 0x40000000*/ {p = qr2; q = qs2;} + z = 1.0f/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = 1.0f+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5]))))); + return (.375f + r/s)/x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/jn.c b/lib/mlibc/options/ansi/musl-generic-math/jn.c new file mode 100644 index 0000000..4878a54 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/jn.c @@ -0,0 +1,280 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_jn.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * jn(n, x), yn(n, x) + * floating point Bessel's function of the 1st and 2nd kind + * of order n + * + * Special cases: + * y0(0)=y1(0)=yn(n,0) = -inf with division by zero signal; + * y0(-ve)=y1(-ve)=yn(n,-ve) are NaN with invalid signal. + * Note 2. About jn(n,x), yn(n,x) + * For n=0, j0(x) is called, + * for n=1, j1(x) is called, + * for n<=x, forward recursion is used starting + * from values of j0(x) and j1(x). + * for n>x, a continued fraction approximation to + * j(n,x)/j(n-1,x) is evaluated and then backward + * recursion is used starting from a supposed value + * for j(n,x). The resulting value of j(0,x) is + * compared with the actual value to correct the + * supposed value of j(n,x). + * + * yn(n,x) is similar in all respects, except + * that forward recursion is used for all + * values of n>1. + */ + +#include "libm.h" + +static const double invsqrtpi = 5.64189583547756279280e-01; /* 0x3FE20DD7, 0x50429B6D */ + +double jn(int n, double x) +{ + uint32_t ix, lx; + int nm1, i, sign; + double a, b, temp; + + EXTRACT_WORDS(ix, lx, x); + sign = ix>>31; + ix &= 0x7fffffff; + + if ((ix | (lx|-lx)>>31) > 0x7ff00000) /* nan */ + return x; + + /* J(-n,x) = (-1)^n * J(n, x), J(n, -x) = (-1)^n * J(n, x) + * Thus, J(-n,x) = J(n,-x) + */ + /* nm1 = |n|-1 is used instead of |n| to handle n==INT_MIN */ + if (n == 0) + return j0(x); + if (n < 0) { + nm1 = -(n+1); + x = -x; + sign ^= 1; + } else + nm1 = n-1; + if (nm1 == 0) + return j1(x); + + sign &= n; /* even n: 0, odd n: signbit(x) */ + x = fabs(x); + if ((ix|lx) == 0 || ix == 0x7ff00000) /* if x is 0 or inf */ + b = 0.0; + else if (nm1 < x) { + /* Safe to use J(n+1,x)=2n/x *J(n,x)-J(n-1,x) */ + if (ix >= 0x52d00000) { /* x > 2**302 */ + /* (x >> n**2) + * Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi) + * Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi) + * Let s=sin(x), c=cos(x), + * xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then + * + * n sin(xn)*sqt2 cos(xn)*sqt2 + * ---------------------------------- + * 0 s-c c+s + * 1 -s-c -c+s + * 2 -s+c -c-s + * 3 s+c c-s + */ + switch(nm1&3) { + case 0: temp = -cos(x)+sin(x); break; + case 1: temp = -cos(x)-sin(x); break; + case 2: temp = cos(x)-sin(x); break; + default: + case 3: temp = cos(x)+sin(x); break; + } + b = invsqrtpi*temp/sqrt(x); + } else { + a = j0(x); + b = j1(x); + for (i=0; i<nm1; ) { + i++; + temp = b; + b = b*(2.0*i/x) - a; /* avoid underflow */ + a = temp; + } + } + } else { + if (ix < 0x3e100000) { /* x < 2**-29 */ + /* x is tiny, return the first Taylor expansion of J(n,x) + * J(n,x) = 1/n!*(x/2)^n - ... + */ + if (nm1 > 32) /* underflow */ + b = 0.0; + else { + temp = x*0.5; + b = temp; + a = 1.0; + for (i=2; i<=nm1+1; i++) { + a *= (double)i; /* a = n! */ + b *= temp; /* b = (x/2)^n */ + } + b = b/a; + } + } else { + /* use backward recurrence */ + /* x x^2 x^2 + * J(n,x)/J(n-1,x) = ---- ------ ------ ..... + * 2n - 2(n+1) - 2(n+2) + * + * 1 1 1 + * (for large x) = ---- ------ ------ ..... + * 2n 2(n+1) 2(n+2) + * -- - ------ - ------ - + * x x x + * + * Let w = 2n/x and h=2/x, then the above quotient + * is equal to the continued fraction: + * 1 + * = ----------------------- + * 1 + * w - ----------------- + * 1 + * w+h - --------- + * w+2h - ... + * + * To determine how many terms needed, let + * Q(0) = w, Q(1) = w(w+h) - 1, + * Q(k) = (w+k*h)*Q(k-1) - Q(k-2), + * When Q(k) > 1e4 good for single + * When Q(k) > 1e9 good for double + * When Q(k) > 1e17 good for quadruple + */ + /* determine k */ + double t,q0,q1,w,h,z,tmp,nf; + int k; + + nf = nm1 + 1.0; + w = 2*nf/x; + h = 2/x; + z = w+h; + q0 = w; + q1 = w*z - 1.0; + k = 1; + while (q1 < 1.0e9) { + k += 1; + z += h; + tmp = z*q1 - q0; + q0 = q1; + q1 = tmp; + } + for (t=0.0, i=k; i>=0; i--) + t = 1/(2*(i+nf)/x - t); + a = t; + b = 1.0; + /* estimate log((2/x)^n*n!) = n*log(2/x)+n*ln(n) + * Hence, if n*(log(2n/x)) > ... + * single 8.8722839355e+01 + * double 7.09782712893383973096e+02 + * long double 1.1356523406294143949491931077970765006170e+04 + * then recurrent value may overflow and the result is + * likely underflow to zero + */ + tmp = nf*log(fabs(w)); + if (tmp < 7.09782712893383973096e+02) { + for (i=nm1; i>0; i--) { + temp = b; + b = b*(2.0*i)/x - a; + a = temp; + } + } else { + for (i=nm1; i>0; i--) { + temp = b; + b = b*(2.0*i)/x - a; + a = temp; + /* scale b to avoid spurious overflow */ + if (b > 0x1p500) { + a /= b; + t /= b; + b = 1.0; + } + } + } + z = j0(x); + w = j1(x); + if (fabs(z) >= fabs(w)) + b = t*z/b; + else + b = t*w/a; + } + } + return sign ? -b : b; +} + + +double yn(int n, double x) +{ + uint32_t ix, lx, ib; + int nm1, sign, i; + double a, b, temp; + + EXTRACT_WORDS(ix, lx, x); + sign = ix>>31; + ix &= 0x7fffffff; + + if ((ix | (lx|-lx)>>31) > 0x7ff00000) /* nan */ + return x; + if (sign && (ix|lx)!=0) /* x < 0 */ + return 0/0.0; + if (ix == 0x7ff00000) + return 0.0; + + if (n == 0) + return y0(x); + if (n < 0) { + nm1 = -(n+1); + sign = n&1; + } else { + nm1 = n-1; + sign = 0; + } + if (nm1 == 0) + return sign ? -y1(x) : y1(x); + + if (ix >= 0x52d00000) { /* x > 2**302 */ + /* (x >> n**2) + * Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi) + * Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi) + * Let s=sin(x), c=cos(x), + * xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then + * + * n sin(xn)*sqt2 cos(xn)*sqt2 + * ---------------------------------- + * 0 s-c c+s + * 1 -s-c -c+s + * 2 -s+c -c-s + * 3 s+c c-s + */ + switch(nm1&3) { + case 0: temp = -sin(x)-cos(x); break; + case 1: temp = -sin(x)+cos(x); break; + case 2: temp = sin(x)+cos(x); break; + default: + case 3: temp = sin(x)-cos(x); break; + } + b = invsqrtpi*temp/sqrt(x); + } else { + a = y0(x); + b = y1(x); + /* quit if b is -inf */ + GET_HIGH_WORD(ib, b); + for (i=0; i<nm1 && ib!=0xfff00000; ){ + i++; + temp = b; + b = (2.0*i/x)*b - a; + GET_HIGH_WORD(ib, b); + a = temp; + } + } + return sign ? -b : b; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/jnf.c b/lib/mlibc/options/ansi/musl-generic-math/jnf.c new file mode 100644 index 0000000..f63c062 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/jnf.c @@ -0,0 +1,202 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_jnf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include "libm.h" + +float jnf(int n, float x) +{ + uint32_t ix; + int nm1, sign, i; + float a, b, temp; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix > 0x7f800000) /* nan */ + return x; + + /* J(-n,x) = J(n,-x), use |n|-1 to avoid overflow in -n */ + if (n == 0) + return j0f(x); + if (n < 0) { + nm1 = -(n+1); + x = -x; + sign ^= 1; + } else + nm1 = n-1; + if (nm1 == 0) + return j1f(x); + + sign &= n; /* even n: 0, odd n: signbit(x) */ + x = fabsf(x); + if (ix == 0 || ix == 0x7f800000) /* if x is 0 or inf */ + b = 0.0f; + else if (nm1 < x) { + /* Safe to use J(n+1,x)=2n/x *J(n,x)-J(n-1,x) */ + a = j0f(x); + b = j1f(x); + for (i=0; i<nm1; ){ + i++; + temp = b; + b = b*(2.0f*i/x) - a; + a = temp; + } + } else { + if (ix < 0x35800000) { /* x < 2**-20 */ + /* x is tiny, return the first Taylor expansion of J(n,x) + * J(n,x) = 1/n!*(x/2)^n - ... + */ + if (nm1 > 8) /* underflow */ + nm1 = 8; + temp = 0.5f * x; + b = temp; + a = 1.0f; + for (i=2; i<=nm1+1; i++) { + a *= (float)i; /* a = n! */ + b *= temp; /* b = (x/2)^n */ + } + b = b/a; + } else { + /* use backward recurrence */ + /* x x^2 x^2 + * J(n,x)/J(n-1,x) = ---- ------ ------ ..... + * 2n - 2(n+1) - 2(n+2) + * + * 1 1 1 + * (for large x) = ---- ------ ------ ..... + * 2n 2(n+1) 2(n+2) + * -- - ------ - ------ - + * x x x + * + * Let w = 2n/x and h=2/x, then the above quotient + * is equal to the continued fraction: + * 1 + * = ----------------------- + * 1 + * w - ----------------- + * 1 + * w+h - --------- + * w+2h - ... + * + * To determine how many terms needed, let + * Q(0) = w, Q(1) = w(w+h) - 1, + * Q(k) = (w+k*h)*Q(k-1) - Q(k-2), + * When Q(k) > 1e4 good for single + * When Q(k) > 1e9 good for double + * When Q(k) > 1e17 good for quadruple + */ + /* determine k */ + float t,q0,q1,w,h,z,tmp,nf; + int k; + + nf = nm1+1.0f; + w = 2*nf/x; + h = 2/x; + z = w+h; + q0 = w; + q1 = w*z - 1.0f; + k = 1; + while (q1 < 1.0e4f) { + k += 1; + z += h; + tmp = z*q1 - q0; + q0 = q1; + q1 = tmp; + } + for (t=0.0f, i=k; i>=0; i--) + t = 1.0f/(2*(i+nf)/x-t); + a = t; + b = 1.0f; + /* estimate log((2/x)^n*n!) = n*log(2/x)+n*ln(n) + * Hence, if n*(log(2n/x)) > ... + * single 8.8722839355e+01 + * double 7.09782712893383973096e+02 + * long double 1.1356523406294143949491931077970765006170e+04 + * then recurrent value may overflow and the result is + * likely underflow to zero + */ + tmp = nf*logf(fabsf(w)); + if (tmp < 88.721679688f) { + for (i=nm1; i>0; i--) { + temp = b; + b = 2.0f*i*b/x - a; + a = temp; + } + } else { + for (i=nm1; i>0; i--){ + temp = b; + b = 2.0f*i*b/x - a; + a = temp; + /* scale b to avoid spurious overflow */ + if (b > 0x1p60f) { + a /= b; + t /= b; + b = 1.0f; + } + } + } + z = j0f(x); + w = j1f(x); + if (fabsf(z) >= fabsf(w)) + b = t*z/b; + else + b = t*w/a; + } + } + return sign ? -b : b; +} + +float ynf(int n, float x) +{ + uint32_t ix, ib; + int nm1, sign, i; + float a, b, temp; + + GET_FLOAT_WORD(ix, x); + sign = ix>>31; + ix &= 0x7fffffff; + if (ix > 0x7f800000) /* nan */ + return x; + if (sign && ix != 0) /* x < 0 */ + return 0/0.0f; + if (ix == 0x7f800000) + return 0.0f; + + if (n == 0) + return y0f(x); + if (n < 0) { + nm1 = -(n+1); + sign = n&1; + } else { + nm1 = n-1; + sign = 0; + } + if (nm1 == 0) + return sign ? -y1f(x) : y1f(x); + + a = y0f(x); + b = y1f(x); + /* quit if b is -inf */ + GET_FLOAT_WORD(ib,b); + for (i = 0; i < nm1 && ib != 0xff800000; ) { + i++; + temp = b; + b = (2.0f*i/x)*b - a; + GET_FLOAT_WORD(ib, b); + a = temp; + } + return sign ? -b : b; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/ldexp.c b/lib/mlibc/options/ansi/musl-generic-math/ldexp.c new file mode 100644 index 0000000..f4d1cd6 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ldexp.c @@ -0,0 +1,6 @@ +#include <math.h> + +double ldexp(double x, int n) +{ + return scalbn(x, n); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/ldexpf.c b/lib/mlibc/options/ansi/musl-generic-math/ldexpf.c new file mode 100644 index 0000000..3bad5f3 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ldexpf.c @@ -0,0 +1,6 @@ +#include <math.h> + +float ldexpf(float x, int n) +{ + return scalbnf(x, n); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/ldexpl.c b/lib/mlibc/options/ansi/musl-generic-math/ldexpl.c new file mode 100644 index 0000000..fd145cc --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/ldexpl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long double ldexpl(long double x, int n) +{ + return scalbnl(x, n); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/lgamma.c b/lib/mlibc/options/ansi/musl-generic-math/lgamma.c new file mode 100644 index 0000000..e25ec8e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lgamma.c @@ -0,0 +1,9 @@ +#include <math.h> + +extern int __signgam; +double __lgamma_r(double, int *); + +double lgamma(double x) +{ + return __lgamma_r(x, &__signgam); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/lgamma_r.c b/lib/mlibc/options/ansi/musl-generic-math/lgamma_r.c new file mode 100644 index 0000000..84596a3 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lgamma_r.c @@ -0,0 +1,285 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_lgamma_r.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ +/* lgamma_r(x, signgamp) + * Reentrant version of the logarithm of the Gamma function + * with user provide pointer for the sign of Gamma(x). + * + * Method: + * 1. Argument Reduction for 0 < x <= 8 + * Since gamma(1+s)=s*gamma(s), for x in [0,8], we may + * reduce x to a number in [1.5,2.5] by + * lgamma(1+s) = log(s) + lgamma(s) + * for example, + * lgamma(7.3) = log(6.3) + lgamma(6.3) + * = log(6.3*5.3) + lgamma(5.3) + * = log(6.3*5.3*4.3*3.3*2.3) + lgamma(2.3) + * 2. Polynomial approximation of lgamma around its + * minimun ymin=1.461632144968362245 to maintain monotonicity. + * On [ymin-0.23, ymin+0.27] (i.e., [1.23164,1.73163]), use + * Let z = x-ymin; + * lgamma(x) = -1.214862905358496078218 + z^2*poly(z) + * where + * poly(z) is a 14 degree polynomial. + * 2. Rational approximation in the primary interval [2,3] + * We use the following approximation: + * s = x-2.0; + * lgamma(x) = 0.5*s + s*P(s)/Q(s) + * with accuracy + * |P/Q - (lgamma(x)-0.5s)| < 2**-61.71 + * Our algorithms are based on the following observation + * + * zeta(2)-1 2 zeta(3)-1 3 + * lgamma(2+s) = s*(1-Euler) + --------- * s - --------- * s + ... + * 2 3 + * + * where Euler = 0.5771... is the Euler constant, which is very + * close to 0.5. + * + * 3. For x>=8, we have + * lgamma(x)~(x-0.5)log(x)-x+0.5*log(2pi)+1/(12x)-1/(360x**3)+.... + * (better formula: + * lgamma(x)~(x-0.5)*(log(x)-1)-.5*(log(2pi)-1) + ...) + * Let z = 1/x, then we approximation + * f(z) = lgamma(x) - (x-0.5)(log(x)-1) + * by + * 3 5 11 + * w = w0 + w1*z + w2*z + w3*z + ... + w6*z + * where + * |w - f(z)| < 2**-58.74 + * + * 4. For negative x, since (G is gamma function) + * -x*G(-x)*G(x) = pi/sin(pi*x), + * we have + * G(x) = pi/(sin(pi*x)*(-x)*G(-x)) + * since G(-x) is positive, sign(G(x)) = sign(sin(pi*x)) for x<0 + * Hence, for x<0, signgam = sign(sin(pi*x)) and + * lgamma(x) = log(|Gamma(x)|) + * = log(pi/(|x*sin(pi*x)|)) - lgamma(-x); + * Note: one should avoid compute pi*(-x) directly in the + * computation of sin(pi*(-x)). + * + * 5. Special Cases + * lgamma(2+s) ~ s*(1-Euler) for tiny s + * lgamma(1) = lgamma(2) = 0 + * lgamma(x) ~ -log(|x|) for tiny x + * lgamma(0) = lgamma(neg.integer) = inf and raise divide-by-zero + * lgamma(inf) = inf + * lgamma(-inf) = inf (bug for bug compatible with C99!?) + * + */ + +#include "libm.h" +#include "weak_alias.h" +//#include "libc.h" + +static const double +pi = 3.14159265358979311600e+00, /* 0x400921FB, 0x54442D18 */ +a0 = 7.72156649015328655494e-02, /* 0x3FB3C467, 0xE37DB0C8 */ +a1 = 3.22467033424113591611e-01, /* 0x3FD4A34C, 0xC4A60FAD */ +a2 = 6.73523010531292681824e-02, /* 0x3FB13E00, 0x1A5562A7 */ +a3 = 2.05808084325167332806e-02, /* 0x3F951322, 0xAC92547B */ +a4 = 7.38555086081402883957e-03, /* 0x3F7E404F, 0xB68FEFE8 */ +a5 = 2.89051383673415629091e-03, /* 0x3F67ADD8, 0xCCB7926B */ +a6 = 1.19270763183362067845e-03, /* 0x3F538A94, 0x116F3F5D */ +a7 = 5.10069792153511336608e-04, /* 0x3F40B6C6, 0x89B99C00 */ +a8 = 2.20862790713908385557e-04, /* 0x3F2CF2EC, 0xED10E54D */ +a9 = 1.08011567247583939954e-04, /* 0x3F1C5088, 0x987DFB07 */ +a10 = 2.52144565451257326939e-05, /* 0x3EFA7074, 0x428CFA52 */ +a11 = 4.48640949618915160150e-05, /* 0x3F07858E, 0x90A45837 */ +tc = 1.46163214496836224576e+00, /* 0x3FF762D8, 0x6356BE3F */ +tf = -1.21486290535849611461e-01, /* 0xBFBF19B9, 0xBCC38A42 */ +/* tt = -(tail of tf) */ +tt = -3.63867699703950536541e-18, /* 0xBC50C7CA, 0xA48A971F */ +t0 = 4.83836122723810047042e-01, /* 0x3FDEF72B, 0xC8EE38A2 */ +t1 = -1.47587722994593911752e-01, /* 0xBFC2E427, 0x8DC6C509 */ +t2 = 6.46249402391333854778e-02, /* 0x3FB08B42, 0x94D5419B */ +t3 = -3.27885410759859649565e-02, /* 0xBFA0C9A8, 0xDF35B713 */ +t4 = 1.79706750811820387126e-02, /* 0x3F9266E7, 0x970AF9EC */ +t5 = -1.03142241298341437450e-02, /* 0xBF851F9F, 0xBA91EC6A */ +t6 = 6.10053870246291332635e-03, /* 0x3F78FCE0, 0xE370E344 */ +t7 = -3.68452016781138256760e-03, /* 0xBF6E2EFF, 0xB3E914D7 */ +t8 = 2.25964780900612472250e-03, /* 0x3F6282D3, 0x2E15C915 */ +t9 = -1.40346469989232843813e-03, /* 0xBF56FE8E, 0xBF2D1AF1 */ +t10 = 8.81081882437654011382e-04, /* 0x3F4CDF0C, 0xEF61A8E9 */ +t11 = -5.38595305356740546715e-04, /* 0xBF41A610, 0x9C73E0EC */ +t12 = 3.15632070903625950361e-04, /* 0x3F34AF6D, 0x6C0EBBF7 */ +t13 = -3.12754168375120860518e-04, /* 0xBF347F24, 0xECC38C38 */ +t14 = 3.35529192635519073543e-04, /* 0x3F35FD3E, 0xE8C2D3F4 */ +u0 = -7.72156649015328655494e-02, /* 0xBFB3C467, 0xE37DB0C8 */ +u1 = 6.32827064025093366517e-01, /* 0x3FE4401E, 0x8B005DFF */ +u2 = 1.45492250137234768737e+00, /* 0x3FF7475C, 0xD119BD6F */ +u3 = 9.77717527963372745603e-01, /* 0x3FEF4976, 0x44EA8450 */ +u4 = 2.28963728064692451092e-01, /* 0x3FCD4EAE, 0xF6010924 */ +u5 = 1.33810918536787660377e-02, /* 0x3F8B678B, 0xBF2BAB09 */ +v1 = 2.45597793713041134822e+00, /* 0x4003A5D7, 0xC2BD619C */ +v2 = 2.12848976379893395361e+00, /* 0x40010725, 0xA42B18F5 */ +v3 = 7.69285150456672783825e-01, /* 0x3FE89DFB, 0xE45050AF */ +v4 = 1.04222645593369134254e-01, /* 0x3FBAAE55, 0xD6537C88 */ +v5 = 3.21709242282423911810e-03, /* 0x3F6A5ABB, 0x57D0CF61 */ +s0 = -7.72156649015328655494e-02, /* 0xBFB3C467, 0xE37DB0C8 */ +s1 = 2.14982415960608852501e-01, /* 0x3FCB848B, 0x36E20878 */ +s2 = 3.25778796408930981787e-01, /* 0x3FD4D98F, 0x4F139F59 */ +s3 = 1.46350472652464452805e-01, /* 0x3FC2BB9C, 0xBEE5F2F7 */ +s4 = 2.66422703033638609560e-02, /* 0x3F9B481C, 0x7E939961 */ +s5 = 1.84028451407337715652e-03, /* 0x3F5E26B6, 0x7368F239 */ +s6 = 3.19475326584100867617e-05, /* 0x3F00BFEC, 0xDD17E945 */ +r1 = 1.39200533467621045958e+00, /* 0x3FF645A7, 0x62C4AB74 */ +r2 = 7.21935547567138069525e-01, /* 0x3FE71A18, 0x93D3DCDC */ +r3 = 1.71933865632803078993e-01, /* 0x3FC601ED, 0xCCFBDF27 */ +r4 = 1.86459191715652901344e-02, /* 0x3F9317EA, 0x742ED475 */ +r5 = 7.77942496381893596434e-04, /* 0x3F497DDA, 0xCA41A95B */ +r6 = 7.32668430744625636189e-06, /* 0x3EDEBAF7, 0xA5B38140 */ +w0 = 4.18938533204672725052e-01, /* 0x3FDACFE3, 0x90C97D69 */ +w1 = 8.33333333333329678849e-02, /* 0x3FB55555, 0x5555553B */ +w2 = -2.77777777728775536470e-03, /* 0xBF66C16C, 0x16B02E5C */ +w3 = 7.93650558643019558500e-04, /* 0x3F4A019F, 0x98CF38B6 */ +w4 = -5.95187557450339963135e-04, /* 0xBF4380CB, 0x8C0FE741 */ +w5 = 8.36339918996282139126e-04, /* 0x3F4B67BA, 0x4CDAD5D1 */ +w6 = -1.63092934096575273989e-03; /* 0xBF5AB89D, 0x0B9E43E4 */ + +/* sin(pi*x) assuming x > 2^-100, if sin(pi*x)==0 the sign is arbitrary */ +static double sin_pi(double x) +{ + int n; + + /* spurious inexact if odd int */ + x = 2.0*(x*0.5 - floor(x*0.5)); /* x mod 2.0 */ + + n = (int)(x*4.0); + n = (n+1)/2; + x -= n*0.5f; + x *= pi; + + switch (n) { + default: /* case 4: */ + case 0: return __sin(x, 0.0, 0); + case 1: return __cos(x, 0.0); + case 2: return __sin(-x, 0.0, 0); + case 3: return -__cos(x, 0.0); + } +} + +double __lgamma_r(double x, int *signgamp) +{ + union {double f; uint64_t i;} u = {x}; + double_t t,y,z,nadj,p,p1,p2,p3,q,r,w; + uint32_t ix; + int sign,i; + + /* purge off +-inf, NaN, +-0, tiny and negative arguments */ + *signgamp = 1; + sign = u.i>>63; + ix = u.i>>32 & 0x7fffffff; + if (ix >= 0x7ff00000) + return x*x; + if (ix < (0x3ff-70)<<20) { /* |x|<2**-70, return -log(|x|) */ + if(sign) { + x = -x; + *signgamp = -1; + } + return -log(x); + } + if (sign) { + x = -x; + t = sin_pi(x); + if (t == 0.0) /* -integer */ + return 1.0/(x-x); + if (t > 0.0) + *signgamp = -1; + else + t = -t; + nadj = log(pi/(t*x)); + } + + /* purge off 1 and 2 */ + if ((ix == 0x3ff00000 || ix == 0x40000000) && (uint32_t)u.i == 0) + r = 0; + /* for x < 2.0 */ + else if (ix < 0x40000000) { + if (ix <= 0x3feccccc) { /* lgamma(x) = lgamma(x+1)-log(x) */ + r = -log(x); + if (ix >= 0x3FE76944) { + y = 1.0 - x; + i = 0; + } else if (ix >= 0x3FCDA661) { + y = x - (tc-1.0); + i = 1; + } else { + y = x; + i = 2; + } + } else { + r = 0.0; + if (ix >= 0x3FFBB4C3) { /* [1.7316,2] */ + y = 2.0 - x; + i = 0; + } else if(ix >= 0x3FF3B4C4) { /* [1.23,1.73] */ + y = x - tc; + i = 1; + } else { + y = x - 1.0; + i = 2; + } + } + switch (i) { + case 0: + z = y*y; + p1 = a0+z*(a2+z*(a4+z*(a6+z*(a8+z*a10)))); + p2 = z*(a1+z*(a3+z*(a5+z*(a7+z*(a9+z*a11))))); + p = y*p1+p2; + r += (p-0.5*y); + break; + case 1: + z = y*y; + w = z*y; + p1 = t0+w*(t3+w*(t6+w*(t9 +w*t12))); /* parallel comp */ + p2 = t1+w*(t4+w*(t7+w*(t10+w*t13))); + p3 = t2+w*(t5+w*(t8+w*(t11+w*t14))); + p = z*p1-(tt-w*(p2+y*p3)); + r += tf + p; + break; + case 2: + p1 = y*(u0+y*(u1+y*(u2+y*(u3+y*(u4+y*u5))))); + p2 = 1.0+y*(v1+y*(v2+y*(v3+y*(v4+y*v5)))); + r += -0.5*y + p1/p2; + } + } else if (ix < 0x40200000) { /* x < 8.0 */ + i = (int)x; + y = x - (double)i; + p = y*(s0+y*(s1+y*(s2+y*(s3+y*(s4+y*(s5+y*s6)))))); + q = 1.0+y*(r1+y*(r2+y*(r3+y*(r4+y*(r5+y*r6))))); + r = 0.5*y+p/q; + z = 1.0; /* lgamma(1+s) = log(s) + lgamma(s) */ + switch (i) { + case 7: z *= y + 6.0; /* FALLTHRU */ + case 6: z *= y + 5.0; /* FALLTHRU */ + case 5: z *= y + 4.0; /* FALLTHRU */ + case 4: z *= y + 3.0; /* FALLTHRU */ + case 3: z *= y + 2.0; /* FALLTHRU */ + r += log(z); + break; + } + } else if (ix < 0x43900000) { /* 8.0 <= x < 2**58 */ + t = log(x); + z = 1.0/x; + y = z*z; + w = w0+z*(w1+y*(w2+y*(w3+y*(w4+y*(w5+y*w6))))); + r = (x-0.5)*(t-1.0)+w; + } else /* 2**58 <= x <= inf */ + r = x*(log(x)-1.0); + if (sign) + r = nadj - r; + return r; +} + +weak_alias(__lgamma_r, lgamma_r); diff --git a/lib/mlibc/options/ansi/musl-generic-math/lgammaf.c b/lib/mlibc/options/ansi/musl-generic-math/lgammaf.c new file mode 100644 index 0000000..badb6df --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lgammaf.c @@ -0,0 +1,9 @@ +#include <math.h> + +extern int __signgam; +float __lgammaf_r(float, int *); + +float lgammaf(float x) +{ + return __lgammaf_r(x, &__signgam); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/lgammaf_r.c b/lib/mlibc/options/ansi/musl-generic-math/lgammaf_r.c new file mode 100644 index 0000000..f73e89d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lgammaf_r.c @@ -0,0 +1,220 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_lgammaf_r.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" +#include "weak_alias.h" +//#include "libc.h" + +static const float +pi = 3.1415927410e+00, /* 0x40490fdb */ +a0 = 7.7215664089e-02, /* 0x3d9e233f */ +a1 = 3.2246702909e-01, /* 0x3ea51a66 */ +a2 = 6.7352302372e-02, /* 0x3d89f001 */ +a3 = 2.0580807701e-02, /* 0x3ca89915 */ +a4 = 7.3855509982e-03, /* 0x3bf2027e */ +a5 = 2.8905137442e-03, /* 0x3b3d6ec6 */ +a6 = 1.1927076848e-03, /* 0x3a9c54a1 */ +a7 = 5.1006977446e-04, /* 0x3a05b634 */ +a8 = 2.2086278477e-04, /* 0x39679767 */ +a9 = 1.0801156895e-04, /* 0x38e28445 */ +a10 = 2.5214456400e-05, /* 0x37d383a2 */ +a11 = 4.4864096708e-05, /* 0x383c2c75 */ +tc = 1.4616321325e+00, /* 0x3fbb16c3 */ +tf = -1.2148628384e-01, /* 0xbdf8cdcd */ +/* tt = -(tail of tf) */ +tt = 6.6971006518e-09, /* 0x31e61c52 */ +t0 = 4.8383611441e-01, /* 0x3ef7b95e */ +t1 = -1.4758771658e-01, /* 0xbe17213c */ +t2 = 6.4624942839e-02, /* 0x3d845a15 */ +t3 = -3.2788541168e-02, /* 0xbd064d47 */ +t4 = 1.7970675603e-02, /* 0x3c93373d */ +t5 = -1.0314224288e-02, /* 0xbc28fcfe */ +t6 = 6.1005386524e-03, /* 0x3bc7e707 */ +t7 = -3.6845202558e-03, /* 0xbb7177fe */ +t8 = 2.2596477065e-03, /* 0x3b141699 */ +t9 = -1.4034647029e-03, /* 0xbab7f476 */ +t10 = 8.8108185446e-04, /* 0x3a66f867 */ +t11 = -5.3859531181e-04, /* 0xba0d3085 */ +t12 = 3.1563205994e-04, /* 0x39a57b6b */ +t13 = -3.1275415677e-04, /* 0xb9a3f927 */ +t14 = 3.3552918467e-04, /* 0x39afe9f7 */ +u0 = -7.7215664089e-02, /* 0xbd9e233f */ +u1 = 6.3282704353e-01, /* 0x3f2200f4 */ +u2 = 1.4549225569e+00, /* 0x3fba3ae7 */ +u3 = 9.7771751881e-01, /* 0x3f7a4bb2 */ +u4 = 2.2896373272e-01, /* 0x3e6a7578 */ +u5 = 1.3381091878e-02, /* 0x3c5b3c5e */ +v1 = 2.4559779167e+00, /* 0x401d2ebe */ +v2 = 2.1284897327e+00, /* 0x4008392d */ +v3 = 7.6928514242e-01, /* 0x3f44efdf */ +v4 = 1.0422264785e-01, /* 0x3dd572af */ +v5 = 3.2170924824e-03, /* 0x3b52d5db */ +s0 = -7.7215664089e-02, /* 0xbd9e233f */ +s1 = 2.1498242021e-01, /* 0x3e5c245a */ +s2 = 3.2577878237e-01, /* 0x3ea6cc7a */ +s3 = 1.4635047317e-01, /* 0x3e15dce6 */ +s4 = 2.6642270386e-02, /* 0x3cda40e4 */ +s5 = 1.8402845599e-03, /* 0x3af135b4 */ +s6 = 3.1947532989e-05, /* 0x3805ff67 */ +r1 = 1.3920053244e+00, /* 0x3fb22d3b */ +r2 = 7.2193557024e-01, /* 0x3f38d0c5 */ +r3 = 1.7193385959e-01, /* 0x3e300f6e */ +r4 = 1.8645919859e-02, /* 0x3c98bf54 */ +r5 = 7.7794247773e-04, /* 0x3a4beed6 */ +r6 = 7.3266842264e-06, /* 0x36f5d7bd */ +w0 = 4.1893854737e-01, /* 0x3ed67f1d */ +w1 = 8.3333335817e-02, /* 0x3daaaaab */ +w2 = -2.7777778450e-03, /* 0xbb360b61 */ +w3 = 7.9365057172e-04, /* 0x3a500cfd */ +w4 = -5.9518753551e-04, /* 0xba1c065c */ +w5 = 8.3633989561e-04, /* 0x3a5b3dd2 */ +w6 = -1.6309292987e-03; /* 0xbad5c4e8 */ + +/* sin(pi*x) assuming x > 2^-100, if sin(pi*x)==0 the sign is arbitrary */ +static float sin_pi(float x) +{ + double_t y; + int n; + + /* spurious inexact if odd int */ + x = 2*(x*0.5f - floorf(x*0.5f)); /* x mod 2.0 */ + + n = (int)(x*4); + n = (n+1)/2; + y = x - n*0.5f; + y *= 3.14159265358979323846; + switch (n) { + default: /* case 4: */ + case 0: return __sindf(y); + case 1: return __cosdf(y); + case 2: return __sindf(-y); + case 3: return -__cosdf(y); + } +} + +float __lgammaf_r(float x, int *signgamp) +{ + union {float f; uint32_t i;} u = {x}; + float t,y,z,nadj,p,p1,p2,p3,q,r,w; + uint32_t ix; + int i,sign; + + /* purge off +-inf, NaN, +-0, tiny and negative arguments */ + *signgamp = 1; + sign = u.i>>31; + ix = u.i & 0x7fffffff; + if (ix >= 0x7f800000) + return x*x; + if (ix < 0x35000000) { /* |x| < 2**-21, return -log(|x|) */ + if (sign) { + *signgamp = -1; + x = -x; + } + return -logf(x); + } + if (sign) { + x = -x; + t = sin_pi(x); + if (t == 0.0f) /* -integer */ + return 1.0f/(x-x); + if (t > 0.0f) + *signgamp = -1; + else + t = -t; + nadj = logf(pi/(t*x)); + } + + /* purge off 1 and 2 */ + if (ix == 0x3f800000 || ix == 0x40000000) + r = 0; + /* for x < 2.0 */ + else if (ix < 0x40000000) { + if (ix <= 0x3f666666) { /* lgamma(x) = lgamma(x+1)-log(x) */ + r = -logf(x); + if (ix >= 0x3f3b4a20) { + y = 1.0f - x; + i = 0; + } else if (ix >= 0x3e6d3308) { + y = x - (tc-1.0f); + i = 1; + } else { + y = x; + i = 2; + } + } else { + r = 0.0f; + if (ix >= 0x3fdda618) { /* [1.7316,2] */ + y = 2.0f - x; + i = 0; + } else if (ix >= 0x3F9da620) { /* [1.23,1.73] */ + y = x - tc; + i = 1; + } else { + y = x - 1.0f; + i = 2; + } + } + switch(i) { + case 0: + z = y*y; + p1 = a0+z*(a2+z*(a4+z*(a6+z*(a8+z*a10)))); + p2 = z*(a1+z*(a3+z*(a5+z*(a7+z*(a9+z*a11))))); + p = y*p1+p2; + r += p - 0.5f*y; + break; + case 1: + z = y*y; + w = z*y; + p1 = t0+w*(t3+w*(t6+w*(t9 +w*t12))); /* parallel comp */ + p2 = t1+w*(t4+w*(t7+w*(t10+w*t13))); + p3 = t2+w*(t5+w*(t8+w*(t11+w*t14))); + p = z*p1-(tt-w*(p2+y*p3)); + r += (tf + p); + break; + case 2: + p1 = y*(u0+y*(u1+y*(u2+y*(u3+y*(u4+y*u5))))); + p2 = 1.0f+y*(v1+y*(v2+y*(v3+y*(v4+y*v5)))); + r += -0.5f*y + p1/p2; + } + } else if (ix < 0x41000000) { /* x < 8.0 */ + i = (int)x; + y = x - (float)i; + p = y*(s0+y*(s1+y*(s2+y*(s3+y*(s4+y*(s5+y*s6)))))); + q = 1.0f+y*(r1+y*(r2+y*(r3+y*(r4+y*(r5+y*r6))))); + r = 0.5f*y+p/q; + z = 1.0f; /* lgamma(1+s) = log(s) + lgamma(s) */ + switch (i) { + case 7: z *= y + 6.0f; /* FALLTHRU */ + case 6: z *= y + 5.0f; /* FALLTHRU */ + case 5: z *= y + 4.0f; /* FALLTHRU */ + case 4: z *= y + 3.0f; /* FALLTHRU */ + case 3: z *= y + 2.0f; /* FALLTHRU */ + r += logf(z); + break; + } + } else if (ix < 0x5c800000) { /* 8.0 <= x < 2**58 */ + t = logf(x); + z = 1.0f/x; + y = z*z; + w = w0+z*(w1+y*(w2+y*(w3+y*(w4+y*(w5+y*w6))))); + r = (x-0.5f)*(t-1.0f)+w; + } else /* 2**58 <= x <= inf */ + r = x*(logf(x)-1.0f); + if (sign) + r = nadj - r; + return r; +} + +weak_alias(__lgammaf_r, lgammaf_r); diff --git a/lib/mlibc/options/ansi/musl-generic-math/lgammal.c b/lib/mlibc/options/ansi/musl-generic-math/lgammal.c new file mode 100644 index 0000000..f0bea36 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lgammal.c @@ -0,0 +1,361 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_lgammal.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* lgammal(x) + * Reentrant version of the logarithm of the Gamma function + * with user provide pointer for the sign of Gamma(x). + * + * Method: + * 1. Argument Reduction for 0 < x <= 8 + * Since gamma(1+s)=s*gamma(s), for x in [0,8], we may + * reduce x to a number in [1.5,2.5] by + * lgamma(1+s) = log(s) + lgamma(s) + * for example, + * lgamma(7.3) = log(6.3) + lgamma(6.3) + * = log(6.3*5.3) + lgamma(5.3) + * = log(6.3*5.3*4.3*3.3*2.3) + lgamma(2.3) + * 2. Polynomial approximation of lgamma around its + * minimun ymin=1.461632144968362245 to maintain monotonicity. + * On [ymin-0.23, ymin+0.27] (i.e., [1.23164,1.73163]), use + * Let z = x-ymin; + * lgamma(x) = -1.214862905358496078218 + z^2*poly(z) + * 2. Rational approximation in the primary interval [2,3] + * We use the following approximation: + * s = x-2.0; + * lgamma(x) = 0.5*s + s*P(s)/Q(s) + * Our algorithms are based on the following observation + * + * zeta(2)-1 2 zeta(3)-1 3 + * lgamma(2+s) = s*(1-Euler) + --------- * s - --------- * s + ... + * 2 3 + * + * where Euler = 0.5771... is the Euler constant, which is very + * close to 0.5. + * + * 3. For x>=8, we have + * lgamma(x)~(x-0.5)log(x)-x+0.5*log(2pi)+1/(12x)-1/(360x**3)+.... + * (better formula: + * lgamma(x)~(x-0.5)*(log(x)-1)-.5*(log(2pi)-1) + ...) + * Let z = 1/x, then we approximation + * f(z) = lgamma(x) - (x-0.5)(log(x)-1) + * by + * 3 5 11 + * w = w0 + w1*z + w2*z + w3*z + ... + w6*z + * + * 4. For negative x, since (G is gamma function) + * -x*G(-x)*G(x) = pi/sin(pi*x), + * we have + * G(x) = pi/(sin(pi*x)*(-x)*G(-x)) + * since G(-x) is positive, sign(G(x)) = sign(sin(pi*x)) for x<0 + * Hence, for x<0, signgam = sign(sin(pi*x)) and + * lgamma(x) = log(|Gamma(x)|) + * = log(pi/(|x*sin(pi*x)|)) - lgamma(-x); + * Note: one should avoid compute pi*(-x) directly in the + * computation of sin(pi*(-x)). + * + * 5. Special Cases + * lgamma(2+s) ~ s*(1-Euler) for tiny s + * lgamma(1)=lgamma(2)=0 + * lgamma(x) ~ -log(x) for tiny x + * lgamma(0) = lgamma(inf) = inf + * lgamma(-integer) = +-inf + * + */ + +#define _GNU_SOURCE +#include "libm.h" +#include "weak_alias.h" +//#include "libc.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +double __lgamma_r(double x, int *sg); + +long double __lgammal_r(long double x, int *sg) +{ + return __lgamma_r(x, sg); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +static const long double +pi = 3.14159265358979323846264L, + +/* lgam(1+x) = 0.5 x + x a(x)/b(x) + -0.268402099609375 <= x <= 0 + peak relative error 6.6e-22 */ +a0 = -6.343246574721079391729402781192128239938E2L, +a1 = 1.856560238672465796768677717168371401378E3L, +a2 = 2.404733102163746263689288466865843408429E3L, +a3 = 8.804188795790383497379532868917517596322E2L, +a4 = 1.135361354097447729740103745999661157426E2L, +a5 = 3.766956539107615557608581581190400021285E0L, + +b0 = 8.214973713960928795704317259806842490498E3L, +b1 = 1.026343508841367384879065363925870888012E4L, +b2 = 4.553337477045763320522762343132210919277E3L, +b3 = 8.506975785032585797446253359230031874803E2L, +b4 = 6.042447899703295436820744186992189445813E1L, +/* b5 = 1.000000000000000000000000000000000000000E0 */ + + +tc = 1.4616321449683623412626595423257213284682E0L, +tf = -1.2148629053584961146050602565082954242826E-1, /* double precision */ +/* tt = (tail of tf), i.e. tf + tt has extended precision. */ +tt = 3.3649914684731379602768989080467587736363E-18L, +/* lgam ( 1.4616321449683623412626595423257213284682E0 ) = +-1.2148629053584960809551455717769158215135617312999903886372437313313530E-1 */ + +/* lgam (x + tc) = tf + tt + x g(x)/h(x) + -0.230003726999612341262659542325721328468 <= x + <= 0.2699962730003876587373404576742786715318 + peak relative error 2.1e-21 */ +g0 = 3.645529916721223331888305293534095553827E-18L, +g1 = 5.126654642791082497002594216163574795690E3L, +g2 = 8.828603575854624811911631336122070070327E3L, +g3 = 5.464186426932117031234820886525701595203E3L, +g4 = 1.455427403530884193180776558102868592293E3L, +g5 = 1.541735456969245924860307497029155838446E2L, +g6 = 4.335498275274822298341872707453445815118E0L, + +h0 = 1.059584930106085509696730443974495979641E4L, +h1 = 2.147921653490043010629481226937850618860E4L, +h2 = 1.643014770044524804175197151958100656728E4L, +h3 = 5.869021995186925517228323497501767586078E3L, +h4 = 9.764244777714344488787381271643502742293E2L, +h5 = 6.442485441570592541741092969581997002349E1L, +/* h6 = 1.000000000000000000000000000000000000000E0 */ + + +/* lgam (x+1) = -0.5 x + x u(x)/v(x) + -0.100006103515625 <= x <= 0.231639862060546875 + peak relative error 1.3e-21 */ +u0 = -8.886217500092090678492242071879342025627E1L, +u1 = 6.840109978129177639438792958320783599310E2L, +u2 = 2.042626104514127267855588786511809932433E3L, +u3 = 1.911723903442667422201651063009856064275E3L, +u4 = 7.447065275665887457628865263491667767695E2L, +u5 = 1.132256494121790736268471016493103952637E2L, +u6 = 4.484398885516614191003094714505960972894E0L, + +v0 = 1.150830924194461522996462401210374632929E3L, +v1 = 3.399692260848747447377972081399737098610E3L, +v2 = 3.786631705644460255229513563657226008015E3L, +v3 = 1.966450123004478374557778781564114347876E3L, +v4 = 4.741359068914069299837355438370682773122E2L, +v5 = 4.508989649747184050907206782117647852364E1L, +/* v6 = 1.000000000000000000000000000000000000000E0 */ + + +/* lgam (x+2) = .5 x + x s(x)/r(x) + 0 <= x <= 1 + peak relative error 7.2e-22 */ +s0 = 1.454726263410661942989109455292824853344E6L, +s1 = -3.901428390086348447890408306153378922752E6L, +s2 = -6.573568698209374121847873064292963089438E6L, +s3 = -3.319055881485044417245964508099095984643E6L, +s4 = -7.094891568758439227560184618114707107977E5L, +s5 = -6.263426646464505837422314539808112478303E4L, +s6 = -1.684926520999477529949915657519454051529E3L, + +r0 = -1.883978160734303518163008696712983134698E7L, +r1 = -2.815206082812062064902202753264922306830E7L, +r2 = -1.600245495251915899081846093343626358398E7L, +r3 = -4.310526301881305003489257052083370058799E6L, +r4 = -5.563807682263923279438235987186184968542E5L, +r5 = -3.027734654434169996032905158145259713083E4L, +r6 = -4.501995652861105629217250715790764371267E2L, +/* r6 = 1.000000000000000000000000000000000000000E0 */ + + +/* lgam(x) = ( x - 0.5 ) * log(x) - x + LS2PI + 1/x w(1/x^2) + x >= 8 + Peak relative error 1.51e-21 +w0 = LS2PI - 0.5 */ +w0 = 4.189385332046727417803e-1L, +w1 = 8.333333333333331447505E-2L, +w2 = -2.777777777750349603440E-3L, +w3 = 7.936507795855070755671E-4L, +w4 = -5.952345851765688514613E-4L, +w5 = 8.412723297322498080632E-4L, +w6 = -1.880801938119376907179E-3L, +w7 = 4.885026142432270781165E-3L; + +/* sin(pi*x) assuming x > 2^-1000, if sin(pi*x)==0 the sign is arbitrary */ +static long double sin_pi(long double x) +{ + int n; + + /* spurious inexact if odd int */ + x *= 0.5; + x = 2.0*(x - floorl(x)); /* x mod 2.0 */ + + n = (int)(x*4.0); + n = (n+1)/2; + x -= n*0.5f; + x *= pi; + + switch (n) { + default: /* case 4: */ + case 0: return __sinl(x, 0.0, 0); + case 1: return __cosl(x, 0.0); + case 2: return __sinl(-x, 0.0, 0); + case 3: return -__cosl(x, 0.0); + } +} + +long double __lgammal_r(long double x, int *sg) { + long double t, y, z, nadj, p, p1, p2, q, r, w; + union ldshape u = {x}; + uint32_t ix = (u.i.se & 0x7fffU)<<16 | u.i.m>>48; + int sign = u.i.se >> 15; + int i; + + *sg = 1; + + /* purge off +-inf, NaN, +-0, tiny and negative arguments */ + if (ix >= 0x7fff0000) + return x * x; + if (ix < 0x3fc08000) { /* |x|<2**-63, return -log(|x|) */ + if (sign) { + *sg = -1; + x = -x; + } + return -logl(x); + } + if (sign) { + x = -x; + t = sin_pi(x); + if (t == 0.0) + return 1.0 / (x-x); /* -integer */ + if (t > 0.0) + *sg = -1; + else + t = -t; + nadj = logl(pi / (t * x)); + } + + /* purge off 1 and 2 (so the sign is ok with downward rounding) */ + if ((ix == 0x3fff8000 || ix == 0x40008000) && u.i.m == 0) { + r = 0; + } else if (ix < 0x40008000) { /* x < 2.0 */ + if (ix <= 0x3ffee666) { /* 8.99993896484375e-1 */ + /* lgamma(x) = lgamma(x+1) - log(x) */ + r = -logl(x); + if (ix >= 0x3ffebb4a) { /* 7.31597900390625e-1 */ + y = x - 1.0; + i = 0; + } else if (ix >= 0x3ffced33) { /* 2.31639862060546875e-1 */ + y = x - (tc - 1.0); + i = 1; + } else { /* x < 0.23 */ + y = x; + i = 2; + } + } else { + r = 0.0; + if (ix >= 0x3fffdda6) { /* 1.73162841796875 */ + /* [1.7316,2] */ + y = x - 2.0; + i = 0; + } else if (ix >= 0x3fff9da6) { /* 1.23162841796875 */ + /* [1.23,1.73] */ + y = x - tc; + i = 1; + } else { + /* [0.9, 1.23] */ + y = x - 1.0; + i = 2; + } + } + switch (i) { + case 0: + p1 = a0 + y * (a1 + y * (a2 + y * (a3 + y * (a4 + y * a5)))); + p2 = b0 + y * (b1 + y * (b2 + y * (b3 + y * (b4 + y)))); + r += 0.5 * y + y * p1/p2; + break; + case 1: + p1 = g0 + y * (g1 + y * (g2 + y * (g3 + y * (g4 + y * (g5 + y * g6))))); + p2 = h0 + y * (h1 + y * (h2 + y * (h3 + y * (h4 + y * (h5 + y))))); + p = tt + y * p1/p2; + r += (tf + p); + break; + case 2: + p1 = y * (u0 + y * (u1 + y * (u2 + y * (u3 + y * (u4 + y * (u5 + y * u6)))))); + p2 = v0 + y * (v1 + y * (v2 + y * (v3 + y * (v4 + y * (v5 + y))))); + r += (-0.5 * y + p1 / p2); + } + } else if (ix < 0x40028000) { /* 8.0 */ + /* x < 8.0 */ + i = (int)x; + y = x - (double)i; + p = y * (s0 + y * (s1 + y * (s2 + y * (s3 + y * (s4 + y * (s5 + y * s6)))))); + q = r0 + y * (r1 + y * (r2 + y * (r3 + y * (r4 + y * (r5 + y * (r6 + y)))))); + r = 0.5 * y + p / q; + z = 1.0; + /* lgamma(1+s) = log(s) + lgamma(s) */ + switch (i) { + case 7: + z *= (y + 6.0); /* FALLTHRU */ + case 6: + z *= (y + 5.0); /* FALLTHRU */ + case 5: + z *= (y + 4.0); /* FALLTHRU */ + case 4: + z *= (y + 3.0); /* FALLTHRU */ + case 3: + z *= (y + 2.0); /* FALLTHRU */ + r += logl(z); + break; + } + } else if (ix < 0x40418000) { /* 2^66 */ + /* 8.0 <= x < 2**66 */ + t = logl(x); + z = 1.0 / x; + y = z * z; + w = w0 + z * (w1 + y * (w2 + y * (w3 + y * (w4 + y * (w5 + y * (w6 + y * w7)))))); + r = (x - 0.5) * (t - 1.0) + w; + } else /* 2**66 <= x <= inf */ + r = x * (logl(x) - 1.0); + if (sign) + r = nadj - r; + return r; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +double __lgamma_r(double x, int *sg); + +long double __lgammal_r(long double x, int *sg) +{ + return __lgamma_r(x, sg); +} +#endif + +extern int __signgam; + +long double lgammal(long double x) +{ + return __lgammal_r(x, &__signgam); +} + +weak_alias(__lgammal_r, lgammal_r); diff --git a/lib/mlibc/options/ansi/musl-generic-math/libm.h b/lib/mlibc/options/ansi/musl-generic-math/libm.h new file mode 100644 index 0000000..8120292 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/libm.h @@ -0,0 +1,186 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/math_private.h */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#ifndef _LIBM_H +#define _LIBM_H + +#include <stdint.h> +#include <float.h> +#include <math.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 && __BYTE_ORDER == __LITTLE_ENDIAN +union ldshape { + long double f; + struct { + uint64_t m; + uint16_t se; + } i; +}; +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 && __BYTE_ORDER == __LITTLE_ENDIAN +union ldshape { + long double f; + struct { + uint64_t lo; + uint32_t mid; + uint16_t top; + uint16_t se; + } i; + struct { + uint64_t lo; + uint64_t hi; + } i2; +}; +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 && __BYTE_ORDER == __BIG_ENDIAN +union ldshape { + long double f; + struct { + uint16_t se; + uint16_t top; + uint32_t mid; + uint64_t lo; + } i; + struct { + uint64_t hi; + uint64_t lo; + } i2; +}; +#else +#error Unsupported long double representation +#endif + +#define FORCE_EVAL(x) do { \ + if (sizeof(x) == sizeof(float)) { \ + volatile float __x; \ + __x = (x); \ + } else if (sizeof(x) == sizeof(double)) { \ + volatile double __x; \ + __x = (x); \ + } else { \ + volatile long double __x; \ + __x = (x); \ + } \ +} while(0) + +/* Get two 32 bit ints from a double. */ +#define EXTRACT_WORDS(hi,lo,d) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + (hi) = __u.i >> 32; \ + (lo) = (uint32_t)__u.i; \ +} while (0) + +/* Get the more significant 32 bit int from a double. */ +#define GET_HIGH_WORD(hi,d) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + (hi) = __u.i >> 32; \ +} while (0) + +/* Get the less significant 32 bit int from a double. */ +#define GET_LOW_WORD(lo,d) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + (lo) = (uint32_t)__u.i; \ +} while (0) + +/* Set a double from two 32 bit ints. */ +#define INSERT_WORDS(d,hi,lo) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.i = ((uint64_t)(hi)<<32) | (uint32_t)(lo); \ + (d) = __u.f; \ +} while (0) + +/* Set the more significant 32 bits of a double from an int. */ +#define SET_HIGH_WORD(d,hi) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + __u.i &= 0xffffffff; \ + __u.i |= (uint64_t)(hi) << 32; \ + (d) = __u.f; \ +} while (0) + +/* Set the less significant 32 bits of a double from an int. */ +#define SET_LOW_WORD(d,lo) \ +do { \ + union {double f; uint64_t i;} __u; \ + __u.f = (d); \ + __u.i &= 0xffffffff00000000ull; \ + __u.i |= (uint32_t)(lo); \ + (d) = __u.f; \ +} while (0) + +/* Get a 32 bit int from a float. */ +#define GET_FLOAT_WORD(w,d) \ +do { \ + union {float f; uint32_t i;} __u; \ + __u.f = (d); \ + (w) = __u.i; \ +} while (0) + +/* Set a float from a 32 bit int. */ +#define SET_FLOAT_WORD(d,w) \ +do { \ + union {float f; uint32_t i;} __u; \ + __u.i = (w); \ + (d) = __u.f; \ +} while (0) + +#undef __CMPLX +#undef CMPLX +#undef CMPLXF +#undef CMPLXL + +#define __CMPLX(x, y, t) \ + ((union { _Complex t __z; t __xy[2]; }){.__xy = {(x),(y)}}.__z) + +#define CMPLX(x, y) __CMPLX(x, y, double) +#define CMPLXF(x, y) __CMPLX(x, y, float) +#define CMPLXL(x, y) __CMPLX(x, y, long double) + +#ifndef __MLIBC_ABI_ONLY + +/* fdlibm kernel functions */ + +int __rem_pio2_large(double*,double*,int,int,int); + +int __rem_pio2(double,double*); +double __sin(double,double,int); +double __cos(double,double); +double __tan(double,double,int); +double __expo2(double); +//double complex __ldexp_cexp(double complex,int); + +int __rem_pio2f(float,double*); +float __sindf(double); +float __cosdf(double); +float __tandf(double,int); +float __expo2f(float); +//float complex __ldexp_cexpf(float complex,int); + +int __rem_pio2l(long double, long double *); +long double __sinl(long double, long double, int); +long double __cosl(long double, long double); +long double __tanl(long double, long double, int); + +/* polynomial evaluation */ +long double __polevll(long double, const long double *, int); +long double __p1evll(long double, const long double *, int); + +#endif /* !__MLIBC_ABI_ONLY */ + +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/llrint.c b/lib/mlibc/options/ansi/musl-generic-math/llrint.c new file mode 100644 index 0000000..4f583ae --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/llrint.c @@ -0,0 +1,8 @@ +#include <math.h> + +/* uses LLONG_MAX > 2^53, see comments in lrint.c */ + +long long llrint(double x) +{ + return rint(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/llrintf.c b/lib/mlibc/options/ansi/musl-generic-math/llrintf.c new file mode 100644 index 0000000..96949a0 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/llrintf.c @@ -0,0 +1,8 @@ +#include <math.h> + +/* uses LLONG_MAX > 2^24, see comments in lrint.c */ + +long long llrintf(float x) +{ + return rintf(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/llrintl.c b/lib/mlibc/options/ansi/musl-generic-math/llrintl.c new file mode 100644 index 0000000..3449f6f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/llrintl.c @@ -0,0 +1,36 @@ +#include <limits.h> +#include <fenv.h> +#include "libm.h" + + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long long llrintl(long double x) +{ + return llrint(x); +} +#elif defined(FE_INEXACT) +/* +see comments in lrint.c + +Note that if LLONG_MAX == 0x7fffffffffffffff && LDBL_MANT_DIG == 64 +then x == 2**63 - 0.5 is the only input that overflows and +raises inexact (with tonearest or upward rounding mode) +*/ +long long llrintl(long double x) +{ + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); + x = rintl(x); + if (!e && (x > LLONG_MAX || x < LLONG_MIN)) + feclearexcept(FE_INEXACT); + /* conversion */ + return x; +} +#else +long long llrintl(long double x) +{ + return rintl(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/llround.c b/lib/mlibc/options/ansi/musl-generic-math/llround.c new file mode 100644 index 0000000..4d94787 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/llround.c @@ -0,0 +1,6 @@ +#include <math.h> + +long long llround(double x) +{ + return round(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/llroundf.c b/lib/mlibc/options/ansi/musl-generic-math/llroundf.c new file mode 100644 index 0000000..19eb77e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/llroundf.c @@ -0,0 +1,6 @@ +#include <math.h> + +long long llroundf(float x) +{ + return roundf(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/llroundl.c b/lib/mlibc/options/ansi/musl-generic-math/llroundl.c new file mode 100644 index 0000000..2c2ee5e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/llroundl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long long llroundl(long double x) +{ + return roundl(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log.c b/lib/mlibc/options/ansi/musl-generic-math/log.c new file mode 100644 index 0000000..e61e113 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log.c @@ -0,0 +1,118 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* log(x) + * Return the logarithm of x + * + * Method : + * 1. Argument Reduction: find k and f such that + * x = 2^k * (1+f), + * where sqrt(2)/2 < 1+f < sqrt(2) . + * + * 2. Approximation of log(1+f). + * Let s = f/(2+f) ; based on log(1+f) = log(1+s) - log(1-s) + * = 2s + 2/3 s**3 + 2/5 s**5 + ....., + * = 2s + s*R + * We use a special Remez algorithm on [0,0.1716] to generate + * a polynomial of degree 14 to approximate R The maximum error + * of this polynomial approximation is bounded by 2**-58.45. In + * other words, + * 2 4 6 8 10 12 14 + * R(z) ~ Lg1*s +Lg2*s +Lg3*s +Lg4*s +Lg5*s +Lg6*s +Lg7*s + * (the values of Lg1 to Lg7 are listed in the program) + * and + * | 2 14 | -58.45 + * | Lg1*s +...+Lg7*s - R(z) | <= 2 + * | | + * Note that 2s = f - s*f = f - hfsq + s*hfsq, where hfsq = f*f/2. + * In order to guarantee error in log below 1ulp, we compute log + * by + * log(1+f) = f - s*(f - R) (if f is not too large) + * log(1+f) = f - (hfsq - s*(hfsq+R)). (better accuracy) + * + * 3. Finally, log(x) = k*ln2 + log(1+f). + * = k*ln2_hi+(f-(hfsq-(s*(hfsq+R)+k*ln2_lo))) + * Here ln2 is split into two floating point number: + * ln2_hi + ln2_lo, + * where n*ln2_hi is always exact for |n| < 2000. + * + * Special cases: + * log(x) is NaN with signal if x < 0 (including -INF) ; + * log(+INF) is +INF; log(0) is -INF with signal; + * log(NaN) is that NaN with no signal. + * + * Accuracy: + * according to an error analysis, the error is always less than + * 1 ulp (unit in the last place). + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include <math.h> +#include <stdint.h> + +static const double +ln2_hi = 6.93147180369123816490e-01, /* 3fe62e42 fee00000 */ +ln2_lo = 1.90821492927058770002e-10, /* 3dea39ef 35793c76 */ +Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ +Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ +Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ +Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ +Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ +Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ +Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + +double log(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t hfsq,f,s,z,R,w,t1,t2,dk; + uint32_t hx; + int k; + + hx = u.i>>32; + k = 0; + if (hx < 0x00100000 || hx>>31) { + if (u.i<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (hx>>31) + return (x-x)/0.0; /* log(-#) = NaN */ + /* subnormal number, scale x up */ + k -= 54; + x *= 0x1p54; + u.f = x; + hx = u.i>>32; + } else if (hx >= 0x7ff00000) { + return x; + } else if (hx == 0x3ff00000 && u.i<<32 == 0) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + hx += 0x3ff00000 - 0x3fe6a09e; + k += (int)(hx>>20) - 0x3ff; + hx = (hx&0x000fffff) + 0x3fe6a09e; + u.i = (uint64_t)hx<<32 | (u.i&0xffffffff); + x = u.f; + + f = x - 1.0; + hfsq = 0.5*f*f; + s = f/(2.0+f); + z = s*s; + w = z*z; + t1 = w*(Lg2+w*(Lg4+w*Lg6)); + t2 = z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + R = t2 + t1; + dk = k; + return s*(hfsq+R) + dk*ln2_lo - hfsq + f + dk*ln2_hi; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log10.c b/lib/mlibc/options/ansi/musl-generic-math/log10.c new file mode 100644 index 0000000..8102687 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log10.c @@ -0,0 +1,101 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log10.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * Return the base 10 logarithm of x. See log.c for most comments. + * + * Reduce x to 2^k (1+f) and calculate r = log(1+f) - f + f*f/2 + * as in log.c, then combine and scale in extra precision: + * log10(x) = (f - f*f/2 + r)/log(10) + k*log10(2) + */ + +#include <math.h> +#include <stdint.h> + +static const double +ivln10hi = 4.34294481878168880939e-01, /* 0x3fdbcb7b, 0x15200000 */ +ivln10lo = 2.50829467116452752298e-11, /* 0x3dbb9438, 0xca9aadd5 */ +log10_2hi = 3.01029995663611771306e-01, /* 0x3FD34413, 0x509F6000 */ +log10_2lo = 3.69423907715893078616e-13, /* 0x3D59FEF3, 0x11F12B36 */ +Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ +Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ +Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ +Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ +Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ +Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ +Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + +double log10(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t hfsq,f,s,z,R,w,t1,t2,dk,y,hi,lo,val_hi,val_lo; + uint32_t hx; + int k; + + hx = u.i>>32; + k = 0; + if (hx < 0x00100000 || hx>>31) { + if (u.i<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (hx>>31) + return (x-x)/0.0; /* log(-#) = NaN */ + /* subnormal number, scale x up */ + k -= 54; + x *= 0x1p54; + u.f = x; + hx = u.i>>32; + } else if (hx >= 0x7ff00000) { + return x; + } else if (hx == 0x3ff00000 && u.i<<32 == 0) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + hx += 0x3ff00000 - 0x3fe6a09e; + k += (int)(hx>>20) - 0x3ff; + hx = (hx&0x000fffff) + 0x3fe6a09e; + u.i = (uint64_t)hx<<32 | (u.i&0xffffffff); + x = u.f; + + f = x - 1.0; + hfsq = 0.5*f*f; + s = f/(2.0+f); + z = s*s; + w = z*z; + t1 = w*(Lg2+w*(Lg4+w*Lg6)); + t2 = z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + R = t2 + t1; + + /* See log2.c for details. */ + /* hi+lo = f - hfsq + s*(hfsq+R) ~ log(1+f) */ + hi = f - hfsq; + u.f = hi; + u.i &= (uint64_t)-1<<32; + hi = u.f; + lo = f - hi - hfsq + s*(hfsq+R); + + /* val_hi+val_lo ~ log10(1+f) + k*log10(2) */ + val_hi = hi*ivln10hi; + dk = k; + y = dk*log10_2hi; + val_lo = dk*log10_2lo + (lo+hi)*ivln10lo + lo*ivln10hi; + + /* + * Extra precision in for adding y is not strictly needed + * since there is no very large cancellation near x = sqrt(2) or + * x = 1/sqrt(2), but we do it anyway since it costs little on CPUs + * with some parallelism and it reduces the error for many args. + */ + w = y + val_hi; + val_lo += (y - w) + val_hi; + val_hi = w; + + return val_lo + val_hi; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log10f.c b/lib/mlibc/options/ansi/musl-generic-math/log10f.c new file mode 100644 index 0000000..9ca2f01 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log10f.c @@ -0,0 +1,77 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log10f.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in log10.c. + */ + +#include <math.h> +#include <stdint.h> + +static const float +ivln10hi = 4.3432617188e-01, /* 0x3ede6000 */ +ivln10lo = -3.1689971365e-05, /* 0xb804ead9 */ +log10_2hi = 3.0102920532e-01, /* 0x3e9a2080 */ +log10_2lo = 7.9034151668e-07, /* 0x355427db */ +/* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ +Lg1 = 0xaaaaaa.0p-24, /* 0.66666662693 */ +Lg2 = 0xccce13.0p-25, /* 0.40000972152 */ +Lg3 = 0x91e9ee.0p-25, /* 0.28498786688 */ +Lg4 = 0xf89e26.0p-26; /* 0.24279078841 */ + +float log10f(float x) +{ + union {float f; uint32_t i;} u = {x}; + float_t hfsq,f,s,z,R,w,t1,t2,dk,hi,lo; + uint32_t ix; + int k; + + ix = u.i; + k = 0; + if (ix < 0x00800000 || ix>>31) { /* x < 2**-126 */ + if (ix<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (ix>>31) + return (x-x)/0.0f; /* log(-#) = NaN */ + /* subnormal number, scale up x */ + k -= 25; + x *= 0x1p25f; + u.f = x; + ix = u.i; + } else if (ix >= 0x7f800000) { + return x; + } else if (ix == 0x3f800000) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + ix += 0x3f800000 - 0x3f3504f3; + k += (int)(ix>>23) - 0x7f; + ix = (ix&0x007fffff) + 0x3f3504f3; + u.i = ix; + x = u.f; + + f = x - 1.0f; + s = f/(2.0f + f); + z = s*s; + w = z*z; + t1= w*(Lg2+w*Lg4); + t2= z*(Lg1+w*Lg3); + R = t2 + t1; + hfsq = 0.5f*f*f; + + hi = f - hfsq; + u.f = hi; + u.i &= 0xfffff000; + hi = u.f; + lo = f - hi - hfsq + s*(hfsq+R); + dk = k; + return dk*log10_2lo + (lo+hi)*ivln10lo + lo*ivln10hi + hi*ivln10hi + dk*log10_2hi; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log10l.c b/lib/mlibc/options/ansi/musl-generic-math/log10l.c new file mode 100644 index 0000000..63dcc28 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log10l.c @@ -0,0 +1,191 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_log10l.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Common logarithm, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, log10l(); + * + * y = log10l( x ); + * + * + * DESCRIPTION: + * + * Returns the base 10 logarithm of x. + * + * The argument is separated into its exponent and fractional + * parts. If the exponent is between -1 and +1, the logarithm + * of the fraction is approximated by + * + * log(1+x) = x - 0.5 x**2 + x**3 P(x)/Q(x). + * + * Otherwise, setting z = 2(x-1)/x+1), + * + * log(x) = z + z**3 P(z)/Q(z). + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE 0.5, 2.0 30000 9.0e-20 2.6e-20 + * IEEE exp(+-10000) 30000 6.0e-20 2.3e-20 + * + * In the tests over the interval exp(+-10000), the logarithms + * of the random arguments were uniformly distributed over + * [-10000, +10000]. + * + * ERROR MESSAGES: + * + * log singularity: x = 0; returns MINLOG + * log domain: x < 0; returns MINLOG + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double log10l(long double x) +{ + return log10(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* Coefficients for log(1+x) = x - x**2/2 + x**3 P(x)/Q(x) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.2e-22 + */ +static const long double P[] = { + 4.9962495940332550844739E-1L, + 1.0767376367209449010438E1L, + 7.7671073698359539859595E1L, + 2.5620629828144409632571E2L, + 4.2401812743503691187826E2L, + 3.4258224542413922935104E2L, + 1.0747524399916215149070E2L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0,*/ + 2.3479774160285863271658E1L, + 1.9444210022760132894510E2L, + 7.7952888181207260646090E2L, + 1.6911722418503949084863E3L, + 2.0307734695595183428202E3L, + 1.2695660352705325274404E3L, + 3.2242573199748645407652E2L, +}; + +/* Coefficients for log(x) = z + z^3 P(z^2)/Q(z^2), + * where z = 2(x-1)/(x+1) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.16e-22 + */ +static const long double R[4] = { + 1.9757429581415468984296E-3L, +-7.1990767473014147232598E-1L, + 1.0777257190312272158094E1L, +-3.5717684488096787370998E1L, +}; +static const long double S[4] = { +/* 1.00000000000000000000E0L,*/ +-2.6201045551331104417768E1L, + 1.9361891836232102174846E2L, +-4.2861221385716144629696E2L, +}; +/* log10(2) */ +#define L102A 0.3125L +#define L102B -1.1470004336018804786261e-2L +/* log10(e) */ +#define L10EA 0.5L +#define L10EB -6.5705518096748172348871e-2L + +#define SQRTH 0.70710678118654752440L + +long double log10l(long double x) +{ + long double y, z; + int e; + + if (isnan(x)) + return x; + if(x <= 0.0) { + if(x == 0.0) + return -1.0 / (x*x); + return (x - x) / 0.0; + } + if (x == INFINITY) + return INFINITY; + /* separate mantissa from exponent */ + /* Note, frexp is used so that denormal numbers + * will be handled properly. + */ + x = frexpl(x, &e); + + /* logarithm using log(x) = z + z**3 P(z)/Q(z), + * where z = 2(x-1)/x+1) + */ + if (e > 2 || e < -2) { + if (x < SQRTH) { /* 2(2x-1)/(2x+1) */ + e -= 1; + z = x - 0.5; + y = 0.5 * z + 0.5; + } else { /* 2 (x-1)/(x+1) */ + z = x - 0.5; + z -= 0.5; + y = 0.5 * x + 0.5; + } + x = z / y; + z = x*x; + y = x * (z * __polevll(z, R, 3) / __p1evll(z, S, 3)); + goto done; + } + + /* logarithm using log(1+x) = x - .5x**2 + x**3 P(x)/Q(x) */ + if (x < SQRTH) { + e -= 1; + x = 2.0*x - 1.0; + } else { + x = x - 1.0; + } + z = x*x; + y = x * (z * __polevll(x, P, 6) / __p1evll(x, Q, 7)); + y = y - 0.5*z; + +done: + /* Multiply log of fraction by log10(e) + * and base 2 exponent by log10(2). + * + * ***CAUTION*** + * + * This sequence of operations is critical and it may + * be horribly defeated by some compiler optimizers. + */ + z = y * (L10EB); + z += x * (L10EB); + z += e * (L102B); + z += y * (L10EA); + z += x * (L10EA); + z += e * (L102A); + return z; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double log10l(long double x) +{ + return log10(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/log1p.c b/lib/mlibc/options/ansi/musl-generic-math/log1p.c new file mode 100644 index 0000000..0097134 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log1p.c @@ -0,0 +1,122 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_log1p.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* double log1p(double x) + * Return the natural logarithm of 1+x. + * + * Method : + * 1. Argument Reduction: find k and f such that + * 1+x = 2^k * (1+f), + * where sqrt(2)/2 < 1+f < sqrt(2) . + * + * Note. If k=0, then f=x is exact. However, if k!=0, then f + * may not be representable exactly. In that case, a correction + * term is need. Let u=1+x rounded. Let c = (1+x)-u, then + * log(1+x) - log(u) ~ c/u. Thus, we proceed to compute log(u), + * and add back the correction term c/u. + * (Note: when x > 2**53, one can simply return log(x)) + * + * 2. Approximation of log(1+f): See log.c + * + * 3. Finally, log1p(x) = k*ln2 + log(1+f) + c/u. See log.c + * + * Special cases: + * log1p(x) is NaN with signal if x < -1 (including -INF) ; + * log1p(+INF) is +INF; log1p(-1) is -INF with signal; + * log1p(NaN) is that NaN with no signal. + * + * Accuracy: + * according to an error analysis, the error is always less than + * 1 ulp (unit in the last place). + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + * + * Note: Assuming log() return accurate answer, the following + * algorithm can be used to compute log1p(x) to within a few ULP: + * + * u = 1+x; + * if(u==1.0) return x ; else + * return log(u)*(x/(u-1.0)); + * + * See HP-15C Advanced Functions Handbook, p.193. + */ + +#include "libm.h" + +static const double +ln2_hi = 6.93147180369123816490e-01, /* 3fe62e42 fee00000 */ +ln2_lo = 1.90821492927058770002e-10, /* 3dea39ef 35793c76 */ +Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ +Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ +Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ +Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ +Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ +Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ +Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + +double log1p(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t hfsq,f,c,s,z,R,w,t1,t2,dk; + uint32_t hx,hu; + int k; + + hx = u.i>>32; + k = 1; + if (hx < 0x3fda827a || hx>>31) { /* 1+x < sqrt(2)+ */ + if (hx >= 0xbff00000) { /* x <= -1.0 */ + if (x == -1) + return x/0.0; /* log1p(-1) = -inf */ + return (x-x)/0.0; /* log1p(x<-1) = NaN */ + } + if (hx<<1 < 0x3ca00000<<1) { /* |x| < 2**-53 */ + /* underflow if subnormal */ + if ((hx&0x7ff00000) == 0) + FORCE_EVAL((float)x); + return x; + } + if (hx <= 0xbfd2bec4) { /* sqrt(2)/2- <= 1+x < sqrt(2)+ */ + k = 0; + c = 0; + f = x; + } + } else if (hx >= 0x7ff00000) + return x; + if (k) { + u.f = 1 + x; + hu = u.i>>32; + hu += 0x3ff00000 - 0x3fe6a09e; + k = (int)(hu>>20) - 0x3ff; + /* correction term ~ log(1+x)-log(u), avoid underflow in c/u */ + if (k < 54) { + c = k >= 2 ? 1-(u.f-x) : x-(u.f-1); + c /= u.f; + } else + c = 0; + /* reduce u into [sqrt(2)/2, sqrt(2)] */ + hu = (hu&0x000fffff) + 0x3fe6a09e; + u.i = (uint64_t)hu<<32 | (u.i&0xffffffff); + f = u.f - 1; + } + hfsq = 0.5*f*f; + s = f/(2.0+f); + z = s*s; + w = z*z; + t1 = w*(Lg2+w*(Lg4+w*Lg6)); + t2 = z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + R = t2 + t1; + dk = k; + return s*(hfsq+R) + (dk*ln2_lo+c) - hfsq + f + dk*ln2_hi; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log1pf.c b/lib/mlibc/options/ansi/musl-generic-math/log1pf.c new file mode 100644 index 0000000..23985c3 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log1pf.c @@ -0,0 +1,77 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_log1pf.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +ln2_hi = 6.9313812256e-01, /* 0x3f317180 */ +ln2_lo = 9.0580006145e-06, /* 0x3717f7d1 */ +/* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ +Lg1 = 0xaaaaaa.0p-24, /* 0.66666662693 */ +Lg2 = 0xccce13.0p-25, /* 0.40000972152 */ +Lg3 = 0x91e9ee.0p-25, /* 0.28498786688 */ +Lg4 = 0xf89e26.0p-26; /* 0.24279078841 */ + +float log1pf(float x) +{ + union {float f; uint32_t i;} u = {x}; + float_t hfsq,f,c,s,z,R,w,t1,t2,dk; + uint32_t ix,iu; + int k; + + ix = u.i; + k = 1; + if (ix < 0x3ed413d0 || ix>>31) { /* 1+x < sqrt(2)+ */ + if (ix >= 0xbf800000) { /* x <= -1.0 */ + if (x == -1) + return x/0.0f; /* log1p(-1)=+inf */ + return (x-x)/0.0f; /* log1p(x<-1)=NaN */ + } + if (ix<<1 < 0x33800000<<1) { /* |x| < 2**-24 */ + /* underflow if subnormal */ + if ((ix&0x7f800000) == 0) + FORCE_EVAL(x*x); + return x; + } + if (ix <= 0xbe95f619) { /* sqrt(2)/2- <= 1+x < sqrt(2)+ */ + k = 0; + c = 0; + f = x; + } + } else if (ix >= 0x7f800000) + return x; + if (k) { + u.f = 1 + x; + iu = u.i; + iu += 0x3f800000 - 0x3f3504f3; + k = (int)(iu>>23) - 0x7f; + /* correction term ~ log(1+x)-log(u), avoid underflow in c/u */ + if (k < 25) { + c = k >= 2 ? 1-(u.f-x) : x-(u.f-1); + c /= u.f; + } else + c = 0; + /* reduce u into [sqrt(2)/2, sqrt(2)] */ + iu = (iu&0x007fffff) + 0x3f3504f3; + u.i = iu; + f = u.f - 1; + } + s = f/(2.0f + f); + z = s*s; + w = z*z; + t1= w*(Lg2+w*Lg4); + t2= z*(Lg1+w*Lg3); + R = t2 + t1; + hfsq = 0.5f*f*f; + dk = k; + return s*(hfsq+R) + (dk*ln2_lo+c) - hfsq + f + dk*ln2_hi; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log1pl.c b/lib/mlibc/options/ansi/musl-generic-math/log1pl.c new file mode 100644 index 0000000..141b5f0 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log1pl.c @@ -0,0 +1,177 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/s_log1pl.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Relative error logarithm + * Natural logarithm of 1+x, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, log1pl(); + * + * y = log1pl( x ); + * + * + * DESCRIPTION: + * + * Returns the base e (2.718...) logarithm of 1+x. + * + * The argument 1+x is separated into its exponent and fractional + * parts. If the exponent is between -1 and +1, the logarithm + * of the fraction is approximated by + * + * log(1+x) = x - 0.5 x^2 + x^3 P(x)/Q(x). + * + * Otherwise, setting z = 2(x-1)/x+1), + * + * log(x) = z + z^3 P(z)/Q(z). + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE -1.0, 9.0 100000 8.2e-20 2.5e-20 + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double log1pl(long double x) +{ + return log1p(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* Coefficients for log(1+x) = x - x^2 / 2 + x^3 P(x)/Q(x) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 2.32e-20 + */ +static const long double P[] = { + 4.5270000862445199635215E-5L, + 4.9854102823193375972212E-1L, + 6.5787325942061044846969E0L, + 2.9911919328553073277375E1L, + 6.0949667980987787057556E1L, + 5.7112963590585538103336E1L, + 2.0039553499201281259648E1L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0,*/ + 1.5062909083469192043167E1L, + 8.3047565967967209469434E1L, + 2.2176239823732856465394E2L, + 3.0909872225312059774938E2L, + 2.1642788614495947685003E2L, + 6.0118660497603843919306E1L, +}; + +/* Coefficients for log(x) = z + z^3 P(z^2)/Q(z^2), + * where z = 2(x-1)/(x+1) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.16e-22 + */ +static const long double R[4] = { + 1.9757429581415468984296E-3L, +-7.1990767473014147232598E-1L, + 1.0777257190312272158094E1L, +-3.5717684488096787370998E1L, +}; +static const long double S[4] = { +/* 1.00000000000000000000E0L,*/ +-2.6201045551331104417768E1L, + 1.9361891836232102174846E2L, +-4.2861221385716144629696E2L, +}; +static const long double C1 = 6.9314575195312500000000E-1L; +static const long double C2 = 1.4286068203094172321215E-6L; + +#define SQRTH 0.70710678118654752440L + +long double log1pl(long double xm1) +{ + long double x, y, z; + int e; + + if (isnan(xm1)) + return xm1; + if (xm1 == INFINITY) + return xm1; + if (xm1 == 0.0) + return xm1; + + x = xm1 + 1.0; + + /* Test for domain errors. */ + if (x <= 0.0) { + if (x == 0.0) + return -1/(x*x); /* -inf with divbyzero */ + return 0/0.0f; /* nan with invalid */ + } + + /* Separate mantissa from exponent. + Use frexp so that denormal numbers will be handled properly. */ + x = frexpl(x, &e); + + /* logarithm using log(x) = z + z^3 P(z)/Q(z), + where z = 2(x-1)/x+1) */ + if (e > 2 || e < -2) { + if (x < SQRTH) { /* 2(2x-1)/(2x+1) */ + e -= 1; + z = x - 0.5; + y = 0.5 * z + 0.5; + } else { /* 2 (x-1)/(x+1) */ + z = x - 0.5; + z -= 0.5; + y = 0.5 * x + 0.5; + } + x = z / y; + z = x*x; + z = x * (z * __polevll(z, R, 3) / __p1evll(z, S, 3)); + z = z + e * C2; + z = z + x; + z = z + e * C1; + return z; + } + + /* logarithm using log(1+x) = x - .5x**2 + x**3 P(x)/Q(x) */ + if (x < SQRTH) { + e -= 1; + if (e != 0) + x = 2.0 * x - 1.0; + else + x = xm1; + } else { + if (e != 0) + x = x - 1.0; + else + x = xm1; + } + z = x*x; + y = x * (z * __polevll(x, P, 6) / __p1evll(x, Q, 6)); + y = y + e * C2; + z = y - 0.5 * z; + z = z + x; + z = z + e * C1; + return z; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double log1pl(long double x) +{ + return log1p(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/log2.c b/lib/mlibc/options/ansi/musl-generic-math/log2.c new file mode 100644 index 0000000..0aafad4 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log2.c @@ -0,0 +1,122 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log2.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * Return the base 2 logarithm of x. See log.c for most comments. + * + * Reduce x to 2^k (1+f) and calculate r = log(1+f) - f + f*f/2 + * as in log.c, then combine and scale in extra precision: + * log2(x) = (f - f*f/2 + r)/log(2) + k + */ + +#include <math.h> +#include <stdint.h> + +static const double +ivln2hi = 1.44269504072144627571e+00, /* 0x3ff71547, 0x65200000 */ +ivln2lo = 1.67517131648865118353e-10, /* 0x3de705fc, 0x2eefa200 */ +Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ +Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ +Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ +Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ +Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ +Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ +Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + +double log2(double x) +{ + union {double f; uint64_t i;} u = {x}; + double_t hfsq,f,s,z,R,w,t1,t2,y,hi,lo,val_hi,val_lo; + uint32_t hx; + int k; + + hx = u.i>>32; + k = 0; + if (hx < 0x00100000 || hx>>31) { + if (u.i<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (hx>>31) + return (x-x)/0.0; /* log(-#) = NaN */ + /* subnormal number, scale x up */ + k -= 54; + x *= 0x1p54; + u.f = x; + hx = u.i>>32; + } else if (hx >= 0x7ff00000) { + return x; + } else if (hx == 0x3ff00000 && u.i<<32 == 0) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + hx += 0x3ff00000 - 0x3fe6a09e; + k += (int)(hx>>20) - 0x3ff; + hx = (hx&0x000fffff) + 0x3fe6a09e; + u.i = (uint64_t)hx<<32 | (u.i&0xffffffff); + x = u.f; + + f = x - 1.0; + hfsq = 0.5*f*f; + s = f/(2.0+f); + z = s*s; + w = z*z; + t1 = w*(Lg2+w*(Lg4+w*Lg6)); + t2 = z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + R = t2 + t1; + + /* + * f-hfsq must (for args near 1) be evaluated in extra precision + * to avoid a large cancellation when x is near sqrt(2) or 1/sqrt(2). + * This is fairly efficient since f-hfsq only depends on f, so can + * be evaluated in parallel with R. Not combining hfsq with R also + * keeps R small (though not as small as a true `lo' term would be), + * so that extra precision is not needed for terms involving R. + * + * Compiler bugs involving extra precision used to break Dekker's + * theorem for spitting f-hfsq as hi+lo, unless double_t was used + * or the multi-precision calculations were avoided when double_t + * has extra precision. These problems are now automatically + * avoided as a side effect of the optimization of combining the + * Dekker splitting step with the clear-low-bits step. + * + * y must (for args near sqrt(2) and 1/sqrt(2)) be added in extra + * precision to avoid a very large cancellation when x is very near + * these values. Unlike the above cancellations, this problem is + * specific to base 2. It is strange that adding +-1 is so much + * harder than adding +-ln2 or +-log10_2. + * + * This uses Dekker's theorem to normalize y+val_hi, so the + * compiler bugs are back in some configurations, sigh. And I + * don't want to used double_t to avoid them, since that gives a + * pessimization and the support for avoiding the pessimization + * is not yet available. + * + * The multi-precision calculations for the multiplications are + * routine. + */ + + /* hi+lo = f - hfsq + s*(hfsq+R) ~ log(1+f) */ + hi = f - hfsq; + u.f = hi; + u.i &= (uint64_t)-1<<32; + hi = u.f; + lo = f - hi - hfsq + s*(hfsq+R); + + val_hi = hi*ivln2hi; + val_lo = (lo+hi)*ivln2lo + lo*ivln2hi; + + /* spadd(val_hi, val_lo, y), except for not using double_t: */ + y = k; + w = y + val_hi; + val_lo += (y - w) + val_hi; + val_hi = w; + + return val_lo + val_hi; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log2f.c b/lib/mlibc/options/ansi/musl-generic-math/log2f.c new file mode 100644 index 0000000..b3e305f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log2f.c @@ -0,0 +1,74 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_log2f.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * See comments in log2.c. + */ + +#include <math.h> +#include <stdint.h> + +static const float +ivln2hi = 1.4428710938e+00, /* 0x3fb8b000 */ +ivln2lo = -1.7605285393e-04, /* 0xb9389ad4 */ +/* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ +Lg1 = 0xaaaaaa.0p-24, /* 0.66666662693 */ +Lg2 = 0xccce13.0p-25, /* 0.40000972152 */ +Lg3 = 0x91e9ee.0p-25, /* 0.28498786688 */ +Lg4 = 0xf89e26.0p-26; /* 0.24279078841 */ + +float log2f(float x) +{ + union {float f; uint32_t i;} u = {x}; + float_t hfsq,f,s,z,R,w,t1,t2,hi,lo; + uint32_t ix; + int k; + + ix = u.i; + k = 0; + if (ix < 0x00800000 || ix>>31) { /* x < 2**-126 */ + if (ix<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (ix>>31) + return (x-x)/0.0f; /* log(-#) = NaN */ + /* subnormal number, scale up x */ + k -= 25; + x *= 0x1p25f; + u.f = x; + ix = u.i; + } else if (ix >= 0x7f800000) { + return x; + } else if (ix == 0x3f800000) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + ix += 0x3f800000 - 0x3f3504f3; + k += (int)(ix>>23) - 0x7f; + ix = (ix&0x007fffff) + 0x3f3504f3; + u.i = ix; + x = u.f; + + f = x - 1.0f; + s = f/(2.0f + f); + z = s*s; + w = z*z; + t1= w*(Lg2+w*Lg4); + t2= z*(Lg1+w*Lg3); + R = t2 + t1; + hfsq = 0.5f*f*f; + + hi = f - hfsq; + u.f = hi; + u.i &= 0xfffff000; + hi = u.f; + lo = f - hi - hfsq + s*(hfsq+R); + return (lo+hi)*ivln2lo + lo*ivln2hi + hi*ivln2hi + k; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/log2l.c b/lib/mlibc/options/ansi/musl-generic-math/log2l.c new file mode 100644 index 0000000..722b451 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/log2l.c @@ -0,0 +1,182 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_log2l.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Base 2 logarithm, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, log2l(); + * + * y = log2l( x ); + * + * + * DESCRIPTION: + * + * Returns the base 2 logarithm of x. + * + * The argument is separated into its exponent and fractional + * parts. If the exponent is between -1 and +1, the (natural) + * logarithm of the fraction is approximated by + * + * log(1+x) = x - 0.5 x**2 + x**3 P(x)/Q(x). + * + * Otherwise, setting z = 2(x-1)/x+1), + * + * log(x) = z + z**3 P(z)/Q(z). + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE 0.5, 2.0 30000 9.8e-20 2.7e-20 + * IEEE exp(+-10000) 70000 5.4e-20 2.3e-20 + * + * In the tests over the interval exp(+-10000), the logarithms + * of the random arguments were uniformly distributed over + * [-10000, +10000]. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double log2l(long double x) +{ + return log2(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* Coefficients for ln(1+x) = x - x**2/2 + x**3 P(x)/Q(x) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.2e-22 + */ +static const long double P[] = { + 4.9962495940332550844739E-1L, + 1.0767376367209449010438E1L, + 7.7671073698359539859595E1L, + 2.5620629828144409632571E2L, + 4.2401812743503691187826E2L, + 3.4258224542413922935104E2L, + 1.0747524399916215149070E2L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0,*/ + 2.3479774160285863271658E1L, + 1.9444210022760132894510E2L, + 7.7952888181207260646090E2L, + 1.6911722418503949084863E3L, + 2.0307734695595183428202E3L, + 1.2695660352705325274404E3L, + 3.2242573199748645407652E2L, +}; + +/* Coefficients for log(x) = z + z^3 P(z^2)/Q(z^2), + * where z = 2(x-1)/(x+1) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.16e-22 + */ +static const long double R[4] = { + 1.9757429581415468984296E-3L, +-7.1990767473014147232598E-1L, + 1.0777257190312272158094E1L, +-3.5717684488096787370998E1L, +}; +static const long double S[4] = { +/* 1.00000000000000000000E0L,*/ +-2.6201045551331104417768E1L, + 1.9361891836232102174846E2L, +-4.2861221385716144629696E2L, +}; +/* log2(e) - 1 */ +#define LOG2EA 4.4269504088896340735992e-1L + +#define SQRTH 0.70710678118654752440L + +long double log2l(long double x) +{ + long double y, z; + int e; + + if (isnan(x)) + return x; + if (x == INFINITY) + return x; + if (x <= 0.0) { + if (x == 0.0) + return -1/(x*x); /* -inf with divbyzero */ + return 0/0.0f; /* nan with invalid */ + } + + /* separate mantissa from exponent */ + /* Note, frexp is used so that denormal numbers + * will be handled properly. + */ + x = frexpl(x, &e); + + /* logarithm using log(x) = z + z**3 P(z)/Q(z), + * where z = 2(x-1)/x+1) + */ + if (e > 2 || e < -2) { + if (x < SQRTH) { /* 2(2x-1)/(2x+1) */ + e -= 1; + z = x - 0.5; + y = 0.5 * z + 0.5; + } else { /* 2 (x-1)/(x+1) */ + z = x - 0.5; + z -= 0.5; + y = 0.5 * x + 0.5; + } + x = z / y; + z = x*x; + y = x * (z * __polevll(z, R, 3) / __p1evll(z, S, 3)); + goto done; + } + + /* logarithm using log(1+x) = x - .5x**2 + x**3 P(x)/Q(x) */ + if (x < SQRTH) { + e -= 1; + x = 2.0*x - 1.0; + } else { + x = x - 1.0; + } + z = x*x; + y = x * (z * __polevll(x, P, 6) / __p1evll(x, Q, 7)); + y = y - 0.5*z; + +done: + /* Multiply log of fraction by log2(e) + * and base 2 exponent by 1 + * + * ***CAUTION*** + * + * This sequence of operations is critical and it may + * be horribly defeated by some compiler optimizers. + */ + z = y * LOG2EA; + z += x * LOG2EA; + z += y; + z += x; + z += e; + return z; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double log2l(long double x) +{ + return log2(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/logb.c b/lib/mlibc/options/ansi/musl-generic-math/logb.c new file mode 100644 index 0000000..7f8bdfa --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/logb.c @@ -0,0 +1,17 @@ +#include <math.h> + +/* +special cases: + logb(+-0) = -inf, and raise divbyzero + logb(+-inf) = +inf + logb(nan) = nan +*/ + +double logb(double x) +{ + if (!isfinite(x)) + return x * x; + if (x == 0) + return -1/(x*x); + return ilogb(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/logbf.c b/lib/mlibc/options/ansi/musl-generic-math/logbf.c new file mode 100644 index 0000000..a0a0b5e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/logbf.c @@ -0,0 +1,10 @@ +#include <math.h> + +float logbf(float x) +{ + if (!isfinite(x)) + return x * x; + if (x == 0) + return -1/(x*x); + return ilogbf(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/logbl.c b/lib/mlibc/options/ansi/musl-generic-math/logbl.c new file mode 100644 index 0000000..962973a --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/logbl.c @@ -0,0 +1,16 @@ +#include <math.h> +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double logbl(long double x) +{ + return logb(x); +} +#else +long double logbl(long double x) +{ + if (!isfinite(x)) + return x * x; + if (x == 0) + return -1/(x*x); + return ilogbl(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/logf.c b/lib/mlibc/options/ansi/musl-generic-math/logf.c new file mode 100644 index 0000000..52230a1 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/logf.c @@ -0,0 +1,69 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_logf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include <math.h> +#include <stdint.h> + +static const float +ln2_hi = 6.9313812256e-01, /* 0x3f317180 */ +ln2_lo = 9.0580006145e-06, /* 0x3717f7d1 */ +/* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ +Lg1 = 0xaaaaaa.0p-24, /* 0.66666662693 */ +Lg2 = 0xccce13.0p-25, /* 0.40000972152 */ +Lg3 = 0x91e9ee.0p-25, /* 0.28498786688 */ +Lg4 = 0xf89e26.0p-26; /* 0.24279078841 */ + +float logf(float x) +{ + union {float f; uint32_t i;} u = {x}; + float_t hfsq,f,s,z,R,w,t1,t2,dk; + uint32_t ix; + int k; + + ix = u.i; + k = 0; + if (ix < 0x00800000 || ix>>31) { /* x < 2**-126 */ + if (ix<<1 == 0) + return -1/(x*x); /* log(+-0)=-inf */ + if (ix>>31) + return (x-x)/0.0f; /* log(-#) = NaN */ + /* subnormal number, scale up x */ + k -= 25; + x *= 0x1p25f; + u.f = x; + ix = u.i; + } else if (ix >= 0x7f800000) { + return x; + } else if (ix == 0x3f800000) + return 0; + + /* reduce x into [sqrt(2)/2, sqrt(2)] */ + ix += 0x3f800000 - 0x3f3504f3; + k += (int)(ix>>23) - 0x7f; + ix = (ix&0x007fffff) + 0x3f3504f3; + u.i = ix; + x = u.f; + + f = x - 1.0f; + s = f/(2.0f + f); + z = s*s; + w = z*z; + t1= w*(Lg2+w*Lg4); + t2= z*(Lg1+w*Lg3); + R = t2 + t1; + hfsq = 0.5f*f*f; + dk = k; + return s*(hfsq+R) + dk*ln2_lo - hfsq + f + dk*ln2_hi; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/logl.c b/lib/mlibc/options/ansi/musl-generic-math/logl.c new file mode 100644 index 0000000..5d53659 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/logl.c @@ -0,0 +1,175 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_logl.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Natural logarithm, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, logl(); + * + * y = logl( x ); + * + * + * DESCRIPTION: + * + * Returns the base e (2.718...) logarithm of x. + * + * The argument is separated into its exponent and fractional + * parts. If the exponent is between -1 and +1, the logarithm + * of the fraction is approximated by + * + * log(1+x) = x - 0.5 x**2 + x**3 P(x)/Q(x). + * + * Otherwise, setting z = 2(x-1)/(x+1), + * + * log(x) = log(1+z/2) - log(1-z/2) = z + z**3 P(z)/Q(z). + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE 0.5, 2.0 150000 8.71e-20 2.75e-20 + * IEEE exp(+-10000) 100000 5.39e-20 2.34e-20 + * + * In the tests over the interval exp(+-10000), the logarithms + * of the random arguments were uniformly distributed over + * [-10000, +10000]. + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double logl(long double x) +{ + return log(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* Coefficients for log(1+x) = x - x**2/2 + x**3 P(x)/Q(x) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 2.32e-20 + */ +static const long double P[] = { + 4.5270000862445199635215E-5L, + 4.9854102823193375972212E-1L, + 6.5787325942061044846969E0L, + 2.9911919328553073277375E1L, + 6.0949667980987787057556E1L, + 5.7112963590585538103336E1L, + 2.0039553499201281259648E1L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0,*/ + 1.5062909083469192043167E1L, + 8.3047565967967209469434E1L, + 2.2176239823732856465394E2L, + 3.0909872225312059774938E2L, + 2.1642788614495947685003E2L, + 6.0118660497603843919306E1L, +}; + +/* Coefficients for log(x) = z + z^3 P(z^2)/Q(z^2), + * where z = 2(x-1)/(x+1) + * 1/sqrt(2) <= x < sqrt(2) + * Theoretical peak relative error = 6.16e-22 + */ +static const long double R[4] = { + 1.9757429581415468984296E-3L, +-7.1990767473014147232598E-1L, + 1.0777257190312272158094E1L, +-3.5717684488096787370998E1L, +}; +static const long double S[4] = { +/* 1.00000000000000000000E0L,*/ +-2.6201045551331104417768E1L, + 1.9361891836232102174846E2L, +-4.2861221385716144629696E2L, +}; +static const long double C1 = 6.9314575195312500000000E-1L; +static const long double C2 = 1.4286068203094172321215E-6L; + +#define SQRTH 0.70710678118654752440L + +long double logl(long double x) +{ + long double y, z; + int e; + + if (isnan(x)) + return x; + if (x == INFINITY) + return x; + if (x <= 0.0) { + if (x == 0.0) + return -1/(x*x); /* -inf with divbyzero */ + return 0/0.0f; /* nan with invalid */ + } + + /* separate mantissa from exponent */ + /* Note, frexp is used so that denormal numbers + * will be handled properly. + */ + x = frexpl(x, &e); + + /* logarithm using log(x) = z + z**3 P(z)/Q(z), + * where z = 2(x-1)/(x+1) + */ + if (e > 2 || e < -2) { + if (x < SQRTH) { /* 2(2x-1)/(2x+1) */ + e -= 1; + z = x - 0.5; + y = 0.5 * z + 0.5; + } else { /* 2 (x-1)/(x+1) */ + z = x - 0.5; + z -= 0.5; + y = 0.5 * x + 0.5; + } + x = z / y; + z = x*x; + z = x * (z * __polevll(z, R, 3) / __p1evll(z, S, 3)); + z = z + e * C2; + z = z + x; + z = z + e * C1; + return z; + } + + /* logarithm using log(1+x) = x - .5x**2 + x**3 P(x)/Q(x) */ + if (x < SQRTH) { + e -= 1; + x = 2.0*x - 1.0; + } else { + x = x - 1.0; + } + z = x*x; + y = x * (z * __polevll(x, P, 6) / __p1evll(x, Q, 6)); + y = y + e * C2; + z = y - 0.5*z; + /* Note, the sum of above terms does not exceed x/4, + * so it contributes at most about 1/4 lsb to the error. + */ + z = z + x; + z = z + e * C1; /* This sum has an error of 1/2 lsb. */ + return z; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double logl(long double x) +{ + return log(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/lrint.c b/lib/mlibc/options/ansi/musl-generic-math/lrint.c new file mode 100644 index 0000000..bdca8b7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lrint.c @@ -0,0 +1,46 @@ +#include <limits.h> +#include <fenv.h> +#include "libm.h" + +/* +If the result cannot be represented (overflow, nan), then +lrint raises the invalid exception. + +Otherwise if the input was not an integer then the inexact +exception is raised. + +C99 is a bit vague about whether inexact exception is +allowed to be raised when invalid is raised. +(F.9 explicitly allows spurious inexact exceptions, F.9.6.5 +does not make it clear if that rule applies to lrint, but +IEEE 754r 7.8 seems to forbid spurious inexact exception in +the ineger conversion functions) + +So we try to make sure that no spurious inexact exception is +raised in case of an overflow. + +If the bit size of long > precision of double, then there +cannot be inexact rounding in case the result overflows, +otherwise LONG_MAX and LONG_MIN can be represented exactly +as a double. +*/ + +#if LONG_MAX < 1U<<53 && defined(FE_INEXACT) +long lrint(double x) +{ + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); + x = rint(x); + if (!e && (x > LONG_MAX || x < LONG_MIN)) + feclearexcept(FE_INEXACT); + /* conversion */ + return x; +} +#else +long lrint(double x) +{ + return rint(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/lrintf.c b/lib/mlibc/options/ansi/musl-generic-math/lrintf.c new file mode 100644 index 0000000..ca0b6a4 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lrintf.c @@ -0,0 +1,8 @@ +#include <math.h> + +/* uses LONG_MAX > 2^24, see comments in lrint.c */ + +long lrintf(float x) +{ + return rintf(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/lrintl.c b/lib/mlibc/options/ansi/musl-generic-math/lrintl.c new file mode 100644 index 0000000..b2a8106 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lrintl.c @@ -0,0 +1,36 @@ +#include <limits.h> +#include <fenv.h> +#include "libm.h" + + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long lrintl(long double x) +{ + return lrint(x); +} +#elif defined(FE_INEXACT) +/* +see comments in lrint.c + +Note that if LONG_MAX == 0x7fffffffffffffff && LDBL_MANT_DIG == 64 +then x == 2**63 - 0.5 is the only input that overflows and +raises inexact (with tonearest or upward rounding mode) +*/ +long lrintl(long double x) +{ + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); + x = rintl(x); + if (!e && (x > LONG_MAX || x < LONG_MIN)) + feclearexcept(FE_INEXACT); + /* conversion */ + return x; +} +#else +long lrintl(long double x) +{ + return rintl(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/lround.c b/lib/mlibc/options/ansi/musl-generic-math/lround.c new file mode 100644 index 0000000..b8b7954 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lround.c @@ -0,0 +1,6 @@ +#include <math.h> + +long lround(double x) +{ + return round(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/lroundf.c b/lib/mlibc/options/ansi/musl-generic-math/lroundf.c new file mode 100644 index 0000000..c4707e7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lroundf.c @@ -0,0 +1,6 @@ +#include <math.h> + +long lroundf(float x) +{ + return roundf(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/lroundl.c b/lib/mlibc/options/ansi/musl-generic-math/lroundl.c new file mode 100644 index 0000000..094fdf6 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/lroundl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long lroundl(long double x) +{ + return roundl(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/modf.c b/lib/mlibc/options/ansi/musl-generic-math/modf.c new file mode 100644 index 0000000..1c8a1db --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/modf.c @@ -0,0 +1,34 @@ +#include "libm.h" + +double modf(double x, double *iptr) +{ + union {double f; uint64_t i;} u = {x}; + uint64_t mask; + int e = (int)(u.i>>52 & 0x7ff) - 0x3ff; + + /* no fractional part */ + if (e >= 52) { + *iptr = x; + if (e == 0x400 && u.i<<12 != 0) /* nan */ + return x; + u.i &= 1ULL<<63; + return u.f; + } + + /* no integral part*/ + if (e < 0) { + u.i &= 1ULL<<63; + *iptr = u.f; + return x; + } + + mask = -1ULL>>12>>e; + if ((u.i & mask) == 0) { + *iptr = x; + u.i &= 1ULL<<63; + return u.f; + } + u.i &= ~mask; + *iptr = u.f; + return x - u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/modff.c b/lib/mlibc/options/ansi/musl-generic-math/modff.c new file mode 100644 index 0000000..639514e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/modff.c @@ -0,0 +1,34 @@ +#include "libm.h" + +float modff(float x, float *iptr) +{ + union {float f; uint32_t i;} u = {x}; + uint32_t mask; + int e = (int)(u.i>>23 & 0xff) - 0x7f; + + /* no fractional part */ + if (e >= 23) { + *iptr = x; + if (e == 0x80 && u.i<<9 != 0) { /* nan */ + return x; + } + u.i &= 0x80000000; + return u.f; + } + /* no integral part */ + if (e < 0) { + u.i &= 0x80000000; + *iptr = u.f; + return x; + } + + mask = 0x007fffff>>e; + if ((u.i & mask) == 0) { + *iptr = x; + u.i &= 0x80000000; + return u.f; + } + u.i &= ~mask; + *iptr = u.f; + return x - u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/modfl.c b/lib/mlibc/options/ansi/musl-generic-math/modfl.c new file mode 100644 index 0000000..a47b192 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/modfl.c @@ -0,0 +1,53 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double modfl(long double x, long double *iptr) +{ + double d; + long double r; + + r = modf(x, &d); + *iptr = d; + return r; +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double modfl(long double x, long double *iptr) +{ + union ldshape u = {x}; + int e = (u.i.se & 0x7fff) - 0x3fff; + int s = u.i.se >> 15; + long double absx; + long double y; + + /* no fractional part */ + if (e >= LDBL_MANT_DIG-1) { + *iptr = x; + if (isnan(x)) + return x; + return s ? -0.0 : 0.0; + } + + /* no integral part*/ + if (e < 0) { + *iptr = s ? -0.0 : 0.0; + return x; + } + + /* raises spurious inexact */ + absx = s ? -x : x; + y = absx + toint - toint - absx; + if (y == 0) { + *iptr = x; + return s ? -0.0 : 0.0; + } + if (y > 0) + y -= 1; + if (s) + y = -y; + *iptr = x + y; + return -y; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/nan.c b/lib/mlibc/options/ansi/musl-generic-math/nan.c new file mode 100644 index 0000000..9e0826c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nan.c @@ -0,0 +1,6 @@ +#include <math.h> + +double nan(const char *s) +{ + return NAN; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nanf.c b/lib/mlibc/options/ansi/musl-generic-math/nanf.c new file mode 100644 index 0000000..752ce54 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nanf.c @@ -0,0 +1,6 @@ +#include <math.h> + +float nanf(const char *s) +{ + return NAN; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nanl.c b/lib/mlibc/options/ansi/musl-generic-math/nanl.c new file mode 100644 index 0000000..969af56 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nanl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long double nanl(const char *s) +{ + return NAN; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nearbyint.c b/lib/mlibc/options/ansi/musl-generic-math/nearbyint.c new file mode 100644 index 0000000..f4e8aac --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nearbyint.c @@ -0,0 +1,20 @@ +#include <fenv.h> +#include <math.h> + +/* nearbyint is the same as rint, but it must not raise the inexact exception */ + +double nearbyint(double x) +{ +#ifdef FE_INEXACT + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); +#endif + x = rint(x); +#ifdef FE_INEXACT + if (!e) + feclearexcept(FE_INEXACT); +#endif + return x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nearbyintf.c b/lib/mlibc/options/ansi/musl-generic-math/nearbyintf.c new file mode 100644 index 0000000..092e9ff --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nearbyintf.c @@ -0,0 +1,18 @@ +#include <fenv.h> +#include <math.h> + +float nearbyintf(float x) +{ +#ifdef FE_INEXACT + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); +#endif + x = rintf(x); +#ifdef FE_INEXACT + if (!e) + feclearexcept(FE_INEXACT); +#endif + return x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nearbyintl.c b/lib/mlibc/options/ansi/musl-generic-math/nearbyintl.c new file mode 100644 index 0000000..8285249 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nearbyintl.c @@ -0,0 +1,26 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double nearbyintl(long double x) +{ + return nearbyint(x); +} +#else +#include <fenv.h> +long double nearbyintl(long double x) +{ +#ifdef FE_INEXACT + #pragma STDC FENV_ACCESS ON + int e; + + e = fetestexcept(FE_INEXACT); +#endif + x = rintl(x); +#ifdef FE_INEXACT + if (!e) + feclearexcept(FE_INEXACT); +#endif + return x; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/nextafter.c b/lib/mlibc/options/ansi/musl-generic-math/nextafter.c new file mode 100644 index 0000000..ab5795a --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nextafter.c @@ -0,0 +1,31 @@ +#include "libm.h" + +double nextafter(double x, double y) +{ + union {double f; uint64_t i;} ux={x}, uy={y}; + uint64_t ax, ay; + int e; + + if (isnan(x) || isnan(y)) + return x + y; + if (ux.i == uy.i) + return y; + ax = ux.i & -1ULL/2; + ay = uy.i & -1ULL/2; + if (ax == 0) { + if (ay == 0) + return y; + ux.i = (uy.i & 1ULL<<63) | 1; + } else if (ax > ay || ((ux.i ^ uy.i) & 1ULL<<63)) + ux.i--; + else + ux.i++; + e = ux.i >> 52 & 0x7ff; + /* raise overflow if ux.f is infinite and x is finite */ + if (e == 0x7ff) + FORCE_EVAL(x+x); + /* raise underflow if ux.f is subnormal or zero */ + if (e == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nextafterf.c b/lib/mlibc/options/ansi/musl-generic-math/nextafterf.c new file mode 100644 index 0000000..75a09f7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nextafterf.c @@ -0,0 +1,30 @@ +#include "libm.h" + +float nextafterf(float x, float y) +{ + union {float f; uint32_t i;} ux={x}, uy={y}; + uint32_t ax, ay, e; + + if (isnan(x) || isnan(y)) + return x + y; + if (ux.i == uy.i) + return y; + ax = ux.i & 0x7fffffff; + ay = uy.i & 0x7fffffff; + if (ax == 0) { + if (ay == 0) + return y; + ux.i = (uy.i & 0x80000000) | 1; + } else if (ax > ay || ((ux.i ^ uy.i) & 0x80000000)) + ux.i--; + else + ux.i++; + e = ux.i & 0x7f800000; + /* raise overflow if ux.f is infinite and x is finite */ + if (e == 0x7f800000) + FORCE_EVAL(x+x); + /* raise underflow if ux.f is subnormal or zero */ + if (e == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nextafterl.c b/lib/mlibc/options/ansi/musl-generic-math/nextafterl.c new file mode 100644 index 0000000..37e858f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nextafterl.c @@ -0,0 +1,75 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double nextafterl(long double x, long double y) +{ + return nextafter(x, y); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +long double nextafterl(long double x, long double y) +{ + union ldshape ux, uy; + + if (isnan(x) || isnan(y)) + return x + y; + if (x == y) + return y; + ux.f = x; + if (x == 0) { + uy.f = y; + ux.i.m = 1; + ux.i.se = uy.i.se & 0x8000; + } else if ((x < y) == !(ux.i.se & 0x8000)) { + ux.i.m++; + if (ux.i.m << 1 == 0) { + ux.i.m = 1ULL << 63; + ux.i.se++; + } + } else { + if (ux.i.m << 1 == 0) { + ux.i.se--; + if (ux.i.se) + ux.i.m = 0; + } + ux.i.m--; + } + /* raise overflow if ux is infinite and x is finite */ + if ((ux.i.se & 0x7fff) == 0x7fff) + return x + x; + /* raise underflow if ux is subnormal or zero */ + if ((ux.i.se & 0x7fff) == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +long double nextafterl(long double x, long double y) +{ + union ldshape ux, uy; + + if (isnan(x) || isnan(y)) + return x + y; + if (x == y) + return y; + ux.f = x; + if (x == 0) { + uy.f = y; + ux.i.lo = 1; + ux.i.se = uy.i.se & 0x8000; + } else if ((x < y) == !(ux.i.se & 0x8000)) { + ux.i2.lo++; + if (ux.i2.lo == 0) + ux.i2.hi++; + } else { + if (ux.i2.lo == 0) + ux.i2.hi--; + ux.i2.lo--; + } + /* raise overflow if ux is infinite and x is finite */ + if ((ux.i.se & 0x7fff) == 0x7fff) + return x + x; + /* raise underflow if ux is subnormal or zero */ + if ((ux.i.se & 0x7fff) == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/nexttoward.c b/lib/mlibc/options/ansi/musl-generic-math/nexttoward.c new file mode 100644 index 0000000..827ee5c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nexttoward.c @@ -0,0 +1,42 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +double nexttoward(double x, long double y) +{ + return nextafter(x, y); +} +#else +double nexttoward(double x, long double y) +{ + union {double f; uint64_t i;} ux = {x}; + int e; + + if (isnan(x) || isnan(y)) + return x + y; + if (x == y) + return y; + if (x == 0) { + ux.i = 1; + if (signbit(y)) + ux.i |= 1ULL<<63; + } else if (x < y) { + if (signbit(x)) + ux.i--; + else + ux.i++; + } else { + if (signbit(x)) + ux.i++; + else + ux.i--; + } + e = ux.i>>52 & 0x7ff; + /* raise overflow if ux.f is infinite and x is finite */ + if (e == 0x7ff) + FORCE_EVAL(x+x); + /* raise underflow if ux.f is subnormal or zero */ + if (e == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/nexttowardf.c b/lib/mlibc/options/ansi/musl-generic-math/nexttowardf.c new file mode 100644 index 0000000..bbf172f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nexttowardf.c @@ -0,0 +1,35 @@ +#include "libm.h" + +float nexttowardf(float x, long double y) +{ + union {float f; uint32_t i;} ux = {x}; + uint32_t e; + + if (isnan(x) || isnan(y)) + return x + y; + if (x == y) + return y; + if (x == 0) { + ux.i = 1; + if (signbit(y)) + ux.i |= 0x80000000; + } else if (x < y) { + if (signbit(x)) + ux.i--; + else + ux.i++; + } else { + if (signbit(x)) + ux.i++; + else + ux.i--; + } + e = ux.i & 0x7f800000; + /* raise overflow if ux.f is infinite and x is finite */ + if (e == 0x7f800000) + FORCE_EVAL(x+x); + /* raise underflow if ux.f is subnormal or zero */ + if (e == 0) + FORCE_EVAL(x*x + ux.f*ux.f); + return ux.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/nexttowardl.c b/lib/mlibc/options/ansi/musl-generic-math/nexttowardl.c new file mode 100644 index 0000000..67a6340 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/nexttowardl.c @@ -0,0 +1,6 @@ +#include <math.h> + +long double nexttowardl(long double x, long double y) +{ + return nextafterl(x, y); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/pow.c b/lib/mlibc/options/ansi/musl-generic-math/pow.c new file mode 100644 index 0000000..3ddc1b6 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/pow.c @@ -0,0 +1,328 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_pow.c */ +/* + * ==================================================== + * Copyright (C) 2004 by Sun Microsystems, Inc. All rights reserved. + * + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* pow(x,y) return x**y + * + * n + * Method: Let x = 2 * (1+f) + * 1. Compute and return log2(x) in two pieces: + * log2(x) = w1 + w2, + * where w1 has 53-24 = 29 bit trailing zeros. + * 2. Perform y*log2(x) = n+y' by simulating muti-precision + * arithmetic, where |y'|<=0.5. + * 3. Return x**y = 2**n*exp(y'*log2) + * + * Special cases: + * 1. (anything) ** 0 is 1 + * 2. 1 ** (anything) is 1 + * 3. (anything except 1) ** NAN is NAN + * 4. NAN ** (anything except 0) is NAN + * 5. +-(|x| > 1) ** +INF is +INF + * 6. +-(|x| > 1) ** -INF is +0 + * 7. +-(|x| < 1) ** +INF is +0 + * 8. +-(|x| < 1) ** -INF is +INF + * 9. -1 ** +-INF is 1 + * 10. +0 ** (+anything except 0, NAN) is +0 + * 11. -0 ** (+anything except 0, NAN, odd integer) is +0 + * 12. +0 ** (-anything except 0, NAN) is +INF, raise divbyzero + * 13. -0 ** (-anything except 0, NAN, odd integer) is +INF, raise divbyzero + * 14. -0 ** (+odd integer) is -0 + * 15. -0 ** (-odd integer) is -INF, raise divbyzero + * 16. +INF ** (+anything except 0,NAN) is +INF + * 17. +INF ** (-anything except 0,NAN) is +0 + * 18. -INF ** (+odd integer) is -INF + * 19. -INF ** (anything) = -0 ** (-anything), (anything except odd integer) + * 20. (anything) ** 1 is (anything) + * 21. (anything) ** -1 is 1/(anything) + * 22. (-anything) ** (integer) is (-1)**(integer)*(+anything**integer) + * 23. (-anything except 0 and inf) ** (non-integer) is NAN + * + * Accuracy: + * pow(x,y) returns x**y nearly rounded. In particular + * pow(integer,integer) + * always returns the correct integer provided it is + * representable. + * + * Constants : + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "libm.h" + +static const double +bp[] = {1.0, 1.5,}, +dp_h[] = { 0.0, 5.84962487220764160156e-01,}, /* 0x3FE2B803, 0x40000000 */ +dp_l[] = { 0.0, 1.35003920212974897128e-08,}, /* 0x3E4CFDEB, 0x43CFD006 */ +two53 = 9007199254740992.0, /* 0x43400000, 0x00000000 */ +huge = 1.0e300, +tiny = 1.0e-300, +/* poly coefs for (3/2)*(log(x)-2s-2/3*s**3 */ +L1 = 5.99999999999994648725e-01, /* 0x3FE33333, 0x33333303 */ +L2 = 4.28571428578550184252e-01, /* 0x3FDB6DB6, 0xDB6FABFF */ +L3 = 3.33333329818377432918e-01, /* 0x3FD55555, 0x518F264D */ +L4 = 2.72728123808534006489e-01, /* 0x3FD17460, 0xA91D4101 */ +L5 = 2.30660745775561754067e-01, /* 0x3FCD864A, 0x93C9DB65 */ +L6 = 2.06975017800338417784e-01, /* 0x3FCA7E28, 0x4A454EEF */ +P1 = 1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */ +P2 = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */ +P3 = 6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */ +P4 = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */ +P5 = 4.13813679705723846039e-08, /* 0x3E663769, 0x72BEA4D0 */ +lg2 = 6.93147180559945286227e-01, /* 0x3FE62E42, 0xFEFA39EF */ +lg2_h = 6.93147182464599609375e-01, /* 0x3FE62E43, 0x00000000 */ +lg2_l = -1.90465429995776804525e-09, /* 0xBE205C61, 0x0CA86C39 */ +ovt = 8.0085662595372944372e-017, /* -(1024-log2(ovfl+.5ulp)) */ +cp = 9.61796693925975554329e-01, /* 0x3FEEC709, 0xDC3A03FD =2/(3ln2) */ +cp_h = 9.61796700954437255859e-01, /* 0x3FEEC709, 0xE0000000 =(float)cp */ +cp_l = -7.02846165095275826516e-09, /* 0xBE3E2FE0, 0x145B01F5 =tail of cp_h*/ +ivln2 = 1.44269504088896338700e+00, /* 0x3FF71547, 0x652B82FE =1/ln2 */ +ivln2_h = 1.44269502162933349609e+00, /* 0x3FF71547, 0x60000000 =24b 1/ln2*/ +ivln2_l = 1.92596299112661746887e-08; /* 0x3E54AE0B, 0xF85DDF44 =1/ln2 tail*/ + +double pow(double x, double y) +{ + double z,ax,z_h,z_l,p_h,p_l; + double y1,t1,t2,r,s,t,u,v,w; + int32_t i,j,k,yisint,n; + int32_t hx,hy,ix,iy; + uint32_t lx,ly; + + EXTRACT_WORDS(hx, lx, x); + EXTRACT_WORDS(hy, ly, y); + ix = hx & 0x7fffffff; + iy = hy & 0x7fffffff; + + /* x**0 = 1, even if x is NaN */ + if ((iy|ly) == 0) + return 1.0; + /* 1**y = 1, even if y is NaN */ + if (hx == 0x3ff00000 && lx == 0) + return 1.0; + /* NaN if either arg is NaN */ + if (ix > 0x7ff00000 || (ix == 0x7ff00000 && lx != 0) || + iy > 0x7ff00000 || (iy == 0x7ff00000 && ly != 0)) + return x + y; + + /* determine if y is an odd int when x < 0 + * yisint = 0 ... y is not an integer + * yisint = 1 ... y is an odd int + * yisint = 2 ... y is an even int + */ + yisint = 0; + if (hx < 0) { + if (iy >= 0x43400000) + yisint = 2; /* even integer y */ + else if (iy >= 0x3ff00000) { + k = (iy>>20) - 0x3ff; /* exponent */ + if (k > 20) { + uint32_t j = ly>>(52-k); + if ((j<<(52-k)) == ly) + yisint = 2 - (j&1); + } else if (ly == 0) { + uint32_t j = iy>>(20-k); + if ((j<<(20-k)) == iy) + yisint = 2 - (j&1); + } + } + } + + /* special value of y */ + if (ly == 0) { + if (iy == 0x7ff00000) { /* y is +-inf */ + if (((ix-0x3ff00000)|lx) == 0) /* (-1)**+-inf is 1 */ + return 1.0; + else if (ix >= 0x3ff00000) /* (|x|>1)**+-inf = inf,0 */ + return hy >= 0 ? y : 0.0; + else /* (|x|<1)**+-inf = 0,inf */ + return hy >= 0 ? 0.0 : -y; + } + if (iy == 0x3ff00000) { /* y is +-1 */ + if (hy >= 0) + return x; + y = 1/x; +#if FLT_EVAL_METHOD!=0 + { + union {double f; uint64_t i;} u = {y}; + uint64_t i = u.i & -1ULL/2; + if (i>>52 == 0 && (i&(i-1))) + FORCE_EVAL((float)y); + } +#endif + return y; + } + if (hy == 0x40000000) /* y is 2 */ + return x*x; + if (hy == 0x3fe00000) { /* y is 0.5 */ + if (hx >= 0) /* x >= +0 */ + return sqrt(x); + } + } + + ax = fabs(x); + /* special value of x */ + if (lx == 0) { + if (ix == 0x7ff00000 || ix == 0 || ix == 0x3ff00000) { /* x is +-0,+-inf,+-1 */ + z = ax; + if (hy < 0) /* z = (1/|x|) */ + z = 1.0/z; + if (hx < 0) { + if (((ix-0x3ff00000)|yisint) == 0) { + z = (z-z)/(z-z); /* (-1)**non-int is NaN */ + } else if (yisint == 1) + z = -z; /* (x<0)**odd = -(|x|**odd) */ + } + return z; + } + } + + s = 1.0; /* sign of result */ + if (hx < 0) { + if (yisint == 0) /* (x<0)**(non-int) is NaN */ + return (x-x)/(x-x); + if (yisint == 1) /* (x<0)**(odd int) */ + s = -1.0; + } + + /* |y| is huge */ + if (iy > 0x41e00000) { /* if |y| > 2**31 */ + if (iy > 0x43f00000) { /* if |y| > 2**64, must o/uflow */ + if (ix <= 0x3fefffff) + return hy < 0 ? huge*huge : tiny*tiny; + if (ix >= 0x3ff00000) + return hy > 0 ? huge*huge : tiny*tiny; + } + /* over/underflow if x is not close to one */ + if (ix < 0x3fefffff) + return hy < 0 ? s*huge*huge : s*tiny*tiny; + if (ix > 0x3ff00000) + return hy > 0 ? s*huge*huge : s*tiny*tiny; + /* now |1-x| is tiny <= 2**-20, suffice to compute + log(x) by x-x^2/2+x^3/3-x^4/4 */ + t = ax - 1.0; /* t has 20 trailing zeros */ + w = (t*t)*(0.5 - t*(0.3333333333333333333333-t*0.25)); + u = ivln2_h*t; /* ivln2_h has 21 sig. bits */ + v = t*ivln2_l - w*ivln2; + t1 = u + v; + SET_LOW_WORD(t1, 0); + t2 = v - (t1-u); + } else { + double ss,s2,s_h,s_l,t_h,t_l; + n = 0; + /* take care subnormal number */ + if (ix < 0x00100000) { + ax *= two53; + n -= 53; + GET_HIGH_WORD(ix,ax); + } + n += ((ix)>>20) - 0x3ff; + j = ix & 0x000fffff; + /* determine interval */ + ix = j | 0x3ff00000; /* normalize ix */ + if (j <= 0x3988E) /* |x|<sqrt(3/2) */ + k = 0; + else if (j < 0xBB67A) /* |x|<sqrt(3) */ + k = 1; + else { + k = 0; + n += 1; + ix -= 0x00100000; + } + SET_HIGH_WORD(ax, ix); + + /* compute ss = s_h+s_l = (x-1)/(x+1) or (x-1.5)/(x+1.5) */ + u = ax - bp[k]; /* bp[0]=1.0, bp[1]=1.5 */ + v = 1.0/(ax+bp[k]); + ss = u*v; + s_h = ss; + SET_LOW_WORD(s_h, 0); + /* t_h=ax+bp[k] High */ + t_h = 0.0; + SET_HIGH_WORD(t_h, ((ix>>1)|0x20000000) + 0x00080000 + (k<<18)); + t_l = ax - (t_h-bp[k]); + s_l = v*((u-s_h*t_h)-s_h*t_l); + /* compute log(ax) */ + s2 = ss*ss; + r = s2*s2*(L1+s2*(L2+s2*(L3+s2*(L4+s2*(L5+s2*L6))))); + r += s_l*(s_h+ss); + s2 = s_h*s_h; + t_h = 3.0 + s2 + r; + SET_LOW_WORD(t_h, 0); + t_l = r - ((t_h-3.0)-s2); + /* u+v = ss*(1+...) */ + u = s_h*t_h; + v = s_l*t_h + t_l*ss; + /* 2/(3log2)*(ss+...) */ + p_h = u + v; + SET_LOW_WORD(p_h, 0); + p_l = v - (p_h-u); + z_h = cp_h*p_h; /* cp_h+cp_l = 2/(3*log2) */ + z_l = cp_l*p_h+p_l*cp + dp_l[k]; + /* log2(ax) = (ss+..)*2/(3*log2) = n + dp_h + z_h + z_l */ + t = (double)n; + t1 = ((z_h + z_l) + dp_h[k]) + t; + SET_LOW_WORD(t1, 0); + t2 = z_l - (((t1 - t) - dp_h[k]) - z_h); + } + + /* split up y into y1+y2 and compute (y1+y2)*(t1+t2) */ + y1 = y; + SET_LOW_WORD(y1, 0); + p_l = (y-y1)*t1 + y*t2; + p_h = y1*t1; + z = p_l + p_h; + EXTRACT_WORDS(j, i, z); + if (j >= 0x40900000) { /* z >= 1024 */ + if (((j-0x40900000)|i) != 0) /* if z > 1024 */ + return s*huge*huge; /* overflow */ + if (p_l + ovt > z - p_h) + return s*huge*huge; /* overflow */ + } else if ((j&0x7fffffff) >= 0x4090cc00) { /* z <= -1075 */ // FIXME: instead of abs(j) use unsigned j + if (((j-0xc090cc00)|i) != 0) /* z < -1075 */ + return s*tiny*tiny; /* underflow */ + if (p_l <= z - p_h) + return s*tiny*tiny; /* underflow */ + } + /* + * compute 2**(p_h+p_l) + */ + i = j & 0x7fffffff; + k = (i>>20) - 0x3ff; + n = 0; + if (i > 0x3fe00000) { /* if |z| > 0.5, set n = [z+0.5] */ + n = j + (0x00100000>>(k+1)); + k = ((n&0x7fffffff)>>20) - 0x3ff; /* new k for n */ + t = 0.0; + SET_HIGH_WORD(t, n & ~(0x000fffff>>k)); + n = ((n&0x000fffff)|0x00100000)>>(20-k); + if (j < 0) + n = -n; + p_h -= t; + } + t = p_l + p_h; + SET_LOW_WORD(t, 0); + u = t*lg2_h; + v = (p_l-(t-p_h))*lg2 + t*lg2_l; + z = u + v; + w = v - (z-u); + t = z*z; + t1 = z - t*(P1+t*(P2+t*(P3+t*(P4+t*P5)))); + r = (z*t1)/(t1-2.0) - (w + z*w); + z = 1.0 - (r-z); + GET_HIGH_WORD(j, z); + j += n<<20; + if ((j>>20) <= 0) /* subnormal output */ + z = scalbn(z,n); + else + SET_HIGH_WORD(z, j); + return s*z; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/powf.c b/lib/mlibc/options/ansi/musl-generic-math/powf.c new file mode 100644 index 0000000..427c896 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/powf.c @@ -0,0 +1,259 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_powf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float +bp[] = {1.0, 1.5,}, +dp_h[] = { 0.0, 5.84960938e-01,}, /* 0x3f15c000 */ +dp_l[] = { 0.0, 1.56322085e-06,}, /* 0x35d1cfdc */ +two24 = 16777216.0, /* 0x4b800000 */ +huge = 1.0e30, +tiny = 1.0e-30, +/* poly coefs for (3/2)*(log(x)-2s-2/3*s**3 */ +L1 = 6.0000002384e-01, /* 0x3f19999a */ +L2 = 4.2857143283e-01, /* 0x3edb6db7 */ +L3 = 3.3333334327e-01, /* 0x3eaaaaab */ +L4 = 2.7272811532e-01, /* 0x3e8ba305 */ +L5 = 2.3066075146e-01, /* 0x3e6c3255 */ +L6 = 2.0697501302e-01, /* 0x3e53f142 */ +P1 = 1.6666667163e-01, /* 0x3e2aaaab */ +P2 = -2.7777778450e-03, /* 0xbb360b61 */ +P3 = 6.6137559770e-05, /* 0x388ab355 */ +P4 = -1.6533901999e-06, /* 0xb5ddea0e */ +P5 = 4.1381369442e-08, /* 0x3331bb4c */ +lg2 = 6.9314718246e-01, /* 0x3f317218 */ +lg2_h = 6.93145752e-01, /* 0x3f317200 */ +lg2_l = 1.42860654e-06, /* 0x35bfbe8c */ +ovt = 4.2995665694e-08, /* -(128-log2(ovfl+.5ulp)) */ +cp = 9.6179670095e-01, /* 0x3f76384f =2/(3ln2) */ +cp_h = 9.6191406250e-01, /* 0x3f764000 =12b cp */ +cp_l = -1.1736857402e-04, /* 0xb8f623c6 =tail of cp_h */ +ivln2 = 1.4426950216e+00, /* 0x3fb8aa3b =1/ln2 */ +ivln2_h = 1.4426879883e+00, /* 0x3fb8aa00 =16b 1/ln2*/ +ivln2_l = 7.0526075433e-06; /* 0x36eca570 =1/ln2 tail*/ + +float powf(float x, float y) +{ + float z,ax,z_h,z_l,p_h,p_l; + float y1,t1,t2,r,s,sn,t,u,v,w; + int32_t i,j,k,yisint,n; + int32_t hx,hy,ix,iy,is; + + GET_FLOAT_WORD(hx, x); + GET_FLOAT_WORD(hy, y); + ix = hx & 0x7fffffff; + iy = hy & 0x7fffffff; + + /* x**0 = 1, even if x is NaN */ + if (iy == 0) + return 1.0f; + /* 1**y = 1, even if y is NaN */ + if (hx == 0x3f800000) + return 1.0f; + /* NaN if either arg is NaN */ + if (ix > 0x7f800000 || iy > 0x7f800000) + return x + y; + + /* determine if y is an odd int when x < 0 + * yisint = 0 ... y is not an integer + * yisint = 1 ... y is an odd int + * yisint = 2 ... y is an even int + */ + yisint = 0; + if (hx < 0) { + if (iy >= 0x4b800000) + yisint = 2; /* even integer y */ + else if (iy >= 0x3f800000) { + k = (iy>>23) - 0x7f; /* exponent */ + j = iy>>(23-k); + if ((j<<(23-k)) == iy) + yisint = 2 - (j & 1); + } + } + + /* special value of y */ + if (iy == 0x7f800000) { /* y is +-inf */ + if (ix == 0x3f800000) /* (-1)**+-inf is 1 */ + return 1.0f; + else if (ix > 0x3f800000) /* (|x|>1)**+-inf = inf,0 */ + return hy >= 0 ? y : 0.0f; + else /* (|x|<1)**+-inf = 0,inf */ + return hy >= 0 ? 0.0f: -y; + } + if (iy == 0x3f800000) /* y is +-1 */ + return hy >= 0 ? x : 1.0f/x; + if (hy == 0x40000000) /* y is 2 */ + return x*x; + if (hy == 0x3f000000) { /* y is 0.5 */ + if (hx >= 0) /* x >= +0 */ + return sqrtf(x); + } + + ax = fabsf(x); + /* special value of x */ + if (ix == 0x7f800000 || ix == 0 || ix == 0x3f800000) { /* x is +-0,+-inf,+-1 */ + z = ax; + if (hy < 0) /* z = (1/|x|) */ + z = 1.0f/z; + if (hx < 0) { + if (((ix-0x3f800000)|yisint) == 0) { + z = (z-z)/(z-z); /* (-1)**non-int is NaN */ + } else if (yisint == 1) + z = -z; /* (x<0)**odd = -(|x|**odd) */ + } + return z; + } + + sn = 1.0f; /* sign of result */ + if (hx < 0) { + if (yisint == 0) /* (x<0)**(non-int) is NaN */ + return (x-x)/(x-x); + if (yisint == 1) /* (x<0)**(odd int) */ + sn = -1.0f; + } + + /* |y| is huge */ + if (iy > 0x4d000000) { /* if |y| > 2**27 */ + /* over/underflow if x is not close to one */ + if (ix < 0x3f7ffff8) + return hy < 0 ? sn*huge*huge : sn*tiny*tiny; + if (ix > 0x3f800007) + return hy > 0 ? sn*huge*huge : sn*tiny*tiny; + /* now |1-x| is tiny <= 2**-20, suffice to compute + log(x) by x-x^2/2+x^3/3-x^4/4 */ + t = ax - 1; /* t has 20 trailing zeros */ + w = (t*t)*(0.5f - t*(0.333333333333f - t*0.25f)); + u = ivln2_h*t; /* ivln2_h has 16 sig. bits */ + v = t*ivln2_l - w*ivln2; + t1 = u + v; + GET_FLOAT_WORD(is, t1); + SET_FLOAT_WORD(t1, is & 0xfffff000); + t2 = v - (t1-u); + } else { + float s2,s_h,s_l,t_h,t_l; + n = 0; + /* take care subnormal number */ + if (ix < 0x00800000) { + ax *= two24; + n -= 24; + GET_FLOAT_WORD(ix, ax); + } + n += ((ix)>>23) - 0x7f; + j = ix & 0x007fffff; + /* determine interval */ + ix = j | 0x3f800000; /* normalize ix */ + if (j <= 0x1cc471) /* |x|<sqrt(3/2) */ + k = 0; + else if (j < 0x5db3d7) /* |x|<sqrt(3) */ + k = 1; + else { + k = 0; + n += 1; + ix -= 0x00800000; + } + SET_FLOAT_WORD(ax, ix); + + /* compute s = s_h+s_l = (x-1)/(x+1) or (x-1.5)/(x+1.5) */ + u = ax - bp[k]; /* bp[0]=1.0, bp[1]=1.5 */ + v = 1.0f/(ax+bp[k]); + s = u*v; + s_h = s; + GET_FLOAT_WORD(is, s_h); + SET_FLOAT_WORD(s_h, is & 0xfffff000); + /* t_h=ax+bp[k] High */ + is = ((ix>>1) & 0xfffff000) | 0x20000000; + SET_FLOAT_WORD(t_h, is + 0x00400000 + (k<<21)); + t_l = ax - (t_h - bp[k]); + s_l = v*((u - s_h*t_h) - s_h*t_l); + /* compute log(ax) */ + s2 = s*s; + r = s2*s2*(L1+s2*(L2+s2*(L3+s2*(L4+s2*(L5+s2*L6))))); + r += s_l*(s_h+s); + s2 = s_h*s_h; + t_h = 3.0f + s2 + r; + GET_FLOAT_WORD(is, t_h); + SET_FLOAT_WORD(t_h, is & 0xfffff000); + t_l = r - ((t_h - 3.0f) - s2); + /* u+v = s*(1+...) */ + u = s_h*t_h; + v = s_l*t_h + t_l*s; + /* 2/(3log2)*(s+...) */ + p_h = u + v; + GET_FLOAT_WORD(is, p_h); + SET_FLOAT_WORD(p_h, is & 0xfffff000); + p_l = v - (p_h - u); + z_h = cp_h*p_h; /* cp_h+cp_l = 2/(3*log2) */ + z_l = cp_l*p_h + p_l*cp+dp_l[k]; + /* log2(ax) = (s+..)*2/(3*log2) = n + dp_h + z_h + z_l */ + t = (float)n; + t1 = (((z_h + z_l) + dp_h[k]) + t); + GET_FLOAT_WORD(is, t1); + SET_FLOAT_WORD(t1, is & 0xfffff000); + t2 = z_l - (((t1 - t) - dp_h[k]) - z_h); + } + + /* split up y into y1+y2 and compute (y1+y2)*(t1+t2) */ + GET_FLOAT_WORD(is, y); + SET_FLOAT_WORD(y1, is & 0xfffff000); + p_l = (y-y1)*t1 + y*t2; + p_h = y1*t1; + z = p_l + p_h; + GET_FLOAT_WORD(j, z); + if (j > 0x43000000) /* if z > 128 */ + return sn*huge*huge; /* overflow */ + else if (j == 0x43000000) { /* if z == 128 */ + if (p_l + ovt > z - p_h) + return sn*huge*huge; /* overflow */ + } else if ((j&0x7fffffff) > 0x43160000) /* z < -150 */ // FIXME: check should be (uint32_t)j > 0xc3160000 + return sn*tiny*tiny; /* underflow */ + else if (j == 0xc3160000) { /* z == -150 */ + if (p_l <= z-p_h) + return sn*tiny*tiny; /* underflow */ + } + /* + * compute 2**(p_h+p_l) + */ + i = j & 0x7fffffff; + k = (i>>23) - 0x7f; + n = 0; + if (i > 0x3f000000) { /* if |z| > 0.5, set n = [z+0.5] */ + n = j + (0x00800000>>(k+1)); + k = ((n&0x7fffffff)>>23) - 0x7f; /* new k for n */ + SET_FLOAT_WORD(t, n & ~(0x007fffff>>k)); + n = ((n&0x007fffff)|0x00800000)>>(23-k); + if (j < 0) + n = -n; + p_h -= t; + } + t = p_l + p_h; + GET_FLOAT_WORD(is, t); + SET_FLOAT_WORD(t, is & 0xffff8000); + u = t*lg2_h; + v = (p_l-(t-p_h))*lg2 + t*lg2_l; + z = u + v; + w = v - (z - u); + t = z*z; + t1 = z - t*(P1+t*(P2+t*(P3+t*(P4+t*P5)))); + r = (z*t1)/(t1-2.0f) - (w+z*w); + z = 1.0f - (r - z); + GET_FLOAT_WORD(j, z); + j += n<<23; + if ((j>>23) <= 0) /* subnormal output */ + z = scalbnf(z, n); + else + SET_FLOAT_WORD(z, j); + return sn*z; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/powl.c b/lib/mlibc/options/ansi/musl-generic-math/powl.c new file mode 100644 index 0000000..5b6da07 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/powl.c @@ -0,0 +1,522 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_powl.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* powl.c + * + * Power function, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, z, powl(); + * + * z = powl( x, y ); + * + * + * DESCRIPTION: + * + * Computes x raised to the yth power. Analytically, + * + * x**y = exp( y log(x) ). + * + * Following Cody and Waite, this program uses a lookup table + * of 2**-i/32 and pseudo extended precision arithmetic to + * obtain several extra bits of accuracy in both the logarithm + * and the exponential. + * + * + * ACCURACY: + * + * The relative error of pow(x,y) can be estimated + * by y dl ln(2), where dl is the absolute error of + * the internally computed base 2 logarithm. At the ends + * of the approximation interval the logarithm equal 1/32 + * and its relative error is about 1 lsb = 1.1e-19. Hence + * the predicted relative error in the result is 2.3e-21 y . + * + * Relative error: + * arithmetic domain # trials peak rms + * + * IEEE +-1000 40000 2.8e-18 3.7e-19 + * .001 < x < 1000, with log(x) uniformly distributed. + * -1000 < y < 1000, y uniformly distributed. + * + * IEEE 0,8700 60000 6.5e-18 1.0e-18 + * 0.99 < x < 1.01, 0 < y < 8700, uniformly distributed. + * + * + * ERROR MESSAGES: + * + * message condition value returned + * pow overflow x**y > MAXNUM INFINITY + * pow underflow x**y < 1/MAXNUM 0.0 + * pow domain x<0 and y noninteger 0.0 + * + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double powl(long double x, long double y) +{ + return pow(x, y); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 + +/* Table size */ +#define NXT 32 + +/* log(1+x) = x - .5x^2 + x^3 * P(z)/Q(z) + * on the domain 2^(-1/32) - 1 <= x <= 2^(1/32) - 1 + */ +static const long double P[] = { + 8.3319510773868690346226E-4L, + 4.9000050881978028599627E-1L, + 1.7500123722550302671919E0L, + 1.4000100839971580279335E0L, +}; +static const long double Q[] = { +/* 1.0000000000000000000000E0L,*/ + 5.2500282295834889175431E0L, + 8.4000598057587009834666E0L, + 4.2000302519914740834728E0L, +}; +/* A[i] = 2^(-i/32), rounded to IEEE long double precision. + * If i is even, A[i] + B[i/2] gives additional accuracy. + */ +static const long double A[33] = { + 1.0000000000000000000000E0L, + 9.7857206208770013448287E-1L, + 9.5760328069857364691013E-1L, + 9.3708381705514995065011E-1L, + 9.1700404320467123175367E-1L, + 8.9735453750155359320742E-1L, + 8.7812608018664974155474E-1L, + 8.5930964906123895780165E-1L, + 8.4089641525371454301892E-1L, + 8.2287773907698242225554E-1L, + 8.0524516597462715409607E-1L, + 7.8799042255394324325455E-1L, + 7.7110541270397041179298E-1L, + 7.5458221379671136985669E-1L, + 7.3841307296974965571198E-1L, + 7.2259040348852331001267E-1L, + 7.0710678118654752438189E-1L, + 6.9195494098191597746178E-1L, + 6.7712777346844636413344E-1L, + 6.6261832157987064729696E-1L, + 6.4841977732550483296079E-1L, + 6.3452547859586661129850E-1L, + 6.2092890603674202431705E-1L, + 6.0762367999023443907803E-1L, + 5.9460355750136053334378E-1L, + 5.8186242938878875689693E-1L, + 5.6939431737834582684856E-1L, + 5.5719337129794626814472E-1L, + 5.4525386633262882960438E-1L, + 5.3357020033841180906486E-1L, + 5.2213689121370692017331E-1L, + 5.1094857432705833910408E-1L, + 5.0000000000000000000000E-1L, +}; +static const long double B[17] = { + 0.0000000000000000000000E0L, + 2.6176170809902549338711E-20L, +-1.0126791927256478897086E-20L, + 1.3438228172316276937655E-21L, + 1.2207982955417546912101E-20L, +-6.3084814358060867200133E-21L, + 1.3164426894366316434230E-20L, +-1.8527916071632873716786E-20L, + 1.8950325588932570796551E-20L, + 1.5564775779538780478155E-20L, + 6.0859793637556860974380E-21L, +-2.0208749253662532228949E-20L, + 1.4966292219224761844552E-20L, + 3.3540909728056476875639E-21L, +-8.6987564101742849540743E-22L, +-1.2327176863327626135542E-20L, + 0.0000000000000000000000E0L, +}; + +/* 2^x = 1 + x P(x), + * on the interval -1/32 <= x <= 0 + */ +static const long double R[] = { + 1.5089970579127659901157E-5L, + 1.5402715328927013076125E-4L, + 1.3333556028915671091390E-3L, + 9.6181291046036762031786E-3L, + 5.5504108664798463044015E-2L, + 2.4022650695910062854352E-1L, + 6.9314718055994530931447E-1L, +}; + +#define MEXP (NXT*16384.0L) +/* The following if denormal numbers are supported, else -MEXP: */ +#define MNEXP (-NXT*(16384.0L+64.0L)) +/* log2(e) - 1 */ +#define LOG2EA 0.44269504088896340735992L + +#define F W +#define Fa Wa +#define Fb Wb +#define G W +#define Ga Wa +#define Gb u +#define H W +#define Ha Wb +#define Hb Wb + +static const long double MAXLOGL = 1.1356523406294143949492E4L; +static const long double MINLOGL = -1.13994985314888605586758E4L; +static const long double LOGE2L = 6.9314718055994530941723E-1L; +static const long double huge = 0x1p10000L; +/* XXX Prevent gcc from erroneously constant folding this. */ +static const volatile long double twom10000 = 0x1p-10000L; + +static long double reducl(long double); +static long double powil(long double, int); + +long double powl(long double x, long double y) +{ + /* double F, Fa, Fb, G, Ga, Gb, H, Ha, Hb */ + int i, nflg, iyflg, yoddint; + long e; + volatile long double z=0; + long double w=0, W=0, Wa=0, Wb=0, ya=0, yb=0, u=0; + + /* make sure no invalid exception is raised by nan comparision */ + if (isnan(x)) { + if (!isnan(y) && y == 0.0) + return 1.0; + return x; + } + if (isnan(y)) { + if (x == 1.0) + return 1.0; + return y; + } + if (x == 1.0) + return 1.0; /* 1**y = 1, even if y is nan */ + if (x == -1.0 && !isfinite(y)) + return 1.0; /* -1**inf = 1 */ + if (y == 0.0) + return 1.0; /* x**0 = 1, even if x is nan */ + if (y == 1.0) + return x; + if (y >= LDBL_MAX) { + if (x > 1.0 || x < -1.0) + return INFINITY; + if (x != 0.0) + return 0.0; + } + if (y <= -LDBL_MAX) { + if (x > 1.0 || x < -1.0) + return 0.0; + if (x != 0.0 || y == -INFINITY) + return INFINITY; + } + if (x >= LDBL_MAX) { + if (y > 0.0) + return INFINITY; + return 0.0; + } + + w = floorl(y); + + /* Set iyflg to 1 if y is an integer. */ + iyflg = 0; + if (w == y) + iyflg = 1; + + /* Test for odd integer y. */ + yoddint = 0; + if (iyflg) { + ya = fabsl(y); + ya = floorl(0.5 * ya); + yb = 0.5 * fabsl(w); + if( ya != yb ) + yoddint = 1; + } + + if (x <= -LDBL_MAX) { + if (y > 0.0) { + if (yoddint) + return -INFINITY; + return INFINITY; + } + if (y < 0.0) { + if (yoddint) + return -0.0; + return 0.0; + } + } + nflg = 0; /* (x<0)**(odd int) */ + if (x <= 0.0) { + if (x == 0.0) { + if (y < 0.0) { + if (signbit(x) && yoddint) + /* (-0.0)**(-odd int) = -inf, divbyzero */ + return -1.0/0.0; + /* (+-0.0)**(negative) = inf, divbyzero */ + return 1.0/0.0; + } + if (signbit(x) && yoddint) + return -0.0; + return 0.0; + } + if (iyflg == 0) + return (x - x) / (x - x); /* (x<0)**(non-int) is NaN */ + /* (x<0)**(integer) */ + if (yoddint) + nflg = 1; /* negate result */ + x = -x; + } + /* (+integer)**(integer) */ + if (iyflg && floorl(x) == x && fabsl(y) < 32768.0) { + w = powil(x, (int)y); + return nflg ? -w : w; + } + + /* separate significand from exponent */ + x = frexpl(x, &i); + e = i; + + /* find significand in antilog table A[] */ + i = 1; + if (x <= A[17]) + i = 17; + if (x <= A[i+8]) + i += 8; + if (x <= A[i+4]) + i += 4; + if (x <= A[i+2]) + i += 2; + if (x >= A[1]) + i = -1; + i += 1; + + /* Find (x - A[i])/A[i] + * in order to compute log(x/A[i]): + * + * log(x) = log( a x/a ) = log(a) + log(x/a) + * + * log(x/a) = log(1+v), v = x/a - 1 = (x-a)/a + */ + x -= A[i]; + x -= B[i/2]; + x /= A[i]; + + /* rational approximation for log(1+v): + * + * log(1+v) = v - v**2/2 + v**3 P(v) / Q(v) + */ + z = x*x; + w = x * (z * __polevll(x, P, 3) / __p1evll(x, Q, 3)); + w = w - 0.5*z; + + /* Convert to base 2 logarithm: + * multiply by log2(e) = 1 + LOG2EA + */ + z = LOG2EA * w; + z += w; + z += LOG2EA * x; + z += x; + + /* Compute exponent term of the base 2 logarithm. */ + w = -i; + w /= NXT; + w += e; + /* Now base 2 log of x is w + z. */ + + /* Multiply base 2 log by y, in extended precision. */ + + /* separate y into large part ya + * and small part yb less than 1/NXT + */ + ya = reducl(y); + yb = y - ya; + + /* (w+z)(ya+yb) + * = w*ya + w*yb + z*y + */ + F = z * y + w * yb; + Fa = reducl(F); + Fb = F - Fa; + + G = Fa + w * ya; + Ga = reducl(G); + Gb = G - Ga; + + H = Fb + Gb; + Ha = reducl(H); + w = (Ga + Ha) * NXT; + + /* Test the power of 2 for overflow */ + if (w > MEXP) + return huge * huge; /* overflow */ + if (w < MNEXP) + return twom10000 * twom10000; /* underflow */ + + e = w; + Hb = H - Ha; + + if (Hb > 0.0) { + e += 1; + Hb -= 1.0/NXT; /*0.0625L;*/ + } + + /* Now the product y * log2(x) = Hb + e/NXT. + * + * Compute base 2 exponential of Hb, + * where -0.0625 <= Hb <= 0. + */ + z = Hb * __polevll(Hb, R, 6); /* z = 2**Hb - 1 */ + + /* Express e/NXT as an integer plus a negative number of (1/NXT)ths. + * Find lookup table entry for the fractional power of 2. + */ + if (e < 0) + i = 0; + else + i = 1; + i = e/NXT + i; + e = NXT*i - e; + w = A[e]; + z = w * z; /* 2**-e * ( 1 + (2**Hb-1) ) */ + z = z + w; + z = scalbnl(z, i); /* multiply by integer power of 2 */ + + if (nflg) + z = -z; + return z; +} + + +/* Find a multiple of 1/NXT that is within 1/NXT of x. */ +static long double reducl(long double x) +{ + long double t; + + t = x * NXT; + t = floorl(t); + t = t / NXT; + return t; +} + +/* + * Positive real raised to integer power, long double precision + * + * + * SYNOPSIS: + * + * long double x, y, powil(); + * int n; + * + * y = powil( x, n ); + * + * + * DESCRIPTION: + * + * Returns argument x>0 raised to the nth power. + * The routine efficiently decomposes n as a sum of powers of + * two. The desired power is a product of two-to-the-kth + * powers of x. Thus to compute the 32767 power of x requires + * 28 multiplications instead of 32767 multiplications. + * + * + * ACCURACY: + * + * Relative error: + * arithmetic x domain n domain # trials peak rms + * IEEE .001,1000 -1022,1023 50000 4.3e-17 7.8e-18 + * IEEE 1,2 -1022,1023 20000 3.9e-17 7.6e-18 + * IEEE .99,1.01 0,8700 10000 3.6e-16 7.2e-17 + * + * Returns MAXNUM on overflow, zero on underflow. + */ + +static long double powil(long double x, int nn) +{ + long double ww, y; + long double s; + int n, e, sign, lx; + + if (nn == 0) + return 1.0; + + if (nn < 0) { + sign = -1; + n = -nn; + } else { + sign = 1; + n = nn; + } + + /* Overflow detection */ + + /* Calculate approximate logarithm of answer */ + s = x; + s = frexpl( s, &lx); + e = (lx - 1)*n; + if ((e == 0) || (e > 64) || (e < -64)) { + s = (s - 7.0710678118654752e-1L) / (s + 7.0710678118654752e-1L); + s = (2.9142135623730950L * s - 0.5 + lx) * nn * LOGE2L; + } else { + s = LOGE2L * e; + } + + if (s > MAXLOGL) + return huge * huge; /* overflow */ + + if (s < MINLOGL) + return twom10000 * twom10000; /* underflow */ + /* Handle tiny denormal answer, but with less accuracy + * since roundoff error in 1.0/x will be amplified. + * The precise demarcation should be the gradual underflow threshold. + */ + if (s < -MAXLOGL+2.0) { + x = 1.0/x; + sign = -sign; + } + + /* First bit of the power */ + if (n & 1) + y = x; + else + y = 1.0; + + ww = x; + n >>= 1; + while (n) { + ww = ww * ww; /* arg to the 2-to-the-kth power */ + if (n & 1) /* if that bit is set, then include in product */ + y *= ww; + n >>= 1; + } + + if (sign < 0) + y = 1.0/y; + return y; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double powl(long double x, long double y) +{ + return pow(x, y); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/remainder.c b/lib/mlibc/options/ansi/musl-generic-math/remainder.c new file mode 100644 index 0000000..e4abcd7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/remainder.c @@ -0,0 +1,11 @@ +#include <math.h> +#include "weak_alias.h" +//#include "libc.h" + +double remainder(double x, double y) +{ + int q; + return remquo(x, y, &q); +} + +weak_alias(remainder, drem); diff --git a/lib/mlibc/options/ansi/musl-generic-math/remainderf.c b/lib/mlibc/options/ansi/musl-generic-math/remainderf.c new file mode 100644 index 0000000..e1fcdaa --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/remainderf.c @@ -0,0 +1,11 @@ +#include <math.h> +#include "weak_alias.h" +//#include "libc.h" + +float remainderf(float x, float y) +{ + int q; + return remquof(x, y, &q); +} + +weak_alias(remainderf, dremf); diff --git a/lib/mlibc/options/ansi/musl-generic-math/remainderl.c b/lib/mlibc/options/ansi/musl-generic-math/remainderl.c new file mode 100644 index 0000000..2a13c1d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/remainderl.c @@ -0,0 +1,15 @@ +#include <math.h> +#include <float.h> + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double remainderl(long double x, long double y) +{ + return remainder(x, y); +} +#else +long double remainderl(long double x, long double y) +{ + int q; + return remquol(x, y, &q); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/remquo.c b/lib/mlibc/options/ansi/musl-generic-math/remquo.c new file mode 100644 index 0000000..59d5ad5 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/remquo.c @@ -0,0 +1,82 @@ +#include <math.h> +#include <stdint.h> + +double remquo(double x, double y, int *quo) +{ + union {double f; uint64_t i;} ux = {x}, uy = {y}; + int ex = ux.i>>52 & 0x7ff; + int ey = uy.i>>52 & 0x7ff; + int sx = ux.i>>63; + int sy = uy.i>>63; + uint32_t q; + uint64_t i; + uint64_t uxi = ux.i; + + *quo = 0; + if (uy.i<<1 == 0 || isnan(y) || ex == 0x7ff) + return (x*y)/(x*y); + if (ux.i<<1 == 0) + return x; + + /* normalize x and y */ + if (!ex) { + for (i = uxi<<12; i>>63 == 0; ex--, i <<= 1); + uxi <<= -ex + 1; + } else { + uxi &= -1ULL >> 12; + uxi |= 1ULL << 52; + } + if (!ey) { + for (i = uy.i<<12; i>>63 == 0; ey--, i <<= 1); + uy.i <<= -ey + 1; + } else { + uy.i &= -1ULL >> 12; + uy.i |= 1ULL << 52; + } + + q = 0; + if (ex < ey) { + if (ex+1 == ey) + goto end; + return x; + } + + /* x mod y */ + for (; ex > ey; ex--) { + i = uxi - uy.i; + if (i >> 63 == 0) { + uxi = i; + q++; + } + uxi <<= 1; + q <<= 1; + } + i = uxi - uy.i; + if (i >> 63 == 0) { + uxi = i; + q++; + } + if (uxi == 0) + ex = -60; + else + for (; uxi>>52 == 0; uxi <<= 1, ex--); +end: + /* scale result and decide between |x| and |x|-|y| */ + if (ex > 0) { + uxi -= 1ULL << 52; + uxi |= (uint64_t)ex << 52; + } else { + uxi >>= -ex + 1; + } + ux.i = uxi; + x = ux.f; + if (sy) + y = -y; + if (ex == ey || (ex+1 == ey && (2*x > y || (2*x == y && q%2)))) { + x -= y; + q++; + } + q &= 0x7fffffff; + *quo = sx^sy ? -(int)q : (int)q; + return sx ? -x : x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/remquof.c b/lib/mlibc/options/ansi/musl-generic-math/remquof.c new file mode 100644 index 0000000..2f41ff7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/remquof.c @@ -0,0 +1,82 @@ +#include <math.h> +#include <stdint.h> + +float remquof(float x, float y, int *quo) +{ + union {float f; uint32_t i;} ux = {x}, uy = {y}; + int ex = ux.i>>23 & 0xff; + int ey = uy.i>>23 & 0xff; + int sx = ux.i>>31; + int sy = uy.i>>31; + uint32_t q; + uint32_t i; + uint32_t uxi = ux.i; + + *quo = 0; + if (uy.i<<1 == 0 || isnan(y) || ex == 0xff) + return (x*y)/(x*y); + if (ux.i<<1 == 0) + return x; + + /* normalize x and y */ + if (!ex) { + for (i = uxi<<9; i>>31 == 0; ex--, i <<= 1); + uxi <<= -ex + 1; + } else { + uxi &= -1U >> 9; + uxi |= 1U << 23; + } + if (!ey) { + for (i = uy.i<<9; i>>31 == 0; ey--, i <<= 1); + uy.i <<= -ey + 1; + } else { + uy.i &= -1U >> 9; + uy.i |= 1U << 23; + } + + q = 0; + if (ex < ey) { + if (ex+1 == ey) + goto end; + return x; + } + + /* x mod y */ + for (; ex > ey; ex--) { + i = uxi - uy.i; + if (i >> 31 == 0) { + uxi = i; + q++; + } + uxi <<= 1; + q <<= 1; + } + i = uxi - uy.i; + if (i >> 31 == 0) { + uxi = i; + q++; + } + if (uxi == 0) + ex = -30; + else + for (; uxi>>23 == 0; uxi <<= 1, ex--); +end: + /* scale result and decide between |x| and |x|-|y| */ + if (ex > 0) { + uxi -= 1U << 23; + uxi |= (uint32_t)ex << 23; + } else { + uxi >>= -ex + 1; + } + ux.i = uxi; + x = ux.f; + if (sy) + y = -y; + if (ex == ey || (ex+1 == ey && (2*x > y || (2*x == y && q%2)))) { + x -= y; + q++; + } + q &= 0x7fffffff; + *quo = sx^sy ? -(int)q : (int)q; + return sx ? -x : x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/remquol.c b/lib/mlibc/options/ansi/musl-generic-math/remquol.c new file mode 100644 index 0000000..9b065c0 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/remquol.c @@ -0,0 +1,124 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double remquol(long double x, long double y, int *quo) +{ + return remquo(x, y, quo); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double remquol(long double x, long double y, int *quo) +{ + union ldshape ux = {x}, uy = {y}; + int ex = ux.i.se & 0x7fff; + int ey = uy.i.se & 0x7fff; + int sx = ux.i.se >> 15; + int sy = uy.i.se >> 15; + uint32_t q; + + *quo = 0; + if (y == 0 || isnan(y) || ex == 0x7fff) + return (x*y)/(x*y); + if (x == 0) + return x; + + /* normalize x and y */ + if (!ex) { + ux.i.se = ex; + ux.f *= 0x1p120f; + ex = ux.i.se - 120; + } + if (!ey) { + uy.i.se = ey; + uy.f *= 0x1p120f; + ey = uy.i.se - 120; + } + + q = 0; + if (ex >= ey) { + /* x mod y */ +#if LDBL_MANT_DIG == 64 + uint64_t i, mx, my; + mx = ux.i.m; + my = uy.i.m; + for (; ex > ey; ex--) { + i = mx - my; + if (mx >= my) { + mx = 2*i; + q++; + q <<= 1; + } else if (2*mx < mx) { + mx = 2*mx - my; + q <<= 1; + q++; + } else { + mx = 2*mx; + q <<= 1; + } + } + i = mx - my; + if (mx >= my) { + mx = i; + q++; + } + if (mx == 0) + ex = -120; + else + for (; mx >> 63 == 0; mx *= 2, ex--); + ux.i.m = mx; +#elif LDBL_MANT_DIG == 113 + uint64_t hi, lo, xhi, xlo, yhi, ylo; + xhi = (ux.i2.hi & -1ULL>>16) | 1ULL<<48; + yhi = (uy.i2.hi & -1ULL>>16) | 1ULL<<48; + xlo = ux.i2.lo; + ylo = ux.i2.lo; + for (; ex > ey; ex--) { + hi = xhi - yhi; + lo = xlo - ylo; + if (xlo < ylo) + hi -= 1; + if (hi >> 63 == 0) { + xhi = 2*hi + (lo>>63); + xlo = 2*lo; + q++; + } else { + xhi = 2*xhi + (xlo>>63); + xlo = 2*xlo; + } + q <<= 1; + } + hi = xhi - yhi; + lo = xlo - ylo; + if (xlo < ylo) + hi -= 1; + if (hi >> 63 == 0) { + xhi = hi; + xlo = lo; + q++; + } + if ((xhi|xlo) == 0) + ex = -120; + else + for (; xhi >> 48 == 0; xhi = 2*xhi + (xlo>>63), xlo = 2*xlo, ex--); + ux.i2.hi = xhi; + ux.i2.lo = xlo; +#endif + } + + /* scale result and decide between |x| and |x|-|y| */ + if (ex <= 0) { + ux.i.se = ex + 120; + ux.f *= 0x1p-120f; + } else + ux.i.se = ex; + x = ux.f; + if (sy) + y = -y; + if (ex == ey || (ex+1 == ey && (2*x > y || (2*x == y && q%2)))) { + x -= y; + q++; + } + q &= 0x7fffffff; + *quo = sx^sy ? -(int)q : (int)q; + return sx ? -x : x; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/rint.c b/lib/mlibc/options/ansi/musl-generic-math/rint.c new file mode 100644 index 0000000..fbba390 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/rint.c @@ -0,0 +1,28 @@ +#include <float.h> +#include <math.h> +#include <stdint.h> + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const double_t toint = 1/EPS; + +double rint(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i>>52 & 0x7ff; + int s = u.i>>63; + double_t y; + + if (e >= 0x3ff+52) + return x; + if (s) + y = x - toint + toint; + else + y = x + toint - toint; + if (y == 0) + return s ? -0.0 : 0; + return y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/rintf.c b/lib/mlibc/options/ansi/musl-generic-math/rintf.c new file mode 100644 index 0000000..9047688 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/rintf.c @@ -0,0 +1,30 @@ +#include <float.h> +#include <math.h> +#include <stdint.h> + +#if FLT_EVAL_METHOD==0 +#define EPS FLT_EPSILON +#elif FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const float_t toint = 1/EPS; + +float rintf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = u.i>>23 & 0xff; + int s = u.i>>31; + float_t y; + + if (e >= 0x7f+23) + return x; + if (s) + y = x - toint + toint; + else + y = x + toint - toint; + if (y == 0) + return s ? -0.0f : 0.0f; + return y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/rintl.c b/lib/mlibc/options/ansi/musl-generic-math/rintl.c new file mode 100644 index 0000000..374327d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/rintl.c @@ -0,0 +1,29 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double rintl(long double x) +{ + return rint(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double rintl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + int s = u.i.se >> 15; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1) + return x; + if (s) + y = x - toint + toint; + else + y = x + toint - toint; + if (y == 0) + return 0*x; + return y; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/round.c b/lib/mlibc/options/ansi/musl-generic-math/round.c new file mode 100644 index 0000000..130d58d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/round.c @@ -0,0 +1,35 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const double_t toint = 1/EPS; + +double round(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = u.i >> 52 & 0x7ff; + double_t y; + + if (e >= 0x3ff+52) + return x; + if (u.i >> 63) + x = -x; + if (e < 0x3ff-1) { + /* raise inexact if x!=0 */ + FORCE_EVAL(x + toint); + return 0*u.f; + } + y = x + toint - toint - x; + if (y > 0.5) + y = y + x - 1; + else if (y <= -0.5) + y = y + x + 1; + else + y = y + x; + if (u.i >> 63) + y = -y; + return y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/roundf.c b/lib/mlibc/options/ansi/musl-generic-math/roundf.c new file mode 100644 index 0000000..e8210af --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/roundf.c @@ -0,0 +1,36 @@ +#include "libm.h" + +#if FLT_EVAL_METHOD==0 +#define EPS FLT_EPSILON +#elif FLT_EVAL_METHOD==1 +#define EPS DBL_EPSILON +#elif FLT_EVAL_METHOD==2 +#define EPS LDBL_EPSILON +#endif +static const float_t toint = 1/EPS; + +float roundf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = u.i >> 23 & 0xff; + float_t y; + + if (e >= 0x7f+23) + return x; + if (u.i >> 31) + x = -x; + if (e < 0x7f-1) { + FORCE_EVAL(x + toint); + return 0*u.f; + } + y = x + toint - toint - x; + if (y > 0.5f) + y = y + x - 1; + else if (y <= -0.5f) + y = y + x + 1; + else + y = y + x; + if (u.i >> 31) + y = -y; + return y; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/roundl.c b/lib/mlibc/options/ansi/musl-generic-math/roundl.c new file mode 100644 index 0000000..f4ff682 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/roundl.c @@ -0,0 +1,37 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double roundl(long double x) +{ + return round(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double roundl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1) + return x; + if (u.i.se >> 15) + x = -x; + if (e < 0x3fff-1) { + FORCE_EVAL(x + toint); + return 0*u.f; + } + y = x + toint - toint - x; + if (y > 0.5) + y = y + x - 1; + else if (y <= -0.5) + y = y + x + 1; + else + y = y + x; + if (u.i.se >> 15) + y = -y; + return y; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalb.c b/lib/mlibc/options/ansi/musl-generic-math/scalb.c new file mode 100644 index 0000000..efe69e6 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalb.c @@ -0,0 +1,35 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_scalb.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * scalb(x, fn) is provide for + * passing various standard test suite. One + * should use scalbn() instead. + */ + +#define _GNU_SOURCE +#include <math.h> + +double scalb(double x, double fn) +{ + if (isnan(x) || isnan(fn)) + return x*fn; + if (!isfinite(fn)) { + if (fn > 0.0) + return x*fn; + else + return x/(-fn); + } + if (rint(fn) != fn) return (fn-fn)/(fn-fn); + if ( fn > 65000.0) return scalbn(x, 65000); + if (-fn > 65000.0) return scalbn(x,-65000); + return scalbn(x,(int)fn); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalbf.c b/lib/mlibc/options/ansi/musl-generic-math/scalbf.c new file mode 100644 index 0000000..f44ed5b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalbf.c @@ -0,0 +1,32 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_scalbf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include <math.h> + +float scalbf(float x, float fn) +{ + if (isnan(x) || isnan(fn)) return x*fn; + if (!isfinite(fn)) { + if (fn > 0.0f) + return x*fn; + else + return x/(-fn); + } + if (rintf(fn) != fn) return (fn-fn)/(fn-fn); + if ( fn > 65000.0f) return scalbnf(x, 65000); + if (-fn > 65000.0f) return scalbnf(x,-65000); + return scalbnf(x,(int)fn); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalbln.c b/lib/mlibc/options/ansi/musl-generic-math/scalbln.c new file mode 100644 index 0000000..4fb3d06 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalbln.c @@ -0,0 +1,12 @@ +#include <limits.h> +#include <math.h> +#include "libm.h" + +double scalbln(double x, long n) +{ + if (n > INT_MAX) + n = INT_MAX; + else if (n < INT_MIN) + n = INT_MIN; + return scalbn(x, n); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalblnf.c b/lib/mlibc/options/ansi/musl-generic-math/scalblnf.c new file mode 100644 index 0000000..b6bdeed --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalblnf.c @@ -0,0 +1,12 @@ +#include <limits.h> +#include <math.h> +#include "libm.h" + +float scalblnf(float x, long n) +{ + if (n > INT_MAX) + n = INT_MAX; + else if (n < INT_MIN) + n = INT_MIN; + return scalbnf(x, n); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalblnl.c b/lib/mlibc/options/ansi/musl-generic-math/scalblnl.c new file mode 100644 index 0000000..b1a0f7f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalblnl.c @@ -0,0 +1,20 @@ +#include <limits.h> +#include <math.h> +#include <float.h> +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double scalblnl(long double x, long n) +{ + return scalbln(x, n); +} +#else +long double scalblnl(long double x, long n) +{ + if (n > INT_MAX) + n = INT_MAX; + else if (n < INT_MIN) + n = INT_MIN; + return scalbnl(x, n); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalbn.c b/lib/mlibc/options/ansi/musl-generic-math/scalbn.c new file mode 100644 index 0000000..182f561 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalbn.c @@ -0,0 +1,33 @@ +#include <math.h> +#include <stdint.h> + +double scalbn(double x, int n) +{ + union {double f; uint64_t i;} u; + double_t y = x; + + if (n > 1023) { + y *= 0x1p1023; + n -= 1023; + if (n > 1023) { + y *= 0x1p1023; + n -= 1023; + if (n > 1023) + n = 1023; + } + } else if (n < -1022) { + /* make sure final n < -53 to avoid double + rounding in the subnormal range */ + y *= 0x1p-1022 * 0x1p53; + n += 1022 - 53; + if (n < -1022) { + y *= 0x1p-1022 * 0x1p53; + n += 1022 - 53; + if (n < -1022) + n = -1022; + } + } + u.i = (uint64_t)(0x3ff+n)<<52; + x = y * u.f; + return x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalbnf.c b/lib/mlibc/options/ansi/musl-generic-math/scalbnf.c new file mode 100644 index 0000000..a5ad208 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalbnf.c @@ -0,0 +1,31 @@ +#include <math.h> +#include <stdint.h> + +float scalbnf(float x, int n) +{ + union {float f; uint32_t i;} u; + float_t y = x; + + if (n > 127) { + y *= 0x1p127f; + n -= 127; + if (n > 127) { + y *= 0x1p127f; + n -= 127; + if (n > 127) + n = 127; + } + } else if (n < -126) { + y *= 0x1p-126f * 0x1p24f; + n += 126 - 24; + if (n < -126) { + y *= 0x1p-126f * 0x1p24f; + n += 126 - 24; + if (n < -126) + n = -126; + } + } + u.i = (uint32_t)(0x7f+n)<<23; + x = y * u.f; + return x; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/scalbnl.c b/lib/mlibc/options/ansi/musl-generic-math/scalbnl.c new file mode 100644 index 0000000..db44dab --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/scalbnl.c @@ -0,0 +1,36 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double scalbnl(long double x, int n) +{ + return scalbn(x, n); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double scalbnl(long double x, int n) +{ + union ldshape u; + + if (n > 16383) { + x *= 0x1p16383L; + n -= 16383; + if (n > 16383) { + x *= 0x1p16383L; + n -= 16383; + if (n > 16383) + n = 16383; + } + } else if (n < -16382) { + x *= 0x1p-16382L * 0x1p113L; + n += 16382 - 113; + if (n < -16382) { + x *= 0x1p-16382L * 0x1p113L; + n += 16382 - 113; + if (n < -16382) + n = -16382; + } + } + u.f = 1.0; + u.i.se = 0x3fff + n; + return x * u.f; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/signgam.c b/lib/mlibc/options/ansi/musl-generic-math/signgam.c new file mode 100644 index 0000000..3a5b9f7 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/signgam.c @@ -0,0 +1,5 @@ +#include <math.h> +#include "weak_alias.h" +//#include "libc.h" + +int signgam = 0; diff --git a/lib/mlibc/options/ansi/musl-generic-math/significand.c b/lib/mlibc/options/ansi/musl-generic-math/significand.c new file mode 100644 index 0000000..40d9aa9 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/significand.c @@ -0,0 +1,7 @@ +#define _GNU_SOURCE +#include <math.h> + +double significand(double x) +{ + return scalbn(x, -ilogb(x)); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/significandf.c b/lib/mlibc/options/ansi/musl-generic-math/significandf.c new file mode 100644 index 0000000..8a697e1 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/significandf.c @@ -0,0 +1,7 @@ +#define _GNU_SOURCE +#include <math.h> + +float significandf(float x) +{ + return scalbnf(x, -ilogbf(x)); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sin.c b/lib/mlibc/options/ansi/musl-generic-math/sin.c new file mode 100644 index 0000000..055e215 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sin.c @@ -0,0 +1,78 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_sin.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* sin(x) + * Return sine function of x. + * + * kernel function: + * __sin ... sine function on [-pi/4,pi/4] + * __cos ... cose function on [-pi/4,pi/4] + * __rem_pio2 ... argument reduction routine + * + * Method. + * Let S,C and T denote the sin, cos and tan respectively on + * [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 + * in [-pi/4 , +pi/4], and let n = k mod 4. + * We have + * + * n sin(x) cos(x) tan(x) + * ---------------------------------------------------------- + * 0 S C T + * 1 C -S -1/T + * 2 -S -C T + * 3 -C S -1/T + * ---------------------------------------------------------- + * + * Special cases: + * Let trig be any of sin, cos, or tan. + * trig(+-INF) is NaN, with signals; + * trig(NaN) is that NaN; + * + * Accuracy: + * TRIG(x) returns trig(x) nearly rounded + */ + +#include "libm.h" + +double sin(double x) +{ + double y[2]; + uint32_t ix; + unsigned n; + + /* High word of x. */ + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* |x| ~< pi/4 */ + if (ix <= 0x3fe921fb) { + if (ix < 0x3e500000) { /* |x| < 2**-26 */ + /* raise inexact if x != 0 and underflow if subnormal*/ + FORCE_EVAL(ix < 0x00100000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __sin(x, 0.0, 0); + } + + /* sin(Inf or NaN) is NaN */ + if (ix >= 0x7ff00000) + return x - x; + + /* argument reduction needed */ + n = __rem_pio2(x, y); + switch (n&3) { + case 0: return __sin(y[0], y[1], 1); + case 1: return __cos(y[0], y[1]); + case 2: return -__sin(y[0], y[1], 1); + default: + return -__cos(y[0], y[1]); + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sincos.c b/lib/mlibc/options/ansi/musl-generic-math/sincos.c new file mode 100644 index 0000000..35b2d92 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sincos.c @@ -0,0 +1,69 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_sin.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include "libm.h" + +void sincos(double x, double *sin, double *cos) +{ + double y[2], s, c; + uint32_t ix; + unsigned n; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* |x| ~< pi/4 */ + if (ix <= 0x3fe921fb) { + /* if |x| < 2**-27 * sqrt(2) */ + if (ix < 0x3e46a09e) { + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00100000 ? x/0x1p120f : x+0x1p120f); + *sin = x; + *cos = 1.0; + return; + } + *sin = __sin(x, 0.0, 0); + *cos = __cos(x, 0.0); + return; + } + + /* sincos(Inf or NaN) is NaN */ + if (ix >= 0x7ff00000) { + *sin = *cos = x - x; + return; + } + + /* argument reduction needed */ + n = __rem_pio2(x, y); + s = __sin(y[0], y[1], 1); + c = __cos(y[0], y[1]); + switch (n&3) { + case 0: + *sin = s; + *cos = c; + break; + case 1: + *sin = c; + *cos = -s; + break; + case 2: + *sin = -s; + *cos = -c; + break; + case 3: + default: + *sin = -c; + *cos = s; + break; + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sincosf.c b/lib/mlibc/options/ansi/musl-generic-math/sincosf.c new file mode 100644 index 0000000..f8ca723 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sincosf.c @@ -0,0 +1,117 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_sinf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#define _GNU_SOURCE +#include "libm.h" + +/* Small multiples of pi/2 rounded to double precision. */ +static const double +s1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ +s2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ +s3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ +s4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + +void sincosf(float x, float *sin, float *cos) +{ + double y; + float_t s, c; + uint32_t ix; + unsigned n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + /* |x| ~<= pi/4 */ + if (ix <= 0x3f490fda) { + /* |x| < 2**-12 */ + if (ix < 0x39800000) { + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00100000 ? x/0x1p120f : x+0x1p120f); + *sin = x; + *cos = 1.0f; + return; + } + *sin = __sindf(x); + *cos = __cosdf(x); + return; + } + + /* |x| ~<= 5*pi/4 */ + if (ix <= 0x407b53d1) { + if (ix <= 0x4016cbe3) { /* |x| ~<= 3pi/4 */ + if (sign) { + *sin = -__cosdf(x + s1pio2); + *cos = __sindf(x + s1pio2); + } else { + *sin = __cosdf(s1pio2 - x); + *cos = __sindf(s1pio2 - x); + } + return; + } + /* -sin(x+c) is not correct if x+c could be 0: -0 vs +0 */ + *sin = -__sindf(sign ? x + s2pio2 : x - s2pio2); + *cos = -__cosdf(sign ? x + s2pio2 : x - s2pio2); + return; + } + + /* |x| ~<= 9*pi/4 */ + if (ix <= 0x40e231d5) { + if (ix <= 0x40afeddf) { /* |x| ~<= 7*pi/4 */ + if (sign) { + *sin = __cosdf(x + s3pio2); + *cos = -__sindf(x + s3pio2); + } else { + *sin = -__cosdf(x - s3pio2); + *cos = __sindf(x - s3pio2); + } + return; + } + *sin = __sindf(sign ? x + s4pio2 : x - s4pio2); + *cos = __cosdf(sign ? x + s4pio2 : x - s4pio2); + return; + } + + /* sin(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) { + *sin = *cos = x - x; + return; + } + + /* general argument reduction needed */ + n = __rem_pio2f(x, &y); + s = __sindf(y); + c = __cosdf(y); + switch (n&3) { + case 0: + *sin = s; + *cos = c; + break; + case 1: + *sin = c; + *cos = -s; + break; + case 2: + *sin = -s; + *cos = -c; + break; + case 3: + default: + *sin = -c; + *cos = s; + break; + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sincosl.c b/lib/mlibc/options/ansi/musl-generic-math/sincosl.c new file mode 100644 index 0000000..d3ac1c4 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sincosl.c @@ -0,0 +1,60 @@ +#define _GNU_SOURCE +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +void sincosl(long double x, long double *sin, long double *cos) +{ + double sind, cosd; + sincos(x, &sind, &cosd); + *sin = sind; + *cos = cosd; +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +void sincosl(long double x, long double *sin, long double *cos) +{ + union ldshape u = {x}; + unsigned n; + long double y[2], s, c; + + u.i.se &= 0x7fff; + if (u.i.se == 0x7fff) { + *sin = *cos = x - x; + return; + } + if (u.f < M_PI_4) { + if (u.i.se < 0x3fff - LDBL_MANT_DIG) { + /* raise underflow if subnormal */ + if (u.i.se == 0) FORCE_EVAL(x*0x1p-120f); + *sin = x; + /* raise inexact if x!=0 */ + *cos = 1.0 + x; + return; + } + *sin = __sinl(x, 0, 0); + *cos = __cosl(x, 0); + return; + } + n = __rem_pio2l(x, y); + s = __sinl(y[0], y[1], 1); + c = __cosl(y[0], y[1]); + switch (n & 3) { + case 0: + *sin = s; + *cos = c; + break; + case 1: + *sin = c; + *cos = -s; + break; + case 2: + *sin = -s; + *cos = -c; + break; + case 3: + default: + *sin = -c; + *cos = s; + break; + } +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/sinf.c b/lib/mlibc/options/ansi/musl-generic-math/sinf.c new file mode 100644 index 0000000..64e39f5 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sinf.c @@ -0,0 +1,76 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_sinf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* Small multiples of pi/2 rounded to double precision. */ +static const double +s1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ +s2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ +s3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ +s4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + +float sinf(float x) +{ + double y; + uint32_t ix; + int n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00800000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __sindf(x); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix <= 0x4016cbe3) { /* |x| ~<= 3pi/4 */ + if (sign) + return -__cosdf(x + s1pio2); + else + return __cosdf(x - s1pio2); + } + return __sindf(sign ? -(x + s2pio2) : -(x - s2pio2)); + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix <= 0x40afeddf) { /* |x| ~<= 7*pi/4 */ + if (sign) + return __cosdf(x + s3pio2); + else + return -__cosdf(x - s3pio2); + } + return __sindf(sign ? x + s4pio2 : x - s4pio2); + } + + /* sin(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x - x; + + /* general argument reduction needed */ + n = __rem_pio2f(x, &y); + switch (n&3) { + case 0: return __sindf(y); + case 1: return __cosdf(y); + case 2: return __sindf(-y); + default: + return -__cosdf(y); + } +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sinh.c b/lib/mlibc/options/ansi/musl-generic-math/sinh.c new file mode 100644 index 0000000..00022c4 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sinh.c @@ -0,0 +1,39 @@ +#include "libm.h" + +/* sinh(x) = (exp(x) - 1/exp(x))/2 + * = (exp(x)-1 + (exp(x)-1)/exp(x))/2 + * = x + x^3/6 + o(x^5) + */ +double sinh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + uint32_t w; + double t, h, absx; + + h = 0.5; + if (u.i >> 63) + h = -h; + /* |x| */ + u.i &= (uint64_t)-1/2; + absx = u.f; + w = u.i >> 32; + + /* |x| < log(DBL_MAX) */ + if (w < 0x40862e42) { + t = expm1(absx); + if (w < 0x3ff00000) { + if (w < 0x3ff00000 - (26<<20)) + /* note: inexact and underflow are raised by expm1 */ + /* note: this branch avoids spurious underflow */ + return x; + return h*(2*t - t*t/(t+1)); + } + /* note: |x|>log(0x1p26)+eps could be just h*exp(x) */ + return h*(t + t/(t+1)); + } + + /* |x| > log(DBL_MAX) or nan */ + /* note: the result is stored to handle overflow */ + t = 2*h*__expo2(absx); + return t; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sinhf.c b/lib/mlibc/options/ansi/musl-generic-math/sinhf.c new file mode 100644 index 0000000..6ad19ea --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sinhf.c @@ -0,0 +1,31 @@ +#include "libm.h" + +float sinhf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + uint32_t w; + float t, h, absx; + + h = 0.5; + if (u.i >> 31) + h = -h; + /* |x| */ + u.i &= 0x7fffffff; + absx = u.f; + w = u.i; + + /* |x| < log(FLT_MAX) */ + if (w < 0x42b17217) { + t = expm1f(absx); + if (w < 0x3f800000) { + if (w < 0x3f800000 - (12<<23)) + return x; + return h*(2*t - t*t/(t+1)); + } + return h*(t + t/(t+1)); + } + + /* |x| > logf(FLT_MAX) or nan */ + t = 2*h*__expo2f(absx); + return t; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sinhl.c b/lib/mlibc/options/ansi/musl-generic-math/sinhl.c new file mode 100644 index 0000000..b305d4d --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sinhl.c @@ -0,0 +1,43 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double sinhl(long double x) +{ + return sinh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +long double sinhl(long double x) +{ + union ldshape u = {x}; + unsigned ex = u.i.se & 0x7fff; + long double h, t, absx; + + h = 0.5; + if (u.i.se & 0x8000) + h = -h; + /* |x| */ + u.i.se = ex; + absx = u.f; + + /* |x| < log(LDBL_MAX) */ + if (ex < 0x3fff+13 || (ex == 0x3fff+13 && u.i.m>>32 < 0xb17217f7)) { + t = expm1l(absx); + if (ex < 0x3fff) { + if (ex < 0x3fff-32) + return x; + return h*(2*t - t*t/(1+t)); + } + return h*(t + t/(t+1)); + } + + /* |x| > log(LDBL_MAX) or nan */ + t = expl(0.5*absx); + return h*t*t; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double sinhl(long double x) +{ + return sinh(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/sinl.c b/lib/mlibc/options/ansi/musl-generic-math/sinl.c new file mode 100644 index 0000000..9c0b16e --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sinl.c @@ -0,0 +1,41 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double sinl(long double x) +{ + return sin(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double sinl(long double x) +{ + union ldshape u = {x}; + unsigned n; + long double y[2], hi, lo; + + u.i.se &= 0x7fff; + if (u.i.se == 0x7fff) + return x - x; + if (u.f < M_PI_4) { + if (u.i.se < 0x3fff - LDBL_MANT_DIG/2) { + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(u.i.se == 0 ? x*0x1p-120f : x+0x1p120f); + return x; + } + return __sinl(x, 0.0, 0); + } + n = __rem_pio2l(x, y); + hi = y[0]; + lo = y[1]; + switch (n & 3) { + case 0: + return __sinl(hi, lo, 1); + case 1: + return __cosl(hi, lo); + case 2: + return -__sinl(hi, lo, 1); + case 3: + default: + return -__cosl(hi, lo); + } +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/sqrt.c b/lib/mlibc/options/ansi/musl-generic-math/sqrt.c new file mode 100644 index 0000000..b277567 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sqrt.c @@ -0,0 +1,185 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_sqrt.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunSoft, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* sqrt(x) + * Return correctly rounded sqrt. + * ------------------------------------------ + * | Use the hardware sqrt if you have one | + * ------------------------------------------ + * Method: + * Bit by bit method using integer arithmetic. (Slow, but portable) + * 1. Normalization + * Scale x to y in [1,4) with even powers of 2: + * find an integer k such that 1 <= (y=x*2^(2k)) < 4, then + * sqrt(x) = 2^k * sqrt(y) + * 2. Bit by bit computation + * Let q = sqrt(y) truncated to i bit after binary point (q = 1), + * i 0 + * i+1 2 + * s = 2*q , and y = 2 * ( y - q ). (1) + * i i i i + * + * To compute q from q , one checks whether + * i+1 i + * + * -(i+1) 2 + * (q + 2 ) <= y. (2) + * i + * -(i+1) + * If (2) is false, then q = q ; otherwise q = q + 2 . + * i+1 i i+1 i + * + * With some algebric manipulation, it is not difficult to see + * that (2) is equivalent to + * -(i+1) + * s + 2 <= y (3) + * i i + * + * The advantage of (3) is that s and y can be computed by + * i i + * the following recurrence formula: + * if (3) is false + * + * s = s , y = y ; (4) + * i+1 i i+1 i + * + * otherwise, + * -i -(i+1) + * s = s + 2 , y = y - s - 2 (5) + * i+1 i i+1 i i + * + * One may easily use induction to prove (4) and (5). + * Note. Since the left hand side of (3) contain only i+2 bits, + * it does not necessary to do a full (53-bit) comparison + * in (3). + * 3. Final rounding + * After generating the 53 bits result, we compute one more bit. + * Together with the remainder, we can decide whether the + * result is exact, bigger than 1/2ulp, or less than 1/2ulp + * (it will never equal to 1/2ulp). + * The rounding mode can be detected by checking whether + * huge + tiny is equal to huge, and whether huge - tiny is + * equal to huge for some floating point number "huge" and "tiny". + * + * Special cases: + * sqrt(+-0) = +-0 ... exact + * sqrt(inf) = inf + * sqrt(-ve) = NaN ... with invalid signal + * sqrt(NaN) = NaN ... with invalid signal for signaling NaN + */ + +#include "libm.h" + +static const double tiny = 1.0e-300; + +double sqrt(double x) +{ + double z; + int32_t sign = (int)0x80000000; + int32_t ix0,s0,q,m,t,i; + uint32_t r,t1,s1,ix1,q1; + + EXTRACT_WORDS(ix0, ix1, x); + + /* take care of Inf and NaN */ + if ((ix0&0x7ff00000) == 0x7ff00000) { + return x*x + x; /* sqrt(NaN)=NaN, sqrt(+inf)=+inf, sqrt(-inf)=sNaN */ + } + /* take care of zero */ + if (ix0 <= 0) { + if (((ix0&~sign)|ix1) == 0) + return x; /* sqrt(+-0) = +-0 */ + if (ix0 < 0) + return (x-x)/(x-x); /* sqrt(-ve) = sNaN */ + } + /* normalize x */ + m = ix0>>20; + if (m == 0) { /* subnormal x */ + while (ix0 == 0) { + m -= 21; + ix0 |= (ix1>>11); + ix1 <<= 21; + } + for (i=0; (ix0&0x00100000) == 0; i++) + ix0<<=1; + m -= i - 1; + ix0 |= ix1>>(32-i); + ix1 <<= i; + } + m -= 1023; /* unbias exponent */ + ix0 = (ix0&0x000fffff)|0x00100000; + if (m & 1) { /* odd m, double x to make it even */ + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + } + m >>= 1; /* m = [m/2] */ + + /* generate sqrt(x) bit by bit */ + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + q = q1 = s0 = s1 = 0; /* [q,q1] = sqrt(x) */ + r = 0x00200000; /* r = moving bit from right to left */ + + while (r != 0) { + t = s0 + r; + if (t <= ix0) { + s0 = t + r; + ix0 -= t; + q += r; + } + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + r >>= 1; + } + + r = sign; + while (r != 0) { + t1 = s1 + r; + t = s0; + if (t < ix0 || (t == ix0 && t1 <= ix1)) { + s1 = t1 + r; + if ((t1&sign) == sign && (s1&sign) == 0) + s0++; + ix0 -= t; + if (ix1 < t1) + ix0--; + ix1 -= t1; + q1 += r; + } + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + r >>= 1; + } + + /* use floating add to find out rounding direction */ + if ((ix0|ix1) != 0) { + z = 1.0 - tiny; /* raise inexact flag */ + if (z >= 1.0) { + z = 1.0 + tiny; + if (q1 == (uint32_t)0xffffffff) { + q1 = 0; + q++; + } else if (z > 1.0) { + if (q1 == (uint32_t)0xfffffffe) + q++; + q1 += 2; + } else + q1 += q1 & 1; + } + } + ix0 = (q>>1) + 0x3fe00000; + ix1 = q1>>1; + if (q&1) + ix1 |= sign; + ix0 += m << 20; + INSERT_WORDS(z, ix0, ix1); + return z; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sqrtf.c b/lib/mlibc/options/ansi/musl-generic-math/sqrtf.c new file mode 100644 index 0000000..28cb4ad --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sqrtf.c @@ -0,0 +1,84 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/e_sqrtf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +static const float tiny = 1.0e-30; + +float sqrtf(float x) +{ + float z; + int32_t sign = (int)0x80000000; + int32_t ix,s,q,m,t,i; + uint32_t r; + + GET_FLOAT_WORD(ix, x); + + /* take care of Inf and NaN */ + if ((ix&0x7f800000) == 0x7f800000) + return x*x + x; /* sqrt(NaN)=NaN, sqrt(+inf)=+inf, sqrt(-inf)=sNaN */ + + /* take care of zero */ + if (ix <= 0) { + if ((ix&~sign) == 0) + return x; /* sqrt(+-0) = +-0 */ + if (ix < 0) + return (x-x)/(x-x); /* sqrt(-ve) = sNaN */ + } + /* normalize x */ + m = ix>>23; + if (m == 0) { /* subnormal x */ + for (i = 0; (ix&0x00800000) == 0; i++) + ix<<=1; + m -= i - 1; + } + m -= 127; /* unbias exponent */ + ix = (ix&0x007fffff)|0x00800000; + if (m&1) /* odd m, double x to make it even */ + ix += ix; + m >>= 1; /* m = [m/2] */ + + /* generate sqrt(x) bit by bit */ + ix += ix; + q = s = 0; /* q = sqrt(x) */ + r = 0x01000000; /* r = moving bit from right to left */ + + while (r != 0) { + t = s + r; + if (t <= ix) { + s = t+r; + ix -= t; + q += r; + } + ix += ix; + r >>= 1; + } + + /* use floating add to find out rounding direction */ + if (ix != 0) { + z = 1.0f - tiny; /* raise inexact flag */ + if (z >= 1.0f) { + z = 1.0f + tiny; + if (z > 1.0f) + q += 2; + else + q += q & 1; + } + } + ix = (q>>1) + 0x3f000000; + ix += m << 23; + SET_FLOAT_WORD(z, ix); + return z; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/sqrtl.c b/lib/mlibc/options/ansi/musl-generic-math/sqrtl.c new file mode 100644 index 0000000..83a8f80 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/sqrtl.c @@ -0,0 +1,7 @@ +#include <math.h> + +long double sqrtl(long double x) +{ + /* FIXME: implement in C, this is for LDBL_MANT_DIG == 64 only */ + return sqrt(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/tan.c b/lib/mlibc/options/ansi/musl-generic-math/tan.c new file mode 100644 index 0000000..9c724a4 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tan.c @@ -0,0 +1,70 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_tan.c */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* tan(x) + * Return tangent function of x. + * + * kernel function: + * __tan ... tangent function on [-pi/4,pi/4] + * __rem_pio2 ... argument reduction routine + * + * Method. + * Let S,C and T denote the sin, cos and tan respectively on + * [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 + * in [-pi/4 , +pi/4], and let n = k mod 4. + * We have + * + * n sin(x) cos(x) tan(x) + * ---------------------------------------------------------- + * 0 S C T + * 1 C -S -1/T + * 2 -S -C T + * 3 -C S -1/T + * ---------------------------------------------------------- + * + * Special cases: + * Let trig be any of sin, cos, or tan. + * trig(+-INF) is NaN, with signals; + * trig(NaN) is that NaN; + * + * Accuracy: + * TRIG(x) returns trig(x) nearly rounded + */ + +#include "libm.h" + +double tan(double x) +{ + double y[2]; + uint32_t ix; + unsigned n; + + GET_HIGH_WORD(ix, x); + ix &= 0x7fffffff; + + /* |x| ~< pi/4 */ + if (ix <= 0x3fe921fb) { + if (ix < 0x3e400000) { /* |x| < 2**-27 */ + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00100000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __tan(x, 0.0, 0); + } + + /* tan(Inf or NaN) is NaN */ + if (ix >= 0x7ff00000) + return x - x; + + /* argument reduction */ + n = __rem_pio2(x, y); + return __tan(y[0], y[1], n&1); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/tanf.c b/lib/mlibc/options/ansi/musl-generic-math/tanf.c new file mode 100644 index 0000000..aba1977 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tanf.c @@ -0,0 +1,64 @@ +/* origin: FreeBSD /usr/src/lib/msun/src/s_tanf.c */ +/* + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + * Optimized by Bruce D. Evans. + */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "libm.h" + +/* Small multiples of pi/2 rounded to double precision. */ +static const double +t1pio2 = 1*M_PI_2, /* 0x3FF921FB, 0x54442D18 */ +t2pio2 = 2*M_PI_2, /* 0x400921FB, 0x54442D18 */ +t3pio2 = 3*M_PI_2, /* 0x4012D97C, 0x7F3321D2 */ +t4pio2 = 4*M_PI_2; /* 0x401921FB, 0x54442D18 */ + +float tanf(float x) +{ + double y; + uint32_t ix; + unsigned n, sign; + + GET_FLOAT_WORD(ix, x); + sign = ix >> 31; + ix &= 0x7fffffff; + + if (ix <= 0x3f490fda) { /* |x| ~<= pi/4 */ + if (ix < 0x39800000) { /* |x| < 2**-12 */ + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(ix < 0x00800000 ? x/0x1p120f : x+0x1p120f); + return x; + } + return __tandf(x, 0); + } + if (ix <= 0x407b53d1) { /* |x| ~<= 5*pi/4 */ + if (ix <= 0x4016cbe3) /* |x| ~<= 3pi/4 */ + return __tandf((sign ? x+t1pio2 : x-t1pio2), 1); + else + return __tandf((sign ? x+t2pio2 : x-t2pio2), 0); + } + if (ix <= 0x40e231d5) { /* |x| ~<= 9*pi/4 */ + if (ix <= 0x40afeddf) /* |x| ~<= 7*pi/4 */ + return __tandf((sign ? x+t3pio2 : x-t3pio2), 1); + else + return __tandf((sign ? x+t4pio2 : x-t4pio2), 0); + } + + /* tan(Inf or NaN) is NaN */ + if (ix >= 0x7f800000) + return x - x; + + /* argument reduction */ + n = __rem_pio2f(x, &y); + return __tandf(y, n&1); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/tanh.c b/lib/mlibc/options/ansi/musl-generic-math/tanh.c new file mode 100644 index 0000000..20d6dbc --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tanh.c @@ -0,0 +1,45 @@ +#include "libm.h" + +/* tanh(x) = (exp(x) - exp(-x))/(exp(x) + exp(-x)) + * = (exp(2*x) - 1)/(exp(2*x) - 1 + 2) + * = (1 - exp(-2*x))/(exp(-2*x) - 1 + 2) + */ +double tanh(double x) +{ + union {double f; uint64_t i;} u = {.f = x}; + uint32_t w; + int sign; + double_t t; + + /* x = |x| */ + sign = u.i >> 63; + u.i &= (uint64_t)-1/2; + x = u.f; + w = u.i >> 32; + + if (w > 0x3fe193ea) { + /* |x| > log(3)/2 ~= 0.5493 or nan */ + if (w > 0x40340000) { + /* |x| > 20 or nan */ + /* note: this branch avoids raising overflow */ + t = 1 - 0/x; + } else { + t = expm1(2*x); + t = 1 - 2/(t+2); + } + } else if (w > 0x3fd058ae) { + /* |x| > log(5/3)/2 ~= 0.2554 */ + t = expm1(2*x); + t = t/(t+2); + } else if (w >= 0x00100000) { + /* |x| >= 0x1p-1022, up to 2ulp error in [0.1,0.2554] */ + t = expm1(-2*x); + t = -t/(t+2); + } else { + /* |x| is subnormal */ + /* note: the branch above would not raise underflow in [0x1p-1023,0x1p-1022) */ + FORCE_EVAL((float)x); + t = x; + } + return sign ? -t : t; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/tanhf.c b/lib/mlibc/options/ansi/musl-generic-math/tanhf.c new file mode 100644 index 0000000..10636fb --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tanhf.c @@ -0,0 +1,39 @@ +#include "libm.h" + +float tanhf(float x) +{ + union {float f; uint32_t i;} u = {.f = x}; + uint32_t w; + int sign; + float t; + + /* x = |x| */ + sign = u.i >> 31; + u.i &= 0x7fffffff; + x = u.f; + w = u.i; + + if (w > 0x3f0c9f54) { + /* |x| > log(3)/2 ~= 0.5493 or nan */ + if (w > 0x41200000) { + /* |x| > 10 */ + t = 1 + 0/x; + } else { + t = expm1f(2*x); + t = 1 - 2/(t+2); + } + } else if (w > 0x3e82c578) { + /* |x| > log(5/3)/2 ~= 0.2554 */ + t = expm1f(2*x); + t = t/(t+2); + } else if (w >= 0x00800000) { + /* |x| >= 0x1p-126 */ + t = expm1f(-2*x); + t = -t/(t+2); + } else { + /* |x| is subnormal */ + FORCE_EVAL(x*x); + t = x; + } + return sign ? -t : t; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/tanhl.c b/lib/mlibc/options/ansi/musl-generic-math/tanhl.c new file mode 100644 index 0000000..4e1aa9f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tanhl.c @@ -0,0 +1,48 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double tanhl(long double x) +{ + return tanh(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +long double tanhl(long double x) +{ + union ldshape u = {x}; + unsigned ex = u.i.se & 0x7fff; + unsigned sign = u.i.se & 0x8000; + uint32_t w; + long double t; + + /* x = |x| */ + u.i.se = ex; + x = u.f; + w = u.i.m >> 32; + + if (ex > 0x3ffe || (ex == 0x3ffe && w > 0x8c9f53d5)) { + /* |x| > log(3)/2 ~= 0.5493 or nan */ + if (ex >= 0x3fff+5) { + /* |x| >= 32 */ + t = 1 + 0/(x + 0x1p-120f); + } else { + t = expm1l(2*x); + t = 1 - 2/(t+2); + } + } else if (ex > 0x3ffd || (ex == 0x3ffd && w > 0x82c577d4)) { + /* |x| > log(5/3)/2 ~= 0.2554 */ + t = expm1l(2*x); + t = t/(t+2); + } else { + /* |x| is small */ + t = expm1l(-2*x); + t = -t/(t+2); + } + return sign ? -t : t; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double tanhl(long double x) +{ + return tanh(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/tanl.c b/lib/mlibc/options/ansi/musl-generic-math/tanl.c new file mode 100644 index 0000000..6af0671 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tanl.c @@ -0,0 +1,29 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double tanl(long double x) +{ + return tan(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 +long double tanl(long double x) +{ + union ldshape u = {x}; + long double y[2]; + unsigned n; + + u.i.se &= 0x7fff; + if (u.i.se == 0x7fff) + return x - x; + if (u.f < M_PI_4) { + if (u.i.se < 0x3fff - LDBL_MANT_DIG/2) { + /* raise inexact if x!=0 and underflow if subnormal */ + FORCE_EVAL(u.i.se == 0 ? x*0x1p-120f : x+0x1p120f); + return x; + } + return __tanl(x, 0, 0); + } + n = __rem_pio2l(x, y); + return __tanl(y[0], y[1], n&1); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/tgamma.c b/lib/mlibc/options/ansi/musl-generic-math/tgamma.c new file mode 100644 index 0000000..28f6e0f --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tgamma.c @@ -0,0 +1,222 @@ +/* +"A Precision Approximation of the Gamma Function" - Cornelius Lanczos (1964) +"Lanczos Implementation of the Gamma Function" - Paul Godfrey (2001) +"An Analysis of the Lanczos Gamma Approximation" - Glendon Ralph Pugh (2004) + +approximation method: + + (x - 0.5) S(x) +Gamma(x) = (x + g - 0.5) * ---------------- + exp(x + g - 0.5) + +with + a1 a2 a3 aN +S(x) ~= [ a0 + ----- + ----- + ----- + ... + ----- ] + x + 1 x + 2 x + 3 x + N + +with a0, a1, a2, a3,.. aN constants which depend on g. + +for x < 0 the following reflection formula is used: + +Gamma(x)*Gamma(-x) = -pi/(x sin(pi x)) + +most ideas and constants are from boost and python +*/ +#include "libm.h" + +static const double pi = 3.141592653589793238462643383279502884; + +/* sin(pi x) with x > 0x1p-100, if sin(pi*x)==0 the sign is arbitrary */ +static double sinpi(double x) +{ + int n; + + /* argument reduction: x = |x| mod 2 */ + /* spurious inexact when x is odd int */ + x = x * 0.5; + x = 2 * (x - floor(x)); + + /* reduce x into [-.25,.25] */ + n = 4 * x; + n = (n+1)/2; + x -= n * 0.5; + + x *= pi; + switch (n) { + default: /* case 4 */ + case 0: + return __sin(x, 0, 0); + case 1: + return __cos(x, 0); + case 2: + return __sin(-x, 0, 0); + case 3: + return -__cos(x, 0); + } +} + +#define N 12 +//static const double g = 6.024680040776729583740234375; +static const double gmhalf = 5.524680040776729583740234375; +static const double Snum[N+1] = { + 23531376880.410759688572007674451636754734846804940, + 42919803642.649098768957899047001988850926355848959, + 35711959237.355668049440185451547166705960488635843, + 17921034426.037209699919755754458931112671403265390, + 6039542586.3520280050642916443072979210699388420708, + 1439720407.3117216736632230727949123939715485786772, + 248874557.86205415651146038641322942321632125127801, + 31426415.585400194380614231628318205362874684987640, + 2876370.6289353724412254090516208496135991145378768, + 186056.26539522349504029498971604569928220784236328, + 8071.6720023658162106380029022722506138218516325024, + 210.82427775157934587250973392071336271166969580291, + 2.5066282746310002701649081771338373386264310793408, +}; +static const double Sden[N+1] = { + 0, 39916800, 120543840, 150917976, 105258076, 45995730, 13339535, + 2637558, 357423, 32670, 1925, 66, 1, +}; +/* n! for small integer n */ +static const double fact[] = { + 1, 1, 2, 6, 24, 120, 720, 5040.0, 40320.0, 362880.0, 3628800.0, 39916800.0, + 479001600.0, 6227020800.0, 87178291200.0, 1307674368000.0, 20922789888000.0, + 355687428096000.0, 6402373705728000.0, 121645100408832000.0, + 2432902008176640000.0, 51090942171709440000.0, 1124000727777607680000.0, +}; + +/* S(x) rational function for positive x */ +static double S(double x) +{ + double_t num = 0, den = 0; + int i; + + /* to avoid overflow handle large x differently */ + if (x < 8) + for (i = N; i >= 0; i--) { + num = num * x + Snum[i]; + den = den * x + Sden[i]; + } + else + for (i = 0; i <= N; i++) { + num = num / x + Snum[i]; + den = den / x + Sden[i]; + } + return num/den; +} + +double tgamma(double x) +{ + union {double f; uint64_t i;} u = {x}; + double absx, y; + double_t dy, z, r; + uint32_t ix = u.i>>32 & 0x7fffffff; + int sign = u.i>>63; + + /* special cases */ + if (ix >= 0x7ff00000) + /* tgamma(nan)=nan, tgamma(inf)=inf, tgamma(-inf)=nan with invalid */ + return x + INFINITY; + if (ix < (0x3ff-54)<<20) + /* |x| < 2^-54: tgamma(x) ~ 1/x, +-0 raises div-by-zero */ + return 1/x; + + /* integer arguments */ + /* raise inexact when non-integer */ + if (x == floor(x)) { + if (sign) + return 0/0.0; + if (x <= sizeof fact/sizeof *fact) + return fact[(int)x - 1]; + } + + /* x >= 172: tgamma(x)=inf with overflow */ + /* x =< -184: tgamma(x)=+-0 with underflow */ + if (ix >= 0x40670000) { /* |x| >= 184 */ + if (sign) { + FORCE_EVAL((float)(0x1p-126/x)); + if (floor(x) * 0.5 == floor(x * 0.5)) + return 0; + return -0.0; + } + x *= 0x1p1023; + return x; + } + + absx = sign ? -x : x; + + /* handle the error of x + g - 0.5 */ + y = absx + gmhalf; + if (absx > gmhalf) { + dy = y - absx; + dy -= gmhalf; + } else { + dy = y - gmhalf; + dy -= absx; + } + + z = absx - 0.5; + r = S(absx) * exp(-y); + if (x < 0) { + /* reflection formula for negative x */ + /* sinpi(absx) is not 0, integers are already handled */ + r = -pi / (sinpi(absx) * absx * r); + dy = -dy; + z = -z; + } + r += dy * (gmhalf+0.5) * r / y; + z = pow(y, 0.5*z); + y = r * z * z; + return y; +} + +#if 0 +double __lgamma_r(double x, int *sign) +{ + double r, absx; + + *sign = 1; + + /* special cases */ + if (!isfinite(x)) + /* lgamma(nan)=nan, lgamma(+-inf)=inf */ + return x*x; + + /* integer arguments */ + if (x == floor(x) && x <= 2) { + /* n <= 0: lgamma(n)=inf with divbyzero */ + /* n == 1,2: lgamma(n)=0 */ + if (x <= 0) + return 1/0.0; + return 0; + } + + absx = fabs(x); + + /* lgamma(x) ~ -log(|x|) for tiny |x| */ + if (absx < 0x1p-54) { + *sign = 1 - 2*!!signbit(x); + return -log(absx); + } + + /* use tgamma for smaller |x| */ + if (absx < 128) { + x = tgamma(x); + *sign = 1 - 2*!!signbit(x); + return log(fabs(x)); + } + + /* second term (log(S)-g) could be more precise here.. */ + /* or with stirling: (|x|-0.5)*(log(|x|)-1) + poly(1/|x|) */ + r = (absx-0.5)*(log(absx+gmhalf)-1) + (log(S(absx)) - (gmhalf+0.5)); + if (x < 0) { + /* reflection formula for negative x */ + x = sinpi(absx); + *sign = 2*!!signbit(x) - 1; + r = log(pi/(fabs(x)*absx)) - r; + } + return r; +} + +weak_alias(__lgamma_r, lgamma_r); +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/tgammaf.c b/lib/mlibc/options/ansi/musl-generic-math/tgammaf.c new file mode 100644 index 0000000..b4ca51c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tgammaf.c @@ -0,0 +1,6 @@ +#include <math.h> + +float tgammaf(float x) +{ + return tgamma(x); +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/tgammal.c b/lib/mlibc/options/ansi/musl-generic-math/tgammal.c new file mode 100644 index 0000000..5336c5b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/tgammal.c @@ -0,0 +1,281 @@ +/* origin: OpenBSD /usr/src/lib/libm/src/ld80/e_tgammal.c */ +/* + * Copyright (c) 2008 Stephen L. Moshier <steve@moshier.net> + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ +/* + * Gamma function + * + * + * SYNOPSIS: + * + * long double x, y, tgammal(); + * + * y = tgammal( x ); + * + * + * DESCRIPTION: + * + * Returns gamma function of the argument. The result is + * correctly signed. + * + * Arguments |x| <= 13 are reduced by recurrence and the function + * approximated by a rational function of degree 7/8 in the + * interval (2,3). Large arguments are handled by Stirling's + * formula. Large negative arguments are made positive using + * a reflection formula. + * + * + * ACCURACY: + * + * Relative error: + * arithmetic domain # trials peak rms + * IEEE -40,+40 10000 3.6e-19 7.9e-20 + * IEEE -1755,+1755 10000 4.8e-18 6.5e-19 + * + * Accuracy for large arguments is dominated by error in powl(). + * + */ + +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double tgammal(long double x) +{ + return tgamma(x); +} +#elif LDBL_MANT_DIG == 64 && LDBL_MAX_EXP == 16384 +/* +tgamma(x+2) = tgamma(x+2) P(x)/Q(x) +0 <= x <= 1 +Relative error +n=7, d=8 +Peak error = 1.83e-20 +Relative error spread = 8.4e-23 +*/ +static const long double P[8] = { + 4.212760487471622013093E-5L, + 4.542931960608009155600E-4L, + 4.092666828394035500949E-3L, + 2.385363243461108252554E-2L, + 1.113062816019361559013E-1L, + 3.629515436640239168939E-1L, + 8.378004301573126728826E-1L, + 1.000000000000000000009E0L, +}; +static const long double Q[9] = { +-1.397148517476170440917E-5L, + 2.346584059160635244282E-4L, +-1.237799246653152231188E-3L, +-7.955933682494738320586E-4L, + 2.773706565840072979165E-2L, +-4.633887671244534213831E-2L, +-2.243510905670329164562E-1L, + 4.150160950588455434583E-1L, + 9.999999999999999999908E-1L, +}; + +/* +static const long double P[] = { +-3.01525602666895735709e0L, +-3.25157411956062339893e1L, +-2.92929976820724030353e2L, +-1.70730828800510297666e3L, +-7.96667499622741999770e3L, +-2.59780216007146401957e4L, +-5.99650230220855581642e4L, +-7.15743521530849602425e4L +}; +static const long double Q[] = { + 1.00000000000000000000e0L, +-1.67955233807178858919e1L, + 8.85946791747759881659e1L, + 5.69440799097468430177e1L, +-1.98526250512761318471e3L, + 3.31667508019495079814e3L, + 1.60577839621734713377e4L, +-2.97045081369399940529e4L, +-7.15743521530849602412e4L +}; +*/ +#define MAXGAML 1755.455L +/*static const long double LOGPI = 1.14472988584940017414L;*/ + +/* Stirling's formula for the gamma function +tgamma(x) = sqrt(2 pi) x^(x-.5) exp(-x) (1 + 1/x P(1/x)) +z(x) = x +13 <= x <= 1024 +Relative error +n=8, d=0 +Peak error = 9.44e-21 +Relative error spread = 8.8e-4 +*/ +static const long double STIR[9] = { + 7.147391378143610789273E-4L, +-2.363848809501759061727E-5L, +-5.950237554056330156018E-4L, + 6.989332260623193171870E-5L, + 7.840334842744753003862E-4L, +-2.294719747873185405699E-4L, +-2.681327161876304418288E-3L, + 3.472222222230075327854E-3L, + 8.333333333333331800504E-2L, +}; + +#define MAXSTIR 1024.0L +static const long double SQTPI = 2.50662827463100050242E0L; + +/* 1/tgamma(x) = z P(z) + * z(x) = 1/x + * 0 < x < 0.03125 + * Peak relative error 4.2e-23 + */ +static const long double S[9] = { +-1.193945051381510095614E-3L, + 7.220599478036909672331E-3L, +-9.622023360406271645744E-3L, +-4.219773360705915470089E-2L, + 1.665386113720805206758E-1L, +-4.200263503403344054473E-2L, +-6.558780715202540684668E-1L, + 5.772156649015328608253E-1L, + 1.000000000000000000000E0L, +}; + +/* 1/tgamma(-x) = z P(z) + * z(x) = 1/x + * 0 < x < 0.03125 + * Peak relative error 5.16e-23 + * Relative error spread = 2.5e-24 + */ +static const long double SN[9] = { + 1.133374167243894382010E-3L, + 7.220837261893170325704E-3L, + 9.621911155035976733706E-3L, +-4.219773343731191721664E-2L, +-1.665386113944413519335E-1L, +-4.200263503402112910504E-2L, + 6.558780715202536547116E-1L, + 5.772156649015328608727E-1L, +-1.000000000000000000000E0L, +}; + +static const long double PIL = 3.1415926535897932384626L; + +/* Gamma function computed by Stirling's formula. + */ +static long double stirf(long double x) +{ + long double y, w, v; + + w = 1.0/x; + /* For large x, use rational coefficients from the analytical expansion. */ + if (x > 1024.0) + w = (((((6.97281375836585777429E-5L * w + + 7.84039221720066627474E-4L) * w + - 2.29472093621399176955E-4L) * w + - 2.68132716049382716049E-3L) * w + + 3.47222222222222222222E-3L) * w + + 8.33333333333333333333E-2L) * w + + 1.0; + else + w = 1.0 + w * __polevll(w, STIR, 8); + y = expl(x); + if (x > MAXSTIR) { /* Avoid overflow in pow() */ + v = powl(x, 0.5L * x - 0.25L); + y = v * (v / y); + } else { + y = powl(x, x - 0.5L) / y; + } + y = SQTPI * y * w; + return y; +} + +long double tgammal(long double x) +{ + long double p, q, z; + + if (!isfinite(x)) + return x + INFINITY; + + q = fabsl(x); + if (q > 13.0) { + if (x < 0.0) { + p = floorl(q); + z = q - p; + if (z == 0) + return 0 / z; + if (q > MAXGAML) { + z = 0; + } else { + if (z > 0.5) { + p += 1.0; + z = q - p; + } + z = q * sinl(PIL * z); + z = fabsl(z) * stirf(q); + z = PIL/z; + } + if (0.5 * p == floorl(q * 0.5)) + z = -z; + } else if (x > MAXGAML) { + z = x * 0x1p16383L; + } else { + z = stirf(x); + } + return z; + } + + z = 1.0; + while (x >= 3.0) { + x -= 1.0; + z *= x; + } + while (x < -0.03125L) { + z /= x; + x += 1.0; + } + if (x <= 0.03125L) + goto small; + while (x < 2.0) { + z /= x; + x += 1.0; + } + if (x == 2.0) + return z; + + x -= 2.0; + p = __polevll(x, P, 7); + q = __polevll(x, Q, 8); + z = z * p / q; + return z; + +small: + /* z==1 if x was originally +-0 */ + if (x == 0 && z != 1) + return x / x; + if (x < 0.0) { + x = -x; + q = z / (x * __polevll(x, SN, 8)); + } else + q = z / (x * __polevll(x, S, 8)); + return q; +} +#elif LDBL_MANT_DIG == 113 && LDBL_MAX_EXP == 16384 +// TODO: broken implementation to make things compile +long double tgammal(long double x) +{ + return tgamma(x); +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/trunc.c b/lib/mlibc/options/ansi/musl-generic-math/trunc.c new file mode 100644 index 0000000..d13711b --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/trunc.c @@ -0,0 +1,19 @@ +#include "libm.h" + +double trunc(double x) +{ + union {double f; uint64_t i;} u = {x}; + int e = (int)(u.i >> 52 & 0x7ff) - 0x3ff + 12; + uint64_t m; + + if (e >= 52 + 12) + return x; + if (e < 12) + e = 1; + m = -1ULL >> e; + if ((u.i & m) == 0) + return x; + FORCE_EVAL(x + 0x1p120f); + u.i &= ~m; + return u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/truncf.c b/lib/mlibc/options/ansi/musl-generic-math/truncf.c new file mode 100644 index 0000000..1a7d03c --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/truncf.c @@ -0,0 +1,19 @@ +#include "libm.h" + +float truncf(float x) +{ + union {float f; uint32_t i;} u = {x}; + int e = (int)(u.i >> 23 & 0xff) - 0x7f + 9; + uint32_t m; + + if (e >= 23 + 9) + return x; + if (e < 9) + e = 1; + m = -1U >> e; + if ((u.i & m) == 0) + return x; + FORCE_EVAL(x + 0x1p120f); + u.i &= ~m; + return u.f; +} diff --git a/lib/mlibc/options/ansi/musl-generic-math/truncl.c b/lib/mlibc/options/ansi/musl-generic-math/truncl.c new file mode 100644 index 0000000..f07b193 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/truncl.c @@ -0,0 +1,34 @@ +#include "libm.h" + +#if LDBL_MANT_DIG == 53 && LDBL_MAX_EXP == 1024 +long double truncl(long double x) +{ + return trunc(x); +} +#elif (LDBL_MANT_DIG == 64 || LDBL_MANT_DIG == 113) && LDBL_MAX_EXP == 16384 + +static const long double toint = 1/LDBL_EPSILON; + +long double truncl(long double x) +{ + union ldshape u = {x}; + int e = u.i.se & 0x7fff; + int s = u.i.se >> 15; + long double y; + + if (e >= 0x3fff+LDBL_MANT_DIG-1) + return x; + if (e <= 0x3fff-1) { + FORCE_EVAL(x + 0x1p120f); + return x*0; + } + /* y = int(|x|) - |x|, where int(|x|) is an integer neighbor of |x| */ + if (s) + x = -x; + y = x + toint - toint - x; + if (y > 0) + y -= 1; + x += y; + return s ? -x : x; +} +#endif diff --git a/lib/mlibc/options/ansi/musl-generic-math/weak_alias.h b/lib/mlibc/options/ansi/musl-generic-math/weak_alias.h new file mode 100644 index 0000000..785f9d1 --- /dev/null +++ b/lib/mlibc/options/ansi/musl-generic-math/weak_alias.h @@ -0,0 +1,7 @@ +#ifndef _WEAK_ALIAS_H +#define _WEAK_ALIAS_H + +#define weak_alias(name, alias_to) \ + extern __typeof (name) alias_to __attribute__((__weak__, __alias__(#name))); + +#endif |